From d17885422f51f54f78426e112ae08b5934ff52a9 Mon Sep 17 00:00:00 2001 From: jbj Date: Wed, 21 Nov 2001 19:43:12 +0000 Subject: [PATCH] Initial revision CVS patchset: 5197 CVS date: 2001/11/21 19:43:12 --- bzip2/CHANGES | 167 + bzip2/LICENSE | 39 + bzip2/Makefile | 141 + bzip2/Makefile-libbz2_so | 43 + bzip2/README | 166 + bzip2/README.COMPILATION.PROBLEMS | 130 + bzip2/Y2K_INFO | 34 + bzip2/blocksort.c | 1134 ++ bzip2/bzip2.1 | 439 + bzip2/bzip2.1.preformatted | 462 + bzip2/bzip2.c | 2044 ++ bzip2/bzip2.txt | 376 + bzip2/bzip2recover.c | 435 + bzip2/bzlib.c | 1564 ++ bzip2/bzlib.h | 319 + bzip2/bzlib_private.h | 530 + bzip2/compress.c | 714 + bzip2/crctable.c | 144 + bzip2/decompress.c | 660 + bzip2/dlltest.c | 176 + bzip2/dlltest.dsp | 93 + bzip2/huffman.c | 228 + bzip2/libbz2.def | 27 + bzip2/libbz2.dsp | 130 + bzip2/makefile.msc | 63 + bzip2/manual.ps | 3808 ++++ bzip2/manual.texi | 2215 +++ bzip2/manual_1.html | 47 + bzip2/manual_2.html | 484 + bzip2/manual_3.html | 1773 ++ bzip2/manual_4.html | 528 + bzip2/manual_toc.html | 173 + bzip2/randtable.c | 124 + bzip2/sample1.bz2 | Bin 0 -> 32348 bytes bzip2/sample1.ref | Bin 0 -> 98696 bytes bzip2/sample2.bz2 | Bin 0 -> 73732 bytes bzip2/sample2.ref | Bin 0 -> 212340 bytes bzip2/sample3.bz2 | Bin 0 -> 235 bytes bzip2/sample3.ref | 30007 ++++++++++++++++++++++++++++++ bzip2/spewG.c | 39 + bzip2/unzcrash.c | 126 + bzip2/words0 | 5 + bzip2/words1 | 4 + bzip2/words2 | 5 + bzip2/words3 | 23 + zlib/ChangeLog | 471 + zlib/FAQ | 72 + zlib/INDEX | 86 + zlib/Make_vms.com | 115 + zlib/Makefile | 174 + zlib/Makefile.in | 174 + zlib/Makefile.riscos | 151 + zlib/README | 148 + zlib/adler32.c | 48 + zlib/algorithm.txt | 213 + zlib/amiga/Makefile.pup | 66 + zlib/amiga/Makefile.sas | 64 + zlib/compress.c | 68 + zlib/configure | 212 + zlib/contrib/README.contrib | 34 + zlib/contrib/asm386/gvmat32.asm | 559 + zlib/contrib/asm386/gvmat32c.c | 200 + zlib/contrib/asm386/mkgvmt32.bat | 1 + zlib/contrib/asm386/zlibvc.def | 74 + zlib/contrib/asm386/zlibvc.dsp | 651 + zlib/contrib/asm386/zlibvc.dsw | 41 + zlib/contrib/asm586/README.586 | 43 + zlib/contrib/asm586/match.S | 354 + zlib/contrib/asm686/README.686 | 34 + zlib/contrib/asm686/match.S | 327 + zlib/contrib/delphi/zlib.mak | 36 + zlib/contrib/delphi/zlibdef.pas | 169 + zlib/contrib/delphi2/d_zlib.bpr | 224 + zlib/contrib/delphi2/d_zlib.cpp | 17 + zlib/contrib/delphi2/readme.txt | 17 + zlib/contrib/delphi2/zlib.bpg | 26 + zlib/contrib/delphi2/zlib.bpr | 225 + zlib/contrib/delphi2/zlib.cpp | 22 + zlib/contrib/delphi2/zlib.pas | 534 + zlib/contrib/delphi2/zlib32.bpr | 174 + zlib/contrib/delphi2/zlib32.cpp | 42 + zlib/contrib/iostream/test.cpp | 24 + zlib/contrib/iostream/zfstream.cpp | 329 + zlib/contrib/iostream/zfstream.h | 142 + zlib/contrib/iostream2/zstream.h | 307 + zlib/contrib/iostream2/zstream_test.cpp | 25 + zlib/contrib/minizip/ChangeLogUnzip | 38 + zlib/contrib/minizip/Makefile | 25 + zlib/contrib/minizip/miniunz.c | 508 + zlib/contrib/minizip/minizip.c | 302 + zlib/contrib/minizip/readme.txt | 37 + zlib/contrib/minizip/unzip.c | 1294 ++ zlib/contrib/minizip/unzip.def | 15 + zlib/contrib/minizip/unzip.h | 275 + zlib/contrib/minizip/zip.c | 718 + zlib/contrib/minizip/zip.def | 5 + zlib/contrib/minizip/zip.h | 150 + zlib/contrib/minizip/zlibvc.def | 74 + zlib/contrib/minizip/zlibvc.dsp | 651 + zlib/contrib/minizip/zlibvc.dsw | 41 + zlib/contrib/untgz/Makefile | 14 + zlib/contrib/untgz/makefile.w32 | 63 + zlib/contrib/untgz/untgz.c | 522 + zlib/contrib/visual-basic.txt | 69 + zlib/crc32.c | 162 + zlib/deflate.c | 1350 ++ zlib/deflate.h | 318 + zlib/descrip.mms | 48 + zlib/example.c | 556 + zlib/gzio.c | 875 + zlib/infblock.c | 398 + zlib/infblock.h | 39 + zlib/infcodes.c | 257 + zlib/infcodes.h | 27 + zlib/inffast.c | 170 + zlib/inffast.h | 17 + zlib/inffixed.h | 151 + zlib/inflate.c | 366 + zlib/inftrees.c | 455 + zlib/inftrees.h | 58 + zlib/infutil.c | 87 + zlib/infutil.h | 98 + zlib/maketree.c | 85 + zlib/minigzip.c | 320 + zlib/msdos/Makefile.b32 | 104 + zlib/msdos/Makefile.bor | 125 + zlib/msdos/Makefile.dj2 | 100 + zlib/msdos/Makefile.emx | 69 + zlib/msdos/Makefile.msc | 121 + zlib/msdos/Makefile.tc | 108 + zlib/msdos/Makefile.w32 | 97 + zlib/msdos/Makefile.wat | 103 + zlib/msdos/zlib.def | 60 + zlib/msdos/zlib.rc | 32 + zlib/nt/Makefile.emx | 138 + zlib/nt/Makefile.gcc | 87 + zlib/nt/Makefile.nt | 88 + zlib/nt/zlib.dnt | 47 + zlib/os2/Makefile.os2 | 136 + zlib/os2/zlib.def | 51 + zlib/trees.c | 1214 ++ zlib/trees.h | 128 + zlib/uncompr.c | 58 + zlib/zconf.h | 279 + zlib/zlib.3 | 107 + zlib/zlib.h | 893 + zlib/zutil.c | 225 + zlib/zutil.h | 220 + 148 files changed, 71540 insertions(+) create mode 100644 bzip2/CHANGES create mode 100644 bzip2/LICENSE create mode 100644 bzip2/Makefile create mode 100644 bzip2/Makefile-libbz2_so create mode 100644 bzip2/README create mode 100644 bzip2/README.COMPILATION.PROBLEMS create mode 100644 bzip2/Y2K_INFO create mode 100644 bzip2/blocksort.c create mode 100644 bzip2/bzip2.1 create mode 100644 bzip2/bzip2.1.preformatted create mode 100644 bzip2/bzip2.c create mode 100644 bzip2/bzip2.txt create mode 100644 bzip2/bzip2recover.c create mode 100644 bzip2/bzlib.c create mode 100644 bzip2/bzlib.h create mode 100644 bzip2/bzlib_private.h create mode 100644 bzip2/compress.c create mode 100644 bzip2/crctable.c create mode 100644 bzip2/decompress.c create mode 100644 bzip2/dlltest.c create mode 100644 bzip2/dlltest.dsp create mode 100644 bzip2/huffman.c create mode 100644 bzip2/libbz2.def create mode 100644 bzip2/libbz2.dsp create mode 100644 bzip2/makefile.msc create mode 100644 bzip2/manual.ps create mode 100644 bzip2/manual.texi create mode 100644 bzip2/manual_1.html create mode 100644 bzip2/manual_2.html create mode 100644 bzip2/manual_3.html create mode 100644 bzip2/manual_4.html create mode 100644 bzip2/manual_toc.html create mode 100644 bzip2/randtable.c create mode 100644 bzip2/sample1.bz2 create mode 100644 bzip2/sample1.ref create mode 100644 bzip2/sample2.bz2 create mode 100644 bzip2/sample2.ref create mode 100644 bzip2/sample3.bz2 create mode 100644 bzip2/sample3.ref create mode 100644 bzip2/spewG.c create mode 100644 bzip2/unzcrash.c create mode 100644 bzip2/words0 create mode 100644 bzip2/words1 create mode 100644 bzip2/words2 create mode 100644 bzip2/words3 create mode 100644 zlib/ChangeLog create mode 100644 zlib/FAQ create mode 100644 zlib/INDEX create mode 100644 zlib/Make_vms.com create mode 100644 zlib/Makefile create mode 100644 zlib/Makefile.in create mode 100644 zlib/Makefile.riscos create mode 100644 zlib/README create mode 100644 zlib/adler32.c create mode 100644 zlib/algorithm.txt create mode 100644 zlib/amiga/Makefile.pup create mode 100644 zlib/amiga/Makefile.sas create mode 100644 zlib/compress.c create mode 100755 zlib/configure create mode 100644 zlib/contrib/README.contrib create mode 100644 zlib/contrib/asm386/gvmat32.asm create mode 100644 zlib/contrib/asm386/gvmat32c.c create mode 100644 zlib/contrib/asm386/mkgvmt32.bat create mode 100644 zlib/contrib/asm386/zlibvc.def create mode 100644 zlib/contrib/asm386/zlibvc.dsp create mode 100644 zlib/contrib/asm386/zlibvc.dsw create mode 100644 zlib/contrib/asm586/README.586 create mode 100644 zlib/contrib/asm586/match.S create mode 100644 zlib/contrib/asm686/README.686 create mode 100644 zlib/contrib/asm686/match.S create mode 100644 zlib/contrib/delphi/zlib.mak create mode 100644 zlib/contrib/delphi/zlibdef.pas create mode 100644 zlib/contrib/delphi2/d_zlib.bpr create mode 100644 zlib/contrib/delphi2/d_zlib.cpp create mode 100644 zlib/contrib/delphi2/readme.txt create mode 100644 zlib/contrib/delphi2/zlib.bpg create mode 100644 zlib/contrib/delphi2/zlib.bpr create mode 100644 zlib/contrib/delphi2/zlib.cpp create mode 100644 zlib/contrib/delphi2/zlib.pas create mode 100644 zlib/contrib/delphi2/zlib32.bpr create mode 100644 zlib/contrib/delphi2/zlib32.cpp create mode 100644 zlib/contrib/iostream/test.cpp create mode 100644 zlib/contrib/iostream/zfstream.cpp create mode 100644 zlib/contrib/iostream/zfstream.h create mode 100644 zlib/contrib/iostream2/zstream.h create mode 100644 zlib/contrib/iostream2/zstream_test.cpp create mode 100644 zlib/contrib/minizip/ChangeLogUnzip create mode 100644 zlib/contrib/minizip/Makefile create mode 100644 zlib/contrib/minizip/miniunz.c create mode 100644 zlib/contrib/minizip/minizip.c create mode 100644 zlib/contrib/minizip/readme.txt create mode 100644 zlib/contrib/minizip/unzip.c create mode 100644 zlib/contrib/minizip/unzip.def create mode 100644 zlib/contrib/minizip/unzip.h create mode 100644 zlib/contrib/minizip/zip.c create mode 100644 zlib/contrib/minizip/zip.def create mode 100644 zlib/contrib/minizip/zip.h create mode 100644 zlib/contrib/minizip/zlibvc.def create mode 100644 zlib/contrib/minizip/zlibvc.dsp create mode 100644 zlib/contrib/minizip/zlibvc.dsw create mode 100644 zlib/contrib/untgz/Makefile create mode 100644 zlib/contrib/untgz/makefile.w32 create mode 100644 zlib/contrib/untgz/untgz.c create mode 100644 zlib/contrib/visual-basic.txt create mode 100644 zlib/crc32.c create mode 100644 zlib/deflate.c create mode 100644 zlib/deflate.h create mode 100644 zlib/descrip.mms create mode 100644 zlib/example.c create mode 100644 zlib/gzio.c create mode 100644 zlib/infblock.c create mode 100644 zlib/infblock.h create mode 100644 zlib/infcodes.c create mode 100644 zlib/infcodes.h create mode 100644 zlib/inffast.c create mode 100644 zlib/inffast.h create mode 100644 zlib/inffixed.h create mode 100644 zlib/inflate.c create mode 100644 zlib/inftrees.c create mode 100644 zlib/inftrees.h create mode 100644 zlib/infutil.c create mode 100644 zlib/infutil.h create mode 100644 zlib/maketree.c create mode 100644 zlib/minigzip.c create mode 100644 zlib/msdos/Makefile.b32 create mode 100644 zlib/msdos/Makefile.bor create mode 100644 zlib/msdos/Makefile.dj2 create mode 100644 zlib/msdos/Makefile.emx create mode 100644 zlib/msdos/Makefile.msc create mode 100644 zlib/msdos/Makefile.tc create mode 100644 zlib/msdos/Makefile.w32 create mode 100644 zlib/msdos/Makefile.wat create mode 100644 zlib/msdos/zlib.def create mode 100644 zlib/msdos/zlib.rc create mode 100644 zlib/nt/Makefile.emx create mode 100644 zlib/nt/Makefile.gcc create mode 100644 zlib/nt/Makefile.nt create mode 100644 zlib/nt/zlib.dnt create mode 100644 zlib/os2/Makefile.os2 create mode 100644 zlib/os2/zlib.def create mode 100644 zlib/trees.c create mode 100644 zlib/trees.h create mode 100644 zlib/uncompr.c create mode 100644 zlib/zconf.h create mode 100644 zlib/zlib.3 create mode 100644 zlib/zlib.h create mode 100644 zlib/zutil.c create mode 100644 zlib/zutil.h diff --git a/bzip2/CHANGES b/bzip2/CHANGES new file mode 100644 index 0000000..ecaf417 --- /dev/null +++ b/bzip2/CHANGES @@ -0,0 +1,167 @@ + + +0.9.0 +~~~~~ +First version. + + +0.9.0a +~~~~~~ +Removed 'ranlib' from Makefile, since most modern Unix-es +don't need it, or even know about it. + + +0.9.0b +~~~~~~ +Fixed a problem with error reporting in bzip2.c. This does not effect +the library in any way. Problem is: versions 0.9.0 and 0.9.0a (of the +program proper) compress and decompress correctly, but give misleading +error messages (internal panics) when an I/O error occurs, instead of +reporting the problem correctly. This shouldn't give any data loss +(as far as I can see), but is confusing. + +Made the inline declarations disappear for non-GCC compilers. + + +0.9.0c +~~~~~~ +Fixed some problems in the library pertaining to some boundary cases. +This makes the library behave more correctly in those situations. The +fixes apply only to features (calls and parameters) not used by +bzip2.c, so the non-fixedness of them in previous versions has no +effect on reliability of bzip2.c. + +In bzlib.c: + * made zero-length BZ_FLUSH work correctly in bzCompress(). + * fixed bzWrite/bzRead to ignore zero-length requests. + * fixed bzread to correctly handle read requests after EOF. + * wrong parameter order in call to bzDecompressInit in + bzBuffToBuffDecompress. Fixed. + +In compress.c: + * changed setting of nGroups in sendMTFValues() so as to + do a bit better on small files. This _does_ effect + bzip2.c. + + +0.9.5a +~~~~~~ +Major change: add a fallback sorting algorithm (blocksort.c) +to give reasonable behaviour even for very repetitive inputs. +Nuked --repetitive-best and --repetitive-fast since they are +no longer useful. + +Minor changes: mostly a whole bunch of small changes/ +bugfixes in the driver (bzip2.c). Changes pertaining to the +user interface are: + + allow decompression of symlink'd files to stdout + decompress/test files even without .bz2 extension + give more accurate error messages for I/O errors + when compressing/decompressing to stdout, don't catch control-C + read flags from BZIP2 and BZIP environment variables + decline to break hard links to a file unless forced with -f + allow -c flag even with no filenames + preserve file ownerships as far as possible + make -s -1 give the expected block size (100k) + add a flag -q --quiet to suppress nonessential warnings + stop decoding flags after --, so files beginning in - can be handled + resolved inconsistent naming: bzcat or bz2cat ? + bzip2 --help now returns 0 + +Programming-level changes are: + + fixed syntax error in GET_LL4 for Borland C++ 5.02 + let bzBuffToBuffDecompress return BZ_DATA_ERROR{_MAGIC} + fix overshoot of mode-string end in bzopen_or_bzdopen + wrapped bzlib.h in #ifdef __cplusplus ... extern "C" { ... } + close file handles under all error conditions + added minor mods so it compiles with DJGPP out of the box + fixed Makefile so it doesn't give problems with BSD make + fix uninitialised memory reads in dlltest.c + +0.9.5b +~~~~~~ +Open stdin/stdout in binary mode for DJGPP. + +0.9.5c +~~~~~~ +Changed BZ_N_OVERSHOOT to be ... + 2 instead of ... + 1. The + 1 +version could cause the sorted order to be wrong in some extremely +obscure cases. Also changed setting of quadrant in blocksort.c. + +0.9.5d +~~~~~~ +The only functional change is to make bzlibVersion() in the library +return the correct string. This has no effect whatsoever on the +functioning of the bzip2 program or library. Added a couple of casts +so the library compiles without warnings at level 3 in MS Visual +Studio 6.0. Included a Y2K statement in the file Y2K_INFO. All other +changes are minor documentation changes. + +1.0 +~~~ +Several minor bugfixes and enhancements: + +* Large file support. The library uses 64-bit counters to + count the volume of data passing through it. bzip2.c + is now compiled with -D_FILE_OFFSET_BITS=64 to get large + file support from the C library. -v correctly prints out + file sizes greater than 4 gigabytes. All these changes have + been made without assuming a 64-bit platform or a C compiler + which supports 64-bit ints, so, except for the C library + aspect, they are fully portable. + +* Decompression robustness. The library/program should be + robust to any corruption of compressed data, detecting and + handling _all_ corruption, instead of merely relying on + the CRCs. What this means is that the program should + never crash, given corrupted data, and the library should + always return BZ_DATA_ERROR. + +* Fixed an obscure race-condition bug only ever observed on + Solaris, in which, if you were very unlucky and issued + control-C at exactly the wrong time, both input and output + files would be deleted. + +* Don't run out of file handles on test/decompression when + large numbers of files have invalid magic numbers. + +* Avoid library namespace pollution. Prefix all exported + symbols with BZ2_. + +* Minor sorting enhancements from my DCC2000 paper. + +* Advance the version number to 1.0, so as to counteract the + (false-in-this-case) impression some people have that programs + with version numbers less than 1.0 are in someway, experimental, + pre-release versions. + +* Create an initial Makefile-libbz2_so to build a shared library. + Yes, I know I should really use libtool et al ... + +* Make the program exit with 2 instead of 0 when decompression + fails due to a bad magic number (ie, an invalid bzip2 header). + Also exit with 1 (as the manual claims :-) whenever a diagnostic + message would have been printed AND the corresponding operation + is aborted, for example + bzip2: Output file xx already exists. + When a diagnostic message is printed but the operation is not + aborted, for example + bzip2: Can't guess original name for wurble -- using wurble.out + then the exit value 0 is returned, unless some other problem is + also detected. + + I think it corresponds more closely to what the manual claims now. + + +1.0.1 +~~~~~ +* Modified dlltest.c so it uses the new BZ2_ naming scheme. +* Modified makefile-msc to fix minor build probs on Win2k. +* Updated README.COMPILATION.PROBLEMS. + +There are no functionality changes or bug fixes relative to version +1.0.0. This is just a documentation update + a fix for minor Win32 +build problems. For almost everyone, upgrading from 1.0.0 to 1.0.1 is +utterly pointless. Don't bother. diff --git a/bzip2/LICENSE b/bzip2/LICENSE new file mode 100644 index 0000000..88fa6d8 --- /dev/null +++ b/bzip2/LICENSE @@ -0,0 +1,39 @@ + +This program, "bzip2" and associated library "libbzip2", are +copyright (C) 1996-2000 Julian R Seward. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: + +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + +3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + +4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS +OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Julian Seward, Cambridge, UK. +jseward@acm.org +bzip2/libbzip2 version 1.0 of 21 March 2000 + diff --git a/bzip2/Makefile b/bzip2/Makefile new file mode 100644 index 0000000..ab17f49 --- /dev/null +++ b/bzip2/Makefile @@ -0,0 +1,141 @@ + +SHELL=/bin/sh +CC=gcc +BIGFILES=-D_FILE_OFFSET_BITS=64 +CFLAGS=-Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES) + +OBJS= blocksort.o \ + huffman.o \ + crctable.o \ + randtable.o \ + compress.o \ + decompress.o \ + bzlib.o + +all: libbz2.a bzip2 bzip2recover test + +bzip2: libbz2.a bzip2.o + $(CC) $(CFLAGS) -o bzip2 bzip2.o -L. -lbz2 + +bzip2recover: bzip2recover.o + $(CC) $(CFLAGS) -o bzip2recover bzip2recover.o + +libbz2.a: $(OBJS) + rm -f libbz2.a + ar cq libbz2.a $(OBJS) + @if ( test -f /usr/bin/ranlib -o -f /bin/ranlib -o \ + -f /usr/ccs/bin/ranlib ) ; then \ + echo ranlib libbz2.a ; \ + ranlib libbz2.a ; \ + fi + +test: bzip2 + @cat words1 + ./bzip2 -1 < sample1.ref > sample1.rb2 + ./bzip2 -2 < sample2.ref > sample2.rb2 + ./bzip2 -3 < sample3.ref > sample3.rb2 + ./bzip2 -d < sample1.bz2 > sample1.tst + ./bzip2 -d < sample2.bz2 > sample2.tst + ./bzip2 -ds < sample3.bz2 > sample3.tst + cmp sample1.bz2 sample1.rb2 + cmp sample2.bz2 sample2.rb2 + cmp sample3.bz2 sample3.rb2 + cmp sample1.tst sample1.ref + cmp sample2.tst sample2.ref + cmp sample3.tst sample3.ref + @cat words3 + +PREFIX=/usr + +install: bzip2 bzip2recover + if ( test ! -d $(PREFIX)/bin ) ; then mkdir $(PREFIX)/bin ; fi + if ( test ! -d $(PREFIX)/lib ) ; then mkdir $(PREFIX)/lib ; fi + if ( test ! -d $(PREFIX)/man ) ; then mkdir $(PREFIX)/man ; fi + if ( test ! -d $(PREFIX)/man/man1 ) ; then mkdir $(PREFIX)/man/man1 ; fi + if ( test ! -d $(PREFIX)/include ) ; then mkdir $(PREFIX)/include ; fi + cp -f bzip2 $(PREFIX)/bin/bzip2 + cp -f bzip2 $(PREFIX)/bin/bunzip2 + cp -f bzip2 $(PREFIX)/bin/bzcat + cp -f bzip2recover $(PREFIX)/bin/bzip2recover + chmod a+x $(PREFIX)/bin/bzip2 + chmod a+x $(PREFIX)/bin/bunzip2 + chmod a+x $(PREFIX)/bin/bzcat + chmod a+x $(PREFIX)/bin/bzip2recover + cp -f bzip2.1 $(PREFIX)/man/man1 + chmod a+r $(PREFIX)/man/man1/bzip2.1 + cp -f bzlib.h $(PREFIX)/include + chmod a+r $(PREFIX)/include/bzlib.h + cp -f libbz2.a $(PREFIX)/lib + chmod a+r $(PREFIX)/lib/libbz2.a + +clean: + rm -f *.o libbz2.a bzip2 bzip2recover \ + sample1.rb2 sample2.rb2 sample3.rb2 \ + sample1.tst sample2.tst sample3.tst + +blocksort.o: blocksort.c + @cat words0 + $(CC) $(CFLAGS) -c blocksort.c +huffman.o: huffman.c + $(CC) $(CFLAGS) -c huffman.c +crctable.o: crctable.c + $(CC) $(CFLAGS) -c crctable.c +randtable.o: randtable.c + $(CC) $(CFLAGS) -c randtable.c +compress.o: compress.c + $(CC) $(CFLAGS) -c compress.c +decompress.o: decompress.c + $(CC) $(CFLAGS) -c decompress.c +bzlib.o: bzlib.c + $(CC) $(CFLAGS) -c bzlib.c +bzip2.o: bzip2.c + $(CC) $(CFLAGS) -c bzip2.c +bzip2recover.o: bzip2recover.c + $(CC) $(CFLAGS) -c bzip2recover.c + +DISTNAME=bzip2-1.0.1 +tarfile: + rm -f $(DISTNAME) + ln -sf . $(DISTNAME) + tar cvf $(DISTNAME).tar \ + $(DISTNAME)/blocksort.c \ + $(DISTNAME)/huffman.c \ + $(DISTNAME)/crctable.c \ + $(DISTNAME)/randtable.c \ + $(DISTNAME)/compress.c \ + $(DISTNAME)/decompress.c \ + $(DISTNAME)/bzlib.c \ + $(DISTNAME)/bzip2.c \ + $(DISTNAME)/bzip2recover.c \ + $(DISTNAME)/bzlib.h \ + $(DISTNAME)/bzlib_private.h \ + $(DISTNAME)/Makefile \ + $(DISTNAME)/manual.texi \ + $(DISTNAME)/manual.ps \ + $(DISTNAME)/LICENSE \ + $(DISTNAME)/bzip2.1 \ + $(DISTNAME)/bzip2.1.preformatted \ + $(DISTNAME)/bzip2.txt \ + $(DISTNAME)/words0 \ + $(DISTNAME)/words1 \ + $(DISTNAME)/words2 \ + $(DISTNAME)/words3 \ + $(DISTNAME)/sample1.ref \ + $(DISTNAME)/sample2.ref \ + $(DISTNAME)/sample3.ref \ + $(DISTNAME)/sample1.bz2 \ + $(DISTNAME)/sample2.bz2 \ + $(DISTNAME)/sample3.bz2 \ + $(DISTNAME)/dlltest.c \ + $(DISTNAME)/*.html \ + $(DISTNAME)/README \ + $(DISTNAME)/README.COMPILATION.PROBLEMS \ + $(DISTNAME)/CHANGES \ + $(DISTNAME)/libbz2.def \ + $(DISTNAME)/libbz2.dsp \ + $(DISTNAME)/dlltest.dsp \ + $(DISTNAME)/makefile.msc \ + $(DISTNAME)/Y2K_INFO \ + $(DISTNAME)/unzcrash.c \ + $(DISTNAME)/spewG.c \ + $(DISTNAME)/Makefile-libbz2_so diff --git a/bzip2/Makefile-libbz2_so b/bzip2/Makefile-libbz2_so new file mode 100644 index 0000000..a347c50 --- /dev/null +++ b/bzip2/Makefile-libbz2_so @@ -0,0 +1,43 @@ + +# This Makefile builds a shared version of the library, +# libbz2.so.1.0.1, with soname libbz2.so.1.0, +# at least on x86-Linux (RedHat 5.2), +# with gcc-2.7.2.3. Please see the README file for some +# important info about building the library like this. + +SHELL=/bin/sh +CC=gcc +BIGFILES=-D_FILE_OFFSET_BITS=64 +CFLAGS=-fpic -fPIC -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES) + +OBJS= blocksort.o \ + huffman.o \ + crctable.o \ + randtable.o \ + compress.o \ + decompress.o \ + bzlib.o + +all: $(OBJS) + $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS) + $(CC) $(CFLAGS) -o bzip2-shared bzip2.c libbz2.so.1.0.1 + rm -f libbz2.so.1.0 + ln -s libbz2.so.1.0.1 libbz2.so.1.0 + +clean: + rm -f $(OBJS) bzip2.o libbz2.so.1.0.1 libbz2.so.1.0 bzip2-shared + +blocksort.o: blocksort.c + $(CC) $(CFLAGS) -c blocksort.c +huffman.o: huffman.c + $(CC) $(CFLAGS) -c huffman.c +crctable.o: crctable.c + $(CC) $(CFLAGS) -c crctable.c +randtable.o: randtable.c + $(CC) $(CFLAGS) -c randtable.c +compress.o: compress.c + $(CC) $(CFLAGS) -c compress.c +decompress.o: decompress.c + $(CC) $(CFLAGS) -c decompress.c +bzlib.o: bzlib.c + $(CC) $(CFLAGS) -c bzlib.c diff --git a/bzip2/README b/bzip2/README new file mode 100644 index 0000000..22945a2 --- /dev/null +++ b/bzip2/README @@ -0,0 +1,166 @@ + +This is the README for bzip2, a block-sorting file compressor, version +1.0. This version is fully compatible with the previous public +releases, bzip2-0.1pl2, bzip2-0.9.0 and bzip2-0.9.5. + +bzip2-1.0 is distributed under a BSD-style license. For details, +see the file LICENSE. + +Complete documentation is available in Postscript form (manual.ps) or +html (manual_toc.html). A plain-text version of the manual page is +available as bzip2.txt. A statement about Y2K issues is now included +in the file Y2K_INFO. + + +HOW TO BUILD -- UNIX + +Type `make'. This builds the library libbz2.a and then the +programs bzip2 and bzip2recover. Six self-tests are run. +If the self-tests complete ok, carry on to installation: + +To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type + make install +To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type + make install PREFIX=/xxx/yyy +If you are (justifiably) paranoid and want to see what 'make install' +is going to do, you can first do + make -n install or + make -n install PREFIX=/xxx/yyy respectively. +The -n instructs make to show the commands it would execute, but +not actually execute them. + + +HOW TO BUILD -- UNIX, shared library libbz2.so. + +Do 'make -f Makefile-libbz2_so'. This Makefile seems to work for +Linux-ELF (RedHat 5.2 on an x86 box), with gcc. I make no claims +that it works for any other platform, though I suspect it probably +will work for most platforms employing both ELF and gcc. + +bzip2-shared, a client of the shared library, is also build, but +not self-tested. So I suggest you also build using the normal +Makefile, since that conducts a self-test. + +Important note for people upgrading .so's from 0.9.0/0.9.5 to +version 1.0. All the functions in the library have been renamed, +from (eg) bzCompress to BZ2_bzCompress, to avoid namespace pollution. +Unfortunately this means that the libbz2.so created by +Makefile-libbz2_so will not work with any program which used an +older version of the library. Sorry. I do encourage library +clients to make the effort to upgrade to use version 1.0, since +it is both faster and more robust than previous versions. + + +HOW TO BUILD -- Windows 95, NT, DOS, Mac, etc. + +It's difficult for me to support compilation on all these platforms. +My approach is to collect binaries for these platforms, and put them +on the master web page (http://sourceware.cygnus.com/bzip2). Look +there. However (FWIW), bzip2-1.0 is very standard ANSI C and should +compile unmodified with MS Visual C. For Win32, there is one +important caveat: in bzip2.c, you must set BZ_UNIX to 0 and +BZ_LCCWIN32 to 1 before building. If you have difficulties building, +you might want to read README.COMPILATION.PROBLEMS. + + +VALIDATION + +Correct operation, in the sense that a compressed file can always be +decompressed to reproduce the original, is obviously of paramount +importance. To validate bzip2, I used a modified version of Mark +Nelson's churn program. Churn is an automated test driver which +recursively traverses a directory structure, using bzip2 to compress +and then decompress each file it encounters, and checking that the +decompressed data is the same as the original. There are more details +in Section 4 of the user guide. + + + +Please read and be aware of the following: + +WARNING: + + This program (attempts to) compress data by performing several + non-trivial transformations on it. Unless you are 100% familiar + with *all* the algorithms contained herein, and with the + consequences of modifying them, you should NOT meddle with the + compression or decompression machinery. Incorrect changes can and + very likely *will* lead to disastrous loss of data. + + +DISCLAIMER: + + I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE + USE OF THIS PROGRAM, HOWSOEVER CAUSED. + + Every compression of a file implies an assumption that the + compressed file can be decompressed to reproduce the original. + Great efforts in design, coding and testing have been made to + ensure that this program works correctly. However, the complexity + of the algorithms, and, in particular, the presence of various + special cases in the code which occur with very low but non-zero + probability make it impossible to rule out the possibility of bugs + remaining in the program. DO NOT COMPRESS ANY DATA WITH THIS + PROGRAM UNLESS YOU ARE PREPARED TO ACCEPT THE POSSIBILITY, HOWEVER + SMALL, THAT THE DATA WILL NOT BE RECOVERABLE. + + That is not to say this program is inherently unreliable. Indeed, + I very much hope the opposite is true. bzip2 has been carefully + constructed and extensively tested. + + +PATENTS: + + To the best of my knowledge, bzip2 does not use any patented + algorithms. However, I do not have the resources available to + carry out a full patent search. Therefore I cannot give any + guarantee of the above statement. + +End of legalities. + + +WHAT'S NEW IN 0.9.0 (as compared to 0.1pl2) ? + + * Approx 10% faster compression, 30% faster decompression + * -t (test mode) is a lot quicker + * Can decompress concatenated compressed files + * Programming interface, so programs can directly read/write .bz2 files + * Less restrictive (BSD-style) licensing + * Flag handling more compatible with GNU gzip + * Much more documentation, i.e., a proper user manual + * Hopefully, improved portability (at least of the library) + +WHAT'S NEW IN 0.9.5 ? + + * Compression speed is much less sensitive to the input + data than in previous versions. Specifically, the very + slow performance caused by repetitive data is fixed. + * Many small improvements in file and flag handling. + * A Y2K statement. + +WHAT'S NEW IN 1.0 + + See the CHANGES file. + +I hope you find bzip2 useful. Feel free to contact me at + jseward@acm.org +if you have any suggestions or queries. Many people mailed me with +comments, suggestions and patches after the releases of bzip-0.15, +bzip-0.21, bzip2-0.1pl2 and bzip2-0.9.0, and the changes in bzip2 are +largely a result of this feedback. I thank you for your comments. + +At least for the time being, bzip2's "home" is (or can be reached via) +http://www.muraroa.demon.co.uk. + +Julian Seward +jseward@acm.org + +Cambridge, UK +18 July 1996 (version 0.15) +25 August 1996 (version 0.21) + 7 August 1997 (bzip2, version 0.1) +29 August 1997 (bzip2, version 0.1pl2) +23 August 1998 (bzip2, version 0.9.0) + 8 June 1999 (bzip2, version 0.9.5) + 4 Sept 1999 (bzip2, version 0.9.5d) + 5 May 2000 (bzip2, version 1.0pre8) diff --git a/bzip2/README.COMPILATION.PROBLEMS b/bzip2/README.COMPILATION.PROBLEMS new file mode 100644 index 0000000..d621ad5 --- /dev/null +++ b/bzip2/README.COMPILATION.PROBLEMS @@ -0,0 +1,130 @@ + +bzip2-1.0 should compile without problems on the vast majority of +platforms. Using the supplied Makefile, I've built and tested it +myself for x86-linux, sparc-solaris, alpha-linux, x86-cygwin32 and +alpha-tru64unix. With makefile.msc, Visual C++ 6.0 and nmake, you can +build a native Win32 version too. Large file support seems to work +correctly on at least alpha-tru64unix and x86-cygwin32 (on Windows +2000). + +When I say "large file" I mean a file of size 2,147,483,648 (2^31) +bytes or above. Many older OSs can't handle files above this size, +but many newer ones can. Large files are pretty huge -- most files +you'll encounter are not Large Files. + +Earlier versions of bzip2 (0.1, 0.9.0, 0.9.5) compiled on a wide +variety of platforms without difficulty, and I hope this version will +continue in that tradition. However, in order to support large files, +I've had to include the define -D_FILE_OFFSET_BITS=64 in the Makefile. +This can cause problems. + +The technique of adding -D_FILE_OFFSET_BITS=64 to get large file +support is, as far as I know, the Recommended Way to get correct large +file support. For more details, see the Large File Support +Specification, published by the Large File Summit, at + http://www.sas.com/standard/large.file/ + +As a general comment, if you get compilation errors which you think +are related to large file support, try removing the above define from +the Makefile, ie, delete the line + BIGFILES=-D_FILE_OFFSET_BITS=64 +from the Makefile, and do 'make clean ; make'. This will give you a +version of bzip2 without large file support, which, for most +applications, is probably not a problem. + +Alternatively, try some of the platform-specific hints listed below. + +You can use the spewG.c program to generate huge files to test bzip2's +large file support, if you are feeling paranoid. Be aware though that +any compilation problems which affect bzip2 will also affect spewG.c, +alas. + + +Known problems as of 1.0pre8: +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +* HP/UX 10.20 and 11.00, using gcc (2.7.2.3 and 2.95.2): A large + number of warnings appear, including the following: + + /usr/include/sys/resource.h: In function `getrlimit': + /usr/include/sys/resource.h:168: + warning: implicit declaration of function `__getrlimit64' + /usr/include/sys/resource.h: In function `setrlimit': + /usr/include/sys/resource.h:170: + warning: implicit declaration of function `__setrlimit64' + + This would appear to be a problem with large file support, header + files and gcc. gcc may or may not give up at this point. If it + fails, you might be able to improve matters by adding + -D__STDC_EXT__=1 + to the BIGFILES variable in the Makefile (ie, change its definition + to + BIGFILES=-D_FILE_OFFSET_BITS=64 -D__STDC_EXT__=1 + + Even if gcc does produce a binary which appears to work (ie passes + its self-tests), you might want to test it to see if it works properly + on large files. + + +* HP/UX 10.20 and 11.00, using HP's cc compiler. + + No specific problems for this combination, except that you'll need to + specify the -Ae flag, and zap the gcc-specific stuff + -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce. + You should retain -D_FILE_OFFSET_BITS=64 in order to get large + file support -- which is reported to work ok for this HP/UX + cc + combination. + + +* SunOS 4.1.X. + + Amazingly, there are still people out there using this venerable old + banger. I shouldn't be too rude -- I started life on SunOS, and + it was a pretty darn good OS, way back then. Anyway: + + SunOS doesn't seem to have strerror(), so you'll have to use + perror(), perhaps by doing adding this (warning: UNTESTED CODE): + + char* strerror ( int errnum ) + { + if (errnum < 0 || errnum >= sys_nerr) + return "Unknown error"; + else + return sys_errlist[errnum]; + } + + Or you could comment out the relevant calls to strerror; they're + not mission-critical. Or you could upgrade to Solaris. Ha ha ha! + (what?? you think I've got Bad Attitude?) + + +* Making a shared library on Solaris. (Not really a compilation + problem, but many people ask ...) + + Firstly, if you have Solaris 8, either you have libbz2.so already + on your system, or you can install it from the Solaris CD. + + Secondly, be aware that there are potential naming conflicts + between the .so file supplied with Solaris 8, and the .so file + which Makefile-libbz2_so will make. Makefile-libbz2_so creates + a .so which has the names which I intend to be "official" as + of version 1.0.0 and onwards. Unfortunately, the .so in + Solaris 8 appeared before I decided on the final names, so + the two libraries are incompatible. We have since communicated + and I hope that the problems will have been solved in the next + version of Solaris, whenever that might appear. + + All that said: you might be able to get somewhere + by finding the line in Makefile-libbz2_so which says + + $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS) + + and replacing with + + ($CC) -G -shared -o libbz2.so.1.0.1 -h libbz2.so.1.0 $(OBJS) + + If gcc objects to the combination -fpic -fPIC, get rid of + the second one, leaving just "-fpic". + + +That's the end of the currently known compilation problems. diff --git a/bzip2/Y2K_INFO b/bzip2/Y2K_INFO new file mode 100644 index 0000000..55fd56a --- /dev/null +++ b/bzip2/Y2K_INFO @@ -0,0 +1,34 @@ + +Y2K status of bzip2 and libbzip2, versions 0.1, 0.9.0 and 0.9.5 +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +Informally speaking: + bzip2 is a compression program built on top of libbzip2, + a library which does the real work of compression and + decompression. As far as I am aware, libbzip2 does not have + any date-related code at all. + + bzip2 itself copies dates from source to destination files + when compressing or decompressing, using the 'stat' and 'utime' + UNIX system calls. It doesn't examine, manipulate or store the + dates in any way. So as far as I can see, there shouldn't be any + problem with bzip2 providing 'stat' and 'utime' work correctly + on your system. + + On non-unix platforms (those for which BZ_UNIX in bzip2.c is + not set to 1), bzip2 doesn't even do the date copying. + + Overall, informally speaking, I don't think bzip2 or libbzip2 + have a Y2K problem. + +Formally speaking: + I am not prepared to offer you any assurance whatsoever + regarding Y2K issues in my software. You alone assume the + entire risk of using the software. The disclaimer of liability + in the LICENSE file in the bzip2 source distribution continues + to apply on this issue as with every other issue pertaining + to the software. + +Julian Seward +Cambridge, UK +25 August 1999 diff --git a/bzip2/blocksort.c b/bzip2/blocksort.c new file mode 100644 index 0000000..ec42672 --- /dev/null +++ b/bzip2/blocksort.c @@ -0,0 +1,1134 @@ + +/*-------------------------------------------------------------*/ +/*--- Block sorting machinery ---*/ +/*--- blocksort.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. + + To get some idea how the block sorting algorithms in this file + work, read my paper + On the Performance of BWT Sorting Algorithms + in Proceedings of the IEEE Data Compression Conference 2000, + Snowbird, Utah, USA, 27-30 March 2000. The main sort in this + file implements the algorithm called cache in the paper. +--*/ + + +#include "bzlib_private.h" + +/*---------------------------------------------*/ +/*--- Fallback O(N log(N)^2) sorting ---*/ +/*--- algorithm, for repetitive blocks ---*/ +/*---------------------------------------------*/ + +/*---------------------------------------------*/ +static +__inline__ +void fallbackSimpleSort ( UInt32* fmap, + UInt32* eclass, + Int32 lo, + Int32 hi ) +{ + Int32 i, j, tmp; + UInt32 ec_tmp; + + if (lo == hi) return; + + if (hi - lo > 3) { + for ( i = hi-4; i >= lo; i-- ) { + tmp = fmap[i]; + ec_tmp = eclass[tmp]; + for ( j = i+4; j <= hi && ec_tmp > eclass[fmap[j]]; j += 4 ) + fmap[j-4] = fmap[j]; + fmap[j-4] = tmp; + } + } + + for ( i = hi-1; i >= lo; i-- ) { + tmp = fmap[i]; + ec_tmp = eclass[tmp]; + for ( j = i+1; j <= hi && ec_tmp > eclass[fmap[j]]; j++ ) + fmap[j-1] = fmap[j]; + fmap[j-1] = tmp; + } +} + + +/*---------------------------------------------*/ +#define fswap(zz1, zz2) \ + { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; } + +#define fvswap(zzp1, zzp2, zzn) \ +{ \ + Int32 yyp1 = (zzp1); \ + Int32 yyp2 = (zzp2); \ + Int32 yyn = (zzn); \ + while (yyn > 0) { \ + fswap(fmap[yyp1], fmap[yyp2]); \ + yyp1++; yyp2++; yyn--; \ + } \ +} + + +#define fmin(a,b) ((a) < (b)) ? (a) : (b) + +#define fpush(lz,hz) { stackLo[sp] = lz; \ + stackHi[sp] = hz; \ + sp++; } + +#define fpop(lz,hz) { sp--; \ + lz = stackLo[sp]; \ + hz = stackHi[sp]; } + +#define FALLBACK_QSORT_SMALL_THRESH 10 +#define FALLBACK_QSORT_STACK_SIZE 100 + + +static +void fallbackQSort3 ( UInt32* fmap, + UInt32* eclass, + Int32 loSt, + Int32 hiSt ) +{ + Int32 unLo, unHi, ltLo, gtHi, n, m; + Int32 sp, lo, hi; + UInt32 med, r, r3; + Int32 stackLo[FALLBACK_QSORT_STACK_SIZE]; + Int32 stackHi[FALLBACK_QSORT_STACK_SIZE]; + + r = 0; + + sp = 0; + fpush ( loSt, hiSt ); + + while (sp > 0) { + + AssertH ( sp < FALLBACK_QSORT_STACK_SIZE, 1004 ); + + fpop ( lo, hi ); + if (hi - lo < FALLBACK_QSORT_SMALL_THRESH) { + fallbackSimpleSort ( fmap, eclass, lo, hi ); + continue; + } + + /* Random partitioning. Median of 3 sometimes fails to + avoid bad cases. Median of 9 seems to help but + looks rather expensive. This too seems to work but + is cheaper. Guidance for the magic constants + 7621 and 32768 is taken from Sedgewick's algorithms + book, chapter 35. + */ + r = ((r * 7621) + 1) % 32768; + r3 = r % 3; + if (r3 == 0) med = eclass[fmap[lo]]; else + if (r3 == 1) med = eclass[fmap[(lo+hi)>>1]]; else + med = eclass[fmap[hi]]; + + unLo = ltLo = lo; + unHi = gtHi = hi; + + while (1) { + while (1) { + if (unLo > unHi) break; + n = (Int32)eclass[fmap[unLo]] - (Int32)med; + if (n == 0) { + fswap(fmap[unLo], fmap[ltLo]); + ltLo++; unLo++; + continue; + }; + if (n > 0) break; + unLo++; + } + while (1) { + if (unLo > unHi) break; + n = (Int32)eclass[fmap[unHi]] - (Int32)med; + if (n == 0) { + fswap(fmap[unHi], fmap[gtHi]); + gtHi--; unHi--; + continue; + }; + if (n < 0) break; + unHi--; + } + if (unLo > unHi) break; + fswap(fmap[unLo], fmap[unHi]); unLo++; unHi--; + } + + AssertD ( unHi == unLo-1, "fallbackQSort3(2)" ); + + if (gtHi < ltLo) continue; + + n = fmin(ltLo-lo, unLo-ltLo); fvswap(lo, unLo-n, n); + m = fmin(hi-gtHi, gtHi-unHi); fvswap(unLo, hi-m+1, m); + + n = lo + unLo - ltLo - 1; + m = hi - (gtHi - unHi) + 1; + + if (n - lo > hi - m) { + fpush ( lo, n ); + fpush ( m, hi ); + } else { + fpush ( m, hi ); + fpush ( lo, n ); + } + } +} + +#undef fmin +#undef fpush +#undef fpop +#undef fswap +#undef fvswap +#undef FALLBACK_QSORT_SMALL_THRESH +#undef FALLBACK_QSORT_STACK_SIZE + + +/*---------------------------------------------*/ +/* Pre: + nblock > 0 + eclass exists for [0 .. nblock-1] + ((UChar*)eclass) [0 .. nblock-1] holds block + ptr exists for [0 .. nblock-1] + + Post: + ((UChar*)eclass) [0 .. nblock-1] holds block + All other areas of eclass destroyed + fmap [0 .. nblock-1] holds sorted order + bhtab [ 0 .. 2+(nblock/32) ] destroyed +*/ + +#define SET_BH(zz) bhtab[(zz) >> 5] |= (1 << ((zz) & 31)) +#define CLEAR_BH(zz) bhtab[(zz) >> 5] &= ~(1 << ((zz) & 31)) +#define ISSET_BH(zz) (bhtab[(zz) >> 5] & (1 << ((zz) & 31))) +#define WORD_BH(zz) bhtab[(zz) >> 5] +#define UNALIGNED_BH(zz) ((zz) & 0x01f) + +static +void fallbackSort ( UInt32* fmap, + UInt32* eclass, + UInt32* bhtab, + Int32 nblock, + Int32 verb ) +{ + Int32 ftab[257]; + Int32 ftabCopy[256]; + Int32 H, i, j, k, l, r, cc, cc1; + Int32 nNotDone; + Int32 nBhtab; + UChar* eclass8 = (UChar*)eclass; + + /*-- + Initial 1-char radix sort to generate + initial fmap and initial BH bits. + --*/ + if (verb >= 4) + VPrintf0 ( " bucket sorting ...\n" ); + for (i = 0; i < 257; i++) ftab[i] = 0; + for (i = 0; i < nblock; i++) ftab[eclass8[i]]++; + for (i = 0; i < 256; i++) ftabCopy[i] = ftab[i]; + for (i = 1; i < 257; i++) ftab[i] += ftab[i-1]; + + for (i = 0; i < nblock; i++) { + j = eclass8[i]; + k = ftab[j] - 1; + ftab[j] = k; + fmap[k] = i; + } + + nBhtab = 2 + (nblock / 32); + for (i = 0; i < nBhtab; i++) bhtab[i] = 0; + for (i = 0; i < 256; i++) SET_BH(ftab[i]); + + /*-- + Inductively refine the buckets. Kind-of an + "exponential radix sort" (!), inspired by the + Manber-Myers suffix array construction algorithm. + --*/ + + /*-- set sentinel bits for block-end detection --*/ + for (i = 0; i < 32; i++) { + SET_BH(nblock + 2*i); + CLEAR_BH(nblock + 2*i + 1); + } + + /*-- the log(N) loop --*/ + H = 1; + while (1) { + + if (verb >= 4) + VPrintf1 ( " depth %6d has ", H ); + + j = 0; + for (i = 0; i < nblock; i++) { + if (ISSET_BH(i)) j = i; + k = fmap[i] - H; if (k < 0) k += nblock; + eclass[k] = j; + } + + nNotDone = 0; + r = -1; + while (1) { + + /*-- find the next non-singleton bucket --*/ + k = r + 1; + while (ISSET_BH(k) && UNALIGNED_BH(k)) k++; + if (ISSET_BH(k)) { + while (WORD_BH(k) == 0xffffffff) k += 32; + while (ISSET_BH(k)) k++; + } + l = k - 1; + if (l >= nblock) break; + while (!ISSET_BH(k) && UNALIGNED_BH(k)) k++; + if (!ISSET_BH(k)) { + while (WORD_BH(k) == 0x00000000) k += 32; + while (!ISSET_BH(k)) k++; + } + r = k - 1; + if (r >= nblock) break; + + /*-- now [l, r] bracket current bucket --*/ + if (r > l) { + nNotDone += (r - l + 1); + fallbackQSort3 ( fmap, eclass, l, r ); + + /*-- scan bucket and generate header bits-- */ + cc = -1; + for (i = l; i <= r; i++) { + cc1 = eclass[fmap[i]]; + if (cc != cc1) { SET_BH(i); cc = cc1; }; + } + } + } + + if (verb >= 4) + VPrintf1 ( "%6d unresolved strings\n", nNotDone ); + + H *= 2; + if (H > nblock || nNotDone == 0) break; + } + + /*-- + Reconstruct the original block in + eclass8 [0 .. nblock-1], since the + previous phase destroyed it. + --*/ + if (verb >= 4) + VPrintf0 ( " reconstructing block ...\n" ); + j = 0; + for (i = 0; i < nblock; i++) { + while (ftabCopy[j] == 0) j++; + ftabCopy[j]--; + eclass8[fmap[i]] = (UChar)j; + } + AssertH ( j < 256, 1005 ); +} + +#undef SET_BH +#undef CLEAR_BH +#undef ISSET_BH +#undef WORD_BH +#undef UNALIGNED_BH + + +/*---------------------------------------------*/ +/*--- The main, O(N^2 log(N)) sorting ---*/ +/*--- algorithm. Faster for "normal" ---*/ +/*--- non-repetitive blocks. ---*/ +/*---------------------------------------------*/ + +/*---------------------------------------------*/ +static +__inline__ +Bool mainGtU ( UInt32 i1, + UInt32 i2, + UChar* block, + UInt16* quadrant, + UInt32 nblock, + Int32* budget ) +{ + Int32 k; + UChar c1, c2; + UInt16 s1, s2; + + AssertD ( i1 != i2, "mainGtU" ); + /* 1 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 2 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 3 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 4 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 5 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 6 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 7 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 8 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 9 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 10 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 11 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 12 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + + k = nblock + 8; + + do { + /* 1 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 2 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 3 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 4 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 5 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 6 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 7 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 8 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + + if (i1 >= nblock) i1 -= nblock; + if (i2 >= nblock) i2 -= nblock; + + k -= 8; + (*budget)--; + } + while (k >= 0); + + return False; +} + + +/*---------------------------------------------*/ +/*-- + Knuth's increments seem to work better + than Incerpi-Sedgewick here. Possibly + because the number of elems to sort is + usually small, typically <= 20. +--*/ +static +Int32 incs[14] = { 1, 4, 13, 40, 121, 364, 1093, 3280, + 9841, 29524, 88573, 265720, + 797161, 2391484 }; + +static +void mainSimpleSort ( UInt32* ptr, + UChar* block, + UInt16* quadrant, + Int32 nblock, + Int32 lo, + Int32 hi, + Int32 d, + Int32* budget ) +{ + Int32 i, j, h, bigN, hp; + UInt32 v; + + bigN = hi - lo + 1; + if (bigN < 2) return; + + hp = 0; + while (incs[hp] < bigN) hp++; + hp--; + + for (; hp >= 0; hp--) { + h = incs[hp]; + + i = lo + h; + while (True) { + + /*-- copy 1 --*/ + if (i > hi) break; + v = ptr[i]; + j = i; + while ( mainGtU ( + ptr[j-h]+d, v+d, block, quadrant, nblock, budget + ) ) { + ptr[j] = ptr[j-h]; + j = j - h; + if (j <= (lo + h - 1)) break; + } + ptr[j] = v; + i++; + + /*-- copy 2 --*/ + if (i > hi) break; + v = ptr[i]; + j = i; + while ( mainGtU ( + ptr[j-h]+d, v+d, block, quadrant, nblock, budget + ) ) { + ptr[j] = ptr[j-h]; + j = j - h; + if (j <= (lo + h - 1)) break; + } + ptr[j] = v; + i++; + + /*-- copy 3 --*/ + if (i > hi) break; + v = ptr[i]; + j = i; + while ( mainGtU ( + ptr[j-h]+d, v+d, block, quadrant, nblock, budget + ) ) { + ptr[j] = ptr[j-h]; + j = j - h; + if (j <= (lo + h - 1)) break; + } + ptr[j] = v; + i++; + + if (*budget < 0) return; + } + } +} + + +/*---------------------------------------------*/ +/*-- + The following is an implementation of + an elegant 3-way quicksort for strings, + described in a paper "Fast Algorithms for + Sorting and Searching Strings", by Robert + Sedgewick and Jon L. Bentley. +--*/ + +#define mswap(zz1, zz2) \ + { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; } + +#define mvswap(zzp1, zzp2, zzn) \ +{ \ + Int32 yyp1 = (zzp1); \ + Int32 yyp2 = (zzp2); \ + Int32 yyn = (zzn); \ + while (yyn > 0) { \ + mswap(ptr[yyp1], ptr[yyp2]); \ + yyp1++; yyp2++; yyn--; \ + } \ +} + +static +__inline__ +UChar mmed3 ( UChar a, UChar b, UChar c ) +{ + UChar t; + if (a > b) { t = a; a = b; b = t; }; + if (b > c) { + b = c; + if (a > b) b = a; + } + return b; +} + +#define mmin(a,b) ((a) < (b)) ? (a) : (b) + +#define mpush(lz,hz,dz) { stackLo[sp] = lz; \ + stackHi[sp] = hz; \ + stackD [sp] = dz; \ + sp++; } + +#define mpop(lz,hz,dz) { sp--; \ + lz = stackLo[sp]; \ + hz = stackHi[sp]; \ + dz = stackD [sp]; } + + +#define mnextsize(az) (nextHi[az]-nextLo[az]) + +#define mnextswap(az,bz) \ + { Int32 tz; \ + tz = nextLo[az]; nextLo[az] = nextLo[bz]; nextLo[bz] = tz; \ + tz = nextHi[az]; nextHi[az] = nextHi[bz]; nextHi[bz] = tz; \ + tz = nextD [az]; nextD [az] = nextD [bz]; nextD [bz] = tz; } + + +#define MAIN_QSORT_SMALL_THRESH 20 +#define MAIN_QSORT_DEPTH_THRESH (BZ_N_RADIX + BZ_N_QSORT) +#define MAIN_QSORT_STACK_SIZE 100 + +static +void mainQSort3 ( UInt32* ptr, + UChar* block, + UInt16* quadrant, + Int32 nblock, + Int32 loSt, + Int32 hiSt, + Int32 dSt, + Int32* budget ) +{ + Int32 unLo, unHi, ltLo, gtHi, n, m, med; + Int32 sp, lo, hi, d; + + Int32 stackLo[MAIN_QSORT_STACK_SIZE]; + Int32 stackHi[MAIN_QSORT_STACK_SIZE]; + Int32 stackD [MAIN_QSORT_STACK_SIZE]; + + Int32 nextLo[3]; + Int32 nextHi[3]; + Int32 nextD [3]; + + sp = 0; + mpush ( loSt, hiSt, dSt ); + + while (sp > 0) { + + AssertH ( sp < MAIN_QSORT_STACK_SIZE, 1001 ); + + mpop ( lo, hi, d ); + if (hi - lo < MAIN_QSORT_SMALL_THRESH || + d > MAIN_QSORT_DEPTH_THRESH) { + mainSimpleSort ( ptr, block, quadrant, nblock, lo, hi, d, budget ); + if (*budget < 0) return; + continue; + } + + med = (Int32) + mmed3 ( block[ptr[ lo ]+d], + block[ptr[ hi ]+d], + block[ptr[ (lo+hi)>>1 ]+d] ); + + unLo = ltLo = lo; + unHi = gtHi = hi; + + while (True) { + while (True) { + if (unLo > unHi) break; + n = ((Int32)block[ptr[unLo]+d]) - med; + if (n == 0) { + mswap(ptr[unLo], ptr[ltLo]); + ltLo++; unLo++; continue; + }; + if (n > 0) break; + unLo++; + } + while (True) { + if (unLo > unHi) break; + n = ((Int32)block[ptr[unHi]+d]) - med; + if (n == 0) { + mswap(ptr[unHi], ptr[gtHi]); + gtHi--; unHi--; continue; + }; + if (n < 0) break; + unHi--; + } + if (unLo > unHi) break; + mswap(ptr[unLo], ptr[unHi]); unLo++; unHi--; + } + + AssertD ( unHi == unLo-1, "mainQSort3(2)" ); + + if (gtHi < ltLo) { + mpush(lo, hi, d+1 ); + continue; + } + + n = mmin(ltLo-lo, unLo-ltLo); mvswap(lo, unLo-n, n); + m = mmin(hi-gtHi, gtHi-unHi); mvswap(unLo, hi-m+1, m); + + n = lo + unLo - ltLo - 1; + m = hi - (gtHi - unHi) + 1; + + nextLo[0] = lo; nextHi[0] = n; nextD[0] = d; + nextLo[1] = m; nextHi[1] = hi; nextD[1] = d; + nextLo[2] = n+1; nextHi[2] = m-1; nextD[2] = d+1; + + if (mnextsize(0) < mnextsize(1)) mnextswap(0,1); + if (mnextsize(1) < mnextsize(2)) mnextswap(1,2); + if (mnextsize(0) < mnextsize(1)) mnextswap(0,1); + + AssertD (mnextsize(0) >= mnextsize(1), "mainQSort3(8)" ); + AssertD (mnextsize(1) >= mnextsize(2), "mainQSort3(9)" ); + + mpush (nextLo[0], nextHi[0], nextD[0]); + mpush (nextLo[1], nextHi[1], nextD[1]); + mpush (nextLo[2], nextHi[2], nextD[2]); + } +} + +#undef mswap +#undef mvswap +#undef mpush +#undef mpop +#undef mmin +#undef mnextsize +#undef mnextswap +#undef MAIN_QSORT_SMALL_THRESH +#undef MAIN_QSORT_DEPTH_THRESH +#undef MAIN_QSORT_STACK_SIZE + + +/*---------------------------------------------*/ +/* Pre: + nblock > N_OVERSHOOT + block32 exists for [0 .. nblock-1 +N_OVERSHOOT] + ((UChar*)block32) [0 .. nblock-1] holds block + ptr exists for [0 .. nblock-1] + + Post: + ((UChar*)block32) [0 .. nblock-1] holds block + All other areas of block32 destroyed + ftab [0 .. 65536 ] destroyed + ptr [0 .. nblock-1] holds sorted order + if (*budget < 0), sorting was abandoned +*/ + +#define BIGFREQ(b) (ftab[((b)+1) << 8] - ftab[(b) << 8]) +#define SETMASK (1 << 21) +#define CLEARMASK (~(SETMASK)) + +static +void mainSort ( UInt32* ptr, + UChar* block, + UInt16* quadrant, + UInt32* ftab, + Int32 nblock, + Int32 verb, + Int32* budget ) +{ + Int32 i, j, k, ss, sb; + Int32 runningOrder[256]; + Bool bigDone[256]; + Int32 copyStart[256]; + Int32 copyEnd [256]; + UChar c1; + Int32 numQSorted; + UInt16 s; + if (verb >= 4) VPrintf0 ( " main sort initialise ...\n" ); + + /*-- set up the 2-byte frequency table --*/ + for (i = 65536; i >= 0; i--) ftab[i] = 0; + + j = block[0] << 8; + i = nblock-1; + for (; i >= 3; i -= 4) { + quadrant[i] = 0; + j = (j >> 8) | ( ((UInt16)block[i]) << 8); + ftab[j]++; + quadrant[i-1] = 0; + j = (j >> 8) | ( ((UInt16)block[i-1]) << 8); + ftab[j]++; + quadrant[i-2] = 0; + j = (j >> 8) | ( ((UInt16)block[i-2]) << 8); + ftab[j]++; + quadrant[i-3] = 0; + j = (j >> 8) | ( ((UInt16)block[i-3]) << 8); + ftab[j]++; + } + for (; i >= 0; i--) { + quadrant[i] = 0; + j = (j >> 8) | ( ((UInt16)block[i]) << 8); + ftab[j]++; + } + + /*-- (emphasises close relationship of block & quadrant) --*/ + for (i = 0; i < BZ_N_OVERSHOOT; i++) { + block [nblock+i] = block[i]; + quadrant[nblock+i] = 0; + } + + if (verb >= 4) VPrintf0 ( " bucket sorting ...\n" ); + + /*-- Complete the initial radix sort --*/ + for (i = 1; i <= 65536; i++) ftab[i] += ftab[i-1]; + + s = block[0] << 8; + i = nblock-1; + for (; i >= 3; i -= 4) { + s = (s >> 8) | (block[i] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i; + s = (s >> 8) | (block[i-1] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i-1; + s = (s >> 8) | (block[i-2] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i-2; + s = (s >> 8) | (block[i-3] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i-3; + } + for (; i >= 0; i--) { + s = (s >> 8) | (block[i] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i; + } + + /*-- + Now ftab contains the first loc of every small bucket. + Calculate the running order, from smallest to largest + big bucket. + --*/ + for (i = 0; i <= 255; i++) { + bigDone [i] = False; + runningOrder[i] = i; + } + + { + Int32 vv; + Int32 h = 1; + do h = 3 * h + 1; while (h <= 256); + do { + h = h / 3; + for (i = h; i <= 255; i++) { + vv = runningOrder[i]; + j = i; + while ( BIGFREQ(runningOrder[j-h]) > BIGFREQ(vv) ) { + runningOrder[j] = runningOrder[j-h]; + j = j - h; + if (j <= (h - 1)) goto zero; + } + zero: + runningOrder[j] = vv; + } + } while (h != 1); + } + + /*-- + The main sorting loop. + --*/ + + numQSorted = 0; + + for (i = 0; i <= 255; i++) { + + /*-- + Process big buckets, starting with the least full. + Basically this is a 3-step process in which we call + mainQSort3 to sort the small buckets [ss, j], but + also make a big effort to avoid the calls if we can. + --*/ + ss = runningOrder[i]; + + /*-- + Step 1: + Complete the big bucket [ss] by quicksorting + any unsorted small buckets [ss, j], for j != ss. + Hopefully previous pointer-scanning phases have already + completed many of the small buckets [ss, j], so + we don't have to sort them at all. + --*/ + for (j = 0; j <= 255; j++) { + if (j != ss) { + sb = (ss << 8) + j; + if ( ! (ftab[sb] & SETMASK) ) { + Int32 lo = ftab[sb] & CLEARMASK; + Int32 hi = (ftab[sb+1] & CLEARMASK) - 1; + if (hi > lo) { + if (verb >= 4) + VPrintf4 ( " qsort [0x%x, 0x%x] " + "done %d this %d\n", + ss, j, numQSorted, hi - lo + 1 ); + mainQSort3 ( + ptr, block, quadrant, nblock, + lo, hi, BZ_N_RADIX, budget + ); + numQSorted += (hi - lo + 1); + if (*budget < 0) return; + } + } + ftab[sb] |= SETMASK; + } + } + + AssertH ( !bigDone[ss], 1006 ); + + /*-- + Step 2: + Now scan this big bucket [ss] so as to synthesise the + sorted order for small buckets [t, ss] for all t, + including, magically, the bucket [ss,ss] too. + This will avoid doing Real Work in subsequent Step 1's. + --*/ + { + for (j = 0; j <= 255; j++) { + copyStart[j] = ftab[(j << 8) + ss] & CLEARMASK; + copyEnd [j] = (ftab[(j << 8) + ss + 1] & CLEARMASK) - 1; + } + for (j = ftab[ss << 8] & CLEARMASK; j < copyStart[ss]; j++) { + k = ptr[j]-1; if (k < 0) k += nblock; + c1 = block[k]; + if (!bigDone[c1]) + ptr[ copyStart[c1]++ ] = k; + } + for (j = (ftab[(ss+1) << 8] & CLEARMASK) - 1; j > copyEnd[ss]; j--) { + k = ptr[j]-1; if (k < 0) k += nblock; + c1 = block[k]; + if (!bigDone[c1]) + ptr[ copyEnd[c1]-- ] = k; + } + } + + AssertH ( copyStart[ss]-1 == copyEnd[ss], 1007 ); + + for (j = 0; j <= 255; j++) ftab[(j << 8) + ss] |= SETMASK; + + /*-- + Step 3: + The [ss] big bucket is now done. Record this fact, + and update the quadrant descriptors. Remember to + update quadrants in the overshoot area too, if + necessary. The "if (i < 255)" test merely skips + this updating for the last bucket processed, since + updating for the last bucket is pointless. + + The quadrant array provides a way to incrementally + cache sort orderings, as they appear, so as to + make subsequent comparisons in fullGtU() complete + faster. For repetitive blocks this makes a big + difference (but not big enough to be able to avoid + the fallback sorting mechanism, exponential radix sort). + + The precise meaning is: at all times: + + for 0 <= i < nblock and 0 <= j <= nblock + + if block[i] != block[j], + + then the relative values of quadrant[i] and + quadrant[j] are meaningless. + + else { + if quadrant[i] < quadrant[j] + then the string starting at i lexicographically + precedes the string starting at j + + else if quadrant[i] > quadrant[j] + then the string starting at j lexicographically + precedes the string starting at i + + else + the relative ordering of the strings starting + at i and j has not yet been determined. + } + --*/ + bigDone[ss] = True; + + if (i < 255) { + Int32 bbStart = ftab[ss << 8] & CLEARMASK; + Int32 bbSize = (ftab[(ss+1) << 8] & CLEARMASK) - bbStart; + Int32 shifts = 0; + + while ((bbSize >> shifts) > 65534) shifts++; + + for (j = bbSize-1; j >= 0; j--) { + Int32 a2update = ptr[bbStart + j]; + UInt16 qVal = (UInt16)(j >> shifts); + quadrant[a2update] = qVal; + if (a2update < BZ_N_OVERSHOOT) + quadrant[a2update + nblock] = qVal; + } + AssertH ( ((bbSize-1) >> shifts) <= 65535, 1002 ); + } + + } + + if (verb >= 4) + VPrintf3 ( " %d pointers, %d sorted, %d scanned\n", + nblock, numQSorted, nblock - numQSorted ); +} + +#undef BIGFREQ +#undef SETMASK +#undef CLEARMASK + + +/*---------------------------------------------*/ +/* Pre: + nblock > 0 + arr2 exists for [0 .. nblock-1 +N_OVERSHOOT] + ((UChar*)arr2) [0 .. nblock-1] holds block + arr1 exists for [0 .. nblock-1] + + Post: + ((UChar*)arr2) [0 .. nblock-1] holds block + All other areas of block destroyed + ftab [ 0 .. 65536 ] destroyed + arr1 [0 .. nblock-1] holds sorted order +*/ +void BZ2_blockSort ( EState* s ) +{ + UInt32* ptr = s->ptr; + UChar* block = s->block; + UInt32* ftab = s->ftab; + Int32 nblock = s->nblock; + Int32 verb = s->verbosity; + Int32 wfact = s->workFactor; + UInt16* quadrant; + Int32 budget; + Int32 budgetInit; + Int32 i; + + if (nblock < 10000) { + fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb ); + } else { + /* Calculate the location for quadrant, remembering to get + the alignment right. Assumes that &(block[0]) is at least + 2-byte aligned -- this should be ok since block is really + the first section of arr2. + */ + i = nblock+BZ_N_OVERSHOOT; + if (i & 1) i++; + quadrant = (UInt16*)(&(block[i])); + + /* (wfact-1) / 3 puts the default-factor-30 + transition point at very roughly the same place as + with v0.1 and v0.9.0. + Not that it particularly matters any more, since the + resulting compressed stream is now the same regardless + of whether or not we use the main sort or fallback sort. + */ + if (wfact < 1 ) wfact = 1; + if (wfact > 100) wfact = 100; + budgetInit = nblock * ((wfact-1) / 3); + budget = budgetInit; + + mainSort ( ptr, block, quadrant, ftab, nblock, verb, &budget ); + if (verb >= 3) + VPrintf3 ( " %d work, %d block, ratio %5.2f\n", + budgetInit - budget, + nblock, + (float)(budgetInit - budget) / + (float)(nblock==0 ? 1 : nblock) ); + if (budget < 0) { + if (verb >= 2) + VPrintf0 ( " too repetitive; using fallback" + " sorting algorithm\n" ); + fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb ); + } + } + + s->origPtr = -1; + for (i = 0; i < s->nblock; i++) + if (ptr[i] == 0) + { s->origPtr = i; break; }; + + AssertH( s->origPtr != -1, 1003 ); +} + + +/*-------------------------------------------------------------*/ +/*--- end blocksort.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/bzip2.1 b/bzip2/bzip2.1 new file mode 100644 index 0000000..7de54a0 --- /dev/null +++ b/bzip2/bzip2.1 @@ -0,0 +1,439 @@ +.PU +.TH bzip2 1 +.SH NAME +bzip2, bunzip2 \- a block-sorting file compressor, v1.0 +.br +bzcat \- decompresses files to stdout +.br +bzip2recover \- recovers data from damaged bzip2 files + +.SH SYNOPSIS +.ll +8 +.B bzip2 +.RB [ " \-cdfkqstvzVL123456789 " ] +[ +.I "filenames \&..." +] +.ll -8 +.br +.B bunzip2 +.RB [ " \-fkvsVL " ] +[ +.I "filenames \&..." +] +.br +.B bzcat +.RB [ " \-s " ] +[ +.I "filenames \&..." +] +.br +.B bzip2recover +.I "filename" + +.SH DESCRIPTION +.I bzip2 +compresses files using the Burrows-Wheeler block sorting +text compression algorithm, and Huffman coding. Compression is +generally considerably better than that achieved by more conventional +LZ77/LZ78-based compressors, and approaches the performance of the PPM +family of statistical compressors. + +The command-line options are deliberately very similar to +those of +.I GNU gzip, +but they are not identical. + +.I bzip2 +expects a list of file names to accompany the +command-line flags. Each file is replaced by a compressed version of +itself, with the name "original_name.bz2". +Each compressed file +has the same modification date, permissions, and, when possible, +ownership as the corresponding original, so that these properties can +be correctly restored at decompression time. File name handling is +naive in the sense that there is no mechanism for preserving original +file names, permissions, ownerships or dates in filesystems which lack +these concepts, or have serious file name length restrictions, such as +MS-DOS. + +.I bzip2 +and +.I bunzip2 +will by default not overwrite existing +files. If you want this to happen, specify the \-f flag. + +If no file names are specified, +.I bzip2 +compresses from standard +input to standard output. In this case, +.I bzip2 +will decline to +write compressed output to a terminal, as this would be entirely +incomprehensible and therefore pointless. + +.I bunzip2 +(or +.I bzip2 \-d) +decompresses all +specified files. Files which were not created by +.I bzip2 +will be detected and ignored, and a warning issued. +.I bzip2 +attempts to guess the filename for the decompressed file +from that of the compressed file as follows: + + filename.bz2 becomes filename + filename.bz becomes filename + filename.tbz2 becomes filename.tar + filename.tbz becomes filename.tar + anyothername becomes anyothername.out + +If the file does not end in one of the recognised endings, +.I .bz2, +.I .bz, +.I .tbz2 +or +.I .tbz, +.I bzip2 +complains that it cannot +guess the name of the original file, and uses the original name +with +.I .out +appended. + +As with compression, supplying no +filenames causes decompression from +standard input to standard output. + +.I bunzip2 +will correctly decompress a file which is the +concatenation of two or more compressed files. The result is the +concatenation of the corresponding uncompressed files. Integrity +testing (\-t) +of concatenated +compressed files is also supported. + +You can also compress or decompress files to the standard output by +giving the \-c flag. Multiple files may be compressed and +decompressed like this. The resulting outputs are fed sequentially to +stdout. Compression of multiple files +in this manner generates a stream +containing multiple compressed file representations. Such a stream +can be decompressed correctly only by +.I bzip2 +version 0.9.0 or +later. Earlier versions of +.I bzip2 +will stop after decompressing +the first file in the stream. + +.I bzcat +(or +.I bzip2 -dc) +decompresses all specified files to +the standard output. + +.I bzip2 +will read arguments from the environment variables +.I BZIP2 +and +.I BZIP, +in that order, and will process them +before any arguments read from the command line. This gives a +convenient way to supply default arguments. + +Compression is always performed, even if the compressed +file is slightly +larger than the original. Files of less than about one hundred bytes +tend to get larger, since the compression mechanism has a constant +overhead in the region of 50 bytes. Random data (including the output +of most file compressors) is coded at about 8.05 bits per byte, giving +an expansion of around 0.5%. + +As a self-check for your protection, +.I +bzip2 +uses 32-bit CRCs to +make sure that the decompressed version of a file is identical to the +original. This guards against corruption of the compressed data, and +against undetected bugs in +.I bzip2 +(hopefully very unlikely). The +chances of data corruption going undetected is microscopic, about one +chance in four billion for each file processed. Be aware, though, that +the check occurs upon decompression, so it can only tell you that +something is wrong. It can't help you +recover the original uncompressed +data. You can use +.I bzip2recover +to try to recover data from +damaged files. + +Return values: 0 for a normal exit, 1 for environmental problems (file +not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt +compressed file, 3 for an internal consistency error (eg, bug) which +caused +.I bzip2 +to panic. + +.SH OPTIONS +.TP +.B \-c --stdout +Compress or decompress to standard output. +.TP +.B \-d --decompress +Force decompression. +.I bzip2, +.I bunzip2 +and +.I bzcat +are +really the same program, and the decision about what actions to take is +done on the basis of which name is used. This flag overrides that +mechanism, and forces +.I bzip2 +to decompress. +.TP +.B \-z --compress +The complement to \-d: forces compression, regardless of the +invokation name. +.TP +.B \-t --test +Check integrity of the specified file(s), but don't decompress them. +This really performs a trial decompression and throws away the result. +.TP +.B \-f --force +Force overwrite of output files. Normally, +.I bzip2 +will not overwrite +existing output files. Also forces +.I bzip2 +to break hard links +to files, which it otherwise wouldn't do. +.TP +.B \-k --keep +Keep (don't delete) input files during compression +or decompression. +.TP +.B \-s --small +Reduce memory usage, for compression, decompression and testing. Files +are decompressed and tested using a modified algorithm which only +requires 2.5 bytes per block byte. This means any file can be +decompressed in 2300k of memory, albeit at about half the normal speed. + +During compression, \-s selects a block size of 200k, which limits +memory use to around the same figure, at the expense of your compression +ratio. In short, if your machine is low on memory (8 megabytes or +less), use \-s for everything. See MEMORY MANAGEMENT below. +.TP +.B \-q --quiet +Suppress non-essential warning messages. Messages pertaining to +I/O errors and other critical events will not be suppressed. +.TP +.B \-v --verbose +Verbose mode -- show the compression ratio for each file processed. +Further \-v's increase the verbosity level, spewing out lots of +information which is primarily of interest for diagnostic purposes. +.TP +.B \-L --license -V --version +Display the software version, license terms and conditions. +.TP +.B \-1 to \-9 +Set the block size to 100 k, 200 k .. 900 k when compressing. Has no +effect when decompressing. See MEMORY MANAGEMENT below. +.TP +.B \-- +Treats all subsequent arguments as file names, even if they start +with a dash. This is so you can handle files with names beginning +with a dash, for example: bzip2 \-- \-myfilename. +.TP +.B \--repetitive-fast --repetitive-best +These flags are redundant in versions 0.9.5 and above. They provided +some coarse control over the behaviour of the sorting algorithm in +earlier versions, which was sometimes useful. 0.9.5 and above have an +improved algorithm which renders these flags irrelevant. + +.SH MEMORY MANAGEMENT +.I bzip2 +compresses large files in blocks. The block size affects +both the compression ratio achieved, and the amount of memory needed for +compression and decompression. The flags \-1 through \-9 +specify the block size to be 100,000 bytes through 900,000 bytes (the +default) respectively. At decompression time, the block size used for +compression is read from the header of the compressed file, and +.I bunzip2 +then allocates itself just enough memory to decompress +the file. Since block sizes are stored in compressed files, it follows +that the flags \-1 to \-9 are irrelevant to and so ignored +during decompression. + +Compression and decompression requirements, +in bytes, can be estimated as: + + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) + +Larger block sizes give rapidly diminishing marginal returns. Most of +the compression comes from the first two or three hundred k of block +size, a fact worth bearing in mind when using +.I bzip2 +on small machines. +It is also important to appreciate that the decompression memory +requirement is set at compression time by the choice of block size. + +For files compressed with the default 900k block size, +.I bunzip2 +will require about 3700 kbytes to decompress. To support decompression +of any file on a 4 megabyte machine, +.I bunzip2 +has an option to +decompress using approximately half this amount of memory, about 2300 +kbytes. Decompression speed is also halved, so you should use this +option only where necessary. The relevant flag is -s. + +In general, try and use the largest block size memory constraints allow, +since that maximises the compression achieved. Compression and +decompression speed are virtually unaffected by block size. + +Another significant point applies to files which fit in a single block +-- that means most files you'd encounter using a large block size. The +amount of real memory touched is proportional to the size of the file, +since the file is smaller than a block. For example, compressing a file +20,000 bytes long with the flag -9 will cause the compressor to +allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560 +kbytes of it. Similarly, the decompressor will allocate 3700k but only +touch 100k + 20000 * 4 = 180 kbytes. + +Here is a table which summarises the maximum memory usage for different +block sizes. Also recorded is the total compressed size for 14 files of +the Calgary Text Compression Corpus totalling 3,141,622 bytes. This +column gives some feel for how compression varies with block size. +These figures tend to understate the advantage of larger block sizes for +larger files, since the Corpus is dominated by smaller files. + + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 + +.SH RECOVERING DATA FROM DAMAGED FILES +.I bzip2 +compresses files in blocks, usually 900kbytes long. Each +block is handled independently. If a media or transmission error causes +a multi-block .bz2 +file to become damaged, it may be possible to +recover data from the undamaged blocks in the file. + +The compressed representation of each block is delimited by a 48-bit +pattern, which makes it possible to find the block boundaries with +reasonable certainty. Each block also carries its own 32-bit CRC, so +damaged blocks can be distinguished from undamaged ones. + +.I bzip2recover +is a simple program whose purpose is to search for +blocks in .bz2 files, and write each block out into its own .bz2 +file. You can then use +.I bzip2 +\-t +to test the +integrity of the resulting files, and decompress those which are +undamaged. + +.I bzip2recover +takes a single argument, the name of the damaged file, +and writes a number of files "rec0001file.bz2", +"rec0002file.bz2", etc, containing the extracted blocks. +The output filenames are designed so that the use of +wildcards in subsequent processing -- for example, +"bzip2 -dc rec*file.bz2 > recovered_data" -- lists the files in +the correct order. + +.I bzip2recover +should be of most use dealing with large .bz2 +files, as these will contain many blocks. It is clearly +futile to use it on damaged single-block files, since a +damaged block cannot be recovered. If you wish to minimise +any potential data loss through media or transmission errors, +you might consider compressing with a smaller +block size. + +.SH PERFORMANCE NOTES +The sorting phase of compression gathers together similar strings in the +file. Because of this, files containing very long runs of repeated +symbols, like "aabaabaabaab ..." (repeated several hundred times) may +compress more slowly than normal. Versions 0.9.5 and above fare much +better than previous versions in this respect. The ratio between +worst-case and average-case compression time is in the region of 10:1. +For previous versions, this figure was more like 100:1. You can use the +\-vvvv option to monitor progress in great detail, if you want. + +Decompression speed is unaffected by these phenomena. + +.I bzip2 +usually allocates several megabytes of memory to operate +in, and then charges all over it in a fairly random fashion. This means +that performance, both for compressing and decompressing, is largely +determined by the speed at which your machine can service cache misses. +Because of this, small changes to the code to reduce the miss rate have +been observed to give disproportionately large performance improvements. +I imagine +.I bzip2 +will perform best on machines with very large caches. + +.SH CAVEATS +I/O error messages are not as helpful as they could be. +.I bzip2 +tries hard to detect I/O errors and exit cleanly, but the details of +what the problem is sometimes seem rather misleading. + +This manual page pertains to version 1.0 of +.I bzip2. +Compressed +data created by this version is entirely forwards and backwards +compatible with the previous public releases, versions 0.1pl2, 0.9.0 +and 0.9.5, +but with the following exception: 0.9.0 and above can correctly +decompress multiple concatenated compressed files. 0.1pl2 cannot do +this; it will stop after decompressing just the first file in the +stream. + +.I bzip2recover +uses 32-bit integers to represent bit positions in +compressed files, so it cannot handle compressed files more than 512 +megabytes long. This could easily be fixed. + +.SH AUTHOR +Julian Seward, jseward@acm.org. + +http://sourceware.cygnus.com/bzip2 +http://www.muraroa.demon.co.uk + +The ideas embodied in +.I bzip2 +are due to (at least) the following +people: Michael Burrows and David Wheeler (for the block sorting +transformation), David Wheeler (again, for the Huffman coder), Peter +Fenwick (for the structured coding model in the original +.I bzip, +and many refinements), and Alistair Moffat, Radford Neal and Ian Witten +(for the arithmetic coder in the original +.I bzip). +I am much +indebted for their help, support and advice. See the manual in the +source distribution for pointers to sources of documentation. Christian +von Roques encouraged me to look for faster sorting algorithms, so as to +speed up compression. Bela Lubkin encouraged me to improve the +worst-case compression performance. Many people sent patches, helped +with portability problems, lent machines, gave advice and were generally +helpful. diff --git a/bzip2/bzip2.1.preformatted b/bzip2/bzip2.1.preformatted new file mode 100644 index 0000000..9f18339 --- /dev/null +++ b/bzip2/bzip2.1.preformatted @@ -0,0 +1,462 @@ + + + +bzip2(1) bzip2(1) + + +NNAAMMEE + bzip2, bunzip2 - a block-sorting file compressor, v1.0 + bzcat - decompresses files to stdout + bzip2recover - recovers data from damaged bzip2 files + + +SSYYNNOOPPSSIISS + bbzziipp22 [ --ccddffkkqqssttvvzzVVLL112233445566778899 ] [ _f_i_l_e_n_a_m_e_s _._._. ] + bbuunnzziipp22 [ --ffkkvvssVVLL ] [ _f_i_l_e_n_a_m_e_s _._._. ] + bbzzccaatt [ --ss ] [ _f_i_l_e_n_a_m_e_s _._._. ] + bbzziipp22rreeccoovveerr _f_i_l_e_n_a_m_e + + +DDEESSCCRRIIPPTTIIOONN + _b_z_i_p_2 compresses files using the Burrows-Wheeler block + sorting text compression algorithm, and Huffman coding. + Compression is generally considerably better than that + achieved by more conventional LZ77/LZ78-based compressors, + and approaches the performance of the PPM family of sta- + tistical compressors. + + The command-line options are deliberately very similar to + those of _G_N_U _g_z_i_p_, but they are not identical. + + _b_z_i_p_2 expects a list of file names to accompany the com- + mand-line flags. Each file is replaced by a compressed + version of itself, with the name "original_name.bz2". + Each compressed file has the same modification date, per- + missions, and, when possible, ownership as the correspond- + ing original, so that these properties can be correctly + restored at decompression time. File name handling is + naive in the sense that there is no mechanism for preserv- + ing original file names, permissions, ownerships or dates + in filesystems which lack these concepts, or have serious + file name length restrictions, such as MS-DOS. + + _b_z_i_p_2 and _b_u_n_z_i_p_2 will by default not overwrite existing + files. If you want this to happen, specify the -f flag. + + If no file names are specified, _b_z_i_p_2 compresses from + standard input to standard output. In this case, _b_z_i_p_2 + will decline to write compressed output to a terminal, as + this would be entirely incomprehensible and therefore + pointless. + + _b_u_n_z_i_p_2 (or _b_z_i_p_2 _-_d_) decompresses all specified files. + Files which were not created by _b_z_i_p_2 will be detected and + ignored, and a warning issued. _b_z_i_p_2 attempts to guess + the filename for the decompressed file from that of the + compressed file as follows: + + filename.bz2 becomes filename + filename.bz becomes filename + filename.tbz2 becomes filename.tar + + + + 1 + + + + + +bzip2(1) bzip2(1) + + + filename.tbz becomes filename.tar + anyothername becomes anyothername.out + + If the file does not end in one of the recognised endings, + _._b_z_2_, _._b_z_, _._t_b_z_2 or _._t_b_z_, _b_z_i_p_2 complains that it cannot + guess the name of the original file, and uses the original + name with _._o_u_t appended. + + As with compression, supplying no filenames causes decom- + pression from standard input to standard output. + + _b_u_n_z_i_p_2 will correctly decompress a file which is the con- + catenation of two or more compressed files. The result is + the concatenation of the corresponding uncompressed files. + Integrity testing (-t) of concatenated compressed files is + also supported. + + You can also compress or decompress files to the standard + output by giving the -c flag. Multiple files may be com- + pressed and decompressed like this. The resulting outputs + are fed sequentially to stdout. Compression of multiple + files in this manner generates a stream containing multi- + ple compressed file representations. Such a stream can be + decompressed correctly only by _b_z_i_p_2 version 0.9.0 or + later. Earlier versions of _b_z_i_p_2 will stop after decom- + pressing the first file in the stream. + + _b_z_c_a_t (or _b_z_i_p_2 _-_d_c_) decompresses all specified files to + the standard output. + + _b_z_i_p_2 will read arguments from the environment variables + _B_Z_I_P_2 and _B_Z_I_P_, in that order, and will process them + before any arguments read from the command line. This + gives a convenient way to supply default arguments. + + Compression is always performed, even if the compressed + file is slightly larger than the original. Files of less + than about one hundred bytes tend to get larger, since the + compression mechanism has a constant overhead in the + region of 50 bytes. Random data (including the output of + most file compressors) is coded at about 8.05 bits per + byte, giving an expansion of around 0.5%. + + As a self-check for your protection, _b_z_i_p_2 uses 32-bit + CRCs to make sure that the decompressed version of a file + is identical to the original. This guards against corrup- + tion of the compressed data, and against undetected bugs + in _b_z_i_p_2 (hopefully very unlikely). The chances of data + corruption going undetected is microscopic, about one + chance in four billion for each file processed. Be aware, + though, that the check occurs upon decompression, so it + can only tell you that something is wrong. It can't help + you recover the original uncompressed data. You can use + _b_z_i_p_2_r_e_c_o_v_e_r to try to recover data from damaged files. + + + + 2 + + + + + +bzip2(1) bzip2(1) + + + Return values: 0 for a normal exit, 1 for environmental + problems (file not found, invalid flags, I/O errors, &c), + 2 to indicate a corrupt compressed file, 3 for an internal + consistency error (eg, bug) which caused _b_z_i_p_2 to panic. + + +OOPPTTIIOONNSS + --cc ----ssttddoouutt + Compress or decompress to standard output. + + --dd ----ddeeccoommpprreessss + Force decompression. _b_z_i_p_2_, _b_u_n_z_i_p_2 and _b_z_c_a_t are + really the same program, and the decision about + what actions to take is done on the basis of which + name is used. This flag overrides that mechanism, + and forces _b_z_i_p_2 to decompress. + + --zz ----ccoommpprreessss + The complement to -d: forces compression, regard- + less of the invokation name. + + --tt ----tteesstt + Check integrity of the specified file(s), but don't + decompress them. This really performs a trial + decompression and throws away the result. + + --ff ----ffoorrccee + Force overwrite of output files. Normally, _b_z_i_p_2 + will not overwrite existing output files. Also + forces _b_z_i_p_2 to break hard links to files, which it + otherwise wouldn't do. + + --kk ----kkeeeepp + Keep (don't delete) input files during compression + or decompression. + + --ss ----ssmmaallll + Reduce memory usage, for compression, decompression + and testing. Files are decompressed and tested + using a modified algorithm which only requires 2.5 + bytes per block byte. This means any file can be + decompressed in 2300k of memory, albeit at about + half the normal speed. + + During compression, -s selects a block size of + 200k, which limits memory use to around the same + figure, at the expense of your compression ratio. + In short, if your machine is low on memory (8 + megabytes or less), use -s for everything. See + MEMORY MANAGEMENT below. + + --qq ----qquuiieett + Suppress non-essential warning messages. Messages + pertaining to I/O errors and other critical events + + + + 3 + + + + + +bzip2(1) bzip2(1) + + + will not be suppressed. + + --vv ----vveerrbboossee + Verbose mode -- show the compression ratio for each + file processed. Further -v's increase the ver- + bosity level, spewing out lots of information which + is primarily of interest for diagnostic purposes. + + --LL ----lliicceennssee --VV ----vveerrssiioonn + Display the software version, license terms and + conditions. + + --11 ttoo --99 + Set the block size to 100 k, 200 k .. 900 k when + compressing. Has no effect when decompressing. + See MEMORY MANAGEMENT below. + + ---- Treats all subsequent arguments as file names, even + if they start with a dash. This is so you can han- + dle files with names beginning with a dash, for + example: bzip2 -- -myfilename. + + ----rreeppeettiittiivvee--ffaasstt ----rreeppeettiittiivvee--bbeesstt + These flags are redundant in versions 0.9.5 and + above. They provided some coarse control over the + behaviour of the sorting algorithm in earlier ver- + sions, which was sometimes useful. 0.9.5 and above + have an improved algorithm which renders these + flags irrelevant. + + +MMEEMMOORRYY MMAANNAAGGEEMMEENNTT + _b_z_i_p_2 compresses large files in blocks. The block size + affects both the compression ratio achieved, and the + amount of memory needed for compression and decompression. + The flags -1 through -9 specify the block size to be + 100,000 bytes through 900,000 bytes (the default) respec- + tively. At decompression time, the block size used for + compression is read from the header of the compressed + file, and _b_u_n_z_i_p_2 then allocates itself just enough memory + to decompress the file. Since block sizes are stored in + compressed files, it follows that the flags -1 to -9 are + irrelevant to and so ignored during decompression. + + Compression and decompression requirements, in bytes, can + be estimated as: + + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) + + Larger block sizes give rapidly diminishing marginal + returns. Most of the compression comes from the first two + + + + 4 + + + + + +bzip2(1) bzip2(1) + + + or three hundred k of block size, a fact worth bearing in + mind when using _b_z_i_p_2 on small machines. It is also + important to appreciate that the decompression memory + requirement is set at compression time by the choice of + block size. + + For files compressed with the default 900k block size, + _b_u_n_z_i_p_2 will require about 3700 kbytes to decompress. To + support decompression of any file on a 4 megabyte machine, + _b_u_n_z_i_p_2 has an option to decompress using approximately + half this amount of memory, about 2300 kbytes. Decompres- + sion speed is also halved, so you should use this option + only where necessary. The relevant flag is -s. + + In general, try and use the largest block size memory con- + straints allow, since that maximises the compression + achieved. Compression and decompression speed are virtu- + ally unaffected by block size. + + Another significant point applies to files which fit in a + single block -- that means most files you'd encounter + using a large block size. The amount of real memory + touched is proportional to the size of the file, since the + file is smaller than a block. For example, compressing a + file 20,000 bytes long with the flag -9 will cause the + compressor to allocate around 7600k of memory, but only + touch 400k + 20000 * 8 = 560 kbytes of it. Similarly, the + decompressor will allocate 3700k but only touch 100k + + 20000 * 4 = 180 kbytes. + + Here is a table which summarises the maximum memory usage + for different block sizes. Also recorded is the total + compressed size for 14 files of the Calgary Text Compres- + sion Corpus totalling 3,141,622 bytes. This column gives + some feel for how compression varies with block size. + These figures tend to understate the advantage of larger + block sizes for larger files, since the Corpus is domi- + nated by smaller files. + + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 + + + + + + + 5 + + + + + +bzip2(1) bzip2(1) + + +RREECCOOVVEERRIINNGG DDAATTAA FFRROOMM DDAAMMAAGGEEDD FFIILLEESS + _b_z_i_p_2 compresses files in blocks, usually 900kbytes long. + Each block is handled independently. If a media or trans- + mission error causes a multi-block .bz2 file to become + damaged, it may be possible to recover data from the + undamaged blocks in the file. + + The compressed representation of each block is delimited + by a 48-bit pattern, which makes it possible to find the + block boundaries with reasonable certainty. Each block + also carries its own 32-bit CRC, so damaged blocks can be + distinguished from undamaged ones. + + _b_z_i_p_2_r_e_c_o_v_e_r is a simple program whose purpose is to + search for blocks in .bz2 files, and write each block out + into its own .bz2 file. You can then use _b_z_i_p_2 -t to test + the integrity of the resulting files, and decompress those + which are undamaged. + + _b_z_i_p_2_r_e_c_o_v_e_r takes a single argument, the name of the dam- + aged file, and writes a number of files "rec0001file.bz2", + "rec0002file.bz2", etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, "bzip2 + -dc rec*file.bz2 > recovered_data" -- lists the files in + the correct order. + + _b_z_i_p_2_r_e_c_o_v_e_r should be of most use dealing with large .bz2 + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to min- + imise any potential data loss through media or transmis- + sion errors, you might consider compressing with a smaller + block size. + + +PPEERRFFOORRMMAANNCCEE NNOOTTEESS + The sorting phase of compression gathers together similar + strings in the file. Because of this, files containing + very long runs of repeated symbols, like "aabaabaabaab + ..." (repeated several hundred times) may compress more + slowly than normal. Versions 0.9.5 and above fare much + better than previous versions in this respect. The ratio + between worst-case and average-case compression time is in + the region of 10:1. For previous versions, this figure + was more like 100:1. You can use the -vvvv option to mon- + itor progress in great detail, if you want. + + Decompression speed is unaffected by these phenomena. + + _b_z_i_p_2 usually allocates several megabytes of memory to + operate in, and then charges all over it in a fairly ran- + dom fashion. This means that performance, both for com- + pressing and decompressing, is largely determined by the + + + + 6 + + + + + +bzip2(1) bzip2(1) + + + speed at which your machine can service cache misses. + Because of this, small changes to the code to reduce the + miss rate have been observed to give disproportionately + large performance improvements. I imagine _b_z_i_p_2 will per- + form best on machines with very large caches. + + +CCAAVVEEAATTSS + I/O error messages are not as helpful as they could be. + _b_z_i_p_2 tries hard to detect I/O errors and exit cleanly, + but the details of what the problem is sometimes seem + rather misleading. + + This manual page pertains to version 1.0 of _b_z_i_p_2_. Com- + pressed data created by this version is entirely forwards + and backwards compatible with the previous public + releases, versions 0.1pl2, 0.9.0 and 0.9.5, but with the + following exception: 0.9.0 and above can correctly decom- + press multiple concatenated compressed files. 0.1pl2 can- + not do this; it will stop after decompressing just the + first file in the stream. + + _b_z_i_p_2_r_e_c_o_v_e_r uses 32-bit integers to represent bit posi- + tions in compressed files, so it cannot handle compressed + files more than 512 megabytes long. This could easily be + fixed. + + +AAUUTTHHOORR + Julian Seward, jseward@acm.org. + + http://sourceware.cygnus.com/bzip2 + http://www.muraroa.demon.co.uk + + The ideas embodied in _b_z_i_p_2 are due to (at least) the fol- + lowing people: Michael Burrows and David Wheeler (for the + block sorting transformation), David Wheeler (again, for + the Huffman coder), Peter Fenwick (for the structured cod- + ing model in the original _b_z_i_p_, and many refinements), and + Alistair Moffat, Radford Neal and Ian Witten (for the + arithmetic coder in the original _b_z_i_p_)_. I am much + indebted for their help, support and advice. See the man- + ual in the source distribution for pointers to sources of + documentation. Christian von Roques encouraged me to look + for faster sorting algorithms, so as to speed up compres- + sion. Bela Lubkin encouraged me to improve the worst-case + compression performance. Many people sent patches, helped + with portability problems, lent machines, gave advice and + were generally helpful. + + + + + + + + + 7 + + diff --git a/bzip2/bzip2.c b/bzip2/bzip2.c new file mode 100644 index 0000000..56adfdc --- /dev/null +++ b/bzip2/bzip2.c @@ -0,0 +1,2044 @@ + +/*-----------------------------------------------------------*/ +/*--- A block-sorting, lossless compressor bzip2.c ---*/ +/*-----------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +/*----------------------------------------------------*/ +/*--- IMPORTANT ---*/ +/*----------------------------------------------------*/ + +/*-- + WARNING: + This program and library (attempts to) compress data by + performing several non-trivial transformations on it. + Unless you are 100% familiar with *all* the algorithms + contained herein, and with the consequences of modifying them, + you should NOT meddle with the compression or decompression + machinery. Incorrect changes can and very likely *will* + lead to disasterous loss of data. + + DISCLAIMER: + I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE + USE OF THIS PROGRAM, HOWSOEVER CAUSED. + + Every compression of a file implies an assumption that the + compressed file can be decompressed to reproduce the original. + Great efforts in design, coding and testing have been made to + ensure that this program works correctly. However, the + complexity of the algorithms, and, in particular, the presence + of various special cases in the code which occur with very low + but non-zero probability make it impossible to rule out the + possibility of bugs remaining in the program. DO NOT COMPRESS + ANY DATA WITH THIS PROGRAM AND/OR LIBRARY UNLESS YOU ARE PREPARED + TO ACCEPT THE POSSIBILITY, HOWEVER SMALL, THAT THE DATA WILL + NOT BE RECOVERABLE. + + That is not to say this program is inherently unreliable. + Indeed, I very much hope the opposite is true. bzip2/libbzip2 + has been carefully constructed and extensively tested. + + PATENTS: + To the best of my knowledge, bzip2/libbzip2 does not use any + patented algorithms. However, I do not have the resources + available to carry out a full patent search. Therefore I cannot + give any guarantee of the above statement. +--*/ + + + +/*----------------------------------------------------*/ +/*--- and now for something much more pleasant :-) ---*/ +/*----------------------------------------------------*/ + +/*---------------------------------------------*/ +/*-- + Place a 1 beside your platform, and 0 elsewhere. +--*/ + +/*-- + Generic 32-bit Unix. + Also works on 64-bit Unix boxes. +--*/ +#define BZ_UNIX 1 + +/*-- + Win32, as seen by Jacob Navia's excellent + port of (Chris Fraser & David Hanson)'s excellent + lcc compiler. +--*/ +#define BZ_LCCWIN32 0 + +#if defined(_WIN32) && !defined(__CYGWIN__) +#undef BZ_LCCWIN32 +#define BZ_LCCWIN32 1 +#undef BZ_UNIX +#define BZ_UNIX 0 +#endif + + +/*---------------------------------------------*/ +/*-- + Some stuff for all platforms. +--*/ + +#include +#include +#include +#include +#include +#include +#include +#include "bzlib.h" + +#define ERROR_IF_EOF(i) { if ((i) == EOF) ioError(); } +#define ERROR_IF_NOT_ZERO(i) { if ((i) != 0) ioError(); } +#define ERROR_IF_MINUS_ONE(i) { if ((i) == (-1)) ioError(); } + + +/*---------------------------------------------*/ +/*-- + Platform-specific stuff. +--*/ + +#if BZ_UNIX +# include +# include +# include +# include +# include + +# define PATH_SEP '/' +# define MY_LSTAT lstat +# define MY_S_IFREG S_ISREG +# define MY_STAT stat + +# define APPEND_FILESPEC(root, name) \ + root=snocString((root), (name)) + +# define APPEND_FLAG(root, name) \ + root=snocString((root), (name)) + +# define SET_BINARY_MODE(fd) /**/ + +# ifdef __GNUC__ +# define NORETURN __attribute__ ((noreturn)) +# else +# define NORETURN /**/ +# endif +# ifdef __DJGPP__ +# include +# include +# undef MY_LSTAT +# define MY_LSTAT stat +# undef SET_BINARY_MODE +# define SET_BINARY_MODE(fd) \ + do { \ + int retVal = setmode ( fileno ( fd ), \ + O_BINARY ); \ + ERROR_IF_MINUS_ONE ( retVal ); \ + } while ( 0 ) +# endif +# ifdef __CYGWIN__ +# include +# include +# undef SET_BINARY_MODE +# define SET_BINARY_MODE(fd) \ + do { \ + int retVal = setmode ( fileno ( fd ), \ + O_BINARY ); \ + ERROR_IF_MINUS_ONE ( retVal ); \ + } while ( 0 ) +# endif +#endif + + + +#if BZ_LCCWIN32 +# include +# include +# include + +# define NORETURN /**/ +# define PATH_SEP '\\' +# define MY_LSTAT _stat +# define MY_STAT _stat +# define MY_S_IFREG(x) ((x) & _S_IFREG) + +# define APPEND_FLAG(root, name) \ + root=snocString((root), (name)) + +# if 0 + /*-- lcc-win32 seems to expand wildcards itself --*/ +# define APPEND_FILESPEC(root, spec) \ + do { \ + if ((spec)[0] == '-') { \ + root = snocString((root), (spec)); \ + } else { \ + struct _finddata_t c_file; \ + long hFile; \ + hFile = _findfirst((spec), &c_file); \ + if ( hFile == -1L ) { \ + root = snocString ((root), (spec)); \ + } else { \ + int anInt = 0; \ + while ( anInt == 0 ) { \ + root = snocString((root), \ + &c_file.name[0]); \ + anInt = _findnext(hFile, &c_file); \ + } \ + } \ + } \ + } while ( 0 ) +# else +# define APPEND_FILESPEC(root, name) \ + root = snocString ((root), (name)) +# endif + +# define SET_BINARY_MODE(fd) \ + do { \ + int retVal = setmode ( fileno ( fd ), \ + O_BINARY ); \ + ERROR_IF_MINUS_ONE ( retVal ); \ + } while ( 0 ) + +#endif + + +/*---------------------------------------------*/ +/*-- + Some more stuff for all platforms :-) +--*/ + +typedef char Char; +typedef unsigned char Bool; +typedef unsigned char UChar; +typedef int Int32; +typedef unsigned int UInt32; +typedef short Int16; +typedef unsigned short UInt16; + +#define True ((Bool)1) +#define False ((Bool)0) + +/*-- + IntNative is your platform's `native' int size. + Only here to avoid probs with 64-bit platforms. +--*/ +typedef int IntNative; + + +/*---------------------------------------------------*/ +/*--- Misc (file handling) data decls ---*/ +/*---------------------------------------------------*/ + +Int32 verbosity; +Bool keepInputFiles, smallMode, deleteOutputOnInterrupt; +Bool forceOverwrite, testFailsExist, unzFailsExist, noisy; +Int32 numFileNames, numFilesProcessed, blockSize100k; +Int32 exitValue; + +/*-- source modes; F==file, I==stdin, O==stdout --*/ +#define SM_I2O 1 +#define SM_F2O 2 +#define SM_F2F 3 + +/*-- operation modes --*/ +#define OM_Z 1 +#define OM_UNZ 2 +#define OM_TEST 3 + +Int32 opMode; +Int32 srcMode; + +#define FILE_NAME_LEN 1034 + +Int32 longestFileName; +Char inName [FILE_NAME_LEN]; +Char outName[FILE_NAME_LEN]; +Char tmpName[FILE_NAME_LEN]; +Char *progName; +Char progNameReally[FILE_NAME_LEN]; +FILE *outputHandleJustInCase; +Int32 workFactor; + +static void panic ( Char* ) NORETURN; +static void ioError ( void ) NORETURN; +static void outOfMemory ( void ) NORETURN; +static void configError ( void ) NORETURN; +static void crcError ( void ) NORETURN; +static void cleanUpAndFail ( Int32 ) NORETURN; +static void compressedStreamEOF ( void ) NORETURN; + +static void copyFileName ( Char*, Char* ); +static void* myMalloc ( Int32 ); + + + +/*---------------------------------------------------*/ +/*--- An implementation of 64-bit ints. Sigh. ---*/ +/*--- Roll on widespread deployment of ANSI C9X ! ---*/ +/*---------------------------------------------------*/ + +typedef + struct { UChar b[8]; } + UInt64; + +static +void uInt64_from_UInt32s ( UInt64* n, UInt32 lo32, UInt32 hi32 ) +{ + n->b[7] = (UChar)((hi32 >> 24) & 0xFF); + n->b[6] = (UChar)((hi32 >> 16) & 0xFF); + n->b[5] = (UChar)((hi32 >> 8) & 0xFF); + n->b[4] = (UChar) (hi32 & 0xFF); + n->b[3] = (UChar)((lo32 >> 24) & 0xFF); + n->b[2] = (UChar)((lo32 >> 16) & 0xFF); + n->b[1] = (UChar)((lo32 >> 8) & 0xFF); + n->b[0] = (UChar) (lo32 & 0xFF); +} + +static +double uInt64_to_double ( UInt64* n ) +{ + Int32 i; + double base = 1.0; + double sum = 0.0; + for (i = 0; i < 8; i++) { + sum += base * (double)(n->b[i]); + base *= 256.0; + } + return sum; +} + +static +void uInt64_add ( UInt64* src, UInt64* dst ) +{ + Int32 i; + Int32 carry = 0; + for (i = 0; i < 8; i++) { + carry += ( ((Int32)src->b[i]) + ((Int32)dst->b[i]) ); + dst->b[i] = (UChar)(carry & 0xFF); + carry >>= 8; + } +} + +static +void uInt64_sub ( UInt64* src, UInt64* dst ) +{ + Int32 t, i; + Int32 borrow = 0; + for (i = 0; i < 8; i++) { + t = ((Int32)dst->b[i]) - ((Int32)src->b[i]) - borrow; + if (t < 0) { + dst->b[i] = (UChar)(t + 256); + borrow = 1; + } else { + dst->b[i] = (UChar)t; + borrow = 0; + } + } +} + +static +void uInt64_mul ( UInt64* a, UInt64* b, UInt64* r_hi, UInt64* r_lo ) +{ + UChar sum[16]; + Int32 ia, ib, carry; + for (ia = 0; ia < 16; ia++) sum[ia] = 0; + for (ia = 0; ia < 8; ia++) { + carry = 0; + for (ib = 0; ib < 8; ib++) { + carry += ( ((Int32)sum[ia+ib]) + + ((Int32)a->b[ia]) * ((Int32)b->b[ib]) ); + sum[ia+ib] = (UChar)(carry & 0xFF); + carry >>= 8; + } + sum[ia+8] = (UChar)(carry & 0xFF); + if ((carry >>= 8) != 0) panic ( "uInt64_mul" ); + } + + for (ia = 0; ia < 8; ia++) r_hi->b[ia] = sum[ia+8]; + for (ia = 0; ia < 8; ia++) r_lo->b[ia] = sum[ia]; +} + + +static +void uInt64_shr1 ( UInt64* n ) +{ + Int32 i; + for (i = 0; i < 8; i++) { + n->b[i] >>= 1; + if (i < 7 && (n->b[i+1] & 1)) n->b[i] |= 0x80; + } +} + +static +void uInt64_shl1 ( UInt64* n ) +{ + Int32 i; + for (i = 7; i >= 0; i--) { + n->b[i] <<= 1; + if (i > 0 && (n->b[i-1] & 0x80)) n->b[i]++; + } +} + +static +Bool uInt64_isZero ( UInt64* n ) +{ + Int32 i; + for (i = 0; i < 8; i++) + if (n->b[i] != 0) return 0; + return 1; +} + +static +Int32 uInt64_qrm10 ( UInt64* n ) +{ + /* Divide *n by 10, and return the remainder. Long division + is difficult, so we cheat and instead multiply by + 0xCCCC CCCC CCCC CCCD, which is 0.8 (viz, 0.1 << 3). + */ + Int32 i; + UInt64 tmp1, tmp2, n_orig, zero_point_eight; + + zero_point_eight.b[1] = zero_point_eight.b[2] = + zero_point_eight.b[3] = zero_point_eight.b[4] = + zero_point_eight.b[5] = zero_point_eight.b[6] = + zero_point_eight.b[7] = 0xCC; + zero_point_eight.b[0] = 0xCD; + + n_orig = *n; + + /* divide n by 10, + by multiplying by 0.8 and then shifting right 3 times */ + uInt64_mul ( n, &zero_point_eight, &tmp1, &tmp2 ); + uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); + *n = tmp1; + + /* tmp1 = 8*n, tmp2 = 2*n */ + uInt64_shl1(&tmp1); uInt64_shl1(&tmp1); uInt64_shl1(&tmp1); + tmp2 = *n; uInt64_shl1(&tmp2); + + /* tmp1 = 10*n */ + uInt64_add ( &tmp2, &tmp1 ); + + /* n_orig = n_orig - 10*n */ + uInt64_sub ( &tmp1, &n_orig ); + + /* n_orig should now hold quotient, in range 0 .. 9 */ + for (i = 7; i >= 1; i--) + if (n_orig.b[i] != 0) panic ( "uInt64_qrm10(1)" ); + if (n_orig.b[0] > 9) + panic ( "uInt64_qrm10(2)" ); + + return (int)n_orig.b[0]; +} + +/* ... and the Whole Entire Point of all this UInt64 stuff is + so that we can supply the following function. +*/ +static +void uInt64_toAscii ( char* outbuf, UInt64* n ) +{ + Int32 i, q; + UChar buf[32]; + Int32 nBuf = 0; + UInt64 n_copy = *n; + do { + q = uInt64_qrm10 ( &n_copy ); + buf[nBuf] = q + '0'; + nBuf++; + } while (!uInt64_isZero(&n_copy)); + outbuf[nBuf] = 0; + for (i = 0; i < nBuf; i++) outbuf[i] = buf[nBuf-i-1]; +} + + +/*---------------------------------------------------*/ +/*--- Processing of complete files and streams ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +static +Bool myfeof ( FILE* f ) +{ + Int32 c = fgetc ( f ); + if (c == EOF) return True; + ungetc ( c, f ); + return False; +} + + +/*---------------------------------------------*/ +static +void compressStream ( FILE *stream, FILE *zStream ) +{ + BZFILE* bzf = NULL; + UChar ibuf[5000]; + Int32 nIbuf; + UInt32 nbytes_in_lo32, nbytes_in_hi32; + UInt32 nbytes_out_lo32, nbytes_out_hi32; + Int32 bzerr, bzerr_dummy, ret; + + SET_BINARY_MODE(stream); + SET_BINARY_MODE(zStream); + + if (ferror(stream)) goto errhandler_io; + if (ferror(zStream)) goto errhandler_io; + + bzf = BZ2_bzWriteOpen ( &bzerr, zStream, + blockSize100k, verbosity, workFactor ); + if (bzerr != BZ_OK) goto errhandler; + + if (verbosity >= 2) fprintf ( stderr, "\n" ); + + while (True) { + + if (myfeof(stream)) break; + nIbuf = fread ( ibuf, sizeof(UChar), 5000, stream ); + if (ferror(stream)) goto errhandler_io; + if (nIbuf > 0) BZ2_bzWrite ( &bzerr, bzf, (void*)ibuf, nIbuf ); + if (bzerr != BZ_OK) goto errhandler; + + } + + BZ2_bzWriteClose64 ( &bzerr, bzf, 0, + &nbytes_in_lo32, &nbytes_in_hi32, + &nbytes_out_lo32, &nbytes_out_hi32 ); + if (bzerr != BZ_OK) goto errhandler; + + if (ferror(zStream)) goto errhandler_io; + ret = fflush ( zStream ); + if (ret == EOF) goto errhandler_io; + if (zStream != stdout) { + ret = fclose ( zStream ); + if (ret == EOF) goto errhandler_io; + } + if (ferror(stream)) goto errhandler_io; + ret = fclose ( stream ); + if (ret == EOF) goto errhandler_io; + + if (nbytes_in_lo32 == 0 && nbytes_in_hi32 == 0) + nbytes_in_lo32 = 1; + + if (verbosity >= 1) { + Char buf_nin[32], buf_nout[32]; + UInt64 nbytes_in, nbytes_out; + double nbytes_in_d, nbytes_out_d; + uInt64_from_UInt32s ( &nbytes_in, + nbytes_in_lo32, nbytes_in_hi32 ); + uInt64_from_UInt32s ( &nbytes_out, + nbytes_out_lo32, nbytes_out_hi32 ); + nbytes_in_d = uInt64_to_double ( &nbytes_in ); + nbytes_out_d = uInt64_to_double ( &nbytes_out ); + uInt64_toAscii ( buf_nin, &nbytes_in ); + uInt64_toAscii ( buf_nout, &nbytes_out ); + fprintf ( stderr, "%6.3f:1, %6.3f bits/byte, " + "%5.2f%% saved, %s in, %s out.\n", + nbytes_in_d / nbytes_out_d, + (8.0 * nbytes_out_d) / nbytes_in_d, + 100.0 * (1.0 - nbytes_out_d / nbytes_in_d), + buf_nin, + buf_nout + ); + } + + return; + + errhandler: + BZ2_bzWriteClose64 ( &bzerr_dummy, bzf, 1, + &nbytes_in_lo32, &nbytes_in_hi32, + &nbytes_out_lo32, &nbytes_out_hi32 ); + switch (bzerr) { + case BZ_CONFIG_ERROR: + configError(); break; + case BZ_MEM_ERROR: + outOfMemory (); break; + case BZ_IO_ERROR: + errhandler_io: + ioError(); break; + default: + panic ( "compress:unexpected error" ); + } + + panic ( "compress:end" ); + /*notreached*/ +} + + + +/*---------------------------------------------*/ +static +Bool uncompressStream ( FILE *zStream, FILE *stream ) +{ + BZFILE* bzf = NULL; + Int32 bzerr, bzerr_dummy, ret, nread, streamNo, i; + UChar obuf[5000]; + UChar unused[BZ_MAX_UNUSED]; + Int32 nUnused; + UChar* unusedTmp; + + nUnused = 0; + streamNo = 0; + + SET_BINARY_MODE(stream); + SET_BINARY_MODE(zStream); + + if (ferror(stream)) goto errhandler_io; + if (ferror(zStream)) goto errhandler_io; + + while (True) { + + bzf = BZ2_bzReadOpen ( + &bzerr, zStream, verbosity, + (int)smallMode, unused, nUnused + ); + if (bzf == NULL || bzerr != BZ_OK) goto errhandler; + streamNo++; + + while (bzerr == BZ_OK) { + nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 ); + if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler; + if ((bzerr == BZ_OK || bzerr == BZ_STREAM_END) && nread > 0) + fwrite ( obuf, sizeof(UChar), nread, stream ); + if (ferror(stream)) goto errhandler_io; + } + if (bzerr != BZ_STREAM_END) goto errhandler; + + BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused ); + if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" ); + + for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i]; + + BZ2_bzReadClose ( &bzerr, bzf ); + if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" ); + + if (nUnused == 0 && myfeof(zStream)) break; + + } + + if (ferror(zStream)) goto errhandler_io; + ret = fclose ( zStream ); + if (ret == EOF) goto errhandler_io; + + if (ferror(stream)) goto errhandler_io; + ret = fflush ( stream ); + if (ret != 0) goto errhandler_io; + if (stream != stdout) { + ret = fclose ( stream ); + if (ret == EOF) goto errhandler_io; + } + if (verbosity >= 2) fprintf ( stderr, "\n " ); + return True; + + errhandler: + BZ2_bzReadClose ( &bzerr_dummy, bzf ); + switch (bzerr) { + case BZ_CONFIG_ERROR: + configError(); break; + case BZ_IO_ERROR: + errhandler_io: + ioError(); break; + case BZ_DATA_ERROR: + crcError(); + case BZ_MEM_ERROR: + outOfMemory(); + case BZ_UNEXPECTED_EOF: + compressedStreamEOF(); + case BZ_DATA_ERROR_MAGIC: + if (zStream != stdin) fclose(zStream); + if (stream != stdout) fclose(stream); + if (streamNo == 1) { + return False; + } else { + if (noisy) + fprintf ( stderr, + "\n%s: %s: trailing garbage after EOF ignored\n", + progName, inName ); + return True; + } + default: + panic ( "decompress:unexpected error" ); + } + + panic ( "decompress:end" ); + return True; /*notreached*/ +} + + +/*---------------------------------------------*/ +static +Bool testStream ( FILE *zStream ) +{ + BZFILE* bzf = NULL; + Int32 bzerr, bzerr_dummy, ret, nread, streamNo, i; + UChar obuf[5000]; + UChar unused[BZ_MAX_UNUSED]; + Int32 nUnused; + UChar* unusedTmp; + + nUnused = 0; + streamNo = 0; + + SET_BINARY_MODE(zStream); + if (ferror(zStream)) goto errhandler_io; + + while (True) { + + bzf = BZ2_bzReadOpen ( + &bzerr, zStream, verbosity, + (int)smallMode, unused, nUnused + ); + if (bzf == NULL || bzerr != BZ_OK) goto errhandler; + streamNo++; + + while (bzerr == BZ_OK) { + nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 ); + if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler; + } + if (bzerr != BZ_STREAM_END) goto errhandler; + + BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused ); + if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" ); + + for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i]; + + BZ2_bzReadClose ( &bzerr, bzf ); + if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" ); + if (nUnused == 0 && myfeof(zStream)) break; + + } + + if (ferror(zStream)) goto errhandler_io; + ret = fclose ( zStream ); + if (ret == EOF) goto errhandler_io; + + if (verbosity >= 2) fprintf ( stderr, "\n " ); + return True; + + errhandler: + BZ2_bzReadClose ( &bzerr_dummy, bzf ); + if (verbosity == 0) + fprintf ( stderr, "%s: %s: ", progName, inName ); + switch (bzerr) { + case BZ_CONFIG_ERROR: + configError(); break; + case BZ_IO_ERROR: + errhandler_io: + ioError(); break; + case BZ_DATA_ERROR: + fprintf ( stderr, + "data integrity (CRC) error in data\n" ); + return False; + case BZ_MEM_ERROR: + outOfMemory(); + case BZ_UNEXPECTED_EOF: + fprintf ( stderr, + "file ends unexpectedly\n" ); + return False; + case BZ_DATA_ERROR_MAGIC: + if (zStream != stdin) fclose(zStream); + if (streamNo == 1) { + fprintf ( stderr, + "bad magic number (file not created by bzip2)\n" ); + return False; + } else { + if (noisy) + fprintf ( stderr, + "trailing garbage after EOF ignored\n" ); + return True; + } + default: + panic ( "test:unexpected error" ); + } + + panic ( "test:end" ); + return True; /*notreached*/ +} + + +/*---------------------------------------------------*/ +/*--- Error [non-] handling grunge ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +static +void setExit ( Int32 v ) +{ + if (v > exitValue) exitValue = v; +} + + +/*---------------------------------------------*/ +static +void cadvise ( void ) +{ + if (noisy) + fprintf ( + stderr, + "\nIt is possible that the compressed file(s) have become corrupted.\n" + "You can use the -tvv option to test integrity of such files.\n\n" + "You can use the `bzip2recover' program to *attempt* to recover\n" + "data from undamaged sections of corrupted files.\n\n" + ); +} + + +/*---------------------------------------------*/ +static +void showFileNames ( void ) +{ + if (noisy) + fprintf ( + stderr, + "\tInput file = %s, output file = %s\n", + inName, outName + ); +} + + +/*---------------------------------------------*/ +static +void cleanUpAndFail ( Int32 ec ) +{ + IntNative retVal; + + if ( srcMode == SM_F2F + && opMode != OM_TEST + && deleteOutputOnInterrupt ) { + if (noisy) + fprintf ( stderr, "%s: Deleting output file %s, if it exists.\n", + progName, outName ); + if (outputHandleJustInCase != NULL) + fclose ( outputHandleJustInCase ); + retVal = remove ( outName ); + if (retVal != 0) + fprintf ( stderr, + "%s: WARNING: deletion of output file (apparently) failed.\n", + progName ); + } + if (noisy && numFileNames > 0 && numFilesProcessed < numFileNames) { + fprintf ( stderr, + "%s: WARNING: some files have not been processed:\n" + "\t%d specified on command line, %d not processed yet.\n\n", + progName, numFileNames, + numFileNames - numFilesProcessed ); + } + setExit(ec); + exit(exitValue); +} + + +/*---------------------------------------------*/ +static +void panic ( Char* s ) +{ + fprintf ( stderr, + "\n%s: PANIC -- internal consistency error:\n" + "\t%s\n" + "\tThis is a BUG. Please report it to me at:\n" + "\tjseward@acm.org\n", + progName, s ); + showFileNames(); + cleanUpAndFail( 3 ); +} + + +/*---------------------------------------------*/ +static +void crcError ( void ) +{ + fprintf ( stderr, + "\n%s: Data integrity error when decompressing.\n", + progName ); + showFileNames(); + cadvise(); + cleanUpAndFail( 2 ); +} + + +/*---------------------------------------------*/ +static +void compressedStreamEOF ( void ) +{ + fprintf ( stderr, + "\n%s: Compressed file ends unexpectedly;\n\t" + "perhaps it is corrupted? *Possible* reason follows.\n", + progName ); + perror ( progName ); + showFileNames(); + cadvise(); + cleanUpAndFail( 2 ); +} + + +/*---------------------------------------------*/ +static +void ioError ( void ) +{ + fprintf ( stderr, + "\n%s: I/O or other error, bailing out. " + "Possible reason follows.\n", + progName ); + perror ( progName ); + showFileNames(); + cleanUpAndFail( 1 ); +} + + +/*---------------------------------------------*/ +static +void mySignalCatcher ( IntNative n ) +{ + fprintf ( stderr, + "\n%s: Control-C or similar caught, quitting.\n", + progName ); + cleanUpAndFail(1); +} + + +/*---------------------------------------------*/ +static +void mySIGSEGVorSIGBUScatcher ( IntNative n ) +{ + if (opMode == OM_Z) + fprintf ( + stderr, + "\n%s: Caught a SIGSEGV or SIGBUS whilst compressing.\n" + "\n" + " Possible causes are (most likely first):\n" + " (1) This computer has unreliable memory or cache hardware\n" + " (a surprisingly common problem; try a different machine.)\n" + " (2) A bug in the compiler used to create this executable\n" + " (unlikely, if you didn't compile bzip2 yourself.)\n" + " (3) A real bug in bzip2 -- I hope this should never be the case.\n" + " The user's manual, Section 4.3, has more info on (1) and (2).\n" + " \n" + " If you suspect this is a bug in bzip2, or are unsure about (1)\n" + " or (2), feel free to report it to me at: jseward@acm.org.\n" + " Section 4.3 of the user's manual describes the info a useful\n" + " bug report should have. If the manual is available on your\n" + " system, please try and read it before mailing me. If you don't\n" + " have the manual or can't be bothered to read it, mail me anyway.\n" + "\n", + progName ); + else + fprintf ( + stderr, + "\n%s: Caught a SIGSEGV or SIGBUS whilst decompressing.\n" + "\n" + " Possible causes are (most likely first):\n" + " (1) The compressed data is corrupted, and bzip2's usual checks\n" + " failed to detect this. Try bzip2 -tvv my_file.bz2.\n" + " (2) This computer has unreliable memory or cache hardware\n" + " (a surprisingly common problem; try a different machine.)\n" + " (3) A bug in the compiler used to create this executable\n" + " (unlikely, if you didn't compile bzip2 yourself.)\n" + " (4) A real bug in bzip2 -- I hope this should never be the case.\n" + " The user's manual, Section 4.3, has more info on (2) and (3).\n" + " \n" + " If you suspect this is a bug in bzip2, or are unsure about (2)\n" + " or (3), feel free to report it to me at: jseward@acm.org.\n" + " Section 4.3 of the user's manual describes the info a useful\n" + " bug report should have. If the manual is available on your\n" + " system, please try and read it before mailing me. If you don't\n" + " have the manual or can't be bothered to read it, mail me anyway.\n" + "\n", + progName ); + + showFileNames(); + if (opMode == OM_Z) + cleanUpAndFail( 3 ); else + { cadvise(); cleanUpAndFail( 2 ); } +} + + +/*---------------------------------------------*/ +static +void outOfMemory ( void ) +{ + fprintf ( stderr, + "\n%s: couldn't allocate enough memory\n", + progName ); + showFileNames(); + cleanUpAndFail(1); +} + + +/*---------------------------------------------*/ +static +void configError ( void ) +{ + fprintf ( stderr, + "bzip2: I'm not configured correctly for this platform!\n" + "\tI require Int32, Int16 and Char to have sizes\n" + "\tof 4, 2 and 1 bytes to run properly, and they don't.\n" + "\tProbably you can fix this by defining them correctly,\n" + "\tand recompiling. Bye!\n" ); + setExit(3); + exit(exitValue); +} + + +/*---------------------------------------------------*/ +/*--- The main driver machinery ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +static +void pad ( Char *s ) +{ + Int32 i; + if ( (Int32)strlen(s) >= longestFileName ) return; + for (i = 1; i <= longestFileName - (Int32)strlen(s); i++) + fprintf ( stderr, " " ); +} + + +/*---------------------------------------------*/ +static +void copyFileName ( Char* to, Char* from ) +{ + if ( strlen(from) > FILE_NAME_LEN-10 ) { + fprintf ( + stderr, + "bzip2: file name\n`%s'\n" + "is suspiciously (more than %d chars) long.\n" + "Try using a reasonable file name instead. Sorry! :-)\n", + from, FILE_NAME_LEN-10 + ); + setExit(1); + exit(exitValue); + } + + strncpy(to,from,FILE_NAME_LEN-10); + to[FILE_NAME_LEN-10]='\0'; +} + + +/*---------------------------------------------*/ +static +Bool fileExists ( Char* name ) +{ + FILE *tmp = fopen ( name, "rb" ); + Bool exists = (tmp != NULL); + if (tmp != NULL) fclose ( tmp ); + return exists; +} + + +/*---------------------------------------------*/ +/*-- + if in doubt, return True +--*/ +static +Bool notAStandardFile ( Char* name ) +{ + IntNative i; + struct MY_STAT statBuf; + + i = MY_LSTAT ( name, &statBuf ); + if (i != 0) return True; + if (MY_S_IFREG(statBuf.st_mode)) return False; + return True; +} + + +/*---------------------------------------------*/ +/*-- + rac 11/21/98 see if file has hard links to it +--*/ +static +Int32 countHardLinks ( Char* name ) +{ + IntNative i; + struct MY_STAT statBuf; + + i = MY_LSTAT ( name, &statBuf ); + if (i != 0) return 0; + return (statBuf.st_nlink - 1); +} + + +/*---------------------------------------------*/ +static +void copyDatePermissionsAndOwner ( Char *srcName, Char *dstName ) +{ +#if BZ_UNIX + IntNative retVal; + struct MY_STAT statBuf; + struct utimbuf uTimBuf; + + retVal = MY_LSTAT ( srcName, &statBuf ); + ERROR_IF_NOT_ZERO ( retVal ); + uTimBuf.actime = statBuf.st_atime; + uTimBuf.modtime = statBuf.st_mtime; + + retVal = chmod ( dstName, statBuf.st_mode ); + ERROR_IF_NOT_ZERO ( retVal ); + + retVal = utime ( dstName, &uTimBuf ); + ERROR_IF_NOT_ZERO ( retVal ); + + retVal = chown ( dstName, statBuf.st_uid, statBuf.st_gid ); + /* chown() will in many cases return with EPERM, which can + be safely ignored. + */ +#endif +} + + +/*---------------------------------------------*/ +static +void setInterimPermissions ( Char *dstName ) +{ +#if BZ_UNIX + IntNative retVal; + retVal = chmod ( dstName, S_IRUSR | S_IWUSR ); + ERROR_IF_NOT_ZERO ( retVal ); +#endif +} + + +/*---------------------------------------------*/ +static +Bool containsDubiousChars ( Char* name ) +{ + Bool cdc = False; + for (; *name != '\0'; name++) + if (*name == '?' || *name == '*') cdc = True; + return cdc; +} + + +/*---------------------------------------------*/ +#define BZ_N_SUFFIX_PAIRS 4 + +Char* zSuffix[BZ_N_SUFFIX_PAIRS] + = { ".bz2", ".bz", ".tbz2", ".tbz" }; +Char* unzSuffix[BZ_N_SUFFIX_PAIRS] + = { "", "", ".tar", ".tar" }; + +static +Bool hasSuffix ( Char* s, Char* suffix ) +{ + Int32 ns = strlen(s); + Int32 nx = strlen(suffix); + if (ns < nx) return False; + if (strcmp(s + ns - nx, suffix) == 0) return True; + return False; +} + +static +Bool mapSuffix ( Char* name, + Char* oldSuffix, Char* newSuffix ) +{ + if (!hasSuffix(name,oldSuffix)) return False; + name[strlen(name)-strlen(oldSuffix)] = 0; + strcat ( name, newSuffix ); + return True; +} + + +/*---------------------------------------------*/ +static +void compress ( Char *name ) +{ + FILE *inStr; + FILE *outStr; + Int32 n, i; + + deleteOutputOnInterrupt = False; + + if (name == NULL && srcMode != SM_I2O) + panic ( "compress: bad modes\n" ); + + switch (srcMode) { + case SM_I2O: + copyFileName ( inName, "(stdin)" ); + copyFileName ( outName, "(stdout)" ); + break; + case SM_F2F: + copyFileName ( inName, name ); + copyFileName ( outName, name ); + strcat ( outName, ".bz2" ); + break; + case SM_F2O: + copyFileName ( inName, name ); + copyFileName ( outName, "(stdout)" ); + break; + } + + if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) { + if (noisy) + fprintf ( stderr, "%s: There are no files matching `%s'.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode != SM_I2O && !fileExists ( inName ) ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + } + for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++) { + if (hasSuffix(inName, zSuffix[i])) { + if (noisy) + fprintf ( stderr, + "%s: Input file %s already has %s suffix.\n", + progName, inName, zSuffix[i] ); + setExit(1); + return; + } + } + if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) { + if (noisy) + fprintf ( stderr, "%s: Input file %s is not a normal file.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) { + fprintf ( stderr, "%s: Output file %s already exists.\n", + progName, outName ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && + (n=countHardLinks ( inName )) > 0) { + fprintf ( stderr, "%s: Input file %s has %d other link%s.\n", + progName, inName, n, n > 1 ? "s" : "" ); + setExit(1); + return; + } + + switch ( srcMode ) { + + case SM_I2O: + inStr = stdin; + outStr = stdout; + if ( isatty ( fileno ( stdout ) ) ) { + fprintf ( stderr, + "%s: I won't write compressed data to a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + setExit(1); + return; + }; + break; + + case SM_F2O: + inStr = fopen ( inName, "rb" ); + outStr = stdout; + if ( isatty ( fileno ( stdout ) ) ) { + fprintf ( stderr, + "%s: I won't write compressed data to a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + }; + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + }; + break; + + case SM_F2F: + inStr = fopen ( inName, "rb" ); + outStr = fopen ( outName, "wb" ); + if ( outStr == NULL) { + fprintf ( stderr, "%s: Can't create output file %s: %s.\n", + progName, outName, strerror(errno) ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + } + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + if ( outStr != NULL ) fclose ( outStr ); + setExit(1); + return; + }; + setInterimPermissions ( outName ); + break; + + default: + panic ( "compress: bad srcMode" ); + break; + } + + if (verbosity >= 1) { + fprintf ( stderr, " %s: ", inName ); + pad ( inName ); + fflush ( stderr ); + } + + /*--- Now the input and output handles are sane. Do the Biz. ---*/ + outputHandleJustInCase = outStr; + deleteOutputOnInterrupt = True; + compressStream ( inStr, outStr ); + outputHandleJustInCase = NULL; + + /*--- If there was an I/O error, we won't get here. ---*/ + if ( srcMode == SM_F2F ) { + copyDatePermissionsAndOwner ( inName, outName ); + deleteOutputOnInterrupt = False; + if ( !keepInputFiles ) { + IntNative retVal = remove ( inName ); + ERROR_IF_NOT_ZERO ( retVal ); + } + } + + deleteOutputOnInterrupt = False; +} + + +/*---------------------------------------------*/ +static +void uncompress ( Char *name ) +{ + FILE *inStr; + FILE *outStr; + Int32 n, i; + Bool magicNumberOK; + Bool cantGuess; + + deleteOutputOnInterrupt = False; + + if (name == NULL && srcMode != SM_I2O) + panic ( "uncompress: bad modes\n" ); + + cantGuess = False; + switch (srcMode) { + case SM_I2O: + copyFileName ( inName, "(stdin)" ); + copyFileName ( outName, "(stdout)" ); + break; + case SM_F2F: + copyFileName ( inName, name ); + copyFileName ( outName, name ); + for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++) + if (mapSuffix(outName,zSuffix[i],unzSuffix[i])) + goto zzz; + cantGuess = True; + strcat ( outName, ".out" ); + break; + case SM_F2O: + copyFileName ( inName, name ); + copyFileName ( outName, "(stdout)" ); + break; + } + + zzz: + if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) { + if (noisy) + fprintf ( stderr, "%s: There are no files matching `%s'.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode != SM_I2O && !fileExists ( inName ) ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) { + if (noisy) + fprintf ( stderr, "%s: Input file %s is not a normal file.\n", + progName, inName ); + setExit(1); + return; + } + if ( /* srcMode == SM_F2F implied && */ cantGuess ) { + if (noisy) + fprintf ( stderr, + "%s: Can't guess original name for %s -- using %s\n", + progName, inName, outName ); + /* just a warning, no return */ + } + if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) { + fprintf ( stderr, "%s: Output file %s already exists.\n", + progName, outName ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && + (n=countHardLinks ( inName ) ) > 0) { + fprintf ( stderr, "%s: Input file %s has %d other link%s.\n", + progName, inName, n, n > 1 ? "s" : "" ); + setExit(1); + return; + } + + switch ( srcMode ) { + + case SM_I2O: + inStr = stdin; + outStr = stdout; + if ( isatty ( fileno ( stdin ) ) ) { + fprintf ( stderr, + "%s: I won't read compressed data from a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + setExit(1); + return; + }; + break; + + case SM_F2O: + inStr = fopen ( inName, "rb" ); + outStr = stdout; + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s:%s.\n", + progName, inName, strerror(errno) ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + }; + break; + + case SM_F2F: + inStr = fopen ( inName, "rb" ); + outStr = fopen ( outName, "wb" ); + if ( outStr == NULL) { + fprintf ( stderr, "%s: Can't create output file %s: %s.\n", + progName, outName, strerror(errno) ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + } + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + if ( outStr != NULL ) fclose ( outStr ); + setExit(1); + return; + }; + setInterimPermissions ( outName ); + break; + + default: + panic ( "uncompress: bad srcMode" ); + break; + } + + if (verbosity >= 1) { + fprintf ( stderr, " %s: ", inName ); + pad ( inName ); + fflush ( stderr ); + } + + /*--- Now the input and output handles are sane. Do the Biz. ---*/ + outputHandleJustInCase = outStr; + deleteOutputOnInterrupt = True; + magicNumberOK = uncompressStream ( inStr, outStr ); + outputHandleJustInCase = NULL; + + /*--- If there was an I/O error, we won't get here. ---*/ + if ( magicNumberOK ) { + if ( srcMode == SM_F2F ) { + copyDatePermissionsAndOwner ( inName, outName ); + deleteOutputOnInterrupt = False; + if ( !keepInputFiles ) { + IntNative retVal = remove ( inName ); + ERROR_IF_NOT_ZERO ( retVal ); + } + } + } else { + unzFailsExist = True; + deleteOutputOnInterrupt = False; + if ( srcMode == SM_F2F ) { + IntNative retVal = remove ( outName ); + ERROR_IF_NOT_ZERO ( retVal ); + } + } + deleteOutputOnInterrupt = False; + + if ( magicNumberOK ) { + if (verbosity >= 1) + fprintf ( stderr, "done\n" ); + } else { + setExit(2); + if (verbosity >= 1) + fprintf ( stderr, "not a bzip2 file.\n" ); else + fprintf ( stderr, + "%s: %s is not a bzip2 file.\n", + progName, inName ); + } + +} + + +/*---------------------------------------------*/ +static +void testf ( Char *name ) +{ + FILE *inStr; + Bool allOK; + + deleteOutputOnInterrupt = False; + + if (name == NULL && srcMode != SM_I2O) + panic ( "testf: bad modes\n" ); + + copyFileName ( outName, "(none)" ); + switch (srcMode) { + case SM_I2O: copyFileName ( inName, "(stdin)" ); break; + case SM_F2F: copyFileName ( inName, name ); break; + case SM_F2O: copyFileName ( inName, name ); break; + } + + if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) { + if (noisy) + fprintf ( stderr, "%s: There are no files matching `%s'.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode != SM_I2O && !fileExists ( inName ) ) { + fprintf ( stderr, "%s: Can't open input %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + } + + switch ( srcMode ) { + + case SM_I2O: + if ( isatty ( fileno ( stdin ) ) ) { + fprintf ( stderr, + "%s: I won't read compressed data from a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + setExit(1); + return; + }; + inStr = stdin; + break; + + case SM_F2O: case SM_F2F: + inStr = fopen ( inName, "rb" ); + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s:%s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + }; + break; + + default: + panic ( "testf: bad srcMode" ); + break; + } + + if (verbosity >= 1) { + fprintf ( stderr, " %s: ", inName ); + pad ( inName ); + fflush ( stderr ); + } + + /*--- Now the input handle is sane. Do the Biz. ---*/ + allOK = testStream ( inStr ); + + if (allOK && verbosity >= 1) fprintf ( stderr, "ok\n" ); + if (!allOK) testFailsExist = True; +} + + +/*---------------------------------------------*/ +static +void license ( void ) +{ + fprintf ( stderr, + + "bzip2, a block-sorting file compressor. " + "Version %s.\n" + " \n" + " Copyright (C) 1996-2000 by Julian Seward.\n" + " \n" + " This program is free software; you can redistribute it and/or modify\n" + " it under the terms set out in the LICENSE file, which is included\n" + " in the bzip2-1.0 source distribution.\n" + " \n" + " This program is distributed in the hope that it will be useful,\n" + " but WITHOUT ANY WARRANTY; without even the implied warranty of\n" + " MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n" + " LICENSE file for more details.\n" + " \n", + BZ2_bzlibVersion() + ); +} + + +/*---------------------------------------------*/ +static +void usage ( Char *fullProgName ) +{ + fprintf ( + stderr, + "bzip2, a block-sorting file compressor. " + "Version %s.\n" + "\n usage: %s [flags and input files in any order]\n" + "\n" + " -h --help print this message\n" + " -d --decompress force decompression\n" + " -z --compress force compression\n" + " -k --keep keep (don't delete) input files\n" + " -f --force overwrite existing output files\n" + " -t --test test compressed file integrity\n" + " -c --stdout output to standard out\n" + " -q --quiet suppress noncritical error messages\n" + " -v --verbose be verbose (a 2nd -v gives more)\n" + " -L --license display software version & license\n" + " -V --version display software version & license\n" + " -s --small use less memory (at most 2500k)\n" + " -1 .. -9 set block size to 100k .. 900k\n" + "\n" + " If invoked as `bzip2', default action is to compress.\n" + " as `bunzip2', default action is to decompress.\n" + " as `bzcat', default action is to decompress to stdout.\n" + "\n" + " If no file names are given, bzip2 compresses or decompresses\n" + " from standard input to standard output. You can combine\n" + " short flags, so `-v -4' means the same as -v4 or -4v, &c.\n" +#if BZ_UNIX + "\n" +#endif + , + + BZ2_bzlibVersion(), + fullProgName + ); +} + + +/*---------------------------------------------*/ +static +void redundant ( Char* flag ) +{ + fprintf ( + stderr, + "%s: %s is redundant in versions 0.9.5 and above\n", + progName, flag ); +} + + +/*---------------------------------------------*/ +/*-- + All the garbage from here to main() is purely to + implement a linked list of command-line arguments, + into which main() copies argv[1 .. argc-1]. + + The purpose of this exercise is to facilitate + the expansion of wildcard characters * and ? in + filenames for OSs which don't know how to do it + themselves, like MSDOS, Windows 95 and NT. + + The actual Dirty Work is done by the platform- + specific macro APPEND_FILESPEC. +--*/ + +typedef + struct zzzz { + Char *name; + struct zzzz *link; + } + Cell; + + +/*---------------------------------------------*/ +static +void *myMalloc ( Int32 n ) +{ + void* p; + + p = malloc ( (size_t)n ); + if (p == NULL) outOfMemory (); + return p; +} + + +/*---------------------------------------------*/ +static +Cell *mkCell ( void ) +{ + Cell *c; + + c = (Cell*) myMalloc ( sizeof ( Cell ) ); + c->name = NULL; + c->link = NULL; + return c; +} + + +/*---------------------------------------------*/ +static +Cell *snocString ( Cell *root, Char *name ) +{ + if (root == NULL) { + Cell *tmp = mkCell(); + tmp->name = (Char*) myMalloc ( 5 + strlen(name) ); + strcpy ( tmp->name, name ); + return tmp; + } else { + Cell *tmp = root; + while (tmp->link != NULL) tmp = tmp->link; + tmp->link = snocString ( tmp->link, name ); + return root; + } +} + + +/*---------------------------------------------*/ +static +void addFlagsFromEnvVar ( Cell** argList, Char* varName ) +{ + Int32 i, j, k; + Char *envbase, *p; + + envbase = getenv(varName); + if (envbase != NULL) { + p = envbase; + i = 0; + while (True) { + if (p[i] == 0) break; + p += i; + i = 0; + while (isspace((Int32)(p[0]))) p++; + while (p[i] != 0 && !isspace((Int32)(p[i]))) i++; + if (i > 0) { + k = i; if (k > FILE_NAME_LEN-10) k = FILE_NAME_LEN-10; + for (j = 0; j < k; j++) tmpName[j] = p[j]; + tmpName[k] = 0; + APPEND_FLAG(*argList, tmpName); + } + } + } +} + + +/*---------------------------------------------*/ +#define ISFLAG(s) (strcmp(aa->name, (s))==0) + +IntNative main ( IntNative argc, Char *argv[] ) +{ + Int32 i, j; + Char *tmp; + Cell *argList; + Cell *aa; + Bool decode; + + /*-- Be really really really paranoid :-) --*/ + if (sizeof(Int32) != 4 || sizeof(UInt32) != 4 || + sizeof(Int16) != 2 || sizeof(UInt16) != 2 || + sizeof(Char) != 1 || sizeof(UChar) != 1) + configError(); + + /*-- Initialise --*/ + outputHandleJustInCase = NULL; + smallMode = False; + keepInputFiles = False; + forceOverwrite = False; + noisy = True; + verbosity = 0; + blockSize100k = 9; + testFailsExist = False; + unzFailsExist = False; + numFileNames = 0; + numFilesProcessed = 0; + workFactor = 30; + deleteOutputOnInterrupt = False; + exitValue = 0; + i = j = 0; /* avoid bogus warning from egcs-1.1.X */ + + /*-- Set up signal handlers for mem access errors --*/ + signal (SIGSEGV, mySIGSEGVorSIGBUScatcher); +#if BZ_UNIX +#ifndef __DJGPP__ + signal (SIGBUS, mySIGSEGVorSIGBUScatcher); +#endif +#endif + + copyFileName ( inName, "(none)" ); + copyFileName ( outName, "(none)" ); + + copyFileName ( progNameReally, argv[0] ); + progName = &progNameReally[0]; + for (tmp = &progNameReally[0]; *tmp != '\0'; tmp++) + if (*tmp == PATH_SEP) progName = tmp + 1; + + + /*-- Copy flags from env var BZIP2, and + expand filename wildcards in arg list. + --*/ + argList = NULL; + addFlagsFromEnvVar ( &argList, "BZIP2" ); + addFlagsFromEnvVar ( &argList, "BZIP" ); + for (i = 1; i <= argc-1; i++) + APPEND_FILESPEC(argList, argv[i]); + + + /*-- Find the length of the longest filename --*/ + longestFileName = 7; + numFileNames = 0; + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFileNames++; + if (longestFileName < (Int32)strlen(aa->name) ) + longestFileName = (Int32)strlen(aa->name); + } + + + /*-- Determine source modes; flag handling may change this too. --*/ + if (numFileNames == 0) + srcMode = SM_I2O; else srcMode = SM_F2F; + + + /*-- Determine what to do (compress/uncompress/test/cat). --*/ + /*-- Note that subsequent flag handling may change this. --*/ + opMode = OM_Z; + + if ( (strstr ( progName, "unzip" ) != 0) || + (strstr ( progName, "UNZIP" ) != 0) ) + opMode = OM_UNZ; + + if ( (strstr ( progName, "z2cat" ) != 0) || + (strstr ( progName, "Z2CAT" ) != 0) || + (strstr ( progName, "zcat" ) != 0) || + (strstr ( progName, "ZCAT" ) != 0) ) { + opMode = OM_UNZ; + srcMode = (numFileNames == 0) ? SM_I2O : SM_F2O; + } + + + /*-- Look at the flags. --*/ + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) break; + if (aa->name[0] == '-' && aa->name[1] != '-') { + for (j = 1; aa->name[j] != '\0'; j++) { + switch (aa->name[j]) { + case 'c': srcMode = SM_F2O; break; + case 'd': opMode = OM_UNZ; break; + case 'z': opMode = OM_Z; break; + case 'f': forceOverwrite = True; break; + case 't': opMode = OM_TEST; break; + case 'k': keepInputFiles = True; break; + case 's': smallMode = True; break; + case 'q': noisy = False; break; + case '1': blockSize100k = 1; break; + case '2': blockSize100k = 2; break; + case '3': blockSize100k = 3; break; + case '4': blockSize100k = 4; break; + case '5': blockSize100k = 5; break; + case '6': blockSize100k = 6; break; + case '7': blockSize100k = 7; break; + case '8': blockSize100k = 8; break; + case '9': blockSize100k = 9; break; + case 'V': + case 'L': license(); break; + case 'v': verbosity++; break; + case 'h': usage ( progName ); + exit ( 0 ); + break; + default: fprintf ( stderr, "%s: Bad flag `%s'\n", + progName, aa->name ); + usage ( progName ); + exit ( 1 ); + break; + } + } + } + } + + /*-- And again ... --*/ + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) break; + if (ISFLAG("--stdout")) srcMode = SM_F2O; else + if (ISFLAG("--decompress")) opMode = OM_UNZ; else + if (ISFLAG("--compress")) opMode = OM_Z; else + if (ISFLAG("--force")) forceOverwrite = True; else + if (ISFLAG("--test")) opMode = OM_TEST; else + if (ISFLAG("--keep")) keepInputFiles = True; else + if (ISFLAG("--small")) smallMode = True; else + if (ISFLAG("--quiet")) noisy = False; else + if (ISFLAG("--version")) license(); else + if (ISFLAG("--license")) license(); else + if (ISFLAG("--exponential")) workFactor = 1; else + if (ISFLAG("--repetitive-best")) redundant(aa->name); else + if (ISFLAG("--repetitive-fast")) redundant(aa->name); else + if (ISFLAG("--verbose")) verbosity++; else + if (ISFLAG("--help")) { usage ( progName ); exit ( 0 ); } + else + if (strncmp ( aa->name, "--", 2) == 0) { + fprintf ( stderr, "%s: Bad flag `%s'\n", progName, aa->name ); + usage ( progName ); + exit ( 1 ); + } + } + + if (verbosity > 4) verbosity = 4; + if (opMode == OM_Z && smallMode && blockSize100k > 2) + blockSize100k = 2; + + if (opMode == OM_TEST && srcMode == SM_F2O) { + fprintf ( stderr, "%s: -c and -t cannot be used together.\n", + progName ); + exit ( 1 ); + } + + if (srcMode == SM_F2O && numFileNames == 0) + srcMode = SM_I2O; + + if (opMode != OM_Z) blockSize100k = 0; + + if (srcMode == SM_F2F) { + signal (SIGINT, mySignalCatcher); + signal (SIGTERM, mySignalCatcher); +# if BZ_UNIX + signal (SIGHUP, mySignalCatcher); +# endif + } + + if (opMode == OM_Z) { + if (srcMode == SM_I2O) { + compress ( NULL ); + } else { + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFilesProcessed++; + compress ( aa->name ); + } + } + } + else + + if (opMode == OM_UNZ) { + unzFailsExist = False; + if (srcMode == SM_I2O) { + uncompress ( NULL ); + } else { + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFilesProcessed++; + uncompress ( aa->name ); + } + } + if (unzFailsExist) { + setExit(2); + exit(exitValue); + } + } + + else { + testFailsExist = False; + if (srcMode == SM_I2O) { + testf ( NULL ); + } else { + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFilesProcessed++; + testf ( aa->name ); + } + } + if (testFailsExist && noisy) { + fprintf ( stderr, + "\n" + "You can use the `bzip2recover' program to attempt to recover\n" + "data from undamaged sections of corrupted files.\n\n" + ); + setExit(2); + exit(exitValue); + } + } + + /* Free the argument list memory to mollify leak detectors + (eg) Purify, Checker. Serves no other useful purpose. + */ + aa = argList; + while (aa != NULL) { + Cell* aa2 = aa->link; + if (aa->name != NULL) free(aa->name); + free(aa); + aa = aa2; + } + + return exitValue; +} + + +/*-----------------------------------------------------------*/ +/*--- end bzip2.c ---*/ +/*-----------------------------------------------------------*/ diff --git a/bzip2/bzip2.txt b/bzip2/bzip2.txt new file mode 100644 index 0000000..4f1ae86 --- /dev/null +++ b/bzip2/bzip2.txt @@ -0,0 +1,376 @@ + + +NAME + bzip2, bunzip2 - a block-sorting file compressor, v1.0 + bzcat - decompresses files to stdout + bzip2recover - recovers data from damaged bzip2 files + + +SYNOPSIS + bzip2 [ -cdfkqstvzVL123456789 ] [ filenames ... ] + bunzip2 [ -fkvsVL ] [ filenames ... ] + bzcat [ -s ] [ filenames ... ] + bzip2recover filename + + +DESCRIPTION + bzip2 compresses files using the Burrows-Wheeler block + sorting text compression algorithm, and Huffman coding. + Compression is generally considerably better than that + achieved by more conventional LZ77/LZ78-based compressors, + and approaches the performance of the PPM family of sta- + tistical compressors. + + The command-line options are deliberately very similar to + those of GNU gzip, but they are not identical. + + bzip2 expects a list of file names to accompany the com- + mand-line flags. Each file is replaced by a compressed + version of itself, with the name "original_name.bz2". + Each compressed file has the same modification date, per- + missions, and, when possible, ownership as the correspond- + ing original, so that these properties can be correctly + restored at decompression time. File name handling is + naive in the sense that there is no mechanism for preserv- + ing original file names, permissions, ownerships or dates + in filesystems which lack these concepts, or have serious + file name length restrictions, such as MS-DOS. + + bzip2 and bunzip2 will by default not overwrite existing + files. If you want this to happen, specify the -f flag. + + If no file names are specified, bzip2 compresses from + standard input to standard output. In this case, bzip2 + will decline to write compressed output to a terminal, as + this would be entirely incomprehensible and therefore + pointless. + + bunzip2 (or bzip2 -d) decompresses all specified files. + Files which were not created by bzip2 will be detected and + ignored, and a warning issued. bzip2 attempts to guess + the filename for the decompressed file from that of the + compressed file as follows: + + filename.bz2 becomes filename + filename.bz becomes filename + filename.tbz2 becomes filename.tar + filename.tbz becomes filename.tar + anyothername becomes anyothername.out + + If the file does not end in one of the recognised endings, + .bz2, .bz, .tbz2 or .tbz, bzip2 complains that it cannot + guess the name of the original file, and uses the original + name with .out appended. + + As with compression, supplying no filenames causes decom- + pression from standard input to standard output. + + bunzip2 will correctly decompress a file which is the con- + catenation of two or more compressed files. The result is + the concatenation of the corresponding uncompressed files. + Integrity testing (-t) of concatenated compressed files is + also supported. + + You can also compress or decompress files to the standard + output by giving the -c flag. Multiple files may be com- + pressed and decompressed like this. The resulting outputs + are fed sequentially to stdout. Compression of multiple + files in this manner generates a stream containing multi- + ple compressed file representations. Such a stream can be + decompressed correctly only by bzip2 version 0.9.0 or + later. Earlier versions of bzip2 will stop after decom- + pressing the first file in the stream. + + bzcat (or bzip2 -dc) decompresses all specified files to + the standard output. + + bzip2 will read arguments from the environment variables + BZIP2 and BZIP, in that order, and will process them + before any arguments read from the command line. This + gives a convenient way to supply default arguments. + + Compression is always performed, even if the compressed + file is slightly larger than the original. Files of less + than about one hundred bytes tend to get larger, since the + compression mechanism has a constant overhead in the + region of 50 bytes. Random data (including the output of + most file compressors) is coded at about 8.05 bits per + byte, giving an expansion of around 0.5%. + + As a self-check for your protection, bzip2 uses 32-bit + CRCs to make sure that the decompressed version of a file + is identical to the original. This guards against corrup- + tion of the compressed data, and against undetected bugs + in bzip2 (hopefully very unlikely). The chances of data + corruption going undetected is microscopic, about one + chance in four billion for each file processed. Be aware, + though, that the check occurs upon decompression, so it + can only tell you that something is wrong. It can't help + you recover the original uncompressed data. You can use + bzip2recover to try to recover data from damaged files. + + Return values: 0 for a normal exit, 1 for environmental + problems (file not found, invalid flags, I/O errors, &c), + 2 to indicate a corrupt compressed file, 3 for an internal + consistency error (eg, bug) which caused bzip2 to panic. + + +OPTIONS + -c --stdout + Compress or decompress to standard output. + + -d --decompress + Force decompression. bzip2, bunzip2 and bzcat are + really the same program, and the decision about + what actions to take is done on the basis of which + name is used. This flag overrides that mechanism, + and forces bzip2 to decompress. + + -z --compress + The complement to -d: forces compression, regard- + less of the invokation name. + + -t --test + Check integrity of the specified file(s), but don't + decompress them. This really performs a trial + decompression and throws away the result. + + -f --force + Force overwrite of output files. Normally, bzip2 + will not overwrite existing output files. Also + forces bzip2 to break hard links to files, which it + otherwise wouldn't do. + + -k --keep + Keep (don't delete) input files during compression + or decompression. + + -s --small + Reduce memory usage, for compression, decompression + and testing. Files are decompressed and tested + using a modified algorithm which only requires 2.5 + bytes per block byte. This means any file can be + decompressed in 2300k of memory, albeit at about + half the normal speed. + + During compression, -s selects a block size of + 200k, which limits memory use to around the same + figure, at the expense of your compression ratio. + In short, if your machine is low on memory (8 + megabytes or less), use -s for everything. See + MEMORY MANAGEMENT below. + + -q --quiet + Suppress non-essential warning messages. Messages + pertaining to I/O errors and other critical events + will not be suppressed. + + -v --verbose + Verbose mode -- show the compression ratio for each + file processed. Further -v's increase the ver- + bosity level, spewing out lots of information which + is primarily of interest for diagnostic purposes. + + -L --license -V --version + Display the software version, license terms and + conditions. + + -1 to -9 + Set the block size to 100 k, 200 k .. 900 k when + compressing. Has no effect when decompressing. + See MEMORY MANAGEMENT below. + + -- Treats all subsequent arguments as file names, even + if they start with a dash. This is so you can han- + dle files with names beginning with a dash, for + example: bzip2 -- -myfilename. + + --repetitive-fast --repetitive-best + These flags are redundant in versions 0.9.5 and + above. They provided some coarse control over the + behaviour of the sorting algorithm in earlier ver- + sions, which was sometimes useful. 0.9.5 and above + have an improved algorithm which renders these + flags irrelevant. + + +MEMORY MANAGEMENT + bzip2 compresses large files in blocks. The block size + affects both the compression ratio achieved, and the + amount of memory needed for compression and decompression. + The flags -1 through -9 specify the block size to be + 100,000 bytes through 900,000 bytes (the default) respec- + tively. At decompression time, the block size used for + compression is read from the header of the compressed + file, and bunzip2 then allocates itself just enough memory + to decompress the file. Since block sizes are stored in + compressed files, it follows that the flags -1 to -9 are + irrelevant to and so ignored during decompression. + + Compression and decompression requirements, in bytes, can + be estimated as: + + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) + + Larger block sizes give rapidly diminishing marginal + returns. Most of the compression comes from the first two + or three hundred k of block size, a fact worth bearing in + mind when using bzip2 on small machines. It is also + important to appreciate that the decompression memory + requirement is set at compression time by the choice of + block size. + + For files compressed with the default 900k block size, + bunzip2 will require about 3700 kbytes to decompress. To + support decompression of any file on a 4 megabyte machine, + bunzip2 has an option to decompress using approximately + half this amount of memory, about 2300 kbytes. Decompres- + sion speed is also halved, so you should use this option + only where necessary. The relevant flag is -s. + + In general, try and use the largest block size memory con- + straints allow, since that maximises the compression + achieved. Compression and decompression speed are virtu- + ally unaffected by block size. + + Another significant point applies to files which fit in a + single block -- that means most files you'd encounter + using a large block size. The amount of real memory + touched is proportional to the size of the file, since the + file is smaller than a block. For example, compressing a + file 20,000 bytes long with the flag -9 will cause the + compressor to allocate around 7600k of memory, but only + touch 400k + 20000 * 8 = 560 kbytes of it. Similarly, the + decompressor will allocate 3700k but only touch 100k + + 20000 * 4 = 180 kbytes. + + Here is a table which summarises the maximum memory usage + for different block sizes. Also recorded is the total + compressed size for 14 files of the Calgary Text Compres- + sion Corpus totalling 3,141,622 bytes. This column gives + some feel for how compression varies with block size. + These figures tend to understate the advantage of larger + block sizes for larger files, since the Corpus is domi- + nated by smaller files. + + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 + + +RECOVERING DATA FROM DAMAGED FILES + bzip2 compresses files in blocks, usually 900kbytes long. + Each block is handled independently. If a media or trans- + mission error causes a multi-block .bz2 file to become + damaged, it may be possible to recover data from the + undamaged blocks in the file. + + The compressed representation of each block is delimited + by a 48-bit pattern, which makes it possible to find the + block boundaries with reasonable certainty. Each block + also carries its own 32-bit CRC, so damaged blocks can be + distinguished from undamaged ones. + + bzip2recover is a simple program whose purpose is to + search for blocks in .bz2 files, and write each block out + into its own .bz2 file. You can then use bzip2 -t to test + the integrity of the resulting files, and decompress those + which are undamaged. + + bzip2recover takes a single argument, the name of the dam- + aged file, and writes a number of files "rec0001file.bz2", + "rec0002file.bz2", etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, "bzip2 + -dc rec*file.bz2 > recovered_data" -- lists the files in + the correct order. + + bzip2recover should be of most use dealing with large .bz2 + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to min- + imise any potential data loss through media or transmis- + sion errors, you might consider compressing with a smaller + block size. + + +PERFORMANCE NOTES + The sorting phase of compression gathers together similar + strings in the file. Because of this, files containing + very long runs of repeated symbols, like "aabaabaabaab + ..." (repeated several hundred times) may compress more + slowly than normal. Versions 0.9.5 and above fare much + better than previous versions in this respect. The ratio + between worst-case and average-case compression time is in + the region of 10:1. For previous versions, this figure + was more like 100:1. You can use the -vvvv option to mon- + itor progress in great detail, if you want. + + Decompression speed is unaffected by these phenomena. + + bzip2 usually allocates several megabytes of memory to + operate in, and then charges all over it in a fairly ran- + dom fashion. This means that performance, both for com- + pressing and decompressing, is largely determined by the + speed at which your machine can service cache misses. + Because of this, small changes to the code to reduce the + miss rate have been observed to give disproportionately + large performance improvements. I imagine bzip2 will per- + form best on machines with very large caches. + + +CAVEATS + I/O error messages are not as helpful as they could be. + bzip2 tries hard to detect I/O errors and exit cleanly, + but the details of what the problem is sometimes seem + rather misleading. + + This manual page pertains to version 1.0 of bzip2. Com- + pressed data created by this version is entirely forwards + and backwards compatible with the previous public + releases, versions 0.1pl2, 0.9.0 and 0.9.5, but with the + following exception: 0.9.0 and above can correctly decom- + press multiple concatenated compressed files. 0.1pl2 can- + not do this; it will stop after decompressing just the + first file in the stream. + + bzip2recover uses 32-bit integers to represent bit posi- + tions in compressed files, so it cannot handle compressed + files more than 512 megabytes long. This could easily be + fixed. + + +AUTHOR + Julian Seward, jseward@acm.org. + + http://sourceware.cygnus.com/bzip2 + http://www.muraroa.demon.co.uk + + The ideas embodied in bzip2 are due to (at least) the fol- + lowing people: Michael Burrows and David Wheeler (for the + block sorting transformation), David Wheeler (again, for + the Huffman coder), Peter Fenwick (for the structured cod- + ing model in the original bzip, and many refinements), and + Alistair Moffat, Radford Neal and Ian Witten (for the + arithmetic coder in the original bzip). I am much + indebted for their help, support and advice. See the man- + ual in the source distribution for pointers to sources of + documentation. Christian von Roques encouraged me to look + for faster sorting algorithms, so as to speed up compres- + sion. Bela Lubkin encouraged me to improve the worst-case + compression performance. Many people sent patches, helped + with portability problems, lent machines, gave advice and + were generally helpful. + diff --git a/bzip2/bzip2recover.c b/bzip2/bzip2recover.c new file mode 100644 index 0000000..ba3d175 --- /dev/null +++ b/bzip2/bzip2recover.c @@ -0,0 +1,435 @@ + +/*-----------------------------------------------------------*/ +/*--- Block recoverer program for bzip2 ---*/ +/*--- bzip2recover.c ---*/ +/*-----------------------------------------------------------*/ + +/*-- + This program is bzip2recover, a program to attempt data + salvage from damaged files created by the accompanying + bzip2-1.0 program. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 +--*/ + +/*-- + This program is a complete hack and should be rewritten + properly. It isn't very complicated. +--*/ + +#include +#include +#include +#include + +typedef unsigned int UInt32; +typedef int Int32; +typedef unsigned char UChar; +typedef char Char; +typedef unsigned char Bool; +#define True ((Bool)1) +#define False ((Bool)0) + + +Char inFileName[2000]; +Char outFileName[2000]; +Char progName[2000]; + +UInt32 bytesOut = 0; +UInt32 bytesIn = 0; + + +/*---------------------------------------------------*/ +/*--- I/O errors ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +void readError ( void ) +{ + fprintf ( stderr, + "%s: I/O error reading `%s', possible reason follows.\n", + progName, inFileName ); + perror ( progName ); + fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n", + progName ); + exit ( 1 ); +} + + +/*---------------------------------------------*/ +void writeError ( void ) +{ + fprintf ( stderr, + "%s: I/O error reading `%s', possible reason follows.\n", + progName, inFileName ); + perror ( progName ); + fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n", + progName ); + exit ( 1 ); +} + + +/*---------------------------------------------*/ +void mallocFail ( Int32 n ) +{ + fprintf ( stderr, + "%s: malloc failed on request for %d bytes.\n", + progName, n ); + fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n", + progName ); + exit ( 1 ); +} + + +/*---------------------------------------------------*/ +/*--- Bit stream I/O ---*/ +/*---------------------------------------------------*/ + +typedef + struct { + FILE* handle; + Int32 buffer; + Int32 buffLive; + Char mode; + } + BitStream; + + +/*---------------------------------------------*/ +BitStream* bsOpenReadStream ( FILE* stream ) +{ + BitStream *bs = malloc ( sizeof(BitStream) ); + if (bs == NULL) mallocFail ( sizeof(BitStream) ); + bs->handle = stream; + bs->buffer = 0; + bs->buffLive = 0; + bs->mode = 'r'; + return bs; +} + + +/*---------------------------------------------*/ +BitStream* bsOpenWriteStream ( FILE* stream ) +{ + BitStream *bs = malloc ( sizeof(BitStream) ); + if (bs == NULL) mallocFail ( sizeof(BitStream) ); + bs->handle = stream; + bs->buffer = 0; + bs->buffLive = 0; + bs->mode = 'w'; + return bs; +} + + +/*---------------------------------------------*/ +void bsPutBit ( BitStream* bs, Int32 bit ) +{ + if (bs->buffLive == 8) { + Int32 retVal = putc ( (UChar) bs->buffer, bs->handle ); + if (retVal == EOF) writeError(); + bytesOut++; + bs->buffLive = 1; + bs->buffer = bit & 0x1; + } else { + bs->buffer = ( (bs->buffer << 1) | (bit & 0x1) ); + bs->buffLive++; + }; +} + + +/*---------------------------------------------*/ +/*-- + Returns 0 or 1, or 2 to indicate EOF. +--*/ +Int32 bsGetBit ( BitStream* bs ) +{ + if (bs->buffLive > 0) { + bs->buffLive --; + return ( ((bs->buffer) >> (bs->buffLive)) & 0x1 ); + } else { + Int32 retVal = getc ( bs->handle ); + if ( retVal == EOF ) { + if (errno != 0) readError(); + return 2; + } + bs->buffLive = 7; + bs->buffer = retVal; + return ( ((bs->buffer) >> 7) & 0x1 ); + } +} + + +/*---------------------------------------------*/ +void bsClose ( BitStream* bs ) +{ + Int32 retVal; + + if ( bs->mode == 'w' ) { + while ( bs->buffLive < 8 ) { + bs->buffLive++; + bs->buffer <<= 1; + }; + retVal = putc ( (UChar) (bs->buffer), bs->handle ); + if (retVal == EOF) writeError(); + bytesOut++; + retVal = fflush ( bs->handle ); + if (retVal == EOF) writeError(); + } + retVal = fclose ( bs->handle ); + if (retVal == EOF) { + if (bs->mode == 'w') writeError(); else readError(); + } + free ( bs ); +} + + +/*---------------------------------------------*/ +void bsPutUChar ( BitStream* bs, UChar c ) +{ + Int32 i; + for (i = 7; i >= 0; i--) + bsPutBit ( bs, (((UInt32) c) >> i) & 0x1 ); +} + + +/*---------------------------------------------*/ +void bsPutUInt32 ( BitStream* bs, UInt32 c ) +{ + Int32 i; + + for (i = 31; i >= 0; i--) + bsPutBit ( bs, (c >> i) & 0x1 ); +} + + +/*---------------------------------------------*/ +Bool endsInBz2 ( Char* name ) +{ + Int32 n = strlen ( name ); + if (n <= 4) return False; + return + (name[n-4] == '.' && + name[n-3] == 'b' && + name[n-2] == 'z' && + name[n-1] == '2'); +} + + +/*---------------------------------------------------*/ +/*--- ---*/ +/*---------------------------------------------------*/ + +#define BLOCK_HEADER_HI 0x00003141UL +#define BLOCK_HEADER_LO 0x59265359UL + +#define BLOCK_ENDMARK_HI 0x00001772UL +#define BLOCK_ENDMARK_LO 0x45385090UL + + +UInt32 bStart[20000]; +UInt32 bEnd[20000]; +UInt32 rbStart[20000]; +UInt32 rbEnd[20000]; + +Int32 main ( Int32 argc, Char** argv ) +{ + FILE* inFile; + FILE* outFile; + BitStream* bsIn, *bsWr; + Int32 currBlock, b, wrBlock; + UInt32 bitsRead; + Int32 rbCtr; + + + UInt32 buffHi, buffLo, blockCRC; + Char* p; + + strcpy ( progName, argv[0] ); + inFileName[0] = outFileName[0] = 0; + + fprintf ( stderr, "bzip2recover 1.0: extracts blocks from damaged .bz2 files.\n" ); + + if (argc != 2) { + fprintf ( stderr, "%s: usage is `%s damaged_file_name'.\n", + progName, progName ); + exit(1); + } + + strcpy ( inFileName, argv[1] ); + + inFile = fopen ( inFileName, "rb" ); + if (inFile == NULL) { + fprintf ( stderr, "%s: can't read `%s'\n", progName, inFileName ); + exit(1); + } + + bsIn = bsOpenReadStream ( inFile ); + fprintf ( stderr, "%s: searching for block boundaries ...\n", progName ); + + bitsRead = 0; + buffHi = buffLo = 0; + currBlock = 0; + bStart[currBlock] = 0; + + rbCtr = 0; + + while (True) { + b = bsGetBit ( bsIn ); + bitsRead++; + if (b == 2) { + if (bitsRead >= bStart[currBlock] && + (bitsRead - bStart[currBlock]) >= 40) { + bEnd[currBlock] = bitsRead-1; + if (currBlock > 0) + fprintf ( stderr, " block %d runs from %d to %d (incomplete)\n", + currBlock, bStart[currBlock], bEnd[currBlock] ); + } else + currBlock--; + break; + } + buffHi = (buffHi << 1) | (buffLo >> 31); + buffLo = (buffLo << 1) | (b & 1); + if ( ( (buffHi & 0x0000ffff) == BLOCK_HEADER_HI + && buffLo == BLOCK_HEADER_LO) + || + ( (buffHi & 0x0000ffff) == BLOCK_ENDMARK_HI + && buffLo == BLOCK_ENDMARK_LO) + ) { + if (bitsRead > 49) + bEnd[currBlock] = bitsRead-49; else + bEnd[currBlock] = 0; + if (currBlock > 0 && + (bEnd[currBlock] - bStart[currBlock]) >= 130) { + fprintf ( stderr, " block %d runs from %d to %d\n", + rbCtr+1, bStart[currBlock], bEnd[currBlock] ); + rbStart[rbCtr] = bStart[currBlock]; + rbEnd[rbCtr] = bEnd[currBlock]; + rbCtr++; + } + currBlock++; + + bStart[currBlock] = bitsRead; + } + } + + bsClose ( bsIn ); + + /*-- identified blocks run from 1 to rbCtr inclusive. --*/ + + if (rbCtr < 1) { + fprintf ( stderr, + "%s: sorry, I couldn't find any block boundaries.\n", + progName ); + exit(1); + }; + + fprintf ( stderr, "%s: splitting into blocks\n", progName ); + + inFile = fopen ( inFileName, "rb" ); + if (inFile == NULL) { + fprintf ( stderr, "%s: can't open `%s'\n", progName, inFileName ); + exit(1); + } + bsIn = bsOpenReadStream ( inFile ); + + /*-- placate gcc's dataflow analyser --*/ + blockCRC = 0; bsWr = 0; + + bitsRead = 0; + outFile = NULL; + wrBlock = 0; + while (True) { + b = bsGetBit(bsIn); + if (b == 2) break; + buffHi = (buffHi << 1) | (buffLo >> 31); + buffLo = (buffLo << 1) | (b & 1); + if (bitsRead == 47+rbStart[wrBlock]) + blockCRC = (buffHi << 16) | (buffLo >> 16); + + if (outFile != NULL && bitsRead >= rbStart[wrBlock] + && bitsRead <= rbEnd[wrBlock]) { + bsPutBit ( bsWr, b ); + } + + bitsRead++; + + if (bitsRead == rbEnd[wrBlock]+1) { + if (outFile != NULL) { + bsPutUChar ( bsWr, 0x17 ); bsPutUChar ( bsWr, 0x72 ); + bsPutUChar ( bsWr, 0x45 ); bsPutUChar ( bsWr, 0x38 ); + bsPutUChar ( bsWr, 0x50 ); bsPutUChar ( bsWr, 0x90 ); + bsPutUInt32 ( bsWr, blockCRC ); + bsClose ( bsWr ); + } + if (wrBlock >= rbCtr) break; + wrBlock++; + } else + if (bitsRead == rbStart[wrBlock]) { + outFileName[0] = 0; + sprintf ( outFileName, "rec%4d", wrBlock+1 ); + for (p = outFileName; *p != 0; p++) if (*p == ' ') *p = '0'; + strcat ( outFileName, inFileName ); + if ( !endsInBz2(outFileName)) strcat ( outFileName, ".bz2" ); + + fprintf ( stderr, " writing block %d to `%s' ...\n", + wrBlock+1, outFileName ); + + outFile = fopen ( outFileName, "wb" ); + if (outFile == NULL) { + fprintf ( stderr, "%s: can't write `%s'\n", + progName, outFileName ); + exit(1); + } + bsWr = bsOpenWriteStream ( outFile ); + bsPutUChar ( bsWr, 'B' ); bsPutUChar ( bsWr, 'Z' ); + bsPutUChar ( bsWr, 'h' ); bsPutUChar ( bsWr, '9' ); + bsPutUChar ( bsWr, 0x31 ); bsPutUChar ( bsWr, 0x41 ); + bsPutUChar ( bsWr, 0x59 ); bsPutUChar ( bsWr, 0x26 ); + bsPutUChar ( bsWr, 0x53 ); bsPutUChar ( bsWr, 0x59 ); + } + } + + fprintf ( stderr, "%s: finished\n", progName ); + return 0; +} + + + +/*-----------------------------------------------------------*/ +/*--- end bzip2recover.c ---*/ +/*-----------------------------------------------------------*/ diff --git a/bzip2/bzlib.c b/bzip2/bzlib.c new file mode 100644 index 0000000..4a06d9f --- /dev/null +++ b/bzip2/bzlib.c @@ -0,0 +1,1564 @@ + +/*-------------------------------------------------------------*/ +/*--- Library top-level functions. ---*/ +/*--- bzlib.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + +/*-- + CHANGES + ~~~~~~~ + 0.9.0 -- original version. + + 0.9.0a/b -- no changes in this file. + + 0.9.0c + * made zero-length BZ_FLUSH work correctly in bzCompress(). + * fixed bzWrite/bzRead to ignore zero-length requests. + * fixed bzread to correctly handle read requests after EOF. + * wrong parameter order in call to bzDecompressInit in + bzBuffToBuffDecompress. Fixed. +--*/ + +#include "bzlib_private.h" + + +/*---------------------------------------------------*/ +/*--- Compression stuff ---*/ +/*---------------------------------------------------*/ + + +/*---------------------------------------------------*/ +#ifndef BZ_NO_STDIO +void BZ2_bz__AssertH__fail ( int errcode ) +{ + fprintf(stderr, + "\n\nbzip2/libbzip2: internal error number %d.\n" + "This is a bug in bzip2/libbzip2, %s.\n" + "Please report it to me at: jseward@acm.org. If this happened\n" + "when you were using some program which uses libbzip2 as a\n" + "component, you should also report this bug to the author(s)\n" + "of that program. Please make an effort to report this bug;\n" + "timely and accurate bug reports eventually lead to higher\n" + "quality software. Thanks. Julian Seward, 21 March 2000.\n\n", + errcode, + BZ2_bzlibVersion() + ); + exit(3); +} +#endif + + +/*---------------------------------------------------*/ +static +int bz_config_ok ( void ) +{ + if (sizeof(int) != 4) return 0; + if (sizeof(short) != 2) return 0; + if (sizeof(char) != 1) return 0; + return 1; +} + + +/*---------------------------------------------------*/ +static +void* default_bzalloc ( void* opaque, Int32 items, Int32 size ) +{ + void* v = malloc ( items * size ); + return v; +} + +static +void default_bzfree ( void* opaque, void* addr ) +{ + if (addr != NULL) free ( addr ); +} + + +/*---------------------------------------------------*/ +static +void prepare_new_block ( EState* s ) +{ + Int32 i; + s->nblock = 0; + s->numZ = 0; + s->state_out_pos = 0; + BZ_INITIALISE_CRC ( s->blockCRC ); + for (i = 0; i < 256; i++) s->inUse[i] = False; + s->blockNo++; +} + + +/*---------------------------------------------------*/ +static +void init_RL ( EState* s ) +{ + s->state_in_ch = 256; + s->state_in_len = 0; +} + + +static +Bool isempty_RL ( EState* s ) +{ + if (s->state_in_ch < 256 && s->state_in_len > 0) + return False; else + return True; +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzCompressInit) + ( bz_stream* strm, + int blockSize100k, + int verbosity, + int workFactor ) +{ + Int32 n; + EState* s; + + if (!bz_config_ok()) return BZ_CONFIG_ERROR; + + if (strm == NULL || + blockSize100k < 1 || blockSize100k > 9 || + workFactor < 0 || workFactor > 250) + return BZ_PARAM_ERROR; + + if (workFactor == 0) workFactor = 30; + if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc; + if (strm->bzfree == NULL) strm->bzfree = default_bzfree; + + s = BZALLOC( sizeof(EState) ); + if (s == NULL) return BZ_MEM_ERROR; + s->strm = strm; + + s->arr1 = NULL; + s->arr2 = NULL; + s->ftab = NULL; + + n = 100000 * blockSize100k; + s->arr1 = BZALLOC( n * sizeof(UInt32) ); + s->arr2 = BZALLOC( (n+BZ_N_OVERSHOOT) * sizeof(UInt32) ); + s->ftab = BZALLOC( 65537 * sizeof(UInt32) ); + + if (s->arr1 == NULL || s->arr2 == NULL || s->ftab == NULL) { + if (s->arr1 != NULL) BZFREE(s->arr1); + if (s->arr2 != NULL) BZFREE(s->arr2); + if (s->ftab != NULL) BZFREE(s->ftab); + if (s != NULL) BZFREE(s); + return BZ_MEM_ERROR; + } + + s->blockNo = 0; + s->state = BZ_S_INPUT; + s->mode = BZ_M_RUNNING; + s->combinedCRC = 0; + s->blockSize100k = blockSize100k; + s->nblockMAX = 100000 * blockSize100k - 19; + s->verbosity = verbosity; + s->workFactor = workFactor; + + s->block = (UChar*)s->arr2; + s->mtfv = (UInt16*)s->arr1; + s->zbits = NULL; + s->ptr = (UInt32*)s->arr1; + + strm->state = s; + strm->total_in_lo32 = 0; + strm->total_in_hi32 = 0; + strm->total_out_lo32 = 0; + strm->total_out_hi32 = 0; + init_RL ( s ); + prepare_new_block ( s ); + return BZ_OK; +} + + +/*---------------------------------------------------*/ +static +void add_pair_to_block ( EState* s ) +{ + Int32 i; + UChar ch = (UChar)(s->state_in_ch); + for (i = 0; i < s->state_in_len; i++) { + BZ_UPDATE_CRC( s->blockCRC, ch ); + } + s->inUse[s->state_in_ch] = True; + switch (s->state_in_len) { + case 1: + s->block[s->nblock] = (UChar)ch; s->nblock++; + break; + case 2: + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + break; + case 3: + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + break; + default: + s->inUse[s->state_in_len-4] = True; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = ((UChar)(s->state_in_len-4)); + s->nblock++; + break; + } +} + + +/*---------------------------------------------------*/ +static +void flush_RL ( EState* s ) +{ + if (s->state_in_ch < 256) add_pair_to_block ( s ); + init_RL ( s ); +} + + +/*---------------------------------------------------*/ +#define ADD_CHAR_TO_BLOCK(zs,zchh0) \ +{ \ + UInt32 zchh = (UInt32)(zchh0); \ + /*-- fast track the common case --*/ \ + if (zchh != zs->state_in_ch && \ + zs->state_in_len == 1) { \ + UChar ch = (UChar)(zs->state_in_ch); \ + BZ_UPDATE_CRC( zs->blockCRC, ch ); \ + zs->inUse[zs->state_in_ch] = True; \ + zs->block[zs->nblock] = (UChar)ch; \ + zs->nblock++; \ + zs->state_in_ch = zchh; \ + } \ + else \ + /*-- general, uncommon cases --*/ \ + if (zchh != zs->state_in_ch || \ + zs->state_in_len == 255) { \ + if (zs->state_in_ch < 256) \ + add_pair_to_block ( zs ); \ + zs->state_in_ch = zchh; \ + zs->state_in_len = 1; \ + } else { \ + zs->state_in_len++; \ + } \ +} + + +/*---------------------------------------------------*/ +static +Bool copy_input_until_stop ( EState* s ) +{ + Bool progress_in = False; + + if (s->mode == BZ_M_RUNNING) { + + /*-- fast track the common case --*/ + while (True) { + /*-- block full? --*/ + if (s->nblock >= s->nblockMAX) break; + /*-- no input? --*/ + if (s->strm->avail_in == 0) break; + progress_in = True; + ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) ); + s->strm->next_in++; + s->strm->avail_in--; + s->strm->total_in_lo32++; + if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++; + } + + } else { + + /*-- general, uncommon case --*/ + while (True) { + /*-- block full? --*/ + if (s->nblock >= s->nblockMAX) break; + /*-- no input? --*/ + if (s->strm->avail_in == 0) break; + /*-- flush/finish end? --*/ + if (s->avail_in_expect == 0) break; + progress_in = True; + ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) ); + s->strm->next_in++; + s->strm->avail_in--; + s->strm->total_in_lo32++; + if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++; + s->avail_in_expect--; + } + } + return progress_in; +} + + +/*---------------------------------------------------*/ +static +Bool copy_output_until_stop ( EState* s ) +{ + Bool progress_out = False; + + while (True) { + + /*-- no output space? --*/ + if (s->strm->avail_out == 0) break; + + /*-- block done? --*/ + if (s->state_out_pos >= s->numZ) break; + + progress_out = True; + *(s->strm->next_out) = s->zbits[s->state_out_pos]; + s->state_out_pos++; + s->strm->avail_out--; + s->strm->next_out++; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + return progress_out; +} + + +/*---------------------------------------------------*/ +static +Bool handle_compress ( bz_stream* strm ) +{ + Bool progress_in = False; + Bool progress_out = False; + EState* s = strm->state; + + while (True) { + + if (s->state == BZ_S_OUTPUT) { + progress_out |= copy_output_until_stop ( s ); + if (s->state_out_pos < s->numZ) break; + if (s->mode == BZ_M_FINISHING && + s->avail_in_expect == 0 && + isempty_RL(s)) break; + prepare_new_block ( s ); + s->state = BZ_S_INPUT; + if (s->mode == BZ_M_FLUSHING && + s->avail_in_expect == 0 && + isempty_RL(s)) break; + } + + if (s->state == BZ_S_INPUT) { + progress_in |= copy_input_until_stop ( s ); + if (s->mode != BZ_M_RUNNING && s->avail_in_expect == 0) { + flush_RL ( s ); + BZ2_compressBlock ( s, (Bool)(s->mode == BZ_M_FINISHING) ); + s->state = BZ_S_OUTPUT; + } + else + if (s->nblock >= s->nblockMAX) { + BZ2_compressBlock ( s, False ); + s->state = BZ_S_OUTPUT; + } + else + if (s->strm->avail_in == 0) { + break; + } + } + + } + + return progress_in || progress_out; +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzCompress) ( bz_stream *strm, int action ) +{ + Bool progress; + EState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + preswitch: + switch (s->mode) { + + case BZ_M_IDLE: + return BZ_SEQUENCE_ERROR; + + case BZ_M_RUNNING: + if (action == BZ_RUN) { + progress = handle_compress ( strm ); + return progress ? BZ_RUN_OK : BZ_PARAM_ERROR; + } + else + if (action == BZ_FLUSH) { + s->avail_in_expect = strm->avail_in; + s->mode = BZ_M_FLUSHING; + goto preswitch; + } + else + if (action == BZ_FINISH) { + s->avail_in_expect = strm->avail_in; + s->mode = BZ_M_FINISHING; + goto preswitch; + } + else + return BZ_PARAM_ERROR; + + case BZ_M_FLUSHING: + if (action != BZ_FLUSH) return BZ_SEQUENCE_ERROR; + if (s->avail_in_expect != s->strm->avail_in) + return BZ_SEQUENCE_ERROR; + progress = handle_compress ( strm ); + if (s->avail_in_expect > 0 || !isempty_RL(s) || + s->state_out_pos < s->numZ) return BZ_FLUSH_OK; + s->mode = BZ_M_RUNNING; + return BZ_RUN_OK; + + case BZ_M_FINISHING: + if (action != BZ_FINISH) return BZ_SEQUENCE_ERROR; + if (s->avail_in_expect != s->strm->avail_in) + return BZ_SEQUENCE_ERROR; + progress = handle_compress ( strm ); + if (!progress) return BZ_SEQUENCE_ERROR; + if (s->avail_in_expect > 0 || !isempty_RL(s) || + s->state_out_pos < s->numZ) return BZ_FINISH_OK; + s->mode = BZ_M_IDLE; + return BZ_STREAM_END; + } + return BZ_OK; /*--not reached--*/ +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzCompressEnd) ( bz_stream *strm ) +{ + EState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + if (s->arr1 != NULL) BZFREE(s->arr1); + if (s->arr2 != NULL) BZFREE(s->arr2); + if (s->ftab != NULL) BZFREE(s->ftab); + BZFREE(strm->state); + + strm->state = NULL; + + return BZ_OK; +} + + +/*---------------------------------------------------*/ +/*--- Decompression stuff ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzDecompressInit) + ( bz_stream* strm, + int verbosity, + int small ) +{ + DState* s; + + if (!bz_config_ok()) return BZ_CONFIG_ERROR; + + if (strm == NULL) return BZ_PARAM_ERROR; + if (small != 0 && small != 1) return BZ_PARAM_ERROR; + if (verbosity < 0 || verbosity > 4) return BZ_PARAM_ERROR; + + if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc; + if (strm->bzfree == NULL) strm->bzfree = default_bzfree; + + s = BZALLOC( sizeof(DState) ); + if (s == NULL) return BZ_MEM_ERROR; + s->strm = strm; + strm->state = s; + s->state = BZ_X_MAGIC_1; + s->bsLive = 0; + s->bsBuff = 0; + s->calculatedCombinedCRC = 0; + strm->total_in_lo32 = 0; + strm->total_in_hi32 = 0; + strm->total_out_lo32 = 0; + strm->total_out_hi32 = 0; + s->smallDecompress = (Bool)small; + s->ll4 = NULL; + s->ll16 = NULL; + s->tt = NULL; + s->currBlockNo = 0; + s->verbosity = verbosity; + + return BZ_OK; +} + + +/*---------------------------------------------------*/ +static +void unRLE_obuf_to_output_FAST ( DState* s ) +{ + UChar k1; + + if (s->blockRandomised) { + + while (True) { + /* try to finish existing run */ + while (True) { + if (s->strm->avail_out == 0) return; + if (s->state_out_len == 0) break; + *( (UChar*)(s->strm->next_out) ) = s->state_out_ch; + BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch ); + s->state_out_len--; + s->strm->next_out++; + s->strm->avail_out--; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + /* can a new run be started? */ + if (s->nblock_used == s->save_nblock+1) return; + + + s->state_out_len = 1; + s->state_out_ch = s->k0; + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 2; + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 3; + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + s->state_out_len = ((Int32)k1) + 4; + BZ_GET_FAST(s->k0); BZ_RAND_UPD_MASK; + s->k0 ^= BZ_RAND_MASK; s->nblock_used++; + } + + } else { + + /* restore */ + UInt32 c_calculatedBlockCRC = s->calculatedBlockCRC; + UChar c_state_out_ch = s->state_out_ch; + Int32 c_state_out_len = s->state_out_len; + Int32 c_nblock_used = s->nblock_used; + Int32 c_k0 = s->k0; + UInt32* c_tt = s->tt; + UInt32 c_tPos = s->tPos; + char* cs_next_out = s->strm->next_out; + unsigned int cs_avail_out = s->strm->avail_out; + /* end restore */ + + UInt32 avail_out_INIT = cs_avail_out; + Int32 s_save_nblockPP = s->save_nblock+1; + unsigned int total_out_lo32_old; + + while (True) { + + /* try to finish existing run */ + if (c_state_out_len > 0) { + while (True) { + if (cs_avail_out == 0) goto return_notr; + if (c_state_out_len == 1) break; + *( (UChar*)(cs_next_out) ) = c_state_out_ch; + BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch ); + c_state_out_len--; + cs_next_out++; + cs_avail_out--; + } + s_state_out_len_eq_one: + { + if (cs_avail_out == 0) { + c_state_out_len = 1; goto return_notr; + }; + *( (UChar*)(cs_next_out) ) = c_state_out_ch; + BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch ); + cs_next_out++; + cs_avail_out--; + } + } + /* can a new run be started? */ + if (c_nblock_used == s_save_nblockPP) { + c_state_out_len = 0; goto return_notr; + }; + c_state_out_ch = c_k0; + BZ_GET_FAST_C(k1); c_nblock_used++; + if (k1 != c_k0) { + c_k0 = k1; goto s_state_out_len_eq_one; + }; + if (c_nblock_used == s_save_nblockPP) + goto s_state_out_len_eq_one; + + c_state_out_len = 2; + BZ_GET_FAST_C(k1); c_nblock_used++; + if (c_nblock_used == s_save_nblockPP) continue; + if (k1 != c_k0) { c_k0 = k1; continue; }; + + c_state_out_len = 3; + BZ_GET_FAST_C(k1); c_nblock_used++; + if (c_nblock_used == s_save_nblockPP) continue; + if (k1 != c_k0) { c_k0 = k1; continue; }; + + BZ_GET_FAST_C(k1); c_nblock_used++; + c_state_out_len = ((Int32)k1) + 4; + BZ_GET_FAST_C(c_k0); c_nblock_used++; + } + + return_notr: + total_out_lo32_old = s->strm->total_out_lo32; + s->strm->total_out_lo32 += (avail_out_INIT - cs_avail_out); + if (s->strm->total_out_lo32 < total_out_lo32_old) + s->strm->total_out_hi32++; + + /* save */ + s->calculatedBlockCRC = c_calculatedBlockCRC; + s->state_out_ch = c_state_out_ch; + s->state_out_len = c_state_out_len; + s->nblock_used = c_nblock_used; + s->k0 = c_k0; + s->tt = c_tt; + s->tPos = c_tPos; + s->strm->next_out = cs_next_out; + s->strm->avail_out = cs_avail_out; + /* end save */ + } +} + + + +/*---------------------------------------------------*/ +__inline__ Int32 BZ2_indexIntoF ( Int32 indx, Int32 *cftab ) +{ + Int32 nb, na, mid; + nb = 0; + na = 256; + do { + mid = (nb + na) >> 1; + if (indx >= cftab[mid]) nb = mid; else na = mid; + } + while (na - nb != 1); + return nb; +} + + +/*---------------------------------------------------*/ +static +void unRLE_obuf_to_output_SMALL ( DState* s ) +{ + UChar k1; + + if (s->blockRandomised) { + + while (True) { + /* try to finish existing run */ + while (True) { + if (s->strm->avail_out == 0) return; + if (s->state_out_len == 0) break; + *( (UChar*)(s->strm->next_out) ) = s->state_out_ch; + BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch ); + s->state_out_len--; + s->strm->next_out++; + s->strm->avail_out--; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + /* can a new run be started? */ + if (s->nblock_used == s->save_nblock+1) return; + + + s->state_out_len = 1; + s->state_out_ch = s->k0; + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 2; + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 3; + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + s->state_out_len = ((Int32)k1) + 4; + BZ_GET_SMALL(s->k0); BZ_RAND_UPD_MASK; + s->k0 ^= BZ_RAND_MASK; s->nblock_used++; + } + + } else { + + while (True) { + /* try to finish existing run */ + while (True) { + if (s->strm->avail_out == 0) return; + if (s->state_out_len == 0) break; + *( (UChar*)(s->strm->next_out) ) = s->state_out_ch; + BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch ); + s->state_out_len--; + s->strm->next_out++; + s->strm->avail_out--; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + /* can a new run be started? */ + if (s->nblock_used == s->save_nblock+1) return; + + s->state_out_len = 1; + s->state_out_ch = s->k0; + BZ_GET_SMALL(k1); s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 2; + BZ_GET_SMALL(k1); s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 3; + BZ_GET_SMALL(k1); s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + BZ_GET_SMALL(k1); s->nblock_used++; + s->state_out_len = ((Int32)k1) + 4; + BZ_GET_SMALL(s->k0); s->nblock_used++; + } + + } +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzDecompress) ( bz_stream *strm ) +{ + DState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + while (True) { + if (s->state == BZ_X_IDLE) return BZ_SEQUENCE_ERROR; + if (s->state == BZ_X_OUTPUT) { + if (s->smallDecompress) + unRLE_obuf_to_output_SMALL ( s ); else + unRLE_obuf_to_output_FAST ( s ); + if (s->nblock_used == s->save_nblock+1 && s->state_out_len == 0) { + BZ_FINALISE_CRC ( s->calculatedBlockCRC ); + if (s->verbosity >= 3) + VPrintf2 ( " {0x%x, 0x%x}", s->storedBlockCRC, + s->calculatedBlockCRC ); + if (s->verbosity >= 2) VPrintf0 ( "]" ); + if (s->calculatedBlockCRC != s->storedBlockCRC) + return BZ_DATA_ERROR; + s->calculatedCombinedCRC + = (s->calculatedCombinedCRC << 1) | + (s->calculatedCombinedCRC >> 31); + s->calculatedCombinedCRC ^= s->calculatedBlockCRC; + s->state = BZ_X_BLKHDR_1; + } else { + return BZ_OK; + } + } + if (s->state >= BZ_X_MAGIC_1) { + Int32 r = BZ2_decompress ( s ); + if (r == BZ_STREAM_END) { + if (s->verbosity >= 3) + VPrintf2 ( "\n combined CRCs: stored = 0x%x, computed = 0x%x", + s->storedCombinedCRC, s->calculatedCombinedCRC ); + if (s->calculatedCombinedCRC != s->storedCombinedCRC) + return BZ_DATA_ERROR; + return r; + } + if (s->state != BZ_X_OUTPUT) return r; + } + } + + AssertH ( 0, 6001 ); + + return 0; /*NOTREACHED*/ +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzDecompressEnd) ( bz_stream *strm ) +{ + DState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + if (s->tt != NULL) BZFREE(s->tt); + if (s->ll16 != NULL) BZFREE(s->ll16); + if (s->ll4 != NULL) BZFREE(s->ll4); + + BZFREE(strm->state); + strm->state = NULL; + + return BZ_OK; +} + + +#ifndef BZ_NO_STDIO +/*---------------------------------------------------*/ +/*--- File I/O stuff ---*/ +/*---------------------------------------------------*/ + +#define BZ_SETERR(eee) \ +{ \ + if (bzerror != NULL) *bzerror = eee; \ + if (bzf != NULL) bzf->lastErr = eee; \ +} + +typedef + struct { + FILE* handle; + Char buf[BZ_MAX_UNUSED]; + Int32 bufN; + Bool writing; + bz_stream strm; + Int32 lastErr; + Bool initialisedOk; + } + bzFile; + + +/*---------------------------------------------*/ +static Bool myfeof ( FILE* f ) +{ + Int32 c = fgetc ( f ); + if (c == EOF) return True; + ungetc ( c, f ); + return False; +} + + +/*---------------------------------------------------*/ +BZFILE* BZ_API(BZ2_bzWriteOpen) + ( int* bzerror, + FILE* f, + int blockSize100k, + int verbosity, + int workFactor ) +{ + Int32 ret; + bzFile* bzf = NULL; + + BZ_SETERR(BZ_OK); + + if (f == NULL || + (blockSize100k < 1 || blockSize100k > 9) || + (workFactor < 0 || workFactor > 250) || + (verbosity < 0 || verbosity > 4)) + { BZ_SETERR(BZ_PARAM_ERROR); return NULL; }; + + if (ferror(f)) + { BZ_SETERR(BZ_IO_ERROR); return NULL; }; + + bzf = malloc ( sizeof(bzFile) ); + if (bzf == NULL) + { BZ_SETERR(BZ_MEM_ERROR); return NULL; }; + + BZ_SETERR(BZ_OK); + bzf->initialisedOk = False; + bzf->bufN = 0; + bzf->handle = f; + bzf->writing = True; + bzf->strm.bzalloc = NULL; + bzf->strm.bzfree = NULL; + bzf->strm.opaque = NULL; + + if (workFactor == 0) workFactor = 30; + ret = BZ2_bzCompressInit ( &(bzf->strm), blockSize100k, + verbosity, workFactor ); + if (ret != BZ_OK) + { BZ_SETERR(ret); free(bzf); return NULL; }; + + bzf->strm.avail_in = 0; + bzf->initialisedOk = True; + return bzf; +} + + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzWrite) + ( int* bzerror, + BZFILE* b, + void* buf, + int len ) +{ + Int32 n, n2, ret; + bzFile* bzf = (bzFile*)b; + + BZ_SETERR(BZ_OK); + if (bzf == NULL || buf == NULL || len < 0) + { BZ_SETERR(BZ_PARAM_ERROR); return; }; + if (!(bzf->writing)) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + + if (len == 0) + { BZ_SETERR(BZ_OK); return; }; + + bzf->strm.avail_in = len; + bzf->strm.next_in = buf; + + while (True) { + bzf->strm.avail_out = BZ_MAX_UNUSED; + bzf->strm.next_out = bzf->buf; + ret = BZ2_bzCompress ( &(bzf->strm), BZ_RUN ); + if (ret != BZ_RUN_OK) + { BZ_SETERR(ret); return; }; + + if (bzf->strm.avail_out < BZ_MAX_UNUSED) { + n = BZ_MAX_UNUSED - bzf->strm.avail_out; + n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar), + n, bzf->handle ); + if (n != n2 || ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + } + + if (bzf->strm.avail_in == 0) + { BZ_SETERR(BZ_OK); return; }; + } +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzWriteClose) + ( int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out ) +{ + BZ2_bzWriteClose64 ( bzerror, b, abandon, + nbytes_in, NULL, nbytes_out, NULL ); +} + + +void BZ_API(BZ2_bzWriteClose64) + ( int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 ) +{ + Int32 n, n2, ret; + bzFile* bzf = (bzFile*)b; + + if (bzf == NULL) + { BZ_SETERR(BZ_OK); return; }; + if (!(bzf->writing)) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + + if (nbytes_in_lo32 != NULL) *nbytes_in_lo32 = 0; + if (nbytes_in_hi32 != NULL) *nbytes_in_hi32 = 0; + if (nbytes_out_lo32 != NULL) *nbytes_out_lo32 = 0; + if (nbytes_out_hi32 != NULL) *nbytes_out_hi32 = 0; + + if ((!abandon) && bzf->lastErr == BZ_OK) { + while (True) { + bzf->strm.avail_out = BZ_MAX_UNUSED; + bzf->strm.next_out = bzf->buf; + ret = BZ2_bzCompress ( &(bzf->strm), BZ_FINISH ); + if (ret != BZ_FINISH_OK && ret != BZ_STREAM_END) + { BZ_SETERR(ret); return; }; + + if (bzf->strm.avail_out < BZ_MAX_UNUSED) { + n = BZ_MAX_UNUSED - bzf->strm.avail_out; + n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar), + n, bzf->handle ); + if (n != n2 || ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + } + + if (ret == BZ_STREAM_END) break; + } + } + + if ( !abandon && !ferror ( bzf->handle ) ) { + fflush ( bzf->handle ); + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + } + + if (nbytes_in_lo32 != NULL) + *nbytes_in_lo32 = bzf->strm.total_in_lo32; + if (nbytes_in_hi32 != NULL) + *nbytes_in_hi32 = bzf->strm.total_in_hi32; + if (nbytes_out_lo32 != NULL) + *nbytes_out_lo32 = bzf->strm.total_out_lo32; + if (nbytes_out_hi32 != NULL) + *nbytes_out_hi32 = bzf->strm.total_out_hi32; + + BZ_SETERR(BZ_OK); + BZ2_bzCompressEnd ( &(bzf->strm) ); + free ( bzf ); +} + + +/*---------------------------------------------------*/ +BZFILE* BZ_API(BZ2_bzReadOpen) + ( int* bzerror, + FILE* f, + int verbosity, + int small, + void* unused, + int nUnused ) +{ + bzFile* bzf = NULL; + int ret; + + BZ_SETERR(BZ_OK); + + if (f == NULL || + (small != 0 && small != 1) || + (verbosity < 0 || verbosity > 4) || + (unused == NULL && nUnused != 0) || + (unused != NULL && (nUnused < 0 || nUnused > BZ_MAX_UNUSED))) + { BZ_SETERR(BZ_PARAM_ERROR); return NULL; }; + + if (ferror(f)) + { BZ_SETERR(BZ_IO_ERROR); return NULL; }; + + bzf = malloc ( sizeof(bzFile) ); + if (bzf == NULL) + { BZ_SETERR(BZ_MEM_ERROR); return NULL; }; + + BZ_SETERR(BZ_OK); + + bzf->initialisedOk = False; + bzf->handle = f; + bzf->bufN = 0; + bzf->writing = False; + bzf->strm.bzalloc = NULL; + bzf->strm.bzfree = NULL; + bzf->strm.opaque = NULL; + + while (nUnused > 0) { + bzf->buf[bzf->bufN] = *((UChar*)(unused)); bzf->bufN++; + unused = ((void*)( 1 + ((UChar*)(unused)) )); + nUnused--; + } + + ret = BZ2_bzDecompressInit ( &(bzf->strm), verbosity, small ); + if (ret != BZ_OK) + { BZ_SETERR(ret); free(bzf); return NULL; }; + + bzf->strm.avail_in = bzf->bufN; + bzf->strm.next_in = bzf->buf; + + bzf->initialisedOk = True; + return bzf; +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzReadClose) ( int *bzerror, BZFILE *b ) +{ + bzFile* bzf = (bzFile*)b; + + BZ_SETERR(BZ_OK); + if (bzf == NULL) + { BZ_SETERR(BZ_OK); return; }; + + if (bzf->writing) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + + if (bzf->initialisedOk) + (void)BZ2_bzDecompressEnd ( &(bzf->strm) ); + free ( bzf ); +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzRead) + ( int* bzerror, + BZFILE* b, + void* buf, + int len ) +{ + Int32 n, ret; + bzFile* bzf = (bzFile*)b; + + BZ_SETERR(BZ_OK); + + if (bzf == NULL || buf == NULL || len < 0) + { BZ_SETERR(BZ_PARAM_ERROR); return 0; }; + + if (bzf->writing) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return 0; }; + + if (len == 0) + { BZ_SETERR(BZ_OK); return 0; }; + + bzf->strm.avail_out = len; + bzf->strm.next_out = buf; + + while (True) { + + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return 0; }; + + if (bzf->strm.avail_in == 0 && !myfeof(bzf->handle)) { + n = fread ( bzf->buf, sizeof(UChar), + BZ_MAX_UNUSED, bzf->handle ); + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return 0; }; + bzf->bufN = n; + bzf->strm.avail_in = bzf->bufN; + bzf->strm.next_in = bzf->buf; + } + + ret = BZ2_bzDecompress ( &(bzf->strm) ); + + if (ret != BZ_OK && ret != BZ_STREAM_END) + { BZ_SETERR(ret); return 0; }; + + if (ret == BZ_OK && myfeof(bzf->handle) && + bzf->strm.avail_in == 0 && bzf->strm.avail_out > 0) + { BZ_SETERR(BZ_UNEXPECTED_EOF); return 0; }; + + if (ret == BZ_STREAM_END) + { BZ_SETERR(BZ_STREAM_END); + return len - bzf->strm.avail_out; }; + if (bzf->strm.avail_out == 0) + { BZ_SETERR(BZ_OK); return len; }; + + } + + return 0; /*not reached*/ +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzReadGetUnused) + ( int* bzerror, + BZFILE* b, + void** unused, + int* nUnused ) +{ + bzFile* bzf = (bzFile*)b; + if (bzf == NULL) + { BZ_SETERR(BZ_PARAM_ERROR); return; }; + if (bzf->lastErr != BZ_STREAM_END) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + if (unused == NULL || nUnused == NULL) + { BZ_SETERR(BZ_PARAM_ERROR); return; }; + + BZ_SETERR(BZ_OK); + *nUnused = bzf->strm.avail_in; + *unused = bzf->strm.next_in; +} +#endif + + +/*---------------------------------------------------*/ +/*--- Misc convenience stuff ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzBuffToBuffCompress) + ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor ) +{ + bz_stream strm; + int ret; + + if (dest == NULL || destLen == NULL || + source == NULL || + blockSize100k < 1 || blockSize100k > 9 || + verbosity < 0 || verbosity > 4 || + workFactor < 0 || workFactor > 250) + return BZ_PARAM_ERROR; + + if (workFactor == 0) workFactor = 30; + strm.bzalloc = NULL; + strm.bzfree = NULL; + strm.opaque = NULL; + ret = BZ2_bzCompressInit ( &strm, blockSize100k, + verbosity, workFactor ); + if (ret != BZ_OK) return ret; + + strm.next_in = source; + strm.next_out = dest; + strm.avail_in = sourceLen; + strm.avail_out = *destLen; + + ret = BZ2_bzCompress ( &strm, BZ_FINISH ); + if (ret == BZ_FINISH_OK) goto output_overflow; + if (ret != BZ_STREAM_END) goto errhandler; + + /* normal termination */ + *destLen -= strm.avail_out; + BZ2_bzCompressEnd ( &strm ); + return BZ_OK; + + output_overflow: + BZ2_bzCompressEnd ( &strm ); + return BZ_OUTBUFF_FULL; + + errhandler: + BZ2_bzCompressEnd ( &strm ); + return ret; +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzBuffToBuffDecompress) + ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity ) +{ + bz_stream strm; + int ret; + + if (dest == NULL || destLen == NULL || + source == NULL || + (small != 0 && small != 1) || + verbosity < 0 || verbosity > 4) + return BZ_PARAM_ERROR; + + strm.bzalloc = NULL; + strm.bzfree = NULL; + strm.opaque = NULL; + ret = BZ2_bzDecompressInit ( &strm, verbosity, small ); + if (ret != BZ_OK) return ret; + + strm.next_in = source; + strm.next_out = dest; + strm.avail_in = sourceLen; + strm.avail_out = *destLen; + + ret = BZ2_bzDecompress ( &strm ); + if (ret == BZ_OK) goto output_overflow_or_eof; + if (ret != BZ_STREAM_END) goto errhandler; + + /* normal termination */ + *destLen -= strm.avail_out; + BZ2_bzDecompressEnd ( &strm ); + return BZ_OK; + + output_overflow_or_eof: + if (strm.avail_out > 0) { + BZ2_bzDecompressEnd ( &strm ); + return BZ_UNEXPECTED_EOF; + } else { + BZ2_bzDecompressEnd ( &strm ); + return BZ_OUTBUFF_FULL; + }; + + errhandler: + BZ2_bzDecompressEnd ( &strm ); + return ret; +} + + +/*---------------------------------------------------*/ +/*-- + Code contributed by Yoshioka Tsuneo + (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp), + to support better zlib compatibility. + This code is not _officially_ part of libbzip2 (yet); + I haven't tested it, documented it, or considered the + threading-safeness of it. + If this code breaks, please contact both Yoshioka and me. +--*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +/*-- + return version like "0.9.0c". +--*/ +const char * BZ_API(BZ2_bzlibVersion)(void) +{ + return BZ_VERSION; +} + + +#ifndef BZ_NO_STDIO +/*---------------------------------------------------*/ + +#if defined(_WIN32) || defined(OS2) || defined(MSDOS) +# include +# include +# define SET_BINARY_MODE(file) setmode(fileno(file),O_BINARY) +#else +# define SET_BINARY_MODE(file) +#endif +static +BZFILE * bzopen_or_bzdopen + ( const char *path, /* no use when bzdopen */ + int fd, /* no use when bzdopen */ + const char *mode, + int open_mode) /* bzopen: 0, bzdopen:1 */ +{ + int bzerr; + char unused[BZ_MAX_UNUSED]; + int blockSize100k = 9; + int writing = 0; + char mode2[10] = ""; + FILE *fp = NULL; + BZFILE *bzfp = NULL; + int verbosity = 0; + int workFactor = 30; + int smallMode = 0; + int nUnused = 0; + + if (mode == NULL) return NULL; + while (*mode) { + switch (*mode) { + case 'r': + writing = 0; break; + case 'w': + writing = 1; break; + case 's': + smallMode = 1; break; + default: + if (isdigit((int)(*mode))) { + blockSize100k = *mode-'0'; + } + } + mode++; + } + strcat(mode2, writing ? "w" : "r" ); + strcat(mode2,"b"); /* binary mode */ + + if (open_mode==0) { + if (path==NULL || strcmp(path,"")==0) { + fp = (writing ? stdout : stdin); + SET_BINARY_MODE(fp); + } else { + fp = fopen(path,mode2); + } + } else { +#ifdef BZ_STRICT_ANSI + fp = NULL; +#else + fp = fdopen(fd,mode2); +#endif + } + if (fp == NULL) return NULL; + + if (writing) { + /* Guard against total chaos and anarchy -- JRS */ + if (blockSize100k < 1) blockSize100k = 1; + if (blockSize100k > 9) blockSize100k = 9; + bzfp = BZ2_bzWriteOpen(&bzerr,fp,blockSize100k, + verbosity,workFactor); + } else { + bzfp = BZ2_bzReadOpen(&bzerr,fp,verbosity,smallMode, + unused,nUnused); + } + if (bzfp == NULL) { + if (fp != stdin && fp != stdout) fclose(fp); + return NULL; + } + return bzfp; +} + + +/*---------------------------------------------------*/ +/*-- + open file for read or write. + ex) bzopen("file","w9") + case path="" or NULL => use stdin or stdout. +--*/ +BZFILE * BZ_API(BZ2_bzopen) + ( const char *path, + const char *mode ) +{ + return bzopen_or_bzdopen(path,-1,mode,/*bzopen*/0); +} + + +/*---------------------------------------------------*/ +BZFILE * BZ_API(BZ2_bzdopen) + ( int fd, + const char *mode ) +{ + return bzopen_or_bzdopen(NULL,fd,mode,/*bzdopen*/1); +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzread) (BZFILE* b, void* buf, int len ) +{ + int bzerr, nread; + if (((bzFile*)b)->lastErr == BZ_STREAM_END) return 0; + nread = BZ2_bzRead(&bzerr,b,buf,len); + if (bzerr == BZ_OK || bzerr == BZ_STREAM_END) { + return nread; + } else { + return -1; + } +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzwrite) (BZFILE* b, void* buf, int len ) +{ + int bzerr; + + BZ2_bzWrite(&bzerr,b,buf,len); + if(bzerr == BZ_OK){ + return len; + }else{ + return -1; + } +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzflush) (BZFILE *b) +{ + /* do nothing now... */ + return 0; +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzclose) (BZFILE* b) +{ + int bzerr; + FILE *fp = ((bzFile *)b)->handle; + + if (b==NULL) {return;} + if(((bzFile*)b)->writing){ + BZ2_bzWriteClose(&bzerr,b,0,NULL,NULL); + if(bzerr != BZ_OK){ + BZ2_bzWriteClose(NULL,b,1,NULL,NULL); + } + }else{ + BZ2_bzReadClose(&bzerr,b); + } + if(fp!=stdin && fp!=stdout){ + fclose(fp); + } +} + + +/*---------------------------------------------------*/ +/*-- + return last error code +--*/ +static char *bzerrorstrings[] = { + "OK" + ,"SEQUENCE_ERROR" + ,"PARAM_ERROR" + ,"MEM_ERROR" + ,"DATA_ERROR" + ,"DATA_ERROR_MAGIC" + ,"IO_ERROR" + ,"UNEXPECTED_EOF" + ,"OUTBUFF_FULL" + ,"CONFIG_ERROR" + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ +}; + + +const char * BZ_API(BZ2_bzerror) (BZFILE *b, int *errnum) +{ + int err = ((bzFile *)b)->lastErr; + + if(err>0) err = 0; + *errnum = err; + return bzerrorstrings[err*-1]; +} +#endif + + +/*-------------------------------------------------------------*/ +/*--- end bzlib.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/bzlib.h b/bzip2/bzlib.h new file mode 100644 index 0000000..c9447a2 --- /dev/null +++ b/bzip2/bzlib.h @@ -0,0 +1,319 @@ + +/*-------------------------------------------------------------*/ +/*--- Public header file for the library. ---*/ +/*--- bzlib.h ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#ifndef _BZLIB_H +#define _BZLIB_H + +#ifdef __cplusplus +extern "C" { +#endif + +#define BZ_RUN 0 +#define BZ_FLUSH 1 +#define BZ_FINISH 2 + +#define BZ_OK 0 +#define BZ_RUN_OK 1 +#define BZ_FLUSH_OK 2 +#define BZ_FINISH_OK 3 +#define BZ_STREAM_END 4 +#define BZ_SEQUENCE_ERROR (-1) +#define BZ_PARAM_ERROR (-2) +#define BZ_MEM_ERROR (-3) +#define BZ_DATA_ERROR (-4) +#define BZ_DATA_ERROR_MAGIC (-5) +#define BZ_IO_ERROR (-6) +#define BZ_UNEXPECTED_EOF (-7) +#define BZ_OUTBUFF_FULL (-8) +#define BZ_CONFIG_ERROR (-9) + +typedef + struct { + char *next_in; + unsigned int avail_in; + unsigned int total_in_lo32; + unsigned int total_in_hi32; + + char *next_out; + unsigned int avail_out; + unsigned int total_out_lo32; + unsigned int total_out_hi32; + + void *state; + + void *(*bzalloc)(void *,int,int); + void (*bzfree)(void *,void *); + void *opaque; + } + bz_stream; + + +#ifndef BZ_IMPORT +#define BZ_EXPORT +#endif + +#ifdef _WIN32 +# include +# include +# ifdef small + /* windows.h define small to char */ +# undef small +# endif +# ifdef BZ_EXPORT +# define BZ_API(func) WINAPI func +# define BZ_EXTERN extern +# else + /* import windows dll dynamically */ +# define BZ_API(func) (WINAPI * func) +# define BZ_EXTERN +# endif +#else +# define BZ_API(func) func +# define BZ_EXTERN extern +#endif + + +/*-- Core (low-level) library functions --*/ + +BZ_EXTERN int BZ_API(BZ2_bzCompressInit) ( + bz_stream* strm, + int blockSize100k, + int verbosity, + int workFactor + ); + +BZ_EXTERN int BZ_API(BZ2_bzCompress) ( + bz_stream* strm, + int action + ); + +BZ_EXTERN int BZ_API(BZ2_bzCompressEnd) ( + bz_stream* strm + ); + +BZ_EXTERN int BZ_API(BZ2_bzDecompressInit) ( + bz_stream *strm, + int verbosity, + int small + ); + +BZ_EXTERN int BZ_API(BZ2_bzDecompress) ( + bz_stream* strm + ); + +BZ_EXTERN int BZ_API(BZ2_bzDecompressEnd) ( + bz_stream *strm + ); + + + +/*-- High(er) level library functions --*/ + +#ifndef BZ_NO_STDIO +#define BZ_MAX_UNUSED 5000 + +typedef void BZFILE; + +BZ_EXTERN BZFILE* BZ_API(BZ2_bzReadOpen) ( + int* bzerror, + FILE* f, + int verbosity, + int small, + void* unused, + int nUnused + ); + +BZ_EXTERN void BZ_API(BZ2_bzReadClose) ( + int* bzerror, + BZFILE* b + ); + +BZ_EXTERN void BZ_API(BZ2_bzReadGetUnused) ( + int* bzerror, + BZFILE* b, + void** unused, + int* nUnused + ); + +BZ_EXTERN int BZ_API(BZ2_bzRead) ( + int* bzerror, + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN BZFILE* BZ_API(BZ2_bzWriteOpen) ( + int* bzerror, + FILE* f, + int blockSize100k, + int verbosity, + int workFactor + ); + +BZ_EXTERN void BZ_API(BZ2_bzWrite) ( + int* bzerror, + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN void BZ_API(BZ2_bzWriteClose) ( + int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out + ); + +BZ_EXTERN void BZ_API(BZ2_bzWriteClose64) ( + int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 + ); +#endif + + +/*-- Utility functions --*/ + +BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffCompress) ( + char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor + ); + +BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffDecompress) ( + char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity + ); + + +/*-- + Code contributed by Yoshioka Tsuneo + (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp), + to support better zlib compatibility. + This code is not _officially_ part of libbzip2 (yet); + I haven't tested it, documented it, or considered the + threading-safeness of it. + If this code breaks, please contact both Yoshioka and me. +--*/ + +BZ_EXTERN const char * BZ_API(BZ2_bzlibVersion) ( + void + ); + +#ifndef BZ_NO_STDIO +BZ_EXTERN BZFILE * BZ_API(BZ2_bzopen) ( + const char *path, + const char *mode + ); + +BZ_EXTERN BZFILE * BZ_API(BZ2_bzdopen) ( + int fd, + const char *mode + ); + +BZ_EXTERN int BZ_API(BZ2_bzread) ( + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN int BZ_API(BZ2_bzwrite) ( + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN int BZ_API(BZ2_bzflush) ( + BZFILE* b + ); + +BZ_EXTERN void BZ_API(BZ2_bzclose) ( + BZFILE* b + ); + +BZ_EXTERN const char * BZ_API(BZ2_bzerror) ( + BZFILE *b, + int *errnum + ); +#endif + +#ifdef __cplusplus +} +#endif + +#endif + +/*-------------------------------------------------------------*/ +/*--- end bzlib.h ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/bzlib_private.h b/bzip2/bzlib_private.h new file mode 100644 index 0000000..fb51c7a --- /dev/null +++ b/bzip2/bzlib_private.h @@ -0,0 +1,530 @@ + +/*-------------------------------------------------------------*/ +/*--- Private header file for the library. ---*/ +/*--- bzlib_private.h ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#ifndef _BZLIB_PRIVATE_H +#define _BZLIB_PRIVATE_H + +#include + +#ifndef BZ_NO_STDIO +#include +#include +#include +#endif + +#include "bzlib.h" + + + +/*-- General stuff. --*/ + +#define BZ_VERSION "1.0.1, 23-June-2000" + +typedef char Char; +typedef unsigned char Bool; +typedef unsigned char UChar; +typedef int Int32; +typedef unsigned int UInt32; +typedef short Int16; +typedef unsigned short UInt16; + +#define True ((Bool)1) +#define False ((Bool)0) + +#ifndef __GNUC__ +#define __inline__ /* */ +#endif + +#ifndef BZ_NO_STDIO +extern void BZ2_bz__AssertH__fail ( int errcode ); +#define AssertH(cond,errcode) \ + { if (!(cond)) BZ2_bz__AssertH__fail ( errcode ); } +#if BZ_DEBUG +#define AssertD(cond,msg) \ + { if (!(cond)) { \ + fprintf ( stderr, \ + "\n\nlibbzip2(debug build): internal error\n\t%s\n", msg );\ + exit(1); \ + }} +#else +#define AssertD(cond,msg) /* */ +#endif +#define VPrintf0(zf) \ + fprintf(stderr,zf) +#define VPrintf1(zf,za1) \ + fprintf(stderr,zf,za1) +#define VPrintf2(zf,za1,za2) \ + fprintf(stderr,zf,za1,za2) +#define VPrintf3(zf,za1,za2,za3) \ + fprintf(stderr,zf,za1,za2,za3) +#define VPrintf4(zf,za1,za2,za3,za4) \ + fprintf(stderr,zf,za1,za2,za3,za4) +#define VPrintf5(zf,za1,za2,za3,za4,za5) \ + fprintf(stderr,zf,za1,za2,za3,za4,za5) +#else +extern void bz_internal_error ( int errcode ); +#define AssertH(cond,errcode) \ + { if (!(cond)) bz_internal_error ( errcode ); } +#define AssertD(cond,msg) /* */ +#define VPrintf0(zf) /* */ +#define VPrintf1(zf,za1) /* */ +#define VPrintf2(zf,za1,za2) /* */ +#define VPrintf3(zf,za1,za2,za3) /* */ +#define VPrintf4(zf,za1,za2,za3,za4) /* */ +#define VPrintf5(zf,za1,za2,za3,za4,za5) /* */ +#endif + + +#define BZALLOC(nnn) (strm->bzalloc)(strm->opaque,(nnn),1) +#define BZFREE(ppp) (strm->bzfree)(strm->opaque,(ppp)) + + +/*-- Constants for the back end. --*/ + +#define BZ_MAX_ALPHA_SIZE 258 +#define BZ_MAX_CODE_LEN 23 + +#define BZ_RUNA 0 +#define BZ_RUNB 1 + +#define BZ_N_GROUPS 6 +#define BZ_G_SIZE 50 +#define BZ_N_ITERS 4 + +#define BZ_MAX_SELECTORS (2 + (900000 / BZ_G_SIZE)) + + + +/*-- Stuff for randomising repetitive blocks. --*/ + +extern Int32 BZ2_rNums[512]; + +#define BZ_RAND_DECLS \ + Int32 rNToGo; \ + Int32 rTPos \ + +#define BZ_RAND_INIT_MASK \ + s->rNToGo = 0; \ + s->rTPos = 0 \ + +#define BZ_RAND_MASK ((s->rNToGo == 1) ? 1 : 0) + +#define BZ_RAND_UPD_MASK \ + if (s->rNToGo == 0) { \ + s->rNToGo = BZ2_rNums[s->rTPos]; \ + s->rTPos++; \ + if (s->rTPos == 512) s->rTPos = 0; \ + } \ + s->rNToGo--; + + + +/*-- Stuff for doing CRCs. --*/ + +extern UInt32 BZ2_crc32Table[256]; + +#define BZ_INITIALISE_CRC(crcVar) \ +{ \ + crcVar = 0xffffffffL; \ +} + +#define BZ_FINALISE_CRC(crcVar) \ +{ \ + crcVar = ~(crcVar); \ +} + +#define BZ_UPDATE_CRC(crcVar,cha) \ +{ \ + crcVar = (crcVar << 8) ^ \ + BZ2_crc32Table[(crcVar >> 24) ^ \ + ((UChar)cha)]; \ +} + + + +/*-- States and modes for compression. --*/ + +#define BZ_M_IDLE 1 +#define BZ_M_RUNNING 2 +#define BZ_M_FLUSHING 3 +#define BZ_M_FINISHING 4 + +#define BZ_S_OUTPUT 1 +#define BZ_S_INPUT 2 + +#define BZ_N_RADIX 2 +#define BZ_N_QSORT 12 +#define BZ_N_SHELL 18 +#define BZ_N_OVERSHOOT (BZ_N_RADIX + BZ_N_QSORT + BZ_N_SHELL + 2) + + + + +/*-- Structure holding all the compression-side stuff. --*/ + +typedef + struct { + /* pointer back to the struct bz_stream */ + bz_stream* strm; + + /* mode this stream is in, and whether inputting */ + /* or outputting data */ + Int32 mode; + Int32 state; + + /* remembers avail_in when flush/finish requested */ + UInt32 avail_in_expect; + + /* for doing the block sorting */ + UInt32* arr1; + UInt32* arr2; + UInt32* ftab; + Int32 origPtr; + + /* aliases for arr1 and arr2 */ + UInt32* ptr; + UChar* block; + UInt16* mtfv; + UChar* zbits; + + /* for deciding when to use the fallback sorting algorithm */ + Int32 workFactor; + + /* run-length-encoding of the input */ + UInt32 state_in_ch; + Int32 state_in_len; + BZ_RAND_DECLS; + + /* input and output limits and current posns */ + Int32 nblock; + Int32 nblockMAX; + Int32 numZ; + Int32 state_out_pos; + + /* map of bytes used in block */ + Int32 nInUse; + Bool inUse[256]; + UChar unseqToSeq[256]; + + /* the buffer for bit stream creation */ + UInt32 bsBuff; + Int32 bsLive; + + /* block and combined CRCs */ + UInt32 blockCRC; + UInt32 combinedCRC; + + /* misc administratium */ + Int32 verbosity; + Int32 blockNo; + Int32 blockSize100k; + + /* stuff for coding the MTF values */ + Int32 nMTF; + Int32 mtfFreq [BZ_MAX_ALPHA_SIZE]; + UChar selector [BZ_MAX_SELECTORS]; + UChar selectorMtf[BZ_MAX_SELECTORS]; + + UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 code [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 rfreq [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + /* second dimension: only 3 needed; 4 makes index calculations faster */ + UInt32 len_pack[BZ_MAX_ALPHA_SIZE][4]; + + } + EState; + + + +/*-- externs for compression. --*/ + +extern void +BZ2_blockSort ( EState* ); + +extern void +BZ2_compressBlock ( EState*, Bool ); + +extern void +BZ2_bsInitWrite ( EState* ); + +extern void +BZ2_hbAssignCodes ( Int32*, UChar*, Int32, Int32, Int32 ); + +extern void +BZ2_hbMakeCodeLengths ( UChar*, Int32*, Int32, Int32 ); + + + +/*-- states for decompression. --*/ + +#define BZ_X_IDLE 1 +#define BZ_X_OUTPUT 2 + +#define BZ_X_MAGIC_1 10 +#define BZ_X_MAGIC_2 11 +#define BZ_X_MAGIC_3 12 +#define BZ_X_MAGIC_4 13 +#define BZ_X_BLKHDR_1 14 +#define BZ_X_BLKHDR_2 15 +#define BZ_X_BLKHDR_3 16 +#define BZ_X_BLKHDR_4 17 +#define BZ_X_BLKHDR_5 18 +#define BZ_X_BLKHDR_6 19 +#define BZ_X_BCRC_1 20 +#define BZ_X_BCRC_2 21 +#define BZ_X_BCRC_3 22 +#define BZ_X_BCRC_4 23 +#define BZ_X_RANDBIT 24 +#define BZ_X_ORIGPTR_1 25 +#define BZ_X_ORIGPTR_2 26 +#define BZ_X_ORIGPTR_3 27 +#define BZ_X_MAPPING_1 28 +#define BZ_X_MAPPING_2 29 +#define BZ_X_SELECTOR_1 30 +#define BZ_X_SELECTOR_2 31 +#define BZ_X_SELECTOR_3 32 +#define BZ_X_CODING_1 33 +#define BZ_X_CODING_2 34 +#define BZ_X_CODING_3 35 +#define BZ_X_MTF_1 36 +#define BZ_X_MTF_2 37 +#define BZ_X_MTF_3 38 +#define BZ_X_MTF_4 39 +#define BZ_X_MTF_5 40 +#define BZ_X_MTF_6 41 +#define BZ_X_ENDHDR_2 42 +#define BZ_X_ENDHDR_3 43 +#define BZ_X_ENDHDR_4 44 +#define BZ_X_ENDHDR_5 45 +#define BZ_X_ENDHDR_6 46 +#define BZ_X_CCRC_1 47 +#define BZ_X_CCRC_2 48 +#define BZ_X_CCRC_3 49 +#define BZ_X_CCRC_4 50 + + + +/*-- Constants for the fast MTF decoder. --*/ + +#define MTFA_SIZE 4096 +#define MTFL_SIZE 16 + + + +/*-- Structure holding all the decompression-side stuff. --*/ + +typedef + struct { + /* pointer back to the struct bz_stream */ + bz_stream* strm; + + /* state indicator for this stream */ + Int32 state; + + /* for doing the final run-length decoding */ + UChar state_out_ch; + Int32 state_out_len; + Bool blockRandomised; + BZ_RAND_DECLS; + + /* the buffer for bit stream reading */ + UInt32 bsBuff; + Int32 bsLive; + + /* misc administratium */ + Int32 blockSize100k; + Bool smallDecompress; + Int32 currBlockNo; + Int32 verbosity; + + /* for undoing the Burrows-Wheeler transform */ + Int32 origPtr; + UInt32 tPos; + Int32 k0; + Int32 unzftab[256]; + Int32 nblock_used; + Int32 cftab[257]; + Int32 cftabCopy[257]; + + /* for undoing the Burrows-Wheeler transform (FAST) */ + UInt32 *tt; + + /* for undoing the Burrows-Wheeler transform (SMALL) */ + UInt16 *ll16; + UChar *ll4; + + /* stored and calculated CRCs */ + UInt32 storedBlockCRC; + UInt32 storedCombinedCRC; + UInt32 calculatedBlockCRC; + UInt32 calculatedCombinedCRC; + + /* map of bytes used in block */ + Int32 nInUse; + Bool inUse[256]; + Bool inUse16[16]; + UChar seqToUnseq[256]; + + /* for decoding the MTF values */ + UChar mtfa [MTFA_SIZE]; + Int32 mtfbase[256 / MTFL_SIZE]; + UChar selector [BZ_MAX_SELECTORS]; + UChar selectorMtf[BZ_MAX_SELECTORS]; + UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + + Int32 limit [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 base [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 perm [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 minLens[BZ_N_GROUPS]; + + /* save area for scalars in the main decompress code */ + Int32 save_i; + Int32 save_j; + Int32 save_t; + Int32 save_alphaSize; + Int32 save_nGroups; + Int32 save_nSelectors; + Int32 save_EOB; + Int32 save_groupNo; + Int32 save_groupPos; + Int32 save_nextSym; + Int32 save_nblockMAX; + Int32 save_nblock; + Int32 save_es; + Int32 save_N; + Int32 save_curr; + Int32 save_zt; + Int32 save_zn; + Int32 save_zvec; + Int32 save_zj; + Int32 save_gSel; + Int32 save_gMinlen; + Int32* save_gLimit; + Int32* save_gBase; + Int32* save_gPerm; + + } + DState; + + + +/*-- Macros for decompression. --*/ + +#define BZ_GET_FAST(cccc) \ + s->tPos = s->tt[s->tPos]; \ + cccc = (UChar)(s->tPos & 0xff); \ + s->tPos >>= 8; + +#define BZ_GET_FAST_C(cccc) \ + c_tPos = c_tt[c_tPos]; \ + cccc = (UChar)(c_tPos & 0xff); \ + c_tPos >>= 8; + +#define SET_LL4(i,n) \ + { if (((i) & 0x1) == 0) \ + s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0xf0) | (n); else \ + s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0x0f) | ((n) << 4); \ + } + +#define GET_LL4(i) \ + ((((UInt32)(s->ll4[(i) >> 1])) >> (((i) << 2) & 0x4)) & 0xF) + +#define SET_LL(i,n) \ + { s->ll16[i] = (UInt16)(n & 0x0000ffff); \ + SET_LL4(i, n >> 16); \ + } + +#define GET_LL(i) \ + (((UInt32)s->ll16[i]) | (GET_LL4(i) << 16)) + +#define BZ_GET_SMALL(cccc) \ + cccc = BZ2_indexIntoF ( s->tPos, s->cftab ); \ + s->tPos = GET_LL(s->tPos); + + +/*-- externs for decompression. --*/ + +extern Int32 +BZ2_indexIntoF ( Int32, Int32* ); + +extern Int32 +BZ2_decompress ( DState* ); + +extern void +BZ2_hbCreateDecodeTables ( Int32*, Int32*, Int32*, UChar*, + Int32, Int32, Int32 ); + + +#endif + + +/*-- BZ_NO_STDIO seems to make NULL disappear on some platforms. --*/ + +#ifdef BZ_NO_STDIO +#ifndef NULL +#define NULL 0 +#endif +#endif + + +/*-------------------------------------------------------------*/ +/*--- end bzlib_private.h ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/compress.c b/bzip2/compress.c new file mode 100644 index 0000000..cc5e31d --- /dev/null +++ b/bzip2/compress.c @@ -0,0 +1,714 @@ + +/*-------------------------------------------------------------*/ +/*--- Compression machinery (not incl block sorting) ---*/ +/*--- compress.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + +/*-- + CHANGES + ~~~~~~~ + 0.9.0 -- original version. + + 0.9.0a/b -- no changes in this file. + + 0.9.0c + * changed setting of nGroups in sendMTFValues() so as to + do a bit better on small files +--*/ + +#include "bzlib_private.h" + + +/*---------------------------------------------------*/ +/*--- Bit stream I/O ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +void BZ2_bsInitWrite ( EState* s ) +{ + s->bsLive = 0; + s->bsBuff = 0; +} + + +/*---------------------------------------------------*/ +static +void bsFinishWrite ( EState* s ) +{ + while (s->bsLive > 0) { + s->zbits[s->numZ] = (UChar)(s->bsBuff >> 24); + s->numZ++; + s->bsBuff <<= 8; + s->bsLive -= 8; + } +} + + +/*---------------------------------------------------*/ +#define bsNEEDW(nz) \ +{ \ + while (s->bsLive >= 8) { \ + s->zbits[s->numZ] \ + = (UChar)(s->bsBuff >> 24); \ + s->numZ++; \ + s->bsBuff <<= 8; \ + s->bsLive -= 8; \ + } \ +} + + +/*---------------------------------------------------*/ +static +__inline__ +void bsW ( EState* s, Int32 n, UInt32 v ) +{ + bsNEEDW ( n ); + s->bsBuff |= (v << (32 - s->bsLive - n)); + s->bsLive += n; +} + + +/*---------------------------------------------------*/ +static +void bsPutUInt32 ( EState* s, UInt32 u ) +{ + bsW ( s, 8, (u >> 24) & 0xffL ); + bsW ( s, 8, (u >> 16) & 0xffL ); + bsW ( s, 8, (u >> 8) & 0xffL ); + bsW ( s, 8, u & 0xffL ); +} + + +/*---------------------------------------------------*/ +static +void bsPutUChar ( EState* s, UChar c ) +{ + bsW( s, 8, (UInt32)c ); +} + + +/*---------------------------------------------------*/ +/*--- The back end proper ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +static +void makeMaps_e ( EState* s ) +{ + Int32 i; + s->nInUse = 0; + for (i = 0; i < 256; i++) + if (s->inUse[i]) { + s->unseqToSeq[i] = s->nInUse; + s->nInUse++; + } +} + + +/*---------------------------------------------------*/ +static +void generateMTFValues ( EState* s ) +{ + UChar yy[256]; + Int32 i, j; + Int32 zPend; + Int32 wr; + Int32 EOB; + + /* + After sorting (eg, here), + s->arr1 [ 0 .. s->nblock-1 ] holds sorted order, + and + ((UChar*)s->arr2) [ 0 .. s->nblock-1 ] + holds the original block data. + + The first thing to do is generate the MTF values, + and put them in + ((UInt16*)s->arr1) [ 0 .. s->nblock-1 ]. + Because there are strictly fewer or equal MTF values + than block values, ptr values in this area are overwritten + with MTF values only when they are no longer needed. + + The final compressed bitstream is generated into the + area starting at + (UChar*) (&((UChar*)s->arr2)[s->nblock]) + + These storage aliases are set up in bzCompressInit(), + except for the last one, which is arranged in + compressBlock(). + */ + UInt32* ptr = s->ptr; + UChar* block = s->block; + UInt16* mtfv = s->mtfv; + + makeMaps_e ( s ); + EOB = s->nInUse+1; + + for (i = 0; i <= EOB; i++) s->mtfFreq[i] = 0; + + wr = 0; + zPend = 0; + for (i = 0; i < s->nInUse; i++) yy[i] = (UChar) i; + + for (i = 0; i < s->nblock; i++) { + UChar ll_i; + AssertD ( wr <= i, "generateMTFValues(1)" ); + j = ptr[i]-1; if (j < 0) j += s->nblock; + ll_i = s->unseqToSeq[block[j]]; + AssertD ( ll_i < s->nInUse, "generateMTFValues(2a)" ); + + if (yy[0] == ll_i) { + zPend++; + } else { + + if (zPend > 0) { + zPend--; + while (True) { + if (zPend & 1) { + mtfv[wr] = BZ_RUNB; wr++; + s->mtfFreq[BZ_RUNB]++; + } else { + mtfv[wr] = BZ_RUNA; wr++; + s->mtfFreq[BZ_RUNA]++; + } + if (zPend < 2) break; + zPend = (zPend - 2) / 2; + }; + zPend = 0; + } + { + register UChar rtmp; + register UChar* ryy_j; + register UChar rll_i; + rtmp = yy[1]; + yy[1] = yy[0]; + ryy_j = &(yy[1]); + rll_i = ll_i; + while ( rll_i != rtmp ) { + register UChar rtmp2; + ryy_j++; + rtmp2 = rtmp; + rtmp = *ryy_j; + *ryy_j = rtmp2; + }; + yy[0] = rtmp; + j = ryy_j - &(yy[0]); + mtfv[wr] = j+1; wr++; s->mtfFreq[j+1]++; + } + + } + } + + if (zPend > 0) { + zPend--; + while (True) { + if (zPend & 1) { + mtfv[wr] = BZ_RUNB; wr++; + s->mtfFreq[BZ_RUNB]++; + } else { + mtfv[wr] = BZ_RUNA; wr++; + s->mtfFreq[BZ_RUNA]++; + } + if (zPend < 2) break; + zPend = (zPend - 2) / 2; + }; + zPend = 0; + } + + mtfv[wr] = EOB; wr++; s->mtfFreq[EOB]++; + + s->nMTF = wr; +} + + +/*---------------------------------------------------*/ +#define BZ_LESSER_ICOST 0 +#define BZ_GREATER_ICOST 15 + +static +void sendMTFValues ( EState* s ) +{ + Int32 v, t, i, j, gs, ge, totc, bt, bc, iter; + Int32 nSelectors, alphaSize, minLen, maxLen, selCtr; + Int32 nGroups, nBytes; + + /*-- + UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + is a global since the decoder also needs it. + + Int32 code[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 rfreq[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + are also globals only used in this proc. + Made global to keep stack frame size small. + --*/ + + + UInt16 cost[BZ_N_GROUPS]; + Int32 fave[BZ_N_GROUPS]; + + UInt16* mtfv = s->mtfv; + + if (s->verbosity >= 3) + VPrintf3( " %d in block, %d after MTF & 1-2 coding, " + "%d+2 syms in use\n", + s->nblock, s->nMTF, s->nInUse ); + + alphaSize = s->nInUse+2; + for (t = 0; t < BZ_N_GROUPS; t++) + for (v = 0; v < alphaSize; v++) + s->len[t][v] = BZ_GREATER_ICOST; + + /*--- Decide how many coding tables to use ---*/ + AssertH ( s->nMTF > 0, 3001 ); + if (s->nMTF < 200) nGroups = 2; else + if (s->nMTF < 600) nGroups = 3; else + if (s->nMTF < 1200) nGroups = 4; else + if (s->nMTF < 2400) nGroups = 5; else + nGroups = 6; + + /*--- Generate an initial set of coding tables ---*/ + { + Int32 nPart, remF, tFreq, aFreq; + + nPart = nGroups; + remF = s->nMTF; + gs = 0; + while (nPart > 0) { + tFreq = remF / nPart; + ge = gs-1; + aFreq = 0; + while (aFreq < tFreq && ge < alphaSize-1) { + ge++; + aFreq += s->mtfFreq[ge]; + } + + if (ge > gs + && nPart != nGroups && nPart != 1 + && ((nGroups-nPart) % 2 == 1)) { + aFreq -= s->mtfFreq[ge]; + ge--; + } + + if (s->verbosity >= 3) + VPrintf5( " initial group %d, [%d .. %d], " + "has %d syms (%4.1f%%)\n", + nPart, gs, ge, aFreq, + (100.0 * (float)aFreq) / (float)(s->nMTF) ); + + for (v = 0; v < alphaSize; v++) + if (v >= gs && v <= ge) + s->len[nPart-1][v] = BZ_LESSER_ICOST; else + s->len[nPart-1][v] = BZ_GREATER_ICOST; + + nPart--; + gs = ge+1; + remF -= aFreq; + } + } + + /*--- + Iterate up to BZ_N_ITERS times to improve the tables. + ---*/ + for (iter = 0; iter < BZ_N_ITERS; iter++) { + + for (t = 0; t < nGroups; t++) fave[t] = 0; + + for (t = 0; t < nGroups; t++) + for (v = 0; v < alphaSize; v++) + s->rfreq[t][v] = 0; + + /*--- + Set up an auxiliary length table which is used to fast-track + the common case (nGroups == 6). + ---*/ + if (nGroups == 6) { + for (v = 0; v < alphaSize; v++) { + s->len_pack[v][0] = (s->len[1][v] << 16) | s->len[0][v]; + s->len_pack[v][1] = (s->len[3][v] << 16) | s->len[2][v]; + s->len_pack[v][2] = (s->len[5][v] << 16) | s->len[4][v]; + } + } + + nSelectors = 0; + totc = 0; + gs = 0; + while (True) { + + /*--- Set group start & end marks. --*/ + if (gs >= s->nMTF) break; + ge = gs + BZ_G_SIZE - 1; + if (ge >= s->nMTF) ge = s->nMTF-1; + + /*-- + Calculate the cost of this group as coded + by each of the coding tables. + --*/ + for (t = 0; t < nGroups; t++) cost[t] = 0; + + if (nGroups == 6 && 50 == ge-gs+1) { + /*--- fast track the common case ---*/ + register UInt32 cost01, cost23, cost45; + register UInt16 icv; + cost01 = cost23 = cost45 = 0; + +# define BZ_ITER(nn) \ + icv = mtfv[gs+(nn)]; \ + cost01 += s->len_pack[icv][0]; \ + cost23 += s->len_pack[icv][1]; \ + cost45 += s->len_pack[icv][2]; \ + + BZ_ITER(0); BZ_ITER(1); BZ_ITER(2); BZ_ITER(3); BZ_ITER(4); + BZ_ITER(5); BZ_ITER(6); BZ_ITER(7); BZ_ITER(8); BZ_ITER(9); + BZ_ITER(10); BZ_ITER(11); BZ_ITER(12); BZ_ITER(13); BZ_ITER(14); + BZ_ITER(15); BZ_ITER(16); BZ_ITER(17); BZ_ITER(18); BZ_ITER(19); + BZ_ITER(20); BZ_ITER(21); BZ_ITER(22); BZ_ITER(23); BZ_ITER(24); + BZ_ITER(25); BZ_ITER(26); BZ_ITER(27); BZ_ITER(28); BZ_ITER(29); + BZ_ITER(30); BZ_ITER(31); BZ_ITER(32); BZ_ITER(33); BZ_ITER(34); + BZ_ITER(35); BZ_ITER(36); BZ_ITER(37); BZ_ITER(38); BZ_ITER(39); + BZ_ITER(40); BZ_ITER(41); BZ_ITER(42); BZ_ITER(43); BZ_ITER(44); + BZ_ITER(45); BZ_ITER(46); BZ_ITER(47); BZ_ITER(48); BZ_ITER(49); + +# undef BZ_ITER + + cost[0] = cost01 & 0xffff; cost[1] = cost01 >> 16; + cost[2] = cost23 & 0xffff; cost[3] = cost23 >> 16; + cost[4] = cost45 & 0xffff; cost[5] = cost45 >> 16; + + } else { + /*--- slow version which correctly handles all situations ---*/ + for (i = gs; i <= ge; i++) { + UInt16 icv = mtfv[i]; + for (t = 0; t < nGroups; t++) cost[t] += s->len[t][icv]; + } + } + + /*-- + Find the coding table which is best for this group, + and record its identity in the selector table. + --*/ + bc = 999999999; bt = -1; + for (t = 0; t < nGroups; t++) + if (cost[t] < bc) { bc = cost[t]; bt = t; }; + totc += bc; + fave[bt]++; + s->selector[nSelectors] = bt; + nSelectors++; + + /*-- + Increment the symbol frequencies for the selected table. + --*/ + if (nGroups == 6 && 50 == ge-gs+1) { + /*--- fast track the common case ---*/ + +# define BZ_ITUR(nn) s->rfreq[bt][ mtfv[gs+(nn)] ]++ + + BZ_ITUR(0); BZ_ITUR(1); BZ_ITUR(2); BZ_ITUR(3); BZ_ITUR(4); + BZ_ITUR(5); BZ_ITUR(6); BZ_ITUR(7); BZ_ITUR(8); BZ_ITUR(9); + BZ_ITUR(10); BZ_ITUR(11); BZ_ITUR(12); BZ_ITUR(13); BZ_ITUR(14); + BZ_ITUR(15); BZ_ITUR(16); BZ_ITUR(17); BZ_ITUR(18); BZ_ITUR(19); + BZ_ITUR(20); BZ_ITUR(21); BZ_ITUR(22); BZ_ITUR(23); BZ_ITUR(24); + BZ_ITUR(25); BZ_ITUR(26); BZ_ITUR(27); BZ_ITUR(28); BZ_ITUR(29); + BZ_ITUR(30); BZ_ITUR(31); BZ_ITUR(32); BZ_ITUR(33); BZ_ITUR(34); + BZ_ITUR(35); BZ_ITUR(36); BZ_ITUR(37); BZ_ITUR(38); BZ_ITUR(39); + BZ_ITUR(40); BZ_ITUR(41); BZ_ITUR(42); BZ_ITUR(43); BZ_ITUR(44); + BZ_ITUR(45); BZ_ITUR(46); BZ_ITUR(47); BZ_ITUR(48); BZ_ITUR(49); + +# undef BZ_ITUR + + } else { + /*--- slow version which correctly handles all situations ---*/ + for (i = gs; i <= ge; i++) + s->rfreq[bt][ mtfv[i] ]++; + } + + gs = ge+1; + } + if (s->verbosity >= 3) { + VPrintf2 ( " pass %d: size is %d, grp uses are ", + iter+1, totc/8 ); + for (t = 0; t < nGroups; t++) + VPrintf1 ( "%d ", fave[t] ); + VPrintf0 ( "\n" ); + } + + /*-- + Recompute the tables based on the accumulated frequencies. + --*/ + for (t = 0; t < nGroups; t++) + BZ2_hbMakeCodeLengths ( &(s->len[t][0]), &(s->rfreq[t][0]), + alphaSize, 20 ); + } + + + AssertH( nGroups < 8, 3002 ); + AssertH( nSelectors < 32768 && + nSelectors <= (2 + (900000 / BZ_G_SIZE)), + 3003 ); + + + /*--- Compute MTF values for the selectors. ---*/ + { + UChar pos[BZ_N_GROUPS], ll_i, tmp2, tmp; + for (i = 0; i < nGroups; i++) pos[i] = i; + for (i = 0; i < nSelectors; i++) { + ll_i = s->selector[i]; + j = 0; + tmp = pos[j]; + while ( ll_i != tmp ) { + j++; + tmp2 = tmp; + tmp = pos[j]; + pos[j] = tmp2; + }; + pos[0] = tmp; + s->selectorMtf[i] = j; + } + }; + + /*--- Assign actual codes for the tables. --*/ + for (t = 0; t < nGroups; t++) { + minLen = 32; + maxLen = 0; + for (i = 0; i < alphaSize; i++) { + if (s->len[t][i] > maxLen) maxLen = s->len[t][i]; + if (s->len[t][i] < minLen) minLen = s->len[t][i]; + } + AssertH ( !(maxLen > 20), 3004 ); + AssertH ( !(minLen < 1), 3005 ); + BZ2_hbAssignCodes ( &(s->code[t][0]), &(s->len[t][0]), + minLen, maxLen, alphaSize ); + } + + /*--- Transmit the mapping table. ---*/ + { + Bool inUse16[16]; + for (i = 0; i < 16; i++) { + inUse16[i] = False; + for (j = 0; j < 16; j++) + if (s->inUse[i * 16 + j]) inUse16[i] = True; + } + + nBytes = s->numZ; + for (i = 0; i < 16; i++) + if (inUse16[i]) bsW(s,1,1); else bsW(s,1,0); + + for (i = 0; i < 16; i++) + if (inUse16[i]) + for (j = 0; j < 16; j++) { + if (s->inUse[i * 16 + j]) bsW(s,1,1); else bsW(s,1,0); + } + + if (s->verbosity >= 3) + VPrintf1( " bytes: mapping %d, ", s->numZ-nBytes ); + } + + /*--- Now the selectors. ---*/ + nBytes = s->numZ; + bsW ( s, 3, nGroups ); + bsW ( s, 15, nSelectors ); + for (i = 0; i < nSelectors; i++) { + for (j = 0; j < s->selectorMtf[i]; j++) bsW(s,1,1); + bsW(s,1,0); + } + if (s->verbosity >= 3) + VPrintf1( "selectors %d, ", s->numZ-nBytes ); + + /*--- Now the coding tables. ---*/ + nBytes = s->numZ; + + for (t = 0; t < nGroups; t++) { + Int32 curr = s->len[t][0]; + bsW ( s, 5, curr ); + for (i = 0; i < alphaSize; i++) { + while (curr < s->len[t][i]) { bsW(s,2,2); curr++; /* 10 */ }; + while (curr > s->len[t][i]) { bsW(s,2,3); curr--; /* 11 */ }; + bsW ( s, 1, 0 ); + } + } + + if (s->verbosity >= 3) + VPrintf1 ( "code lengths %d, ", s->numZ-nBytes ); + + /*--- And finally, the block data proper ---*/ + nBytes = s->numZ; + selCtr = 0; + gs = 0; + while (True) { + if (gs >= s->nMTF) break; + ge = gs + BZ_G_SIZE - 1; + if (ge >= s->nMTF) ge = s->nMTF-1; + AssertH ( s->selector[selCtr] < nGroups, 3006 ); + + if (nGroups == 6 && 50 == ge-gs+1) { + /*--- fast track the common case ---*/ + UInt16 mtfv_i; + UChar* s_len_sel_selCtr + = &(s->len[s->selector[selCtr]][0]); + Int32* s_code_sel_selCtr + = &(s->code[s->selector[selCtr]][0]); + +# define BZ_ITAH(nn) \ + mtfv_i = mtfv[gs+(nn)]; \ + bsW ( s, \ + s_len_sel_selCtr[mtfv_i], \ + s_code_sel_selCtr[mtfv_i] ) + + BZ_ITAH(0); BZ_ITAH(1); BZ_ITAH(2); BZ_ITAH(3); BZ_ITAH(4); + BZ_ITAH(5); BZ_ITAH(6); BZ_ITAH(7); BZ_ITAH(8); BZ_ITAH(9); + BZ_ITAH(10); BZ_ITAH(11); BZ_ITAH(12); BZ_ITAH(13); BZ_ITAH(14); + BZ_ITAH(15); BZ_ITAH(16); BZ_ITAH(17); BZ_ITAH(18); BZ_ITAH(19); + BZ_ITAH(20); BZ_ITAH(21); BZ_ITAH(22); BZ_ITAH(23); BZ_ITAH(24); + BZ_ITAH(25); BZ_ITAH(26); BZ_ITAH(27); BZ_ITAH(28); BZ_ITAH(29); + BZ_ITAH(30); BZ_ITAH(31); BZ_ITAH(32); BZ_ITAH(33); BZ_ITAH(34); + BZ_ITAH(35); BZ_ITAH(36); BZ_ITAH(37); BZ_ITAH(38); BZ_ITAH(39); + BZ_ITAH(40); BZ_ITAH(41); BZ_ITAH(42); BZ_ITAH(43); BZ_ITAH(44); + BZ_ITAH(45); BZ_ITAH(46); BZ_ITAH(47); BZ_ITAH(48); BZ_ITAH(49); + +# undef BZ_ITAH + + } else { + /*--- slow version which correctly handles all situations ---*/ + for (i = gs; i <= ge; i++) { + bsW ( s, + s->len [s->selector[selCtr]] [mtfv[i]], + s->code [s->selector[selCtr]] [mtfv[i]] ); + } + } + + + gs = ge+1; + selCtr++; + } + AssertH( selCtr == nSelectors, 3007 ); + + if (s->verbosity >= 3) + VPrintf1( "codes %d\n", s->numZ-nBytes ); +} + + +/*---------------------------------------------------*/ +void BZ2_compressBlock ( EState* s, Bool is_last_block ) +{ + if (s->nblock > 0) { + + BZ_FINALISE_CRC ( s->blockCRC ); + s->combinedCRC = (s->combinedCRC << 1) | (s->combinedCRC >> 31); + s->combinedCRC ^= s->blockCRC; + if (s->blockNo > 1) s->numZ = 0; + + if (s->verbosity >= 2) + VPrintf4( " block %d: crc = 0x%8x, " + "combined CRC = 0x%8x, size = %d\n", + s->blockNo, s->blockCRC, s->combinedCRC, s->nblock ); + + BZ2_blockSort ( s ); + } + + s->zbits = (UChar*) (&((UChar*)s->arr2)[s->nblock]); + + /*-- If this is the first block, create the stream header. --*/ + if (s->blockNo == 1) { + BZ2_bsInitWrite ( s ); + bsPutUChar ( s, 'B' ); + bsPutUChar ( s, 'Z' ); + bsPutUChar ( s, 'h' ); + bsPutUChar ( s, (UChar)('0' + s->blockSize100k) ); + } + + if (s->nblock > 0) { + + bsPutUChar ( s, 0x31 ); bsPutUChar ( s, 0x41 ); + bsPutUChar ( s, 0x59 ); bsPutUChar ( s, 0x26 ); + bsPutUChar ( s, 0x53 ); bsPutUChar ( s, 0x59 ); + + /*-- Now the block's CRC, so it is in a known place. --*/ + bsPutUInt32 ( s, s->blockCRC ); + + /*-- + Now a single bit indicating (non-)randomisation. + As of version 0.9.5, we use a better sorting algorithm + which makes randomisation unnecessary. So always set + the randomised bit to 'no'. Of course, the decoder + still needs to be able to handle randomised blocks + so as to maintain backwards compatibility with + older versions of bzip2. + --*/ + bsW(s,1,0); + + bsW ( s, 24, s->origPtr ); + generateMTFValues ( s ); + sendMTFValues ( s ); + } + + + /*-- If this is the last block, add the stream trailer. --*/ + if (is_last_block) { + + bsPutUChar ( s, 0x17 ); bsPutUChar ( s, 0x72 ); + bsPutUChar ( s, 0x45 ); bsPutUChar ( s, 0x38 ); + bsPutUChar ( s, 0x50 ); bsPutUChar ( s, 0x90 ); + bsPutUInt32 ( s, s->combinedCRC ); + if (s->verbosity >= 2) + VPrintf1( " final combined CRC = 0x%x\n ", s->combinedCRC ); + bsFinishWrite ( s ); + } +} + + +/*-------------------------------------------------------------*/ +/*--- end compress.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/crctable.c b/bzip2/crctable.c new file mode 100644 index 0000000..61c040c --- /dev/null +++ b/bzip2/crctable.c @@ -0,0 +1,144 @@ + +/*-------------------------------------------------------------*/ +/*--- Table for doing CRCs ---*/ +/*--- crctable.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + +/*-- + I think this is an implementation of the AUTODIN-II, + Ethernet & FDDI 32-bit CRC standard. Vaguely derived + from code by Rob Warnock, in Section 51 of the + comp.compression FAQ. +--*/ + +UInt32 BZ2_crc32Table[256] = { + + /*-- Ugly, innit? --*/ + + 0x00000000L, 0x04c11db7L, 0x09823b6eL, 0x0d4326d9L, + 0x130476dcL, 0x17c56b6bL, 0x1a864db2L, 0x1e475005L, + 0x2608edb8L, 0x22c9f00fL, 0x2f8ad6d6L, 0x2b4bcb61L, + 0x350c9b64L, 0x31cd86d3L, 0x3c8ea00aL, 0x384fbdbdL, + 0x4c11db70L, 0x48d0c6c7L, 0x4593e01eL, 0x4152fda9L, + 0x5f15adacL, 0x5bd4b01bL, 0x569796c2L, 0x52568b75L, + 0x6a1936c8L, 0x6ed82b7fL, 0x639b0da6L, 0x675a1011L, + 0x791d4014L, 0x7ddc5da3L, 0x709f7b7aL, 0x745e66cdL, + 0x9823b6e0L, 0x9ce2ab57L, 0x91a18d8eL, 0x95609039L, + 0x8b27c03cL, 0x8fe6dd8bL, 0x82a5fb52L, 0x8664e6e5L, + 0xbe2b5b58L, 0xbaea46efL, 0xb7a96036L, 0xb3687d81L, + 0xad2f2d84L, 0xa9ee3033L, 0xa4ad16eaL, 0xa06c0b5dL, + 0xd4326d90L, 0xd0f37027L, 0xddb056feL, 0xd9714b49L, + 0xc7361b4cL, 0xc3f706fbL, 0xceb42022L, 0xca753d95L, + 0xf23a8028L, 0xf6fb9d9fL, 0xfbb8bb46L, 0xff79a6f1L, + 0xe13ef6f4L, 0xe5ffeb43L, 0xe8bccd9aL, 0xec7dd02dL, + 0x34867077L, 0x30476dc0L, 0x3d044b19L, 0x39c556aeL, + 0x278206abL, 0x23431b1cL, 0x2e003dc5L, 0x2ac12072L, + 0x128e9dcfL, 0x164f8078L, 0x1b0ca6a1L, 0x1fcdbb16L, + 0x018aeb13L, 0x054bf6a4L, 0x0808d07dL, 0x0cc9cdcaL, + 0x7897ab07L, 0x7c56b6b0L, 0x71159069L, 0x75d48ddeL, + 0x6b93dddbL, 0x6f52c06cL, 0x6211e6b5L, 0x66d0fb02L, + 0x5e9f46bfL, 0x5a5e5b08L, 0x571d7dd1L, 0x53dc6066L, + 0x4d9b3063L, 0x495a2dd4L, 0x44190b0dL, 0x40d816baL, + 0xaca5c697L, 0xa864db20L, 0xa527fdf9L, 0xa1e6e04eL, + 0xbfa1b04bL, 0xbb60adfcL, 0xb6238b25L, 0xb2e29692L, + 0x8aad2b2fL, 0x8e6c3698L, 0x832f1041L, 0x87ee0df6L, + 0x99a95df3L, 0x9d684044L, 0x902b669dL, 0x94ea7b2aL, + 0xe0b41de7L, 0xe4750050L, 0xe9362689L, 0xedf73b3eL, + 0xf3b06b3bL, 0xf771768cL, 0xfa325055L, 0xfef34de2L, + 0xc6bcf05fL, 0xc27dede8L, 0xcf3ecb31L, 0xcbffd686L, + 0xd5b88683L, 0xd1799b34L, 0xdc3abdedL, 0xd8fba05aL, + 0x690ce0eeL, 0x6dcdfd59L, 0x608edb80L, 0x644fc637L, + 0x7a089632L, 0x7ec98b85L, 0x738aad5cL, 0x774bb0ebL, + 0x4f040d56L, 0x4bc510e1L, 0x46863638L, 0x42472b8fL, + 0x5c007b8aL, 0x58c1663dL, 0x558240e4L, 0x51435d53L, + 0x251d3b9eL, 0x21dc2629L, 0x2c9f00f0L, 0x285e1d47L, + 0x36194d42L, 0x32d850f5L, 0x3f9b762cL, 0x3b5a6b9bL, + 0x0315d626L, 0x07d4cb91L, 0x0a97ed48L, 0x0e56f0ffL, + 0x1011a0faL, 0x14d0bd4dL, 0x19939b94L, 0x1d528623L, + 0xf12f560eL, 0xf5ee4bb9L, 0xf8ad6d60L, 0xfc6c70d7L, + 0xe22b20d2L, 0xe6ea3d65L, 0xeba91bbcL, 0xef68060bL, + 0xd727bbb6L, 0xd3e6a601L, 0xdea580d8L, 0xda649d6fL, + 0xc423cd6aL, 0xc0e2d0ddL, 0xcda1f604L, 0xc960ebb3L, + 0xbd3e8d7eL, 0xb9ff90c9L, 0xb4bcb610L, 0xb07daba7L, + 0xae3afba2L, 0xaafbe615L, 0xa7b8c0ccL, 0xa379dd7bL, + 0x9b3660c6L, 0x9ff77d71L, 0x92b45ba8L, 0x9675461fL, + 0x8832161aL, 0x8cf30badL, 0x81b02d74L, 0x857130c3L, + 0x5d8a9099L, 0x594b8d2eL, 0x5408abf7L, 0x50c9b640L, + 0x4e8ee645L, 0x4a4ffbf2L, 0x470cdd2bL, 0x43cdc09cL, + 0x7b827d21L, 0x7f436096L, 0x7200464fL, 0x76c15bf8L, + 0x68860bfdL, 0x6c47164aL, 0x61043093L, 0x65c52d24L, + 0x119b4be9L, 0x155a565eL, 0x18197087L, 0x1cd86d30L, + 0x029f3d35L, 0x065e2082L, 0x0b1d065bL, 0x0fdc1becL, + 0x3793a651L, 0x3352bbe6L, 0x3e119d3fL, 0x3ad08088L, + 0x2497d08dL, 0x2056cd3aL, 0x2d15ebe3L, 0x29d4f654L, + 0xc5a92679L, 0xc1683bceL, 0xcc2b1d17L, 0xc8ea00a0L, + 0xd6ad50a5L, 0xd26c4d12L, 0xdf2f6bcbL, 0xdbee767cL, + 0xe3a1cbc1L, 0xe760d676L, 0xea23f0afL, 0xeee2ed18L, + 0xf0a5bd1dL, 0xf464a0aaL, 0xf9278673L, 0xfde69bc4L, + 0x89b8fd09L, 0x8d79e0beL, 0x803ac667L, 0x84fbdbd0L, + 0x9abc8bd5L, 0x9e7d9662L, 0x933eb0bbL, 0x97ffad0cL, + 0xafb010b1L, 0xab710d06L, 0xa6322bdfL, 0xa2f33668L, + 0xbcb4666dL, 0xb8757bdaL, 0xb5365d03L, 0xb1f740b4L +}; + + +/*-------------------------------------------------------------*/ +/*--- end crctable.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/decompress.c b/bzip2/decompress.c new file mode 100644 index 0000000..cdced18 --- /dev/null +++ b/bzip2/decompress.c @@ -0,0 +1,660 @@ + +/*-------------------------------------------------------------*/ +/*--- Decompression machinery ---*/ +/*--- decompress.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + + +/*---------------------------------------------------*/ +static +void makeMaps_d ( DState* s ) +{ + Int32 i; + s->nInUse = 0; + for (i = 0; i < 256; i++) + if (s->inUse[i]) { + s->seqToUnseq[s->nInUse] = i; + s->nInUse++; + } +} + + +/*---------------------------------------------------*/ +#define RETURN(rrr) \ + { retVal = rrr; goto save_state_and_return; }; + +#define GET_BITS(lll,vvv,nnn) \ + case lll: s->state = lll; \ + while (True) { \ + if (s->bsLive >= nnn) { \ + UInt32 v; \ + v = (s->bsBuff >> \ + (s->bsLive-nnn)) & ((1 << nnn)-1); \ + s->bsLive -= nnn; \ + vvv = v; \ + break; \ + } \ + if (s->strm->avail_in == 0) RETURN(BZ_OK); \ + s->bsBuff \ + = (s->bsBuff << 8) | \ + ((UInt32) \ + (*((UChar*)(s->strm->next_in)))); \ + s->bsLive += 8; \ + s->strm->next_in++; \ + s->strm->avail_in--; \ + s->strm->total_in_lo32++; \ + if (s->strm->total_in_lo32 == 0) \ + s->strm->total_in_hi32++; \ + } + +#define GET_UCHAR(lll,uuu) \ + GET_BITS(lll,uuu,8) + +#define GET_BIT(lll,uuu) \ + GET_BITS(lll,uuu,1) + +/*---------------------------------------------------*/ +#define GET_MTF_VAL(label1,label2,lval) \ +{ \ + if (groupPos == 0) { \ + groupNo++; \ + if (groupNo >= nSelectors) \ + RETURN(BZ_DATA_ERROR); \ + groupPos = BZ_G_SIZE; \ + gSel = s->selector[groupNo]; \ + gMinlen = s->minLens[gSel]; \ + gLimit = &(s->limit[gSel][0]); \ + gPerm = &(s->perm[gSel][0]); \ + gBase = &(s->base[gSel][0]); \ + } \ + groupPos--; \ + zn = gMinlen; \ + GET_BITS(label1, zvec, zn); \ + while (1) { \ + if (zn > 20 /* the longest code */) \ + RETURN(BZ_DATA_ERROR); \ + if (zvec <= gLimit[zn]) break; \ + zn++; \ + GET_BIT(label2, zj); \ + zvec = (zvec << 1) | zj; \ + }; \ + if (zvec - gBase[zn] < 0 \ + || zvec - gBase[zn] >= BZ_MAX_ALPHA_SIZE) \ + RETURN(BZ_DATA_ERROR); \ + lval = gPerm[zvec - gBase[zn]]; \ +} + + +/*---------------------------------------------------*/ +Int32 BZ2_decompress ( DState* s ) +{ + UChar uc; + Int32 retVal; + Int32 minLen, maxLen; + bz_stream* strm = s->strm; + + /* stuff that needs to be saved/restored */ + Int32 i; + Int32 j; + Int32 t; + Int32 alphaSize; + Int32 nGroups; + Int32 nSelectors; + Int32 EOB; + Int32 groupNo; + Int32 groupPos; + Int32 nextSym; + Int32 nblockMAX; + Int32 nblock; + Int32 es; + Int32 N; + Int32 curr; + Int32 zt; + Int32 zn; + Int32 zvec; + Int32 zj; + Int32 gSel; + Int32 gMinlen; + Int32* gLimit; + Int32* gBase; + Int32* gPerm; + + if (s->state == BZ_X_MAGIC_1) { + /*initialise the save area*/ + s->save_i = 0; + s->save_j = 0; + s->save_t = 0; + s->save_alphaSize = 0; + s->save_nGroups = 0; + s->save_nSelectors = 0; + s->save_EOB = 0; + s->save_groupNo = 0; + s->save_groupPos = 0; + s->save_nextSym = 0; + s->save_nblockMAX = 0; + s->save_nblock = 0; + s->save_es = 0; + s->save_N = 0; + s->save_curr = 0; + s->save_zt = 0; + s->save_zn = 0; + s->save_zvec = 0; + s->save_zj = 0; + s->save_gSel = 0; + s->save_gMinlen = 0; + s->save_gLimit = NULL; + s->save_gBase = NULL; + s->save_gPerm = NULL; + } + + /*restore from the save area*/ + i = s->save_i; + j = s->save_j; + t = s->save_t; + alphaSize = s->save_alphaSize; + nGroups = s->save_nGroups; + nSelectors = s->save_nSelectors; + EOB = s->save_EOB; + groupNo = s->save_groupNo; + groupPos = s->save_groupPos; + nextSym = s->save_nextSym; + nblockMAX = s->save_nblockMAX; + nblock = s->save_nblock; + es = s->save_es; + N = s->save_N; + curr = s->save_curr; + zt = s->save_zt; + zn = s->save_zn; + zvec = s->save_zvec; + zj = s->save_zj; + gSel = s->save_gSel; + gMinlen = s->save_gMinlen; + gLimit = s->save_gLimit; + gBase = s->save_gBase; + gPerm = s->save_gPerm; + + retVal = BZ_OK; + + switch (s->state) { + + GET_UCHAR(BZ_X_MAGIC_1, uc); + if (uc != 'B') RETURN(BZ_DATA_ERROR_MAGIC); + + GET_UCHAR(BZ_X_MAGIC_2, uc); + if (uc != 'Z') RETURN(BZ_DATA_ERROR_MAGIC); + + GET_UCHAR(BZ_X_MAGIC_3, uc) + if (uc != 'h') RETURN(BZ_DATA_ERROR_MAGIC); + + GET_BITS(BZ_X_MAGIC_4, s->blockSize100k, 8) + if (s->blockSize100k < '1' || + s->blockSize100k > '9') RETURN(BZ_DATA_ERROR_MAGIC); + s->blockSize100k -= '0'; + + if (s->smallDecompress) { + s->ll16 = BZALLOC( s->blockSize100k * 100000 * sizeof(UInt16) ); + s->ll4 = BZALLOC( + ((1 + s->blockSize100k * 100000) >> 1) * sizeof(UChar) + ); + if (s->ll16 == NULL || s->ll4 == NULL) RETURN(BZ_MEM_ERROR); + } else { + s->tt = BZALLOC( s->blockSize100k * 100000 * sizeof(Int32) ); + if (s->tt == NULL) RETURN(BZ_MEM_ERROR); + } + + GET_UCHAR(BZ_X_BLKHDR_1, uc); + + if (uc == 0x17) goto endhdr_2; + if (uc != 0x31) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_2, uc); + if (uc != 0x41) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_3, uc); + if (uc != 0x59) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_4, uc); + if (uc != 0x26) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_5, uc); + if (uc != 0x53) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_6, uc); + if (uc != 0x59) RETURN(BZ_DATA_ERROR); + + s->currBlockNo++; + if (s->verbosity >= 2) + VPrintf1 ( "\n [%d: huff+mtf ", s->currBlockNo ); + + s->storedBlockCRC = 0; + GET_UCHAR(BZ_X_BCRC_1, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_BCRC_2, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_BCRC_3, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_BCRC_4, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + + GET_BITS(BZ_X_RANDBIT, s->blockRandomised, 1); + + s->origPtr = 0; + GET_UCHAR(BZ_X_ORIGPTR_1, uc); + s->origPtr = (s->origPtr << 8) | ((Int32)uc); + GET_UCHAR(BZ_X_ORIGPTR_2, uc); + s->origPtr = (s->origPtr << 8) | ((Int32)uc); + GET_UCHAR(BZ_X_ORIGPTR_3, uc); + s->origPtr = (s->origPtr << 8) | ((Int32)uc); + + if (s->origPtr < 0) + RETURN(BZ_DATA_ERROR); + if (s->origPtr > 10 + 100000*s->blockSize100k) + RETURN(BZ_DATA_ERROR); + + /*--- Receive the mapping table ---*/ + for (i = 0; i < 16; i++) { + GET_BIT(BZ_X_MAPPING_1, uc); + if (uc == 1) + s->inUse16[i] = True; else + s->inUse16[i] = False; + } + + for (i = 0; i < 256; i++) s->inUse[i] = False; + + for (i = 0; i < 16; i++) + if (s->inUse16[i]) + for (j = 0; j < 16; j++) { + GET_BIT(BZ_X_MAPPING_2, uc); + if (uc == 1) s->inUse[i * 16 + j] = True; + } + makeMaps_d ( s ); + if (s->nInUse == 0) RETURN(BZ_DATA_ERROR); + alphaSize = s->nInUse+2; + + /*--- Now the selectors ---*/ + GET_BITS(BZ_X_SELECTOR_1, nGroups, 3); + if (nGroups < 2 || nGroups > 6) RETURN(BZ_DATA_ERROR); + GET_BITS(BZ_X_SELECTOR_2, nSelectors, 15); + if (nSelectors < 1) RETURN(BZ_DATA_ERROR); + for (i = 0; i < nSelectors; i++) { + j = 0; + while (True) { + GET_BIT(BZ_X_SELECTOR_3, uc); + if (uc == 0) break; + j++; + if (j >= nGroups) RETURN(BZ_DATA_ERROR); + } + s->selectorMtf[i] = j; + } + + /*--- Undo the MTF values for the selectors. ---*/ + { + UChar pos[BZ_N_GROUPS], tmp, v; + for (v = 0; v < nGroups; v++) pos[v] = v; + + for (i = 0; i < nSelectors; i++) { + v = s->selectorMtf[i]; + tmp = pos[v]; + while (v > 0) { pos[v] = pos[v-1]; v--; } + pos[0] = tmp; + s->selector[i] = tmp; + } + } + + /*--- Now the coding tables ---*/ + for (t = 0; t < nGroups; t++) { + GET_BITS(BZ_X_CODING_1, curr, 5); + for (i = 0; i < alphaSize; i++) { + while (True) { + if (curr < 1 || curr > 20) RETURN(BZ_DATA_ERROR); + GET_BIT(BZ_X_CODING_2, uc); + if (uc == 0) break; + GET_BIT(BZ_X_CODING_3, uc); + if (uc == 0) curr++; else curr--; + } + s->len[t][i] = curr; + } + } + + /*--- Create the Huffman decoding tables ---*/ + for (t = 0; t < nGroups; t++) { + minLen = 32; + maxLen = 0; + for (i = 0; i < alphaSize; i++) { + if (s->len[t][i] > maxLen) maxLen = s->len[t][i]; + if (s->len[t][i] < minLen) minLen = s->len[t][i]; + } + BZ2_hbCreateDecodeTables ( + &(s->limit[t][0]), + &(s->base[t][0]), + &(s->perm[t][0]), + &(s->len[t][0]), + minLen, maxLen, alphaSize + ); + s->minLens[t] = minLen; + } + + /*--- Now the MTF values ---*/ + + EOB = s->nInUse+1; + nblockMAX = 100000 * s->blockSize100k; + groupNo = -1; + groupPos = 0; + + for (i = 0; i <= 255; i++) s->unzftab[i] = 0; + + /*-- MTF init --*/ + { + Int32 ii, jj, kk; + kk = MTFA_SIZE-1; + for (ii = 256 / MTFL_SIZE - 1; ii >= 0; ii--) { + for (jj = MTFL_SIZE-1; jj >= 0; jj--) { + s->mtfa[kk] = (UChar)(ii * MTFL_SIZE + jj); + kk--; + } + s->mtfbase[ii] = kk + 1; + } + } + /*-- end MTF init --*/ + + nblock = 0; + GET_MTF_VAL(BZ_X_MTF_1, BZ_X_MTF_2, nextSym); + + while (True) { + + if (nextSym == EOB) break; + + if (nextSym == BZ_RUNA || nextSym == BZ_RUNB) { + + es = -1; + N = 1; + do { + if (nextSym == BZ_RUNA) es = es + (0+1) * N; else + if (nextSym == BZ_RUNB) es = es + (1+1) * N; + N = N * 2; + GET_MTF_VAL(BZ_X_MTF_3, BZ_X_MTF_4, nextSym); + } + while (nextSym == BZ_RUNA || nextSym == BZ_RUNB); + + es++; + uc = s->seqToUnseq[ s->mtfa[s->mtfbase[0]] ]; + s->unzftab[uc] += es; + + if (s->smallDecompress) + while (es > 0) { + if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR); + s->ll16[nblock] = (UInt16)uc; + nblock++; + es--; + } + else + while (es > 0) { + if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR); + s->tt[nblock] = (UInt32)uc; + nblock++; + es--; + }; + + continue; + + } else { + + if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR); + + /*-- uc = MTF ( nextSym-1 ) --*/ + { + Int32 ii, jj, kk, pp, lno, off; + UInt32 nn; + nn = (UInt32)(nextSym - 1); + + if (nn < MTFL_SIZE) { + /* avoid general-case expense */ + pp = s->mtfbase[0]; + uc = s->mtfa[pp+nn]; + while (nn > 3) { + Int32 z = pp+nn; + s->mtfa[(z) ] = s->mtfa[(z)-1]; + s->mtfa[(z)-1] = s->mtfa[(z)-2]; + s->mtfa[(z)-2] = s->mtfa[(z)-3]; + s->mtfa[(z)-3] = s->mtfa[(z)-4]; + nn -= 4; + } + while (nn > 0) { + s->mtfa[(pp+nn)] = s->mtfa[(pp+nn)-1]; nn--; + }; + s->mtfa[pp] = uc; + } else { + /* general case */ + lno = nn / MTFL_SIZE; + off = nn % MTFL_SIZE; + pp = s->mtfbase[lno] + off; + uc = s->mtfa[pp]; + while (pp > s->mtfbase[lno]) { + s->mtfa[pp] = s->mtfa[pp-1]; pp--; + }; + s->mtfbase[lno]++; + while (lno > 0) { + s->mtfbase[lno]--; + s->mtfa[s->mtfbase[lno]] + = s->mtfa[s->mtfbase[lno-1] + MTFL_SIZE - 1]; + lno--; + } + s->mtfbase[0]--; + s->mtfa[s->mtfbase[0]] = uc; + if (s->mtfbase[0] == 0) { + kk = MTFA_SIZE-1; + for (ii = 256 / MTFL_SIZE-1; ii >= 0; ii--) { + for (jj = MTFL_SIZE-1; jj >= 0; jj--) { + s->mtfa[kk] = s->mtfa[s->mtfbase[ii] + jj]; + kk--; + } + s->mtfbase[ii] = kk + 1; + } + } + } + } + /*-- end uc = MTF ( nextSym-1 ) --*/ + + s->unzftab[s->seqToUnseq[uc]]++; + if (s->smallDecompress) + s->ll16[nblock] = (UInt16)(s->seqToUnseq[uc]); else + s->tt[nblock] = (UInt32)(s->seqToUnseq[uc]); + nblock++; + + GET_MTF_VAL(BZ_X_MTF_5, BZ_X_MTF_6, nextSym); + continue; + } + } + + /* Now we know what nblock is, we can do a better sanity + check on s->origPtr. + */ + if (s->origPtr < 0 || s->origPtr >= nblock) + RETURN(BZ_DATA_ERROR); + + s->state_out_len = 0; + s->state_out_ch = 0; + BZ_INITIALISE_CRC ( s->calculatedBlockCRC ); + s->state = BZ_X_OUTPUT; + if (s->verbosity >= 2) VPrintf0 ( "rt+rld" ); + + /*-- Set up cftab to facilitate generation of T^(-1) --*/ + s->cftab[0] = 0; + for (i = 1; i <= 256; i++) s->cftab[i] = s->unzftab[i-1]; + for (i = 1; i <= 256; i++) s->cftab[i] += s->cftab[i-1]; + + if (s->smallDecompress) { + + /*-- Make a copy of cftab, used in generation of T --*/ + for (i = 0; i <= 256; i++) s->cftabCopy[i] = s->cftab[i]; + + /*-- compute the T vector --*/ + for (i = 0; i < nblock; i++) { + uc = (UChar)(s->ll16[i]); + SET_LL(i, s->cftabCopy[uc]); + s->cftabCopy[uc]++; + } + + /*-- Compute T^(-1) by pointer reversal on T --*/ + i = s->origPtr; + j = GET_LL(i); + do { + Int32 tmp = GET_LL(j); + SET_LL(j, i); + i = j; + j = tmp; + } + while (i != s->origPtr); + + s->tPos = s->origPtr; + s->nblock_used = 0; + if (s->blockRandomised) { + BZ_RAND_INIT_MASK; + BZ_GET_SMALL(s->k0); s->nblock_used++; + BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK; + } else { + BZ_GET_SMALL(s->k0); s->nblock_used++; + } + + } else { + + /*-- compute the T^(-1) vector --*/ + for (i = 0; i < nblock; i++) { + uc = (UChar)(s->tt[i] & 0xff); + s->tt[s->cftab[uc]] |= (i << 8); + s->cftab[uc]++; + } + + s->tPos = s->tt[s->origPtr] >> 8; + s->nblock_used = 0; + if (s->blockRandomised) { + BZ_RAND_INIT_MASK; + BZ_GET_FAST(s->k0); s->nblock_used++; + BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK; + } else { + BZ_GET_FAST(s->k0); s->nblock_used++; + } + + } + + RETURN(BZ_OK); + + + + endhdr_2: + + GET_UCHAR(BZ_X_ENDHDR_2, uc); + if (uc != 0x72) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_3, uc); + if (uc != 0x45) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_4, uc); + if (uc != 0x38) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_5, uc); + if (uc != 0x50) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_6, uc); + if (uc != 0x90) RETURN(BZ_DATA_ERROR); + + s->storedCombinedCRC = 0; + GET_UCHAR(BZ_X_CCRC_1, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_CCRC_2, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_CCRC_3, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_CCRC_4, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + + s->state = BZ_X_IDLE; + RETURN(BZ_STREAM_END); + + default: AssertH ( False, 4001 ); + } + + AssertH ( False, 4002 ); + + save_state_and_return: + + s->save_i = i; + s->save_j = j; + s->save_t = t; + s->save_alphaSize = alphaSize; + s->save_nGroups = nGroups; + s->save_nSelectors = nSelectors; + s->save_EOB = EOB; + s->save_groupNo = groupNo; + s->save_groupPos = groupPos; + s->save_nextSym = nextSym; + s->save_nblockMAX = nblockMAX; + s->save_nblock = nblock; + s->save_es = es; + s->save_N = N; + s->save_curr = curr; + s->save_zt = zt; + s->save_zn = zn; + s->save_zvec = zvec; + s->save_zj = zj; + s->save_gSel = gSel; + s->save_gMinlen = gMinlen; + s->save_gLimit = gLimit; + s->save_gBase = gBase; + s->save_gPerm = gPerm; + + return retVal; +} + + +/*-------------------------------------------------------------*/ +/*--- end decompress.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/dlltest.c b/bzip2/dlltest.c new file mode 100644 index 0000000..f79279c --- /dev/null +++ b/bzip2/dlltest.c @@ -0,0 +1,176 @@ +/* + minibz2 + libbz2.dll test program. + by Yoshioka Tsuneo(QWF00133@nifty.ne.jp/tsuneo-y@is.aist-nara.ac.jp) + This file is Public Domain. + welcome any email to me. + + usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename] +*/ + +#define BZ_IMPORT +#include +#include +#include "bzlib.h" +#ifdef _WIN32 +#include +#endif + + +#ifdef _WIN32 + +#define BZ2_LIBNAME "libbz2-1.0.0.DLL" + +#include +static int BZ2DLLLoaded = 0; +static HINSTANCE BZ2DLLhLib; +int BZ2DLLLoadLibrary(void) +{ + HINSTANCE hLib; + + if(BZ2DLLLoaded==1){return 0;} + hLib=LoadLibrary(BZ2_LIBNAME); + if(hLib == NULL){ + fprintf(stderr,"Can't load %s\n",BZ2_LIBNAME); + return -1; + } + BZ2_bzlibVersion=GetProcAddress(hLib,"BZ2_bzlibVersion"); + BZ2_bzopen=GetProcAddress(hLib,"BZ2_bzopen"); + BZ2_bzdopen=GetProcAddress(hLib,"BZ2_bzdopen"); + BZ2_bzread=GetProcAddress(hLib,"BZ2_bzread"); + BZ2_bzwrite=GetProcAddress(hLib,"BZ2_bzwrite"); + BZ2_bzflush=GetProcAddress(hLib,"BZ2_bzflush"); + BZ2_bzclose=GetProcAddress(hLib,"BZ2_bzclose"); + BZ2_bzerror=GetProcAddress(hLib,"BZ2_bzerror"); + + if (!BZ2_bzlibVersion || !BZ2_bzopen || !BZ2_bzdopen + || !BZ2_bzread || !BZ2_bzwrite || !BZ2_bzflush + || !BZ2_bzclose || !BZ2_bzerror) { + fprintf(stderr,"GetProcAddress failed.\n"); + return -1; + } + BZ2DLLLoaded=1; + BZ2DLLhLib=hLib; + return 0; + +} +int BZ2DLLFreeLibrary(void) +{ + if(BZ2DLLLoaded==0){return 0;} + FreeLibrary(BZ2DLLhLib); + BZ2DLLLoaded=0; +} +#endif /* WIN32 */ + +void usage(void) +{ + puts("usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]"); +} + +int main(int argc,char *argv[]) +{ + int decompress = 0; + int level = 9; + char *fn_r = NULL; + char *fn_w = NULL; + +#ifdef _WIN32 + if(BZ2DLLLoadLibrary()<0){ + fprintf(stderr,"Loading of %s failed. Giving up.\n", BZ2_LIBNAME); + exit(1); + } + printf("Loading of %s succeeded. Library version is %s.\n", + BZ2_LIBNAME, BZ2_bzlibVersion() ); +#endif + while(++argv,--argc){ + if(**argv =='-' || **argv=='/'){ + char *p; + + for(p=*argv+1;*p;p++){ + if(*p=='d'){ + decompress = 1; + }else if('1'<=*p && *p<='9'){ + level = *p - '0'; + }else{ + usage(); + exit(1); + } + } + }else{ + break; + } + } + if(argc>=1){ + fn_r = *argv; + argc--;argv++; + }else{ + fn_r = NULL; + } + if(argc>=1){ + fn_w = *argv; + argc--;argv++; + }else{ + fn_w = NULL; + } + { + int len; + char buff[0x1000]; + char mode[10]; + + if(decompress){ + BZFILE *BZ2fp_r = NULL; + FILE *fp_w = NULL; + + if(fn_w){ + if((fp_w = fopen(fn_w,"wb"))==NULL){ + printf("can't open [%s]\n",fn_w); + perror("reason:"); + exit(1); + } + }else{ + fp_w = stdout; + } + if((BZ2fp_r == NULL && (BZ2fp_r = BZ2_bzdopen(fileno(stdin),"rb"))==NULL) + || (BZ2fp_r != NULL && (BZ2fp_r = BZ2_bzopen(fn_r,"rb"))==NULL)){ + printf("can't bz2openstream\n"); + exit(1); + } + while((len=BZ2_bzread(BZ2fp_r,buff,0x1000))>0){ + fwrite(buff,1,len,fp_w); + } + BZ2_bzclose(BZ2fp_r); + if(fp_w != stdout) fclose(fp_w); + }else{ + BZFILE *BZ2fp_w = NULL; + FILE *fp_r = NULL; + + if(fn_r){ + if((fp_r = fopen(fn_r,"rb"))==NULL){ + printf("can't open [%s]\n",fn_r); + perror("reason:"); + exit(1); + } + }else{ + fp_r = stdin; + } + mode[0]='w'; + mode[1] = '0' + level; + mode[2] = '\0'; + + if((fn_w == NULL && (BZ2fp_w = BZ2_bzdopen(fileno(stdout),mode))==NULL) + || (fn_w !=NULL && (BZ2fp_w = BZ2_bzopen(fn_w,mode))==NULL)){ + printf("can't bz2openstream\n"); + exit(1); + } + while((len=fread(buff,1,0x1000,fp_r))>0){ + BZ2_bzwrite(BZ2fp_w,buff,len); + } + BZ2_bzclose(BZ2fp_w); + if(fp_r!=stdin)fclose(fp_r); + } + } +#ifdef _WIN32 + BZ2DLLFreeLibrary(); +#endif + return 0; +} diff --git a/bzip2/dlltest.dsp b/bzip2/dlltest.dsp new file mode 100644 index 0000000..4b1615e --- /dev/null +++ b/bzip2/dlltest.dsp @@ -0,0 +1,93 @@ +# Microsoft Developer Studio Project File - Name="dlltest" - Package Owner=<4> +# Microsoft Developer Studio Generated Build File, Format Version 5.00 +# ** •ÒW‚µ‚È‚¢‚Å‚­‚¾‚³‚¢ ** + +# TARGTYPE "Win32 (x86) Console Application" 0x0103 + +CFG=dlltest - Win32 Debug +!MESSAGE ‚±‚ê‚Í—LŒø‚ÈÒ²¸Ì§²Ù‚Å‚Í‚ ‚è‚Ü‚¹‚ñB ‚±‚ÌÌßÛ¼Þª¸Ä‚ðËÞÙÄނ·‚邽‚ß‚É‚Í NMAKE ‚ðŽg—p‚µ‚Ä‚­‚¾‚³‚¢B +!MESSAGE [Ò²¸Ì§²Ù‚Ì´¸½Îß°Ä] ºÏÝÄނðŽg—p‚µ‚ÄŽÀs‚µ‚Ä‚­‚¾‚³‚¢ +!MESSAGE +!MESSAGE NMAKE /f "dlltest.mak". +!MESSAGE +!MESSAGE NMAKE ‚ÌŽÀsŽž‚ɍ\¬‚ðŽw’è‚Å‚«‚Ü‚· +!MESSAGE ºÏÝÄÞ ×²Ýã‚Åϸۂ̐ݒè‚ð’è‹`‚µ‚Ü‚·B—á: +!MESSAGE +!MESSAGE NMAKE /f "dlltest.mak" CFG="dlltest - Win32 Debug" +!MESSAGE +!MESSAGE ‘I‘ð‰Â”\‚ÈËÞÙÄÞ Ó°ÄÞ: +!MESSAGE +!MESSAGE "dlltest - Win32 Release" ("Win32 (x86) Console Application" —p) +!MESSAGE "dlltest - Win32 Debug" ("Win32 (x86) Console Application" —p) +!MESSAGE + +# Begin Project +# PROP Scc_ProjName "" +# PROP Scc_LocalPath "" +CPP=cl.exe +RSC=rc.exe + +!IF "$(CFG)" == "dlltest - Win32 Release" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "Release" +# PROP BASE Intermediate_Dir "Release" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "Release" +# PROP Intermediate_Dir "Release" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +# ADD BASE CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c +# ADD CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c +# ADD BASE RSC /l 0x411 /d "NDEBUG" +# ADD RSC /l 0x411 /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386 +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386 /out:"minibz2.exe" + +!ELSEIF "$(CFG)" == "dlltest - Win32 Debug" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 1 +# PROP BASE Output_Dir "dlltest_" +# PROP BASE Intermediate_Dir "dlltest_" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 1 +# PROP Output_Dir "dlltest_" +# PROP Intermediate_Dir "dlltest_" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +# ADD BASE CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c +# ADD CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c +# ADD BASE RSC /l 0x411 /d "_DEBUG" +# ADD RSC /l 0x411 /d "_DEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /pdbtype:sept +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /out:"minibz2.exe" /pdbtype:sept + +!ENDIF + +# Begin Target + +# Name "dlltest - Win32 Release" +# Name "dlltest - Win32 Debug" +# Begin Source File + +SOURCE=.\bzlib.h +# End Source File +# Begin Source File + +SOURCE=.\dlltest.c +# End Source File +# End Target +# End Project diff --git a/bzip2/huffman.c b/bzip2/huffman.c new file mode 100644 index 0000000..9b446c4 --- /dev/null +++ b/bzip2/huffman.c @@ -0,0 +1,228 @@ + +/*-------------------------------------------------------------*/ +/*--- Huffman coding low-level stuff ---*/ +/*--- huffman.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + +/*---------------------------------------------------*/ +#define WEIGHTOF(zz0) ((zz0) & 0xffffff00) +#define DEPTHOF(zz1) ((zz1) & 0x000000ff) +#define MYMAX(zz2,zz3) ((zz2) > (zz3) ? (zz2) : (zz3)) + +#define ADDWEIGHTS(zw1,zw2) \ + (WEIGHTOF(zw1)+WEIGHTOF(zw2)) | \ + (1 + MYMAX(DEPTHOF(zw1),DEPTHOF(zw2))) + +#define UPHEAP(z) \ +{ \ + Int32 zz, tmp; \ + zz = z; tmp = heap[zz]; \ + while (weight[tmp] < weight[heap[zz >> 1]]) { \ + heap[zz] = heap[zz >> 1]; \ + zz >>= 1; \ + } \ + heap[zz] = tmp; \ +} + +#define DOWNHEAP(z) \ +{ \ + Int32 zz, yy, tmp; \ + zz = z; tmp = heap[zz]; \ + while (True) { \ + yy = zz << 1; \ + if (yy > nHeap) break; \ + if (yy < nHeap && \ + weight[heap[yy+1]] < weight[heap[yy]]) \ + yy++; \ + if (weight[tmp] < weight[heap[yy]]) break; \ + heap[zz] = heap[yy]; \ + zz = yy; \ + } \ + heap[zz] = tmp; \ +} + + +/*---------------------------------------------------*/ +void BZ2_hbMakeCodeLengths ( UChar *len, + Int32 *freq, + Int32 alphaSize, + Int32 maxLen ) +{ + /*-- + Nodes and heap entries run from 1. Entry 0 + for both the heap and nodes is a sentinel. + --*/ + Int32 nNodes, nHeap, n1, n2, i, j, k; + Bool tooLong; + + Int32 heap [ BZ_MAX_ALPHA_SIZE + 2 ]; + Int32 weight [ BZ_MAX_ALPHA_SIZE * 2 ]; + Int32 parent [ BZ_MAX_ALPHA_SIZE * 2 ]; + + for (i = 0; i < alphaSize; i++) + weight[i+1] = (freq[i] == 0 ? 1 : freq[i]) << 8; + + while (True) { + + nNodes = alphaSize; + nHeap = 0; + + heap[0] = 0; + weight[0] = 0; + parent[0] = -2; + + for (i = 1; i <= alphaSize; i++) { + parent[i] = -1; + nHeap++; + heap[nHeap] = i; + UPHEAP(nHeap); + } + + AssertH( nHeap < (BZ_MAX_ALPHA_SIZE+2), 2001 ); + + while (nHeap > 1) { + n1 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1); + n2 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1); + nNodes++; + parent[n1] = parent[n2] = nNodes; + weight[nNodes] = ADDWEIGHTS(weight[n1], weight[n2]); + parent[nNodes] = -1; + nHeap++; + heap[nHeap] = nNodes; + UPHEAP(nHeap); + } + + AssertH( nNodes < (BZ_MAX_ALPHA_SIZE * 2), 2002 ); + + tooLong = False; + for (i = 1; i <= alphaSize; i++) { + j = 0; + k = i; + while (parent[k] >= 0) { k = parent[k]; j++; } + len[i-1] = j; + if (j > maxLen) tooLong = True; + } + + if (! tooLong) break; + + for (i = 1; i < alphaSize; i++) { + j = weight[i] >> 8; + j = 1 + (j / 2); + weight[i] = j << 8; + } + } +} + + +/*---------------------------------------------------*/ +void BZ2_hbAssignCodes ( Int32 *code, + UChar *length, + Int32 minLen, + Int32 maxLen, + Int32 alphaSize ) +{ + Int32 n, vec, i; + + vec = 0; + for (n = minLen; n <= maxLen; n++) { + for (i = 0; i < alphaSize; i++) + if (length[i] == n) { code[i] = vec; vec++; }; + vec <<= 1; + } +} + + +/*---------------------------------------------------*/ +void BZ2_hbCreateDecodeTables ( Int32 *limit, + Int32 *base, + Int32 *perm, + UChar *length, + Int32 minLen, + Int32 maxLen, + Int32 alphaSize ) +{ + Int32 pp, i, j, vec; + + pp = 0; + for (i = minLen; i <= maxLen; i++) + for (j = 0; j < alphaSize; j++) + if (length[j] == i) { perm[pp] = j; pp++; }; + + for (i = 0; i < BZ_MAX_CODE_LEN; i++) base[i] = 0; + for (i = 0; i < alphaSize; i++) base[length[i]+1]++; + + for (i = 1; i < BZ_MAX_CODE_LEN; i++) base[i] += base[i-1]; + + for (i = 0; i < BZ_MAX_CODE_LEN; i++) limit[i] = 0; + vec = 0; + + for (i = minLen; i <= maxLen; i++) { + vec += (base[i+1] - base[i]); + limit[i] = vec-1; + vec <<= 1; + } + for (i = minLen + 1; i <= maxLen; i++) + base[i] = ((limit[i-1] + 1) << 1) - base[i]; +} + + +/*-------------------------------------------------------------*/ +/*--- end huffman.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/libbz2.def b/bzip2/libbz2.def new file mode 100644 index 0000000..2dc0dd8 --- /dev/null +++ b/bzip2/libbz2.def @@ -0,0 +1,27 @@ +LIBRARY LIBBZ2 +DESCRIPTION "libbzip2: library for data compression" +EXPORTS + BZ2_bzCompressInit + BZ2_bzCompress + BZ2_bzCompressEnd + BZ2_bzDecompressInit + BZ2_bzDecompress + BZ2_bzDecompressEnd + BZ2_bzReadOpen + BZ2_bzReadClose + BZ2_bzReadGetUnused + BZ2_bzRead + BZ2_bzWriteOpen + BZ2_bzWrite + BZ2_bzWriteClose + BZ2_bzWriteClose64 + BZ2_bzBuffToBuffCompress + BZ2_bzBuffToBuffDecompress + BZ2_bzlibVersion + BZ2_bzopen + BZ2_bzdopen + BZ2_bzread + BZ2_bzwrite + BZ2_bzflush + BZ2_bzclose + BZ2_bzerror diff --git a/bzip2/libbz2.dsp b/bzip2/libbz2.dsp new file mode 100644 index 0000000..a21a20f --- /dev/null +++ b/bzip2/libbz2.dsp @@ -0,0 +1,130 @@ +# Microsoft Developer Studio Project File - Name="libbz2" - Package Owner=<4> +# Microsoft Developer Studio Generated Build File, Format Version 5.00 +# ** •ÒW‚µ‚È‚¢‚Å‚­‚¾‚³‚¢ ** + +# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102 + +CFG=libbz2 - Win32 Debug +!MESSAGE ‚±‚ê‚Í—LŒø‚ÈÒ²¸Ì§²Ù‚Å‚Í‚ ‚è‚Ü‚¹‚ñB ‚±‚ÌÌßÛ¼Þª¸Ä‚ðËÞÙÄނ·‚邽‚ß‚É‚Í NMAKE ‚ðŽg—p‚µ‚Ä‚­‚¾‚³‚¢B +!MESSAGE [Ò²¸Ì§²Ù‚Ì´¸½Îß°Ä] ºÏÝÄނðŽg—p‚µ‚ÄŽÀs‚µ‚Ä‚­‚¾‚³‚¢ +!MESSAGE +!MESSAGE NMAKE /f "libbz2.mak". +!MESSAGE +!MESSAGE NMAKE ‚ÌŽÀsŽž‚ɍ\¬‚ðŽw’è‚Å‚«‚Ü‚· +!MESSAGE ºÏÝÄÞ ×²Ýã‚Åϸۂ̐ݒè‚ð’è‹`‚µ‚Ü‚·B—á: +!MESSAGE +!MESSAGE NMAKE /f "libbz2.mak" CFG="libbz2 - Win32 Debug" +!MESSAGE +!MESSAGE ‘I‘ð‰Â”\‚ÈËÞÙÄÞ Ó°ÄÞ: +!MESSAGE +!MESSAGE "libbz2 - Win32 Release" ("Win32 (x86) Dynamic-Link Library" —p) +!MESSAGE "libbz2 - Win32 Debug" ("Win32 (x86) Dynamic-Link Library" —p) +!MESSAGE + +# Begin Project +# PROP Scc_ProjName "" +# PROP Scc_LocalPath "" +CPP=cl.exe +MTL=midl.exe +RSC=rc.exe + +!IF "$(CFG)" == "libbz2 - Win32 Release" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "Release" +# PROP BASE Intermediate_Dir "Release" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "Release" +# PROP Intermediate_Dir "Release" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32 +# ADD BASE RSC /l 0x411 /d "NDEBUG" +# ADD RSC /l 0x411 /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 /out:"libbz2.dll" + +!ELSEIF "$(CFG)" == "libbz2 - Win32 Debug" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 1 +# PROP BASE Output_Dir "Debug" +# PROP BASE Intermediate_Dir "Debug" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 1 +# PROP Output_Dir "Debug" +# PROP Intermediate_Dir "Debug" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c +# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c +# ADD BASE MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32 +# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32 +# ADD BASE RSC /l 0x411 /d "_DEBUG" +# ADD RSC /l 0x411 /d "_DEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /pdbtype:sept +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:"libbz2.dll" /pdbtype:sept + +!ENDIF + +# Begin Target + +# Name "libbz2 - Win32 Release" +# Name "libbz2 - Win32 Debug" +# Begin Source File + +SOURCE=.\blocksort.c +# End Source File +# Begin Source File + +SOURCE=.\bzlib.c +# End Source File +# Begin Source File + +SOURCE=.\bzlib.h +# End Source File +# Begin Source File + +SOURCE=.\bzlib_private.h +# End Source File +# Begin Source File + +SOURCE=.\compress.c +# End Source File +# Begin Source File + +SOURCE=.\crctable.c +# End Source File +# Begin Source File + +SOURCE=.\decompress.c +# End Source File +# Begin Source File + +SOURCE=.\huffman.c +# End Source File +# Begin Source File + +SOURCE=.\libbz2.def +# End Source File +# Begin Source File + +SOURCE=.\randtable.c +# End Source File +# End Target +# End Project diff --git a/bzip2/makefile.msc b/bzip2/makefile.msc new file mode 100644 index 0000000..3fe4232 --- /dev/null +++ b/bzip2/makefile.msc @@ -0,0 +1,63 @@ +# Makefile for Microsoft Visual C++ 6.0 +# usage: nmake -f makefile.msc +# K.M. Syring (syring@gsf.de) +# Fixed up by JRS for bzip2-0.9.5d release. + +CC=cl +CFLAGS= -DWIN32 -MD -Ox -D_FILE_OFFSET_BITS=64 + +OBJS= blocksort.obj \ + huffman.obj \ + crctable.obj \ + randtable.obj \ + compress.obj \ + decompress.obj \ + bzlib.obj + +all: lib bzip2 test + +bzip2: lib + $(CC) $(CFLAGS) -o bzip2 bzip2.c libbz2.lib setargv.obj + $(CC) $(CFLAGS) -o bzip2recover bzip2recover.c + +lib: $(OBJS) + lib /out:libbz2.lib $(OBJS) + +test: bzip2 + type words1 + .\\bzip2 -1 < sample1.ref > sample1.rb2 + .\\bzip2 -2 < sample2.ref > sample2.rb2 + .\\bzip2 -3 < sample3.ref > sample3.rb2 + .\\bzip2 -d < sample1.bz2 > sample1.tst + .\\bzip2 -d < sample2.bz2 > sample2.tst + .\\bzip2 -ds < sample3.bz2 > sample3.tst + @echo All six of the fc's should find no differences. + @echo If fc finds an error on sample3.bz2, this could be + @echo because WinZip's 'TAR file smart CR/LF conversion' + @echo is too clever for its own good. Disable this option. + @echo The correct size for sample3.ref is 120,244. If it + @echo is 150,251, WinZip has messed it up. + fc sample1.bz2 sample1.rb2 + fc sample2.bz2 sample2.rb2 + fc sample3.bz2 sample3.rb2 + fc sample1.tst sample1.ref + fc sample2.tst sample2.ref + fc sample3.tst sample3.ref + + + +clean: + del *.obj + del libbz2.lib + del bzip2.exe + del bzip2recover.exe + del sample1.rb2 + del sample2.rb2 + del sample3.rb2 + del sample1.tst + del sample2.tst + del sample3.tst + +.c.obj: + $(CC) $(CFLAGS) -c $*.c -o $*.obj + diff --git a/bzip2/manual.ps b/bzip2/manual.ps new file mode 100644 index 0000000..1a7dbac --- /dev/null +++ b/bzip2/manual.ps @@ -0,0 +1,3808 @@ +%!PS-Adobe-2.0 +%%Creator: dvips(k) 5.78 Copyright 1998 Radical Eye Software (www.radicaleye.com) +%%Title: manual.dvi +%%Pages: 39 +%%PageOrder: Ascend +%%BoundingBox: 0 0 596 842 +%%EndComments +%DVIPSCommandLine: dvips -o manual.ps manual.dvi +%DVIPSParameters: dpi=600, compressed +%DVIPSSource: TeX output 2000.03.23:2343 +%%BeginProcSet: texc.pro +%! +/TeXDict 300 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N +/X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 +mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} +ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale +isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div +hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul +TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} +forall round exch round exch]setmatrix}N /@landscape{/isls true N}B +/@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B +/FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ +/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N +string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N +end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ +/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] +N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup +length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ +128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub +get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data +dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N +/rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup +/base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx +0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff +setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff +.1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N +/cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id +gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp +add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add +/gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{ +dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1 +adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2 +idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string +putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval +adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg} +{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{ +adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2 +chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{] +}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup +length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ +cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin +0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul +add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict +/eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook +known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X +/IE 256 array N 2 string 0 1 255{IE S dup 360 add 36 4 index cvrs cvn +put}for pop 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N +/RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley +X /rulex X V}B /V{}B /RV statusdict begin /product where{pop false[ +(Display)(NeXT)(LaserWriter 16/600)]{dup length product length le{dup +length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse} +forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false +RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 +false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform +round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg +rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail +{dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} +B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ +4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ +p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p +a}B /bos{/SS save N}B /eos{SS restore}B end + +%%EndProcSet +TeXDict begin 39158280 55380996 1000 600 600 (manual.dvi) +@start +%DVIPSBitmapFont: Fa cmti10 10.95 1 +/Fa 1 47 df<120FEA3FC0127FA212FFA31380EA7F00123C0A0A77891C>46 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fb cmbxti10 14.4 1 +/Fb 1 47 df<13FCEA03FF000F13804813C05AA25AA2B5FCA31480A214006C5A6C5A6C5A +EA0FE0121271912B>46 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fc cmsl10 10.95 25 +/Fc 25 122 df37 D44 D48 D<157015F014011407143F903803FFE0137FEBFFCFEBF80F1300 +141F15C0A5143F1580A5147F1500A55C5CA513015CA513035CA513075CA5130F5CA3131F +497EB612F8A31D3D78BC2D>I<133C137F5B481380A31400A26C5A137890C7FCB3EA0780 +EA0FE0121F123FA5121FEA0F601200A213E05BA212015B120390C7FC5A1206120E5A5A12 +3012705A5A11397AA619>59 D97 DIIIII<147FEB3FFFA313017FA25CA513015CA51303 +5CA4ED07F80107EB1FFF9139F0781FC09138F1E00F9139F38007E0ECF70002FE14F0495A +5CA25CA24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B491500 +A300015D486C491380B5D8F87F13FCA32E3F7DBE33>104 D<1478EB01FE130314FFA25B +14FE130314FCEB00F01400ACEB03F8EA01FF14F0A2EA001F130FA314E0A5131F14C0A513 +3F1480A5137F1400A55B5BA4EA03FF007F13F0A2B5FC183E7DBD1A>I<143FEB1FFF5BA2 +13017FA214FEA5130114FCA5130314F8A5130714F0A5130F14E0A5131F14C0A5133F1480 +A5137F1400A55B5BA4EA03FF007F13F8A2B5FC183F7DBE1A>108 +D<902707F007F8EB03FCD803FFD91FFF90380FFF80913CE0781FC03C0FE09126E1E00FEB +F0073E001FE38007E1C003F090260FE700EBE38002EEDAF70013F802FC14FE02D85C14F8 +4A5CA24A5C011F020F14074A4A14F0A5013F021F140F4A4A14E0A5017F023F141F91C749 +14C0A549027F143F4992C71380A300014B147F486C496DEBFFC0B5D8F87FD9FC3F13FEA3 +47287DA74C>I<903907F007F8D803FFEB1FFF9139E0781FC09138E1E00F3B001FE38007 +E090380FE70002EE14F014FC14D814F85CA24A130F131F4A14E0A4161F133F4A14C0A416 +3F137F91C71380A4167F5B491500A300015D486C491380B5D8F87F13FCA32E287DA733> +II<91387F01FE903A7FFF0FFFC09139FE3E03F09238F801F890 +3A01FFE000FE4B137F6D497F4990C713804A15C04A141FA218E0A20103150F5C18F0A317 +1F010716E05CA3173F18C0130F4A147F1880A2EFFF004C5A011F5D16034C5A6E495AEE1F +C06E495AD93FDC017EC7FC91388F01F8913883FFE0028090C8FC92C9FC137FA291CAFCA4 +5BA25BA31201487EB512F8A3343A81A733>I<903907F01F80D803FFEB7FE09138E1E1F0 +9138E387F839001FE707EB0FE614EE02FC13F002D813E09138F801804AC7FCA25C131FA2 +5CA4133F5CA5137F91C8FCA55B5BA31201487EB512FEA325287EA724>114 +D<9138FF81C0010713E390381F807F90397C003F8049131F4848130F5B00031407A24848 +1400A27FA27F6D90C7FCEBFF8014FC6C13FF6C14C015F06C6C7F011F7F13079038007FFE +1403140100381300157EA2123C153E157E007C147CA2007E147815F8007F495A4A5A486C +485A26F9E01FC7FC38E0FFFC38C01FE0222A7DA824>II<01FE147F00FFEC7FFF4914FEA20007140300031401A34914FCA4 +150312074914F8A41507120F4914F0A4150F121F4914E0A2151FA3153F4914C0157F15FF +EC01DF3A0FC003BFE09138073FFF3803F01E3801FFF826003FE01380282977A733>III<90B539E007FFF05E18E0902707FE000313006D48EB01FC +705A5F01014A5A5F16036E5C0100140794C7FC160E805E805E1678ED8070023F13F05EED +81C015C191381FC38015C793C8FC15EF15EEEC0FFCA25DA26E5AA25DA26E5A5DA24AC9FC +5C140E141E141C5C121C003F5B5A485B495A130300FE5B4848CAFCEA701EEA783CEA3FF0 +EA0FC0343A80A630>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fd cmtt12 14.4 10 +/Fd 10 123 df50 D<383FFF805AB57EA37E7EEA003FAEED07FC92383FFF +8092B512E002C314F802CF8002DF8091B7FCDBF80F1380DBC00113C092C713E04A143F4A +EC1FF04A15F84A140F4AEC07FCA217034A15FE1701A318FF83A95F18FEA280170318FC6E +140718F86E140FEF1FF06E143F6EEC7FE06EECFFC0DBC0031380EDF01F92B6120002DF14 +FC02CF5C02C35CD91F8114C090260F807F90C7FC90C7EA0FF8384A7FC83E>98 +D<923803FFF85D4B7FA38181ED0003AEEC1FF0ECFFFE0103EBFF83010F14E34914F3017F +14FB90B7FC48EBF80F48EBC00191C7FC4848143F4848141F5B4848140F491407123F4914 +03127F5BA312FF90C8FCA97F127FA216077F123F6D140FA26C6C141F6D143F000F157F6C +6C14FF01FF5B6C6D5A6CD9F01FEBFFFC6C90B500FB13FE6D02F313FF6D14E3010F14C36D +020113FE010101FC14FC9026003FE0C8FC384A7CC83E>100 D<143E147F4A7E497FA56D +5B6EC8FC143E91C9FCAC003FB57E5A81A47EC7123FB3B3007FB71280B812C0A56C16802A +4A76C93E>105 D<007FB512C0B6FC81A47EC7121FB3B3B3A5007FB712F8B812FCA56C16 +F82E4978C83E>108 D111 +DI<903901FFF00F011F9038 +FE1F8090B612BF000315FF5A5A5A393FFE003F01F01307D87FC0130190C8FC5A48157FA4 +7EEE3F00D87FC091C7FC13F0EA3FFE381FFFF06CEBFFC06C14FE6C6E7EC615E0013F14F8 +010780D9003F7F02007F03071380030013C0003EED3FE0007F151F48150F17F06D1407A3 +7FA26D140F6D15E0161F01FCEC3FC06D14FF9026FFC00F138091B612005E485D013F5C6D +14E0D8FC0714802778007FF8C7FC2C3677B43E>115 D<147C14FC497EAD003FB712FC5A +B87EA36C5EA2260001FEC9FCB3A6173FA2EF7F80A76E14FF6D16006F5A9238C007FE9138 +7FF01F92B55A6E5C6E5C6E5C6E1480020149C7FC9138003FF031437DC13E>I<000FB812 +804817C04817E0A418C001C0C712014C13804C1300EE1FFE4C5AEE7FF06C484A5A4B5BC8 +485B4B90C7FC4B5A4B5A4B5A4B5A4B5A4A5B4A5B4A90C8FC4A5A4A5A4A5A4A5A4A5A495B +495B4990C9FC495A495A4948EC0FC0495A4948EC1FE0485B00075B4890C8FCEA1FFC485A +485A90B8FCB9FCA46C17C07E33337CB23E>122 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fe cmtt12 13.14 31 +/Fe 31 123 df50 D<003FB6FC4815E0B712F882826C816C16802701FC000113C0 +9238007FE0161FEE0FF0A2160717F81603A6160717F0A2160FEE1FE0163FEE7FC0923801 +FF80030F130090B65A5E16F08216FEEEFF8017C001FCC7EA7FE0EE1FF0EE07F8160317FC +EE01FE1600A217FF177FA717FF17FE16011603EE07FC160FEE3FF8EEFFF0003FB7FC4816 +E0B812C01780EEFE006C15F86C15C030437DC238>66 DI<007FB512F8B7FC16C08216F8826C813A03F8001FFF15 +07030113806F13C0167FEE3FE0161FEE0FF0A2EE07F8A2EE03FCA21601A217FE1600A417 +7FAD17FF17FEA4160117FCA2160317F81607A2EE0FF0161FEE3FE0167FEEFFC04B13805D +031F1300007FB65AB75A5E5E16C093C7FC6C14F830437DC238>I<007FB712FCB87EA57E +D801FCC8FCA9177C94C7FCA6ED07C04B7EA590B6FCA79038FC000FA56F5A92C9FCA7EF0F +80EF1FC0AA007FB8FCB9FCA56C178032437DC238>I<91391FF003C091397FFC07E049B5 +FC010714CF4914EF4914FF5B90387FF81F9038FFE00748EB800191C7FC4848147F485A49 +143F485A161F485AA249140F123F5BA2127F90C8EA07C093C7FCA35A5AAA923807FFFC4B +13FE4B13FF7E7E6F13FE6F13FC9238000FE07F003F151FA27F121F7F163F6C7EA26C6C14 +7F7F6C6C14FF6C6C5B6E5A6C6D5A90387FF81F6DB6FC6D14EF6D14CF6D148F0101140F90 +3A007FFC07C0DA1FF0C7FC30457CC338>71 D<007FB612F0B712F8A56C15F0260001FCC7 +FCB3B3B1007FB612F0B712F8A56C15F0254377C238>73 D<90380FFFFE90B612E0000315 +F8488148814881A2273FFE000F138001F01301497F49147F4848EC3FC0A290C8121FA448 +16E0A248150FB3AC6C151FA36C16C0A36D143FA36C6CEC7F806D14FF6D5B01FE130F6CB7 +1200A26C5D6C5D6C5DC615E0010F49C7FC2B457AC338>79 D<003FB512F04814FEB77E16 +E0826C816C813A01FC003FFEED07FF03017F81707E163F161F83160FA7161F5F163F167F +4C5A5D030790C7FCED3FFE90B65A5E5E5EA282829038FC001FED07FC6F7E150115008282 +AA18E0EF01F0EF03F8A31783EE3F87263FFFE0ECC7F0486D14FFB56C7F18E07013C06C49 +6D13806C496D1300CA12FC35447EC238>82 D<003FB8FC481780B9FCA53BFE0007F0003F +A9007CEE1F00C792C7FCB3B3A70107B512F04980A56D5C31437DC238>84 +D<267FFFF090387FFFF0B56C90B512F8A56C496D13F0D801FCC73801FC00B3B3A66D1403 +00005EA36D14076D5D6E130F6D6C495A6E133F6D6C495A6D6C495AECFF076D90B5C7FC6D +5C6D5C6D5C023F13E0020F1380DA03FEC8FC35447FC238>I87 +D<001FB712F04816F85AA417F090C8121F17E0EE3FC0167F1780EEFF00A24B5A4B5A123E +C8485A4B5AA24B5A4B5AA24B5A4BC7FCA24A5A14035D4A5A140F5D4A5A143F5D4A5A14FF +92C8FC495A13035C495AA2495A495AA2495A495A17F849C7EA01FC485AA2485A485AA248 +5A121F5B485A127F90B7FCB8FCA56C16F82E437BC238>90 D<003FB712804816C0B812E0 +A46C16C06C16802B087A7D38>95 D97 DIIIII<14F0497E497E497EA4 +6D5A6D5A6D5A91C8FCAB383FFFFC487FB5FCA37E7EC7FCB3AF007FB612F0B712F816FCA3 +16F86C15F0264476C338>105 D<387FFFFEB6FCA57EC77EB3B3B1007FB7FCB81280A56C +1600294379C238>108 D<023FEB07E03B3FE0FFC01FF8D87FF39038E07FFCD8FFF76D48 +7E90B500F97F15FB6C91B612806C01C1EBF83F00030100EBE01F4902C013C0A24990387F +800FA2491400A349137EB3A73C3FFF03FFE07FFC4801879038F0FFFEB500C76D13FFA36C +01874913FE6C01039038E07FFC383080AF38>IIII114 D<903907FF80F0017FEBF1F848B5 +12FD000714FF5A5A5AEBFC00D87FE0131F0180130F48C71207481403A5007FEC01F001C0 +90C7FCEA3FF013FE381FFFF86CEBFFC0000314F8C614FF013F1480010714E0D9003F13F0 +020013F8ED0FFC1503003CEC01FE007E140000FE15FF167F7EA37F6D14FF16FE01F01303 +6DEB07FC01FF137F91B512F816F016E04815C0D8FC3F1400010F13FCD8780113E0283278 +B038>III<000FB712FC4816FE5AA417 +FC0180C7EA1FF8EE3FF0EE7FE0EEFFC04B13804B13006CC7485AC8485A4B5A4B5A4B5A4B +5A4A5B4A90C7FCEC07FC4A5A4A5A4A5A4A5A49485A4990C8FC495A495A495A495A494814 +7C494814FE485B4890C8FC485A485A485A485A48B7FCB8FCA56C16FC2F2F7DAE38>122 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Ff cmbx12 13.14 53 +/Ff 53 122 df<923807FFE092B512FC020714FF021F81027F9038007FC0902601FFF0EB +0FE04901C0497E4990C7487ED90FFC147F011F824A14FF495AA2137F5CA2715A715A715A +EF078094C8FCA7EF07FCB9FCA526007FF0C7123F171FB3B3A2003FB5D8E00FB512F8A53D +4D7ECC44>12 D45 DI<177817F8EE01FCA21603A2EE07F8A217F016 +0FA217E0161FA2EE3FC0A21780167FA217005EA24B5AA25E1503A24B5AA25E150FA25E15 +1FA24B5AA25E157FA24BC7FCA25D1401A25D1403A24A5AA25D140FA24A5AA25D143FA25D +147FA24AC8FCA25C1301A25C1303A2495AA25C130FA2495AA25C133FA25C137FA249C9FC +A25B1201A2485AA25B1207A25B120FA2485AA25B123FA25B127FA248CAFCA25AA2127CA2 +2E6D79D13D>I<15F014011407141F147FEB03FF137FB6FCA313FC1380C7FCB3B3B2007F +B712E0A52B4777C63D>49 DIIIII<121F7F7F13FE90B812E0A45A18C0188018005F5FA25F485E90C8 +EA07E0007E4B5A5F007C151F4CC7FC167E5E485D15014B5A4B5AC8485A4B5AA24BC8FC15 +7EA25D1401A24A5A1407A24A5AA2141FA24A5AA2147FA314FFA3495BA45BA55BAA6D5BA2 +6D90C9FCEB007C334B79C93D>III65 +D<93261FFF80EB01C00307B500F81303033F02FE13074AB7EAC00F0207EEE03F021F903A +FE007FF87F027F01E0903807FCFF91B5C70001B5FC010301FC6E7E4901F0151F4901C081 +4949814990C97E494882494882485B48197F4A173F5A4A171F5A5C48190FA2485B1A07A2 +5AA297C7FC91CDFCA2B5FCAD7EA280A2F207C07EA36C7FA26C190F6E18807E6E171F6C1A +006E5F6C193E6C6D177E6D6C5F6D6C4C5A6D6D15036D6D4B5A6D01F04B5A6D01FCED3FC0 +010001FFEDFF806E01E0D903FEC7FC021F01FEEB3FFC020790B612F002015EDA003F92C8 +FC030714FCDB001F13804A4D79CB59>67 D +III<93261FFF80EB01C00307B500F8 +1303033F02FE13074AB7EAC00F0207EEE03F021F903AFE007FF87F027F01E0903807FCFF +91B5C70001B5FC010301FC6E7E4901F0151F4901C0814949814990C97E49488249488248 +5B48197F4A173F5A4A171F5A5C48190FA2485B1A07A25AA297C8FC91CEFCA2B5FCAD6C04 +0FB712C0A280A36C93C7001FEBC000A2807EA27E807E807E806C7F7E6D7E6D7E6D7F6D01 +E05D6D6D5D6D13FC010001FF4AB5FC6E01E0EB07F9021F01FFEB3FF0020791B5EAE07F02 +01EEC01FDA003FED0007030702F81301DB001F018090C8FC524D79CB61>III76 DII +II82 DI<003FBB12C0A5DA80019038FC001FD9FC001601D8 +7FF09438007FE001C0183F49181F90C7170FA2007E1907A3007C1903A500FC1AF0481901 +A5C894C7FCB3B3A749B812FCA54C4A7CC955>III89 D97 +DI<91380FFF8091B512F8 +010314FF010F15804948C613C0D97FF8EB1FE0D9FFE0EB3FF04849137F4849EBFFF84890 +C7FCA2485A121FA24848EC7FF0EE3FE0EE1FC0007F92C7FC5BA212FFAC127FA27FA2123F +A26C6C153EA26C6C157E177C6C6D14FC6C6D14F86C6D13036C6DEB07F0D97FFCEB1FE06D +B4EBFFC0010F90B5120001035C010014F0020F13802F347CB237>IIIIII<13FCEA03FF487F487FA2487FA66C5BA26C5B6C90C7FCEA00FC90C8 +FCABEB7FC0B5FCA512037EB3B3A2B61280A5194D7BCC22>I108 D<90287FC001FFC0EC7FF0B5010F01FC0103B5FC033F +6D010F804B6D4980DBFE079026803F817F9126C1F801903AC07E007FF00003D9C3E0DAE0 +F8806C9026C78000D9F1E06D7E02CFC7EBF3C002DEEDF780DD7FFF6E7E02FC93C7FC4A5D +A24A5DA34A5DB3AAB6D8C03FB5D8F00FB512FCA55E327BB167>I<903A7FC001FFC0B501 +0F13F8033F7F4B13FFDBFE077F9138C1F00300039026C3E0017F6CD9C78080ECCF0014DE +02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFFE0A53B327BB144>I<913807FF80027F13 +F80103B6FC010F15C090261FFE017F903A7FF0003FF849486D7E480180EB07FE4890C76C +7E4817804980000F17C048486E13E0A2003F17F0A249157F007F17F8A400FF17FCAB007F +17F8A46C6CEDFFF0A2001F17E0A26C6C4A13C0A26C6C4A13806C6D4913006C5E6C01E0EB +1FFC6D6C495A903A3FFE01FFF0010FB612C0010392C7FCD9007F13F80207138036347DB2 +3D>I<90397FC007FFB5017F13E002C1B512FC02C714FF9126CFF80F7F9126DFC0037F00 +0301FFC77F6C496E7E02F8814A6E7E717E4A81831980A28319C0A37113E0AC19C05FA319 +805F19005F606E143F6E5D4D5A6E4A5A02FF495BDBC0075B9126EFF01F5B02E7B548C7FC +02E114F8DAE07F13E0DB0FFEC8FC92CAFCAFB612C0A53B477CB144>I<9039FF803FE0B5 +EBFFF8028113FE02837FDA87E11380EC8F830003D99F0713C06C139E14BCA214F8A24A6C +13806F13006F5A4A90C7FCA45CB3A8B612E0A52A327CB132>114 +D<903907FF8070017FEBF1F048B6FC1207380FFC01391FE0003F4848130F491307127F90 +C71203A2481401A27FA27F01F090C7FC13FCEBFFC06C13FEECFFE06C14FC6C806CECFF80 +6C15C06C15E06C15F06C7E011F14F8010114FCEB000FEC007FED1FFE0078140F00F81407 +15037E1501A27E16FC7E15036D14F86D13076D14F001F8EB1FE001FFEBFFC04890B51280 +486C1400D8F81F13FCD8E00313C027347CB230>I<14F8A51301A41303A21307A2130FA2 +131F133F137F13FF1203000F90B512F0B7FCA426007FF8C7FCB3A7167CAA013F14F880A2 +90391FFE01F0010F1303903907FF87E06DEBFFC06D14806D6C1300EC0FFC26467EC430> +IIII<007FB500C090387FFFE0A5C601F0C73803F8006E5D017F5E6E140701 +3F5E80170F011F5E6E141F6D93C7FC6F5B6D153E6F137E6D157C6F13FCA26D6D5B16016D +5DEDF803027F5CEDFC07023F5CEDFE0F021F5C15FF161F6E91C8FC16BF6E13BE16FE6E5B +A26E5BA36E5BA26F5AA26F5AA26F5AA393C9FC5D153E157E157CD81F8013FC486C5B387F +E001D8FFF05B14035D14074A5A49485A007F133F4948CAFC383F81FE381FFFF86C5B6C13 +C0C648CBFC3B477EB041>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fg cmtt12 17.28 6 +/Fg 6 123 df<913803FFC0023F13FC49B67E010715F04981013F15FE498190B812C048 +8348D9FC0180489026E0001F7F480180130391C87F48486F7E49153F4848ED0FFF834848 +178083496F13C012FF8319E07FA2187FA36C5A6C5A6C5ACBFCA218FFA219C05FA219805F +A24D13005F604D5A173F4D5A4D5AA24C5B4C5B4C5B041F90C7FC4C5A4C5A4C5A4B5B4B5B +4B5B031F5B4B90C8FC4B5AEDFFF84A5B4A5B4A5B021F5B4A90C9FCEC7FFC4A5A495B495B +010F5B495B4948CAFC4948ED1F804948ED3FC04849ED7FE0485B000F5B4890C9FC4890B8 +FC5ABAFCA56C18C06C18803B5A79D94A>50 D<383FFFF0487F80B5FCA37EA27EEA000FB0 +EE0FFC93B57E030714E0031F14F84B14FE92B7FC02FD8291B87E85DCE01F7FEE000703FC +01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A21AE0A219 +7FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A6F130303 +FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0902607F80714C0902603 +F00191C8FC90C8EA3FF043597FD74A>98 D105 D<003FB512FE4880B77EA57E7EC71201B3B3B3 +B0003FB812FC4817FEBAFCA56C17FE6C17FC385877D74A>108 D +112 D<000FB912E04818F04818F8A619F001F0C8000313E04D13C04D13804D13004D5A4D +5A4D5A6C484A5B6C484A5BC9000F5B4C5B4C90C7FC4C5A4C5A4B5B4B5B4B5B4B5B4B5B4B +90C8FC4B5A4B5A4A5B4A5B4A5B4A5B4A5B4A90C9FC4A5A4A5A495B495B495B4949EC07E0 +4949EC0FF04948C8EA1FF8495A495A485B485B485B485B4890C9FC485A48B9FCBAFCA66C +18F06C18E03D3E7BBD4A>122 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fh cmbx12 17.28 28 +/Fh 28 120 df<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007 +C7FCB3B3B3B3007FB91280A6395E74DD51>49 D<913801FFF8021FEBFFC091B612F80103 +15FF010F16C0013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F8 +6E148048486E14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380 +A219FFA283A36C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D +13E0A294B512C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B +13804B90C8FC4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC +7F8092C9FC02FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A +5A5A5A5ABAFCA219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F001 +0FD9C01F13FC90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0 +486D826E806E82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A61 +4C91C7FC604C5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F8 +17FF91C7003F13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A3 +1AC0EA03FCEA0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485B +D81FF85F000F5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90 +B65A011F16F0010716C001014BC8FCD9001F14F0020149C9FC426079DD51>II<4DB5ED03C0057F02F0 +14070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F033F9127F8007FFE +13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A91C9001FB5FC023F01FC +16074A01F08291B54882490280824991CB7E49498449498449498449865D49498490B5FC +484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C7FCA25CA3B5FCB07E +A380A27EA2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E1A00A26C6E616D1BFE6D +7F6F4E5A7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A6E6DEFFF806E01FC4C90 +C7FC020F01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF913803FFE0033F02F8013F +1380030F91B648C8FC030117F86F6C16E004071680DC007F02F8C9FC050191CAFC626677 +E375>67 D72 DI77 +D80 D<001FBEFCA64849C79126E0000F148002E0180091 +C8171F498601F81A0349864986A2491B7FA2491B3F007F1DC090C9181FA4007E1C0FA600 +FE1DE0481C07A5CA95C7FCB3B3B3A3021FBAFCA663617AE070>84 +D<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE001F7FD97FE001077F +D9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7FA26C5B6D5AEB1FC090 +C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE004913F048B512C04891 +C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D7F6EEB01F96C6DD903 +F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E6C6C4B7E011F02FC13 +0F010302F001011400D9001F90CBFC49437CC14E>97 D<903807FF80B6FCA6C6FC7F7FB3 +A8EFFFF8040FEBFF80047F14F00381B612FC038715FF038F010014C0DBBFF0011F7FDBFF +C001077F93C76C7F4B02007F03F8824B6F7E4B6F13804B17C0851BE0A27313F0A21BF8A3 +7313FCA41BFEAE1BFCA44F13F8A31BF0A24F13E0A24F13C06F17804F1300816F4B5A6F4A +5B4AB402075B4A6C6C495B9126F83FE0013F13C09127F00FFC03B55A4A6CB648C7FCDAC0 +0115F84A6C15E091C7001F91C8FC90C8000313E04F657BE35A>I<92380FFFF04AB67E02 +0F15F0023F15FC91B77E01039039FE001FFF4901F8010113804901E0010713C049018049 +13E0017F90C7FC49484A13F0A2485B485B5A5C5A7113E0485B7113C048701380943800FE +0095C7FC485BA4B5FCAE7EA280A27EA2806C18FCA26C6D150119F87E6C6D15036EED07F0 +6C18E06C6D150F6D6DEC1FC06D01E0EC7F806D6DECFF00010701FCEB03FE6D9039FFC03F +FC010091B512F0023F5D020F1580020102FCC7FCDA000F13C03E437BC148>II<92380FFFC0 +4AB512FC020FECFF80023F15E091B712F80103D9FE037F499039F0007FFF011F01C0011F +7F49496D7F4990C76C7F49486E7F48498048844A804884485B727E5A5C48717EA35A5C72 +1380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27EA27E6E160FF11F806C183F6C7FF1 +7F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E04A5A6D6DEC3FE0010301FC49B45A +6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0020092C8FC030713F041437CC14A +>III<903807FF80B6FCA6C6FC7F7FB3A8EF1FFF94B512F0040714 +FC041F14FF4C8193267FE07F7F922781FE001F7FDB83F86D7FDB87F07FDB8FC0814C7F03 +9FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F007B71280A651647BE35A>II<903807FF80B6 +FCA6C6FC7F7FB3B3B3B3ADB712E0A623647BE32C>108 D<902607FF80D91FFFEEFFF8B6 +91B500F00207EBFF80040702FC023F14E0041F02FF91B612F84C6F488193267FE07F6D48 +01037F922781FE001F9027E00FF0007FC6DA83F86D9026F01FC06D7F6DD987F06D4A487F +6DD98FC0DBF87EC7804C6D027C80039FC76E488203BEEEFDF003BC6E4A8003FC04FF834B +5FA24B5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB612FCA67E417BC087>I<902607 +FF80EB1FFFB691B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FC6DA83 +F86D7F6DD987F07F6DD98FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2 +B7D8F007B71280A651417BC05A>I<923807FFE092B6FC020715E0021F15F8027F15FE49 +4848C66C6C7E010701F0010F13E04901C001037F49496D7F4990C87F49486F7E49486F7E +48496F13804819C04A814819E048496F13F0A24819F8A348496F13FCA34819FEA4B518FF +AD6C19FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19E06C6D4B13C0A26C6D4B13806C +6D4B13006D6C4B5A6D6D495B6D6D495B010701F0010F13E06D01FE017F5B010090B7C7FC +023F15FC020715E0020092C8FC030713E048437CC151>I114 D<913A3FFF8007800107B5EAF81F011FECFE7F017F91B5FC48B8FC48EBE0 +014890C7121FD80FFC1407D81FF0801600485A007F167F49153FA212FF171FA27F7F7F6D +92C7FC13FF14E014FF6C14F8EDFFC06C15FC16FF6C16C06C16F06C826C826C826C82013F +1680010F16C01303D9007F15E0020315F0EC001F1500041F13F81607007C150100FC8117 +7F6C163FA2171F7EA26D16F0A27F173F6D16E06D157F6D16C001FEEDFF806D0203130002 +C0EB0FFE02FCEB7FFC01DFB65A010F5DD8FE0315C026F8007F49C7FC48010F13E035437B +C140>II<90 +2607FFC0ED3FFEB60207B5FCA6C6EE00076D826D82B3B3A260A360A2607F60183E6D6D14 +7E4E7F6D6D4948806D6DD907F0ECFF806D01FFEB3FE06D91B55A6E1500021F5C020314F8 +DA003F018002F0C7FC51427BC05A>I119 D +E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fi cmsy10 10.95 1 +/Fi 1 16 df15 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fj cmtt10 10.95 89 +/Fj 89 127 df<121C127FEAFF80B3EA7F00B2123EC7FCA8121C127FA2EAFF80A3EA7F00 +A2121C09396DB830>33 D<00101304007C131F00FEEB3F80A26C137FA248133FB2007E14 +00007C7F003C131E00101304191C75B830>I<903907C007C0A2496C487EA8011F131FA2 +02C05BA3007FB7FCA2B81280A36C16006C5D3A007F807F80A2020090C7FCA9495BA2003F +90B512FE4881B81280A36C1600A22701FC01FCC7FCA300031303A201F85BA76C486C5AA2 +29387DB730>I38 DI<141E147F14FF5BEB03FEEB07FCEB0FF0EB1FE0EB3FC0EB7F80EBFF00 +485A5B12035B485A120F5BA2485AA2123F5BA2127F90C7FCA412FEAD127FA47F123FA27F +121FA26C7EA27F12076C7E7F12017F6C7EEB7F80EB3FC0EB1FE0EB0FF0EB07FCEB03FEEB +01FF7F147F141E184771BE30>I<127812FE7E7F6C7E6C7EEA0FF06C7E6C7E6C7E6C7EEB +7F80133F14C0131FEB0FE014F01307A2EB03F8A214FC1301A214FE1300A4147FAD14FEA4 +130114FCA2130314F8A2EB07F0A2130F14E0EB1FC0133F1480137FEBFF00485A485A485A +485AEA3FE0485A485A90C7FC5A1278184778BE30>I<14E0497E497EA60038EC0380007E +EC0FC0D8FF83EB3FE001C3137F9038F3F9FF267FFBFB13C06CB61280000FECFE00000314 +F86C5C6C6C13C0011F90C7FC017F13C048B512F04880000F14FE003FECFF80267FFBFB13 +C026FFF3F913E09038C3F87F0183133FD87E03EB0FC00038EC0380000091C7FCA66D5A6D +5A23277AAE30>I<143EA2147FAF007FB7FCA2B81280A36C1600A2C76CC8FCAF143EA229 +297DAF30>II<007FB612F0 +A2B712F8A36C15F0A225077B9E30>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0 +EA0F000C0C6E8B30>I<16F01501ED03F8A21507A2ED0FF0A2ED1FE0A2ED3FC0A2ED7F80 +A2EDFF00A24A5AA25D1403A24A5AA24A5AA24A5AA24A5AA24A5AA24AC7FCA2495AA25C13 +03A2495AA2495AA2495AA2495AA2495AA249C8FCA2485AA25B1203A2485AA2485AA2485A +A2485AA2485AA248C9FCA25AA2127CA225477BBE30>I<14FE903807FFC0497F013F13F8 +497F90B57E48EB83FF4848C6138049137F4848EB3FC04848EB1FE049130F001F15F04913 +07A24848EB03F8A290C712014815FCA400FEEC00FEAD6C14016C15FCA36D1303003F15F8 +A26D1307001F15F0A26D130F6C6CEB1FE0A26C6CEB3FC06C6CEB7F806D13FF2601FF8313 +006CEBFFFE6D5B6D5B010F13E06D5BD900FEC7FC273A7CB830>IIIII<000FB612804815C05AA316800180C8FCAEEB83FF019F13C0 +90B512F015FC8181D9FE0313809039F0007FC049133F0180EB1FE06CC7120F000E15F0C8 +1207A216F81503A31218127EA2B4FC150716F048140F6C15E06C141F6DEB3FC06D137F3A +3FE001FF80261FFC0F13006CB55A6C5C6C5C6C14E06C6C1380D90FFCC7FC25397BB730> +II<127CB712FC16FEA416FC48C7EA0FF816F0ED1FE0007CEC3FC0C8EA7F80EDFF00 +A24A5A4A5A5D14075D140F5D4A5AA24A5AA24AC7FCA25C5C13015CA213035CA213075CA4 +495AA6131F5CA96D5A6DC8FC273A7CB830>I<49B4FC011F13F0017F13FC90B57E0003EC +FF804815C048010113E03A1FF8003FF049131FD83FC0EB07F8A24848EB03FC90C71201A5 +6D1303003F15F86D13076C6CEB0FF06C6CEB1FE0D807FCEB7FC03A03FF83FF806C90B512 +006C6C13FC011F13F0497F90B512FE48802607FE0013C0D80FF8EB3FE0D81FE0EB0FF048 +48EB07F8491303007F15FC90C712014815FE481400A66C14016C15FC6D1303003F15F86D +1307D81FF0EB1FF06D133F3A0FFF01FFE06C90B512C06C1580C6ECFE006D5B011F13F001 +0190C7FC273A7CB830>I<49B4FC010F13E0013F13F890B57E4880488048010113803A0F +FC007FC0D81FF0EB3FE04848131F49EB0FF048481307A290C7EA03F85A4815FC1501A416 +FEA37E7E6D130315076C7E6C6C130F6D133FD80FFC13FF6CB6FC7E6C14FE6C14F9013FEB +E1FC010F138190380060011400ED03F8A2150716F0150F000F15E0486C131F486CEB3FC0 +157FEDFF804A1300EC07FE391FF01FFC90B55A6C5C6C5C6C1480C649C7FCEB3FF0273A7C +B830>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F00C7FCAF120FEA3FC0EA +7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C276EA630>II<16F01503ED07F8151F157FEDFFF014034A13C0021F138091383FFE00ECFFF8495B01 +0713C0495BD93FFEC7FC495A3801FFF0485B000F13804890C8FCEA7FFC5BEAFFE05B7FEA +7FF87FEA1FFF6C7F000313E06C7F38007FFC6D7E90380FFF806D7F010113F06D7FEC3FFE +91381FFF80020713C06E13F01400ED7FF8151F1507ED03F01500252F7BB230>I<007FB7 +FCA2B81280A36C16006C5DCBFCA7003FB612FE4881B81280A36C1600A229157DA530>I< +1278127EB4FC13C07FEA7FF813FEEA1FFF6C13C000037F6C13F86C6C7EEB1FFF6D7F0103 +13E06D7F9038007FFC6E7E91380FFF806E13C0020113F080ED3FF8151F153FEDFFF05C02 +0713C04A138091383FFE004A5A903801FFF0495B010F13804990C7FCEB7FFC48485A4813 +E0000F5B4890C8FCEA7FFE13F8EAFFE05B90C9FC127E1278252F7BB230>I64 D<147F4A7EA2497FA449 +7F14F7A401077F14E3A3010F7FA314C1A2011F7FA490383F80FEA590387F007FA4498049 +133F90B6FCA34881A39038FC001F00038149130FA4000781491307A2D87FFFEB7FFFB56C +B51280A46C496C130029397DB830>I<007FB512F0B612FE6F7E82826C813A03F8001FF8 +15076F7E1501A26F7EA615015EA24B5A1507ED1FF0ED7FE090B65A5E4BC7FC6F7E16E082 +9039F8000FF8ED03FC6F7E1500167FA3EE3F80A6167F1700A25E4B5A1503ED1FFC007FB6 +FCB75A5E16C05E6C02FCC7FC29387EB730>I<91387F803C903903FFF03E49EBFC7E011F +13FE49EBFFFE5B9038FFE07F48EB801F3903FE000F484813075B48481303A2484813015B +123F491300A2127F90C8FC167C16005A5AAC7E7EA2167C6D14FE123FA27F121F6D13016C +6C14FCA26C6CEB03F86D13076C6CEB0FF03901FF801F6C9038E07FE06DB512C06D14806D +1400010713FC6D13F09038007FC0273A7CB830>I<003FB512E04814FCB67E6F7E6C816C +813A03F8007FF0ED1FF8150F6F7E6F7E15016F7EA2EE7F80A2163F17C0161FA4EE0FE0AC +161F17C0A3163F1780A2167F17005E4B5A15034B5A150F4B5AED7FF0003FB65A485DB75A +93C7FC6C14FC6C14E02B387FB730>I<007FB7FCB81280A47ED803F8C7123FA8EE1F0093 +C7FCA4157C15FEA490B5FCA6EBF800A4157C92C8FCA5EE07C0EE0FE0A9007FB7FCB8FCA4 +6C16C02B387EB730>I<003FB712804816C0B8FCA27E7ED801FCC7121FA8EE0F8093C7FC +A5153E157FA490B6FCA69038FC007FA4153E92C8FCAE383FFFF8487FB5FCA27E6C5B2A38 +7EB730>I<02FF13F00103EBC0F8010F13F1013F13FD4913FF90B6FC4813C1EC007F4848 +133F4848131F49130F485A491307121F5B123F491303A2127F90C7FC6F5A92C8FC5A5AA8 +92B5FC4A14805CA26C7F6C6D1400ED03F8A27F003F1407A27F121F6D130F120F7F6C6C13 +1FA2D803FE133F6C6C137FECC1FF6C90B5FC7F6D13FB010F13F30103EBC1F0010090C8FC +293A7DB830>I<3B3FFF800FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E0D8 +03F8C7EAFE00B290B6FCA601F8C7FCB3A23B3FFF800FFFE0486D4813F0B56C4813F8A26C +496C13F06C496C13E02D387FB730>I<007FB6FCB71280A46C1500260007F0C7FCB3B3A8 +007FB6FCB71280A46C1500213879B730>I<49B512F04914F85BA27F6D14F090C7EAFE00 +B3B3123C127EB4FCA24A5A1403EB8007397FF01FF86CB55A5D6C5C00075C000149C7FC38 +003FF025397AB730>II<383FFFF8487FB57EA26C5B6C5BD801FCC9FCB3B0EE0F +80EE1FC0A9003FB7FC5AB8FCA27E6C16802A387EB730>III<90383FFFE048B512FC00 +0714FF4815804815C04815E0EBF80001E0133FD87F80EB0FF0A290C71207A44815F84814 +03B3A96C1407A26C15F0A36D130FA26D131F6C6CEB3FE001F813FF90B6FC6C15C06C1580 +6C1500000114FCD8003F13E0253A7BB830>I<007FB512F0B612FE6F7E16E0826C813903 +F8003FED0FFCED03FE15016F7EA2821780163FA6167F17005EA24B5A1503ED0FFCED3FF8 +90B6FC5E5E16804BC7FC15F001F8C9FCB0387FFFC0B57EA46C5B29387EB730>I<90383F +FFE048B512FC000714FF4815804815C04815E0EBF80001E0133F4848EB1FF049130F90C7 +1207A44815F8481403B3A8147E14FE6CEBFF076C15F0EC7F87A2EC3FC7018013CF9038C0 +1FFFD83FE014E0EBF80F90B6FC6C15C06C15806C1500000114FCD8003F7FEB00016E7EA2 +1680157F16C0153F16E0151F16F0150FED07E025467BB830>I<003FB57E4814F0B612FC +15FF6C816C812603F8017F9138003FF0151F6F7E15071503821501A515035E1507150F4B +5A153F4AB45A90B65A5E93C7FC5D8182D9F8007FED3FE0151F150F821507A817F8EEF1FC +A53A3FFF8003FB4801C0EBFFF8B56C7E17F06C496C13E06C49EB7FC0C9EA1F002E397FB7 +30>I<90390FF803C0D97FFF13E048B512C74814F74814FF5A381FF80F383FE001497E48 +48137F90C7123F5A48141FA2150FA37EED07C06C91C7FC7F7FEA3FF0EA1FFEEBFFF06C13 +FF6C14E0000114F86C80011F13FF01031480D9003F13C014019138007FE0151FED0FF0A2 +ED07F8A2007C140312FEA56C140716F07F6DEB0FE06D131F01F8EB3FC001FF13FF91B512 +80160000FD5CD8FC7F13F8D8F81F5BD878011380253A7BB830>I<003FB712C04816E0B8 +FCA43AFE003F800FA8007CED07C0C791C7FCB3B1011FB5FC4980A46D91C7FC2B387EB730 +>I<3B7FFFC007FFFCB56C4813FEA46C496C13FCD803F8C7EA3F80B3B16D147F00011600 +A36C6C14FE6D13016D5CEC800390393FE00FF890391FF83FF06DB55A6D5C6D5C6D91C7FC +9038007FFCEC1FF02F3980B730>III<3A3FFF01FFF84801837F02C77FA202835B6C01015B3A01FC007F806D91C7 +FC00005C6D5BEB7F01EC81FCEB3F8314C3011F5B14E7010F5B14FF6D5BA26D5BA26D5BA2 +6D90C8FCA4497FA2497FA2815B81EB0FE781EB1FC381EB3F8181EB7F0081497F49800001 +143F49800003141F49800007140FD87FFEEB7FFFB590B5128080A25C6C486D130029387D +B730>II<001FB612FC4815FE5AA490C7EA03FCED07F816F0150FED1FE016C0153F +ED7F80003E1500C85A4A5A5D14034A5A5D140F4A5A5D143F4A5A92C7FC5C495A5C130349 +5A5C130F495A5C133F495A91C8FC5B4848147C4914FE1203485A5B120F485A5B123F485A +90B6FCB7FCA46C15FC27387CB730>I<007FB5FCB61280A4150048C8FCB3B3B3A5B6FC15 +80A46C140019476DBE30>I<007FB5FCB61280A47EC7123FB3B3B3A5007FB5FCB6FCA46C +140019477DBE30>93 D<1307EB1FC0EB7FF0497E000313FE000FEBFF80003F14E0D87FFD +13F039FFF07FF8EBC01FEB800F38FE0003007CEB01F00010EB00401D0E77B730>I<007F +B612F0A2B712F8A36C15F0A225077B7D30>I97 +DII<913801FFE04A7F5C +A28080EC0007AAEB03FE90381FFF874913E790B6FC5A5A481303380FFC00D81FF0133F49 +131F485A150F4848130790C7FCA25AA25AA87E6C140FA27F003F141F6D133F6C7E6D137F +390FF801FF2607FE07EBFFC06CB712E06C16F06C14F76D01C713E0011F010313C0D907FC +C8FC2C397DB730>I<49B4FC010713E0011F13F8017F7F90B57E488048018113803A07FC +007FC04848133FD81FE0EB1FE0150F484814F0491307127F90C7FCED03F85A5AB7FCA516 +F048C9FC7E7EA27F003FEC01F06DEB03F86C7E6C7E6D1307D807FEEB1FF03A03FFC07FE0 +6C90B5FC6C15C0013F14806DEBFE00010713F8010013C0252A7CA830>IIII< +14E0EB03F8A2497EA36D5AA2EB00E091C8FCA9381FFFF8487F5AA27E7EEA0001B3A9003F +B612C04815E0B7FCA27E6C15C023397AB830>III<387FFFF8B57EA47EEA0001B3B3A8007FB612F0B712F8A46C15F025387BB7 +30>I<02FC137E3B7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F138726 +07FE07EB03F801FC13FE9039F803FC01A201F013F8A301E013F0B3A23C7FFE0FFF07FF80 +B548018F13C0A46C486C01071380322881A730>II< +49B4FC010F13E0013F13F8497F90B57E0003ECFF8014013A07FC007FC04848EB3FE0D81F +E0EB0FF0A24848EB07F8491303007F15FC90C71201A300FEEC00FEA86C14016C15FCA26D +1303003F15F86D13076D130F6C6CEB1FF06C6CEB3FE06D137F3A07FF01FFC06C90B51280 +6C15006C6C13FC6D5B010F13E0010190C7FC272A7CA830>II<49B413F8010FEBC1FC013F13F14913FD48B6FC5A4813 +81390FFC007F49131F4848130F491307485A491303127F90C7FC15015A5AA77E7E15037F +A26C6C1307150F6C6C131F6C6C133F01FC137F3907FF01FF6C90B5FC6C14FD6C14F9013F +13F1010F13C1903803FE0190C7FCAD92B512F84A14FCA46E14F82E3C7DA730>II<90381FFC1E48B5129F000714FF5A5A5A387FF007EB800100FEC7FC4880A46C143E +007F91C7FC13E06CB4FC6C13FC6CEBFF806C14E0000114F86C6C7F01037F9038000FFF02 +001380007C147F00FEEC1FC0A2150F7EA27F151F6DEB3F806D137F9039FC03FF0090B6FC +5D5D00FC14F0D8F83F13C026780FFEC7FC222A79A830>III<3B3F +FFC07FFF80486DB512C0B515E0A26C16C06C496C13803B01F80003F000A26D130700005D +A26D130F017E5CA2017F131F6D5CA2EC803F011F91C7FCA26E5A010F137EA2ECE0FE0107 +5BA214F101035BA3903801FBF0A314FF6D5BA36E5A6E5A2B277EA630>I<3B3FFFC01FFF +E0486D4813F0B515F8A26C16F06C496C13E0D807E0C7EA3F00A26D5C0003157EA56D14FE +00015DEC0F80EC1FC0EC3FE0A33A00FC7FF1F8A2147DA2ECFDF9017C5C14F8A3017E13FB +A290393FF07FE0A3ECE03FA2011F5C90390F800F802D277FA630>I<3A3FFF81FFFC4801 +C37FB580A26C5D6C01815BC648C66CC7FC137FEC80FE90383F81FC90381FC3F8EB0FE3EC +E7F06DB45A6D5B7F6D5B92C8FC147E147F5C497F81903803F7E0EB07E790380FE3F0ECC1 +F890381F81FC90383F80FE90387F007E017E137F01FE6D7E48486D7E267FFF80B5FCB500 +C1148014E3A214C16C0180140029277DA630>I<3B3FFFC07FFF80486DB512C0B515E0A2 +6C16C06C496C13803B01FC0003F000A2000014076D5C137E150F017F5C7F151FD91F805B +A214C0010F49C7FCA214E00107137EA2EB03F0157C15FCEB01F85DA2EB00F9ECFDF0147D +147FA26E5AA36E5AA35DA2143F92C8FCA25C147EA2000F13FE486C5AEA3FC1EBC3F81387 +EB8FF0EBFFE06C5B5C6C90C9FC6C5AEA01F02B3C7EA630>I<001FB612FC4815FE5AA316 +FC90C7EA0FF8ED1FF0ED3FE0ED7FC0EDFF80003E491300C7485A4A5A4A5A4A5A4A5A4A5A +4A5A4990C7FC495A495A495A495A495A495A4948133E4890C7127F485A485A485A485A48 +5A48B7FCB8FCA46C15FE28277DA630>II< +127CA212FEB3B3B3AD127CA207476CBE30>II<017C13 +3848B4137C48EB80FE4813C14813C348EBEFFC397FEFFFF0D8FF8713E0010713C0486C13 +80D87C0113003838007C1F0C78B730>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fk cmbx12 14.4 49 +/Fk 49 122 df12 D45 DI<157815FC14031407141F14FF130F00 +07B5FCB6FCA2147F13F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>49 +DI<91380FFFC091B512FC0107ECFF80011F15E09026 +3FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D807FC8048B416C080486D15 +E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B +5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113F89238007FFE707E701380 +7013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FC +A25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A1380D80FF84A13006CB44A5A +6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F1380374F7ACD43>I<177C +17FEA2160116031607160FA2161F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C +15FCEC01F815F0EC03E01407EC0FC01580EC1F005C147E147C5C1301495A495A5C495A13 +1F49C7FC133E5B13FC485A5B485A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7 +FCAF020FB712C0A53A4F7CCE43>III<121F7F7FEB +FF8091B81280A45A1900606060A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F +4C5A160F4C5A484B5A4C5A94C8FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FF +A24A90C9FCA25C5D1407A2140FA25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC0 +6E5A395279D043>I<913807FFC0027F13FC0103B67E010F15E090261FFC0113F8903A3F +E0003FFCD97F80EB0FFE49C76C7E48488048486E1380000717C04980120F18E0177FA212 +1F7FA27F7F6E14FF02E015C014F802FE4913806C7FDBC00313009238F007FE6C02F85B92 +38FE1FF86C9138FFBFF06CEDFFE017806C4BC7FC6D806D81010F15E06D81010115FC0107 +81011F81491680EBFFE748018115C048D9007F14E04848011F14F048487F484813030300 +14F8484880161F4848020713FC1601824848157F173FA2171FA2170FA218F8A27F007F17 +F06D151FA26C6CED3FE0001F17C06D157F6C6CEDFF806C6C6C010313006C01E0EB0FFE6C +01FCEBFFFC6C6CB612F06D5D010F1580010102FCC7FCD9000F13C0364F7ACD43>I<9138 +0FFF8091B512F8010314FE010F6E7E4901037F90267FF8007F4948EB3FF048496D7E4849 +80486F7E484980824817805A91C714C05A7013E0A218F0B5FCA318F8A618FCA46C5DA37E +A25E6C7F6C5DA26C5D6C7F6C6D137B6C6D13F390387FF803011FB512E36D14C301030283 +13F89039007FFE03EC00401500A218F05EA3D801F816E0487E486C16C0487E486D491380 +A218005E5F4C5A91C7FC6C484A5A494A5A49495B6C48495BD803FC010F5B9027FF807FFE +C7FC6C90B55A6C6C14F06D14C0010F49C8FC010013F0364F7ACD43>I<91B5FC010F14F8 +017F14FF90B712C00003D9C00F7F2707FC00017FD80FE06D7F48486E7E48C87FD87FE06E +7E7F7F486C1680A66C5A18006C485C6C5AC9485A5F4B5B4B5B4B5B4B5B4B90C7FC16FC4B +5A4B5A16C04B5A93C8FC4A5A5D14035D5D14075DA25D140FA25DAB91CAFCAAEC1FC04A7E +ECFFF8497FA2497FA76D5BA26D5BEC3FE06E5A315479D340>63 D68 DI +I72 D +I<027FB71280A591C76C90C7FCB3B3B3EA07F0EA1FFC487E487EA2B57EA44C5AA34A485B +7E49495BD83FF8495BD81FE05DD80FFC011F5B2707FF807F90C8FC000190B512FC6C6C14 +F0011F14C0010101F8C9FC39537DD145>I76 DI80 +D82 D<91260FFF80130791B5 +00F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5 +FC4848C87E48488149150F001F824981123F4981007F82A28412FF84A27FA26D82A27F7F +6D93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C83 +6C836D826D82010F821303010082021F16801400030F15C0ED007F040714E01600173F05 +0F13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D +5D01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7 +FC48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC1280A59126C0003F +9038C0007F49C71607D87FF8060113C001E08449197F49193F90C8171FA2007E1A0FA300 +7C1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD05E>II87 +D97 +DI<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE0001 +FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F1300705A48 +92C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC +3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49C7FC +020113E033387CB63C>I<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13FC91 +B6FC010315C7010F9038E03FE74990380007F7D97FFC0101B5FC49487F4849143F484980 +485B83485B5A91C8FC5AA3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C +6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9 +003F13F8020301C049C7FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C04901 +817F903A3FFC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C0488191 +C7FC4817E0A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01 +F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE +903A0FFFC03FF8010390B55A010015C0021F49C7FC020113F034387CB63D>IIII<137F497E +000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3 +A6B612E0A51B547BD325>I +107 DIII<913801FFE0021F13FE91B612C0010315F0010F9038 +807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C8 +6C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA2 +6C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF80 +7FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F +13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F +92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F61 +6E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F14 +80031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380F +FF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF +150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114 +D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980 +127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C +816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00 +F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF +C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414 +FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE +07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203 +13802A4D7ECB34>IIII121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fl cmr10 10.95 86 +/Fl 86 124 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907 +F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7 +FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11 +D<4AB4FC021F13C091387F01F0903901FC0078D907F0131C4948133E494813FF49485A13 +7F1400A213FE6F5A163893C7FCAA167FB8FCA33900FE00018182B3AC486CECFF80007FD9 +FC3F13FEA32F407FBF33>I<4AB47E021F13F791387F00FFEB01F8903807F001EB0FE0EB +1FC0EB3F80137F14008101FE80AEB8FCA3C648C77EB3AE486CECFF80007FD9FC3F13FEA3 +2F407FBF33>I<4AB4ECFF80021FD9C00F13E0913B7F01F03F80F8903C01F80078FE003C +D907F0D93FF8130E49484948131F49484948EB7F804948484913FF137F02005CA201FE92 +C7FC6FED7F0070141C96C7FCAAF13F80BBFCA3C648C76CC7FC197F193FB3AC486C4A6CEB +7FC0007FD9FC3FD9FE1FB5FCA348407FBF4C>I<121EEA7F80EAFFC0A9EA7F80ACEA3F00 +AC121EAB120CC7FCA8121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A4179C019>33 +D<001E130F397F803FC000FF137F01C013E0A201E013F0A3007F133F391E600F30000013 +00A401E01370491360A3000114E04913C00003130101001380481303000EEB070048130E +0018130C0038131C003013181C1C7DBE2D>I<013F4C7ED9FFC04B7E2601E0E015072607 +C070150F48486C4B5A023E4BC7FC48486C5D48D90FC0EB01FE003ED90EF0EB07FCDA0F3F +133E007E903A070FFFF8F8007C0200EBC1F0EE000300FC6D6C495A604D5A171F95C8FC17 +3E177E177C5F16015F007C4948485A1607007E5E003E49495A020E131F003F93C9FC6C49 +133E260F803C137E0238137C6C6C485B3901E0E0016CB448485AD93F0049133F90C74848 +EBFFC0030F903801E0E093398007C0704B4848487E4B153C033E90381F001C4B497F03FC +133E4B150F4A48017E7F0203147C5D4A4801FCEB0380140F5D4AC7FC5C143E5C14FC5C49 +5A13034948027CEB07005C4948147E011F033E5B91C8140E013E153F017E6F5B017C9238 +0F803C4917380001706C5A49923801E0E0496FB45A6C48043FC7FC41497BC34C>37 +DI<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113801203 +13005A120E5A1218123812300B1C79BE19>I<1430147014E0EB01C0EB03801307EB0F00 +131E133E133C5B13F85B12015B1203A2485AA2120F5BA2121F90C7FCA25AA3123E127EA6 +127C12FCB2127C127EA6123E123FA37EA27F120FA27F1207A26C7EA212017F12007F1378 +7F133E131E7FEB07801303EB01C0EB00E014701430145A77C323>I<12C07E12707E7E12 +1E7E6C7E7F12036C7E7F12007F1378137CA27FA2133F7FA21480130FA214C0A3130714E0 +A6130314F0B214E01307A614C0130FA31480A2131F1400A25B133EA25BA2137813F85B12 +015B485A12075B48C7FC121E121C5A5A5A5A145A7BC323>II<121EEA7F8012FF13C0A213 +E0A3127FEA1E601200A413E013C0A312011380120313005A120E5A1218123812300B1C79 +8919>44 DI<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A79 +8919>IIIIII<150E151E153EA2157EA215FE1401A21403EC +077E1406140E141CA214381470A214E0EB01C0A2EB0380EB0700A2130E5BA25B5BA25B5B +1201485A90C7FC5A120E120C121C5AA25A5AB8FCA3C8EAFE00AC4A7E49B6FCA3283E7EBD +2D>I<00061403D80780131F01F813FE90B5FC5D5D5D15C092C7FC14FCEB3FE090C9FCAC +EB01FE90380FFF8090383E03E090387001F8496C7E49137E497F90C713800006141FC813 +C0A216E0150FA316F0A3120C127F7F12FFA416E090C7121F12FC007015C012780038EC3F +80123C6CEC7F00001F14FE6C6C485A6C6C485A3903F80FE0C6B55A013F90C7FCEB07F824 +3F7CBC2D>II<1238123C123F90B6 +12FCA316F85A16F016E00078C712010070EC03C0ED078016005D48141E151C153C5DC812 +7015F04A5A5D14034A5A92C7FC5C141EA25CA2147C147814F8A213015C1303A31307A313 +0F5CA2131FA6133FAA6D5A0107C8FC26407BBD2D>III<12 +1EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121EEA7F80A2EAFFC0A4EA7F80A2EA1E00 +0A2779A619>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121E127FEAFF80A213 +C0A4127F121E1200A412011380A3120313005A1206120E120C121C5A1230A20A3979A619 +>I<007FB912E0BA12F0A26C18E0CDFCAE007FB912E0BA12F0A26C18E03C167BA147>61 +D63 D<15074B7EA34B7EA34B7EA34B7EA34B7E15E7A2913801C7FC15C3A291380381 +FEA34AC67EA3020E6D7EA34A6D7EA34A6D7EA34A6D7EA34A6D7EA349486D7E91B6FCA249 +819138800001A249C87EA24982010E157FA2011E82011C153FA2013C820138151FA20178 +82170F13FC00034C7ED80FFF4B7EB500F0010FB512F8A33D417DC044>65 +DII +IIII< +B6D8C01FB512F8A3000101E0C7383FFC0026007F80EC0FF0B3A691B7FCA30280C7120FB3 +A92601FFE0EC3FFCB6D8C01FB512F8A33D3E7DBD44>II<011FB512FCA3D9000713006E5A1401B3B3A6123FEA +7F80EAFFC0A44A5A1380D87F005B007C130700385C003C495A6C495A6C495A2603E07EC7 +FC3800FFF8EB3FC026407CBD2F>IIIIIII +III<003FB91280A3903AF0 +007FE001018090393FC0003F48C7ED1FC0007E1707127C00781703A300701701A548EF00 +E0A5C81600B3B14B7E4B7E0107B612FEA33B3D7DBC42>IIII<007F +B5D8C003B512E0A3C649C7EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E6D6C141C +6D6C143C5F6D6C14706D6D13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC020F5BED +F81E913807FC1C163C6E6C5A913801FF7016F06E5B6F5AA26F7E6F7EA28282153FED3BFE +ED71FF15F103E07F913801C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C6D7E0238 +6D7E14784A6D7E4A6D7F130149486E7E4A6E7E130749C86C7E496F7E497ED9FFC04A7E00 +076DEC7FFFB500FC0103B512FEA33F3E7EBD44>II<003FB712F8A391C7EA1FF013F801E0EC3FE00180EC7FC090C8FC003EED +FF80A2003C4A1300007C4A5A12784B5A4B5AA200704A5AA24B5A4B5AA2C8485A4A90C7FC +A24A5A4A5AA24A5AA24A5A4A5AA24A5A4A5AA24990C8FCA2495A4948141CA2495A495AA2 +495A495A173C495AA24890C8FC485A1778485A484815F8A24848140116034848140F4848 +143FED01FFB8FCA32E3E7BBD38>I +I<486C13C00003130101001380481303000EEB070048130E0018130C0038131C00301318 +0070133800601330A300E01370481360A400CFEB678039FFC07FE001E013F0A3007F133F +A2003F131F01C013E0390F0007801C1C73BE2D>II97 +DI<49B4FC010F13E090383F00F8017C131E4848131F +4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290C9FC5AAB6C7EA3 +003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C6C137890383F01 +F090380FFFC0D901FEC7FC222A7DA828>II +II<167C903903F801 +FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC0600000F6EC7FC +49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E03903FE0FC026071F +FFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15E06C810003813A +0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E157E6C5D6C6C49 +5A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D7EA82D>III<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC147FEB7FFFA313 +017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03F0381E07C0380F +FF803801FC00185185BD1C>II +I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B7803F03C01F80007 +903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91C75B13FF4992C7FC +A2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>I<3901F801FE00FF +903807FFC091381E07E091387803F000079038E001F82603F9C07F0001138001FB6D7E91 +C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14FF010713E090381F +81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F15F04848EB01F8A2 +003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F86C6CEB03F0A26C6C +EB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFFF0010090C7FC282A +7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F03A03FFC001FC6C49 +6C7E91C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0A4EE1FE0A2EE3FC0 +6D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA3FFFC7FCEC07F891 +C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F80F090397F00387C +01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485AA448C7FCAA6C7EA3 +6C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E137990383F81F190380FFFC1 +903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E000FFEB1FF8EC787C +ECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35BB3A5487EB512FEA3 +1F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E1307003C1303127C00 +78130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F6C1480000114C0D8 +003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F07E14016C14E06CEB +03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<131CA6133CA4137CA2 +13FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912009038FE01C0A2EB +7F03013F138090381F8700EB07FEEB01F81B397EB723>IIIIII<001FB61280A2EBE0000180140049485A001E495A121C4A5A003C49 +5A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90393FC00380A2EB7F +80EBFF005A5B484813071207491400485A48485BA248485B4848137F00FF495A90B6FCA2 +21277EA628>II E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fm cmbx12 20.736 9 +/Fm 9 123 df<92380FFFE04AB67E020F15F0027F15FE49B87E4917E0010F17F8013F83 +49D9C01F14FF9027FFFC0001814801E06D6C80480180021F804890C86C8048486F804848 +6F8001FF6F804801C06E8002F081486D18806E816E18C0B5821BE06E81A37214F0A56C5B +A36C5B6C5B6C5B000313C0C690C9FC90CA15E060A34E14C0A21B80601B0060626295B55A +5F624D5C624D5C4D91C7FC614D5B4D13F04D5B6194B55A4C49C8FC4C5B4C5B4C13E04C5B +604C90C9FCEE7FFC4C5A4B5B4B5B4B0180EC0FF04B90C8FC4B5A4B5A4B48ED1FE0EDFFE0 +4A5B4A5B4A90C9FC4A48163F4A5ADA3FF017C05D4A48167F4A5A4990CA12FFD903FC1607 +49BAFC5B4919805B5B90BBFC5A5A5A5A481A005A5ABCFCA462A44C7176F061>50 +D<92383FFFF80207B612E0027F15FC49B87E010717E0011F83499026F0007F13FC4948C7 +000F7F90B502036D7E486E6D806F6D80727F486E6E7F8486727FA28684A26C5C72806C5C +6D90C8FC6D5AEB0FF8EB03E090CAFCA70507B6FC041FB7FC0303B8FC157F0203B9FC021F +ECFE0391B612800103ECF800010F14C04991C7FC017F13FC90B512F04814C0485C4891C8 +FC485B5A485B5C5A5CA2B5FC5CA360A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A48 +14FC6C6ED90FF0ECFFFC6C02E090263FE07F14FE00019139FC03FFC06C91B6487E013F4B +487E010F4B1307010303F01301D9003F0280D9003F13FC020101F8CBFC57507ACE5E>97 +D<903801FFFCB6FCA8C67E131F7FB3ADF0FFFC050FEBFFE0057F14FE0403B77E040F16E0 +043F16F84CD9007F13FE9226FDFFF001077F92B500C001018094C86C13E004FC6F7F4C6F +7F04E06F7F4C6F7F5E747F93C915804B7014C0A27414E0A21DF087A21DF8A31DFC87A41D +FEAF1DFCA4631DF8A31DF098B5FC1DE0A25014C0A26F1980501400705D705F704B5B505B +704B5B04FC4B5BDBE7FE92B55A9226C3FF8001035C038101E0011F49C7FC9226807FFC90 +B55A4B6CB712F04A010F16C04A010393C8FC4A010015F84A023F14C090C9000301F0C9FC +5F797AF76C>I<97380FFFE00607B6FCA8F00003190086B3AD93383FFF800307B512F803 +3F14FF4AB712C0020716F0021F16FC027F9039FE007FFE91B500F0EB0FFF010302800101 +90B5FC4949C87E49498149498149498149498190B548814884484A8192CAFC5AA2485BA2 +5A5C5AA35A5CA4B5FCAF7EA4807EA37EA2807EA26C7F616C6E5D6C606C80616D6D5D6D6D +5D6D6D92B67E6D6D4A15FC010301FF0207EDFFFE6D02C0EB3FFE6D6C9039FC01FFF86E90 +B65A020F16C002031600DA007F14FC030F14E09226007FFEC749C7FC5F797AF76C>100 +D105 D<903801FFFCB6FCA8C67E131F7FB3B3B3B3B3ABB812C0A82A7879F7 +35>108 D<902601FFF891380FFFE0B692B512FE05036E7E050F15E0053F15F84D819327 +01FFF01F7F4CD900077FDC07FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC04 +7E6F7F5EEDF9F85E03FB707F5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A861 +4E79CD6C>110 D<902601FFFCEC7FFEB6020FB512F0057F14FE4CB712C0040716F0041F +82047F16FE93B5C66C7F92B500F0010F14C0C66C0380010380011F4AC76C806D4A6E8004 +F06F7F4C6F7F4C6F7F4C8193C915804B7014C0861DE0A27414F0A27414F8A47513FCA575 +13FEAF5113FCA598B512F8A31DF0621DE0621DC0621D806F5E701800704B5B505B704B5B +7092B55A04FC4A5C704A5C706C010F5C05E0013F49C7FC9227FE7FFC01B55A70B712F004 +0F16C0040393C8FC040015F8053F14C0050301F0C9FC94CCFCB3A6B812E0A85F6F7ACD6C +>112 D<0007BA12FC1AFEA503E0C714FC4AC74814F84801F04A14F05C02804A14E091C8 +4814C04D14805B494B14004D5B4992B55AA24C5C494A5C615E4C5C001F4B5C5B4C91C7FC +4C5B93B55AA24B5CC8485C4B5CA24B5C4B5C4B91C8FCA24B5B92B55AA24A5C4A5C4A4A14 +FFA24A5C4A5C4A91C8FC614A4915FE91B55A495CA2495C494A14035E5B495C4991C81207 +A24949ED0FFC90B55A484A151FA2484A153F484A157F484A15FF1803484A140F4891C812 +3F48490207B5FC91B9FCBB12F8A57E484D7BCC56>122 D E +%EndDVIPSBitmapFont +end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 600dpi +TeXDict begin +%%PaperSize: A4 + +%%EndSetup +%%Page: 1 1 +1 0 bop 150 1318 a Fm(bzip2)64 b(and)g(libbzip2)p 150 +1418 3600 34 v 2010 1515 a Fl(a)31 b(program)f(and)g(library)e(for)i +(data)h(compression)2198 1623 y(cop)m(yrigh)m(t)f(\(C\))h(1996-2000)j +(Julian)28 b(Sew)m(ard)2605 1731 y(v)m(ersion)i(1.0)h(of)g(21)g(Marc)m +(h)g(2000)150 5091 y Fk(Julian)46 b(Sew)l(ard)p 150 5141 +3600 17 v eop +%%Page: 1 2 +1 1 bop 3705 -116 a Fl(1)150 299 y(This)24 b(program,)j +Fj(bzip2)p Fl(,)e(and)g(asso)s(ciated)i(library)c Fj(libbzip2)p +Fl(,)i(are)h(Cop)m(yrigh)m(t)g(\(C\))g(1996-2000)j(Julian)150 +408 y(R)h(Sew)m(ard.)40 b(All)29 b(righ)m(ts)h(reserv)m(ed.)150 +565 y(Redistribution)f(and)i(use)h(in)f(source)h(and)g(binary)e(forms,) +j(with)e(or)h(without)f(mo)s(di\014cation,)g(are)i(p)s(er-)150 +675 y(mitted)d(pro)m(vided)f(that)i(the)f(follo)m(wing)f(conditions)g +(are)i(met:)225 832 y Fi(\017)60 b Fl(Redistributions)26 +b(of)k(source)g(co)s(de)g(m)m(ust)g(retain)f(the)h(ab)s(o)m(v)m(e)h +(cop)m(yrigh)m(t)g(notice,)f(this)f(list)f(of)i(con-)330 +941 y(ditions)e(and)i(the)h(follo)m(wing)e(disclaimer.)225 +1076 y Fi(\017)60 b Fl(The)33 b(origin)f(of)h(this)f(soft)m(w)m(are)j +(m)m(ust)e(not)h(b)s(e)e(misrepresen)m(ted;)i(y)m(ou)g(m)m(ust)f(not)g +(claim)g(that)h(y)m(ou)330 1185 y(wrote)d(the)h(original)d(soft)m(w)m +(are.)44 b(If)31 b(y)m(ou)g(use)g(this)f(soft)m(w)m(are)i(in)e(a)h(pro) +s(duct,)g(an)f(ac)m(kno)m(wledgmen)m(t)330 1295 y(in)f(the)i(pro)s +(duct)e(do)s(cumen)m(tation)h(w)m(ould)f(b)s(e)h(appreciated)g(but)g +(is)f(not)i(required.)225 1429 y Fi(\017)60 b Fl(Altered)21 +b(source)g(v)m(ersions)f(m)m(ust)h(b)s(e)f(plainly)e(mark)m(ed)j(as)g +(suc)m(h,)i(and)d(m)m(ust)h(not)g(b)s(e)f(misrepresen)m(ted)330 +1539 y(as)31 b(b)s(eing)e(the)h(original)f(soft)m(w)m(are.)225 +1674 y Fi(\017)60 b Fl(The)27 b(name)h(of)f(the)h(author)f(ma)m(y)h +(not)g(b)s(e)f(used)g(to)h(endorse)f(or)h(promote)g(pro)s(ducts)e +(deriv)m(ed)g(from)330 1783 y(this)j(soft)m(w)m(are)j(without)d(sp)s +(eci\014c)h(prior)e(written)i(p)s(ermission.)150 1965 +y(THIS)37 b(SOFTW)-10 b(ARE)38 b(IS)f(PR)m(O)m(VIDED)i(BY)g(THE)f(A)m +(UTHOR)g(\\AS)g(IS")g(AND)h(ANY)f(EXPRESS)150 2074 y(OR)31 +b(IMPLIED)h(W)-10 b(ARRANTIES,)31 b(INCLUDING,)i(BUT)f(NOT)f(LIMITED)g +(TO,)h(THE)f(IMPLIED)150 2184 y(W)-10 b(ARRANTIES)27 +b(OF)h(MER)m(CHANT)-8 b(ABILITY)28 b(AND)g(FITNESS)f(F)m(OR)g(A)h(P)-8 +b(AR)g(TICULAR)28 b(PUR-)150 2294 y(POSE)37 b(ARE)g(DISCLAIMED.)h(IN)f +(NO)h(EVENT)f(SHALL)g(THE)g(A)m(UTHOR)h(BE)g(LIABLE)g(F)m(OR)150 +2403 y(ANY)56 b(DIRECT,)f(INDIRECT,)h(INCIDENT)-8 b(AL,)56 +b(SPECIAL,)e(EXEMPLAR)-8 b(Y,)57 b(OR)e(CONSE-)150 2513 +y(QUENTIAL)48 b(D)m(AMA)m(GES)i(\(INCLUDING,)g(BUT)f(NOT)f(LIMITED)g +(TO,)g(PR)m(OCUREMENT)150 2622 y(OF)35 b(SUBSTITUTE)e(GOODS)i(OR)f(SER) +-10 b(VICES;)34 b(LOSS)f(OF)i(USE,)g(D)m(A)-8 b(T)g(A,)36 +b(OR)f(PR)m(OFITS;)f(OR)150 2732 y(BUSINESS)28 b(INTERR)m(UPTION\))g +(HO)m(WEVER)i(CA)m(USED)f(AND)g(ON)g(ANY)g(THEOR)-8 b(Y)29 +b(OF)g(LIA-)150 2842 y(BILITY,)36 b(WHETHER)g(IN)g(CONTRA)m(CT,)g +(STRICT)e(LIABILITY,)i(OR)g(TOR)-8 b(T)35 b(\(INCLUDING)150 +2951 y(NEGLIGENCE)45 b(OR)g(OTHER)-10 b(WISE\))44 b(ARISING)h(IN)g(ANY) +h(W)-10 b(A)i(Y)46 b(OUT)e(OF)i(THE)e(USE)h(OF)150 3061 +y(THIS)29 b(SOFTW)-10 b(ARE,)31 b(EVEN)f(IF)g(AD)m(VISED)i(OF)e(THE)g +(POSSIBILITY)e(OF)j(SUCH)f(D)m(AMA)m(GE.)150 3218 y(Julian)e(Sew)m +(ard,)i(Cam)m(bridge,)g(UK.)150 3374 y Fj(jseward@acm.org)150 +3531 y(http://sourceware.cygnus)o(.com)o(/bzi)o(p2)150 +3688 y(http://www.cacheprof.org)150 3845 y(http://www.muraroa.demon)o +(.co.)o(uk)150 4002 y(bzip2)p Fl(/)p Fj(libbzip2)d Fl(v)m(ersion)j(1.0) +i(of)e(21)h(Marc)m(h)g(2000.)150 4159 y(P)-8 b(A)g(TENTS:)40 +b(T)-8 b(o)40 b(the)g(b)s(est)g(of)g(m)m(y)g(kno)m(wledge,)j +Fj(bzip2)38 b Fl(do)s(es)i(not)g(use)g(an)m(y)g(paten)m(ted)h +(algorithms.)150 4268 y(Ho)m(w)m(ev)m(er,)33 b(I)e(do)f(not)h(ha)m(v)m +(e)h(the)f(resources)g(a)m(v)-5 b(ailable)30 b(to)h(carry)g(out)g(a)g +(full)d(paten)m(t)k(searc)m(h.)42 b(Therefore)150 4378 +y(I)30 b(cannot)h(giv)m(e)g(an)m(y)g(guaran)m(tee)h(of)e(the)h(ab)s(o)m +(v)m(e)g(statemen)m(t.)p eop +%%Page: 2 3 +2 2 bop 150 -116 a Fl(Chapter)30 b(1:)41 b(In)m(tro)s(duction)2591 +b(2)150 299 y Fh(1)80 b(In)l(tro)t(duction)150 555 y +Fj(bzip2)20 b Fl(compresses)h(\014les)f(using)g(the)h(Burro)m +(ws-Wheeler)g(blo)s(c)m(k-sorting)f(text)j(compression)d(algorithm,)150 +665 y(and)33 b(Hu\013man)g(co)s(ding.)50 b(Compression)32 +b(is)h(generally)g(considerably)f(b)s(etter)i(than)f(that)h(ac)m(hiev)m +(ed)h(b)m(y)150 775 y(more)f(con)m(v)m(en)m(tional)g(LZ77/LZ78-based)g +(compressors,)g(and)f(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the) +150 884 y(PPM)c(family)f(of)i(statistical)f(compressors.)150 +1041 y Fj(bzip2)k Fl(is)h(built)e(on)i(top)h(of)g Fj(libbzip2)p +Fl(,)e(a)i(\015exible)e(library)f(for)i(handling)e(compressed)i(data)i +(in)d(the)150 1151 y Fj(bzip2)c Fl(format.)43 b(This)30 +b(man)m(ual)g(describ)s(es)g(b)s(oth)g(ho)m(w)i(to)g(use)f(the)g +(program)g(and)g(ho)m(w)g(to)h(w)m(ork)f(with)150 1260 +y(the)d(library)d(in)m(terface.)41 b(Most)28 b(of)g(the)g(man)m(ual)f +(is)g(dev)m(oted)i(to)f(this)f(library)-8 b(,)26 b(not)i(the)g +(program,)g(whic)m(h)150 1370 y(is)h(go)s(o)s(d)i(news)e(if)h(y)m(our)g +(in)m(terest)h(is)e(only)g(in)h(the)g(program.)150 1527 +y(Chapter)24 b(2)g(describ)s(es)f(ho)m(w)h(to)h(use)f +Fj(bzip2)p Fl(;)h(this)e(is)g(the)i(only)e(part)h(y)m(ou)h(need)f(to)h +(read)f(if)f(y)m(ou)h(just)g(w)m(an)m(t)150 1636 y(to)35 +b(kno)m(w)f(ho)m(w)g(to)g(op)s(erate)h(the)f(program.)51 +b(Chapter)34 b(3)g(describ)s(es)e(the)i(programming)f(in)m(terfaces)h +(in)150 1746 y(detail,)23 b(and)d(Chapter)h(4)h(records)f(some)h +(miscellaneous)e(notes)i(whic)m(h)e(I)h(though)m(t)h(ough)m(t)g(to)g(b) +s(e)f(recorded)150 1855 y(somewhere.)p eop +%%Page: 3 4 +3 3 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(3)150 299 y Fh(2)80 b(Ho)l(w)53 +b(to)g(use)g Fg(bzip2)150 566 y Fl(This)29 b(c)m(hapter)i(con)m(tains)f +(a)h(cop)m(y)g(of)g(the)f Fj(bzip2)f Fl(man)h(page,)h(and)f(nothing)g +(else.)390 818 y Ff(NAME)570 1004 y Fj(bzip2)p Fl(,)f +Fj(bunzip2)g Fl(-)h(a)h(blo)s(c)m(k-sorting)f(\014le)f(compressor,)i +(v1.0)570 1136 y Fj(bzcat)e Fl(-)i(decompresses)f(\014les)f(to)i +(stdout)570 1267 y Fj(bzip2recover)c Fl(-)k(reco)m(v)m(ers)h(data)f +(from)f(damaged)g(bzip2)g(\014les)390 1519 y Ff(SYNOPSIS)570 +1706 y Fj(bzip2)f Fl([)h(-cdfkqstvzVL123456789)35 b(])c([)g +(\014lenames)e(...)41 b(])570 1837 y Fj(bunzip2)28 b +Fl([)j(-fkvsVL)f(])h([)f(\014lenames)g(...)41 b(])570 +1968 y Fj(bzcat)29 b Fl([)h(-s)h(])g([)f(\014lenames)g(...)41 +b(])570 2100 y Fj(bzip2recover)27 b Fl(\014lename)390 +2352 y Ff(DESCRIPTION)390 2538 y Fj(bzip2)i Fl(compresses)i(\014les)f +(using)f(the)i(Burro)m(ws-Wheeler)g(blo)s(c)m(k)f(sorting)g(text)i +(compres-)390 2642 y(sion)40 b(algorithm,)j(and)d(Hu\013man)h(co)s +(ding.)71 b(Compression)40 b(is)g(generally)g(considerably)390 +2746 y(b)s(etter)25 b(than)g(that)h(ac)m(hiev)m(ed)g(b)m(y)f(more)g +(con)m(v)m(en)m(tional)h(LZ77/LZ78-based)g(compressors,)390 +2850 y(and)k(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the)f(PPM)g +(family)f(of)i(statistical)f(compressors.)390 3001 y(The)e +(command-line)e(options)i(are)h(delib)s(erately)d(v)m(ery)i(similar)e +(to)j(those)g(of)f(GNU)h Fj(gzip)p Fl(,)390 3104 y(but)h(they)g(are)h +(not)g(iden)m(tical.)390 3255 y Fj(bzip2)f Fl(exp)s(ects)h(a)g(list)f +(of)h(\014le)f(names)h(to)h(accompan)m(y)h(the)e(command-line)e +(\015ags.)43 b(Eac)m(h)390 3359 y(\014le)e(is)h(replaced)g(b)m(y)g(a)h +(compressed)f(v)m(ersion)g(of)g(itself,)i(with)e(the)g(name)g +Fj(original_)390 3463 y(name.bz2)p Fl(.)49 b(Eac)m(h)34 +b(compressed)g(\014le)f(has)g(the)h(same)g(mo)s(di\014cation)e(date,)k +(p)s(ermissions,)390 3567 y(and,)24 b(when)f(p)s(ossible,)f(o)m +(wnership)f(as)j(the)f(corresp)s(onding)f(original,)h(so)g(that)h +(these)g(prop-)390 3671 y(erties)34 b(can)g(b)s(e)f(correctly)i +(restored)f(at)g(decompression)f(time.)51 b(File)34 b(name)g(handling)d +(is)390 3774 y(naiv)m(e)26 b(in)f(the)i(sense)f(that)h(there)f(is)f(no) +i(mec)m(hanism)e(for)h(preserving)f(original)f(\014le)i(names,)390 +3878 y(p)s(ermissions,)37 b(o)m(wnerships)f(or)h(dates)i(in)d +(\014lesystems)h(whic)m(h)g(lac)m(k)h(these)g(concepts,)j(or)390 +3982 y(ha)m(v)m(e)32 b(serious)d(\014le)g(name)i(length)f +(restrictions,)f(suc)m(h)h(as)h(MS-DOS.)390 4133 y Fj(bzip2)26 +b Fl(and)h Fj(bunzip2)e Fl(will)f(b)m(y)k(default)e(not)i(o)m(v)m +(erwrite)g(existing)e(\014les.)38 b(If)27 b(y)m(ou)h(w)m(an)m(t)g(this) +390 4237 y(to)j(happ)s(en,)e(sp)s(ecify)g(the)i Fj(-f)e +Fl(\015ag.)390 4388 y(If)34 b(no)h(\014le)f(names)g(are)i(sp)s +(eci\014ed,)e Fj(bzip2)f Fl(compresses)i(from)f(standard)g(input)f(to)j +(stan-)390 4491 y(dard)c(output.)49 b(In)32 b(this)g(case,)k +Fj(bzip2)31 b Fl(will)g(decline)h(to)i(write)e(compressed)h(output)g +(to)h(a)390 4595 y(terminal,)29 b(as)i(this)e(w)m(ould)g(b)s(e)h(en)m +(tirely)f(incomprehensible)e(and)j(therefore)h(p)s(oin)m(tless.)390 +4746 y Fj(bunzip2)36 b Fl(\(or)j Fj(bzip2)29 b(-d)p Fl(\))37 +b(decompresses)i(all)e(sp)s(eci\014ed)f(\014les.)63 b(Files)37 +b(whic)m(h)g(w)m(ere)i(not)390 4850 y(created)e(b)m(y)f +Fj(bzip2)f Fl(will)e(b)s(e)i(detected)j(and)d(ignored,)i(and)e(a)i(w)m +(arning)d(issued.)56 b Fj(bzip2)390 4954 y Fl(attempts)31 +b(to)f(guess)g(the)g(\014lename)f(for)h(the)g(decompressed)f(\014le)g +(from)h(that)g(of)g(the)g(com-)390 5058 y(pressed)f(\014le)h(as)h +(follo)m(ws:)570 5209 y Fj(filename.bz2)57 b Fl(b)s(ecomes)31 +b Fj(filename)570 5340 y(filename.bz)58 b Fl(b)s(ecomes)30 +b Fj(filename)p eop +%%Page: 4 5 +4 4 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(4)570 299 y Fj(filename.tbz2)27 +b Fl(b)s(ecomes)j Fj(filename.tar)570 470 y(filename.tbz)57 +b Fl(b)s(ecomes)31 b Fj(filename.tar)570 641 y(anyothername)57 +b Fl(b)s(ecomes)31 b Fj(anyothername.out)390 859 y Fl(If)j(the)h +(\014le)e(do)s(es)i(not)f(end)g(in)f(one)i(of)g(the)g(recognised)f +(endings,)g Fj(.bz2)p Fl(,)h Fj(.bz)p Fl(,)g Fj(.tbz2)e +Fl(or)390 963 y Fj(.tbz)p Fl(,)h Fj(bzip2)f Fl(complains)f(that)j(it)e +(cannot)i(guess)f(the)g(name)h(of)f(the)g(original)e(\014le,)j(and)390 +1067 y(uses)30 b(the)g(original)f(name)h(with)g Fj(.out)f +Fl(app)s(ended.)390 1218 y(As)j(with)f(compression,)h(supplying)c(no)k +(\014lenames)f(causes)i(decompression)e(from)h(stan-)390 +1321 y(dard)d(input)g(to)i(standard)e(output.)390 1472 +y Fj(bunzip2)k Fl(will)g(correctly)j(decompress)e(a)i(\014le)e(whic)m +(h)g(is)h(the)g(concatenation)i(of)e(t)m(w)m(o)i(or)390 +1576 y(more)j(compressed)f(\014les.)67 b(The)39 b(result)g(is)g(the)g +(concatenation)i(of)f(the)g(corresp)s(onding)390 1680 +y(uncompressed)c(\014les.)59 b(In)m(tegrit)m(y)38 b(testing)f(\()p +Fj(-t)p Fl(\))g(of)g(concatenated)i(compressed)e(\014les)f(is)390 +1784 y(also)30 b(supp)s(orted.)390 1935 y(Y)-8 b(ou)40 +b(can)g(also)f(compress)g(or)g(decompress)g(\014les)g(to)h(the)f +(standard)g(output)g(b)m(y)g(giving)390 2039 y(the)30 +b Fj(-c)g Fl(\015ag.)40 b(Multiple)28 b(\014les)h(ma)m(y)i(b)s(e)e +(compressed)h(and)f(decompressed)h(lik)m(e)f(this.)39 +b(The)390 2142 y(resulting)31 b(outputs)i(are)h(fed)f(sequen)m(tially)f +(to)i(stdout.)49 b(Compression)32 b(of)h(m)m(ultiple)e(\014les)390 +2246 y(in)24 b(this)g(manner)h(generates)h(a)g(stream)f(con)m(taining)g +(m)m(ultiple)e(compressed)i(\014le)f(represen-)390 2350 +y(tations.)58 b(Suc)m(h)36 b(a)g(stream)g(can)h(b)s(e)e(decompressed)h +(correctly)h(only)e(b)m(y)h Fj(bzip2)e Fl(v)m(ersion)390 +2454 y(0.9.0)g(or)e(later.)47 b(Earlier)30 b(v)m(ersions)i(of)g +Fj(bzip2)f Fl(will)f(stop)i(after)h(decompressing)e(the)i(\014rst)390 +2558 y(\014le)c(in)h(the)g(stream.)390 2709 y Fj(bzcat)f +Fl(\(or)i Fj(bzip2)e(-dc)p Fl(\))g(decompresses)i(all)e(sp)s(eci\014ed) +g(\014les)g(to)i(the)g(standard)e(output.)390 2860 y +Fj(bzip2)f Fl(will)g(read)i(argumen)m(ts)g(from)f(the)h(en)m(vironmen)m +(t)g(v)-5 b(ariables)28 b Fj(BZIP2)h Fl(and)g Fj(BZIP)p +Fl(,)g(in)390 2963 y(that)24 b(order,)g(and)f(will)e(pro)s(cess)i(them) +g(b)s(efore)g(an)m(y)h(argumen)m(ts)f(read)h(from)f(the)g(command)390 +3067 y(line.)39 b(This)29 b(giv)m(es)h(a)h(con)m(v)m(enien)m(t)h(w)m(a) +m(y)f(to)g(supply)d(default)i(argumen)m(ts.)390 3218 +y(Compression)h(is)h(alw)m(a)m(ys)i(p)s(erformed,)e(ev)m(en)h(if)f(the) +h(compressed)g(\014le)f(is)g(sligh)m(tly)f(larger)390 +3322 y(than)26 b(the)g(original.)38 b(Files)25 b(of)h(less)g(than)g(ab) +s(out)g(one)g(h)m(undred)e(b)m(ytes)j(tend)f(to)h(get)g(larger,)390 +3426 y(since)34 b(the)g(compression)f(mec)m(hanism)h(has)f(a)i(constan) +m(t)g(o)m(v)m(erhead)h(in)d(the)h(region)g(of)g(50)390 +3529 y(b)m(ytes.)54 b(Random)34 b(data)h(\(including)d(the)i(output)h +(of)f(most)h(\014le)f(compressors\))h(is)e(co)s(ded)390 +3633 y(at)e(ab)s(out)f(8.05)i(bits)d(p)s(er)h(b)m(yte,)h(giving)e(an)h +(expansion)g(of)g(around)g(0.5\045.)390 3784 y(As)h(a)g(self-c)m(hec)m +(k)h(for)e(y)m(our)h(protection,)g Fj(bzip2)f Fl(uses)g(32-bit)h(CR)m +(Cs)f(to)i(mak)m(e)f(sure)f(that)390 3888 y(the)45 b(decompressed)f(v)m +(ersion)g(of)g(a)h(\014le)e(is)h(iden)m(tical)f(to)i(the)g(original.)81 +b(This)43 b(guards)390 3992 y(against)i(corruption)e(of)h(the)h +(compressed)f(data,)49 b(and)44 b(against)h(undetected)g(bugs)e(in)390 +4096 y Fj(bzip2)35 b Fl(\(hop)s(efully)e(v)m(ery)k(unlik)m(ely\).)56 +b(The)36 b(c)m(hances)h(of)f(data)h(corruption)e(going)h(unde-)390 +4199 y(tected)g(is)e(microscopic,)h(ab)s(out)f(one)h(c)m(hance)g(in)f +(four)g(billion)d(for)j(eac)m(h)i(\014le)d(pro)s(cessed.)390 +4303 y(Be)38 b(a)m(w)m(are,)k(though,)d(that)f(the)g(c)m(hec)m(k)i(o)s +(ccurs)d(up)s(on)f(decompression,)j(so)f(it)f(can)h(only)390 +4407 y(tell)28 b(y)m(ou)g(that)i(something)d(is)h(wrong.)40 +b(It)28 b(can't)i(help)d(y)m(ou)i(reco)m(v)m(er)h(the)e(original)f +(uncom-)390 4511 y(pressed)h(data.)41 b(Y)-8 b(ou)30 +b(can)f(use)g Fj(bzip2recover)d Fl(to)k(try)f(to)h(reco)m(v)m(er)h +(data)f(from)e(damaged)390 4614 y(\014les.)390 4766 y(Return)22 +b(v)-5 b(alues:)37 b(0)23 b(for)g(a)g(normal)f(exit,)j(1)e(for)g(en)m +(vironmen)m(tal)f(problems)f(\(\014le)i(not)g(found,)390 +4869 y(in)m(v)-5 b(alid)30 b(\015ags,)k(I/O)f(errors,)g(&c\),)h(2)f(to) +g(indicate)f(a)h(corrupt)f(compressed)h(\014le,)f(3)i(for)e(an)390 +4973 y(in)m(ternal)d(consistency)h(error)g(\(eg,)i(bug\))e(whic)m(h)f +(caused)i Fj(bzip2)e Fl(to)i(panic.)390 5304 y Ff(OPTIONS)p +eop +%%Page: 5 6 +5 5 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(5)390 299 y Fj(-c)30 +b(--stdout)870 403 y Fl(Compress)f(or)i(decompress)f(to)h(standard)e +(output.)390 557 y Fj(-d)h(--decompress)870 661 y Fl(F)-8 +b(orce)44 b(decompression.)77 b Fj(bzip2)p Fl(,)44 b +Fj(bunzip2)d Fl(and)h Fj(bzcat)f Fl(are)i(really)f(the)870 +764 y(same)27 b(program,)h(and)e(the)i(decision)d(ab)s(out)i(what)g +(actions)g(to)h(tak)m(e)g(is)e(done)870 868 y(on)k(the)h(basis)e(of)i +(whic)m(h)e(name)h(is)g(used.)40 b(This)28 b(\015ag)j(o)m(v)m(errides)f +(that)h(mec)m(h-)870 972 y(anism,)e(and)h(forces)h(bzip2)e(to)i +(decompress.)390 1126 y Fj(-z)f(--compress)870 1230 y +Fl(The)39 b(complemen)m(t)h(to)g Fj(-d)p Fl(:)59 b(forces)40 +b(compression,)h(regardless)d(of)i(the)g(in-)870 1334 +y(v)m(ok)-5 b(ation)31 b(name.)390 1488 y Fj(-t)f(--test)8 +b Fl(Chec)m(k)33 b(in)m(tegrit)m(y)j(of)f(the)g(sp)s(eci\014ed)e +(\014le\(s\),)k(but)d(don't)h(decompress)g(them.)870 +1591 y(This)40 b(really)g(p)s(erforms)g(a)i(trial)e(decompression)h +(and)g(thro)m(ws)g(a)m(w)m(a)m(y)j(the)870 1695 y(result.)390 +1849 y Fj(-f)30 b(--force)870 1953 y Fl(F)-8 b(orce)31 +b(o)m(v)m(erwrite)f(of)g(output)f(\014les.)40 b(Normally)-8 +b(,)29 b Fj(bzip2)f Fl(will)f(not)j(o)m(v)m(erwrite)870 +2057 y(existing)e(output)g(\014les.)39 b(Also)28 b(forces)h +Fj(bzip2)e Fl(to)i(break)g(hard)e(links)f(to)k(\014les,)870 +2161 y(whic)m(h)f(it)h(otherwise)g(w)m(ouldn't)f(do.)390 +2315 y Fj(-k)h(--keep)8 b Fl(Keep)24 b(\(don't)i(delete\))h(input)d +(\014les)g(during)g(compression)h(or)h(decompression.)390 +2469 y Fj(-s)k(--small)870 2573 y Fl(Reduce)23 b(memory)f(usage,)j(for) +d(compression,)h(decompression)f(and)g(testing.)870 2676 +y(Files)f(are)i(decompressed)e(and)h(tested)h(using)e(a)h(mo)s +(di\014ed)e(algorithm)h(whic)m(h)870 2780 y(only)30 b(requires)g(2.5)j +(b)m(ytes)f(p)s(er)e(blo)s(c)m(k)h(b)m(yte.)44 b(This)30 +b(means)h(an)m(y)h(\014le)e(can)i(b)s(e)870 2884 y(decompressed)d(in)f +(2300k)j(of)e(memory)-8 b(,)30 b(alb)s(eit)e(at)i(ab)s(out)f(half)g +(the)g(normal)870 2988 y(sp)s(eed.)870 3117 y(During)42 +b(compression,)k Fj(-s)d Fl(selects)h(a)g(blo)s(c)m(k)g(size)f(of)h +(200k,)k(whic)m(h)42 b(lim-)870 3220 y(its)33 b(memory)g(use)g(to)h +(around)e(the)i(same)f(\014gure,)h(at)g(the)g(exp)s(ense)f(of)g(y)m +(our)870 3324 y(compression)g(ratio.)50 b(In)33 b(short,)i(if)d(y)m +(our)i(mac)m(hine)f(is)g(lo)m(w)g(on)h(memory)f(\(8)870 +3428 y(megab)m(ytes)42 b(or)e(less\),)j(use)d(-s)g(for)g(ev)m +(erything.)71 b(See)40 b(MEMOR)-8 b(Y)41 b(MAN-)870 3532 +y(A)m(GEMENT)31 b(b)s(elo)m(w.)390 3686 y Fj(-q)f(--quiet)870 +3790 y Fl(Suppress)j(non-essen)m(tial)j(w)m(arning)e(messages.)58 +b(Messages)38 b(p)s(ertaining)33 b(to)870 3893 y(I/O)d(errors)g(and)g +(other)h(critical)e(ev)m(en)m(ts)j(will)27 b(not)k(b)s(e)f(suppressed.) +390 4047 y Fj(-v)g(--verbose)870 4151 y Fl(V)-8 b(erb)s(ose)28 +b(mo)s(de)f({)i(sho)m(w)e(the)h(compression)f(ratio)h(for)f(eac)m(h)i +(\014le)e(pro)s(cessed.)870 4255 y(F)-8 b(urther)30 b +Fj(-v)p Fl('s)g(increase)g(the)g(v)m(erb)s(osit)m(y)g(lev)m(el,)h(sp)s +(ewing)d(out)j(lots)f(of)g(infor-)870 4359 y(mation)g(whic)m(h)f(is)h +(primarily)d(of)j(in)m(terest)h(for)f(diagnostic)g(purp)s(oses.)390 +4513 y Fj(-L)g(--license)e(-V)h(--version)870 4617 y +Fl(Displa)m(y)h(the)g(soft)m(w)m(are)i(v)m(ersion,)e(license)f(terms)i +(and)e(conditions.)390 4771 y Fj(-1)h(to)g(-9)72 b Fl(Set)35 +b(the)g(blo)s(c)m(k)f(size)h(to)g(100)h(k,)g(200)g(k)f(..)53 +b(900)36 b(k)f(when)f(compressing.)53 b(Has)870 4875 +y(no)41 b(e\013ect)h(when)d(decompressing.)71 b(See)41 +b(MEMOR)-8 b(Y)41 b(MANA)m(GEMENT)870 4978 y(b)s(elo)m(w.)390 +5132 y Fj(--)324 b Fl(T)-8 b(reats)25 b(all)e(subsequen)m(t)g(argumen)m +(ts)i(as)f(\014le)g(names,)h(ev)m(en)g(if)e(they)i(start)f(with)870 +5236 y(a)32 b(dash.)43 b(This)29 b(is)h(so)i(y)m(ou)g(can)f(handle)f +(\014les)g(with)g(names)i(b)s(eginning)c(with)870 5340 +y(a)j(dash,)f(for)g(example:)40 b Fj(bzip2)29 b(--)h(-myfilename)p +Fl(.)p eop +%%Page: 6 7 +6 6 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(6)390 299 y Fj(--repetitive-fast)390 +427 y(--repetitive-best)870 530 y Fl(These)34 b(\015ags)g(are)h +(redundan)m(t)e(in)g(v)m(ersions)g(0.9.5)j(and)e(ab)s(o)m(v)m(e.)53 +b(They)34 b(pro-)870 634 y(vided)h(some)i(coarse)g(con)m(trol)g(o)m(v)m +(er)g(the)g(b)s(eha)m(viour)e(of)h(the)g(sorting)g(algo-)870 +738 y(rithm)h(in)h(earlier)g(v)m(ersions,)j(whic)m(h)d(w)m(as)h +(sometimes)h(useful.)65 b(0.9.5)41 b(and)870 842 y(ab)s(o)m(v)m(e)34 +b(ha)m(v)m(e)g(an)f(impro)m(v)m(ed)g(algorithm)f(whic)m(h)f(renders)h +(these)h(\015ags)h(irrel-)870 946 y(ev)-5 b(an)m(t.)390 +1190 y Ff(MEMOR)-10 b(Y)40 b(MANA)m(GEMENT)390 1377 y +Fj(bzip2)25 b Fl(compresses)i(large)g(\014les)e(in)g(blo)s(c)m(ks.)39 +b(The)26 b(blo)s(c)m(k)h(size)f(a\013ects)i(b)s(oth)e(the)h(compres-) +390 1481 y(sion)39 b(ratio)g(ac)m(hiev)m(ed,)k(and)d(the)f(amoun)m(t)i +(of)e(memory)h(needed)f(for)h(compression)f(and)390 1585 +y(decompression.)59 b(The)36 b(\015ags)h Fj(-1)f Fl(through)h +Fj(-9)f Fl(sp)s(ecify)f(the)i(blo)s(c)m(k)g(size)f(to)i(b)s(e)e +(100,000)390 1688 y(b)m(ytes)29 b(through)e(900,000)k(b)m(ytes)d(\(the) +h(default\))e(resp)s(ectiv)m(ely)-8 b(.)40 b(A)m(t)29 +b(decompression)e(time,)390 1792 y(the)32 b(blo)s(c)m(k)g(size)g(used)g +(for)g(compression)f(is)g(read)h(from)g(the)g(header)g(of)h(the)f +(compressed)390 1896 y(\014le,)j(and)f Fj(bunzip2)e Fl(then)i(allo)s +(cates)h(itself)e(just)h(enough)g(memory)g(to)i(decompress)e(the)390 +2000 y(\014le.)39 b(Since)29 b(blo)s(c)m(k)g(sizes)g(are)h(stored)f(in) +f(compressed)h(\014les,)g(it)g(follo)m(ws)f(that)i(the)g(\015ags)g +Fj(-1)390 2103 y Fl(to)h Fj(-9)f Fl(are)h(irrelev)-5 +b(an)m(t)29 b(to)i(and)f(so)h(ignored)e(during)f(decompression.)390 +2255 y(Compression)h(and)g(decompression)h(requiremen)m(ts,)f(in)g(b)m +(ytes,)j(can)e(b)s(e)g(estimated)h(as:)869 2406 y Fj(Compression:)140 +b(400k)46 b(+)i(\()f(8)h(x)f(block)f(size)h(\))869 2613 +y(Decompression:)d(100k)i(+)i(\()f(4)h(x)f(block)f(size)h(\),)g(or)1585 +2717 y(100k)f(+)i(\()f(2.5)g(x)g(block)g(size)f(\))390 +2868 y Fl(Larger)29 b(blo)s(c)m(k)f(sizes)h(giv)m(e)g(rapidly)d +(diminishing)e(marginal)k(returns.)39 b(Most)29 b(of)g(the)g(com-)390 +2972 y(pression)d(comes)j(from)f(the)g(\014rst)g(t)m(w)m(o)h(or)f +(three)h(h)m(undred)d(k)i(of)g(blo)s(c)m(k)g(size,)g(a)h(fact)g(w)m +(orth)390 3075 y(b)s(earing)j(in)f(mind)g(when)h(using)f +Fj(bzip2)h Fl(on)g(small)g(mac)m(hines.)47 b(It)33 b(is)f(also)h(imp)s +(ortan)m(t)f(to)390 3179 y(appreciate)j(that)h(the)f(decompression)f +(memory)h(requiremen)m(t)f(is)h(set)g(at)h(compression)390 +3283 y(time)30 b(b)m(y)g(the)h(c)m(hoice)g(of)g(blo)s(c)m(k)f(size.)390 +3434 y(F)-8 b(or)45 b(\014les)f(compressed)g(with)g(the)g(default)g +(900k)i(blo)s(c)m(k)e(size,)49 b Fj(bunzip2)42 b Fl(will)g(require)390 +3538 y(ab)s(out)29 b(3700)j(kb)m(ytes)e(to)h(decompress.)40 +b(T)-8 b(o)30 b(supp)s(ort)e(decompression)h(of)h(an)m(y)g(\014le)f(on) +g(a)i(4)390 3642 y(megab)m(yte)h(mac)m(hine,)d Fj(bunzip2)f +Fl(has)i(an)g(option)f(to)i(decompress)e(using)g(appro)m(ximately)390 +3745 y(half)k(this)g(amoun)m(t)i(of)f(memory)-8 b(,)36 +b(ab)s(out)e(2300)i(kb)m(ytes.)53 b(Decompression)34 +b(sp)s(eed)g(is)f(also)390 3849 y(halv)m(ed,)i(so)f(y)m(ou)h(should)d +(use)h(this)g(option)h(only)f(where)h(necessary)-8 b(.)53 +b(The)33 b(relev)-5 b(an)m(t)35 b(\015ag)390 3953 y(is)29 +b Fj(-s)p Fl(.)390 4104 y(In)34 b(general,)i(try)f(and)f(use)g(the)h +(largest)h(blo)s(c)m(k)e(size)h(memory)f(constrain)m(ts)h(allo)m(w,)h +(since)390 4208 y(that)45 b(maximises)f(the)h(compression)f(ac)m(hiev)m +(ed.)85 b(Compression)43 b(and)h(decompression)390 4311 +y(sp)s(eed)30 b(are)g(virtually)e(una\013ected)j(b)m(y)f(blo)s(c)m(k)g +(size.)390 4463 y(Another)25 b(signi\014can)m(t)f(p)s(oin)m(t)g +(applies)f(to)j(\014les)e(whic)m(h)g(\014t)h(in)e(a)j(single)d(blo)s(c) +m(k)i({)g(that)h(means)390 4566 y(most)g(\014les)g(y)m(ou'd)g(encoun)m +(ter)h(using)d(a)j(large)f(blo)s(c)m(k)g(size.)39 b(The)25 +b(amoun)m(t)i(of)f(real)g(memory)390 4670 y(touc)m(hed)38 +b(is)e(prop)s(ortional)f(to)j(the)f(size)g(of)h(the)f(\014le,)h(since)f +(the)g(\014le)g(is)f(smaller)g(than)h(a)390 4774 y(blo)s(c)m(k.)49 +b(F)-8 b(or)35 b(example,)f(compressing)e(a)i(\014le)e(20,000)k(b)m +(ytes)e(long)f(with)f(the)i(\015ag)g Fj(-9)f Fl(will)390 +4878 y(cause)28 b(the)f(compressor)g(to)h(allo)s(cate)f(around)f(7600k) +j(of)e(memory)-8 b(,)28 b(but)f(only)f(touc)m(h)i(400k)390 +4981 y Fj(+)h Fl(20000)j(*)e(8)g(=)f(560)i(kb)m(ytes)f(of)g(it.)40 +b(Similarly)-8 b(,)26 b(the)k(decompressor)f(will)e(allo)s(cate)j +(3700k)390 5085 y(but)g(only)f(touc)m(h)i(100k)h Fj(+)e +Fl(20000)i(*)f(4)g(=)f(180)i(kb)m(ytes.)390 5236 y(Here)41 +b(is)f(a)i(table)f(whic)m(h)e(summarises)g(the)j(maxim)m(um)d(memory)i +(usage)h(for)e(di\013eren)m(t)390 5340 y(blo)s(c)m(k)25 +b(sizes.)38 b(Also)25 b(recorded)g(is)f(the)i(total)g(compressed)e +(size)h(for)g(14)h(\014les)e(of)i(the)f(Calgary)p eop +%%Page: 7 8 +7 7 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(7)390 299 y(T)-8 b(ext)38 +b(Compression)d(Corpus)h(totalling)h(3,141,622)k(b)m(ytes.)61 +b(This)36 b(column)g(giv)m(es)i(some)390 403 y(feel)23 +b(for)f(ho)m(w)h(compression)f(v)-5 b(aries)23 b(with)e(blo)s(c)m(k)i +(size.)38 b(These)23 b(\014gures)f(tend)g(to)i(understate)390 +506 y(the)g(adv)-5 b(an)m(tage)26 b(of)e(larger)f(blo)s(c)m(k)h(sizes)f +(for)h(larger)f(\014les,)h(since)g(the)g(Corpus)e(is)h(dominated)390 +610 y(b)m(y)30 b(smaller)f(\014les.)1107 761 y Fj(Compress)141 +b(Decompress)g(Decompress)f(Corpus)773 865 y(Flag)238 +b(usage)285 b(usage)332 b(-s)48 b(usage)237 b(Size)821 +1073 y(-1)286 b(1200k)332 b(500k)429 b(350k)285 b(914704)821 +1176 y(-2)h(2000k)332 b(900k)429 b(600k)285 b(877703)821 +1280 y(-3)h(2800k)f(1300k)428 b(850k)285 b(860338)821 +1384 y(-4)h(3600k)f(1700k)380 b(1100k)285 b(846899)821 +1488 y(-5)h(4400k)f(2100k)380 b(1350k)285 b(845160)821 +1591 y(-6)h(5200k)f(2500k)380 b(1600k)285 b(838626)821 +1695 y(-7)h(6100k)f(2900k)380 b(1850k)285 b(834096)821 +1799 y(-8)h(6800k)f(3300k)380 b(2100k)285 b(828642)821 +1903 y(-9)h(7600k)f(3700k)380 b(2350k)285 b(828642)390 +2147 y Ff(RECO)m(VERING)37 b(D)m(A)-10 b(T)g(A)40 b(FR)m(OM)h(D)m(AMA)m +(GED)e(FILES)390 2333 y Fj(bzip2)25 b Fl(compresses)h(\014les)g(in)f +(blo)s(c)m(ks,)h(usually)e(900kb)m(ytes)29 b(long.)39 +b(Eac)m(h)27 b(blo)s(c)m(k)e(is)h(handled)390 2437 y(indep)s(enden)m +(tly)-8 b(.)47 b(If)32 b(a)i(media)e(or)h(transmission)e(error)i +(causes)h(a)f(m)m(ulti-blo)s(c)m(k)f Fj(.bz2)g Fl(\014le)390 +2541 y(to)k(b)s(ecome)h(damaged,)g(it)e(ma)m(y)i(b)s(e)e(p)s(ossible)e +(to)k(reco)m(v)m(er)g(data)f(from)g(the)f(undamaged)390 +2645 y(blo)s(c)m(ks)30 b(in)f(the)h(\014le.)390 2796 +y(The)j(compressed)h(represen)m(tation)f(of)h(eac)m(h)h(blo)s(c)m(k)e +(is)g(delimited)e(b)m(y)j(a)g(48-bit)g(pattern,)390 2900 +y(whic)m(h)27 b(mak)m(es)j(it)e(p)s(ossible)e(to)j(\014nd)e(the)i(blo)s +(c)m(k)f(b)s(oundaries)e(with)i(reasonable)g(certain)m(t)m(y)-8 +b(.)390 3003 y(Eac)m(h)34 b(blo)s(c)m(k)f(also)g(carries)g(its)g(o)m +(wn)g(32-bit)g(CR)m(C,)h(so)f(damaged)h(blo)s(c)m(ks)f(can)g(b)s(e)g +(distin-)390 3107 y(guished)c(from)h(undamaged)g(ones.)390 +3258 y Fj(bzip2recover)37 b Fl(is)j(a)h(simple)e(program)h(whose)g +(purp)s(ose)f(is)h(to)i(searc)m(h)f(for)f(blo)s(c)m(ks)g(in)390 +3362 y Fj(.bz2)34 b Fl(\014les,)i(and)f(write)f(eac)m(h)j(blo)s(c)m(k)d +(out)i(in)m(to)f(its)g(o)m(wn)g Fj(.bz2)f Fl(\014le.)55 +b(Y)-8 b(ou)36 b(can)f(then)g(use)390 3466 y Fj(bzip2)29 +b(-t)c Fl(to)i(test)f(the)g(in)m(tegrit)m(y)g(of)g(the)g(resulting)e +(\014les,)i(and)f(decompress)h(those)g(whic)m(h)390 3569 +y(are)31 b(undamaged.)390 3721 y Fj(bzip2recover)41 b +Fl(tak)m(es)46 b(a)f(single)e(argumen)m(t,)49 b(the)44 +b(name)h(of)g(the)f(damaged)h(\014le,)j(and)390 3824 +y(writes)33 b(a)i(n)m(um)m(b)s(er)d(of)j(\014les)e Fj(rec0001file.bz2)p +Fl(,)e Fj(rec0002file.bz2)p Fl(,)g(etc,)36 b(con)m(taining)390 +3928 y(the)42 b(extracted)g(blo)s(c)m(ks.)74 b(The)41 +b(output)g(\014lenames)f(are)i(designed)e(so)i(that)g(the)g(use)f(of) +390 4032 y(wildcards)30 b(in)h(subsequen)m(t)h(pro)s(cessing)f({)i(for) +g(example,)g Fj(bzip2)c(-dc)g(rec*file.bz2)e(>)390 4136 +y(recovered_data)f Fl({)31 b(lists)e(the)i(\014les)e(in)g(the)i +(correct)g(order.)390 4287 y Fj(bzip2recover)38 b Fl(should)i(b)s(e)g +(of)i(most)g(use)f(dealing)f(with)g(large)i Fj(.bz2)e +Fl(\014les,)k(as)d(these)390 4390 y(will)29 b(con)m(tain)j(man)m(y)g +(blo)s(c)m(ks.)45 b(It)32 b(is)f(clearly)g(futile)f(to)i(use)g(it)f(on) +h(damaged)g(single-blo)s(c)m(k)390 4494 y(\014les,)g(since)f(a)h +(damaged)h(blo)s(c)m(k)e(cannot)i(b)s(e)e(reco)m(v)m(ered.)47 +b(If)32 b(y)m(ou)g(wish)e(to)j(minimise)c(an)m(y)390 +4598 y(p)s(oten)m(tial)36 b(data)i(loss)e(through)g(media)h(or)f +(transmission)f(errors,)j(y)m(ou)f(migh)m(t)g(consider)390 +4702 y(compressing)29 b(with)g(a)i(smaller)e(blo)s(c)m(k)h(size.)390 +4946 y Ff(PERF)m(ORMANCE)39 b(NOTES)390 5132 y Fl(The)f(sorting)f +(phase)h(of)h(compression)e(gathers)i(together)h(similar)35 +b(strings)i(in)g(the)i(\014le.)390 5236 y(Because)54 +b(of)f(this,)58 b(\014les)52 b(con)m(taining)g(v)m(ery)h(long)g(runs)e +(of)i(rep)s(eated)g(sym)m(b)s(ols,)58 b(lik)m(e)390 5340 +y Fj(")p Fl(aabaabaabaab)e(...)p Fj(")g Fl(\(rep)s(eated)g(sev)m(eral)f +(h)m(undred)e(times\))i(ma)m(y)h(compress)f(more)p eop +%%Page: 8 9 +8 8 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(8)390 299 y(slo)m(wly)33 +b(than)g(normal.)50 b(V)-8 b(ersions)33 b(0.9.5)i(and)f(ab)s(o)m(v)m(e) +h(fare)e(m)m(uc)m(h)h(b)s(etter)g(than)f(previous)390 +403 y(v)m(ersions)i(in)g(this)f(resp)s(ect.)57 b(The)35 +b(ratio)h(b)s(et)m(w)m(een)h(w)m(orst-case)g(and)e(a)m(v)m(erage-case) +40 b(com-)390 506 y(pression)e(time)h(is)f(in)g(the)h(region)g(of)h +(10:1.)69 b(F)-8 b(or)40 b(previous)e(v)m(ersions,)j(this)d(\014gure)h +(w)m(as)390 610 y(more)f(lik)m(e)g(100:1.)66 b(Y)-8 b(ou)38 +b(can)h(use)e(the)i Fj(-vvvv)d Fl(option)i(to)h(monitor)e(progress)h +(in)f(great)390 714 y(detail,)30 b(if)f(y)m(ou)i(w)m(an)m(t.)390 +865 y(Decompression)f(sp)s(eed)g(is)f(una\013ected)i(b)m(y)f(these)h +(phenomena.)390 1016 y Fj(bzip2)i Fl(usually)g(allo)s(cates)i(sev)m +(eral)f(megab)m(ytes)j(of)d(memory)h(to)g(op)s(erate)h(in,)e(and)g +(then)390 1120 y(c)m(harges)k(all)d(o)m(v)m(er)j(it)f(in)e(a)i(fairly)e +(random)h(fashion.)59 b(This)34 b(means)j(that)g(p)s(erformance,)390 +1224 y(b)s(oth)27 b(for)h(compressing)f(and)g(decompressing,)h(is)f +(largely)g(determined)g(b)m(y)h(the)g(sp)s(eed)f(at)390 +1327 y(whic)m(h)35 b(y)m(our)h(mac)m(hine)g(can)g(service)g(cac)m(he)i +(misses.)57 b(Because)37 b(of)g(this,)f(small)f(c)m(hanges)390 +1431 y(to)f(the)f(co)s(de)h(to)f(reduce)g(the)h(miss)d(rate)j(ha)m(v)m +(e)h(b)s(een)d(observ)m(ed)h(to)h(giv)m(e)g(disprop)s(ortion-)390 +1535 y(ately)i(large)f(p)s(erformance)f(impro)m(v)m(emen)m(ts.)56 +b(I)35 b(imagine)f Fj(bzip2)g Fl(will)e(p)s(erform)i(b)s(est)h(on)390 +1639 y(mac)m(hines)30 b(with)f(v)m(ery)i(large)f(cac)m(hes.)390 +1885 y Ff(CA)-14 b(VEA)k(TS)390 2072 y Fl(I/O)38 b(error)g(messages)h +(are)f(not)h(as)f(helpful)e(as)i(they)g(could)f(b)s(e.)64 +b Fj(bzip2)37 b Fl(tries)g(hard)g(to)390 2176 y(detect)29 +b(I/O)e(errors)g(and)f(exit)i(cleanly)-8 b(,)27 b(but)g(the)h(details)e +(of)h(what)h(the)f(problem)f(is)g(some-)390 2280 y(times)k(seem)h +(rather)f(misleading.)390 2431 y(This)j(man)m(ual)g(page)i(p)s(ertains) +e(to)i(v)m(ersion)f(1.0)i(of)e Fj(bzip2)p Fl(.)51 b(Compressed)34 +b(data)h(created)390 2534 y(b)m(y)25 b(this)e(v)m(ersion)i(is)e(en)m +(tirely)h(forw)m(ards)h(and)f(bac)m(kw)m(ards)h(compatible)f(with)f +(the)i(previous)390 2638 y(public)18 b(releases,)24 b(v)m(ersions)c +(0.1pl2,)k(0.9.0)e(and)f(0.9.5,)k(but)20 b(with)g(the)h(follo)m(wing)e +(exception:)390 2742 y(0.9.0)43 b(and)e(ab)s(o)m(v)m(e)h(can)g +(correctly)f(decompress)g(m)m(ultiple)e(concatenated)k(compressed)390 +2846 y(\014les.)c(0.1pl2)30 b(cannot)g(do)f(this;)f(it)h(will)e(stop)i +(after)h(decompressing)e(just)g(the)i(\014rst)e(\014le)g(in)390 +2949 y(the)j(stream.)390 3100 y Fj(bzip2recover)20 b +Fl(uses)k(32-bit)g(in)m(tegers)f(to)i(represen)m(t)f(bit)e(p)s +(ositions)g(in)g(compressed)i(\014les,)390 3204 y(so)j(it)f(cannot)i +(handle)d(compressed)i(\014les)f(more)h(than)f(512)i(megab)m(ytes)h +(long.)39 b(This)25 b(could)390 3308 y(easily)30 b(b)s(e)f(\014xed.)390 +3555 y Ff(A)m(UTHOR)390 3741 y Fl(Julian)f(Sew)m(ard,)i +Fj(jseward@acm.org)p Fl(.)390 3892 y(The)24 b(ideas)f(em)m(b)s(o)s +(died)f(in)h Fj(bzip2)f Fl(are)j(due)e(to)i(\(at)g(least\))g(the)f +(follo)m(wing)e(p)s(eople:)37 b(Mic)m(hael)390 3996 y(Burro)m(ws)48 +b(and)g(Da)m(vid)h(Wheeler)f(\(for)h(the)g(blo)s(c)m(k)f(sorting)g +(transformation\),)53 b(Da)m(vid)390 4100 y(Wheeler)45 +b(\(again,)50 b(for)45 b(the)g(Hu\013man)g(co)s(der\),)k(P)m(eter)d(F) +-8 b(en)m(wic)m(k)46 b(\(for)g(the)f(structured)390 4204 +y(co)s(ding)26 b(mo)s(del)g(in)f(the)i(original)e Fj(bzip)p +Fl(,)i(and)f(man)m(y)h(re\014nemen)m(ts\),)h(and)e(Alistair)f +(Mo\013at,)390 4307 y(Radford)34 b(Neal)h(and)f(Ian)h(Witten)g(\(for)f +(the)h(arithmetic)g(co)s(der)f(in)g(the)h(original)d +Fj(bzip)p Fl(\).)390 4411 y(I)41 b(am)g(m)m(uc)m(h)h(indebted)e(for)h +(their)f(help,)j(supp)s(ort)c(and)i(advice.)74 b(See)41 +b(the)h(man)m(ual)e(in)390 4515 y(the)28 b(source)g(distribution)23 +b(for)28 b(p)s(oin)m(ters)e(to)j(sources)e(of)h(do)s(cumen)m(tation.)40 +b(Christian)25 b(v)m(on)390 4619 y(Ro)s(ques)31 b(encouraged)h(me)g(to) +g(lo)s(ok)f(for)h(faster)g(sorting)f(algorithms,)f(so)i(as)g(to)g(sp)s +(eed)f(up)390 4723 y(compression.)47 b(Bela)34 b(Lubkin)c(encouraged)k +(me)f(to)g(impro)m(v)m(e)g(the)g(w)m(orst-case)i(compres-)390 +4826 y(sion)25 b(p)s(erformance.)38 b(Man)m(y)26 b(p)s(eople)f(sen)m(t) +h(patc)m(hes,)h(help)s(ed)d(with)g(p)s(ortabilit)m(y)f(problems,)390 +4930 y(len)m(t)30 b(mac)m(hines,)g(ga)m(v)m(e)j(advice)d(and)g(w)m(ere) +h(generally)f(helpful.)p eop +%%Page: 9 10 +9 9 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1927 b Fl(9)150 299 y Fh(3)80 b(Programming)53 +b(with)h Fg(libbzip2)150 568 y Fl(This)29 b(c)m(hapter)i(describ)s(es)d +(the)j(programming)e(in)m(terface)i(to)g Fj(libbzip2)p +Fl(.)150 725 y(F)-8 b(or)36 b(general)e(bac)m(kground)h(information,)f +(particularly)f(ab)s(out)h(memory)h(use)f(and)g(p)s(erformance)g(as-) +150 834 y(p)s(ects,)d(y)m(ou'd)f(b)s(e)g(w)m(ell)f(advised)g(to)j(read) +e(Chapter)g(2)g(as)h(w)m(ell.)150 1124 y Fk(3.1)68 b(T)-11 +b(op-lev)l(el)46 b(structure)150 1316 y Fj(libbzip2)33 +b Fl(is)i(a)h(\015exible)e(library)f(for)j(compressing)f(and)g +(decompressing)f(data)j(in)d(the)i Fj(bzip2)e Fl(data)150 +1426 y(format.)39 b(Although)24 b(pac)m(k)-5 b(aged)26 +b(as)e(a)h(single)e(en)m(tit)m(y)-8 b(,)27 b(it)d(helps)f(to)i(regard)g +(the)g(library)d(as)i(three)h(separate)150 1535 y(parts:)40 +b(the)31 b(lo)m(w)f(lev)m(el)g(in)m(terface,)h(and)f(the)h(high)e(lev)m +(el)h(in)m(terface,)h(and)f(some)h(utilit)m(y)d(functions.)150 +1692 y(The)38 b(structure)g(of)g Fj(libbzip2)p Fl('s)e(in)m(terfaces)j +(is)e(similar)f(to)j(that)g(of)g(Jean-loup)e(Gailly's)g(and)h(Mark)150 +1802 y(Adler's)29 b(excellen)m(t)i Fj(zlib)e Fl(library)-8 +b(.)150 1959 y(All)29 b(externally)g(visible)f(sym)m(b)s(ols)h(ha)m(v)m +(e)i(names)f(b)s(eginning)e Fj(BZ2_)p Fl(.)39 b(This)29 +b(is)g(new)h(in)f(v)m(ersion)h(1.0.)41 b(The)150 2068 +y(in)m(ten)m(tion)30 b(is)f(to)i(minimise)d(p)s(ollution)f(of)k(the)f +(namespaces)h(of)g(library)d(clien)m(ts.)150 2321 y Ff(3.1.1)63 +b(Lo)m(w-lev)m(el)39 b(summary)150 2514 y Fl(This)21 +b(in)m(terface)h(pro)m(vides)g(services)g(for)g(compressing)f(and)h +(decompressing)f(data)i(in)e(memory)-8 b(.)38 b(There's)150 +2623 y(no)43 b(pro)m(vision)e(for)h(dealing)g(with)f(\014les,)k +(streams)e(or)g(an)m(y)g(other)g(I/O)g(mec)m(hanisms,)i(just)e(straigh) +m(t)150 2733 y(memory-to-memory)25 b(w)m(ork.)38 b(In)23 +b(fact,)k(this)22 b(part)i(of)f(the)h(library)d(can)j(b)s(e)f(compiled) +f(without)h(inclusion)150 2843 y(of)31 b Fj(stdio.h)p +Fl(,)d(whic)m(h)h(ma)m(y)i(b)s(e)f(helpful)d(for)k(em)m(b)s(edded)e +(applications.)150 2999 y(The)h(lo)m(w-lev)m(el)g(part)g(of)h(the)f +(library)e(has)i(no)h(global)e(v)-5 b(ariables)29 b(and)h(is)g +(therefore)g(thread-safe.)150 3156 y(Six)d(routines)g(mak)m(e)j(up)d +(the)i(lo)m(w)f(lev)m(el)g(in)m(terface:)41 b Fj(BZ2_bzCompressInit)p +Fl(,)24 b Fj(BZ2_bzCompress)p Fl(,)h(and)150 3266 y Fj +(BZ2_bzCompressEnd)h Fl(for)k(compression,)f(and)h(a)h(corresp)s +(onding)d(trio)i Fj(BZ2_bzDecompressInit)p Fl(,)150 3375 +y Fj(BZ2_bzDecompress)37 b Fl(and)j Fj(BZ2_bzDecompressEnd)c +Fl(for)42 b(decompression.)72 b(The)41 b Fj(*Init)e Fl(functions)150 +3485 y(allo)s(cate)44 b(memory)g(for)f(compression/decompression)f(and) +h(do)h(other)g(initialisations,)f(whilst)f(the)150 3595 +y Fj(*End)29 b Fl(functions)g(close)i(do)m(wn)f(op)s(erations)f(and)h +(release)h(memory)-8 b(.)150 3751 y(The)36 b(real)f(w)m(ork)i(is)e +(done)h(b)m(y)g Fj(BZ2_bzCompress)c Fl(and)j Fj(BZ2_bzDecompress)p +Fl(.)54 b(These)36 b(compress)g(and)150 3861 y(decompress)30 +b(data)h(from)f(a)h(user-supplied)c(input)i(bu\013er)g(to)i(a)g +(user-supplied)c(output)j(bu\013er.)40 b(These)150 3971 +y(bu\013ers)32 b(can)i(b)s(e)e(an)m(y)i(size;)g(arbitrary)e(quan)m +(tities)h(of)g(data)h(are)g(handled)d(b)m(y)i(making)f(rep)s(eated)i +(calls)150 4080 y(to)f(these)f(functions.)44 b(This)30 +b(is)h(a)h(\015exible)e(mec)m(hanism)i(allo)m(wing)e(a)i(consumer-pull) +e(st)m(yle)i(of)g(activit)m(y)-8 b(,)150 4190 y(or)30 +b(pro)s(ducer-push,)e(or)i(a)h(mixture)e(of)i(b)s(oth.)150 +4443 y Ff(3.1.2)63 b(High-lev)m(el)41 b(summary)150 4635 +y Fl(This)d(in)m(terface)j(pro)m(vides)e(some)h(handy)f(wrapp)s(ers)f +(around)h(the)i(lo)m(w-lev)m(el)f(in)m(terface)g(to)h(facilitate)150 +4745 y(reading)26 b(and)g(writing)f Fj(bzip2)g Fl(format)i(\014les)f +(\()p Fj(.bz2)g Fl(\014les\).)38 b(The)27 b(routines)e(pro)m(vide)h(ho) +s(oks)h(to)g(facilitate)150 4854 y(reading)43 b(\014les)f(in)h(whic)m +(h)f(the)i Fj(bzip2)f Fl(data)h(stream)g(is)f(em)m(b)s(edded)f(within)g +(some)i(larger-scale)g(\014le)150 4964 y(structure,)30 +b(or)h(where)e(there)i(are)g(m)m(ultiple)d Fj(bzip2)h +Fl(data)i(streams)f(concatenated)j(end-to-end.)150 5121 +y(F)-8 b(or)31 b(reading)f(\014les,)f Fj(BZ2_bzReadOpen)p +Fl(,)e Fj(BZ2_bzRead)p Fl(,)h Fj(BZ2_bzReadClose)e Fl(and)150 +5230 y Fj(BZ2_bzReadGetUnused)19 b Fl(are)25 b(supplied.)36 +b(F)-8 b(or)25 b(writing)d(\014les,)j Fj(BZ2_bzWriteOpen)p +Fl(,)d Fj(BZ2_bzWrite)g Fl(and)150 5340 y Fj(BZ2_bzWriteFinish)k +Fl(are)k(a)m(v)-5 b(ailable.)p eop +%%Page: 10 11 +10 10 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(10)150 299 y(As)24 b(with)f(the)h(lo)m +(w-lev)m(el)h(library)-8 b(,)23 b(no)h(global)g(v)-5 +b(ariables)23 b(are)h(used)g(so)g(the)h(library)c(is)j(p)s(er)f(se)h +(thread-safe.)150 408 y(Ho)m(w)m(ev)m(er,)32 b(if)c(I/O)h(errors)g(o)s +(ccur)g(whilst)e(reading)i(or)g(writing)e(the)j(underlying)c +(compressed)j(\014les,)g(y)m(ou)150 518 y(ma)m(y)j(ha)m(v)m(e)g(to)g +(consult)e Fj(errno)g Fl(to)h(determine)g(the)g(cause)g(of)h(the)f +(error.)42 b(In)30 b(that)i(case,)h(y)m(ou'd)e(need)g(a)150 +628 y(C)f(library)e(whic)m(h)h(correctly)i(supp)s(orts)d +Fj(errno)h Fl(in)g(a)i(m)m(ultithreaded)e(en)m(vironmen)m(t.)150 +784 y(T)-8 b(o)56 b(mak)m(e)g(the)g(library)d(a)j(little)e(simpler)f +(and)i(more)h(p)s(ortable,)61 b Fj(BZ2_bzReadOpen)51 +b Fl(and)k Fj(BZ2_)150 894 y(bzWriteOpen)34 b Fl(require)j(y)m(ou)g(to) +i(pass)e(them)g(\014le)g(handles)f(\()p Fj(FILE*)p Fl(s\))g(whic)m(h)h +(ha)m(v)m(e)h(previously)e(b)s(een)150 1004 y(op)s(ened)41 +b(for)g(reading)f(or)h(writing)f(resp)s(ectiv)m(ely)-8 +b(.)73 b(That)41 b(a)m(v)m(oids)h(p)s(ortabilit)m(y)d(problems)g(asso)s +(ciated)150 1113 y(with)j(\014le)h(op)s(erations)g(and)g(\014le)g +(attributes,)j(whilst)c(not)i(b)s(eing)e(m)m(uc)m(h)h(of)h(an)g(imp)s +(osition)c(on)k(the)150 1223 y(programmer.)150 1474 y +Ff(3.1.3)63 b(Utilit)m(y)40 b(functions)h(summary)150 +1666 y Fl(F)-8 b(or)45 b(v)m(ery)g(simple)d(needs,)48 +b Fj(BZ2_bzBuffToBuffCompres)o(s)38 b Fl(and)44 b Fj +(BZ2_bzBuffToBuffDecompres)o(s)150 1776 y Fl(are)29 b(pro)m(vided.)38 +b(These)28 b(compress)g(data)h(in)e(memory)h(from)g(one)h(bu\013er)e +(to)i(another)f(bu\013er)g(in)f(a)h(single)150 1885 y(function)38 +b(call.)67 b(Y)-8 b(ou)40 b(should)d(assess)j(whether)f(these)h +(functions)d(ful\014ll)f(y)m(our)k(memory-to-memory)150 +1995 y(compression/decompression)26 b(requiremen)m(ts)h(b)s(efore)g(in) +m(v)m(esting)g(e\013ort)i(in)d(understanding)f(the)j(more)150 +2105 y(general)i(but)g(more)h(complex)f(lo)m(w-lev)m(el)g(in)m +(terface.)150 2261 y(Y)-8 b(oshiok)j(a)47 b(Tsuneo)e(\()p +Fj(QWF00133@niftyserve.or.jp)40 b Fl(/)46 b Fj +(tsuneo-y@is.aist-nara.ac.)o(jp)p Fl(\))40 b(has)150 +2371 y(con)m(tributed)f(some)h(functions)e(to)j(giv)m(e)f(b)s(etter)g +Fj(zlib)f Fl(compatibilit)m(y)-8 b(.)67 b(These)40 b(functions)e(are)i +Fj(BZ2_)150 2481 y(bzopen)p Fl(,)e Fj(BZ2_bzread)p Fl(,)f +Fj(BZ2_bzwrite)p Fl(,)g Fj(BZ2_bzflush)p Fl(,)g Fj(BZ2_bzclose)p +Fl(,)f Fj(BZ2_bzerror)f Fl(and)i Fj(BZ2_)150 2590 y(bzlibVersion)p +Fl(.)49 b(Y)-8 b(ou)35 b(ma)m(y)g(\014nd)e(these)i(functions)d(more)j +(con)m(v)m(enien)m(t)g(for)f(simple)f(\014le)g(reading)h(and)150 +2700 y(writing,)c(than)h(those)h(in)e(the)i(high-lev)m(el)e(in)m +(terface.)45 b(These)31 b(functions)f(are)i(not)g(\(y)m(et\))h +(o\016cially)d(part)150 2809 y(of)k(the)g(library)-8 +b(,)33 b(and)g(are)h(minimally)c(do)s(cumen)m(ted)k(here.)51 +b(If)33 b(they)h(break,)h(y)m(ou)f(get)h(to)g(k)m(eep)f(all)f(the)150 +2919 y(pieces.)40 b(I)31 b(hop)s(e)e(to)i(do)s(cumen)m(t)g(them)f(prop) +s(erly)e(when)h(time)i(p)s(ermits.)150 3076 y(Y)-8 b(oshiok)j(a)27 +b(also)g(con)m(tributed)f(mo)s(di\014cations)f(to)i(allo)m(w)f(the)h +(library)e(to)i(b)s(e)f(built)f(as)i(a)g(Windo)m(ws)f(DLL.)150 +3362 y Fk(3.2)68 b(Error)45 b(handling)150 3554 y Fl(The)23 +b(library)f(is)h(designed)g(to)i(reco)m(v)m(er)g(cleanly)f(in)e(all)h +(situations,)h(including)d(the)j(w)m(orst-case)i(situation)150 +3664 y(of)j(decompressing)e(random)g(data.)41 b(I'm)28 +b(not)h(100\045)g(sure)f(that)h(it)f(can)h(alw)m(a)m(ys)g(do)f(this,)g +(so)g(y)m(ou)h(migh)m(t)150 3774 y(w)m(an)m(t)i(to)g(add)e(a)i(signal)d +(handler)g(to)j(catc)m(h)h(segmen)m(tation)f(violations)e(during)f +(decompression)h(if)g(y)m(ou)150 3883 y(are)g(feeling)f(esp)s(ecially)f +(paranoid.)39 b(I)28 b(w)m(ould)g(b)s(e)g(in)m(terested)h(in)e(hearing) +h(more)h(ab)s(out)f(the)h(robustness)150 3993 y(of)i(the)f(library)e +(to)j(corrupted)f(compressed)g(data.)150 4150 y(V)-8 +b(ersion)39 b(1.0)h(is)f(m)m(uc)m(h)g(more)h(robust)e(in)g(this)g(resp) +s(ect)i(than)f(0.9.0)i(or)e(0.9.5.)70 b(In)m(v)m(estigations)39 +b(with)150 4259 y(Chec)m(k)m(er)21 b(\(a)g(to)s(ol)g(for)f(detecting)h +(problems)d(with)h(memory)h(managemen)m(t,)k(similar)18 +b(to)j(Purify\))e(indicate)150 4369 y(that,)40 b(at)e(least)f(for)g +(the)h(few)e(\014les)h(I)g(tested,)j(all)c(single-bit)f(errors)i(in)e +(the)j(decompressed)f(data)h(are)150 4478 y(caugh)m(t)c(prop)s(erly)-8 +b(,)31 b(with)g(no)i(segmen)m(tation)h(faults,)e(no)g(reads)h(of)g +(uninitialised)27 b(data)34 b(and)e(no)g(out)h(of)150 +4588 y(range)f(reads)g(or)f(writes.)44 b(So)32 b(it's)f(certainly)g(m)m +(uc)m(h)h(impro)m(v)m(ed,)g(although)f(I)g(w)m(ouldn't)g(claim)g(it)g +(to)i(b)s(e)150 4698 y(totally)d(b)s(om)m(bpro)s(of.)150 +4854 y(The)25 b(\014le)g Fj(bzlib.h)f Fl(con)m(tains)i(all)f +(de\014nitions)e(needed)i(to)i(use)e(the)h(library)-8 +b(.)37 b(In)26 b(particular,)f(y)m(ou)h(should)150 4964 +y(de\014nitely)i(not)j(include)d Fj(bzlib_private.h)p +Fl(.)150 5121 y(In)39 b Fj(bzlib.h)p Fl(,)h(the)g(v)-5 +b(arious)39 b(return)f(v)-5 b(alues)39 b(are)h(de\014ned.)68 +b(The)39 b(follo)m(wing)f(list)h(is)f(not)i(in)m(tended)f(as)150 +5230 y(an)c(exhaustiv)m(e)h(description)d(of)i(the)h(circumstances)f +(in)f(whic)m(h)g(a)i(giv)m(en)f(v)-5 b(alue)35 b(ma)m(y)h(b)s(e)e +(returned)h({)150 5340 y(those)h(descriptions)d(are)j(giv)m(en)f +(later.)56 b(Rather,)37 b(it)d(is)h(in)m(tended)f(to)i(con)m(v)m(ey)h +(the)e(rough)g(meaning)g(of)p eop +%%Page: 11 12 +11 11 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(11)150 299 y(eac)m(h)38 +b(return)d(v)-5 b(alue.)59 b(The)36 b(\014rst)g(\014v)m(e)g(actions)h +(are)g(normal)f(and)f(not)i(in)m(tended)f(to)h(denote)g(an)f(error)150 +408 y(situation.)150 592 y Fj(BZ_OK)180 b Fl(The)30 b(requested)g +(action)h(w)m(as)g(completed)f(successfully)-8 b(.)150 +756 y Fj(BZ_RUN_OK)150 866 y(BZ_FLUSH_OK)150 975 y(BZ_FINISH_OK)630 +1085 y Fl(In)24 b Fj(BZ2_bzCompress)p Fl(,)e(the)i(requested)g +(\015ush/\014nish/nothing-sp)s(ecial)c(action)k(w)m(as)h(com-)630 +1194 y(pleted)30 b(successfully)-8 b(.)150 1358 y Fj(BZ_STREAM_END)630 +1468 y Fl(Compression)38 b(of)j(data)f(w)m(as)h(completed,)h(or)f(the)f +(logical)f(stream)i(end)e(w)m(as)i(detected)630 1577 +y(during)28 b(decompression.)150 1761 y(The)i(follo)m(wing)f(return)g +(v)-5 b(alues)30 b(indicate)f(an)h(error)g(of)h(some)g(kind.)150 +1945 y Fj(BZ_CONFIG_ERROR)630 2055 y Fl(Indicates)48 +b(that)h(the)g(library)e(has)h(b)s(een)g(improp)s(erly)d(compiled)j(on) +g(y)m(our)h(platform)630 2164 y({)j(a)g(ma)5 b(jor)51 +b(con\014guration)g(error.)104 b(Sp)s(eci\014cally)-8 +b(,)55 b(it)c(means)g(that)h Fj(sizeof\(char\))p Fl(,)630 +2274 y Fj(sizeof\(short\))44 b Fl(and)i Fj(sizeof\(int\))f +Fl(are)j(not)f(1,)52 b(2)c(and)f(4)h(resp)s(ectiv)m(ely)-8 +b(,)51 b(as)d(they)630 2384 y(should)27 b(b)s(e.)40 b(Note)30 +b(that)g(the)f(library)e(should)g(still)g(w)m(ork)i(prop)s(erly)e(on)i +(64-bit)g(platforms)630 2493 y(whic)m(h)d(follo)m(w)h(the)g(LP64)h +(programming)e(mo)s(del)h({)g(that)h(is,)g(where)e Fj(sizeof\(long\))f +Fl(and)630 2603 y Fj(sizeof\(void*\))e Fl(are)k(8.)40 +b(Under)25 b(LP64,)j Fj(sizeof\(int\))c Fl(is)h(still)f(4,)k(so)f +Fj(libbzip2)p Fl(,)e(whic)m(h)630 2712 y(do)s(esn't)30 +b(use)g(the)h Fj(long)e Fl(t)m(yp)s(e,)i(is)e(OK.)150 +2876 y Fj(BZ_SEQUENCE_ERROR)630 2986 y Fl(When)43 b(using)f(the)i +(library)-8 b(,)45 b(it)e(is)f(imp)s(ortan)m(t)h(to)h(call)e(the)i +(functions)e(in)g(the)i(correct)630 3095 y(sequence)28 +b(and)f(with)f(data)j(structures)e(\(bu\013ers)f(etc\))j(in)e(the)g +(correct)i(states.)41 b Fj(libbzip2)630 3205 y Fl(c)m(hec)m(ks)26 +b(as)e(m)m(uc)m(h)h(as)f(it)g(can)g(to)h(ensure)f(this)f(is)g(happ)s +(ening,)h(and)f(returns)g Fj(BZ_SEQUENCE_)630 3314 y(ERROR)36 +b Fl(if)h(not.)62 b(Co)s(de)37 b(whic)m(h)g(complies)f(precisely)g +(with)h(the)g(function)g(seman)m(tics,)j(as)630 3424 +y(detailed)d(b)s(elo)m(w,)i(should)d(nev)m(er)i(receiv)m(e)h(this)d(v) +-5 b(alue;)41 b(suc)m(h)d(an)g(ev)m(en)m(t)h(denotes)f(buggy)630 +3534 y(co)s(de)31 b(whic)m(h)e(y)m(ou)h(should)f(in)m(v)m(estigate.)150 +3697 y Fj(BZ_PARAM_ERROR)630 3807 y Fl(Returned)43 b(when)f(a)i +(parameter)g(to)h(a)f(function)e(call)h(is)f(out)i(of)g(range)g(or)g +(otherwise)630 3917 y(manifestly)34 b(incorrect.)57 b(As)36 +b(with)e Fj(BZ_SEQUENCE_ERROR)p Fl(,)f(this)i(denotes)h(a)g(bug)f(in)g +(the)630 4026 y(clien)m(t)23 b(co)s(de.)39 b(The)22 b(distinction)f(b)s +(et)m(w)m(een)j Fj(BZ_PARAM_ERROR)c Fl(and)j Fj(BZ_SEQUENCE_ERROR)630 +4136 y Fl(is)29 b(a)i(bit)f(hazy)-8 b(,)31 b(but)f(still)e(w)m(orth)i +(making.)150 4300 y Fj(BZ_MEM_ERROR)630 4409 y Fl(Returned)g(when)f(a)i +(request)f(to)i(allo)s(cate)f(memory)f(failed.)40 b(Note)31 +b(that)g(the)g(quan)m(tit)m(y)g(of)630 4519 y(memory)21 +b(needed)g(to)i(decompress)e(a)g(stream)h(cannot)g(b)s(e)f(determined)f +(un)m(til)g(the)h(stream's)630 4628 y(header)29 b(has)g(b)s(een)g +(read.)40 b(So)29 b Fj(BZ2_bzDecompress)c Fl(and)j Fj(BZ2_bzRead)f +Fl(ma)m(y)j(return)e Fj(BZ_)630 4738 y(MEM_ERROR)d Fl(ev)m(en)k(though) +e(some)h(of)g(the)g(compressed)g(data)g(has)g(b)s(een)f(read.)39 +b(The)28 b(same)630 4847 y(is)38 b(not)i(true)f(for)g(compression;)k +(once)d Fj(BZ2_bzCompressInit)34 b Fl(or)39 b Fj(BZ2_bzWriteOpen)630 +4957 y Fl(ha)m(v)m(e)32 b(successfully)c(completed,)j +Fj(BZ_MEM_ERROR)c Fl(cannot)k(o)s(ccur.)150 5121 y Fj(BZ_DATA_ERROR)630 +5230 y Fl(Returned)h(when)g(a)h(data)g(in)m(tegrit)m(y)g(error)g(is)e +(detected)k(during)30 b(decompression.)47 b(Most)630 +5340 y(imp)s(ortan)m(tly)-8 b(,)31 b(this)f(means)i(when)f(stored)g +(and)g(computed)h(CR)m(Cs)f(for)g(the)h(data)g(do)g(not)p +eop +%%Page: 12 13 +12 12 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(12)630 299 y(matc)m(h.)41 +b(This)28 b(v)-5 b(alue)29 b(is)f(also)i(returned)e(up)s(on)g +(detection)i(of)g(an)m(y)g(other)f(anomaly)h(in)e(the)630 +408 y(compressed)i(data.)150 560 y Fj(BZ_DATA_ERROR_MAGIC)630 +670 y Fl(As)k(a)g(sp)s(ecial)f(case)i(of)f Fj(BZ_DATA_ERROR)p +Fl(,)d(it)i(is)g(sometimes)h(useful)e(to)j(kno)m(w)f(when)f(the)630 +779 y(compressed)d(stream)h(do)s(es)f(not)g(start)h(with)e(the)i +(correct)h(magic)e(b)m(ytes)h(\()p Fj('B')f('Z')f('h')p +Fl(\).)150 931 y Fj(BZ_IO_ERROR)630 1040 y Fl(Returned)k(b)m(y)h +Fj(BZ2_bzRead)d Fl(and)i Fj(BZ2_bzWrite)e Fl(when)i(there)h(is)f(an)g +(error)h(reading)f(or)630 1150 y(writing)28 b(in)h(the)h(compressed)g +(\014le,)f(and)h(b)m(y)g Fj(BZ2_bzReadOpen)c Fl(and)j +Fj(BZ2_bzWriteOpen)630 1259 y Fl(for)i(attempts)i(to)f(use)f(a)h +(\014le)e(for)i(whic)m(h)e(the)h(error)g(indicator)g(\(viz,)g +Fj(ferror\(f\))p Fl(\))f(is)g(set.)630 1369 y(On)h(receipt)g(of)h +Fj(BZ_IO_ERROR)p Fl(,)e(the)h(caller)h(should)d(consult)i +Fj(errno)g Fl(and/or)g Fj(perror)f Fl(to)630 1479 y(acquire)g(op)s +(erating-system)g(sp)s(eci\014c)f(information)g(ab)s(out)h(the)h +(problem.)150 1630 y Fj(BZ_UNEXPECTED_EOF)630 1740 y +Fl(Returned)36 b(b)m(y)g Fj(BZ2_bzRead)e Fl(when)i(the)h(compressed)f +(\014le)g(\014nishes)e(b)s(efore)j(the)f(logical)630 +1849 y(end)30 b(of)g(stream)h(is)e(detected.)150 2001 +y Fj(BZ_OUTBUFF_FULL)630 2110 y Fl(Returned)g(b)m(y)i +Fj(BZ2_bzBuffToBuffCompres)o(s)24 b Fl(and)30 b Fj +(BZ2_bzBuffToBuffDecompres)o(s)630 2220 y Fl(to)h(indicate)f(that)h +(the)f(output)g(data)h(will)d(not)i(\014t)h(in)m(to)f(the)h(output)f +(bu\013er)f(pro)m(vided.)150 2492 y Fk(3.3)68 b(Lo)l(w-lev)l(el)47 +b(in)l(terface)150 2766 y Ff(3.3.1)63 b Fe(BZ2_bzCompressInit)390 +2953 y Fj(typedef)533 3057 y(struct)46 b({)676 3161 y(char)h(*next_in;) +676 3264 y(unsigned)f(int)h(avail_in;)676 3368 y(unsigned)f(int)h +(total_in_lo32;)676 3472 y(unsigned)f(int)h(total_in_hi32;)676 +3680 y(char)g(*next_out;)676 3783 y(unsigned)f(int)h(avail_out;)676 +3887 y(unsigned)f(int)h(total_out_lo32;)676 3991 y(unsigned)f(int)h +(total_out_hi32;)676 4198 y(void)g(*state;)676 4406 y(void)g +(*\(*bzalloc\)\(void)c(*,int,int\);)676 4510 y(void)k +(\(*bzfree\)\(void)d(*,void)i(*\);)676 4614 y(void)h(*opaque;)533 +4717 y(})533 4821 y(bz_stream;)390 5029 y(int)g(BZ2_bzCompressInit)c +(\()k(bz_stream)e(*strm,)1583 5132 y(int)i(blockSize100k,)1583 +5236 y(int)g(verbosity,)1583 5340 y(int)g(workFactor)e(\);)p +eop +%%Page: 13 14 +13 13 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(13)150 456 y(Prepares)32 +b(for)h(compression.)47 b(The)32 b Fj(bz_stream)e Fl(structure)j(holds) +e(all)h(data)h(p)s(ertaining)e(to)i(the)g(com-)150 565 +y(pression)i(activit)m(y)-8 b(.)62 b(A)37 b Fj(bz_stream)e +Fl(structure)h(should)f(b)s(e)i(allo)s(cated)g(and)f(initialised)e +(prior)h(to)j(the)150 675 y(call.)67 b(The)39 b(\014elds)e(of)j +Fj(bz_stream)d Fl(comprise)h(the)i(en)m(tiret)m(y)g(of)f(the)h +(user-visible)c(data.)68 b Fj(state)38 b Fl(is)h(a)150 +784 y(p)s(oin)m(ter)29 b(to)i(the)g(priv)-5 b(ate)30 +b(data)h(structures)f(required)e(for)i(compression.)150 +941 y(Custom)37 b(memory)g(allo)s(cators)g(are)h(supp)s(orted,)f(via)g +(\014elds)f Fj(bzalloc)p Fl(,)h Fj(bzfree)p Fl(,)g(and)g +Fj(opaque)p Fl(.)59 b(The)150 1051 y(v)-5 b(alue)32 b +Fj(opaque)e Fl(is)i(passed)f(to)i(as)g(the)f(\014rst)g(argumen)m(t)h +(to)g(all)e(calls)g(to)i Fj(bzalloc)d Fl(and)i Fj(bzfree)p +Fl(,)f(but)h(is)150 1160 y(otherwise)d(ignored)g(b)m(y)h(the)g(library) +-8 b(.)38 b(The)29 b(call)h Fj(bzalloc)e(\()i(opaque,)e(n,)i(m)g(\))g +Fl(is)e(exp)s(ected)j(to)f(return)150 1270 y(a)g(p)s(oin)m(ter)e +Fj(p)h Fl(to)h Fj(n)g(*)g(m)f Fl(b)m(ytes)h(of)g(memory)-8 +b(,)30 b(and)e Fj(bzfree)h(\()h(opaque,)f(p)h(\))f Fl(should)e(free)i +(that)h(memory)-8 b(.)150 1427 y(If)33 b(y)m(ou)g(don't)h(w)m(an)m(t)g +(to)g(use)f(a)g(custom)h(memory)f(allo)s(cator,)h(set)g +Fj(bzalloc)p Fl(,)e Fj(bzfree)g Fl(and)h Fj(opaque)e +Fl(to)150 1537 y Fj(NULL)p Fl(,)e(and)h(the)h(library)d(will)f(then)k +(use)f(the)g(standard)g Fj(malloc)p Fl(/)p Fj(free)e +Fl(routines.)150 1693 y(Before)39 b(calling)d Fj(BZ2_bzCompressInit)p +Fl(,)f(\014elds)h Fj(bzalloc)p Fl(,)h Fj(bzfree)f Fl(and)h +Fj(opaque)f Fl(should)g(b)s(e)h(\014lled)150 1803 y(appropriately)-8 +b(,)35 b(as)h(just)f(describ)s(ed.)53 b(Up)s(on)34 b(return,)i(the)g +(in)m(ternal)e(state)i(will)d(ha)m(v)m(e)j(b)s(een)f(allo)s(cated)150 +1913 y(and)43 b(initialised,)g(and)g Fj(total_in_lo32)p +Fl(,)h Fj(total_in_hi32)p Fl(,)f Fj(total_out_lo32)d +Fl(and)j Fj(total_out_)150 2022 y(hi32)37 b Fl(will)f(ha)m(v)m(e)j(b)s +(een)f(set)h(to)g(zero.)65 b(These)38 b(four)g(\014elds)e(are)j(used)f +(b)m(y)g(the)g(library)e(to)j(inform)e(the)150 2132 y(caller)j(of)g +(the)h(total)g(amoun)m(t)g(of)g(data)g(passed)f(in)m(to)g(and)g(out)g +(of)h(the)g(library)-8 b(,)41 b(resp)s(ectiv)m(ely)-8 +b(.)70 b(Y)-8 b(ou)150 2241 y(should)34 b(not)j(try)f(to)h(c)m(hange)g +(them.)58 b(As)36 b(of)h(v)m(ersion)f(1.0,)j(64-bit)d(coun)m(ts)h(are)f +(main)m(tained,)h(ev)m(en)g(on)150 2351 y(32-bit)i(platforms,)h(using)d +(the)i Fj(_hi32)e Fl(\014elds)g(to)j(store)f(the)g(upp)s(er)d(32)k +(bits)d(of)i(the)g(coun)m(t.)66 b(So,)41 b(for)150 2460 +y(example,)30 b(the)h(total)g(amoun)m(t)g(of)f(data)h(in)f(is)f +Fj(\(total_in_hi32)d(<<)k(32\))g(+)g(total_in_lo32)p +Fl(.)150 2617 y(P)m(arameter)g Fj(blockSize100k)25 b +Fl(sp)s(eci\014es)i(the)h(blo)s(c)m(k)g(size)h(to)g(b)s(e)f(used)f(for) +h(compression.)40 b(It)28 b(should)f(b)s(e)150 2727 y(a)k(v)-5 +b(alue)30 b(b)s(et)m(w)m(een)i(1)f(and)f(9)h(inclusiv)m(e,)e(and)h(the) +h(actual)g(blo)s(c)m(k)f(size)g(used)g(is)g(100000)j(x)e(this)e +(\014gure.)42 b(9)150 2836 y(giv)m(es)31 b(the)f(b)s(est)g(compression) +g(but)f(tak)m(es)j(most)f(memory)-8 b(.)150 2993 y(P)m(arameter)29 +b Fj(verbosity)c Fl(should)h(b)s(e)h(set)i(to)f(a)h(n)m(um)m(b)s(er)d +(b)s(et)m(w)m(een)j(0)f(and)f(4)h(inclusiv)m(e.)38 b(0)28 +b(is)f(silen)m(t,)h(and)150 3103 y(greater)j(n)m(um)m(b)s(ers)c(giv)m +(e)j(increasingly)d(v)m(erb)s(ose)j(monitoring/debugging)d(output.)40 +b(If)29 b(the)g(library)e(has)150 3212 y(b)s(een)j(compiled)e(with)i +Fj(-DBZ_NO_STDIO)p Fl(,)d(no)j(suc)m(h)g(output)g(will)e(app)s(ear)h +(for)h(an)m(y)h(v)m(erb)s(osit)m(y)f(setting.)150 3369 +y(P)m(arameter)35 b Fj(workFactor)d Fl(con)m(trols)i(ho)m(w)g(the)g +(compression)f(phase)h(b)s(eha)m(v)m(es)g(when)f(presen)m(ted)h(with) +150 3479 y(w)m(orst)40 b(case,)j(highly)37 b(rep)s(etitiv)m(e,)k(input) +d(data.)68 b(If)39 b(compression)g(runs)e(in)m(to)j(di\016culties)d +(caused)i(b)m(y)150 3588 y(rep)s(etitiv)m(e)34 b(data,)j(the)e(library) +d(switc)m(hes)j(from)f(the)h(standard)f(sorting)g(algorithm)g(to)i(a)f +(fallbac)m(k)f(al-)150 3698 y(gorithm.)47 b(The)32 b(fallbac)m(k)g(is)g +(slo)m(w)m(er)g(than)h(the)f(standard)g(algorithm)g(b)m(y)g(p)s(erhaps) +f(a)i(factor)h(of)e(three,)150 3808 y(but)e(alw)m(a)m(ys)h(b)s(eha)m(v) +m(es)f(reasonably)-8 b(,)31 b(no)f(matter)h(ho)m(w)g(bad)f(the)g +(input.)150 3965 y(Lo)m(w)m(er)25 b(v)-5 b(alues)24 b(of)h +Fj(workFactor)d Fl(reduce)i(the)h(amoun)m(t)g(of)g(e\013ort)g(the)g +(standard)f(algorithm)f(will)f(exp)s(end)150 4074 y(b)s(efore)j +(resorting)h(to)g(the)g(fallbac)m(k.)39 b(Y)-8 b(ou)27 +b(should)c(set)k(this)e(parameter)h(carefully;)g(to)s(o)h(lo)m(w,)g +(and)e(man)m(y)150 4184 y(inputs)32 b(will)f(b)s(e)i(handled)f(b)m(y)i +(the)g(fallbac)m(k)g(algorithm)f(and)g(so)h(compress)g(rather)g(slo)m +(wly)-8 b(,)34 b(to)s(o)h(high,)150 4293 y(and)24 b(y)m(our)h(a)m(v)m +(erage-to-w)m(orst)30 b(case)c(compression)e(times)h(can)g(b)s(ecome)g +(v)m(ery)h(large.)39 b(The)24 b(default)g(v)-5 b(alue)150 +4403 y(of)31 b(30)g(giv)m(es)f(reasonable)h(b)s(eha)m(viour)e(o)m(v)m +(er)i(a)g(wide)e(range)i(of)f(circumstances.)150 4560 +y(Allo)m(w)m(able)h(v)-5 b(alues)31 b(range)i(from)e(0)i(to)f(250)h +(inclusiv)m(e.)44 b(0)32 b(is)f(a)h(sp)s(ecial)f(case,)i(equiv)-5 +b(alen)m(t)32 b(to)g(using)f(the)150 4669 y(default)f(v)-5 +b(alue)29 b(of)i(30.)150 4826 y(Note)38 b(that)f(the)g(compressed)f +(output)g(generated)h(is)f(the)g(same)h(regardless)f(of)h(whether)f(or) +g(not)h(the)150 4936 y(fallbac)m(k)30 b(algorithm)f(is)h(used.)150 +5093 y(Be)23 b(a)m(w)m(are)h(also)f(that)g(this)f(parameter)h(ma)m(y)g +(disapp)s(ear)e(en)m(tirely)h(in)f(future)h(v)m(ersions)g(of)h(the)g +(library)-8 b(.)36 b(In)150 5202 y(principle)20 b(it)j(should)e(b)s(e)h +(p)s(ossible)f(to)j(devise)f(a)g(go)s(o)s(d)g(w)m(a)m(y)i(to)f +(automatically)f(c)m(ho)s(ose)h(whic)m(h)e(algorithm)150 +5312 y(to)31 b(use.)41 b(Suc)m(h)29 b(a)i(mec)m(hanism)f(w)m(ould)f +(render)g(the)i(parameter)g(obsolete.)p eop +%%Page: 14 15 +14 14 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(14)150 299 y(P)m(ossible)29 +b(return)h(v)-5 b(alues:)572 450 y Fj(BZ_CONFIG_ERROR)663 +554 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +657 y Fj(BZ_PARAM_ERROR)663 761 y Fl(if)g Fj(strm)g Fl(is)h +Fj(NULL)663 865 y Fl(or)g Fj(blockSize)e(<)i Fl(1)h(or)f +Fj(blockSize)e(>)i Fl(9)663 969 y(or)g Fj(verbosity)e(<)i +Fl(0)h(or)f Fj(verbosity)e(>)i Fl(4)663 1073 y(or)g Fj(workFactor)e(<)i +Fl(0)g(or)h Fj(workFactor)c(>)j Fl(250)572 1176 y Fj(BZ_MEM_ERROR)663 +1280 y Fl(if)f(not)i(enough)f(memory)g(is)f(a)m(v)-5 +b(ailable)572 1384 y Fj(BZ_OK)663 1488 y Fl(otherwise)150 +1645 y(Allo)m(w)m(able)30 b(next)g(actions:)572 1796 +y Fj(BZ2_bzCompress)663 1899 y Fl(if)f Fj(BZ_OK)g Fl(is)g(returned)572 +2003 y(no)h(sp)s(eci\014c)f(action)i(needed)f(in)f(case)i(of)g(error) +150 2255 y Ff(3.3.2)63 b Fe(BZ2_bzCompress)533 2441 y +Fj(int)47 b(BZ2_bzCompress)d(\()j(bz_stream)f(*strm,)g(int)h(action)f +(\);)150 2598 y Fl(Pro)m(vides)28 b(more)g(input)f(and/or)h(output)g +(bu\013er)g(space)h(for)f(the)h(library)-8 b(.)38 b(The)28 +b(caller)g(main)m(tains)f(input)150 2708 y(and)j(output)g(bu\013ers,)f +(and)h(calls)g Fj(BZ2_bzCompress)c Fl(to)31 b(transfer)f(data)h(b)s(et) +m(w)m(een)g(them.)150 2865 y(Before)j(eac)m(h)g(call)e(to)i +Fj(BZ2_bzCompress)p Fl(,)c Fj(next_in)h Fl(should)g(p)s(oin)m(t)h(at)h +(the)g(data)h(to)g(b)s(e)e(compressed,)150 2974 y(and)41 +b Fj(avail_in)f Fl(should)g(indicate)h(ho)m(w)h(man)m(y)f(b)m(ytes)i +(the)f(library)d(ma)m(y)k(read.)75 b Fj(BZ2_bzCompress)150 +3084 y Fl(up)s(dates)29 b Fj(next_in)p Fl(,)g Fj(avail_in)f +Fl(and)i Fj(total_in)e Fl(to)j(re\015ect)g(the)g(n)m(um)m(b)s(er)e(of)h +(b)m(ytes)h(it)f(has)g(read.)150 3241 y(Similarly)-8 +b(,)27 b Fj(next_out)h Fl(should)g(p)s(oin)m(t)h(to)i(a)f(bu\013er)f +(in)g(whic)m(h)g(the)h(compressed)g(data)h(is)e(to)i(b)s(e)e(placed,) +150 3350 y(with)i Fj(avail_out)f Fl(indicating)h(ho)m(w)h(m)m(uc)m(h)h +(output)f(space)h(is)f(a)m(v)-5 b(ailable.)46 b Fj(BZ2_bzCompress)29 +b Fl(up)s(dates)150 3460 y Fj(next_out)p Fl(,)f Fj(avail_out)g +Fl(and)i Fj(total_out)e Fl(to)j(re\015ect)g(the)f(n)m(um)m(b)s(er)g(of) +g(b)m(ytes)h(output.)150 3617 y(Y)-8 b(ou)40 b(ma)m(y)g(pro)m(vide)e +(and)h(remo)m(v)m(e)i(as)f(little)e(or)h(as)h(m)m(uc)m(h)f(data)h(as)g +(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e(of)g Fj(BZ2_)150 +3726 y(bzCompress)p Fl(.)48 b(In)33 b(the)h(limit,)f(it)h(is)f +(acceptable)h(to)h(supply)c(and)j(remo)m(v)m(e)h(data)g(one)f(b)m(yte)g +(at)h(a)f(time,)150 3836 y(although)28 b(this)f(w)m(ould)g(b)s(e)h +(terribly)e(ine\016cien)m(t.)39 b(Y)-8 b(ou)29 b(should)e(alw)m(a)m(ys) +h(ensure)g(that)h(at)g(least)g(one)f(b)m(yte)150 3946 +y(of)j(output)f(space)g(is)g(a)m(v)-5 b(ailable)30 b(at)h(eac)m(h)g +(call.)150 4102 y(A)38 b(second)h(purp)s(ose)d(of)j Fj(BZ2_bzCompress) +34 b Fl(is)j(to)i(request)f(a)h(c)m(hange)g(of)g(mo)s(de)e(of)i(the)f +(compressed)150 4212 y(stream.)150 4369 y(Conceptually)-8 +b(,)24 b(a)g(compressed)g(stream)g(can)f(b)s(e)g(in)g(one)h(of)f(four)g +(states:)39 b(IDLE,)24 b(R)m(UNNING,)h(FLUSH-)150 4478 +y(ING)37 b(and)g(FINISHING.)g(Before)i(initialisation)33 +b(\()p Fj(BZ2_bzCompressInit)p Fl(\))g(and)j(after)i(termination)150 +4588 y(\()p Fj(BZ2_bzCompressEnd)p Fl(\),)27 b(a)j(stream)h(is)f +(regarded)g(as)g(IDLE.)150 4745 y(Up)s(on)35 b(initialisation)e(\()p +Fj(BZ2_bzCompressInit)p Fl(\),)h(the)i(stream)h(is)e(placed)h(in)e(the) +j(R)m(UNNING)g(state.)150 4854 y(Subsequen)m(t)j(calls)g(to)i +Fj(BZ2_bzCompress)37 b Fl(should)j(pass)g Fj(BZ_RUN)g +Fl(as)h(the)g(requested)h(action;)47 b(other)150 4964 +y(actions)31 b(are)f(illegal)f(and)h(will)d(result)j(in)f +Fj(BZ_SEQUENCE_ERROR)p Fl(.)150 5121 y(A)m(t)38 b(some)f(p)s(oin)m(t,)h +(the)f(calling)e(program)i(will)d(ha)m(v)m(e)k(pro)m(vided)e(all)f(the) +i(input)e(data)j(it)e(w)m(an)m(ts)i(to.)61 b(It)150 5230 +y(will)28 b(then)h(w)m(an)m(t)i(to)g(\014nish)d(up)h({)i(in)d +(e\013ect,)k(asking)e(the)g(library)e(to)j(pro)s(cess)f(an)m(y)g(data)h +(it)f(migh)m(t)g(ha)m(v)m(e)150 5340 y(bu\013ered)25 +b(in)m(ternally)-8 b(.)38 b(In)25 b(this)g(state,)k Fj(BZ2_bzCompress) +22 b Fl(will)i(no)i(longer)g(attempt)h(to)g(read)f(data)h(from)p +eop +%%Page: 15 16 +15 15 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(15)150 299 y Fj(next_in)p +Fl(,)33 b(but)g(it)h(will)d(w)m(an)m(t)k(to)g(write)e(data)h(to)h +Fj(next_out)p Fl(.)49 b(Because)36 b(the)e(output)f(bu\013er)g +(supplied)150 408 y(b)m(y)e(the)h(user)e(can)i(b)s(e)f(arbitrarily)d +(small,)j(the)g(\014nishing-up)d(op)s(eration)i(cannot)i(necessarily)e +(b)s(e)h(done)150 518 y(with)e(a)i(single)e(call)h(of)g +Fj(BZ2_bzCompress)p Fl(.)150 675 y(Instead,)47 b(the)d(calling)f +(program)g(passes)h Fj(BZ_FINISH)d Fl(as)j(an)g(action)g(to)h +Fj(BZ2_bzCompress)p Fl(.)77 b(This)150 784 y(c)m(hanges)30 +b(the)f(stream's)g(state)h(to)f(FINISHING.)g(An)m(y)g(remaining)e +(input)g(\(ie,)i Fj(next_in[0)f(..)i(avail_)150 894 y(in-1])p +Fl(\))36 b(is)f(compressed)i(and)f(transferred)g(to)h(the)g(output)g +(bu\013er.)58 b(T)-8 b(o)38 b(do)e(this,)i Fj(BZ2_bzCompress)150 +1004 y Fl(m)m(ust)h(b)s(e)f(called)g(rep)s(eatedly)h(un)m(til)e(all)h +(the)h(output)f(has)h(b)s(een)f(consumed.)66 b(A)m(t)40 +b(that)g(p)s(oin)m(t,)g Fj(BZ2_)150 1113 y(bzCompress)h +Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(and)f(the)h(stream's)g(state)h +(is)d(set)j(bac)m(k)f(to)g(IDLE.)g Fj(BZ2_)150 1223 y(bzCompressEnd)27 +b Fl(should)h(then)i(b)s(e)g(called.)150 1380 y(Just)25 +b(to)i(mak)m(e)g(sure)e(the)i(calling)d(program)i(do)s(es)g(not)g(c)m +(heat,)i(the)f(library)c(mak)m(es)k(a)f(note)h(of)f Fj(avail_in)150 +1489 y Fl(at)g(the)g(time)f(of)g(the)g(\014rst)g(call)g(to)h +Fj(BZ2_bzCompress)21 b Fl(whic)m(h)j(has)h Fj(BZ_FINISH)e +Fl(as)i(an)h(action)f(\(ie,)i(at)f(the)150 1599 y(time)d(the)h(program) +g(has)f(announced)g(its)h(in)m(ten)m(tion)f(to)h(not)g(supply)e(an)m(y) +i(more)g(input\).)37 b(By)24 b(comparing)150 1708 y(this)k(v)-5 +b(alue)28 b(with)g(that)h(of)h Fj(avail_in)c Fl(o)m(v)m(er)k(subsequen) +m(t)f(calls)f(to)h Fj(BZ2_bzCompress)p Fl(,)d(the)j(library)e(can)150 +1818 y(detect)33 b(an)m(y)e(attempts)i(to)f(slip)d(in)h(more)h(data)h +(to)h(compress.)43 b(An)m(y)31 b(calls)g(for)g(whic)m(h)f(this)g(is)h +(detected)150 1928 y(will)j(return)h Fj(BZ_SEQUENCE_ERROR)p +Fl(.)55 b(This)34 b(indicates)i(a)h(programming)e(mistak)m(e)i(whic)m +(h)e(should)g(b)s(e)150 2037 y(corrected.)150 2194 y(Instead)i(of)g +(asking)f(to)h(\014nish,)f(the)h(calling)f(program)g(ma)m(y)h(ask)g +Fj(BZ2_bzCompress)c Fl(to)38 b(tak)m(e)g(all)e(the)150 +2304 y(remaining)j(input,)i(compress)f(it)g(and)g(terminate)h(the)g +(curren)m(t)f(\(Burro)m(ws-Wheeler\))h(compression)150 +2413 y(blo)s(c)m(k.)e(This)26 b(could)h(b)s(e)g(useful)f(for)h(error)h +(con)m(trol)g(purp)s(oses.)38 b(The)27 b(mec)m(hanism)g(is)g(analogous) +h(to)g(that)150 2523 y(for)35 b(\014nishing:)46 b(call)35 +b Fj(BZ2_bzCompress)c Fl(with)i(an)i(action)g(of)g Fj(BZ_FLUSH)p +Fl(,)g(remo)m(v)m(e)h(output)f(data,)i(and)150 2632 y(p)s(ersist)h +(with)g(the)i Fj(BZ_FLUSH)e Fl(action)i(un)m(til)e(the)i(v)-5 +b(alue)39 b Fj(BZ_RUN)f Fl(is)h(returned.)68 b(As)39 +b(with)g(\014nishing,)150 2742 y Fj(BZ2_bzCompress)23 +b Fl(detects)28 b(an)m(y)f(attempt)h(to)f(pro)m(vide)f(more)h(input)e +(data)i(once)g(the)g(\015ush)e(has)i(b)s(egun.)150 2899 +y(Once)j(the)h(\015ush)e(is)g(complete,)i(the)g(stream)f(returns)g(to)h +(the)f(normal)g(R)m(UNNING)h(state.)150 3056 y(This)f(all)h(sounds)g +(prett)m(y)h(complex,)h(but)e(isn't)g(really)-8 b(.)45 +b(Here's)33 b(a)f(table)g(whic)m(h)f(sho)m(ws)h(whic)m(h)f(actions)150 +3165 y(are)e(allo)m(w)m(able)f(in)f(eac)m(h)j(state,)g(what)f(action)g +(will)c(b)s(e)j(tak)m(en,)j(what)d(the)h(next)f(state)i(is,)e(and)g +(what)h(the)150 3275 y(non-error)h(return)f(v)-5 b(alues)29 +b(are.)41 b(Note)32 b(that)e(y)m(ou)h(can't)g(explicitly)d(ask)i(what)g +(state)i(the)e(stream)h(is)e(in,)150 3384 y(but)h(nor)g(do)g(y)m(ou)h +(need)f(to)h({)g(it)e(can)i(b)s(e)f(inferred)e(from)i(the)h(v)-5 +b(alues)29 b(returned)h(b)m(y)g Fj(BZ2_bzCompress)p Fl(.)390 +3535 y(IDLE/)p Fj(any)572 3639 y Fl(Illegal.)60 b(IDLE)30 +b(state)i(only)d(exists)h(after)h Fj(BZ2_bzCompressEnd)26 +b Fl(or)572 3743 y(b)s(efore)k Fj(BZ2_bzCompressInit)p +Fl(.)572 3847 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)390 +4054 y Fl(R)m(UNNING/)p Fj(BZ_RUN)572 4158 y Fl(Compress)f(from)h +Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s +(ossible.)572 4262 y(Next)h(state)h(=)e(R)m(UNNING)572 +4366 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_RUN_OK)390 +4573 y Fl(R)m(UNNING/)p Fj(BZ_FLUSH)572 4677 y Fl(Remem)m(b)s(er)g +(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59 +b(Compress)30 b(from)g Fj(next_in)572 4781 y Fl(to)h +Fj(next_out)d Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g +(accept)i(an)m(y)f(more)f(input.)572 4885 y(Next)h(state)h(=)e +(FLUSHING)572 4988 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FLUSH_OK)390 +5196 y Fl(R)m(UNNING/)p Fj(BZ_FINISH)572 5300 y Fl(Remem)m(b)s(er)g +(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59 +b(Compress)30 b(from)g Fj(next_in)p eop +%%Page: 16 17 +16 16 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(16)572 299 y(to)31 b Fj(next_out)d +Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g(accept)i(an)m +(y)f(more)f(input.)572 403 y(Next)h(state)h(=)e(FINISHING)572 +506 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FINISH_OK)390 +714 y Fl(FLUSHING/)p Fj(BZ_FLUSH)572 818 y Fl(Compress)f(from)h +Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s +(ossible,)572 922 y(but)f(do)i(not)f(accept)i(an)m(y)f(more)f(input.) +572 1025 y(If)g(all)f(the)i(existing)e(input)f(has)i(b)s(een)g(used)g +(up)f(and)h(all)f(compressed)572 1129 y(output)h(has)g(b)s(een)g(remo)m +(v)m(ed)663 1233 y(Next)h(state)h(=)e(R)m(UNNING;)i(Return)d(v)-5 +b(alue)30 b(=)g Fj(BZ_RUN_OK)572 1337 y Fl(else)663 1440 +y(Next)h(state)h(=)e(FLUSHING;)h(Return)e(v)-5 b(alue)30 +b(=)g Fj(BZ_FLUSH_OK)390 1648 y Fl(FLUSHING/other)572 +1752 y(Illegal.)572 1856 y(Return)f(v)-5 b(alue)30 b(=)g +Fj(BZ_SEQUENCE_ERROR)390 2063 y Fl(FINISHING/)p Fj(BZ_FINISH)572 +2167 y Fl(Compress)f(from)h Fj(next_in)f Fl(to)i Fj(next_out)d +Fl(as)i(m)m(uc)m(h)h(as)f(p)s(ossible,)572 2271 y(but)f(to)j(not)e +(accept)i(an)m(y)f(more)f(input.)572 2374 y(If)g(all)f(the)i(existing)e +(input)f(has)i(b)s(een)g(used)g(up)f(and)h(all)f(compressed)572 +2478 y(output)h(has)g(b)s(een)g(remo)m(v)m(ed)663 2582 +y(Next)h(state)h(=)e(IDLE;)g(Return)g(v)-5 b(alue)30 +b(=)g Fj(BZ_STREAM_END)572 2686 y Fl(else)663 2790 y(Next)h(state)h(=)e +(FINISHING;)g(Return)g(v)-5 b(alue)30 b(=)g Fj(BZ_FINISHING)390 +2997 y Fl(FINISHING/other)572 3101 y(Illegal.)572 3205 +y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)150 +3361 y Fl(That)24 b(still)f(lo)s(oks)g(complicated?)39 +b(W)-8 b(ell,)25 b(fair)f(enough.)38 b(The)24 b(usual)f(sequence)i(of)f +(calls)g(for)g(compressing)150 3471 y(a)31 b(load)f(of)g(data)h(is:)225 +3628 y Fi(\017)60 b Fl(Get)31 b(started)g(with)e Fj(BZ2_bzCompressInit) +p Fl(.)225 3774 y Fi(\017)60 b Fl(Sho)m(v)m(el)38 b(data)h(in)e(and)g +(shlurp)e(out)k(its)e(compressed)h(form)g(using)e(zero)j(or)f(more)h +(calls)e(of)h Fj(BZ2_)330 3884 y(bzCompress)28 b Fl(with)h(action)h(=)g +Fj(BZ_RUN)p Fl(.)225 4030 y Fi(\017)60 b Fl(Finish)23 +b(up.)38 b(Rep)s(eatedly)25 b(call)f Fj(BZ2_bzCompress)e +Fl(with)i(action)h(=)g Fj(BZ_FINISH)p Fl(,)f(cop)m(ying)h(out)h(the)330 +4139 y(compressed)k(output,)g(un)m(til)f Fj(BZ_STREAM_END)e +Fl(is)i(returned.)225 4285 y Fi(\017)60 b Fl(Close)30 +b(up)f(and)h(go)h(home.)41 b(Call)29 b Fj(BZ2_bzCompressEnd)p +Fl(.)150 4478 y(If)23 b(the)h(data)h(y)m(ou)f(w)m(an)m(t)h(to)f +(compress)g(\014ts)f(in)m(to)h(y)m(our)g(input)e(bu\013er)h(all)f(at)j +(once,)h(y)m(ou)e(can)g(skip)f(the)h(calls)150 4588 y(of)37 +b Fj(BZ2_bzCompress)26 b(\()k(...,)f(BZ_RUN)g(\))36 b +Fl(and)g(just)g(do)h(the)g Fj(BZ2_bzCompress)26 b(\()k(...,)f +(BZ_FINISH)150 4698 y(\))h Fl(calls.)150 4854 y(All)36 +b(required)g(memory)h(is)f(allo)s(cated)i(b)m(y)f Fj +(BZ2_bzCompressInit)p Fl(.)56 b(The)37 b(compression)g(library)e(can) +150 4964 y(accept)g(an)m(y)f(data)h(at)g(all)d(\(ob)m(viously\).)51 +b(So)34 b(y)m(ou)g(shouldn't)e(get)j(an)m(y)f(error)f(return)g(v)-5 +b(alues)33 b(from)h(the)150 5074 y Fj(BZ2_bzCompress)29 +b Fl(calls.)46 b(If)32 b(y)m(ou)h(do,)g(they)g(will)d(b)s(e)i +Fj(BZ_SEQUENCE_ERROR)p Fl(,)d(and)j(indicate)f(a)i(bug)f(in)150 +5183 y(y)m(our)e(programming.)150 5340 y(T)-8 b(rivial)28 +b(other)j(p)s(ossible)d(return)h(v)-5 b(alues:)p eop +%%Page: 17 18 +17 17 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(17)572 299 y Fj(BZ_PARAM_ERROR)663 +403 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)p Fl(,)f(or)i +Fj(strm->s)d Fl(is)h Fj(NULL)150 652 y Ff(3.3.3)63 b +Fe(BZ2_bzCompressEnd)390 839 y Fj(int)47 b(BZ2_bzCompressEnd)c(\()k +(bz_stream)f(*strm)g(\);)150 996 y Fl(Releases)31 b(all)e(memory)h +(asso)s(ciated)h(with)e(a)i(compression)e(stream.)150 +1153 y(P)m(ossible)g(return)h(v)-5 b(alues:)481 1304 +y Fj(BZ_PARAM_ERROR)117 b Fl(if)30 b Fj(strm)f Fl(is)g +Fj(NULL)g Fl(or)i Fj(strm->s)d Fl(is)i Fj(NULL)481 1408 +y(BZ_OK)120 b Fl(otherwise)150 1657 y Ff(3.3.4)63 b Fe +(BZ2_bzDecompressInit)390 1844 y Fj(int)47 b(BZ2_bzDecompressInit)42 +b(\()48 b(bz_stream)d(*strm,)h(int)h(verbosity,)e(int)i(small)f(\);)150 +2001 y Fl(Prepares)30 b(for)f(decompression.)40 b(As)29 +b(with)g Fj(BZ2_bzCompressInit)p Fl(,)c(a)31 b Fj(bz_stream)c +Fl(record)j(should)e(b)s(e)150 2110 y(allo)s(cated)c(and)f(initialised) +e(b)s(efore)i(the)i(call.)38 b(Fields)22 b Fj(bzalloc)p +Fl(,)i Fj(bzfree)e Fl(and)i Fj(opaque)e Fl(should)g(b)s(e)h(set)i(if) +150 2220 y(a)h(custom)f(memory)g(allo)s(cator)g(is)g(required,)f(or)h +(made)h Fj(NULL)e Fl(for)h(the)g(normal)f Fj(malloc)p +Fl(/)p Fj(free)f Fl(routines.)150 2330 y(Up)s(on)h(return,)h(the)g(in)m +(ternal)f(state)i(will)c(ha)m(v)m(e)k(b)s(een)f(initialised,)d(and)i +Fj(total_in)f Fl(and)h Fj(total_out)f Fl(will)150 2439 +y(b)s(e)30 b(zero.)150 2596 y(F)-8 b(or)31 b(the)g(meaning)e(of)i +(parameter)g Fj(verbosity)p Fl(,)d(see)j Fj(BZ2_bzCompressInit)p +Fl(.)150 2753 y(If)e Fj(small)e Fl(is)h(nonzero,)i(the)f(library)e +(will)f(use)j(an)g(alternativ)m(e)h(decompression)e(algorithm)g(whic)m +(h)f(uses)150 2862 y(less)c(memory)g(but)g(at)h(the)g(cost)h(of)e +(decompressing)g(more)g(slo)m(wly)g(\(roughly)f(sp)s(eaking,)i(half)f +(the)h(sp)s(eed,)150 2972 y(but)34 b(the)i(maxim)m(um)d(memory)i +(requiremen)m(t)g(drops)e(to)j(around)e(2300k\).)57 b(See)35 +b(Chapter)g(2)g(for)g(more)150 3082 y(information)29 +b(on)h(memory)g(managemen)m(t.)150 3238 y(Note)40 b(that)f(the)f(amoun) +m(t)h(of)g(memory)f(needed)g(to)i(decompress)e(a)h(stream)f(cannot)h(b) +s(e)f(determined)150 3348 y(un)m(til)j(the)h(stream's)h(header)f(has)g +(b)s(een)g(read,)j(so)e(ev)m(en)g(if)e Fj(BZ2_bzDecompressInit)c +Fl(succeeds,)46 b(a)150 3458 y(subsequen)m(t)30 b Fj(BZ2_bzDecompress)c +Fl(could)j(fail)g(with)g Fj(BZ_MEM_ERROR)p Fl(.)150 3614 +y(P)m(ossible)g(return)h(v)-5 b(alues:)572 3765 y Fj(BZ_CONFIG_ERROR) +663 3869 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +3973 y Fj(BZ_PARAM_ERROR)663 4077 y Fl(if)g Fj(\(small)46 +b(!=)h(0)h(&&)f(small)f(!=)h(1\))663 4181 y Fl(or)30 +b Fj(\(verbosity)45 b(<)j(0)f(||)g(verbosity)e(>)j(4\))572 +4284 y(BZ_MEM_ERROR)663 4388 y Fl(if)29 b(insu\016cien)m(t)g(memory)h +(is)f(a)m(v)-5 b(ailable)150 4545 y(Allo)m(w)m(able)30 +b(next)g(actions:)572 4696 y Fj(BZ2_bzDecompress)663 +4800 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4904 +y(no)f(sp)s(eci\014c)f(action)i(required)e(in)g(case)i(of)g(error)150 +5153 y Ff(3.3.5)63 b Fe(BZ2_bzDecompress)390 5340 y Fj(int)47 +b(BZ2_bzDecompress)c(\()48 b(bz_stream)d(*strm)h(\);)p +eop +%%Page: 18 19 +18 18 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(18)150 299 y(Pro)m(vides)24 +b(more)g(input)f(and/out)h(output)g(bu\013er)g(space)h(for)f(the)g +(library)-8 b(.)37 b(The)24 b(caller)g(main)m(tains)f(input)150 +408 y(and)30 b(output)g(bu\013ers,)f(and)h(uses)g Fj(BZ2_bzDecompress)c +Fl(to)31 b(transfer)f(data)h(b)s(et)m(w)m(een)g(them.)150 +565 y(Before)g(eac)m(h)g(call)f(to)g Fj(BZ2_bzDecompress)p +Fl(,)c Fj(next_in)i Fl(should)h(p)s(oin)m(t)g(at)h(the)h(compressed)e +(data,)j(and)150 675 y Fj(avail_in)h Fl(should)h(indicate)h(ho)m(w)h +(man)m(y)f(b)m(ytes)i(the)e(library)f(ma)m(y)i(read.)56 +b Fj(BZ2_bzDecompress)32 b Fl(up-)150 784 y(dates)f Fj(next_in)p +Fl(,)e Fj(avail_in)f Fl(and)h Fj(total_in)g Fl(to)i(re\015ect)g(the)f +(n)m(um)m(b)s(er)f(of)i(b)m(ytes)g(it)f(has)g(read.)150 +941 y(Similarly)-8 b(,)37 b Fj(next_out)f Fl(should)g(p)s(oin)m(t)i(to) +g(a)h(bu\013er)e(in)g(whic)m(h)g(the)i(uncompressed)e(output)g(is)h(to) +h(b)s(e)150 1051 y(placed,)d(with)e Fj(avail_out)f Fl(indicating)g(ho)m +(w)i(m)m(uc)m(h)g(output)g(space)h(is)e(a)m(v)-5 b(ailable.)55 +b Fj(BZ2_bzCompress)150 1160 y Fl(up)s(dates)29 b Fj(next_out)p +Fl(,)g Fj(avail_out)f Fl(and)h Fj(total_out)f Fl(to)j(re\015ect)g(the)g +(n)m(um)m(b)s(er)e(of)h(b)m(ytes)h(output.)150 1317 y(Y)-8 +b(ou)40 b(ma)m(y)g(pro)m(vide)e(and)h(remo)m(v)m(e)i(as)f(little)e(or)h +(as)h(m)m(uc)m(h)f(data)h(as)g(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e +(of)g Fj(BZ2_)150 1427 y(bzDecompress)p Fl(.)e(In)27 +b(the)i(limit,)d(it)i(is)f(acceptable)j(to)f(supply)d(and)h(remo)m(v)m +(e)j(data)f(one)f(b)m(yte)h(at)g(a)g(time,)150 1537 y(although)f(this)f +(w)m(ould)g(b)s(e)h(terribly)e(ine\016cien)m(t.)39 b(Y)-8 +b(ou)29 b(should)e(alw)m(a)m(ys)h(ensure)g(that)h(at)g(least)g(one)f(b) +m(yte)150 1646 y(of)j(output)f(space)g(is)g(a)m(v)-5 +b(ailable)30 b(at)h(eac)m(h)g(call.)150 1803 y(Use)g(of)f +Fj(BZ2_bzDecompress)c Fl(is)k(simpler)e(than)i Fj(BZ2_bzCompress)p +Fl(.)150 1960 y(Y)-8 b(ou)31 b(should)d(pro)m(vide)h(input)f(and)i +(remo)m(v)m(e)i(output)d(as)i(describ)s(ed)d(ab)s(o)m(v)m(e,)k(and)d +(rep)s(eatedly)h(call)f Fj(BZ2_)150 2069 y(bzDecompress)35 +b Fl(un)m(til)i Fj(BZ_STREAM_END)e Fl(is)j(returned.)64 +b(App)s(earance)39 b(of)g Fj(BZ_STREAM_END)c Fl(denotes)150 +2179 y(that)47 b Fj(BZ2_bzDecompress)42 b Fl(has)k(detected)h(the)f +(logical)g(end)g(of)g(the)h(compressed)e(stream.)89 b +Fj(BZ2_)150 2289 y(bzDecompress)28 b Fl(will)g(not)j(pro)s(duce)f +Fj(BZ_STREAM_END)d Fl(un)m(til)j(all)f(output)i(data)h(has)e(b)s(een)h +(placed)f(in)m(to)150 2398 y(the)36 b(output)g(bu\013er,)h(so)g(once)g +Fj(BZ_STREAM_END)32 b Fl(app)s(ears,)38 b(y)m(ou)e(are)h(guaran)m(teed) +g(to)g(ha)m(v)m(e)h(a)m(v)-5 b(ailable)150 2508 y(all)29 +b(the)i(decompressed)f(output,)g(and)g Fj(BZ2_bzDecompressEnd)25 +b Fl(can)31 b(safely)f(b)s(e)f(called.)150 2665 y(If)40 +b(case)h(of)f(an)h(error)e(return)h(v)-5 b(alue,)42 b(y)m(ou)f(should)d +(call)h Fj(BZ2_bzDecompressEnd)c Fl(to)41 b(clean)f(up)g(and)150 +2774 y(release)31 b(memory)-8 b(.)150 2931 y(P)m(ossible)29 +b(return)h(v)-5 b(alues:)572 3082 y Fj(BZ_PARAM_ERROR)663 +3186 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)f Fl(or)h +Fj(strm->s)f Fl(is)g Fj(NULL)663 3290 y Fl(or)h Fj(strm->avail_out)44 +b(<)j(1)572 3393 y(BZ_DATA_ERROR)663 3497 y Fl(if)29 +b(a)i(data)g(in)m(tegrit)m(y)f(error)g(is)g(detected)h(in)e(the)i +(compressed)f(stream)572 3601 y Fj(BZ_DATA_ERROR_MAGIC)663 +3705 y Fl(if)f(the)i(compressed)f(stream)g(do)s(esn't)h(b)s(egin)e +(with)g(the)h(righ)m(t)g(magic)h(b)m(ytes)572 3808 y +Fj(BZ_MEM_ERROR)663 3912 y Fl(if)e(there)i(w)m(asn't)f(enough)h(memory) +f(a)m(v)-5 b(ailable)572 4016 y Fj(BZ_STREAM_END)663 +4120 y Fl(if)29 b(the)i(logical)e(end)h(of)h(the)f(data)h(stream)g(w)m +(as)g(detected)g(and)f(all)663 4224 y(output)g(in)f(has)h(b)s(een)g +(consumed,)f(eg)j Fj(s->avail_out)44 b(>)k(0)572 4327 +y(BZ_OK)663 4431 y Fl(otherwise)150 4588 y(Allo)m(w)m(able)30 +b(next)g(actions:)572 4739 y Fj(BZ2_bzDecompress)663 +4843 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4946 +y Fj(BZ2_bzDecompressEnd)663 5050 y Fl(otherwise)p eop +%%Page: 19 20 +19 19 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(19)150 299 y Ff(3.3.6)63 +b Fe(BZ2_bzDecompressEnd)390 486 y Fj(int)47 b(BZ2_bzDecompressEnd)42 +b(\()48 b(bz_stream)d(*strm)i(\);)150 643 y Fl(Releases)31 +b(all)e(memory)h(asso)s(ciated)h(with)e(a)i(decompression)e(stream.)150 +799 y(P)m(ossible)g(return)h(v)-5 b(alues:)572 950 y +Fj(BZ_PARAM_ERROR)663 1054 y Fl(if)29 b Fj(strm)g Fl(is)h +Fj(NULL)f Fl(or)h Fj(strm->s)f Fl(is)g Fj(NULL)572 1158 +y(BZ_OK)663 1262 y Fl(otherwise)150 1419 y(Allo)m(w)m(able)h(next)g +(actions:)572 1570 y(None.)150 1857 y Fk(3.4)68 b(High-lev)l(el)47 +b(in)l(terface)150 2050 y Fl(This)35 b(in)m(terface)j(pro)m(vides)d +(functions)h(for)g(reading)g(and)h(writing)e Fj(bzip2)g +Fl(format)i(\014les.)59 b(First,)39 b(some)150 2159 y(general)30 +b(p)s(oin)m(ts.)225 2316 y Fi(\017)60 b Fl(All)35 b(of)h(the)g +(functions)e(tak)m(e)k(an)e Fj(int*)f Fl(\014rst)g(argumen)m(t,)j +Fj(bzerror)p Fl(.)56 b(After)36 b(eac)m(h)h(call,)g Fj(bzerror)330 +2426 y Fl(should)23 b(b)s(e)i(consulted)g(\014rst)g(to)h(determine)e +(the)i(outcome)h(of)e(the)h(call.)38 b(If)25 b Fj(bzerror)f +Fl(is)g Fj(BZ_OK)p Fl(,)i(the)330 2535 y(call)35 b(completed)g +(successfully)-8 b(,)36 b(and)f(only)g(then)g(should)f(the)h(return)g +(v)-5 b(alue)35 b(of)h(the)f(function)g(\(if)330 2645 +y(an)m(y\))30 b(b)s(e)f(consulted.)39 b(If)29 b Fj(bzerror)e +Fl(is)h Fj(BZ_IO_ERROR)p Fl(,)f(there)i(w)m(as)h(an)f(error)g +(reading/writing)e(the)330 2754 y(underlying)32 b(compressed)j(\014le,) +h(and)f(y)m(ou)h(should)d(then)i(consult)g Fj(errno)p +Fl(/)p Fj(perror)e Fl(to)j(determine)330 2864 y(the)i(cause)g(of)g(the) +g(di\016cult)m(y)-8 b(.)61 b Fj(bzerror)36 b Fl(ma)m(y)i(also)g(b)s(e)f +(set)h(to)g(v)-5 b(arious)37 b(other)h(v)-5 b(alues;)41 +b(precise)330 2974 y(details)29 b(are)i(giv)m(en)g(on)f(a)h(p)s +(er-function)d(basis)h(b)s(elo)m(w.)225 3111 y Fi(\017)60 +b Fl(If)40 b Fj(bzerror)f Fl(indicates)g(an)i(error)f(\(ie,)j(an)m +(ything)d(except)h Fj(BZ_OK)f Fl(and)g Fj(BZ_STREAM_END)p +Fl(\),)g(y)m(ou)330 3220 y(should)56 b(immediately)h(call)g +Fj(BZ2_bzReadClose)e Fl(\(or)j Fj(BZ2_bzWriteClose)p +Fl(,)j(dep)s(ending)56 b(on)330 3330 y(whether)50 b(y)m(ou)g(are)h +(attempting)g(to)g(read)f(or)g(to)i(write\))d(to)j(free)e(up)f(all)h +(resources)g(asso)s(ci-)330 3439 y(ated)33 b(with)e(the)i(stream.)47 +b(Once)32 b(an)h(error)f(has)g(b)s(een)g(indicated,)f(b)s(eha)m(viour)g +(of)i(all)e(calls)h(except)330 3549 y Fj(BZ2_bzReadClose)46 +b Fl(\()p Fj(BZ2_bzWriteClose)p Fl(\))h(is)j(unde\014ned.)99 +b(The)50 b(implication)e(is)i(that)h(\(1\))330 3659 y +Fj(bzerror)44 b Fl(should)g(b)s(e)h(c)m(hec)m(k)m(ed)j(after)e(eac)m(h) +h(call,)i(and)c(\(2\))i(if)e Fj(bzerror)f Fl(indicates)g(an)i(error,) +330 3768 y Fj(BZ2_bzReadClose)26 b Fl(\()p Fj(BZ2_bzWriteClose)p +Fl(\))h(should)h(then)i(b)s(e)g(called)g(to)h(clean)f(up.)225 +3905 y Fi(\017)60 b Fl(The)33 b Fj(FILE*)f Fl(argumen)m(ts)h(passed)g +(to)h Fj(BZ2_bzReadOpen)p Fl(/)p Fj(BZ2_bzWriteOp)o(en)27 +b Fl(should)32 b(b)s(e)g(set)i(to)330 4015 y(binary)23 +b(mo)s(de.)38 b(Most)26 b(Unix)d(systems)i(will)d(do)i(this)g(b)m(y)g +(default,)i(but)e(other)g(platforms,)h(including)330 +4124 y(Windo)m(ws)20 b(and)g(Mac,)k(will)19 b(not.)38 +b(If)20 b(y)m(ou)h(omit)g(this,)h(y)m(ou)f(ma)m(y)h(encoun)m(ter)f +(problems)e(when)h(mo)m(ving)330 4234 y(co)s(de)31 b(to)g(new)f +(platforms.)225 4371 y Fi(\017)60 b Fl(Memory)23 b(allo)s(cation)f +(requests)h(are)g(handled)e(b)m(y)i Fj(malloc)p Fl(/)p +Fj(free)p Fl(.)36 b(A)m(t)23 b(presen)m(t)g(there)g(is)f(no)h(facilit)m +(y)330 4481 y(for)40 b(user-de\014ned)e(memory)i(allo)s(cators)g(in)f +(the)h(\014le)g(I/O)g(functions)e(\(could)i(easily)f(b)s(e)g(added,)330 +4590 y(though\).)150 4842 y Ff(3.4.1)63 b Fe(BZ2_bzReadOpen)533 +5029 y Fj(typedef)46 b(void)h(BZFILE;)533 5236 y(BZFILE)f +(*BZ2_bzReadOpen)e(\()j(int)g(*bzerror,)f(FILE)g(*f,)1726 +5340 y(int)h(small,)f(int)h(verbosity,)p eop +%%Page: 20 21 +20 20 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g +Fj(libbzip2)1891 b Fl(20)1726 299 y Fj(void)47 b(*unused,)f(int)g +(nUnused)g(\);)150 456 y Fl(Prepare)29 b(to)g(read)g(compressed)f(data) +i(from)e(\014le)g(handle)f Fj(f)p Fl(.)40 b Fj(f)29 b +Fl(should)d(refer)j(to)h(a)f(\014le)f(whic)m(h)f(has)i(b)s(een)150 +565 y(op)s(ened)h(for)h(reading,)f(and)h(for)f(whic)m(h)g(the)h(error)g +(indicator)e(\()p Fj(ferror\(f\))p Fl(\)is)f(not)k(set.)42 +b(If)31 b Fj(small)e Fl(is)h(1,)150 675 y(the)h(library)d(will)f(try)j +(to)i(decompress)e(using)f(less)g(memory)-8 b(,)31 b(at)g(the)g(exp)s +(ense)f(of)g(sp)s(eed.)150 832 y(F)-8 b(or)39 b(reasons)f(explained)f +(b)s(elo)m(w,)j Fj(BZ2_bzRead)35 b Fl(will)h(decompress)i(the)g +Fj(nUnused)e Fl(b)m(ytes)j(starting)f(at)150 941 y Fj(unused)p +Fl(,)k(b)s(efore)e(starting)h(to)g(read)g(from)f(the)h(\014le)f +Fj(f)p Fl(.)71 b(A)m(t)42 b(most)f Fj(BZ_MAX_UNUSED)c +Fl(b)m(ytes)k(ma)m(y)h(b)s(e)150 1051 y(supplied)32 b(lik)m(e)k(this.) +55 b(If)36 b(this)e(facilit)m(y)h(is)g(not)h(required,)g(y)m(ou)g +(should)e(pass)h Fj(NULL)g Fl(and)g Fj(0)g Fl(for)h Fj(unused)150 +1160 y Fl(and)30 b(n)p Fj(Unused)e Fl(resp)s(ectiv)m(ely)-8 +b(.)150 1317 y(F)g(or)31 b(the)g(meaning)e(of)i(parameters)g +Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj +(BZ2_bzDecompressInit)p Fl(.)150 1474 y(The)k(amoun)m(t)g(of)g(memory)g +(needed)g(to)g(decompress)g(a)h(\014le)e(cannot)h(b)s(e)g(determined)e +(un)m(til)h(the)h(\014le's)150 1584 y(header)22 b(has)f(b)s(een)g +(read.)38 b(So)22 b(it)f(is)g(p)s(ossible)e(that)k Fj(BZ2_bzReadOpen)17 +b Fl(returns)k Fj(BZ_OK)f Fl(but)h(a)i(subsequen)m(t)150 +1693 y(call)30 b(of)g Fj(BZ2_bzRead)e Fl(will)f(return)j +Fj(BZ_MEM_ERROR)p Fl(.)150 1850 y(P)m(ossible)f(assignmen)m(ts)h(to)h +Fj(bzerror)p Fl(:)572 2001 y Fj(BZ_CONFIG_ERROR)663 2105 +y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +2209 y Fj(BZ_PARAM_ERROR)663 2313 y Fl(if)g Fj(f)h Fl(is)g +Fj(NULL)663 2416 y Fl(or)g Fj(small)f Fl(is)g(neither)h +Fj(0)g Fl(nor)g Fj(1)663 2520 y Fl(or)g Fj(\(unused)46 +b(==)h(NULL)g(&&)g(nUnused)f(!=)h(0\))663 2624 y Fl(or)30 +b Fj(\(unused)46 b(!=)h(NULL)g(&&)g(!\(0)g(<=)g(nUnused)f(<=)h +(BZ_MAX_UNUSED\)\))572 2728 y(BZ_IO_ERROR)663 2831 y +Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572 2935 +y Fj(BZ_MEM_ERROR)663 3039 y Fl(if)g(insu\016cien)m(t)g(memory)h(is)f +(a)m(v)-5 b(ailable)572 3143 y Fj(BZ_OK)663 3247 y Fl(otherwise.)150 +3403 y(P)m(ossible)29 b(return)h(v)-5 b(alues:)572 3554 +y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h Fj(BZFILE)663 +3658 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 3762 +y(NULL)663 3866 y Fl(otherwise)150 4023 y(Allo)m(w)m(able)g(next)g +(actions:)572 4174 y Fj(BZ2_bzRead)663 4277 y Fl(if)f +Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 4381 y(BZ2_bzClose)663 +4485 y Fl(otherwise)150 4887 y Ff(3.4.2)63 b Fe(BZ2_bzRead)533 +5074 y Fj(int)47 b(BZ2_bzRead)e(\()j(int)e(*bzerror,)g(BZFILE)g(*b,)h +(void)f(*buf,)h(int)g(len)g(\);)150 5230 y Fl(Reads)35 +b(up)f(to)h Fj(len)f Fl(\(uncompressed\))h(b)m(ytes)g(from)f(the)h +(compressed)g(\014le)f Fj(b)g Fl(in)m(to)h(the)g(bu\013er)f +Fj(buf)p Fl(.)53 b(If)150 5340 y(the)30 b(read)f(w)m(as)h(successful,)f +Fj(bzerror)e Fl(is)i(set)h(to)g Fj(BZ_OK)e Fl(and)h(the)h(n)m(um)m(b)s +(er)e(of)i(b)m(ytes)g(read)f(is)g(returned.)p eop +%%Page: 21 22 +21 21 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(21)150 299 y(If)33 b(the)g(logical)g +(end-of-stream)h(w)m(as)g(detected,)i Fj(bzerror)31 b +Fl(will)g(b)s(e)h(set)i(to)g Fj(BZ_STREAM_END)p Fl(,)d(and)i(the)150 +408 y(n)m(um)m(b)s(er)c(of)i(b)m(ytes)f(read)h(is)e(returned.)40 +b(All)29 b(other)h Fj(bzerror)f Fl(v)-5 b(alues)29 b(denote)i(an)g +(error.)150 565 y Fj(BZ2_bzRead)37 b Fl(will)f(supply)h +Fj(len)i Fl(b)m(ytes,)j(unless)c(the)i(logical)f(stream)h(end)e(is)h +(detected)i(or)e(an)g(error)150 675 y(o)s(ccurs.)75 b(Because)43 +b(of)f(this,)i(it)d(is)g(p)s(ossible)e(to)k(detect)g(the)f(stream)g +(end)f(b)m(y)h(observing)f(when)g(the)150 784 y(n)m(um)m(b)s(er)29 +b(of)h(b)m(ytes)g(returned)f(is)g(less)g(than)h(the)g(n)m(um)m(b)s(er)f +(requested.)40 b(Nev)m(ertheless,)31 b(this)e(is)g(regarded)150 +894 y(as)38 b(inadvisable;)g(y)m(ou)g(should)d(instead)i(c)m(hec)m(k)i +Fj(bzerror)d Fl(after)i(ev)m(ery)g(call)e(and)h(w)m(atc)m(h)i(out)f +(for)f Fj(BZ_)150 1004 y(STREAM_END)p Fl(.)150 1160 y(In)m(ternally)-8 +b(,)47 b Fj(BZ2_bzRead)41 b Fl(copies)j(data)g(from)g(the)g(compressed) +g(\014le)f(in)f(c)m(h)m(unks)i(of)g(size)g Fj(BZ_MAX_)150 +1270 y(UNUSED)31 b Fl(b)m(ytes)i(b)s(efore)f(decompressing)f(it.)47 +b(If)32 b(the)h(\014le)e(con)m(tains)i(more)g(b)m(ytes)g(than)f +(strictly)f(needed)150 1380 y(to)48 b(reac)m(h)f(the)g(logical)f +(end-of-stream,)52 b Fj(BZ2_bzRead)44 b Fl(will)g(almost)j(certainly)f +(read)h(some)g(of)g(the)150 1489 y(trailing)c(data)j(b)s(efore)e +(signalling)f Fj(BZ_SEQUENCE_END)p Fl(.)80 b(T)-8 b(o)46 +b(collect)f(the)g(read)g(but)g(un)m(used)e(data)150 1599 +y(once)29 b Fj(BZ_SEQUENCE_END)24 b Fl(has)k(app)s(eared,)g(call)f +Fj(BZ2_bzReadGetUnused)c Fl(immediately)j(b)s(efore)i +Fj(BZ2_)150 1708 y(bzReadClose)p Fl(.)150 1865 y(P)m(ossible)h +(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 2016 y Fj(BZ_PARAM_ERROR) +663 2120 y Fl(if)e Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g +Fl(is)f Fj(NULL)g Fl(or)i Fj(len)46 b(<)i(0)572 2224 +y(BZ_SEQUENCE_ERROR)663 2328 y Fl(if)29 b Fj(b)h Fl(w)m(as)h(op)s(ened) +e(with)h Fj(BZ2_bzWriteOpen)572 2431 y(BZ_IO_ERROR)663 +2535 y Fl(if)f(there)i(is)e(an)h(error)g(reading)g(from)g(the)g +(compressed)g(\014le)572 2639 y Fj(BZ_UNEXPECTED_EOF)663 +2743 y Fl(if)f(the)i(compressed)f(\014le)f(ended)h(b)s(efore)g(the)g +(logical)g(end-of-stream)h(w)m(as)g(detected)572 2847 +y Fj(BZ_DATA_ERROR)663 2950 y Fl(if)e(a)i(data)g(in)m(tegrit)m(y)f +(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(stream)572 +3054 y Fj(BZ_DATA_ERROR_MAGIC)663 3158 y Fl(if)f(the)i(stream)f(do)s +(es)g(not)h(b)s(egin)e(with)g(the)i(requisite)e(header)h(b)m(ytes)h +(\(ie,)f(is)g(not)663 3262 y(a)g Fj(bzip2)f Fl(data)i(\014le\).)61 +b(This)28 b(is)i(really)f(a)i(sp)s(ecial)e(case)i(of)g +Fj(BZ_DATA_ERROR)p Fl(.)572 3365 y Fj(BZ_MEM_ERROR)663 +3469 y Fl(if)e(insu\016cien)m(t)g(memory)h(w)m(as)h(a)m(v)-5 +b(ailable)572 3573 y Fj(BZ_STREAM_END)663 3677 y Fl(if)29 +b(the)i(logical)e(end)h(of)h(stream)f(w)m(as)h(detected.)572 +3781 y Fj(BZ_OK)663 3884 y Fl(otherwise.)150 4041 y(P)m(ossible)e +(return)h(v)-5 b(alues:)572 4192 y(n)m(um)m(b)s(er)29 +b(of)h(b)m(ytes)h(read)663 4296 y(if)e Fj(bzerror)f Fl(is)i +Fj(BZ_OK)f Fl(or)h Fj(BZ_STREAM_END)572 4400 y Fl(unde\014ned)663 +4503 y(otherwise)150 4660 y(Allo)m(w)m(able)g(next)g(actions:)572 +4811 y(collect)h(data)g(from)f Fj(buf)p Fl(,)f(then)h +Fj(BZ2_bzRead)e Fl(or)i Fj(BZ2_bzReadClose)663 4915 y +Fl(if)f Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 5019 y Fl(collect)h(data)g +(from)f Fj(buf)p Fl(,)f(then)h Fj(BZ2_bzReadClose)d Fl(or)j +Fj(BZ2_bzReadGetUnused)663 5123 y Fl(if)f Fj(bzerror)f +Fl(is)i Fj(BZ_SEQUENCE_END)572 5226 y(BZ2_bzReadClose)663 +5330 y Fl(otherwise)p eop +%%Page: 22 23 +22 22 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(22)150 299 y Ff(3.4.3)63 +b Fe(BZ2_bzReadGetUnused)533 486 y Fj(void)47 b(BZ2_bzReadGetUnused)42 +b(\()48 b(int*)e(bzerror,)g(BZFILE)g(*b,)1822 589 y(void**)g(unused,)g +(int*)g(nUnused)g(\);)150 746 y Fl(Returns)36 b(data)i(whic)m(h)d(w)m +(as)j(read)f(from)f(the)h(compressed)g(\014le)f(but)g(w)m(as)h(not)h +(needed)e(to)i(get)g(to)g(the)150 856 y(logical)k(end-of-stream.)78 +b Fj(*unused)41 b Fl(is)h(set)h(to)g(the)g(address)f(of)g(the)h(data,)k +(and)42 b Fj(*nUnused)e Fl(to)k(the)150 965 y(n)m(um)m(b)s(er)29 +b(of)i(b)m(ytes.)41 b Fj(*nUnused)28 b Fl(will)g(b)s(e)h(set)i(to)g(a)g +(v)-5 b(alue)30 b(b)s(et)m(w)m(een)h Fj(0)f Fl(and)g +Fj(BZ_MAX_UNUSED)d Fl(inclusiv)m(e.)150 1122 y(This)d(function)h(ma)m +(y)h(only)g(b)s(e)f(called)g(once)i Fj(BZ2_bzRead)c Fl(has)j(signalled) +e Fj(BZ_STREAM_END)e Fl(but)j(b)s(efore)150 1232 y Fj(BZ2_bzReadClose)p +Fl(.)150 1389 y(P)m(ossible)k(assignmen)m(ts)h(to)h Fj(bzerror)p +Fl(:)572 1540 y Fj(BZ_PARAM_ERROR)663 1644 y Fl(if)e +Fj(b)h Fl(is)g Fj(NULL)663 1747 y Fl(or)g Fj(unused)f +Fl(is)g Fj(NULL)g Fl(or)i Fj(nUnused)d Fl(is)i Fj(NULL)572 +1851 y(BZ_SEQUENCE_ERROR)663 1955 y Fl(if)f Fj(BZ_STREAM_END)e +Fl(has)j(not)h(b)s(een)e(signalled)663 2059 y(or)h(if)f +Fj(b)h Fl(w)m(as)h(op)s(ened)f(with)f Fj(BZ2_bzWriteOpen)542 +2162 y(BZ_OK)663 2266 y Fl(otherwise)150 2423 y(Allo)m(w)m(able)h(next) +g(actions:)572 2574 y Fj(BZ2_bzReadClose)150 2882 y Ff(3.4.4)63 +b Fe(BZ2_bzReadClose)533 3068 y Fj(void)47 b(BZ2_bzReadClose)c(\()48 +b(int)f(*bzerror,)e(BZFILE)h(*b)h(\);)150 3225 y Fl(Releases)36 +b(all)e(memory)h(p)s(ertaining)e(to)i(the)h(compressed)f(\014le)f +Fj(b)p Fl(.)54 b Fj(BZ2_bzReadClose)31 b Fl(do)s(es)k(not)h(call)150 +3335 y Fj(fclose)c Fl(on)h(the)h(underlying)d(\014le)h(handle,)h(so)h +(y)m(ou)g(should)e(do)h(that)h(y)m(ourself)f(if)g(appropriate.)49 +b Fj(BZ2_)150 3445 y(bzReadClose)27 b Fl(should)i(b)s(e)g(called)h(to)h +(clean)f(up)g(after)h(all)e(error)h(situations.)150 3601 +y(P)m(ossible)f(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 +3752 y Fj(BZ_SEQUENCE_ERROR)663 3856 y Fl(if)e Fj(b)h +Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzOpenWrite)572 +3960 y(BZ_OK)663 4064 y Fl(otherwise)150 4221 y(Allo)m(w)m(able)g(next) +g(actions:)572 4372 y(none)150 4679 y Ff(3.4.5)63 b Fe(BZ2_bzWriteOpen) +533 4866 y Fj(BZFILE)46 b(*BZ2_bzWriteOpen)e(\()j(int)g(*bzerror,)e +(FILE)i(*f,)1774 4970 y(int)g(blockSize100k,)d(int)j(verbosity,)1774 +5074 y(int)g(workFactor)e(\);)150 5230 y Fl(Prepare)33 +b(to)g(write)f(compressed)h(data)h(to)f(\014le)f(handle)g +Fj(f)p Fl(.)47 b Fj(f)33 b Fl(should)e(refer)i(to)g(a)g(\014le)f(whic)m +(h)g(has)h(b)s(een)150 5340 y(op)s(ened)d(for)g(writing,)e(and)i(for)g +(whic)m(h)f(the)i(error)f(indicator)f(\()p Fj(ferror\(f\))p +Fl(\)is)f(not)i(set.)p eop +%%Page: 23 24 +23 23 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(23)150 299 y(F)-8 b(or)31 +b(the)g(meaning)e(of)i(parameters)g Fj(blockSize100k)p +Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p Fl(,)e(see)150 +408 y Fj(BZ2_bzCompressInit)p Fl(.)150 565 y(All)d(required)f(memory)i +(is)f(allo)s(cated)i(at)g(this)e(stage,)j(so)f(if)e(the)h(call)g +(completes)g(successfully)-8 b(,)26 b Fj(BZ_MEM_)150 +675 y(ERROR)j Fl(cannot)i(b)s(e)f(signalled)e(b)m(y)i(a)h(subsequen)m +(t)f(call)f(to)i Fj(BZ2_bzWrite)p Fl(.)150 832 y(P)m(ossible)e +(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 983 y Fj(BZ_CONFIG_ERROR) +663 1087 y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +1190 y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(f)h Fl(is)g +Fj(NULL)663 1398 y Fl(or)g Fj(blockSize100k)44 b(<)k(1)30 +b Fl(or)g Fj(blockSize100k)44 b(>)k(9)572 1502 y(BZ_IO_ERROR)663 +1605 y Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572 +1709 y Fj(BZ_MEM_ERROR)663 1813 y Fl(if)g(insu\016cien)m(t)g(memory)h +(is)f(a)m(v)-5 b(ailable)572 1917 y Fj(BZ_OK)663 2021 +y Fl(otherwise)150 2177 y(P)m(ossible)29 b(return)h(v)-5 +b(alues:)572 2328 y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h +Fj(BZFILE)663 2432 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 +2536 y(NULL)663 2640 y Fl(otherwise)150 2797 y(Allo)m(w)m(able)g(next)g +(actions:)572 2948 y Fj(BZ2_bzWrite)663 3051 y Fl(if)f +Fj(bzerror)f Fl(is)i Fj(BZ_OK)604 3155 y Fl(\(y)m(ou)25 +b(could)e(go)h(directly)f(to)h Fj(BZ2_bzWriteClose)p +Fl(,)c(but)j(this)g(w)m(ould)g(b)s(e)g(prett)m(y)h(p)s(oin)m(tless\)) +572 3259 y Fj(BZ2_bzWriteClose)663 3363 y Fl(otherwise)150 +3639 y Ff(3.4.6)63 b Fe(BZ2_bzWrite)533 3826 y Fj(void)47 +b(BZ2_bzWrite)e(\()i(int)g(*bzerror,)e(BZFILE)h(*b,)h(void)g(*buf,)f +(int)h(len)g(\);)150 3983 y Fl(Absorbs)26 b Fj(len)g +Fl(b)m(ytes)i(from)e(the)i(bu\013er)e Fj(buf)p Fl(,)h(ev)m(en)m(tually) +g(to)h(b)s(e)e(compressed)h(and)f(written)g(to)i(the)g(\014le.)150 +4140 y(P)m(ossible)h(assignmen)m(ts)h(to)h Fj(bzerror)p +Fl(:)572 4291 y Fj(BZ_PARAM_ERROR)663 4395 y Fl(if)e +Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g Fl(is)f Fj(NULL)g +Fl(or)i Fj(len)46 b(<)i(0)572 4498 y(BZ_SEQUENCE_ERROR)663 +4602 y Fl(if)29 b(b)h(w)m(as)h(op)s(ened)e(with)g Fj(BZ2_bzReadOpen)572 +4706 y(BZ_IO_ERROR)663 4810 y Fl(if)g(there)i(is)e(an)h(error)g +(writing)f(the)h(compressed)g(\014le.)572 4914 y Fj(BZ_OK)663 +5017 y Fl(otherwise)150 5294 y Ff(3.4.7)63 b Fe(BZ2_bzWriteClose)p +eop +%%Page: 24 25 +24 24 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(24)533 299 y Fj(void)47 +b(BZ2_bzWriteClose)c(\()48 b(int)f(*bzerror,)e(BZFILE*)h(f,)1679 +403 y(int)h(abandon,)1679 506 y(unsigned)e(int*)i(nbytes_in,)1679 +610 y(unsigned)e(int*)i(nbytes_out)e(\);)533 818 y(void)i +(BZ2_bzWriteClose64)c(\()k(int)g(*bzerror,)e(BZFILE*)h(f,)1774 +922 y(int)h(abandon,)1774 1025 y(unsigned)f(int*)g(nbytes_in_lo32,)1774 +1129 y(unsigned)g(int*)g(nbytes_in_hi32,)1774 1233 y(unsigned)g(int*)g +(nbytes_out_lo32,)1774 1337 y(unsigned)g(int*)g(nbytes_out_hi32)e(\);) +150 1493 y Fl(Compresses)39 b(and)g(\015ushes)g(to)h(the)g(compressed)g +(\014le)f(all)f(data)j(so)f(far)g(supplied)c(b)m(y)k +Fj(BZ2_bzWrite)p Fl(.)150 1603 y(The)27 b(logical)g(end-of-stream)h +(mark)m(ers)g(are)g(also)f(written,)h(so)f(subsequen)m(t)g(calls)g(to)h +Fj(BZ2_bzWrite)d Fl(are)150 1713 y(illegal.)50 b(All)33 +b(memory)h(asso)s(ciated)g(with)f(the)i(compressed)e(\014le)h +Fj(b)f Fl(is)g(released.)52 b Fj(fflush)33 b Fl(is)g(called)g(on)150 +1822 y(the)e(compressed)f(\014le,)f(but)h(it)g(is)f(not)i +Fj(fclose)p Fl('d.)150 1979 y(If)i Fj(BZ2_bzWriteClose)c +Fl(is)k(called)f(to)j(clean)e(up)f(after)i(an)g(error,)g(the)g(only)e +(action)i(is)f(to)h(release)g(the)150 2089 y(memory)-8 +b(.)42 b(The)30 b(library)e(records)j(the)g(error)f(co)s(des)h(issued)e +(b)m(y)h(previous)f(calls,)i(so)f(this)g(situation)g(will)150 +2198 y(b)s(e)c(detected)h(automatically)-8 b(.)40 b(There)26 +b(is)g(no)g(attempt)h(to)h(complete)e(the)h(compression)f(op)s +(eration,)g(nor)150 2308 y(to)32 b Fj(fflush)d Fl(the)i(compressed)g +(\014le.)42 b(Y)-8 b(ou)32 b(can)f(force)h(this)e(b)s(eha)m(viour)g(to) +h(happ)s(en)f(ev)m(en)i(in)d(the)j(case)g(of)150 2417 +y(no)e(error,)g(b)m(y)h(passing)e(a)i(nonzero)f(v)-5 +b(alue)30 b(to)h Fj(abandon)p Fl(.)150 2574 y(If)j Fj(nbytes_in)d +Fl(is)j(non-n)m(ull,)f Fj(*nbytes_in)e Fl(will)h(b)s(e)h(set)i(to)g(b)s +(e)f(the)g(total)h(v)m(olume)f(of)g(uncompressed)150 +2684 y(data)k(handled.)60 b(Similarly)-8 b(,)35 b Fj(nbytes_out)g +Fl(will)g(b)s(e)h(set)i(to)g(the)g(total)g(v)m(olume)f(of)g(compressed) +g(data)150 2793 y(written.)h(F)-8 b(or)27 b(compatibilit)m(y)d(with)h +(older)g(v)m(ersions)h(of)g(the)g(library)-8 b(,)25 b +Fj(BZ2_bzWriteClose)d Fl(only)j(yields)150 2903 y(the)40 +b(lo)m(w)m(er)g(32)h(bits)d(of)i(these)h(coun)m(ts.)69 +b(Use)40 b Fj(BZ2_bzWriteClose64)35 b Fl(if)k(y)m(ou)h(w)m(an)m(t)h +(the)f(full)d(64)k(bit)150 3013 y(coun)m(ts.)g(These)30 +b(t)m(w)m(o)i(functions)d(are)i(otherwise)f(absolutely)f(iden)m(tical.) +150 3169 y(P)m(ossible)g(assignmen)m(ts)h(to)h Fj(bzerror)p +Fl(:)572 3320 y Fj(BZ_SEQUENCE_ERROR)663 3424 y Fl(if)e +Fj(b)h Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzReadOpen)572 +3528 y(BZ_IO_ERROR)663 3632 y Fl(if)f(there)i(is)e(an)h(error)g +(writing)f(the)h(compressed)g(\014le)572 3736 y Fj(BZ_OK)663 +3839 y Fl(otherwise)150 4161 y Ff(3.4.8)63 b(Handling)41 +b(em)m(b)s(edded)g(compressed)h(data)e(streams)150 4354 +y Fl(The)i(high-lev)m(el)g(library)f(facilitates)h(use)h(of)g +Fj(bzip2)e Fl(data)j(streams)f(whic)m(h)f(form)g(some)i(part)e(of)i(a) +150 4463 y(surrounding,)27 b(larger)j(data)h(stream.)225 +4620 y Fi(\017)60 b Fl(F)-8 b(or)22 b(writing,)f(the)g(library)e(tak)m +(es)k(an)e(op)s(en)f(\014le)g(handle,)i(writes)e(compressed)h(data)h +(to)g(it,)g Fj(fflush)p Fl(es)330 4730 y(it)34 b(but)f(do)s(es)h(not)h +Fj(fclose)d Fl(it.)52 b(The)34 b(calling)f(application)g(can)h(write)g +(its)f(o)m(wn)i(data)g(b)s(efore)f(and)330 4839 y(after)d(the)f +(compressed)h(data)g(stream,)g(using)d(that)j(same)g(\014le)f(handle.) +225 5011 y Fi(\017)60 b Fl(Reading)34 b(is)f(more)i(complex,)g(and)f +(the)h(facilities)d(are)j(not)g(as)g(general)f(as)h(they)f(could)g(b)s +(e)g(since)330 5121 y(generalit)m(y)e(is)f(hard)f(to)j(reconcile)e +(with)f(e\016ciency)-8 b(.)46 b Fj(BZ2_bzRead)29 b Fl(reads)i(from)g +(the)h(compressed)330 5230 y(\014le)39 b(in)g(blo)s(c)m(ks)g(of)h(size) +g Fj(BZ_MAX_UNUSED)c Fl(b)m(ytes,)44 b(and)39 b(in)g(doing)g(so)h +(probably)e(will)f(o)m(v)m(ersho)s(ot)330 5340 y(the)i(logical)g(end)f +(of)h(compressed)f(stream.)67 b(T)-8 b(o)40 b(reco)m(v)m(er)g(this)e +(data)i(once)f(decompression)f(has)p eop +%%Page: 25 26 +25 25 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(25)330 299 y(ended,)28 +b(call)g Fj(BZ2_bzReadGetUnused)23 b Fl(after)29 b(the)g(last)f(call)g +(of)g Fj(BZ2_bzRead)e Fl(\(the)j(one)g(returning)330 +408 y Fj(BZ_STREAM_END)p Fl(\))e(but)j(b)s(efore)g(calling)f +Fj(BZ2_bzReadClose)p Fl(.)150 596 y(This)51 b(mec)m(hanism)g(mak)m(es)j +(it)e(easy)h(to)g(decompress)f(m)m(ultiple)e Fj(bzip2)i +Fl(streams)g(placed)g(end-to-)150 706 y(end.)90 b(As)48 +b(the)f(end)f(of)i(one)f(stream,)52 b(when)46 b Fj(BZ2_bzRead)f +Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(call)e Fj(BZ2_)150 +816 y(bzReadGetUnused)36 b Fl(to)41 b(collect)g(the)g(un)m(used)e(data) +i(\(cop)m(y)g(it)f(in)m(to)g(y)m(our)h(o)m(wn)f(bu\013er)f +(somewhere\).)150 925 y(That)25 b(data)g(forms)f(the)h(start)h(of)e +(the)h(next)g(compressed)g(stream.)39 b(T)-8 b(o)25 b(start)h +(uncompressing)c(that)k(next)150 1035 y(stream,)40 b(call)d +Fj(BZ2_bzReadOpen)d Fl(again,)40 b(feeding)d(in)g(the)h(un)m(used)e +(data)j(via)e(the)h Fj(unused)p Fl(/)p Fj(nUnused)150 +1144 y Fl(parameters.)54 b(Keep)34 b(doing)g(this)f(un)m(til)g +Fj(BZ_STREAM_END)e Fl(return)j(coincides)f(with)h(the)g(ph)m(ysical)g +(end)150 1254 y(of)d(\014le)e(\()p Fj(feof\(f\))p Fl(\).)39 +b(In)30 b(this)f(situation)h Fj(BZ2_bzReadGetUnused)25 +b Fl(will)i(of)k(course)g(return)e(no)h(data.)150 1411 +y(This)c(should)f(giv)m(e)j(some)g(feel)f(for)g(ho)m(w)h(the)g +(high-lev)m(el)e(in)m(terface)i(can)f(b)s(e)g(used.)39 +b(If)27 b(y)m(ou)h(require)e(extra)150 1520 y(\015exibilit)m(y)-8 +b(,)28 b(y)m(ou'll)i(ha)m(v)m(e)h(to)g(bite)f(the)h(bullet)d(and)i(get) +i(to)f(grips)e(with)g(the)h(lo)m(w-lev)m(el)h(in)m(terface.)150 +1779 y Ff(3.4.9)63 b(Standard)40 b(\014le-reading/writing)j(co)s(de)150 +1972 y Fl(Here's)31 b(ho)m(w)f(y)m(ou'd)h(write)e(data)j(to)f(a)f +(compressed)g(\014le:)390 2330 y Fj(FILE*)142 b(f;)390 +2434 y(BZFILE*)46 b(b;)390 2538 y(int)238 b(nBuf;)390 +2642 y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i +(];)390 2746 y(int)238 b(bzerror;)390 2849 y(int)g(nWritten;)390 +3057 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("w")j(\);)390 +3161 y(if)g(\(!f\))g({)533 3264 y(/*)g(handle)f(error)h(*/)390 +3368 y(})390 3472 y(b)g(=)h(BZ2_bzWriteOpen)c(\()j(&bzerror,)e(f,)i(9)h +(\);)390 3576 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533 +3680 y(BZ2_bzWriteClose)e(\()j(b)g(\);)533 3783 y(/*)g(handle)f(error)h +(*/)390 3887 y(})390 4095 y(while)f(\()i(/*)f(condition)e(*/)i(\))h({) +533 4198 y(/*)f(get)g(data)g(to)g(write)f(into)h(buf,)g(and)g(set)g +(nBuf)f(appropriately)e(*/)533 4302 y(nWritten)i(=)h(BZ2_bzWrite)e(\()i +(&bzerror,)f(b,)h(buf,)f(nBuf)h(\);)533 4406 y(if)g(\(bzerror)f(==)h +(BZ_IO_ERROR\))e({)676 4510 y(BZ2_bzWriteClose)f(\()j(&bzerror,)e(b)j +(\);)676 4614 y(/*)g(handle)e(error)g(*/)533 4717 y(})390 +4821 y(})390 5029 y(BZ2_bzWriteClose)d(\()48 b(&bzerror,)d(b)j(\);)390 +5132 y(if)f(\(bzerror)f(==)h(BZ_IO_ERROR\))d({)533 5236 +y(/*)j(handle)f(error)h(*/)390 5340 y(})p eop +%%Page: 26 27 +26 26 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(26)150 299 y(And)29 b(to)j(read)e(from)g +(a)h(compressed)f(\014le:)390 450 y Fj(FILE*)142 b(f;)390 +554 y(BZFILE*)46 b(b;)390 657 y(int)238 b(nBuf;)390 761 +y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i(];)390 +865 y(int)238 b(bzerror;)390 969 y(int)g(nWritten;)390 +1176 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("r")j(\);)390 +1280 y(if)g(\(!f\))g({)533 1384 y(/*)g(handle)f(error)h(*/)390 +1488 y(})390 1591 y(b)g(=)h(BZ2_bzReadOpen)c(\()j(&bzerror,)f(f,)h(0,)g +(NULL,)f(0)i(\);)390 1695 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533 +1799 y(BZ2_bzReadClose)e(\()j(&bzerror,)f(b)h(\);)533 +1903 y(/*)g(handle)f(error)h(*/)390 2007 y(})390 2214 +y(bzerror)f(=)h(BZ_OK;)390 2318 y(while)f(\(bzerror)g(==)h(BZ_OK)f(&&)i +(/*)f(arbitrary)e(other)h(conditions)f(*/\))i({)533 2422 +y(nBuf)g(=)g(BZ2_bzRead)e(\()j(&bzerror,)d(b,)i(buf,)g(/*)g(size)g(of)g +(buf)g(*/)g(\);)533 2525 y(if)g(\(bzerror)f(==)h(BZ_OK\))f({)676 +2629 y(/*)i(do)f(something)e(with)i(buf[0)f(..)h(nBuf-1])f(*/)533 +2733 y(})390 2837 y(})390 2941 y(if)h(\(bzerror)f(!=)h(BZ_STREAM_END\)) +d({)533 3044 y(BZ2_bzReadClose)g(\()j(&bzerror,)f(b)h(\);)533 +3148 y(/*)g(handle)f(error)h(*/)390 3252 y(})g(else)g({)533 +3356 y(BZ2_bzReadClose)d(\()j(&bzerror)f(\);)390 3459 +y(})150 3753 y Fk(3.5)68 b(Utilit)l(y)47 b(functions)150 +4045 y Ff(3.5.1)63 b Fe(BZ2_bzBuffToBuffCompress)533 +4232 y Fj(int)47 b(BZ2_bzBuffToBuffCompress\()41 b(char*)428 +b(dest,)1965 4335 y(unsigned)46 b(int*)g(destLen,)1965 +4439 y(char*)428 b(source,)1965 4543 y(unsigned)46 b(int)94 +b(sourceLen,)1965 4647 y(int)524 b(blockSize100k,)1965 +4751 y(int)g(verbosity,)1965 4854 y(int)g(workFactor)45 +b(\);)150 5011 y Fl(A)m(ttempts)33 b(to)g(compress)f(the)g(data)h(in)e +Fj(source[0)d(..)i(sourceLen-1])e Fl(in)m(to)k(the)h(destination)e +(bu\013er,)150 5121 y Fj(dest[0)e(..)g(*destLen-1])p +Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j +Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 5230 +y(of)i(the)f(compressed)h(data,)g(and)f Fj(BZ_OK)f Fl(is)h(returned.)39 +b(If)28 b(the)h(compressed)f(data)h(w)m(on't)g(\014t,)g +Fj(*destLen)150 5340 y Fl(is)g(unc)m(hanged,)i(and)e +Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)p eop +%%Page: 27 28 +27 27 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g +Fj(libbzip2)1891 b Fl(27)150 299 y(Compression)22 b(in)g(this)h(manner) +g(is)g(a)h(one-shot)g(ev)m(en)m(t,)j(done)c(with)g(a)h(single)e(call)h +(to)i(this)d(function.)37 b(The)150 408 y(resulting)25 +b(compressed)i(data)i(is)d(a)i(complete)f Fj(bzip2)f +Fl(format)i(data)g(stream.)40 b(There)27 b(is)f(no)i(mec)m(hanism)150 +518 y(for)23 b(making)g(additional)e(calls)i(to)h(pro)m(vide)f(extra)h +(input)e(data.)39 b(If)23 b(y)m(ou)h(w)m(an)m(t)g(that)g(kind)e(of)h +(mec)m(hanism,)150 628 y(use)30 b(the)h(lo)m(w-lev)m(el)f(in)m +(terface.)150 784 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g +Fj(blockSize100k)p Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p +Fl(,)150 894 y(see)h Fj(BZ2_bzCompressInit)p Fl(.)150 +1051 y(T)-8 b(o)27 b(guaran)m(tee)h(that)e(the)h(compressed)f(data)h +(will)d(\014t)i(in)f(its)g(bu\013er,)i(allo)s(cate)f(an)g(output)g +(bu\013er)g(of)g(size)150 1160 y(1\045)31 b(larger)f(than)g(the)g +(uncompressed)f(data,)j(plus)c(six)h(h)m(undred)g(extra)i(b)m(ytes.)150 +1317 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25 b Fl(will)k(not)j(write)e +(data)j(at)f(or)f(b)s(ey)m(ond)g Fj(dest[*destLen])p +Fl(,)d(ev)m(en)k(in)150 1427 y(case)f(of)g(bu\013er)e(o)m(v)m(er\015o)m +(w.)150 1584 y(P)m(ossible)g(return)h(v)-5 b(alues:)572 +1735 y Fj(BZ_CONFIG_ERROR)663 1839 y Fl(if)29 b(the)i(library)d(has)i +(b)s(een)f(mis-compiled)572 1942 y Fj(BZ_PARAM_ERROR)663 +2046 y Fl(if)g Fj(dest)g Fl(is)h Fj(NULL)f Fl(or)h Fj(destLen)f +Fl(is)g Fj(NULL)663 2150 y Fl(or)h Fj(blockSize100k)44 +b(<)k(1)30 b Fl(or)g Fj(blockSize100k)44 b(>)k(9)663 +2254 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g +Fj(verbosity)45 b(>)j(4)663 2357 y Fl(or)30 b Fj(workFactor)45 +b(<)j(0)30 b Fl(or)g Fj(workFactor)45 b(>)i(250)572 2461 +y(BZ_MEM_ERROR)663 2565 y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f +(a)m(v)-5 b(ailable)572 2669 y Fj(BZ_OUTBUFF_FULL)663 +2773 y Fl(if)29 b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g +Fj(*destLen)572 2876 y(BZ_OK)663 2980 y Fl(otherwise)150 +3349 y Ff(3.5.2)63 b Fe(BZ2_bzBuffToBuffDecompress)533 +3536 y Fj(int)47 b(BZ2_bzBuffToBuffDecompres)o(s)42 b(\()47 +b(char*)428 b(dest,)2108 3640 y(unsigned)46 b(int*)g(destLen,)2108 +3744 y(char*)428 b(source,)2108 3848 y(unsigned)46 b(int)94 +b(sourceLen,)2108 3951 y(int)524 b(small,)2108 4055 y(int)g(verbosity) +46 b(\);)150 4212 y Fl(A)m(ttempts)24 b(to)g(decompress)f(the)g(data)g +(in)f Fj(source[0)28 b(..)i(sourceLen-1])20 b Fl(in)m(to)j(the)g +(destination)f(bu\013er,)150 4322 y Fj(dest[0)29 b(..)g(*destLen-1])p +Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j +Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 4431 +y(of)21 b(the)g(uncompressed)e(data,)24 b(and)c Fj(BZ_OK)f +Fl(is)h(returned.)36 b(If)20 b(the)h(compressed)g(data)g(w)m(on't)h +(\014t,)g Fj(*destLen)150 4541 y Fl(is)29 b(unc)m(hanged,)i(and)e +Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)150 4698 y Fj(source)g +Fl(is)g(assumed)h(to)h(hold)e(a)i(complete)f Fj(bzip2)f +Fl(format)i(data)g(stream.)150 4807 y Fj(BZ2_bzBuffToBuffDecompre)o(ss) +22 b Fl(tries)28 b(to)i(decompress)e(the)h(en)m(tiret)m(y)g(of)g(the)f +(stream)h(in)m(to)g(the)f(out-)150 4917 y(put)i(bu\013er.)150 +5074 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g +Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj +(BZ2_bzDecompressInit)p Fl(.)150 5230 y(Because)j(the)f(compression)e +(ratio)i(of)g(the)g(compressed)f(data)h(cannot)g(b)s(e)f(kno)m(wn)g(in) +g(adv)-5 b(ance,)34 b(there)150 5340 y(is)d(no)h(easy)g(w)m(a)m(y)h(to) +f(guaran)m(tee)i(that)e(the)g(output)f(bu\013er)g(will)e(b)s(e)i(big)g +(enough.)45 b(Y)-8 b(ou)32 b(ma)m(y)h(of)f(course)p eop +%%Page: 28 29 +28 28 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(28)150 299 y(mak)m(e)36 +b(arrangemen)m(ts)f(in)e(y)m(our)i(co)s(de)g(to)g(record)g(the)g(size)f +(of)h(the)g(uncompressed)f(data,)i(but)e(suc)m(h)h(a)150 +408 y(mec)m(hanism)30 b(is)f(b)s(ey)m(ond)h(the)g(scop)s(e)h(of)f(this) +g(library)-8 b(.)150 565 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25 +b Fl(will)k(not)j(write)e(data)j(at)f(or)f(b)s(ey)m(ond)g +Fj(dest[*destLen])p Fl(,)d(ev)m(en)k(in)150 675 y(case)f(of)g(bu\013er) +e(o)m(v)m(er\015o)m(w.)150 832 y(P)m(ossible)g(return)h(v)-5 +b(alues:)572 983 y Fj(BZ_CONFIG_ERROR)663 1087 y Fl(if)29 +b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 1190 +y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(dest)g Fl(is)h +Fj(NULL)f Fl(or)h Fj(destLen)f Fl(is)g Fj(NULL)663 1398 +y Fl(or)h Fj(small)46 b(!=)i(0)f(&&)g(small)g(!=)g(1)663 +1502 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g +Fj(verbosity)45 b(>)j(4)572 1605 y(BZ_MEM_ERROR)663 1709 +y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f(a)m(v)-5 +b(ailable)572 1813 y Fj(BZ_OUTBUFF_FULL)663 1917 y Fl(if)29 +b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g +Fj(*destLen)572 2021 y(BZ_DATA_ERROR)663 2124 y Fl(if)e(a)i(data)g(in)m +(tegrit)m(y)f(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(data) +572 2228 y Fj(BZ_DATA_ERROR_MAGIC)663 2332 y Fl(if)f(the)i(compressed)f +(data)h(do)s(esn't)f(b)s(egin)f(with)g(the)i(righ)m(t)e(magic)i(b)m +(ytes)572 2436 y Fj(BZ_UNEXPECTED_EOF)663 2539 y Fl(if)e(the)i +(compressed)f(data)h(ends)e(unexp)s(ectedly)572 2643 +y Fj(BZ_OK)663 2747 y Fl(otherwise)150 3116 y Fk(3.6)68 +b Fd(zlib)43 b Fk(compatibilit)l(y)k(functions)150 3308 +y Fl(Y)-8 b(oshiok)j(a)33 b(Tsuneo)e(has)h(con)m(tributed)g(some)g +(functions)f(to)i(giv)m(e)g(b)s(etter)f Fj(zlib)f Fl(compatibilit)m(y) +-8 b(.)45 b(These)150 3418 y(functions)36 b(are)i Fj(BZ2_bzopen)p +Fl(,)e Fj(BZ2_bzread)p Fl(,)h Fj(BZ2_bzwrite)p Fl(,)f +Fj(BZ2_bzflush)p Fl(,)h Fj(BZ2_bzclose)p Fl(,)f Fj(BZ2_)150 +3527 y(bzerror)23 b Fl(and)h Fj(BZ2_bzlibVersion)p Fl(.)34 +b(These)25 b(functions)e(are)j(not)f(\(y)m(et\))h(o\016cially)e(part)h +(of)g(the)g(library)-8 b(.)150 3637 y(If)30 b(they)g(break,)h(y)m(ou)g +(get)g(to)g(k)m(eep)g(all)f(the)g(pieces.)41 b(Nev)m(ertheless,)31 +b(I)f(think)f(they)i(w)m(ork)f(ok.)390 3788 y Fj(typedef)46 +b(void)g(BZFILE;)390 3995 y(const)g(char)h(*)g(BZ2_bzlibVersion)d(\()j +(void)g(\);)150 4152 y Fl(Returns)29 b(a)i(string)f(indicating)e(the)i +(library)e(v)m(ersion.)390 4303 y Fj(BZFILE)46 b(*)i(BZ2_bzopen)92 +b(\()48 b(const)e(char)h(*path,)f(const)g(char)h(*mode)f(\);)390 +4407 y(BZFILE)g(*)i(BZ2_bzdopen)c(\()k(int)381 b(fd,)190 +b(const)46 b(char)h(*mode)f(\);)150 4564 y Fl(Op)s(ens)19 +b(a)j Fj(.bz2)e Fl(\014le)g(for)g(reading)g(or)h(writing,)g(using)f +(either)g(its)h(name)g(or)g(a)g(pre-existing)f(\014le)g(descriptor.)150 +4674 y(Analogous)30 b(to)i Fj(fopen)c Fl(and)i Fj(fdopen)p +Fl(.)390 4825 y Fj(int)47 b(BZ2_bzread)93 b(\()47 b(BZFILE*)f(b,)h +(void*)f(buf,)h(int)g(len)g(\);)390 4928 y(int)g(BZ2_bzwrite)e(\()i +(BZFILE*)f(b,)h(void*)f(buf,)h(int)g(len)g(\);)150 5085 +y Fl(Reads/writes)30 b(data)h(from/to)g(a)g(previously)d(op)s(ened)i +Fj(BZFILE)p Fl(.)39 b(Analogous)30 b(to)h Fj(fread)e +Fl(and)h Fj(fwrite)p Fl(.)390 5236 y Fj(int)95 b(BZ2_bzflush)44 +b(\()k(BZFILE*)e(b)h(\);)390 5340 y(void)g(BZ2_bzclose)d(\()k(BZFILE*)e +(b)h(\);)p eop +%%Page: 29 30 +29 29 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(29)150 299 y(Flushes/closes)27 +b(a)h Fj(BZFILE)p Fl(.)39 b Fj(BZ2_bzflush)24 b Fl(do)s(esn't)k +(actually)f(do)h(an)m(ything.)39 b(Analogous)28 b(to)h +Fj(fflush)150 408 y Fl(and)h Fj(fclose)p Fl(.)390 559 +y Fj(const)46 b(char)h(*)g(BZ2_bzerror)e(\()j(BZFILE)e(*b,)h(int)g +(*errnum)e(\))150 716 y Fl(Returns)31 b(a)i(string)e(describing)f(the)i +(more)g(recen)m(t)h(error)f(status)h(of)f Fj(b)p Fl(,)g(and)g(also)g +(sets)h Fj(*errnum)d Fl(to)j(its)150 826 y(n)m(umerical)c(v)-5 +b(alue.)150 1242 y Fk(3.7)68 b(Using)46 b(the)f(library)g(in)g(a)g +Fd(stdio)p Fk(-free)f(en)l(vironmen)l(t)150 1615 y Ff(3.7.1)63 +b(Getting)40 b(rid)h(of)g Fe(stdio)150 1807 y Fl(In)i(a)g(deeply)g(em)m +(b)s(edded)f(application,)j(y)m(ou)f(migh)m(t)f(w)m(an)m(t)h(to)g(use)f +(just)g(the)h(memory-to-memory)150 1917 y(functions.)39 +b(Y)-8 b(ou)30 b(can)f(do)g(this)g(con)m(v)m(enien)m(tly)g(b)m(y)g +(compiling)e(the)j(library)d(with)h(prepro)s(cessor)g(sym)m(b)s(ol)150 +2026 y Fj(BZ_NO_STDIO)35 b Fl(de\014ned.)63 b(Doing)39 +b(this)e(giv)m(es)h(y)m(ou)h(a)f(library)e(con)m(taining)i(only)f(the)i +(follo)m(wing)e(eigh)m(t)150 2136 y(functions:)150 2293 +y Fj(BZ2_bzCompressInit)p Fl(,)26 b Fj(BZ2_bzCompress)p +Fl(,)g Fj(BZ2_bzCompressEnd)150 2402 y(BZ2_bzDecompressInit)p +Fl(,)f Fj(BZ2_bzDecompress)p Fl(,)h Fj(BZ2_bzDecompressEnd)150 +2512 y(BZ2_bzBuffToBuffCompress)o Fl(,)f Fj(BZ2_bzBuffToBuffDecompre)o +(ss)150 2669 y Fl(When)30 b(compiled)f(lik)m(e)h(this,)f(all)g +(functions)g(will)f(ignore)i Fj(verbosity)e Fl(settings.)150 +3006 y Ff(3.7.2)63 b(Critical)40 b(error)h(handling)150 +3199 y Fj(libbzip2)20 b Fl(con)m(tains)j(a)g(n)m(um)m(b)s(er)f(of)g(in) +m(ternal)g(assertion)g(c)m(hec)m(ks)i(whic)m(h)d(should,)i(needless)f +(to)h(sa)m(y)-8 b(,)26 b(nev)m(er)150 3308 y(b)s(e)g(activ)-5 +b(ated.)40 b(Nev)m(ertheless,)28 b(if)d(an)i(assertion)f(should)e +(fail,)i(b)s(eha)m(viour)f(dep)s(ends)f(on)j(whether)e(or)i(not)150 +3418 y(the)k(library)d(w)m(as)i(compiled)f(with)g Fj(BZ_NO_STDIO)e +Fl(set.)150 3575 y(F)-8 b(or)31 b(a)g(normal)e(compile,)h(an)g +(assertion)g(failure)f(yields)f(the)j(message)533 3726 +y Fj(bzip2/libbzip2:)44 b(internal)h(error)i(number)f(N.)533 +3829 y(This)h(is)g(a)g(bug)g(in)h(bzip2/libbzip2,)43 +b(1.0)k(of)g(21-Mar-2000.)533 3933 y(Please)f(report)g(it)i(to)f(me)g +(at:)g(jseward@acm.org.)91 b(If)47 b(this)g(happened)533 +4037 y(when)g(you)g(were)f(using)h(some)f(program)g(which)h(uses)f +(libbzip2)g(as)h(a)533 4141 y(component,)e(you)i(should)f(also)h +(report)f(this)h(bug)f(to)i(the)f(author\(s\))533 4244 +y(of)g(that)g(program.)93 b(Please)46 b(make)h(an)g(effort)f(to)h +(report)g(this)f(bug;)533 4348 y(timely)g(and)h(accurate)f(bug)h +(reports)e(eventually)g(lead)i(to)g(higher)533 4452 y(quality)f +(software.)93 b(Thanks.)h(Julian)46 b(Seward,)f(21)j(March)e(2000.)150 +4609 y Fl(where)30 b Fj(N)g Fl(is)f(some)i(error)f(co)s(de)h(n)m(um)m +(b)s(er.)39 b Fj(exit\(3\))28 b Fl(is)i(then)g(called.)150 +4766 y(F)-8 b(or)31 b(a)g Fj(stdio)p Fl(-free)e(library)-8 +b(,)29 b(assertion)h(failures)e(result)i(in)f(a)i(call)e(to)i(a)g +(function)e(declared)h(as:)533 4917 y Fj(extern)46 b(void)h +(bz_internal_error)c(\()k(int)g(errcode)f(\);)150 5074 +y Fl(The)30 b(relev)-5 b(an)m(t)31 b(co)s(de)f(is)g(passed)f(as)i(a)g +(parameter.)41 b(Y)-8 b(ou)31 b(should)d(supply)g(suc)m(h)i(a)h +(function.)150 5230 y(In)g(either)g(case,)j(once)e(an)g(assertion)g +(failure)e(has)h(o)s(ccurred,)h(an)m(y)g Fj(bz_stream)e +Fl(records)h(in)m(v)m(olv)m(ed)h(can)150 5340 y(b)s(e)e(regarded)g(as)h +(in)m(v)-5 b(alid.)38 b(Y)-8 b(ou)31 b(should)d(not)j(attempt)g(to)g +(resume)f(normal)g(op)s(eration)f(with)g(them.)p eop +%%Page: 30 31 +30 30 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(30)150 299 y(Y)-8 b(ou)22 +b(ma)m(y)-8 b(,)25 b(of)d(course,)h(c)m(hange)g(critical)e(error)g +(handling)e(to)j(suit)f(y)m(our)g(needs.)38 b(As)21 b(I)h(said)e(ab)s +(o)m(v)m(e,)25 b(critical)150 408 y(errors)30 b(indicate)g(bugs)g(in)g +(the)h(library)d(and)i(should)f(not)i(o)s(ccur.)42 b(All)29 +b Fj(")p Fl(normal)p Fj(")h Fl(error)g(situations)g(are)150 +518 y(indicated)f(via)h(error)g(return)f(co)s(des)i(from)f(functions,)f +(and)g(can)i(b)s(e)f(reco)m(v)m(ered)i(from.)150 798 +y Fk(3.8)68 b(Making)45 b(a)g(Windo)l(ws)h(DLL)150 990 +y Fl(Ev)m(erything)30 b(related)g(to)h(Windo)m(ws)f(has)g(b)s(een)f +(con)m(tributed)h(b)m(y)g(Y)-8 b(oshiok)j(a)31 b(Tsuneo)150 +1100 y(\()p Fj(QWF00133@niftyserve.or.jp)46 b Fl(/)52 +b Fj(tsuneo-y@is.aist-nara.ac.j)o(p)p Fl(\),)g(so)h(y)m(ou)f(should)f +(send)150 1210 y(y)m(our)30 b(queries)g(to)h(him)e(\(but)h(p)s(erhaps)e +(Cc:)41 b(me,)31 b Fj(jseward@acm.org)p Fl(\).)150 1366 +y(My)43 b(v)-5 b(ague)44 b(understanding)d(of)i(what)g(to)h(do)f(is:)65 +b(using)41 b(Visual)h(C)p Fj(++)g Fl(5.0,)48 b(op)s(en)42 +b(the)h(pro)5 b(ject)44 b(\014le)150 1476 y Fj(libbz2.dsp)p +Fl(,)28 b(and)i(build.)37 b(That's)31 b(all.)150 1633 +y(If)41 b(y)m(ou)g(can't)h(op)s(en)e(the)h(pro)5 b(ject)42 +b(\014le)e(for)h(some)g(reason,)j(mak)m(e)e(a)g(new)e(one,)k(naming)c +(these)i(\014les:)150 1742 y Fj(blocksort.c)p Fl(,)28 +b Fj(bzlib.c)p Fl(,)g Fj(compress.c)p Fl(,)g Fj(crctable.c)p +Fl(,)g Fj(decompress.c)p Fl(,)f Fj(huffman.c)p Fl(,)150 +1852 y Fj(randtable.c)32 b Fl(and)j Fj(libbz2.def)p Fl(.)53 +b(Y)-8 b(ou)36 b(will)d(also)i(need)g(to)h(name)g(the)g(header)f +(\014les)f Fj(bzlib.h)g Fl(and)150 1962 y Fj(bzlib_private.h)p +Fl(.)150 2118 y(If)c(y)m(ou)h(don't)f(use)g(V)m(C)p Fj(++)p +Fl(,)g(y)m(ou)h(ma)m(y)g(need)f(to)h(de\014ne)f(the)h(propro)s(cessor)e +(sym)m(b)s(ol)g Fj(_WIN32)p Fl(.)150 2275 y(Finally)-8 +b(,)28 b Fj(dlltest.c)e Fl(is)h(a)i(sample)f(program)g(using)g(the)g +(DLL.)h(It)g(has)f(a)h(pro)5 b(ject)29 b(\014le,)g Fj(dlltest.dsp)p +Fl(.)150 2432 y(If)h(y)m(ou)h(just)e(w)m(an)m(t)j(a)e(mak)m(e\014le)h +(for)f(Visual)f(C,)h(ha)m(v)m(e)i(a)e(lo)s(ok)g(at)i +Fj(makefile.msc)p Fl(.)150 2589 y(Be)k(a)m(w)m(are)g(that)g(if)e(y)m +(ou)h(compile)f Fj(bzip2)g Fl(itself)g(on)h(Win32,)h(y)m(ou)g(m)m(ust)f +(set)g Fj(BZ_UNIX)e Fl(to)j(0)f(and)g Fj(BZ_)150 2698 +y(LCCWIN32)27 b Fl(to)j(1,)g(in)f(the)g(\014le)g Fj(bzip2.c)p +Fl(,)e(b)s(efore)i(compiling.)39 b(Otherwise)28 b(the)h(resulting)f +(binary)f(w)m(on't)150 2808 y(w)m(ork)j(correctly)-8 +b(.)150 2965 y(I)30 b(ha)m(v)m(en't)i(tried)d(an)m(y)i(of)g(this)e +(stu\013)h(m)m(yself,)g(but)g(it)f(all)h(lo)s(oks)g(plausible.)p +eop +%%Page: 31 32 +31 31 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(31)150 299 y Fh(4)80 b(Miscellanea)150 583 y Fl(These)30 +b(are)h(just)f(some)g(random)g(though)m(ts)h(of)f(mine.)40 +b(Y)-8 b(our)30 b(mileage)h(ma)m(y)g(v)-5 b(ary)d(.)150 +884 y Fk(4.1)68 b(Limitations)47 b(of)e(the)g(compressed)g(\014le)h +(format)150 1077 y Fj(bzip2-1.0)p Fl(,)e Fj(0.9.5)e Fl(and)g +Fj(0.9.0)g Fl(use)h(exactly)h(the)f(same)h(\014le)e(format)i(as)f(the)h +(previous)d(v)m(ersion,)150 1186 y Fj(bzip2-0.1)p Fl(.)75 +b(This)41 b(decision)g(w)m(as)i(made)g(in)e(the)i(in)m(terests)g(of)g +(stabilit)m(y)-8 b(.)77 b(Creating)42 b(y)m(et)i(another)150 +1296 y(incompatible)21 b(compressed)i(\014le)f(format)i(w)m(ould)e +(create)i(further)e(confusion)g(and)h(disruption)d(for)j(users.)150 +1453 y(Nev)m(ertheless,)31 b(this)e(is)g(not)h(a)g(painless)e +(decision.)39 b(Dev)m(elopmen)m(t)31 b(w)m(ork)f(since)f(the)h(release) +h(of)f Fj(bzip2-)150 1562 y(0.1)19 b Fl(in)g(August)i(1997)h(has)e(sho) +m(wn)f(complexities)h(in)f(the)h(\014le)g(format)g(whic)m(h)f(slo)m(w)h +(do)m(wn)g(decompression)150 1672 y(and,)30 b(in)f(retrosp)s(ect,)i +(are)g(unnecessary)-8 b(.)40 b(These)31 b(are:)225 1829 +y Fi(\017)60 b Fl(The)20 b(run-length)g(enco)s(der,)i(whic)m(h)e(is)g +(the)h(\014rst)f(of)h(the)g(compression)f(transformations,)i(is)e(en)m +(tirely)330 1938 y(irrelev)-5 b(an)m(t.)63 b(The)38 b(original)e(purp)s +(ose)g(w)m(as)j(to)g(protect)g(the)f(sorting)g(algorithm)f(from)g(the)i +(v)m(ery)330 2048 y(w)m(orst)h(case)h(input:)58 b(a)41 +b(string)e(of)h(rep)s(eated)g(sym)m(b)s(ols.)68 b(But)40 +b(algorithm)f(steps)h(Q6a)h(and)e(Q6b)330 2157 y(in)30 +b(the)i(original)e(Burro)m(ws-Wheeler)i(tec)m(hnical)g(rep)s(ort)f +(\(SR)m(C-124\))i(sho)m(w)f(ho)m(w)g(rep)s(eats)g(can)g(b)s(e)330 +2267 y(handled)c(without)i(di\016cult)m(y)f(in)g(blo)s(c)m(k)h +(sorting.)225 2409 y Fi(\017)60 b Fl(The)30 b(randomisation)e(mec)m +(hanism)i(do)s(esn't)g(really)f(need)h(to)g(b)s(e)g(there.)41 +b(Udi)29 b(Man)m(b)s(er)h(and)f(Gene)330 2518 y(My)m(ers)j(published)c +(a)33 b(su\016x)e(arra)m(y)h(construction)f(algorithm)g(a)h(few)g(y)m +(ears)h(bac)m(k,)g(whic)m(h)d(can)j(b)s(e)330 2628 y(emplo)m(y)m(ed)27 +b(to)h(sort)g(an)m(y)f(blo)s(c)m(k,)h(no)f(matter)h(ho)m(w)f(rep)s +(etitiv)m(e,)h(in)d(O\(N)j(log)f(N\))h(time.)39 b(Subsequen)m(t)330 +2737 y(w)m(ork)25 b(b)m(y)f(Kunihik)m(o)f(Sadak)-5 b(ane)24 +b(has)h(pro)s(duced)e(a)i(deriv)-5 b(ativ)m(e)24 b(O\(N)h(\(log)g(N\))p +Fj(^)p Fl(2\))h(algorithm)d(whic)m(h)330 2847 y(usually)28 +b(outp)s(erforms)h(the)i(Man)m(b)s(er-My)m(ers)g(algorithm.)330 +2988 y(I)g(could)g(ha)m(v)m(e)i(c)m(hanged)f(to)g(Sadak)-5 +b(ane's)32 b(algorithm,)f(but)g(I)g(\014nd)f(it)h(to)h(b)s(e)f(slo)m(w) +m(er)h(than)f Fj(bzip2)p Fl('s)330 3098 y(existing)38 +b(algorithm)g(for)h(most)h(inputs,)f(and)g(the)g(randomisation)f(mec)m +(hanism)g(protects)i(ade-)330 3208 y(quately)34 b(against)f(bad)g +(cases.)52 b(I)33 b(didn't)f(think)g(it)i(w)m(as)g(a)g(go)s(o)s(d)f +(tradeo\013)i(to)f(mak)m(e.)51 b(P)m(artly)34 b(this)330 +3317 y(is)39 b(due)h(to)h(the)f(fact)h(that)g(I)f(w)m(as)g(not)h(\015o) +s(o)s(ded)e(with)g(email)g(complain)m(ts)g(ab)s(out)h +Fj(bzip2-0.1)p Fl('s)330 3427 y(p)s(erformance)30 b(on)g(rep)s(etitiv)m +(e)g(data,)h(so)g(p)s(erhaps)d(it)i(isn't)g(a)h(problem)d(for)j(real)f +(inputs.)330 3568 y(Probably)i(the)h(b)s(est)g(long-term)g(solution,)g +(and)g(the)g(one)h(I)f(ha)m(v)m(e)h(incorp)s(orated)e(in)m(to)i(0.9.5)h +(and)330 3678 y(ab)s(o)m(v)m(e,)42 b(is)c(to)h(use)f(the)h(existing)f +(sorting)g(algorithm)f(initially)-8 b(,)38 b(and)g(fall)f(bac)m(k)i(to) +h(a)f(O\(N)f(\(log)330 3787 y(N\))p Fj(^)p Fl(2\))31 +b(algorithm)f(if)f(the)i(standard)e(algorithm)h(gets)h(in)m(to)f +(di\016culties.)225 3929 y Fi(\017)60 b Fl(The)31 b(compressed)f +(\014le)g(format)i(w)m(as)f(nev)m(er)h(designed)d(to)j(b)s(e)f(handled) +e(b)m(y)i(a)g(library)-8 b(,)29 b(and)i(I)g(ha)m(v)m(e)330 +4039 y(had)d(to)i(jump)e(though)g(some)i(ho)s(ops)e(to)i(pro)s(duce)e +(an)h(e\016cien)m(t)g(implemen)m(tation)f(of)h(decompres-)330 +4148 y(sion.)38 b(It's)26 b(a)h(bit)e(hairy)-8 b(.)38 +b(T)-8 b(ry)26 b(passing)f Fj(decompress.c)d Fl(through)k(the)g(C)f +(prepro)s(cessor)g(and)h(y)m(ou'll)330 4258 y(see)32 +b(what)g(I)f(mean.)45 b(Muc)m(h)32 b(of)g(this)e(complexit)m(y)i(could) +f(ha)m(v)m(e)i(b)s(een)e(a)m(v)m(oided)h(if)e(the)i(compressed)330 +4367 y(size)e(of)h(eac)m(h)g(blo)s(c)m(k)f(of)h(data)g(w)m(as)g +(recorded)f(in)f(the)h(data)h(stream.)225 4509 y Fi(\017)60 +b Fl(An)30 b(Adler-32)g(c)m(hec)m(ksum,)i(rather)e(than)g(a)h(CR)m(C32) +g(c)m(hec)m(ksum,)g(w)m(ould)e(b)s(e)h(faster)h(to)g(compute.)150 +4698 y(It)e(w)m(ould)f(b)s(e)g(fair)g(to)h(sa)m(y)h(that)g(the)f +Fj(bzip2)e Fl(format)i(w)m(as)h(frozen)f(b)s(efore)f(I)h(prop)s(erly)d +(and)j(fully)d(under-)150 4807 y(sto)s(o)s(d)k(the)h(p)s(erformance)e +(consequences)i(of)g(doing)e(so.)150 4964 y(Impro)m(v)m(emen)m(ts)d +(whic)m(h)e(I)i(w)m(as)g(able)f(to)h(incorp)s(orate)f(in)m(to)g(0.9.0,) +k(despite)24 b(using)g(the)i(same)g(\014le)e(format,)150 +5074 y(are:)225 5230 y Fi(\017)60 b Fl(Single)30 b(arra)m(y)i(implemen) +m(tation)e(of)h(the)h(in)m(v)m(erse)f(BWT.)h(This)e(signi\014can)m(tly) +f(sp)s(eeds)i(up)f(decom-)330 5340 y(pression,)f(presumably)f(b)s +(ecause)i(it)g(reduces)g(the)h(n)m(um)m(b)s(er)e(of)i(cac)m(he)h +(misses.)p eop +%%Page: 32 33 +32 32 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(32)225 299 y Fi(\017)60 b Fl(F)-8 b(aster)27 b(in)m(v)m(erse)e(MTF)h +(transform)f(for)g(large)h(MTF)f(v)-5 b(alues.)39 b(The)25 +b(new)g(implemen)m(tation)f(is)g(based)330 408 y(on)30 +b(the)h(notion)f(of)g(sliding)e(blo)s(c)m(ks)h(of)i(v)-5 +b(alues.)225 544 y Fi(\017)60 b Fj(bzip2-0.9.0)24 b Fl(no)m(w)k(reads)f +(and)f(writes)h(\014les)f(with)g Fj(fread)g Fl(and)h +Fj(fwrite)p Fl(;)f(v)m(ersion)h(0.1)i(used)d Fj(putc)330 +653 y Fl(and)k Fj(getc)p Fl(.)39 b(Duh!)h(W)-8 b(ell,)31 +b(y)m(ou)f(liv)m(e)g(and)g(learn.)150 836 y(F)-8 b(urther)30 +b(ahead,)g(it)f(w)m(ould)g(b)s(e)g(nice)h(to)g(b)s(e)g(able)f(to)i(do)e +(random)g(access)j(in)m(to)d(\014les.)40 b(This)28 b(will)f(require)150 +945 y(some)k(careful)e(design)h(of)g(compressed)g(\014le)g(formats.)150 +1227 y Fk(4.2)68 b(P)l(ortabilit)l(y)47 b(issues)150 +1419 y Fl(After)36 b(some)g(consideration,)g(I)f(ha)m(v)m(e)i(decided)d +(not)i(to)g(use)g(GNU)g Fj(autoconf)d Fl(to)j(con\014gure)g(0.9.5)h(or) +150 1529 y(1.0.)150 1686 y Fj(autoconf)p Fl(,)31 b(admirable)g(and)h(w) +m(onderful)f(though)i(it)f(is,)h(mainly)d(assists)j(with)e(p)s +(ortabilit)m(y)g(problems)150 1795 y(b)s(et)m(w)m(een)f(Unix-lik)m(e)d +(platforms.)40 b(But)29 b Fj(bzip2)f Fl(do)s(esn't)h(ha)m(v)m(e)h(m)m +(uc)m(h)f(in)f(the)h(w)m(a)m(y)h(of)g(p)s(ortabilit)m(y)d(prob-)150 +1905 y(lems)35 b(on)h(Unix;)j(most)d(of)g(the)h(di\016culties)d(app)s +(ear)h(when)g(p)s(orting)g(to)i(the)f(Mac,)j(or)d(to)h(Microsoft's)150 +2015 y(op)s(erating)26 b(systems.)40 b Fj(autoconf)25 +b Fl(do)s(esn't)h(help)g(in)f(those)j(cases,)h(and)d(brings)f(in)g(a)j +(whole)e(load)g(of)h(new)150 2124 y(complexit)m(y)-8 +b(.)150 2281 y(Most)28 b(p)s(eople)f(should)f(b)s(e)h(able)g(to)h +(compile)e(the)i(library)d(and)i(program)h(under)e(Unix)g(straigh)m(t)i +(out-of-)150 2391 y(the-b)s(o)m(x,)j(so)g(to)g(sp)s(eak,)f(esp)s +(ecially)f(if)g(y)m(ou)i(ha)m(v)m(e)g(a)g(v)m(ersion)f(of)g(GNU)h(C)f +(a)m(v)-5 b(ailable.)150 2547 y(There)32 b(are)h(a)g(couple)f(of)h +Fj(__inline__)d Fl(directiv)m(es)i(in)f(the)i(co)s(de.)48 +b(GNU)33 b(C)f(\()p Fj(gcc)p Fl(\))g(should)f(b)s(e)h(able)g(to)150 +2657 y(handle)24 b(them.)39 b(If)25 b(y)m(ou're)i(not)e(using)g(GNU)h +(C,)f(y)m(our)h(C)f(compiler)f(shouldn't)g(see)i(them)f(at)i(all.)38 +b(If)25 b(y)m(our)150 2767 y(compiler)k(do)s(es,)i(for)g(some)g +(reason,)h(see)f(them)g(and)f(do)s(esn't)h(lik)m(e)f(them,)i(just)e +Fj(#define)f(__inline__)150 2876 y Fl(to)37 b(b)s(e)f +Fj(/*)30 b(*/)p Fl(.)58 b(One)36 b(easy)h(w)m(a)m(y)g(to)h(do)e(this)f +(is)h(to)h(compile)e(with)g(the)i(\015ag)g Fj(-D__inline__=)p +Fl(,)d(whic)m(h)150 2986 y(should)28 b(b)s(e)i(understo)s(o)s(d)f(b)m +(y)h(most)h(Unix)e(compilers.)150 3143 y(If)35 b(y)m(ou)g(still)e(ha)m +(v)m(e)j(di\016culties,)e(try)h(compiling)e(with)g(the)j(macro)f +Fj(BZ_STRICT_ANSI)c Fl(de\014ned.)54 b(This)150 3252 +y(should)28 b(enable)i(y)m(ou)h(to)g(build)d(the)i(library)e(in)h(a)i +(strictly)f(ANSI)g(complian)m(t)f(en)m(vironmen)m(t.)41 +b(Building)150 3362 y(the)25 b(program)f(itself)f(lik)m(e)g(this)h(is)f +(dangerous)h(and)g(not)g(supp)s(orted,)g(since)g(y)m(ou)h(remo)m(v)m(e) +g Fj(bzip2)p Fl('s)e(c)m(hec)m(ks)150 3471 y(against)30 +b(compressing)f(directories,)g(sym)m(b)s(olic)g(links,)f(devices,)i +(and)f(other)h(not-really-a-\014le)g(en)m(tities.)150 +3581 y(This)f(could)g(cause)i(\014lesystem)f(corruption!)150 +3738 y(One)e(other)i(thing:)39 b(if)27 b(y)m(ou)j(create)g(a)f +Fj(bzip2)f Fl(binary)f(for)i(public)d(distribution,)g(please)i(try)h +(and)g(link)d(it)150 3847 y(statically)g(\()p Fj(gcc)k(-s)p +Fl(\).)39 b(This)25 b(a)m(v)m(oids)i(all)f(sorts)h(of)g(library-v)m +(ersion)d(issues)h(that)i(others)g(ma)m(y)g(encoun)m(ter)150 +3957 y(later)j(on.)150 4114 y(If)f(y)m(ou)g(build)e Fj(bzip2)h +Fl(on)h(Win32,)h(y)m(ou)f(m)m(ust)g(set)h Fj(BZ_UNIX)e +Fl(to)i(0)f(and)g Fj(BZ_LCCWIN32)d Fl(to)k(1,)g(in)e(the)i(\014le)150 +4223 y Fj(bzip2.c)p Fl(,)f(b)s(efore)h(compiling.)38 +b(Otherwise)29 b(the)i(resulting)d(binary)h(w)m(on't)i(w)m(ork)f +(correctly)-8 b(.)150 4505 y Fk(4.3)68 b(Rep)t(orting)46 +b(bugs)150 4698 y Fl(I)25 b(tried)f(prett)m(y)i(hard)e(to)i(mak)m(e)g +(sure)f Fj(bzip2)e Fl(is)i(bug)f(free,)j(b)s(oth)d(b)m(y)h(design)f +(and)h(b)m(y)g(testing.)39 b(Hop)s(efully)150 4807 y(y)m(ou'll)29 +b(nev)m(er)i(need)f(to)h(read)g(this)e(section)h(for)h(real.)150 +4964 y(Nev)m(ertheless,)36 b(if)c Fj(bzip2)h Fl(dies)g(with)f(a)i +(segmen)m(tation)h(fault,)g(a)f(bus)f(error)g(or)h(an)g(in)m(ternal)e +(assertion)150 5074 y(failure,)i(it)h(will)d(ask)j(y)m(ou)g(to)g(email) +f(me)h(a)g(bug)f(rep)s(ort.)54 b(Exp)s(erience)33 b(with)h(v)m(ersion)g +(0.1)i(sho)m(ws)e(that)150 5183 y(almost)c(all)g(these)h(problems)d +(can)j(b)s(e)f(traced)h(to)g(either)f(compiler)e(bugs)i(or)g(hardw)m +(are)g(problems.)225 5340 y Fi(\017)60 b Fl(Recompile)22 +b(the)h(program)g(with)f(no)h(optimisation,)g(and)f(see)i(if)e(it)g(w)m +(orks.)39 b(And/or)22 b(try)h(a)g(di\013eren)m(t)p eop +%%Page: 33 34 +33 33 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(33)330 299 y(compiler.)77 b(I)43 b(heard)f(all)g(sorts)h(of)h +(stories)e(ab)s(out)h(v)-5 b(arious)42 b(\015a)m(v)m(ours)h(of)h(GNU)f +(C)g(\(and)g(other)330 408 y(compilers\))20 b(generating)i(bad)e(co)s +(de)i(for)f Fj(bzip2)p Fl(,)h(and)f(I'v)m(e)h(run)e(across)i(t)m(w)m(o) +g(suc)m(h)f(examples)g(m)m(yself.)330 606 y(2.7.X)35 +b(v)m(ersions)e(of)g(GNU)h(C)f(are)h(kno)m(wn)f(to)h(generate)h(bad)d +(co)s(de)i(from)f(time)g(to)h(time,)g(at)g(high)330 716 +y(optimisation)20 b(lev)m(els.)37 b(If)21 b(y)m(ou)g(get)i(problems,)e +(try)g(using)f(the)i(\015ags)f Fj(-O2)f(-fomit-frame-pointer)330 +825 y(-fno-strength-reduce)p Fl(.)35 b(Y)-8 b(ou)31 b(should)d(sp)s +(eci\014cally)h Fc(not)j Fl(use)e Fj(-funroll-loops)p +Fl(.)330 1023 y(Y)-8 b(ou)38 b(ma)m(y)g(notice)g(that)g(the)g(Mak)m +(e\014le)g(runs)e(six)g(tests)i(as)g(part)f(of)h(the)g(build)c(pro)s +(cess.)62 b(If)37 b(the)330 1132 y(program)43 b(passes)g(all)f(of)h +(these,)k(it's)c(a)h(prett)m(y)f(go)s(o)s(d)g(\(but)g(not)g(100\045\))i +(indication)c(that)j(the)330 1242 y(compiler)29 b(has)h(done)g(its)g +(job)g(correctly)-8 b(.)225 1440 y Fi(\017)60 b Fl(If)33 +b Fj(bzip2)f Fl(crashes)i(randomly)-8 b(,)33 b(and)g(the)h(crashes)g +(are)g(not)g(rep)s(eatable,)g(y)m(ou)g(ma)m(y)g(ha)m(v)m(e)h(a)f +(\015aky)330 1549 y(memory)k(subsystem.)64 b Fj(bzip2)37 +b Fl(really)g(hammers)h(y)m(our)g(memory)g(hierarc)m(h)m(y)-8 +b(,)41 b(and)d(if)f(it's)h(a)h(bit)330 1659 y(marginal,)33 +b(y)m(ou)h(ma)m(y)g(get)h(these)f(problems.)49 b(Ditto)34 +b(if)f(y)m(our)h(disk)e(or)h(I/O)h(subsystem)e(is)h(slo)m(wly)330 +1768 y(failing.)39 b(Y)-8 b(up,)30 b(this)f(really)g(do)s(es)h(happ)s +(en.)330 1966 y(T)-8 b(ry)28 b(using)f(a)i(di\013eren)m(t)f(mac)m(hine) +g(of)h(the)g(same)f(t)m(yp)s(e,)i(and)e(see)h(if)e(y)m(ou)i(can)g(rep)s +(eat)g(the)f(problem.)225 2163 y Fi(\017)60 b Fl(This)21 +b(isn't)i(really)f(a)h(bug,)i(but)d(...)39 b(If)23 b +Fj(bzip2)f Fl(tells)g(y)m(ou)h(y)m(our)h(\014le)e(is)g(corrupted)h(on)g +(decompression,)330 2273 y(and)29 b(y)m(ou)g(obtained)f(the)i(\014le)e +(via)h(FTP)-8 b(,)29 b(there)h(is)e(a)h(p)s(ossibilit)m(y)d(that)k(y)m +(ou)f(forgot)h(to)g(tell)e(FTP)h(to)330 2383 y(do)23 +b(a)g(binary)e(mo)s(de)i(transfer.)38 b(That)23 b(absolutely)f(will)e +(cause)j(the)h(\014le)e(to)h(b)s(e)g(non-decompressible.)330 +2492 y(Y)-8 b(ou'll)30 b(ha)m(v)m(e)h(to)g(transfer)f(it)g(again.)150 +2737 y(If)i(y)m(ou'v)m(e)h(incorp)s(orated)e Fj(libbzip2)f +Fl(in)m(to)i(y)m(our)g(o)m(wn)g(program)g(and)g(are)g(getting)h +(problems,)e(please,)150 2847 y(please,)d(please,)h(c)m(hec)m(k)g(that) +f(the)g(parameters)g(y)m(ou)g(are)g(passing)f(in)f(calls)h(to)h(the)g +(library)-8 b(,)26 b(are)j(correct,)150 2956 y(and)e(in)f(accordance)k +(with)c(what)i(the)g(do)s(cumen)m(tation)f(sa)m(ys)h(is)f(allo)m(w)m +(able.)39 b(I)28 b(ha)m(v)m(e)h(tried)e(to)h(mak)m(e)h(the)150 +3066 y(library)f(robust)i(against)g(suc)m(h)g(problems,)f(but)h(I'm)g +(sure)g(I)g(ha)m(v)m(en't)h(succeeded.)150 3223 y(Finally)-8 +b(,)32 b(if)g(the)h(ab)s(o)m(v)m(e)i(commen)m(ts)e(don't)g(help,)g(y)m +(ou'll)f(ha)m(v)m(e)i(to)g(send)e(me)h(a)g(bug)g(rep)s(ort.)48 +b(No)m(w,)34 b(it's)150 3332 y(just)c(amazing)g(ho)m(w)h(man)m(y)f(p)s +(eople)g(will)d(send)j(me)g(a)h(bug)f(rep)s(ort)g(sa)m(ying)g +(something)g(lik)m(e)481 3483 y(bzip2)f(crashed)h(with)f(segmen)m +(tation)j(fault)e(on)g(m)m(y)g(mac)m(hine)150 3640 y(and)h(absolutely)f +(nothing)h(else.)44 b(Needless)32 b(to)g(sa)m(y)-8 b(,)33 +b(a)f(suc)m(h)f(a)h(rep)s(ort)f(is)g Fc(totally)-8 b(,)32 +b(utterly)-8 b(,)32 b(completely)150 3750 y(and)40 b(comprehensiv)m +(ely)g(100\045)h(useless;)46 b(a)41 b(w)m(aste)g(of)g(y)m(our)g(time,)i +(m)m(y)e(time,)i(and)e(net)g(bandwidth)p Fl(.)150 3859 +y(With)31 b(no)h(details)f(at)i(all,)e(there's)h(no)g(w)m(a)m(y)h(I)f +(can)g(p)s(ossibly)d(b)s(egin)h(to)j(\014gure)e(out)i(what)e(the)i +(problem)150 3969 y(is.)150 4126 y(The)d(rules)e(of)i(the)g(game)h +(are:)41 b(facts,)32 b(facts,)f(facts.)41 b(Don't)31 +b(omit)f(them)g(b)s(ecause)g Fj(")p Fl(oh,)g(they)g(w)m(on't)h(b)s(e) +150 4235 y(relev)-5 b(an)m(t)p Fj(")p Fl(.)41 b(A)m(t)31 +b(the)g(bare)f(minim)m(um:)481 4386 y(Mac)m(hine)h(t)m(yp)s(e.)61 +b(Op)s(erating)29 b(system)h(v)m(ersion.)481 4490 y(Exact)h(v)m(ersion) +f(of)h Fj(bzip2)e Fl(\(do)h Fj(bzip2)47 b(-V)p Fl(\).)481 +4594 y(Exact)31 b(v)m(ersion)f(of)h(the)f(compiler)f(used.)481 +4698 y(Flags)i(passed)e(to)j(the)e(compiler.)150 4854 +y(Ho)m(w)m(ev)m(er,)i(the)d(most)h(imp)s(ortan)m(t)f(single)f(thing)g +(that)i(will)d(help)h(me)h(is)f(the)i(\014le)e(that)i(y)m(ou)g(w)m(ere) +g(trying)150 4964 y(to)f(compress)f(or)g(decompress)g(at)h(the)f(time)g +(the)g(problem)f(happ)s(ened.)38 b(Without)28 b(that,)h(m)m(y)g(abilit) +m(y)d(to)150 5074 y(do)k(an)m(ything)g(more)h(than)f(sp)s(eculate)g(ab) +s(out)g(the)g(cause,)i(is)d(limited.)150 5230 y(Please)34 +b(remem)m(b)s(er)f(that)h(I)f(connect)i(to)f(the)g(In)m(ternet)g(with)e +(a)i(mo)s(dem,)g(so)f(y)m(ou)h(should)e(con)m(tact)k(me)150 +5340 y(b)s(efore)30 b(mailing)e(me)j(h)m(uge)f(\014les.)p +eop +%%Page: 34 35 +34 34 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(34)150 299 y Fk(4.4)68 b(Did)45 b(y)l(ou)g(get)h(the)f(righ)l(t)h +(pac)l(k)-7 b(age?)150 491 y Fj(bzip2)34 b Fl(is)h(a)h(resource)g(hog.) +56 b(It)36 b(soaks)g(up)f(large)g(amoun)m(ts)h(of)g(CPU)f(cycles)h(and) +f(memory)-8 b(.)57 b(Also,)36 b(it)150 601 y(giv)m(es)26 +b(v)m(ery)h(large)f(latencies.)39 b(In)25 b(the)h(w)m(orst)g(case,)i(y) +m(ou)f(can)f(feed)g(man)m(y)g(megab)m(ytes)h(of)f(uncompressed)150 +711 y(data)45 b(in)m(to)e(the)i(library)c(b)s(efore)j(getting)g(an)m(y) +g(compressed)g(output,)j(so)d(this)f(probably)f(rules)h(out)150 +820 y(applications)29 b(requiring)e(in)m(teractiv)m(e)32 +b(b)s(eha)m(viour.)150 977 y(These)38 b(aren't)h(faults)e(of)h(m)m(y)g +(implemen)m(tation,)h(I)f(hop)s(e,)i(but)d(more)h(an)g(in)m(trinsic)e +(prop)s(ert)m(y)h(of)i(the)150 1087 y(Burro)m(ws-Wheeler)30 +b(transform)g(\(unfortunately\).)40 b(Ma)m(yb)s(e)31 +b(this)e(isn't)h(what)g(y)m(ou)h(w)m(an)m(t.)150 1244 +y(If)h(y)m(ou)h(w)m(an)m(t)g(a)g(compressor)g(and/or)f(library)e(whic)m +(h)h(is)h(faster,)i(uses)e(less)g(memory)g(but)g(gets)h(prett)m(y)150 +1353 y(go)s(o)s(d)e(compression,)g(and)g(has)h(minimal)c(latency)-8 +b(,)33 b(consider)e(Jean-loup)f(Gailly's)g(and)h(Mark)h(Adler's)150 +1463 y(w)m(ork,)f Fj(zlib-1.1.2)c Fl(and)j Fj(gzip-1.2.4)p +Fl(.)38 b(Lo)s(ok)31 b(for)f(them)g(at)150 1620 y Fj +(http://www.cdrom.com/pub)o(/inf)o(ozip)o(/zl)o(ib)24 +b Fl(and)30 b Fj(http://www.gzip.org)25 b Fl(resp)s(ectiv)m(ely)-8 +b(.)150 1776 y(F)g(or)32 b(something)f(faster)i(and)e(ligh)m(ter)f +(still,)h(y)m(ou)g(migh)m(t)h(try)f(Markus)h(F)g(X)f(J)h(Ob)s(erh)m +(umer's)d Fj(LZO)i Fl(real-)150 1886 y(time)f +(compression/decompression)f(library)-8 b(,)28 b(at)150 +1996 y Fj(http://wildsau.idv.uni-l)o(inz.)o(ac.a)o(t/m)o(fx/l)o(zo.h)o +(tml)o Fl(.)150 2152 y(If)38 b(y)m(ou)h(w)m(an)m(t)g(to)h(use)e(the)g +Fj(bzip2)g Fl(algorithms)f(to)i(compress)f(small)g(blo)s(c)m(ks)f(of)i +(data,)j(64k)d(b)m(ytes)g(or)150 2262 y(smaller,)i(for)e(example)g(on)h +(an)f(on-the-\015y)h(disk)e(compressor,)k(y)m(ou'd)e(b)s(e)f(w)m(ell)g +(advised)f(not)i(to)g(use)150 2372 y(this)i(library)-8 +b(.)77 b(Instead,)47 b(I'v)m(e)d(made)f(a)h(sp)s(ecial)e(library)f +(tuned)h(for)h(that)h(kind)d(of)j(use.)79 b(It's)43 b(part)150 +2481 y(of)d Fj(e2compr-0.40)p Fl(,)f(an)g(on-the-\015y)h(disk)e +(compressor)h(for)h(the)f(Lin)m(ux)f Fj(ext2)h Fl(\014lesystem.)67 +b(Lo)s(ok)40 b(at)150 2591 y Fj(http://www.netspace.net.)o(au/~)o(reit) +o(er/)o(e2co)o(mpr)p Fl(.)150 2880 y Fk(4.5)68 b(T)-11 +b(esting)150 3072 y Fl(A)30 b(record)h(of)f(the)h(tests)g(I'v)m(e)g +(done.)150 3229 y(First,)f(some)h(data)g(sets:)225 3386 +y Fi(\017)60 b Fl(B:)32 b(a)f(directory)f(con)m(taining)h(6001)i +(\014les,)d(one)h(for)g(ev)m(ery)h(length)e(in)g(the)h(range)g(0)h(to)f +(6000)i(b)m(ytes.)330 3496 y(The)d(\014les)f(con)m(tain)i(random)e(lo)m +(w)m(ercase)j(letters.)41 b(18.7)32 b(megab)m(ytes.)225 +3633 y Fi(\017)60 b Fl(H:)36 b(m)m(y)f(home)h(directory)f(tree.)56 +b(Do)s(cumen)m(ts,)38 b(source)d(co)s(de,)i(mail)d(\014les,)i +(compressed)f(data.)57 b(H)330 3743 y(con)m(tains)39 +b(B,)h(and)f(also)g(a)g(directory)g(of)g(\014les)f(designed)g(as)i(b)s +(oundary)d(cases)j(for)f(the)g(sorting;)330 3853 y(mostly)30 +b(v)m(ery)h(rep)s(etitiv)m(e,)f(nast)m(y)h(\014les.)39 +b(565)32 b(megab)m(ytes.)225 3990 y Fi(\017)60 b Fl(A:)43 +b(directory)f(tree)i(holding)d(v)-5 b(arious)41 b(applications)g(built) +g(from)h(source:)66 b Fj(egcs)p Fl(,)45 b Fj(gcc-2.8.1)p +Fl(,)330 4100 y(KDE,)31 b(GTK,)f(Octa)m(v)m(e,)j(etc.)41 +b(2200)33 b(megab)m(ytes.)150 4285 y(The)i(tests)g(conducted)g(are)h +(as)f(follo)m(ws.)54 b(Eac)m(h)36 b(test)g(means)f(compressing)f(\(a)h +(cop)m(y)h(of)7 b(\))36 b(eac)m(h)g(\014le)e(in)150 4394 +y(the)d(data)g(set,)g(decompressing)e(it)h(and)g(comparing)f(it)h +(against)h(the)g(original.)150 4551 y(First,)26 b(a)g(bunc)m(h)f(of)h +(tests)h(with)d(blo)s(c)m(k)h(sizes)h(and)f(in)m(ternal)g(bu\013er)f +(sizes)i(set)g(v)m(ery)g(small,)g(to)g(detect)i(an)m(y)150 +4661 y(problems)g(with)g(the)i(blo)s(c)m(king)f(and)g(bu\013ering)e +(mec)m(hanisms.)40 b(This)28 b(required)g(mo)s(difying)f(the)j(source) +150 4770 y(co)s(de)h(so)f(as)h(to)g(try)f(to)h(break)g(it.)199 +4927 y(1.)61 b(Data)32 b(set)f(H,)g(with)e(bu\013er)g(size)h(of)h(1)g +(b)m(yte,)g(and)f(blo)s(c)m(k)g(size)g(of)g(23)i(b)m(ytes.)199 +5065 y(2.)61 b(Data)32 b(set)f(B,)g(bu\013er)e(sizes)h(1)h(b)m(yte,)g +(blo)s(c)m(k)f(size)g(1)h(b)m(yte.)199 5202 y(3.)61 b(As)30 +b(\(2\))i(but)d(small-mo)s(de)g(decompression.)199 5340 +y(4.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(2)h(b)m(ytes.)p +eop +%%Page: 35 36 +35 35 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(35)199 299 y(5.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(3)h +(b)m(ytes.)199 431 y(6.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size) +g(4)h(b)m(ytes.)199 564 y(7.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h +(size)g(5)h(b)m(ytes.)199 697 y(8.)61 b(As)30 b(\(2\))i(with)d(blo)s(c) +m(k)h(size)g(6)h(b)m(ytes)g(and)e(small-mo)s(de)g(decompression.)199 +829 y(9.)61 b(H)30 b(with)g(bu\013er)f(size)h(of)h(1)f(b)m(yte,)i(but)d +(normal)h(blo)s(c)m(k)g(size)g(\(up)f(to)j(900000)h(b)m(ytes\).)150 +1009 y(Then)c(some)i(tests)g(with)e(unmo)s(di\014ed)f(source)i(co)s +(de.)199 1166 y(1.)61 b(H,)31 b(all)e(settings)h(normal.)199 +1299 y(2.)61 b(As)30 b(\(1\),)i(with)d(small-mo)s(de)g(decompress.)199 +1431 y(3.)61 b(H,)31 b(compress)f(with)f(\015ag)i Fj(-1)p +Fl(.)199 1564 y(4.)61 b(H,)31 b(compress)f(with)f(\015ag)i +Fj(-s)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)199 +1697 y(5.)61 b(F)-8 b(orw)m(ards)33 b(compatibilit)m(y:)45 +b(H,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j Fj(bzip2-0.9.5)d +Fl(decompressing,)330 1806 y(all)f(settings)i(normal.)199 +1939 y(6.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35 +b(H,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c +Fl(decompressing,)330 2048 y(all)29 b(settings)i(normal.)199 +2181 y(7.)61 b(Bigger)31 b(tests:)41 b(A,)31 b(all)e(settings)i +(normal.)199 2314 y(8.)61 b(As)30 b(\(7\),)i(using)d(the)i(fallbac)m(k) +e(\(Sadak)-5 b(ane-lik)m(e\))31 b(sorting)f(algorithm.)199 +2446 y(9.)61 b(As)30 b(\(8\),)i(compress)e(with)f(\015ag)i +Fj(-1)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)154 +2579 y(10.)61 b(H,)31 b(using)e(the)h(fallbac)m(k)g(sorting)g +(algorithm.)154 2711 y(11.)61 b(F)-8 b(orw)m(ards)33 +b(compatibilit)m(y:)45 b(A,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j +Fj(bzip2-0.9.5)d Fl(decompressing,)330 2821 y(all)f(settings)i(normal.) +154 2954 y(12.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35 +b(A,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c +Fl(decompressing,)330 3063 y(all)29 b(settings)i(normal.)154 +3196 y(13.)61 b(Misc)39 b(test:)58 b(ab)s(out)39 b(400)h(megab)m(ytes)h +(of)e Fj(.tar)f Fl(\014les)f(with)h Fj(bzip2)f Fl(compiled)h(with)f +(Chec)m(k)m(er)j(\(a)330 3305 y(memory)30 b(access)i(error)e(detector,) +i(lik)m(e)e(Purify\).)154 3438 y(14.)61 b(Misc)30 b(tests)h(to)g(mak)m +(e)h(sure)d(it)h(builds)e(and)h(runs)g(ok)i(on)f(non-Lin)m(ux/x86)g +(platforms.)150 3618 y(These)35 b(tests)h(w)m(ere)f(conducted)g(on)g(a) +h(225)g(MHz)g(IDT)f(WinChip)d(mac)m(hine,)k(running)d(Lin)m(ux)g +(2.0.36.)150 3728 y(They)d(represen)m(t)g(nearly)g(a)h(w)m(eek)g(of)f +(con)m(tin)m(uous)g(computation.)41 b(All)29 b(tests)i(completed)f +(successfully)-8 b(.)150 4003 y Fk(4.6)68 b(F)-11 b(urther)44 +b(reading)150 4196 y Fj(bzip2)28 b Fl(is)h(not)h(researc)m(h)g(w)m +(ork,)g(in)e(the)i(sense)g(that)g(it)f(do)s(esn't)g(presen)m(t)h(an)m +(y)g(new)f(ideas.)40 b(Rather,)30 b(it's)150 4306 y(an)g(engineering)f +(exercise)i(based)f(on)g(existing)g(ideas.)150 4463 y(F)-8 +b(our)31 b(do)s(cumen)m(ts)f(describ)s(e)e(essen)m(tially)i(all)f(the)i +(ideas)e(b)s(ehind)f Fj(bzip2)p Fl(:)390 4614 y Fj(Michael)46 +b(Burrows)g(and)h(D.)g(J.)g(Wheeler:)485 4717 y("A)h(block-sorting)c +(lossless)h(data)i(compression)e(algorithm")533 4821 +y(10th)i(May)g(1994.)533 4925 y(Digital)f(SRC)h(Research)e(Report)i +(124.)533 5029 y(ftp://ftp.digital.com/pub)o(/DEC)o(/SR)o(C/re)o(sear)o +(ch-)o(repo)o(rts/)o(SRC)o(-124)o(.ps.)o(gz)533 5132 +y(If)g(you)g(have)g(trouble)f(finding)g(it,)g(try)h(searching)f(at)h +(the)533 5236 y(New)g(Zealand)f(Digital)g(Library,)f +(http://www.nzdl.org.)p eop +%%Page: 36 37 +36 36 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(36)390 299 y Fj(Daniel)46 b(S.)h(Hirschberg)e(and)i(Debra)g(A.)g +(LeLewer)485 403 y("Efficient)e(Decoding)h(of)h(Prefix)f(Codes")533 +506 y(Communications)e(of)j(the)g(ACM,)g(April)f(1990,)h(Vol)f(33,)h +(Number)f(4.)533 610 y(You)h(might)f(be)i(able)e(to)h(get)g(an)h +(electronic)d(copy)h(of)h(this)676 714 y(from)g(the)g(ACM)g(Digital)f +(Library.)390 922 y(David)g(J.)i(Wheeler)533 1025 y(Program)e(bred3.c)g +(and)h(accompanying)d(document)i(bred3.ps.)533 1129 y(This)h(contains)e +(the)i(idea)g(behind)f(the)h(multi-table)e(Huffman)533 +1233 y(coding)h(scheme.)533 1337 y(ftp://ftp.cl.cam.ac.uk/us)o(ers/)o +(djw)o(3/)390 1544 y(Jon)h(L.)g(Bentley)f(and)h(Robert)f(Sedgewick)485 +1648 y("Fast)h(Algorithms)e(for)i(Sorting)f(and)g(Searching)g(Strings") +533 1752 y(Available)f(from)i(Sedgewick's)e(web)i(page,)533 +1856 y(www.cs.princeton.edu/~rs)150 2012 y Fl(The)29 +b(follo)m(wing)f(pap)s(er)g(giv)m(es)h(v)-5 b(aluable)28 +b(additional)g(insigh)m(ts)f(in)m(to)j(the)f(algorithm,)g(but)g(is)f +(not)i(imme-)150 2122 y(diately)g(the)g(basis)f(of)i(an)m(y)g(co)s(de)f +(used)g(in)f(bzip2.)390 2273 y Fj(Peter)46 b(Fenwick:)533 +2377 y(Block)h(Sorting)e(Text)i(Compression)533 2481 +y(Proceedings)e(of)i(the)g(19th)g(Australasian)d(Computer)i(Science)f +(Conference,)629 2584 y(Melbourne,)g(Australia.)92 b(Jan)47 +b(31)g(-)h(Feb)f(2,)g(1996.)533 2688 y(ftp://ftp.cs.auckland.ac.)o +(nz/p)o(ub/)o(pete)o(r-f/)o(ACS)o(C96p)o(aper)o(.ps)150 +2845 y Fl(Kunihik)m(o)28 b(Sadak)-5 b(ane's)31 b(sorting)e(algorithm,)h +(men)m(tioned)g(ab)s(o)m(v)m(e,)i(is)d(a)m(v)-5 b(ailable)30 +b(from:)390 2996 y Fj(http://naomi.is.s.u-toky)o(o.ac)o(.jp/)o(~sa)o +(da/p)o(aper)o(s/S)o(ada9)o(8b.p)o(s.g)o(z)150 3153 y +Fl(The)41 b(Man)m(b)s(er-My)m(ers)g(su\016x)g(arra)m(y)g(construction)g +(algorithm)f(is)g(describ)s(ed)f(in)h(a)i(pap)s(er)e(a)m(v)-5 +b(ailable)150 3262 y(from:)390 3413 y Fj(http://www.cs.arizona.ed)o +(u/pe)o(ople)o(/ge)o(ne/P)o(APER)o(S/s)o(uffi)o(x.ps)150 +3570 y Fl(Finally)d(,)33 b(the)h(follo)m(wing)e(pap)s(er)h(do)s(cumen)m +(ts)g(some)h(recen)m(t)h(in)m(v)m(estigations)e(I)h(made)f(in)m(to)h +(the)g(p)s(erfor-)150 3680 y(mance)d(of)f(sorting)g(algorithms:)390 +3831 y Fj(Julian)46 b(Seward:)533 3935 y(On)h(the)g(Performance)e(of)i +(BWT)g(Sorting)f(Algorithms)533 4038 y(Proceedings)f(of)i(the)g(IEEE)g +(Data)f(Compression)f(Conference)g(2000)629 4142 y(Snowbird,)g(Utah.)94 +b(28-30)46 b(March)h(2000.)p eop +%%Page: -1 38 +-1 37 bop 3725 -116 a Fl(i)150 299 y Fh(T)-13 b(able)54 +b(of)g(Con)l(ten)l(ts)150 641 y Fk(1)135 b(In)l(tro)t(duction)15 +b Fb(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f +(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)60 +b Fk(2)150 911 y(2)135 b(Ho)l(w)45 b(to)h(use)f Fd(bzip2)31 +b Fb(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g +(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)78 b Fk(3)1047 +1048 y Fl(NAME)20 b Fa(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(3)1047 +1157 y(SYNOPSIS)21 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)h(.)f(.)g(.)50 b Fl(3)1047 1267 y(DESCRIPTION)10 +b Fa(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 +b Fl(3)1047 1377 y(OPTIONS)16 b Fa(.)d(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(4)1047 +1486 y(MEMOR)-8 b(Y)31 b(MANA)m(GEMENT)14 b Fa(.)j(.)e(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 +b Fl(6)1047 1596 y(RECO)m(VERING)30 b(D)m(A)-8 b(T)g(A)32 +b(FR)m(OM)f(D)m(AMA)m(GED)i(FILES)1256 1705 y Fa(.)15 +b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)57 b Fl(7)1047 1815 y(PERF)m(ORMANCE)30 +b(NOTES)9 b Fa(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)38 b Fl(7)1047 1924 +y(CA)-10 b(VEA)i(TS)10 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Fl(8)1047 2034 +y(A)m(UTHOR)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Fl(8)150 2276 y Fk(3)135 +b(Programming)46 b(with)f Fd(libbzip2)29 b Fb(.)16 b(.)j(.)h(.)f(.)h(.) +f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)74 b Fk(9)449 +2413 y Fl(3.1)92 b(T)-8 b(op-lev)m(el)30 b(structure)24 +b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)54 b Fl(9)748 2523 y(3.1.1)93 b(Lo)m(w-lev)m(el)30 +b(summary)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)53 +b Fl(9)748 2633 y(3.1.2)93 b(High-lev)m(el)29 b(summary)12 +b Fa(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)41 b +Fl(9)748 2742 y(3.1.3)93 b(Utilit)m(y)29 b(functions)g(summary)12 +b Fa(.)h(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)41 b Fl(10)449 2852 y(3.2)92 b(Error)29 +b(handling)18 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(10)449 +2961 y(3.3)92 b(Lo)m(w-lev)m(el)31 b(in)m(terface)d Fa(.)15 +b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)57 b Fl(12)748 3071 y(3.3.1)93 b Fj(BZ2_bzCompressInit)21 +b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(12)748 +3181 y(3.3.2)93 b Fj(BZ2_bzCompress)9 b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g +(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 b Fl(14)748 3290 y(3.3.3)93 +b Fj(BZ2_bzCompressEnd)23 b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g +(.)52 b Fl(17)748 3400 y(3.3.4)93 b Fj(BZ2_bzDecompressInit)16 +b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(17)748 3509 +y(3.3.5)93 b Fj(BZ2_bzDecompress)21 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)55 b Fl(17)748 3619 y(3.3.6)93 b Fj(BZ2_bzDecompressEnd)18 +b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(19)449 +3729 y(3.4)92 b(High-lev)m(el)30 b(in)m(terface)16 b +Fa(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)45 b Fl(19)748 3838 y(3.4.1)93 b Fj(BZ2_bzReadOpen)9 +b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 +b Fl(19)748 3948 y(3.4.2)93 b Fj(BZ2_bzRead)18 b Fa(.)12 +b(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 +b Fl(20)748 4057 y(3.4.3)93 b Fj(BZ2_bzReadGetUnused)18 +b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(22)748 +4167 y(3.4.4)93 b Fj(BZ2_bzReadClose)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)57 b Fl(22)748 4276 y(3.4.5)93 b +Fj(BZ2_bzWriteOpen)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)57 b Fl(22)748 4386 y(3.4.6)93 b Fj(BZ2_bzWrite)16 +b Fa(.)11 b(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +45 b Fl(23)748 4496 y(3.4.7)93 b Fj(BZ2_bzWriteClose)21 +b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Fl(23)748 +4605 y(3.4.8)93 b(Handling)28 b(em)m(b)s(edded)h(compressed)h(data)h +(streams)17 b Fa(.)f(.)f(.)g(.)46 b Fl(24)748 4715 y(3.4.9)93 +b(Standard)29 b(\014le-reading/writing)e(co)s(de)22 b +Fa(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 +b Fl(25)449 4824 y(3.5)92 b(Utilit)m(y)29 b(functions)f +Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)59 b Fl(26)748 4934 y(3.5.1)93 b +Fj(BZ2_bzBuffToBuffCompres)o(s)22 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)57 b Fl(26)748 +5044 y(3.5.2)93 b Fj(BZ2_bzBuffToBuffDecompr)o(ess)17 +b Fa(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +53 b Fl(27)449 5153 y(3.6)92 b Fj(zlib)29 b Fl(compatibilit)m(y)g +(functions)23 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 +b Fl(28)449 5263 y(3.7)92 b(Using)30 b(the)g(library)e(in)h(a)i +Fj(stdio)p Fl(-free)e(en)m(vironmen)m(t)23 b Fa(.)15 +b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)52 b Fl(29)p +eop +%%Page: -2 39 +-2 38 bop 3699 -116 a Fl(ii)748 83 y(3.7.1)93 b(Getting)31 +b(rid)d(of)j Fj(stdio)20 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 +b Fl(29)748 193 y(3.7.2)93 b(Critical)28 b(error)i(handling)22 +b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Fl(29)449 302 +y(3.8)92 b(Making)30 b(a)h(Windo)m(ws)e(DLL)15 b Fa(.)h(.)f(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)44 b Fl(30)150 545 +y Fk(4)135 b(Miscellanea)11 b Fb(.)21 b(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)h +(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.) +h(.)f(.)g(.)h(.)56 b Fk(31)449 682 y Fl(4.1)92 b(Limitations)29 +b(of)h(the)h(compressed)f(\014le)f(format)9 b Fa(.)15 +b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 +b Fl(31)449 791 y(4.2)92 b(P)m(ortabilit)m(y)30 b(issues)14 +b Fa(.)f(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)h(.)f(.)g(.)43 b Fl(32)449 901 y(4.3)92 b(Rep)s(orting)29 +b(bugs)f Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Fl(32)449 1010 y(4.4)92 +b(Did)29 b(y)m(ou)i(get)h(the)e(righ)m(t)g(pac)m(k)-5 +b(age?)22 b Fa(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 +b Fl(34)449 1120 y(4.5)92 b(T)-8 b(esting)16 b Fa(.)f(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)45 b Fl(34)449 1230 y(4.6)92 +b(F)-8 b(urther)30 b(reading)22 b Fa(.)14 b(.)h(.)g(.)h(.)f(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)51 +b Fl(35)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/bzip2/manual.texi b/bzip2/manual.texi new file mode 100644 index 0000000..336776a --- /dev/null +++ b/bzip2/manual.texi @@ -0,0 +1,2215 @@ +\input texinfo @c -*- Texinfo -*- +@setfilename bzip2.info + +@ignore +This file documents bzip2 version 1.0, and associated library +libbzip2, written by Julian Seward (jseward@acm.org). + +Copyright (C) 1996-2000 Julian R Seward + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +are preserved on all copies. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for verbatim copies. +@end ignore + +@ifinfo +@format +START-INFO-DIR-ENTRY +* Bzip2: (bzip2). A program and library for data compression. +END-INFO-DIR-ENTRY +@end format + +@end ifinfo + +@iftex +@c @finalout +@settitle bzip2 and libbzip2 +@titlepage +@title bzip2 and libbzip2 +@subtitle a program and library for data compression +@subtitle copyright (C) 1996-2000 Julian Seward +@subtitle version 1.0 of 21 March 2000 +@author Julian Seward + +@end titlepage + +@parindent 0mm +@parskip 2mm + +@end iftex +@node Top, Overview, (dir), (dir) + +This program, @code{bzip2}, +and associated library @code{libbzip2}, are +Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +@itemize @bullet +@item + Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +@item + The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. +@item + Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. +@item + The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. +@end itemize +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS +OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Julian Seward, Cambridge, UK. + +@code{jseward@@acm.org} + +@code{http://sourceware.cygnus.com/bzip2} + +@code{http://www.cacheprof.org} + +@code{http://www.muraroa.demon.co.uk} + +@code{bzip2}/@code{libbzip2} version 1.0 of 21 March 2000. + +PATENTS: To the best of my knowledge, @code{bzip2} does not use any patented +algorithms. However, I do not have the resources available to carry out +a full patent search. Therefore I cannot give any guarantee of the +above statement. + + + + + + + +@node Overview, Implementation, Top, Top +@chapter Introduction + +@code{bzip2} compresses files using the Burrows-Wheeler +block-sorting text compression algorithm, and Huffman coding. +Compression is generally considerably better than that +achieved by more conventional LZ77/LZ78-based compressors, +and approaches the performance of the PPM family of statistical compressors. + +@code{bzip2} is built on top of @code{libbzip2}, a flexible library +for handling compressed data in the @code{bzip2} format. This manual +describes both how to use the program and +how to work with the library interface. Most of the +manual is devoted to this library, not the program, +which is good news if your interest is only in the program. + +Chapter 2 describes how to use @code{bzip2}; this is the only part +you need to read if you just want to know how to operate the program. +Chapter 3 describes the programming interfaces in detail, and +Chapter 4 records some miscellaneous notes which I thought +ought to be recorded somewhere. + + +@chapter How to use @code{bzip2} + +This chapter contains a copy of the @code{bzip2} man page, +and nothing else. + +@quotation + +@unnumberedsubsubsec NAME +@itemize +@item @code{bzip2}, @code{bunzip2} +- a block-sorting file compressor, v1.0 +@item @code{bzcat} +- decompresses files to stdout +@item @code{bzip2recover} +- recovers data from damaged bzip2 files +@end itemize + +@unnumberedsubsubsec SYNOPSIS +@itemize +@item @code{bzip2} [ -cdfkqstvzVL123456789 ] [ filenames ... ] +@item @code{bunzip2} [ -fkvsVL ] [ filenames ... ] +@item @code{bzcat} [ -s ] [ filenames ... ] +@item @code{bzip2recover} filename +@end itemize + +@unnumberedsubsubsec DESCRIPTION + +@code{bzip2} compresses files using the Burrows-Wheeler block sorting +text compression algorithm, and Huffman coding. Compression is +generally considerably better than that achieved by more conventional +LZ77/LZ78-based compressors, and approaches the performance of the PPM +family of statistical compressors. + +The command-line options are deliberately very similar to those of GNU +@code{gzip}, but they are not identical. + +@code{bzip2} expects a list of file names to accompany the command-line +flags. Each file is replaced by a compressed version of itself, with +the name @code{original_name.bz2}. Each compressed file has the same +modification date, permissions, and, when possible, ownership as the +corresponding original, so that these properties can be correctly +restored at decompression time. File name handling is naive in the +sense that there is no mechanism for preserving original file names, +permissions, ownerships or dates in filesystems which lack these +concepts, or have serious file name length restrictions, such as MS-DOS. + +@code{bzip2} and @code{bunzip2} will by default not overwrite existing +files. If you want this to happen, specify the @code{-f} flag. + +If no file names are specified, @code{bzip2} compresses from standard +input to standard output. In this case, @code{bzip2} will decline to +write compressed output to a terminal, as this would be entirely +incomprehensible and therefore pointless. + +@code{bunzip2} (or @code{bzip2 -d}) decompresses all +specified files. Files which were not created by @code{bzip2} +will be detected and ignored, and a warning issued. +@code{bzip2} attempts to guess the filename for the decompressed file +from that of the compressed file as follows: +@itemize +@item @code{filename.bz2 } becomes @code{filename} +@item @code{filename.bz } becomes @code{filename} +@item @code{filename.tbz2} becomes @code{filename.tar} +@item @code{filename.tbz } becomes @code{filename.tar} +@item @code{anyothername } becomes @code{anyothername.out} +@end itemize +If the file does not end in one of the recognised endings, +@code{.bz2}, @code{.bz}, +@code{.tbz2} or @code{.tbz}, @code{bzip2} complains that it cannot +guess the name of the original file, and uses the original name +with @code{.out} appended. + +As with compression, supplying no +filenames causes decompression from standard input to standard output. + +@code{bunzip2} will correctly decompress a file which is the +concatenation of two or more compressed files. The result is the +concatenation of the corresponding uncompressed files. Integrity +testing (@code{-t}) of concatenated compressed files is also supported. + +You can also compress or decompress files to the standard output by +giving the @code{-c} flag. Multiple files may be compressed and +decompressed like this. The resulting outputs are fed sequentially to +stdout. Compression of multiple files in this manner generates a stream +containing multiple compressed file representations. Such a stream +can be decompressed correctly only by @code{bzip2} version 0.9.0 or +later. Earlier versions of @code{bzip2} will stop after decompressing +the first file in the stream. + +@code{bzcat} (or @code{bzip2 -dc}) decompresses all specified files to +the standard output. + +@code{bzip2} will read arguments from the environment variables +@code{BZIP2} and @code{BZIP}, in that order, and will process them +before any arguments read from the command line. This gives a +convenient way to supply default arguments. + +Compression is always performed, even if the compressed file is slightly +larger than the original. Files of less than about one hundred bytes +tend to get larger, since the compression mechanism has a constant +overhead in the region of 50 bytes. Random data (including the output +of most file compressors) is coded at about 8.05 bits per byte, giving +an expansion of around 0.5%. + +As a self-check for your protection, @code{bzip2} uses 32-bit CRCs to +make sure that the decompressed version of a file is identical to the +original. This guards against corruption of the compressed data, and +against undetected bugs in @code{bzip2} (hopefully very unlikely). The +chances of data corruption going undetected is microscopic, about one +chance in four billion for each file processed. Be aware, though, that +the check occurs upon decompression, so it can only tell you that +something is wrong. It can't help you recover the original uncompressed +data. You can use @code{bzip2recover} to try to recover data from +damaged files. + +Return values: 0 for a normal exit, 1 for environmental problems (file +not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt +compressed file, 3 for an internal consistency error (eg, bug) which +caused @code{bzip2} to panic. + + +@unnumberedsubsubsec OPTIONS +@table @code +@item -c --stdout +Compress or decompress to standard output. +@item -d --decompress +Force decompression. @code{bzip2}, @code{bunzip2} and @code{bzcat} are +really the same program, and the decision about what actions to take is +done on the basis of which name is used. This flag overrides that +mechanism, and forces bzip2 to decompress. +@item -z --compress +The complement to @code{-d}: forces compression, regardless of the +invokation name. +@item -t --test +Check integrity of the specified file(s), but don't decompress them. +This really performs a trial decompression and throws away the result. +@item -f --force +Force overwrite of output files. Normally, @code{bzip2} will not overwrite +existing output files. Also forces @code{bzip2} to break hard links +to files, which it otherwise wouldn't do. +@item -k --keep +Keep (don't delete) input files during compression +or decompression. +@item -s --small +Reduce memory usage, for compression, decompression and testing. Files +are decompressed and tested using a modified algorithm which only +requires 2.5 bytes per block byte. This means any file can be +decompressed in 2300k of memory, albeit at about half the normal speed. + +During compression, @code{-s} selects a block size of 200k, which limits +memory use to around the same figure, at the expense of your compression +ratio. In short, if your machine is low on memory (8 megabytes or +less), use -s for everything. See MEMORY MANAGEMENT below. +@item -q --quiet +Suppress non-essential warning messages. Messages pertaining to +I/O errors and other critical events will not be suppressed. +@item -v --verbose +Verbose mode -- show the compression ratio for each file processed. +Further @code{-v}'s increase the verbosity level, spewing out lots of +information which is primarily of interest for diagnostic purposes. +@item -L --license -V --version +Display the software version, license terms and conditions. +@item -1 to -9 +Set the block size to 100 k, 200 k .. 900 k when compressing. Has no +effect when decompressing. See MEMORY MANAGEMENT below. +@item -- +Treats all subsequent arguments as file names, even if they start +with a dash. This is so you can handle files with names beginning +with a dash, for example: @code{bzip2 -- -myfilename}. +@item --repetitive-fast +@item --repetitive-best +These flags are redundant in versions 0.9.5 and above. They provided +some coarse control over the behaviour of the sorting algorithm in +earlier versions, which was sometimes useful. 0.9.5 and above have an +improved algorithm which renders these flags irrelevant. +@end table + + +@unnumberedsubsubsec MEMORY MANAGEMENT + +@code{bzip2} compresses large files in blocks. The block size affects +both the compression ratio achieved, and the amount of memory needed for +compression and decompression. The flags @code{-1} through @code{-9} +specify the block size to be 100,000 bytes through 900,000 bytes (the +default) respectively. At decompression time, the block size used for +compression is read from the header of the compressed file, and +@code{bunzip2} then allocates itself just enough memory to decompress +the file. Since block sizes are stored in compressed files, it follows +that the flags @code{-1} to @code{-9} are irrelevant to and so ignored +during decompression. + +Compression and decompression requirements, in bytes, can be estimated +as: +@example + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) +@end example +Larger block sizes give rapidly diminishing marginal returns. Most of +the compression comes from the first two or three hundred k of block +size, a fact worth bearing in mind when using @code{bzip2} on small machines. +It is also important to appreciate that the decompression memory +requirement is set at compression time by the choice of block size. + +For files compressed with the default 900k block size, @code{bunzip2} +will require about 3700 kbytes to decompress. To support decompression +of any file on a 4 megabyte machine, @code{bunzip2} has an option to +decompress using approximately half this amount of memory, about 2300 +kbytes. Decompression speed is also halved, so you should use this +option only where necessary. The relevant flag is @code{-s}. + +In general, try and use the largest block size memory constraints allow, +since that maximises the compression achieved. Compression and +decompression speed are virtually unaffected by block size. + +Another significant point applies to files which fit in a single block +-- that means most files you'd encounter using a large block size. The +amount of real memory touched is proportional to the size of the file, +since the file is smaller than a block. For example, compressing a file +20,000 bytes long with the flag @code{-9} will cause the compressor to +allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560 +kbytes of it. Similarly, the decompressor will allocate 3700k but only +touch 100k + 20000 * 4 = 180 kbytes. + +Here is a table which summarises the maximum memory usage for different +block sizes. Also recorded is the total compressed size for 14 files of +the Calgary Text Compression Corpus totalling 3,141,622 bytes. This +column gives some feel for how compression varies with block size. +These figures tend to understate the advantage of larger block sizes for +larger files, since the Corpus is dominated by smaller files. +@example + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 +@end example + +@unnumberedsubsubsec RECOVERING DATA FROM DAMAGED FILES + +@code{bzip2} compresses files in blocks, usually 900kbytes long. Each +block is handled independently. If a media or transmission error causes +a multi-block @code{.bz2} file to become damaged, it may be possible to +recover data from the undamaged blocks in the file. + +The compressed representation of each block is delimited by a 48-bit +pattern, which makes it possible to find the block boundaries with +reasonable certainty. Each block also carries its own 32-bit CRC, so +damaged blocks can be distinguished from undamaged ones. + +@code{bzip2recover} is a simple program whose purpose is to search for +blocks in @code{.bz2} files, and write each block out into its own +@code{.bz2} file. You can then use @code{bzip2 -t} to test the +integrity of the resulting files, and decompress those which are +undamaged. + +@code{bzip2recover} +takes a single argument, the name of the damaged file, +and writes a number of files @code{rec0001file.bz2}, + @code{rec0002file.bz2}, etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, +@code{bzip2 -dc rec*file.bz2 > recovered_data} -- lists the files in + the correct order. + +@code{bzip2recover} should be of most use dealing with large @code{.bz2} + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to minimise +any potential data loss through media or transmission errors, +you might consider compressing with a smaller + block size. + + +@unnumberedsubsubsec PERFORMANCE NOTES + +The sorting phase of compression gathers together similar strings in the +file. Because of this, files containing very long runs of repeated +symbols, like "aabaabaabaab ..." (repeated several hundred times) may +compress more slowly than normal. Versions 0.9.5 and above fare much +better than previous versions in this respect. The ratio between +worst-case and average-case compression time is in the region of 10:1. +For previous versions, this figure was more like 100:1. You can use the +@code{-vvvv} option to monitor progress in great detail, if you want. + +Decompression speed is unaffected by these phenomena. + +@code{bzip2} usually allocates several megabytes of memory to operate +in, and then charges all over it in a fairly random fashion. This means +that performance, both for compressing and decompressing, is largely +determined by the speed at which your machine can service cache misses. +Because of this, small changes to the code to reduce the miss rate have +been observed to give disproportionately large performance improvements. +I imagine @code{bzip2} will perform best on machines with very large +caches. + + +@unnumberedsubsubsec CAVEATS + +I/O error messages are not as helpful as they could be. @code{bzip2} +tries hard to detect I/O errors and exit cleanly, but the details of +what the problem is sometimes seem rather misleading. + +This manual page pertains to version 1.0 of @code{bzip2}. Compressed +data created by this version is entirely forwards and backwards +compatible with the previous public releases, versions 0.1pl2, 0.9.0 and +0.9.5, but with the following exception: 0.9.0 and above can correctly +decompress multiple concatenated compressed files. 0.1pl2 cannot do +this; it will stop after decompressing just the first file in the +stream. + +@code{bzip2recover} uses 32-bit integers to represent bit positions in +compressed files, so it cannot handle compressed files more than 512 +megabytes long. This could easily be fixed. + + +@unnumberedsubsubsec AUTHOR +Julian Seward, @code{jseward@@acm.org}. + +The ideas embodied in @code{bzip2} are due to (at least) the following +people: Michael Burrows and David Wheeler (for the block sorting +transformation), David Wheeler (again, for the Huffman coder), Peter +Fenwick (for the structured coding model in the original @code{bzip}, +and many refinements), and Alistair Moffat, Radford Neal and Ian Witten +(for the arithmetic coder in the original @code{bzip}). I am much +indebted for their help, support and advice. See the manual in the +source distribution for pointers to sources of documentation. Christian +von Roques encouraged me to look for faster sorting algorithms, so as to +speed up compression. Bela Lubkin encouraged me to improve the +worst-case compression performance. Many people sent patches, helped +with portability problems, lent machines, gave advice and were generally +helpful. + +@end quotation + + + + +@chapter Programming with @code{libbzip2} + +This chapter describes the programming interface to @code{libbzip2}. + +For general background information, particularly about memory +use and performance aspects, you'd be well advised to read Chapter 2 +as well. + +@section Top-level structure + +@code{libbzip2} is a flexible library for compressing and decompressing +data in the @code{bzip2} data format. Although packaged as a single +entity, it helps to regard the library as three separate parts: the low +level interface, and the high level interface, and some utility +functions. + +The structure of @code{libbzip2}'s interfaces is similar to +that of Jean-loup Gailly's and Mark Adler's excellent @code{zlib} +library. + +All externally visible symbols have names beginning @code{BZ2_}. +This is new in version 1.0. The intention is to minimise pollution +of the namespaces of library clients. + +@subsection Low-level summary + +This interface provides services for compressing and decompressing +data in memory. There's no provision for dealing with files, streams +or any other I/O mechanisms, just straight memory-to-memory work. +In fact, this part of the library can be compiled without inclusion +of @code{stdio.h}, which may be helpful for embedded applications. + +The low-level part of the library has no global variables and +is therefore thread-safe. + +Six routines make up the low level interface: +@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, and @* @code{BZ2_bzCompressEnd} +for compression, +and a corresponding trio @code{BZ2_bzDecompressInit}, @* @code{BZ2_bzDecompress} +and @code{BZ2_bzDecompressEnd} for decompression. +The @code{*Init} functions allocate +memory for compression/decompression and do other +initialisations, whilst the @code{*End} functions close down operations +and release memory. + +The real work is done by @code{BZ2_bzCompress} and @code{BZ2_bzDecompress}. +These compress and decompress data from a user-supplied input buffer +to a user-supplied output buffer. These buffers can be any size; +arbitrary quantities of data are handled by making repeated calls +to these functions. This is a flexible mechanism allowing a +consumer-pull style of activity, or producer-push, or a mixture of +both. + + + +@subsection High-level summary + +This interface provides some handy wrappers around the low-level +interface to facilitate reading and writing @code{bzip2} format +files (@code{.bz2} files). The routines provide hooks to facilitate +reading files in which the @code{bzip2} data stream is embedded +within some larger-scale file structure, or where there are +multiple @code{bzip2} data streams concatenated end-to-end. + +For reading files, @code{BZ2_bzReadOpen}, @code{BZ2_bzRead}, +@code{BZ2_bzReadClose} and @* @code{BZ2_bzReadGetUnused} are supplied. For +writing files, @code{BZ2_bzWriteOpen}, @code{BZ2_bzWrite} and +@code{BZ2_bzWriteFinish} are available. + +As with the low-level library, no global variables are used +so the library is per se thread-safe. However, if I/O errors +occur whilst reading or writing the underlying compressed files, +you may have to consult @code{errno} to determine the cause of +the error. In that case, you'd need a C library which correctly +supports @code{errno} in a multithreaded environment. + +To make the library a little simpler and more portable, +@code{BZ2_bzReadOpen} and @code{BZ2_bzWriteOpen} require you to pass them file +handles (@code{FILE*}s) which have previously been opened for reading or +writing respectively. That avoids portability problems associated with +file operations and file attributes, whilst not being much of an +imposition on the programmer. + + + +@subsection Utility functions summary +For very simple needs, @code{BZ2_bzBuffToBuffCompress} and +@code{BZ2_bzBuffToBuffDecompress} are provided. These compress +data in memory from one buffer to another buffer in a single +function call. You should assess whether these functions +fulfill your memory-to-memory compression/decompression +requirements before investing effort in understanding the more +general but more complex low-level interface. + +Yoshioka Tsuneo (@code{QWF00133@@niftyserve.or.jp} / +@code{tsuneo-y@@is.aist-nara.ac.jp}) has contributed some functions to +give better @code{zlib} compatibility. These functions are +@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush}, +@code{BZ2_bzclose}, +@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}. You may find these functions +more convenient for simple file reading and writing, than those in the +high-level interface. These functions are not (yet) officially part of +the library, and are minimally documented here. If they break, you +get to keep all the pieces. I hope to document them properly when time +permits. + +Yoshioka also contributed modifications to allow the library to be +built as a Windows DLL. + + +@section Error handling + +The library is designed to recover cleanly in all situations, including +the worst-case situation of decompressing random data. I'm not +100% sure that it can always do this, so you might want to add +a signal handler to catch segmentation violations during decompression +if you are feeling especially paranoid. I would be interested in +hearing more about the robustness of the library to corrupted +compressed data. + +Version 1.0 is much more robust in this respect than +0.9.0 or 0.9.5. Investigations with Checker (a tool for +detecting problems with memory management, similar to Purify) +indicate that, at least for the few files I tested, all single-bit +errors in the decompressed data are caught properly, with no +segmentation faults, no reads of uninitialised data and no +out of range reads or writes. So it's certainly much improved, +although I wouldn't claim it to be totally bombproof. + +The file @code{bzlib.h} contains all definitions needed to use +the library. In particular, you should definitely not include +@code{bzlib_private.h}. + +In @code{bzlib.h}, the various return values are defined. The following +list is not intended as an exhaustive description of the circumstances +in which a given value may be returned -- those descriptions are given +later. Rather, it is intended to convey the rough meaning of each +return value. The first five actions are normal and not intended to +denote an error situation. +@table @code +@item BZ_OK +The requested action was completed successfully. +@item BZ_RUN_OK +@itemx BZ_FLUSH_OK +@itemx BZ_FINISH_OK +In @code{BZ2_bzCompress}, the requested flush/finish/nothing-special action +was completed successfully. +@item BZ_STREAM_END +Compression of data was completed, or the logical stream end was +detected during decompression. +@end table + +The following return values indicate an error of some kind. +@table @code +@item BZ_CONFIG_ERROR +Indicates that the library has been improperly compiled on your +platform -- a major configuration error. Specifically, it means +that @code{sizeof(char)}, @code{sizeof(short)} and @code{sizeof(int)} +are not 1, 2 and 4 respectively, as they should be. Note that the +library should still work properly on 64-bit platforms which follow +the LP64 programming model -- that is, where @code{sizeof(long)} +and @code{sizeof(void*)} are 8. Under LP64, @code{sizeof(int)} is +still 4, so @code{libbzip2}, which doesn't use the @code{long} type, +is OK. +@item BZ_SEQUENCE_ERROR +When using the library, it is important to call the functions in the +correct sequence and with data structures (buffers etc) in the correct +states. @code{libbzip2} checks as much as it can to ensure this is +happening, and returns @code{BZ_SEQUENCE_ERROR} if not. Code which +complies precisely with the function semantics, as detailed below, +should never receive this value; such an event denotes buggy code +which you should investigate. +@item BZ_PARAM_ERROR +Returned when a parameter to a function call is out of range +or otherwise manifestly incorrect. As with @code{BZ_SEQUENCE_ERROR}, +this denotes a bug in the client code. The distinction between +@code{BZ_PARAM_ERROR} and @code{BZ_SEQUENCE_ERROR} is a bit hazy, but still worth +making. +@item BZ_MEM_ERROR +Returned when a request to allocate memory failed. Note that the +quantity of memory needed to decompress a stream cannot be determined +until the stream's header has been read. So @code{BZ2_bzDecompress} and +@code{BZ2_bzRead} may return @code{BZ_MEM_ERROR} even though some of +the compressed data has been read. The same is not true for +compression; once @code{BZ2_bzCompressInit} or @code{BZ2_bzWriteOpen} have +successfully completed, @code{BZ_MEM_ERROR} cannot occur. +@item BZ_DATA_ERROR +Returned when a data integrity error is detected during decompression. +Most importantly, this means when stored and computed CRCs for the +data do not match. This value is also returned upon detection of any +other anomaly in the compressed data. +@item BZ_DATA_ERROR_MAGIC +As a special case of @code{BZ_DATA_ERROR}, it is sometimes useful to +know when the compressed stream does not start with the correct +magic bytes (@code{'B' 'Z' 'h'}). +@item BZ_IO_ERROR +Returned by @code{BZ2_bzRead} and @code{BZ2_bzWrite} when there is an error +reading or writing in the compressed file, and by @code{BZ2_bzReadOpen} +and @code{BZ2_bzWriteOpen} for attempts to use a file for which the +error indicator (viz, @code{ferror(f)}) is set. +On receipt of @code{BZ_IO_ERROR}, the caller should consult +@code{errno} and/or @code{perror} to acquire operating-system +specific information about the problem. +@item BZ_UNEXPECTED_EOF +Returned by @code{BZ2_bzRead} when the compressed file finishes +before the logical end of stream is detected. +@item BZ_OUTBUFF_FULL +Returned by @code{BZ2_bzBuffToBuffCompress} and +@code{BZ2_bzBuffToBuffDecompress} to indicate that the output data +will not fit into the output buffer provided. +@end table + + + +@section Low-level interface + +@subsection @code{BZ2_bzCompressInit} +@example +typedef + struct @{ + char *next_in; + unsigned int avail_in; + unsigned int total_in_lo32; + unsigned int total_in_hi32; + + char *next_out; + unsigned int avail_out; + unsigned int total_out_lo32; + unsigned int total_out_hi32; + + void *state; + + void *(*bzalloc)(void *,int,int); + void (*bzfree)(void *,void *); + void *opaque; + @} + bz_stream; + +int BZ2_bzCompressInit ( bz_stream *strm, + int blockSize100k, + int verbosity, + int workFactor ); + +@end example + +Prepares for compression. The @code{bz_stream} structure +holds all data pertaining to the compression activity. +A @code{bz_stream} structure should be allocated and initialised +prior to the call. +The fields of @code{bz_stream} +comprise the entirety of the user-visible data. @code{state} +is a pointer to the private data structures required for compression. + +Custom memory allocators are supported, via fields @code{bzalloc}, +@code{bzfree}, +and @code{opaque}. The value +@code{opaque} is passed to as the first argument to +all calls to @code{bzalloc} and @code{bzfree}, but is +otherwise ignored by the library. +The call @code{bzalloc ( opaque, n, m )} is expected to return a +pointer @code{p} to +@code{n * m} bytes of memory, and @code{bzfree ( opaque, p )} +should free +that memory. + +If you don't want to use a custom memory allocator, set @code{bzalloc}, +@code{bzfree} and +@code{opaque} to @code{NULL}, +and the library will then use the standard @code{malloc}/@code{free} +routines. + +Before calling @code{BZ2_bzCompressInit}, fields @code{bzalloc}, +@code{bzfree} and @code{opaque} should +be filled appropriately, as just described. Upon return, the internal +state will have been allocated and initialised, and @code{total_in_lo32}, +@code{total_in_hi32}, @code{total_out_lo32} and +@code{total_out_hi32} will have been set to zero. +These four fields are used by the library +to inform the caller of the total amount of data passed into and out of +the library, respectively. You should not try to change them. +As of version 1.0, 64-bit counts are maintained, even on 32-bit +platforms, using the @code{_hi32} fields to store the upper 32 bits +of the count. So, for example, the total amount of data in +is @code{(total_in_hi32 << 32) + total_in_lo32}. + +Parameter @code{blockSize100k} specifies the block size to be used for +compression. It should be a value between 1 and 9 inclusive, and the +actual block size used is 100000 x this figure. 9 gives the best +compression but takes most memory. + +Parameter @code{verbosity} should be set to a number between 0 and 4 +inclusive. 0 is silent, and greater numbers give increasingly verbose +monitoring/debugging output. If the library has been compiled with +@code{-DBZ_NO_STDIO}, no such output will appear for any verbosity +setting. + +Parameter @code{workFactor} controls how the compression phase behaves +when presented with worst case, highly repetitive, input data. If +compression runs into difficulties caused by repetitive data, the +library switches from the standard sorting algorithm to a fallback +algorithm. The fallback is slower than the standard algorithm by +perhaps a factor of three, but always behaves reasonably, no matter how +bad the input. + +Lower values of @code{workFactor} reduce the amount of effort the +standard algorithm will expend before resorting to the fallback. You +should set this parameter carefully; too low, and many inputs will be +handled by the fallback algorithm and so compress rather slowly, too +high, and your average-to-worst case compression times can become very +large. The default value of 30 gives reasonable behaviour over a wide +range of circumstances. + +Allowable values range from 0 to 250 inclusive. 0 is a special case, +equivalent to using the default value of 30. + +Note that the compressed output generated is the same regardless of +whether or not the fallback algorithm is used. + +Be aware also that this parameter may disappear entirely in future +versions of the library. In principle it should be possible to devise a +good way to automatically choose which algorithm to use. Such a +mechanism would render the parameter obsolete. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL} + or @code{blockSize} < 1 or @code{blockSize} > 9 + or @code{verbosity} < 0 or @code{verbosity} > 4 + or @code{workFactor} < 0 or @code{workFactor} > 250 + @code{BZ_MEM_ERROR} + if not enough memory is available + @code{BZ_OK} + otherwise +@end display +Allowable next actions: +@display + @code{BZ2_bzCompress} + if @code{BZ_OK} is returned + no specific action needed in case of error +@end display + +@subsection @code{BZ2_bzCompress} +@example + int BZ2_bzCompress ( bz_stream *strm, int action ); +@end example +Provides more input and/or output buffer space for the library. The +caller maintains input and output buffers, and calls @code{BZ2_bzCompress} to +transfer data between them. + +Before each call to @code{BZ2_bzCompress}, @code{next_in} should point at +the data to be compressed, and @code{avail_in} should indicate how many +bytes the library may read. @code{BZ2_bzCompress} updates @code{next_in}, +@code{avail_in} and @code{total_in} to reflect the number of bytes it +has read. + +Similarly, @code{next_out} should point to a buffer in which the +compressed data is to be placed, with @code{avail_out} indicating how +much output space is available. @code{BZ2_bzCompress} updates +@code{next_out}, @code{avail_out} and @code{total_out} to reflect the +number of bytes output. + +You may provide and remove as little or as much data as you like on each +call of @code{BZ2_bzCompress}. In the limit, it is acceptable to supply and +remove data one byte at a time, although this would be terribly +inefficient. You should always ensure that at least one byte of output +space is available at each call. + +A second purpose of @code{BZ2_bzCompress} is to request a change of mode of the +compressed stream. + +Conceptually, a compressed stream can be in one of four states: IDLE, +RUNNING, FLUSHING and FINISHING. Before initialisation +(@code{BZ2_bzCompressInit}) and after termination (@code{BZ2_bzCompressEnd}), a +stream is regarded as IDLE. + +Upon initialisation (@code{BZ2_bzCompressInit}), the stream is placed in the +RUNNING state. Subsequent calls to @code{BZ2_bzCompress} should pass +@code{BZ_RUN} as the requested action; other actions are illegal and +will result in @code{BZ_SEQUENCE_ERROR}. + +At some point, the calling program will have provided all the input data +it wants to. It will then want to finish up -- in effect, asking the +library to process any data it might have buffered internally. In this +state, @code{BZ2_bzCompress} will no longer attempt to read data from +@code{next_in}, but it will want to write data to @code{next_out}. +Because the output buffer supplied by the user can be arbitrarily small, +the finishing-up operation cannot necessarily be done with a single call +of @code{BZ2_bzCompress}. + +Instead, the calling program passes @code{BZ_FINISH} as an action to +@code{BZ2_bzCompress}. This changes the stream's state to FINISHING. Any +remaining input (ie, @code{next_in[0 .. avail_in-1]}) is compressed and +transferred to the output buffer. To do this, @code{BZ2_bzCompress} must be +called repeatedly until all the output has been consumed. At that +point, @code{BZ2_bzCompress} returns @code{BZ_STREAM_END}, and the stream's +state is set back to IDLE. @code{BZ2_bzCompressEnd} should then be +called. + +Just to make sure the calling program does not cheat, the library makes +a note of @code{avail_in} at the time of the first call to +@code{BZ2_bzCompress} which has @code{BZ_FINISH} as an action (ie, at the +time the program has announced its intention to not supply any more +input). By comparing this value with that of @code{avail_in} over +subsequent calls to @code{BZ2_bzCompress}, the library can detect any +attempts to slip in more data to compress. Any calls for which this is +detected will return @code{BZ_SEQUENCE_ERROR}. This indicates a +programming mistake which should be corrected. + +Instead of asking to finish, the calling program may ask +@code{BZ2_bzCompress} to take all the remaining input, compress it and +terminate the current (Burrows-Wheeler) compression block. This could +be useful for error control purposes. The mechanism is analogous to +that for finishing: call @code{BZ2_bzCompress} with an action of +@code{BZ_FLUSH}, remove output data, and persist with the +@code{BZ_FLUSH} action until the value @code{BZ_RUN} is returned. As +with finishing, @code{BZ2_bzCompress} detects any attempt to provide more +input data once the flush has begun. + +Once the flush is complete, the stream returns to the normal RUNNING +state. + +This all sounds pretty complex, but isn't really. Here's a table +which shows which actions are allowable in each state, what action +will be taken, what the next state is, and what the non-error return +values are. Note that you can't explicitly ask what state the +stream is in, but nor do you need to -- it can be inferred from the +values returned by @code{BZ2_bzCompress}. +@display +IDLE/@code{any} + Illegal. IDLE state only exists after @code{BZ2_bzCompressEnd} or + before @code{BZ2_bzCompressInit}. + Return value = @code{BZ_SEQUENCE_ERROR} + +RUNNING/@code{BZ_RUN} + Compress from @code{next_in} to @code{next_out} as much as possible. + Next state = RUNNING + Return value = @code{BZ_RUN_OK} + +RUNNING/@code{BZ_FLUSH} + Remember current value of @code{next_in}. Compress from @code{next_in} + to @code{next_out} as much as possible, but do not accept any more input. + Next state = FLUSHING + Return value = @code{BZ_FLUSH_OK} + +RUNNING/@code{BZ_FINISH} + Remember current value of @code{next_in}. Compress from @code{next_in} + to @code{next_out} as much as possible, but do not accept any more input. + Next state = FINISHING + Return value = @code{BZ_FINISH_OK} + +FLUSHING/@code{BZ_FLUSH} + Compress from @code{next_in} to @code{next_out} as much as possible, + but do not accept any more input. + If all the existing input has been used up and all compressed + output has been removed + Next state = RUNNING; Return value = @code{BZ_RUN_OK} + else + Next state = FLUSHING; Return value = @code{BZ_FLUSH_OK} + +FLUSHING/other + Illegal. + Return value = @code{BZ_SEQUENCE_ERROR} + +FINISHING/@code{BZ_FINISH} + Compress from @code{next_in} to @code{next_out} as much as possible, + but to not accept any more input. + If all the existing input has been used up and all compressed + output has been removed + Next state = IDLE; Return value = @code{BZ_STREAM_END} + else + Next state = FINISHING; Return value = @code{BZ_FINISHING} + +FINISHING/other + Illegal. + Return value = @code{BZ_SEQUENCE_ERROR} +@end display + +That still looks complicated? Well, fair enough. The usual sequence +of calls for compressing a load of data is: +@itemize @bullet +@item Get started with @code{BZ2_bzCompressInit}. +@item Shovel data in and shlurp out its compressed form using zero or more +calls of @code{BZ2_bzCompress} with action = @code{BZ_RUN}. +@item Finish up. +Repeatedly call @code{BZ2_bzCompress} with action = @code{BZ_FINISH}, +copying out the compressed output, until @code{BZ_STREAM_END} is returned. +@item Close up and go home. Call @code{BZ2_bzCompressEnd}. +@end itemize +If the data you want to compress fits into your input buffer all +at once, you can skip the calls of @code{BZ2_bzCompress ( ..., BZ_RUN )} and +just do the @code{BZ2_bzCompress ( ..., BZ_FINISH )} calls. + +All required memory is allocated by @code{BZ2_bzCompressInit}. The +compression library can accept any data at all (obviously). So you +shouldn't get any error return values from the @code{BZ2_bzCompress} calls. +If you do, they will be @code{BZ_SEQUENCE_ERROR}, and indicate a bug in +your programming. + +Trivial other possible return values: +@display + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL}, or @code{strm->s} is @code{NULL} +@end display + +@subsection @code{BZ2_bzCompressEnd} +@example +int BZ2_bzCompressEnd ( bz_stream *strm ); +@end example +Releases all memory associated with a compression stream. + +Possible return values: +@display + @code{BZ_PARAM_ERROR} if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL} + @code{BZ_OK} otherwise +@end display + + +@subsection @code{BZ2_bzDecompressInit} +@example +int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small ); +@end example +Prepares for decompression. As with @code{BZ2_bzCompressInit}, a +@code{bz_stream} record should be allocated and initialised before the +call. Fields @code{bzalloc}, @code{bzfree} and @code{opaque} should be +set if a custom memory allocator is required, or made @code{NULL} for +the normal @code{malloc}/@code{free} routines. Upon return, the internal +state will have been initialised, and @code{total_in} and +@code{total_out} will be zero. + +For the meaning of parameter @code{verbosity}, see @code{BZ2_bzCompressInit}. + +If @code{small} is nonzero, the library will use an alternative +decompression algorithm which uses less memory but at the cost of +decompressing more slowly (roughly speaking, half the speed, but the +maximum memory requirement drops to around 2300k). See Chapter 2 for +more information on memory management. + +Note that the amount of memory needed to decompress +a stream cannot be determined until the stream's header has been read, +so even if @code{BZ2_bzDecompressInit} succeeds, a subsequent +@code{BZ2_bzDecompress} could fail with @code{BZ_MEM_ERROR}. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{(small != 0 && small != 1)} + or @code{(verbosity < 0 || verbosity > 4)} + @code{BZ_MEM_ERROR} + if insufficient memory is available +@end display + +Allowable next actions: +@display + @code{BZ2_bzDecompress} + if @code{BZ_OK} was returned + no specific action required in case of error +@end display + + + +@subsection @code{BZ2_bzDecompress} +@example +int BZ2_bzDecompress ( bz_stream *strm ); +@end example +Provides more input and/out output buffer space for the library. The +caller maintains input and output buffers, and uses @code{BZ2_bzDecompress} +to transfer data between them. + +Before each call to @code{BZ2_bzDecompress}, @code{next_in} +should point at the compressed data, +and @code{avail_in} should indicate how many bytes the library +may read. @code{BZ2_bzDecompress} updates @code{next_in}, @code{avail_in} +and @code{total_in} +to reflect the number of bytes it has read. + +Similarly, @code{next_out} should point to a buffer in which the uncompressed +output is to be placed, with @code{avail_out} indicating how much output space +is available. @code{BZ2_bzCompress} updates @code{next_out}, +@code{avail_out} and @code{total_out} to reflect +the number of bytes output. + +You may provide and remove as little or as much data as you like on +each call of @code{BZ2_bzDecompress}. +In the limit, it is acceptable to +supply and remove data one byte at a time, although this would be +terribly inefficient. You should always ensure that at least one +byte of output space is available at each call. + +Use of @code{BZ2_bzDecompress} is simpler than @code{BZ2_bzCompress}. + +You should provide input and remove output as described above, and +repeatedly call @code{BZ2_bzDecompress} until @code{BZ_STREAM_END} is +returned. Appearance of @code{BZ_STREAM_END} denotes that +@code{BZ2_bzDecompress} has detected the logical end of the compressed +stream. @code{BZ2_bzDecompress} will not produce @code{BZ_STREAM_END} until +all output data has been placed into the output buffer, so once +@code{BZ_STREAM_END} appears, you are guaranteed to have available all +the decompressed output, and @code{BZ2_bzDecompressEnd} can safely be +called. + +If case of an error return value, you should call @code{BZ2_bzDecompressEnd} +to clean up and release memory. + +Possible return values: +@display + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL} + or @code{strm->avail_out < 1} + @code{BZ_DATA_ERROR} + if a data integrity error is detected in the compressed stream + @code{BZ_DATA_ERROR_MAGIC} + if the compressed stream doesn't begin with the right magic bytes + @code{BZ_MEM_ERROR} + if there wasn't enough memory available + @code{BZ_STREAM_END} + if the logical end of the data stream was detected and all + output in has been consumed, eg @code{s->avail_out > 0} + @code{BZ_OK} + otherwise +@end display +Allowable next actions: +@display + @code{BZ2_bzDecompress} + if @code{BZ_OK} was returned + @code{BZ2_bzDecompressEnd} + otherwise +@end display + + +@subsection @code{BZ2_bzDecompressEnd} +@example +int BZ2_bzDecompressEnd ( bz_stream *strm ); +@end example +Releases all memory associated with a decompression stream. + +Possible return values: +@display + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL} + @code{BZ_OK} + otherwise +@end display + +Allowable next actions: +@display + None. +@end display + + +@section High-level interface + +This interface provides functions for reading and writing +@code{bzip2} format files. First, some general points. + +@itemize @bullet +@item All of the functions take an @code{int*} first argument, + @code{bzerror}. + After each call, @code{bzerror} should be consulted first to determine + the outcome of the call. If @code{bzerror} is @code{BZ_OK}, + the call completed + successfully, and only then should the return value of the function + (if any) be consulted. If @code{bzerror} is @code{BZ_IO_ERROR}, + there was an error + reading/writing the underlying compressed file, and you should + then consult @code{errno}/@code{perror} to determine the + cause of the difficulty. + @code{bzerror} may also be set to various other values; precise details are + given on a per-function basis below. +@item If @code{bzerror} indicates an error + (ie, anything except @code{BZ_OK} and @code{BZ_STREAM_END}), + you should immediately call @code{BZ2_bzReadClose} (or @code{BZ2_bzWriteClose}, + depending on whether you are attempting to read or to write) + to free up all resources associated + with the stream. Once an error has been indicated, behaviour of all calls + except @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) is undefined. + The implication is that (1) @code{bzerror} should + be checked after each call, and (2) if @code{bzerror} indicates an error, + @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) should then be called to clean up. +@item The @code{FILE*} arguments passed to + @code{BZ2_bzReadOpen}/@code{BZ2_bzWriteOpen} + should be set to binary mode. + Most Unix systems will do this by default, but other platforms, + including Windows and Mac, will not. If you omit this, you may + encounter problems when moving code to new platforms. +@item Memory allocation requests are handled by + @code{malloc}/@code{free}. + At present + there is no facility for user-defined memory allocators in the file I/O + functions (could easily be added, though). +@end itemize + + + +@subsection @code{BZ2_bzReadOpen} +@example + typedef void BZFILE; + + BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f, + int small, int verbosity, + void *unused, int nUnused ); +@end example +Prepare to read compressed data from file handle @code{f}. @code{f} +should refer to a file which has been opened for reading, and for which +the error indicator (@code{ferror(f)})is not set. If @code{small} is 1, +the library will try to decompress using less memory, at the expense of +speed. + +For reasons explained below, @code{BZ2_bzRead} will decompress the +@code{nUnused} bytes starting at @code{unused}, before starting to read +from the file @code{f}. At most @code{BZ_MAX_UNUSED} bytes may be +supplied like this. If this facility is not required, you should pass +@code{NULL} and @code{0} for @code{unused} and n@code{Unused} +respectively. + +For the meaning of parameters @code{small} and @code{verbosity}, +see @code{BZ2_bzDecompressInit}. + +The amount of memory needed to decompress a file cannot be determined +until the file's header has been read. So it is possible that +@code{BZ2_bzReadOpen} returns @code{BZ_OK} but a subsequent call of +@code{BZ2_bzRead} will return @code{BZ_MEM_ERROR}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{f} is @code{NULL} + or @code{small} is neither @code{0} nor @code{1} + or @code{(unused == NULL && nUnused != 0)} + or @code{(unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))} + @code{BZ_IO_ERROR} + if @code{ferror(f)} is nonzero + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OK} + otherwise. +@end display + +Possible return values: +@display + Pointer to an abstract @code{BZFILE} + if @code{bzerror} is @code{BZ_OK} + @code{NULL} + otherwise +@end display + +Allowable next actions: +@display + @code{BZ2_bzRead} + if @code{bzerror} is @code{BZ_OK} + @code{BZ2_bzClose} + otherwise +@end display + + +@subsection @code{BZ2_bzRead} +@example + int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len ); +@end example +Reads up to @code{len} (uncompressed) bytes from the compressed file +@code{b} into +the buffer @code{buf}. If the read was successful, +@code{bzerror} is set to @code{BZ_OK} +and the number of bytes read is returned. If the logical end-of-stream +was detected, @code{bzerror} will be set to @code{BZ_STREAM_END}, +and the number +of bytes read is returned. All other @code{bzerror} values denote an error. + +@code{BZ2_bzRead} will supply @code{len} bytes, +unless the logical stream end is detected +or an error occurs. Because of this, it is possible to detect the +stream end by observing when the number of bytes returned is +less than the number +requested. Nevertheless, this is regarded as inadvisable; you should +instead check @code{bzerror} after every call and watch out for +@code{BZ_STREAM_END}. + +Internally, @code{BZ2_bzRead} copies data from the compressed file in chunks +of size @code{BZ_MAX_UNUSED} bytes +before decompressing it. If the file contains more bytes than strictly +needed to reach the logical end-of-stream, @code{BZ2_bzRead} will almost certainly +read some of the trailing data before signalling @code{BZ_SEQUENCE_END}. +To collect the read but unused data once @code{BZ_SEQUENCE_END} has +appeared, call @code{BZ2_bzReadGetUnused} immediately before @code{BZ2_bzReadClose}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_PARAM_ERROR} + if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0} + @code{BZ_SEQUENCE_ERROR} + if @code{b} was opened with @code{BZ2_bzWriteOpen} + @code{BZ_IO_ERROR} + if there is an error reading from the compressed file + @code{BZ_UNEXPECTED_EOF} + if the compressed file ended before the logical end-of-stream was detected + @code{BZ_DATA_ERROR} + if a data integrity error was detected in the compressed stream + @code{BZ_DATA_ERROR_MAGIC} + if the stream does not begin with the requisite header bytes (ie, is not + a @code{bzip2} data file). This is really a special case of @code{BZ_DATA_ERROR}. + @code{BZ_MEM_ERROR} + if insufficient memory was available + @code{BZ_STREAM_END} + if the logical end of stream was detected. + @code{BZ_OK} + otherwise. +@end display + +Possible return values: +@display + number of bytes read + if @code{bzerror} is @code{BZ_OK} or @code{BZ_STREAM_END} + undefined + otherwise +@end display + +Allowable next actions: +@display + collect data from @code{buf}, then @code{BZ2_bzRead} or @code{BZ2_bzReadClose} + if @code{bzerror} is @code{BZ_OK} + collect data from @code{buf}, then @code{BZ2_bzReadClose} or @code{BZ2_bzReadGetUnused} + if @code{bzerror} is @code{BZ_SEQUENCE_END} + @code{BZ2_bzReadClose} + otherwise +@end display + + + +@subsection @code{BZ2_bzReadGetUnused} +@example + void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b, + void** unused, int* nUnused ); +@end example +Returns data which was read from the compressed file but was not needed +to get to the logical end-of-stream. @code{*unused} is set to the address +of the data, and @code{*nUnused} to the number of bytes. @code{*nUnused} will +be set to a value between @code{0} and @code{BZ_MAX_UNUSED} inclusive. + +This function may only be called once @code{BZ2_bzRead} has signalled +@code{BZ_STREAM_END} but before @code{BZ2_bzReadClose}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_PARAM_ERROR} + if @code{b} is @code{NULL} + or @code{unused} is @code{NULL} or @code{nUnused} is @code{NULL} + @code{BZ_SEQUENCE_ERROR} + if @code{BZ_STREAM_END} has not been signalled + or if @code{b} was opened with @code{BZ2_bzWriteOpen} + @code{BZ_OK} + otherwise +@end display + +Allowable next actions: +@display + @code{BZ2_bzReadClose} +@end display + + +@subsection @code{BZ2_bzReadClose} +@example + void BZ2_bzReadClose ( int *bzerror, BZFILE *b ); +@end example +Releases all memory pertaining to the compressed file @code{b}. +@code{BZ2_bzReadClose} does not call @code{fclose} on the underlying file +handle, so you should do that yourself if appropriate. +@code{BZ2_bzReadClose} should be called to clean up after all error +situations. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_SEQUENCE_ERROR} + if @code{b} was opened with @code{BZ2_bzOpenWrite} + @code{BZ_OK} + otherwise +@end display + +Allowable next actions: +@display + none +@end display + + + +@subsection @code{BZ2_bzWriteOpen} +@example + BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f, + int blockSize100k, int verbosity, + int workFactor ); +@end example +Prepare to write compressed data to file handle @code{f}. +@code{f} should refer to +a file which has been opened for writing, and for which the error +indicator (@code{ferror(f)})is not set. + +For the meaning of parameters @code{blockSize100k}, +@code{verbosity} and @code{workFactor}, see +@* @code{BZ2_bzCompressInit}. + +All required memory is allocated at this stage, so if the call +completes successfully, @code{BZ_MEM_ERROR} cannot be signalled by a +subsequent call to @code{BZ2_bzWrite}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{f} is @code{NULL} + or @code{blockSize100k < 1} or @code{blockSize100k > 9} + @code{BZ_IO_ERROR} + if @code{ferror(f)} is nonzero + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OK} + otherwise +@end display + +Possible return values: +@display + Pointer to an abstract @code{BZFILE} + if @code{bzerror} is @code{BZ_OK} + @code{NULL} + otherwise +@end display + +Allowable next actions: +@display + @code{BZ2_bzWrite} + if @code{bzerror} is @code{BZ_OK} + (you could go directly to @code{BZ2_bzWriteClose}, but this would be pretty pointless) + @code{BZ2_bzWriteClose} + otherwise +@end display + + + +@subsection @code{BZ2_bzWrite} +@example + void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len ); +@end example +Absorbs @code{len} bytes from the buffer @code{buf}, eventually to be +compressed and written to the file. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_PARAM_ERROR} + if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0} + @code{BZ_SEQUENCE_ERROR} + if b was opened with @code{BZ2_bzReadOpen} + @code{BZ_IO_ERROR} + if there is an error writing the compressed file. + @code{BZ_OK} + otherwise +@end display + + + + +@subsection @code{BZ2_bzWriteClose} +@example + void BZ2_bzWriteClose ( int *bzerror, BZFILE* f, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out ); + + void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 ); +@end example + +Compresses and flushes to the compressed file all data so far supplied +by @code{BZ2_bzWrite}. The logical end-of-stream markers are also written, so +subsequent calls to @code{BZ2_bzWrite} are illegal. All memory associated +with the compressed file @code{b} is released. +@code{fflush} is called on the +compressed file, but it is not @code{fclose}'d. + +If @code{BZ2_bzWriteClose} is called to clean up after an error, the only +action is to release the memory. The library records the error codes +issued by previous calls, so this situation will be detected +automatically. There is no attempt to complete the compression +operation, nor to @code{fflush} the compressed file. You can force this +behaviour to happen even in the case of no error, by passing a nonzero +value to @code{abandon}. + +If @code{nbytes_in} is non-null, @code{*nbytes_in} will be set to be the +total volume of uncompressed data handled. Similarly, @code{nbytes_out} +will be set to the total volume of compressed data written. For +compatibility with older versions of the library, @code{BZ2_bzWriteClose} +only yields the lower 32 bits of these counts. Use +@code{BZ2_bzWriteClose64} if you want the full 64 bit counts. These +two functions are otherwise absolutely identical. + + +Possible assignments to @code{bzerror}: +@display + @code{BZ_SEQUENCE_ERROR} + if @code{b} was opened with @code{BZ2_bzReadOpen} + @code{BZ_IO_ERROR} + if there is an error writing the compressed file + @code{BZ_OK} + otherwise +@end display + +@subsection Handling embedded compressed data streams + +The high-level library facilitates use of +@code{bzip2} data streams which form some part of a surrounding, larger +data stream. +@itemize @bullet +@item For writing, the library takes an open file handle, writes +compressed data to it, @code{fflush}es it but does not @code{fclose} it. +The calling application can write its own data before and after the +compressed data stream, using that same file handle. +@item Reading is more complex, and the facilities are not as general +as they could be since generality is hard to reconcile with efficiency. +@code{BZ2_bzRead} reads from the compressed file in blocks of size +@code{BZ_MAX_UNUSED} bytes, and in doing so probably will overshoot +the logical end of compressed stream. +To recover this data once decompression has +ended, call @code{BZ2_bzReadGetUnused} after the last call of @code{BZ2_bzRead} +(the one returning @code{BZ_STREAM_END}) but before calling +@code{BZ2_bzReadClose}. +@end itemize + +This mechanism makes it easy to decompress multiple @code{bzip2} +streams placed end-to-end. As the end of one stream, when @code{BZ2_bzRead} +returns @code{BZ_STREAM_END}, call @code{BZ2_bzReadGetUnused} to collect the +unused data (copy it into your own buffer somewhere). +That data forms the start of the next compressed stream. +To start uncompressing that next stream, call @code{BZ2_bzReadOpen} again, +feeding in the unused data via the @code{unused}/@code{nUnused} +parameters. +Keep doing this until @code{BZ_STREAM_END} return coincides with the +physical end of file (@code{feof(f)}). In this situation +@code{BZ2_bzReadGetUnused} +will of course return no data. + +This should give some feel for how the high-level interface can be used. +If you require extra flexibility, you'll have to bite the bullet and get +to grips with the low-level interface. + +@subsection Standard file-reading/writing code +Here's how you'd write data to a compressed file: +@example @code +FILE* f; +BZFILE* b; +int nBuf; +char buf[ /* whatever size you like */ ]; +int bzerror; +int nWritten; + +f = fopen ( "myfile.bz2", "w" ); +if (!f) @{ + /* handle error */ +@} +b = BZ2_bzWriteOpen ( &bzerror, f, 9 ); +if (bzerror != BZ_OK) @{ + BZ2_bzWriteClose ( b ); + /* handle error */ +@} + +while ( /* condition */ ) @{ + /* get data to write into buf, and set nBuf appropriately */ + nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf ); + if (bzerror == BZ_IO_ERROR) @{ + BZ2_bzWriteClose ( &bzerror, b ); + /* handle error */ + @} +@} + +BZ2_bzWriteClose ( &bzerror, b ); +if (bzerror == BZ_IO_ERROR) @{ + /* handle error */ +@} +@end example +And to read from a compressed file: +@example +FILE* f; +BZFILE* b; +int nBuf; +char buf[ /* whatever size you like */ ]; +int bzerror; +int nWritten; + +f = fopen ( "myfile.bz2", "r" ); +if (!f) @{ + /* handle error */ +@} +b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 ); +if (bzerror != BZ_OK) @{ + BZ2_bzReadClose ( &bzerror, b ); + /* handle error */ +@} + +bzerror = BZ_OK; +while (bzerror == BZ_OK && /* arbitrary other conditions */) @{ + nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ ); + if (bzerror == BZ_OK) @{ + /* do something with buf[0 .. nBuf-1] */ + @} +@} +if (bzerror != BZ_STREAM_END) @{ + BZ2_bzReadClose ( &bzerror, b ); + /* handle error */ +@} else @{ + BZ2_bzReadClose ( &bzerror ); +@} +@end example + + + +@section Utility functions +@subsection @code{BZ2_bzBuffToBuffCompress} +@example + int BZ2_bzBuffToBuffCompress( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor ); +@end example +Attempts to compress the data in @code{source[0 .. sourceLen-1]} +into the destination buffer, @code{dest[0 .. *destLen-1]}. +If the destination buffer is big enough, @code{*destLen} is +set to the size of the compressed data, and @code{BZ_OK} is +returned. If the compressed data won't fit, @code{*destLen} +is unchanged, and @code{BZ_OUTBUFF_FULL} is returned. + +Compression in this manner is a one-shot event, done with a single call +to this function. The resulting compressed data is a complete +@code{bzip2} format data stream. There is no mechanism for making +additional calls to provide extra input data. If you want that kind of +mechanism, use the low-level interface. + +For the meaning of parameters @code{blockSize100k}, @code{verbosity} +and @code{workFactor}, @* see @code{BZ2_bzCompressInit}. + +To guarantee that the compressed data will fit in its buffer, allocate +an output buffer of size 1% larger than the uncompressed data, plus +six hundred extra bytes. + +@code{BZ2_bzBuffToBuffDecompress} will not write data at or +beyond @code{dest[*destLen]}, even in case of buffer overflow. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL} + or @code{blockSize100k < 1} or @code{blockSize100k > 9} + or @code{verbosity < 0} or @code{verbosity > 4} + or @code{workFactor < 0} or @code{workFactor > 250} + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OUTBUFF_FULL} + if the size of the compressed data exceeds @code{*destLen} + @code{BZ_OK} + otherwise +@end display + + + +@subsection @code{BZ2_bzBuffToBuffDecompress} +@example + int BZ2_bzBuffToBuffDecompress ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity ); +@end example +Attempts to decompress the data in @code{source[0 .. sourceLen-1]} +into the destination buffer, @code{dest[0 .. *destLen-1]}. +If the destination buffer is big enough, @code{*destLen} is +set to the size of the uncompressed data, and @code{BZ_OK} is +returned. If the compressed data won't fit, @code{*destLen} +is unchanged, and @code{BZ_OUTBUFF_FULL} is returned. + +@code{source} is assumed to hold a complete @code{bzip2} format +data stream. @* @code{BZ2_bzBuffToBuffDecompress} tries to decompress +the entirety of the stream into the output buffer. + +For the meaning of parameters @code{small} and @code{verbosity}, +see @code{BZ2_bzDecompressInit}. + +Because the compression ratio of the compressed data cannot be known in +advance, there is no easy way to guarantee that the output buffer will +be big enough. You may of course make arrangements in your code to +record the size of the uncompressed data, but such a mechanism is beyond +the scope of this library. + +@code{BZ2_bzBuffToBuffDecompress} will not write data at or +beyond @code{dest[*destLen]}, even in case of buffer overflow. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL} + or @code{small != 0 && small != 1} + or @code{verbosity < 0} or @code{verbosity > 4} + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OUTBUFF_FULL} + if the size of the compressed data exceeds @code{*destLen} + @code{BZ_DATA_ERROR} + if a data integrity error was detected in the compressed data + @code{BZ_DATA_ERROR_MAGIC} + if the compressed data doesn't begin with the right magic bytes + @code{BZ_UNEXPECTED_EOF} + if the compressed data ends unexpectedly + @code{BZ_OK} + otherwise +@end display + + + +@section @code{zlib} compatibility functions +Yoshioka Tsuneo has contributed some functions to +give better @code{zlib} compatibility. These functions are +@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush}, +@code{BZ2_bzclose}, +@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}. +These functions are not (yet) officially part of +the library. If they break, you get to keep all the pieces. +Nevertheless, I think they work ok. +@example +typedef void BZFILE; + +const char * BZ2_bzlibVersion ( void ); +@end example +Returns a string indicating the library version. +@example +BZFILE * BZ2_bzopen ( const char *path, const char *mode ); +BZFILE * BZ2_bzdopen ( int fd, const char *mode ); +@end example +Opens a @code{.bz2} file for reading or writing, using either its name +or a pre-existing file descriptor. +Analogous to @code{fopen} and @code{fdopen}. +@example +int BZ2_bzread ( BZFILE* b, void* buf, int len ); +int BZ2_bzwrite ( BZFILE* b, void* buf, int len ); +@end example +Reads/writes data from/to a previously opened @code{BZFILE}. +Analogous to @code{fread} and @code{fwrite}. +@example +int BZ2_bzflush ( BZFILE* b ); +void BZ2_bzclose ( BZFILE* b ); +@end example +Flushes/closes a @code{BZFILE}. @code{BZ2_bzflush} doesn't actually do +anything. Analogous to @code{fflush} and @code{fclose}. + +@example +const char * BZ2_bzerror ( BZFILE *b, int *errnum ) +@end example +Returns a string describing the more recent error status of +@code{b}, and also sets @code{*errnum} to its numerical value. + + +@section Using the library in a @code{stdio}-free environment + +@subsection Getting rid of @code{stdio} + +In a deeply embedded application, you might want to use just +the memory-to-memory functions. You can do this conveniently +by compiling the library with preprocessor symbol @code{BZ_NO_STDIO} +defined. Doing this gives you a library containing only the following +eight functions: + +@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, @code{BZ2_bzCompressEnd} @* +@code{BZ2_bzDecompressInit}, @code{BZ2_bzDecompress}, @code{BZ2_bzDecompressEnd} @* +@code{BZ2_bzBuffToBuffCompress}, @code{BZ2_bzBuffToBuffDecompress} + +When compiled like this, all functions will ignore @code{verbosity} +settings. + +@subsection Critical error handling +@code{libbzip2} contains a number of internal assertion checks which +should, needless to say, never be activated. Nevertheless, if an +assertion should fail, behaviour depends on whether or not the library +was compiled with @code{BZ_NO_STDIO} set. + +For a normal compile, an assertion failure yields the message +@example + bzip2/libbzip2: internal error number N. + This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000. + Please report it to me at: jseward@@acm.org. If this happened + when you were using some program which uses libbzip2 as a + component, you should also report this bug to the author(s) + of that program. Please make an effort to report this bug; + timely and accurate bug reports eventually lead to higher + quality software. Thanks. Julian Seward, 21 March 2000. +@end example +where @code{N} is some error code number. @code{exit(3)} +is then called. + +For a @code{stdio}-free library, assertion failures result +in a call to a function declared as: +@example + extern void bz_internal_error ( int errcode ); +@end example +The relevant code is passed as a parameter. You should supply +such a function. + +In either case, once an assertion failure has occurred, any +@code{bz_stream} records involved can be regarded as invalid. +You should not attempt to resume normal operation with them. + +You may, of course, change critical error handling to suit +your needs. As I said above, critical errors indicate bugs +in the library and should not occur. All "normal" error +situations are indicated via error return codes from functions, +and can be recovered from. + + +@section Making a Windows DLL +Everything related to Windows has been contributed by Yoshioka Tsuneo +@* (@code{QWF00133@@niftyserve.or.jp} / +@code{tsuneo-y@@is.aist-nara.ac.jp}), so you should send your queries to +him (but perhaps Cc: me, @code{jseward@@acm.org}). + +My vague understanding of what to do is: using Visual C++ 5.0, +open the project file @code{libbz2.dsp}, and build. That's all. + +If you can't +open the project file for some reason, make a new one, naming these files: +@code{blocksort.c}, @code{bzlib.c}, @code{compress.c}, +@code{crctable.c}, @code{decompress.c}, @code{huffman.c}, @* +@code{randtable.c} and @code{libbz2.def}. You will also need +to name the header files @code{bzlib.h} and @code{bzlib_private.h}. + +If you don't use VC++, you may need to define the proprocessor symbol +@code{_WIN32}. + +Finally, @code{dlltest.c} is a sample program using the DLL. It has a +project file, @code{dlltest.dsp}. + +If you just want a makefile for Visual C, have a look at +@code{makefile.msc}. + +Be aware that if you compile @code{bzip2} itself on Win32, you must set +@code{BZ_UNIX} to 0 and @code{BZ_LCCWIN32} to 1, in the file +@code{bzip2.c}, before compiling. Otherwise the resulting binary won't +work correctly. + +I haven't tried any of this stuff myself, but it all looks plausible. + + + +@chapter Miscellanea + +These are just some random thoughts of mine. Your mileage may +vary. + +@section Limitations of the compressed file format +@code{bzip2-1.0}, @code{0.9.5} and @code{0.9.0} +use exactly the same file format as the previous +version, @code{bzip2-0.1}. This decision was made in the interests of +stability. Creating yet another incompatible compressed file format +would create further confusion and disruption for users. + +Nevertheless, this is not a painless decision. Development +work since the release of @code{bzip2-0.1} in August 1997 +has shown complexities in the file format which slow down +decompression and, in retrospect, are unnecessary. These are: +@itemize @bullet +@item The run-length encoder, which is the first of the + compression transformations, is entirely irrelevant. + The original purpose was to protect the sorting algorithm + from the very worst case input: a string of repeated + symbols. But algorithm steps Q6a and Q6b in the original + Burrows-Wheeler technical report (SRC-124) show how + repeats can be handled without difficulty in block + sorting. +@item The randomisation mechanism doesn't really need to be + there. Udi Manber and Gene Myers published a suffix + array construction algorithm a few years back, which + can be employed to sort any block, no matter how + repetitive, in O(N log N) time. Subsequent work by + Kunihiko Sadakane has produced a derivative O(N (log N)^2) + algorithm which usually outperforms the Manber-Myers + algorithm. + + I could have changed to Sadakane's algorithm, but I find + it to be slower than @code{bzip2}'s existing algorithm for + most inputs, and the randomisation mechanism protects + adequately against bad cases. I didn't think it was + a good tradeoff to make. Partly this is due to the fact + that I was not flooded with email complaints about + @code{bzip2-0.1}'s performance on repetitive data, so + perhaps it isn't a problem for real inputs. + + Probably the best long-term solution, + and the one I have incorporated into 0.9.5 and above, + is to use the existing sorting + algorithm initially, and fall back to a O(N (log N)^2) + algorithm if the standard algorithm gets into difficulties. +@item The compressed file format was never designed to be + handled by a library, and I have had to jump though + some hoops to produce an efficient implementation of + decompression. It's a bit hairy. Try passing + @code{decompress.c} through the C preprocessor + and you'll see what I mean. Much of this complexity + could have been avoided if the compressed size of + each block of data was recorded in the data stream. +@item An Adler-32 checksum, rather than a CRC32 checksum, + would be faster to compute. +@end itemize +It would be fair to say that the @code{bzip2} format was frozen +before I properly and fully understood the performance +consequences of doing so. + +Improvements which I was able to incorporate into +0.9.0, despite using the same file format, are: +@itemize @bullet +@item Single array implementation of the inverse BWT. This + significantly speeds up decompression, presumably + because it reduces the number of cache misses. +@item Faster inverse MTF transform for large MTF values. The + new implementation is based on the notion of sliding blocks + of values. +@item @code{bzip2-0.9.0} now reads and writes files with @code{fread} + and @code{fwrite}; version 0.1 used @code{putc} and @code{getc}. + Duh! Well, you live and learn. + +@end itemize +Further ahead, it would be nice +to be able to do random access into files. This will +require some careful design of compressed file formats. + + + +@section Portability issues +After some consideration, I have decided not to use +GNU @code{autoconf} to configure 0.9.5 or 1.0. + +@code{autoconf}, admirable and wonderful though it is, +mainly assists with portability problems between Unix-like +platforms. But @code{bzip2} doesn't have much in the way +of portability problems on Unix; most of the difficulties appear +when porting to the Mac, or to Microsoft's operating systems. +@code{autoconf} doesn't help in those cases, and brings in a +whole load of new complexity. + +Most people should be able to compile the library and program +under Unix straight out-of-the-box, so to speak, especially +if you have a version of GNU C available. + +There are a couple of @code{__inline__} directives in the code. GNU C +(@code{gcc}) should be able to handle them. If you're not using +GNU C, your C compiler shouldn't see them at all. +If your compiler does, for some reason, see them and doesn't +like them, just @code{#define} @code{__inline__} to be @code{/* */}. One +easy way to do this is to compile with the flag @code{-D__inline__=}, +which should be understood by most Unix compilers. + +If you still have difficulties, try compiling with the macro +@code{BZ_STRICT_ANSI} defined. This should enable you to build the +library in a strictly ANSI compliant environment. Building the program +itself like this is dangerous and not supported, since you remove +@code{bzip2}'s checks against compressing directories, symbolic links, +devices, and other not-really-a-file entities. This could cause +filesystem corruption! + +One other thing: if you create a @code{bzip2} binary for public +distribution, please try and link it statically (@code{gcc -s}). This +avoids all sorts of library-version issues that others may encounter +later on. + +If you build @code{bzip2} on Win32, you must set @code{BZ_UNIX} to 0 and +@code{BZ_LCCWIN32} to 1, in the file @code{bzip2.c}, before compiling. +Otherwise the resulting binary won't work correctly. + + + +@section Reporting bugs +I tried pretty hard to make sure @code{bzip2} is +bug free, both by design and by testing. Hopefully +you'll never need to read this section for real. + +Nevertheless, if @code{bzip2} dies with a segmentation +fault, a bus error or an internal assertion failure, it +will ask you to email me a bug report. Experience with +version 0.1 shows that almost all these problems can +be traced to either compiler bugs or hardware problems. +@itemize @bullet +@item +Recompile the program with no optimisation, and see if it +works. And/or try a different compiler. +I heard all sorts of stories about various flavours +of GNU C (and other compilers) generating bad code for +@code{bzip2}, and I've run across two such examples myself. + +2.7.X versions of GNU C are known to generate bad code from +time to time, at high optimisation levels. +If you get problems, try using the flags +@code{-O2} @code{-fomit-frame-pointer} @code{-fno-strength-reduce}. +You should specifically @emph{not} use @code{-funroll-loops}. + +You may notice that the Makefile runs six tests as part of +the build process. If the program passes all of these, it's +a pretty good (but not 100%) indication that the compiler has +done its job correctly. +@item +If @code{bzip2} crashes randomly, and the crashes are not +repeatable, you may have a flaky memory subsystem. @code{bzip2} +really hammers your memory hierarchy, and if it's a bit marginal, +you may get these problems. Ditto if your disk or I/O subsystem +is slowly failing. Yup, this really does happen. + +Try using a different machine of the same type, and see if +you can repeat the problem. +@item This isn't really a bug, but ... If @code{bzip2} tells +you your file is corrupted on decompression, and you +obtained the file via FTP, there is a possibility that you +forgot to tell FTP to do a binary mode transfer. That absolutely +will cause the file to be non-decompressible. You'll have to transfer +it again. +@end itemize + +If you've incorporated @code{libbzip2} into your own program +and are getting problems, please, please, please, check that the +parameters you are passing in calls to the library, are +correct, and in accordance with what the documentation says +is allowable. I have tried to make the library robust against +such problems, but I'm sure I haven't succeeded. + +Finally, if the above comments don't help, you'll have to send +me a bug report. Now, it's just amazing how many people will +send me a bug report saying something like +@display + bzip2 crashed with segmentation fault on my machine +@end display +and absolutely nothing else. Needless to say, a such a report +is @emph{totally, utterly, completely and comprehensively 100% useless; +a waste of your time, my time, and net bandwidth}. +With no details at all, there's no way I can possibly begin +to figure out what the problem is. + +The rules of the game are: facts, facts, facts. Don't omit +them because "oh, they won't be relevant". At the bare +minimum: +@display + Machine type. Operating system version. + Exact version of @code{bzip2} (do @code{bzip2 -V}). + Exact version of the compiler used. + Flags passed to the compiler. +@end display +However, the most important single thing that will help me is +the file that you were trying to compress or decompress at the +time the problem happened. Without that, my ability to do anything +more than speculate about the cause, is limited. + +Please remember that I connect to the Internet with a modem, so +you should contact me before mailing me huge files. + + +@section Did you get the right package? + +@code{bzip2} is a resource hog. It soaks up large amounts of CPU cycles +and memory. Also, it gives very large latencies. In the worst case, you +can feed many megabytes of uncompressed data into the library before +getting any compressed output, so this probably rules out applications +requiring interactive behaviour. + +These aren't faults of my implementation, I hope, but more +an intrinsic property of the Burrows-Wheeler transform (unfortunately). +Maybe this isn't what you want. + +If you want a compressor and/or library which is faster, uses less +memory but gets pretty good compression, and has minimal latency, +consider Jean-loup +Gailly's and Mark Adler's work, @code{zlib-1.1.2} and +@code{gzip-1.2.4}. Look for them at + +@code{http://www.cdrom.com/pub/infozip/zlib} and +@code{http://www.gzip.org} respectively. + +For something faster and lighter still, you might try Markus F X J +Oberhumer's @code{LZO} real-time compression/decompression library, at +@* @code{http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html}. + +If you want to use the @code{bzip2} algorithms to compress small blocks +of data, 64k bytes or smaller, for example on an on-the-fly disk +compressor, you'd be well advised not to use this library. Instead, +I've made a special library tuned for that kind of use. It's part of +@code{e2compr-0.40}, an on-the-fly disk compressor for the Linux +@code{ext2} filesystem. Look at +@code{http://www.netspace.net.au/~reiter/e2compr}. + + + +@section Testing + +A record of the tests I've done. + +First, some data sets: +@itemize @bullet +@item B: a directory containing 6001 files, one for every length in the + range 0 to 6000 bytes. The files contain random lowercase + letters. 18.7 megabytes. +@item H: my home directory tree. Documents, source code, mail files, + compressed data. H contains B, and also a directory of + files designed as boundary cases for the sorting; mostly very + repetitive, nasty files. 565 megabytes. +@item A: directory tree holding various applications built from source: + @code{egcs}, @code{gcc-2.8.1}, KDE, GTK, Octave, etc. + 2200 megabytes. +@end itemize +The tests conducted are as follows. Each test means compressing +(a copy of) each file in the data set, decompressing it and +comparing it against the original. + +First, a bunch of tests with block sizes and internal buffer +sizes set very small, +to detect any problems with the +blocking and buffering mechanisms. +This required modifying the source code so as to try to +break it. +@enumerate +@item Data set H, with + buffer size of 1 byte, and block size of 23 bytes. +@item Data set B, buffer sizes 1 byte, block size 1 byte. +@item As (2) but small-mode decompression. +@item As (2) with block size 2 bytes. +@item As (2) with block size 3 bytes. +@item As (2) with block size 4 bytes. +@item As (2) with block size 5 bytes. +@item As (2) with block size 6 bytes and small-mode decompression. +@item H with buffer size of 1 byte, but normal block + size (up to 900000 bytes). +@end enumerate +Then some tests with unmodified source code. +@enumerate +@item H, all settings normal. +@item As (1), with small-mode decompress. +@item H, compress with flag @code{-1}. +@item H, compress with flag @code{-s}, decompress with flag @code{-s}. +@item Forwards compatibility: H, @code{bzip2-0.1pl2} compressing, + @code{bzip2-0.9.5} decompressing, all settings normal. +@item Backwards compatibility: H, @code{bzip2-0.9.5} compressing, + @code{bzip2-0.1pl2} decompressing, all settings normal. +@item Bigger tests: A, all settings normal. +@item As (7), using the fallback (Sadakane-like) sorting algorithm. +@item As (8), compress with flag @code{-1}, decompress with flag + @code{-s}. +@item H, using the fallback sorting algorithm. +@item Forwards compatibility: A, @code{bzip2-0.1pl2} compressing, + @code{bzip2-0.9.5} decompressing, all settings normal. +@item Backwards compatibility: A, @code{bzip2-0.9.5} compressing, + @code{bzip2-0.1pl2} decompressing, all settings normal. +@item Misc test: about 400 megabytes of @code{.tar} files with + @code{bzip2} compiled with Checker (a memory access error + detector, like Purify). +@item Misc tests to make sure it builds and runs ok on non-Linux/x86 + platforms. +@end enumerate +These tests were conducted on a 225 MHz IDT WinChip machine, running +Linux 2.0.36. They represent nearly a week of continuous computation. +All tests completed successfully. + + +@section Further reading +@code{bzip2} is not research work, in the sense that it doesn't present +any new ideas. Rather, it's an engineering exercise based on existing +ideas. + +Four documents describe essentially all the ideas behind @code{bzip2}: +@example +Michael Burrows and D. J. Wheeler: + "A block-sorting lossless data compression algorithm" + 10th May 1994. + Digital SRC Research Report 124. + ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz + If you have trouble finding it, try searching at the + New Zealand Digital Library, http://www.nzdl.org. + +Daniel S. Hirschberg and Debra A. LeLewer + "Efficient Decoding of Prefix Codes" + Communications of the ACM, April 1990, Vol 33, Number 4. + You might be able to get an electronic copy of this + from the ACM Digital Library. + +David J. Wheeler + Program bred3.c and accompanying document bred3.ps. + This contains the idea behind the multi-table Huffman + coding scheme. + ftp://ftp.cl.cam.ac.uk/users/djw3/ + +Jon L. Bentley and Robert Sedgewick + "Fast Algorithms for Sorting and Searching Strings" + Available from Sedgewick's web page, + www.cs.princeton.edu/~rs +@end example +The following paper gives valuable additional insights into the +algorithm, but is not immediately the basis of any code +used in bzip2. +@example +Peter Fenwick: + Block Sorting Text Compression + Proceedings of the 19th Australasian Computer Science Conference, + Melbourne, Australia. Jan 31 - Feb 2, 1996. + ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps +@end example +Kunihiko Sadakane's sorting algorithm, mentioned above, +is available from: +@example +http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz +@end example +The Manber-Myers suffix array construction +algorithm is described in a paper +available from: +@example +http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps +@end example +Finally, the following paper documents some recent investigations +I made into the performance of sorting algorithms: +@example +Julian Seward: + On the Performance of BWT Sorting Algorithms + Proceedings of the IEEE Data Compression Conference 2000 + Snowbird, Utah. 28-30 March 2000. +@end example + + +@contents + +@bye + diff --git a/bzip2/manual_1.html b/bzip2/manual_1.html new file mode 100644 index 0000000..92ba7c6 --- /dev/null +++ b/bzip2/manual_1.html @@ -0,0 +1,47 @@ + + + + +bzip2 and libbzip2 - Introduction + + + + + +

Go to the first, previous, next, last section, table of contents. +


+ + +

Introduction

+ +

+bzip2 compresses files using the Burrows-Wheeler +block-sorting text compression algorithm, and Huffman coding. +Compression is generally considerably better than that +achieved by more conventional LZ77/LZ78-based compressors, +and approaches the performance of the PPM family of statistical compressors. + +

+

+bzip2 is built on top of libbzip2, a flexible library +for handling compressed data in the bzip2 format. This manual +describes both how to use the program and +how to work with the library interface. Most of the +manual is devoted to this library, not the program, +which is good news if your interest is only in the program. + +

+

+Chapter 2 describes how to use bzip2; this is the only part +you need to read if you just want to know how to operate the program. +Chapter 3 describes the programming interfaces in detail, and +Chapter 4 records some miscellaneous notes which I thought +ought to be recorded somewhere. + +

+ +


+

Go to the first, previous, next, last section, table of contents. + + diff --git a/bzip2/manual_2.html b/bzip2/manual_2.html new file mode 100644 index 0000000..39453c4 --- /dev/null +++ b/bzip2/manual_2.html @@ -0,0 +1,484 @@ + + + + +bzip2 and libbzip2 - How to use bzip2 + + + + + + +

Go to the first, previous, next, last section, table of contents. +


+ + +

How to use bzip2

+ +

+This chapter contains a copy of the bzip2 man page, +and nothing else. + +

+ +
+ + + +

NAME

+ +
    +
  • bzip2, bunzip2 + +- a block-sorting file compressor, v1.0 +
  • bzcat + +- decompresses files to stdout +
  • bzip2recover + +- recovers data from damaged bzip2 files +
+ + + +

SYNOPSIS

+ +
    +
  • bzip2 [ -cdfkqstvzVL123456789 ] [ filenames ... ] + +
  • bunzip2 [ -fkvsVL ] [ filenames ... ] + +
  • bzcat [ -s ] [ filenames ... ] + +
  • bzip2recover filename + +
+ + + +

DESCRIPTION

+ +

+bzip2 compresses files using the Burrows-Wheeler block sorting +text compression algorithm, and Huffman coding. Compression is +generally considerably better than that achieved by more conventional +LZ77/LZ78-based compressors, and approaches the performance of the PPM +family of statistical compressors. + +

+

+The command-line options are deliberately very similar to those of GNU +gzip, but they are not identical. + +

+

+bzip2 expects a list of file names to accompany the command-line +flags. Each file is replaced by a compressed version of itself, with +the name original_name.bz2. Each compressed file has the same +modification date, permissions, and, when possible, ownership as the +corresponding original, so that these properties can be correctly +restored at decompression time. File name handling is naive in the +sense that there is no mechanism for preserving original file names, +permissions, ownerships or dates in filesystems which lack these +concepts, or have serious file name length restrictions, such as MS-DOS. + +

+

+bzip2 and bunzip2 will by default not overwrite existing +files. If you want this to happen, specify the -f flag. + +

+

+If no file names are specified, bzip2 compresses from standard +input to standard output. In this case, bzip2 will decline to +write compressed output to a terminal, as this would be entirely +incomprehensible and therefore pointless. + +

+

+bunzip2 (or bzip2 -d) decompresses all +specified files. Files which were not created by bzip2 +will be detected and ignored, and a warning issued. +bzip2 attempts to guess the filename for the decompressed file +from that of the compressed file as follows: + +

    +
  • filename.bz2 becomes filename + +
  • filename.bz becomes filename + +
  • filename.tbz2 becomes filename.tar + +
  • filename.tbz becomes filename.tar + +
  • anyothername becomes anyothername.out + +
+ +

+If the file does not end in one of the recognised endings, +.bz2, .bz, +.tbz2 or .tbz, bzip2 complains that it cannot +guess the name of the original file, and uses the original name +with .out appended. + +

+

+As with compression, supplying no +filenames causes decompression from standard input to standard output. + +

+

+bunzip2 will correctly decompress a file which is the +concatenation of two or more compressed files. The result is the +concatenation of the corresponding uncompressed files. Integrity +testing (-t) of concatenated compressed files is also supported. + +

+

+You can also compress or decompress files to the standard output by +giving the -c flag. Multiple files may be compressed and +decompressed like this. The resulting outputs are fed sequentially to +stdout. Compression of multiple files in this manner generates a stream +containing multiple compressed file representations. Such a stream +can be decompressed correctly only by bzip2 version 0.9.0 or +later. Earlier versions of bzip2 will stop after decompressing +the first file in the stream. + +

+

+bzcat (or bzip2 -dc) decompresses all specified files to +the standard output. + +

+

+bzip2 will read arguments from the environment variables +BZIP2 and BZIP, in that order, and will process them +before any arguments read from the command line. This gives a +convenient way to supply default arguments. + +

+

+Compression is always performed, even if the compressed file is slightly +larger than the original. Files of less than about one hundred bytes +tend to get larger, since the compression mechanism has a constant +overhead in the region of 50 bytes. Random data (including the output +of most file compressors) is coded at about 8.05 bits per byte, giving +an expansion of around 0.5%. + +

+

+As a self-check for your protection, bzip2 uses 32-bit CRCs to +make sure that the decompressed version of a file is identical to the +original. This guards against corruption of the compressed data, and +against undetected bugs in bzip2 (hopefully very unlikely). The +chances of data corruption going undetected is microscopic, about one +chance in four billion for each file processed. Be aware, though, that +the check occurs upon decompression, so it can only tell you that +something is wrong. It can't help you recover the original uncompressed +data. You can use bzip2recover to try to recover data from +damaged files. + +

+

+Return values: 0 for a normal exit, 1 for environmental problems (file +not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt +compressed file, 3 for an internal consistency error (eg, bug) which +caused bzip2 to panic. + +

+ + + +

OPTIONS

+
+ +
-c --stdout +
+Compress or decompress to standard output. +
-d --decompress +
+Force decompression. bzip2, bunzip2 and bzcat are +really the same program, and the decision about what actions to take is +done on the basis of which name is used. This flag overrides that +mechanism, and forces bzip2 to decompress. +
-z --compress +
+The complement to -d: forces compression, regardless of the +invokation name. +
-t --test +
+Check integrity of the specified file(s), but don't decompress them. +This really performs a trial decompression and throws away the result. +
-f --force +
+Force overwrite of output files. Normally, bzip2 will not overwrite +existing output files. Also forces bzip2 to break hard links +to files, which it otherwise wouldn't do. +
-k --keep +
+Keep (don't delete) input files during compression +or decompression. +
-s --small +
+Reduce memory usage, for compression, decompression and testing. Files +are decompressed and tested using a modified algorithm which only +requires 2.5 bytes per block byte. This means any file can be +decompressed in 2300k of memory, albeit at about half the normal speed. + +During compression, -s selects a block size of 200k, which limits +memory use to around the same figure, at the expense of your compression +ratio. In short, if your machine is low on memory (8 megabytes or +less), use -s for everything. See MEMORY MANAGEMENT below. +
-q --quiet +
+Suppress non-essential warning messages. Messages pertaining to +I/O errors and other critical events will not be suppressed. +
-v --verbose +
+Verbose mode -- show the compression ratio for each file processed. +Further -v's increase the verbosity level, spewing out lots of +information which is primarily of interest for diagnostic purposes. +
-L --license -V --version +
+Display the software version, license terms and conditions. +
-1 to -9 +
+Set the block size to 100 k, 200 k .. 900 k when compressing. Has no +effect when decompressing. See MEMORY MANAGEMENT below. +
-- +
+Treats all subsequent arguments as file names, even if they start +with a dash. This is so you can handle files with names beginning +with a dash, for example: bzip2 -- -myfilename. +
--repetitive-fast +
+
--repetitive-best +
+These flags are redundant in versions 0.9.5 and above. They provided +some coarse control over the behaviour of the sorting algorithm in +earlier versions, which was sometimes useful. 0.9.5 and above have an +improved algorithm which renders these flags irrelevant. +
+ + + +

MEMORY MANAGEMENT

+ +

+bzip2 compresses large files in blocks. The block size affects +both the compression ratio achieved, and the amount of memory needed for +compression and decompression. The flags -1 through -9 +specify the block size to be 100,000 bytes through 900,000 bytes (the +default) respectively. At decompression time, the block size used for +compression is read from the header of the compressed file, and +bunzip2 then allocates itself just enough memory to decompress +the file. Since block sizes are stored in compressed files, it follows +that the flags -1 to -9 are irrelevant to and so ignored +during decompression. + +

+

+Compression and decompression requirements, in bytes, can be estimated +as: + +

+     Compression:   400k + ( 8 x block size )
+
+     Decompression: 100k + ( 4 x block size ), or
+                    100k + ( 2.5 x block size )
+
+ +

+Larger block sizes give rapidly diminishing marginal returns. Most of +the compression comes from the first two or three hundred k of block +size, a fact worth bearing in mind when using bzip2 on small machines. +It is also important to appreciate that the decompression memory +requirement is set at compression time by the choice of block size. + +

+

+For files compressed with the default 900k block size, bunzip2 +will require about 3700 kbytes to decompress. To support decompression +of any file on a 4 megabyte machine, bunzip2 has an option to +decompress using approximately half this amount of memory, about 2300 +kbytes. Decompression speed is also halved, so you should use this +option only where necessary. The relevant flag is -s. + +

+

+In general, try and use the largest block size memory constraints allow, +since that maximises the compression achieved. Compression and +decompression speed are virtually unaffected by block size. + +

+

+Another significant point applies to files which fit in a single block +-- that means most files you'd encounter using a large block size. The +amount of real memory touched is proportional to the size of the file, +since the file is smaller than a block. For example, compressing a file +20,000 bytes long with the flag -9 will cause the compressor to +allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560 +kbytes of it. Similarly, the decompressor will allocate 3700k but only +touch 100k + 20000 * 4 = 180 kbytes. + +

+

+Here is a table which summarises the maximum memory usage for different +block sizes. Also recorded is the total compressed size for 14 files of +the Calgary Text Compression Corpus totalling 3,141,622 bytes. This +column gives some feel for how compression varies with block size. +These figures tend to understate the advantage of larger block sizes for +larger files, since the Corpus is dominated by smaller files. + +

+          Compress   Decompress   Decompress   Corpus
+   Flag     usage      usage       -s usage     Size
+
+    -1      1200k       500k         350k      914704
+    -2      2000k       900k         600k      877703
+    -3      2800k      1300k         850k      860338
+    -4      3600k      1700k        1100k      846899
+    -5      4400k      2100k        1350k      845160
+    -6      5200k      2500k        1600k      838626
+    -7      6100k      2900k        1850k      834096
+    -8      6800k      3300k        2100k      828642
+    -9      7600k      3700k        2350k      828642
+
+ + + +

RECOVERING DATA FROM DAMAGED FILES

+ +

+bzip2 compresses files in blocks, usually 900kbytes long. Each +block is handled independently. If a media or transmission error causes +a multi-block .bz2 file to become damaged, it may be possible to +recover data from the undamaged blocks in the file. + +

+

+The compressed representation of each block is delimited by a 48-bit +pattern, which makes it possible to find the block boundaries with +reasonable certainty. Each block also carries its own 32-bit CRC, so +damaged blocks can be distinguished from undamaged ones. + +

+

+bzip2recover is a simple program whose purpose is to search for +blocks in .bz2 files, and write each block out into its own +.bz2 file. You can then use bzip2 -t to test the +integrity of the resulting files, and decompress those which are +undamaged. + +

+

+bzip2recover +takes a single argument, the name of the damaged file, +and writes a number of files rec0001file.bz2, + rec0002file.bz2, etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, +bzip2 -dc rec*file.bz2 > recovered_data -- lists the files in + the correct order. + +

+

+bzip2recover should be of most use dealing with large .bz2 + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to minimise +any potential data loss through media or transmission errors, +you might consider compressing with a smaller + block size. + +

+ + + +

PERFORMANCE NOTES

+ +

+The sorting phase of compression gathers together similar strings in the +file. Because of this, files containing very long runs of repeated +symbols, like "aabaabaabaab ..." (repeated several hundred times) may +compress more slowly than normal. Versions 0.9.5 and above fare much +better than previous versions in this respect. The ratio between +worst-case and average-case compression time is in the region of 10:1. +For previous versions, this figure was more like 100:1. You can use the +-vvvv option to monitor progress in great detail, if you want. + +

+

+Decompression speed is unaffected by these phenomena. + +

+

+bzip2 usually allocates several megabytes of memory to operate +in, and then charges all over it in a fairly random fashion. This means +that performance, both for compressing and decompressing, is largely +determined by the speed at which your machine can service cache misses. +Because of this, small changes to the code to reduce the miss rate have +been observed to give disproportionately large performance improvements. +I imagine bzip2 will perform best on machines with very large +caches. + +

+ + + +

CAVEATS

+ +

+I/O error messages are not as helpful as they could be. bzip2 +tries hard to detect I/O errors and exit cleanly, but the details of +what the problem is sometimes seem rather misleading. + +

+

+This manual page pertains to version 1.0 of bzip2. Compressed +data created by this version is entirely forwards and backwards +compatible with the previous public releases, versions 0.1pl2, 0.9.0 and +0.9.5, but with the following exception: 0.9.0 and above can correctly +decompress multiple concatenated compressed files. 0.1pl2 cannot do +this; it will stop after decompressing just the first file in the +stream. + +

+

+bzip2recover uses 32-bit integers to represent bit positions in +compressed files, so it cannot handle compressed files more than 512 +megabytes long. This could easily be fixed. + +

+ + + +

AUTHOR

+

+Julian Seward, jseward@acm.org. + +

+

+The ideas embodied in bzip2 are due to (at least) the following +people: Michael Burrows and David Wheeler (for the block sorting +transformation), David Wheeler (again, for the Huffman coder), Peter +Fenwick (for the structured coding model in the original bzip, +and many refinements), and Alistair Moffat, Radford Neal and Ian Witten +(for the arithmetic coder in the original bzip). I am much +indebted for their help, support and advice. See the manual in the +source distribution for pointers to sources of documentation. Christian +von Roques encouraged me to look for faster sorting algorithms, so as to +speed up compression. Bela Lubkin encouraged me to improve the +worst-case compression performance. Many people sent patches, helped +with portability problems, lent machines, gave advice and were generally +helpful. + +

+
+ +


+

Go to the first, previous, next, last section, table of contents. + + diff --git a/bzip2/manual_3.html b/bzip2/manual_3.html new file mode 100644 index 0000000..a8fa7e6 --- /dev/null +++ b/bzip2/manual_3.html @@ -0,0 +1,1773 @@ + + + + +bzip2 and libbzip2 - Programming with libbzip2 + + + + + + +

Go to the first, previous, next, last section, table of contents. +


+ + +

Programming with libbzip2

+ +

+This chapter describes the programming interface to libbzip2. + +

+

+For general background information, particularly about memory +use and performance aspects, you'd be well advised to read Chapter 2 +as well. + +

+ + +

Top-level structure

+ +

+libbzip2 is a flexible library for compressing and decompressing +data in the bzip2 data format. Although packaged as a single +entity, it helps to regard the library as three separate parts: the low +level interface, and the high level interface, and some utility +functions. + +

+

+The structure of libbzip2's interfaces is similar to +that of Jean-loup Gailly's and Mark Adler's excellent zlib +library. + +

+

+All externally visible symbols have names beginning BZ2_. +This is new in version 1.0. The intention is to minimise pollution +of the namespaces of library clients. + +

+ + +

Low-level summary

+ +

+This interface provides services for compressing and decompressing +data in memory. There's no provision for dealing with files, streams +or any other I/O mechanisms, just straight memory-to-memory work. +In fact, this part of the library can be compiled without inclusion +of stdio.h, which may be helpful for embedded applications. + +

+

+The low-level part of the library has no global variables and +is therefore thread-safe. + +

+

+Six routines make up the low level interface: +BZ2_bzCompressInit, BZ2_bzCompress, and
BZ2_bzCompressEnd +for compression, +and a corresponding trio BZ2_bzDecompressInit,
BZ2_bzDecompress +and BZ2_bzDecompressEnd for decompression. +The *Init functions allocate +memory for compression/decompression and do other +initialisations, whilst the *End functions close down operations +and release memory. + +

+

+The real work is done by BZ2_bzCompress and BZ2_bzDecompress. +These compress and decompress data from a user-supplied input buffer +to a user-supplied output buffer. These buffers can be any size; +arbitrary quantities of data are handled by making repeated calls +to these functions. This is a flexible mechanism allowing a +consumer-pull style of activity, or producer-push, or a mixture of +both. + +

+ + + +

High-level summary

+ +

+This interface provides some handy wrappers around the low-level +interface to facilitate reading and writing bzip2 format +files (.bz2 files). The routines provide hooks to facilitate +reading files in which the bzip2 data stream is embedded +within some larger-scale file structure, or where there are +multiple bzip2 data streams concatenated end-to-end. + +

+

+For reading files, BZ2_bzReadOpen, BZ2_bzRead, +BZ2_bzReadClose and
BZ2_bzReadGetUnused are supplied. For +writing files, BZ2_bzWriteOpen, BZ2_bzWrite and +BZ2_bzWriteFinish are available. + +

+

+As with the low-level library, no global variables are used +so the library is per se thread-safe. However, if I/O errors +occur whilst reading or writing the underlying compressed files, +you may have to consult errno to determine the cause of +the error. In that case, you'd need a C library which correctly +supports errno in a multithreaded environment. + +

+

+To make the library a little simpler and more portable, +BZ2_bzReadOpen and BZ2_bzWriteOpen require you to pass them file +handles (FILE*s) which have previously been opened for reading or +writing respectively. That avoids portability problems associated with +file operations and file attributes, whilst not being much of an +imposition on the programmer. + +

+ + + +

Utility functions summary

+

+For very simple needs, BZ2_bzBuffToBuffCompress and +BZ2_bzBuffToBuffDecompress are provided. These compress +data in memory from one buffer to another buffer in a single +function call. You should assess whether these functions +fulfill your memory-to-memory compression/decompression +requirements before investing effort in understanding the more +general but more complex low-level interface. + +

+

+Yoshioka Tsuneo (QWF00133@niftyserve.or.jp / +tsuneo-y@is.aist-nara.ac.jp) has contributed some functions to +give better zlib compatibility. These functions are +BZ2_bzopen, BZ2_bzread, BZ2_bzwrite, BZ2_bzflush, +BZ2_bzclose, +BZ2_bzerror and BZ2_bzlibVersion. You may find these functions +more convenient for simple file reading and writing, than those in the +high-level interface. These functions are not (yet) officially part of +the library, and are minimally documented here. If they break, you +get to keep all the pieces. I hope to document them properly when time +permits. + +

+

+Yoshioka also contributed modifications to allow the library to be +built as a Windows DLL. + +

+ + + +

Error handling

+ +

+The library is designed to recover cleanly in all situations, including +the worst-case situation of decompressing random data. I'm not +100% sure that it can always do this, so you might want to add +a signal handler to catch segmentation violations during decompression +if you are feeling especially paranoid. I would be interested in +hearing more about the robustness of the library to corrupted +compressed data. + +

+

+Version 1.0 is much more robust in this respect than +0.9.0 or 0.9.5. Investigations with Checker (a tool for +detecting problems with memory management, similar to Purify) +indicate that, at least for the few files I tested, all single-bit +errors in the decompressed data are caught properly, with no +segmentation faults, no reads of uninitialised data and no +out of range reads or writes. So it's certainly much improved, +although I wouldn't claim it to be totally bombproof. + +

+

+The file bzlib.h contains all definitions needed to use +the library. In particular, you should definitely not include +bzlib_private.h. + +

+

+In bzlib.h, the various return values are defined. The following +list is not intended as an exhaustive description of the circumstances +in which a given value may be returned -- those descriptions are given +later. Rather, it is intended to convey the rough meaning of each +return value. The first five actions are normal and not intended to +denote an error situation. +

+ +
BZ_OK +
+The requested action was completed successfully. +
BZ_RUN_OK +
+
BZ_FLUSH_OK +
+
BZ_FINISH_OK +
+In BZ2_bzCompress, the requested flush/finish/nothing-special action +was completed successfully. +
BZ_STREAM_END +
+Compression of data was completed, or the logical stream end was +detected during decompression. +
+ +

+The following return values indicate an error of some kind. +

+ +
BZ_CONFIG_ERROR +
+Indicates that the library has been improperly compiled on your +platform -- a major configuration error. Specifically, it means +that sizeof(char), sizeof(short) and sizeof(int) +are not 1, 2 and 4 respectively, as they should be. Note that the +library should still work properly on 64-bit platforms which follow +the LP64 programming model -- that is, where sizeof(long) +and sizeof(void*) are 8. Under LP64, sizeof(int) is +still 4, so libbzip2, which doesn't use the long type, +is OK. +
BZ_SEQUENCE_ERROR +
+When using the library, it is important to call the functions in the +correct sequence and with data structures (buffers etc) in the correct +states. libbzip2 checks as much as it can to ensure this is +happening, and returns BZ_SEQUENCE_ERROR if not. Code which +complies precisely with the function semantics, as detailed below, +should never receive this value; such an event denotes buggy code +which you should investigate. +
BZ_PARAM_ERROR +
+Returned when a parameter to a function call is out of range +or otherwise manifestly incorrect. As with BZ_SEQUENCE_ERROR, +this denotes a bug in the client code. The distinction between +BZ_PARAM_ERROR and BZ_SEQUENCE_ERROR is a bit hazy, but still worth +making. +
BZ_MEM_ERROR +
+Returned when a request to allocate memory failed. Note that the +quantity of memory needed to decompress a stream cannot be determined +until the stream's header has been read. So BZ2_bzDecompress and +BZ2_bzRead may return BZ_MEM_ERROR even though some of +the compressed data has been read. The same is not true for +compression; once BZ2_bzCompressInit or BZ2_bzWriteOpen have +successfully completed, BZ_MEM_ERROR cannot occur. +
BZ_DATA_ERROR +
+Returned when a data integrity error is detected during decompression. +Most importantly, this means when stored and computed CRCs for the +data do not match. This value is also returned upon detection of any +other anomaly in the compressed data. +
BZ_DATA_ERROR_MAGIC +
+As a special case of BZ_DATA_ERROR, it is sometimes useful to +know when the compressed stream does not start with the correct +magic bytes ('B' 'Z' 'h'). +
BZ_IO_ERROR +
+Returned by BZ2_bzRead and BZ2_bzWrite when there is an error +reading or writing in the compressed file, and by BZ2_bzReadOpen +and BZ2_bzWriteOpen for attempts to use a file for which the +error indicator (viz, ferror(f)) is set. +On receipt of BZ_IO_ERROR, the caller should consult +errno and/or perror to acquire operating-system +specific information about the problem. +
BZ_UNEXPECTED_EOF +
+Returned by BZ2_bzRead when the compressed file finishes +before the logical end of stream is detected. +
BZ_OUTBUFF_FULL +
+Returned by BZ2_bzBuffToBuffCompress and +BZ2_bzBuffToBuffDecompress to indicate that the output data +will not fit into the output buffer provided. +
+ + + +

Low-level interface

+ + + +

BZ2_bzCompressInit

+ +
+typedef 
+   struct {
+      char *next_in;
+      unsigned int avail_in;
+      unsigned int total_in_lo32;
+      unsigned int total_in_hi32;
+
+      char *next_out;
+      unsigned int avail_out;
+      unsigned int total_out_lo32;
+      unsigned int total_out_hi32;
+
+      void *state;
+
+      void *(*bzalloc)(void *,int,int);
+      void (*bzfree)(void *,void *);
+      void *opaque;
+   } 
+   bz_stream;
+
+int BZ2_bzCompressInit ( bz_stream *strm, 
+                         int blockSize100k, 
+                         int verbosity,
+                         int workFactor );
+
+
+ +

+Prepares for compression. The bz_stream structure +holds all data pertaining to the compression activity. +A bz_stream structure should be allocated and initialised +prior to the call. +The fields of bz_stream +comprise the entirety of the user-visible data. state +is a pointer to the private data structures required for compression. + +

+

+Custom memory allocators are supported, via fields bzalloc, +bzfree, +and opaque. The value +opaque is passed to as the first argument to +all calls to bzalloc and bzfree, but is +otherwise ignored by the library. +The call bzalloc ( opaque, n, m ) is expected to return a +pointer p to +n * m bytes of memory, and bzfree ( opaque, p ) +should free +that memory. + +

+

+If you don't want to use a custom memory allocator, set bzalloc, +bzfree and +opaque to NULL, +and the library will then use the standard malloc/free +routines. + +

+

+Before calling BZ2_bzCompressInit, fields bzalloc, +bzfree and opaque should +be filled appropriately, as just described. Upon return, the internal +state will have been allocated and initialised, and total_in_lo32, +total_in_hi32, total_out_lo32 and +total_out_hi32 will have been set to zero. +These four fields are used by the library +to inform the caller of the total amount of data passed into and out of +the library, respectively. You should not try to change them. +As of version 1.0, 64-bit counts are maintained, even on 32-bit +platforms, using the _hi32 fields to store the upper 32 bits +of the count. So, for example, the total amount of data in +is (total_in_hi32 << 32) + total_in_lo32. + +

+

+Parameter blockSize100k specifies the block size to be used for +compression. It should be a value between 1 and 9 inclusive, and the +actual block size used is 100000 x this figure. 9 gives the best +compression but takes most memory. + +

+

+Parameter verbosity should be set to a number between 0 and 4 +inclusive. 0 is silent, and greater numbers give increasingly verbose +monitoring/debugging output. If the library has been compiled with +-DBZ_NO_STDIO, no such output will appear for any verbosity +setting. + +

+

+Parameter workFactor controls how the compression phase behaves +when presented with worst case, highly repetitive, input data. If +compression runs into difficulties caused by repetitive data, the +library switches from the standard sorting algorithm to a fallback +algorithm. The fallback is slower than the standard algorithm by +perhaps a factor of three, but always behaves reasonably, no matter how +bad the input. + +

+

+Lower values of workFactor reduce the amount of effort the +standard algorithm will expend before resorting to the fallback. You +should set this parameter carefully; too low, and many inputs will be +handled by the fallback algorithm and so compress rather slowly, too +high, and your average-to-worst case compression times can become very +large. The default value of 30 gives reasonable behaviour over a wide +range of circumstances. + +

+

+Allowable values range from 0 to 250 inclusive. 0 is a special case, +equivalent to using the default value of 30. + +

+

+Note that the compressed output generated is the same regardless of +whether or not the fallback algorithm is used. + +

+

+Be aware also that this parameter may disappear entirely in future +versions of the library. In principle it should be possible to devise a +good way to automatically choose which algorithm to use. Such a +mechanism would render the parameter obsolete. + +

+

+Possible return values: + +

+      BZ_CONFIG_ERROR
+         if the library has been mis-compiled
+      BZ_PARAM_ERROR 
+         if strm is NULL 
+         or blockSize < 1 or blockSize > 9
+         or verbosity < 0 or verbosity > 4
+         or workFactor < 0 or workFactor > 250
+      BZ_MEM_ERROR 
+         if not enough memory is available
+      BZ_OK 
+         otherwise
+
+ +

+Allowable next actions: + +

+      BZ2_bzCompress 
+         if BZ_OK is returned
+      no specific action needed in case of error
+
+ + + +

BZ2_bzCompress

+ +
+   int BZ2_bzCompress ( bz_stream *strm, int action );
+
+ +

+Provides more input and/or output buffer space for the library. The +caller maintains input and output buffers, and calls BZ2_bzCompress to +transfer data between them. + +

+

+Before each call to BZ2_bzCompress, next_in should point at +the data to be compressed, and avail_in should indicate how many +bytes the library may read. BZ2_bzCompress updates next_in, +avail_in and total_in to reflect the number of bytes it +has read. + +

+

+Similarly, next_out should point to a buffer in which the +compressed data is to be placed, with avail_out indicating how +much output space is available. BZ2_bzCompress updates +next_out, avail_out and total_out to reflect the +number of bytes output. + +

+

+You may provide and remove as little or as much data as you like on each +call of BZ2_bzCompress. In the limit, it is acceptable to supply and +remove data one byte at a time, although this would be terribly +inefficient. You should always ensure that at least one byte of output +space is available at each call. + +

+

+A second purpose of BZ2_bzCompress is to request a change of mode of the +compressed stream. + +

+

+Conceptually, a compressed stream can be in one of four states: IDLE, +RUNNING, FLUSHING and FINISHING. Before initialisation +(BZ2_bzCompressInit) and after termination (BZ2_bzCompressEnd), a +stream is regarded as IDLE. + +

+

+Upon initialisation (BZ2_bzCompressInit), the stream is placed in the +RUNNING state. Subsequent calls to BZ2_bzCompress should pass +BZ_RUN as the requested action; other actions are illegal and +will result in BZ_SEQUENCE_ERROR. + +

+

+At some point, the calling program will have provided all the input data +it wants to. It will then want to finish up -- in effect, asking the +library to process any data it might have buffered internally. In this +state, BZ2_bzCompress will no longer attempt to read data from +next_in, but it will want to write data to next_out. +Because the output buffer supplied by the user can be arbitrarily small, +the finishing-up operation cannot necessarily be done with a single call +of BZ2_bzCompress. + +

+

+Instead, the calling program passes BZ_FINISH as an action to +BZ2_bzCompress. This changes the stream's state to FINISHING. Any +remaining input (ie, next_in[0 .. avail_in-1]) is compressed and +transferred to the output buffer. To do this, BZ2_bzCompress must be +called repeatedly until all the output has been consumed. At that +point, BZ2_bzCompress returns BZ_STREAM_END, and the stream's +state is set back to IDLE. BZ2_bzCompressEnd should then be +called. + +

+

+Just to make sure the calling program does not cheat, the library makes +a note of avail_in at the time of the first call to +BZ2_bzCompress which has BZ_FINISH as an action (ie, at the +time the program has announced its intention to not supply any more +input). By comparing this value with that of avail_in over +subsequent calls to BZ2_bzCompress, the library can detect any +attempts to slip in more data to compress. Any calls for which this is +detected will return BZ_SEQUENCE_ERROR. This indicates a +programming mistake which should be corrected. + +

+

+Instead of asking to finish, the calling program may ask +BZ2_bzCompress to take all the remaining input, compress it and +terminate the current (Burrows-Wheeler) compression block. This could +be useful for error control purposes. The mechanism is analogous to +that for finishing: call BZ2_bzCompress with an action of +BZ_FLUSH, remove output data, and persist with the +BZ_FLUSH action until the value BZ_RUN is returned. As +with finishing, BZ2_bzCompress detects any attempt to provide more +input data once the flush has begun. + +

+

+Once the flush is complete, the stream returns to the normal RUNNING +state. + +

+

+This all sounds pretty complex, but isn't really. Here's a table +which shows which actions are allowable in each state, what action +will be taken, what the next state is, and what the non-error return +values are. Note that you can't explicitly ask what state the +stream is in, but nor do you need to -- it can be inferred from the +values returned by BZ2_bzCompress. + +

+IDLE/any           
+      Illegal.  IDLE state only exists after BZ2_bzCompressEnd or
+      before BZ2_bzCompressInit.
+      Return value = BZ_SEQUENCE_ERROR
+
+RUNNING/BZ_RUN     
+      Compress from next_in to next_out as much as possible.
+      Next state = RUNNING
+      Return value = BZ_RUN_OK
+
+RUNNING/BZ_FLUSH   
+      Remember current value of next_in.  Compress from next_in
+      to next_out as much as possible, but do not accept any more input.  
+      Next state = FLUSHING
+      Return value = BZ_FLUSH_OK
+
+RUNNING/BZ_FINISH  
+      Remember current value of next_in.  Compress from next_in
+      to next_out as much as possible, but do not accept any more input.
+      Next state = FINISHING
+      Return value = BZ_FINISH_OK
+
+FLUSHING/BZ_FLUSH  
+      Compress from next_in to next_out as much as possible, 
+      but do not accept any more input.  
+      If all the existing input has been used up and all compressed
+      output has been removed
+         Next state = RUNNING; Return value = BZ_RUN_OK
+      else
+         Next state = FLUSHING; Return value = BZ_FLUSH_OK
+
+FLUSHING/other     
+      Illegal.
+      Return value = BZ_SEQUENCE_ERROR
+
+FINISHING/BZ_FINISH  
+      Compress from next_in to next_out as much as possible,
+      but to not accept any more input.  
+      If all the existing input has been used up and all compressed
+      output has been removed
+         Next state = IDLE; Return value = BZ_STREAM_END
+      else
+         Next state = FINISHING; Return value = BZ_FINISHING
+
+FINISHING/other
+      Illegal.
+      Return value = BZ_SEQUENCE_ERROR
+
+ +

+That still looks complicated? Well, fair enough. The usual sequence +of calls for compressing a load of data is: + +

    +
  • Get started with BZ2_bzCompressInit. + +
  • Shovel data in and shlurp out its compressed form using zero or more + +calls of BZ2_bzCompress with action = BZ_RUN. +
  • Finish up. + +Repeatedly call BZ2_bzCompress with action = BZ_FINISH, +copying out the compressed output, until BZ_STREAM_END is returned. +
  • Close up and go home. Call BZ2_bzCompressEnd. + +
+ +

+If the data you want to compress fits into your input buffer all +at once, you can skip the calls of BZ2_bzCompress ( ..., BZ_RUN ) and +just do the BZ2_bzCompress ( ..., BZ_FINISH ) calls. + +

+

+All required memory is allocated by BZ2_bzCompressInit. The +compression library can accept any data at all (obviously). So you +shouldn't get any error return values from the BZ2_bzCompress calls. +If you do, they will be BZ_SEQUENCE_ERROR, and indicate a bug in +your programming. + +

+

+Trivial other possible return values: + +

+      BZ_PARAM_ERROR   
+         if strm is NULL, or strm->s is NULL
+
+ + + +

BZ2_bzCompressEnd

+ +
+int BZ2_bzCompressEnd ( bz_stream *strm );
+
+ +

+Releases all memory associated with a compression stream. + +

+

+Possible return values: + +

+   BZ_PARAM_ERROR    if strm is NULL or strm->s is NULL
+   BZ_OK    otherwise
+
+ + + +

BZ2_bzDecompressInit

+ +
+int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small );
+
+ +

+Prepares for decompression. As with BZ2_bzCompressInit, a +bz_stream record should be allocated and initialised before the +call. Fields bzalloc, bzfree and opaque should be +set if a custom memory allocator is required, or made NULL for +the normal malloc/free routines. Upon return, the internal +state will have been initialised, and total_in and +total_out will be zero. + +

+

+For the meaning of parameter verbosity, see BZ2_bzCompressInit. + +

+

+If small is nonzero, the library will use an alternative +decompression algorithm which uses less memory but at the cost of +decompressing more slowly (roughly speaking, half the speed, but the +maximum memory requirement drops to around 2300k). See Chapter 2 for +more information on memory management. + +

+

+Note that the amount of memory needed to decompress +a stream cannot be determined until the stream's header has been read, +so even if BZ2_bzDecompressInit succeeds, a subsequent +BZ2_bzDecompress could fail with BZ_MEM_ERROR. + +

+

+Possible return values: + +

+      BZ_CONFIG_ERROR
+         if the library has been mis-compiled
+      BZ_PARAM_ERROR
+         if (small != 0 && small != 1)
+         or (verbosity < 0 || verbosity > 4)
+      BZ_MEM_ERROR
+         if insufficient memory is available
+
+ +

+Allowable next actions: + +

+      BZ2_bzDecompress
+         if BZ_OK was returned
+      no specific action required in case of error
+
+ +

+ + +

+ + +

BZ2_bzDecompress

+ +
+int BZ2_bzDecompress ( bz_stream *strm );
+
+ +

+Provides more input and/out output buffer space for the library. The +caller maintains input and output buffers, and uses BZ2_bzDecompress +to transfer data between them. + +

+

+Before each call to BZ2_bzDecompress, next_in +should point at the compressed data, +and avail_in should indicate how many bytes the library +may read. BZ2_bzDecompress updates next_in, avail_in +and total_in +to reflect the number of bytes it has read. + +

+

+Similarly, next_out should point to a buffer in which the uncompressed +output is to be placed, with avail_out indicating how much output space +is available. BZ2_bzCompress updates next_out, +avail_out and total_out to reflect +the number of bytes output. + +

+

+You may provide and remove as little or as much data as you like on +each call of BZ2_bzDecompress. +In the limit, it is acceptable to +supply and remove data one byte at a time, although this would be +terribly inefficient. You should always ensure that at least one +byte of output space is available at each call. + +

+

+Use of BZ2_bzDecompress is simpler than BZ2_bzCompress. + +

+

+You should provide input and remove output as described above, and +repeatedly call BZ2_bzDecompress until BZ_STREAM_END is +returned. Appearance of BZ_STREAM_END denotes that +BZ2_bzDecompress has detected the logical end of the compressed +stream. BZ2_bzDecompress will not produce BZ_STREAM_END until +all output data has been placed into the output buffer, so once +BZ_STREAM_END appears, you are guaranteed to have available all +the decompressed output, and BZ2_bzDecompressEnd can safely be +called. + +

+

+If case of an error return value, you should call BZ2_bzDecompressEnd +to clean up and release memory. + +

+

+Possible return values: + +

+      BZ_PARAM_ERROR
+         if strm is NULL or strm->s is NULL
+         or strm->avail_out < 1
+      BZ_DATA_ERROR
+         if a data integrity error is detected in the compressed stream
+      BZ_DATA_ERROR_MAGIC
+         if the compressed stream doesn't begin with the right magic bytes
+      BZ_MEM_ERROR
+         if there wasn't enough memory available
+      BZ_STREAM_END
+         if the logical end of the data stream was detected and all
+         output in has been consumed, eg s->avail_out > 0
+      BZ_OK
+         otherwise
+
+ +

+Allowable next actions: + +

+      BZ2_bzDecompress
+         if BZ_OK was returned
+      BZ2_bzDecompressEnd
+         otherwise
+
+ + + +

BZ2_bzDecompressEnd

+ +
+int BZ2_bzDecompressEnd ( bz_stream *strm );
+
+ +

+Releases all memory associated with a decompression stream. + +

+

+Possible return values: + +

+      BZ_PARAM_ERROR
+         if strm is NULL or strm->s is NULL
+      BZ_OK
+         otherwise
+
+ +

+Allowable next actions: + +

+      None.
+
+ + + +

High-level interface

+ +

+This interface provides functions for reading and writing +bzip2 format files. First, some general points. + +

+ +
    +
  • All of the functions take an int* first argument, + + bzerror. + After each call, bzerror should be consulted first to determine + the outcome of the call. If bzerror is BZ_OK, + the call completed + successfully, and only then should the return value of the function + (if any) be consulted. If bzerror is BZ_IO_ERROR, + there was an error + reading/writing the underlying compressed file, and you should + then consult errno/perror to determine the + cause of the difficulty. + bzerror may also be set to various other values; precise details are + given on a per-function basis below. +
  • If bzerror indicates an error + + (ie, anything except BZ_OK and BZ_STREAM_END), + you should immediately call BZ2_bzReadClose (or BZ2_bzWriteClose, + depending on whether you are attempting to read or to write) + to free up all resources associated + with the stream. Once an error has been indicated, behaviour of all calls + except BZ2_bzReadClose (BZ2_bzWriteClose) is undefined. + The implication is that (1) bzerror should + be checked after each call, and (2) if bzerror indicates an error, + BZ2_bzReadClose (BZ2_bzWriteClose) should then be called to clean up. +
  • The FILE* arguments passed to + + BZ2_bzReadOpen/BZ2_bzWriteOpen + should be set to binary mode. + Most Unix systems will do this by default, but other platforms, + including Windows and Mac, will not. If you omit this, you may + encounter problems when moving code to new platforms. +
  • Memory allocation requests are handled by + + malloc/free. + At present + there is no facility for user-defined memory allocators in the file I/O + functions (could easily be added, though). +
+ + + +

BZ2_bzReadOpen

+ +
+   typedef void BZFILE;
+
+   BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f, 
+                            int small, int verbosity,
+                            void *unused, int nUnused );
+
+ +

+Prepare to read compressed data from file handle f. f +should refer to a file which has been opened for reading, and for which +the error indicator (ferror(f))is not set. If small is 1, +the library will try to decompress using less memory, at the expense of +speed. + +

+

+For reasons explained below, BZ2_bzRead will decompress the +nUnused bytes starting at unused, before starting to read +from the file f. At most BZ_MAX_UNUSED bytes may be +supplied like this. If this facility is not required, you should pass +NULL and 0 for unused and nUnused +respectively. + +

+

+For the meaning of parameters small and verbosity, +see BZ2_bzDecompressInit. + +

+

+The amount of memory needed to decompress a file cannot be determined +until the file's header has been read. So it is possible that +BZ2_bzReadOpen returns BZ_OK but a subsequent call of +BZ2_bzRead will return BZ_MEM_ERROR. + +

+

+Possible assignments to bzerror: + +

+      BZ_CONFIG_ERROR
+         if the library has been mis-compiled
+      BZ_PARAM_ERROR
+         if f is NULL 
+         or small is neither 0 nor 1                 
+         or (unused == NULL && nUnused != 0)
+         or (unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))
+      BZ_IO_ERROR    
+         if ferror(f) is nonzero
+      BZ_MEM_ERROR   
+         if insufficient memory is available
+      BZ_OK
+         otherwise.
+
+ +

+Possible return values: + +

+      Pointer to an abstract BZFILE        
+         if bzerror is BZ_OK   
+      NULL
+         otherwise
+
+ +

+Allowable next actions: + +

+      BZ2_bzRead
+         if bzerror is BZ_OK   
+      BZ2_bzClose 
+         otherwise
+
+ + + +

BZ2_bzRead

+ +
+   int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len );
+
+ +

+Reads up to len (uncompressed) bytes from the compressed file +b into +the buffer buf. If the read was successful, +bzerror is set to BZ_OK +and the number of bytes read is returned. If the logical end-of-stream +was detected, bzerror will be set to BZ_STREAM_END, +and the number +of bytes read is returned. All other bzerror values denote an error. + +

+

+BZ2_bzRead will supply len bytes, +unless the logical stream end is detected +or an error occurs. Because of this, it is possible to detect the +stream end by observing when the number of bytes returned is +less than the number +requested. Nevertheless, this is regarded as inadvisable; you should +instead check bzerror after every call and watch out for +BZ_STREAM_END. + +

+

+Internally, BZ2_bzRead copies data from the compressed file in chunks +of size BZ_MAX_UNUSED bytes +before decompressing it. If the file contains more bytes than strictly +needed to reach the logical end-of-stream, BZ2_bzRead will almost certainly +read some of the trailing data before signalling BZ_SEQUENCE_END. +To collect the read but unused data once BZ_SEQUENCE_END has +appeared, call BZ2_bzReadGetUnused immediately before BZ2_bzReadClose. + +

+

+Possible assignments to bzerror: + +

+      BZ_PARAM_ERROR
+         if b is NULL or buf is NULL or len < 0
+      BZ_SEQUENCE_ERROR 
+         if b was opened with BZ2_bzWriteOpen
+      BZ_IO_ERROR 
+         if there is an error reading from the compressed file
+      BZ_UNEXPECTED_EOF 
+         if the compressed file ended before the logical end-of-stream was detected
+      BZ_DATA_ERROR 
+         if a data integrity error was detected in the compressed stream
+      BZ_DATA_ERROR_MAGIC
+         if the stream does not begin with the requisite header bytes (ie, is not 
+         a bzip2 data file).  This is really a special case of BZ_DATA_ERROR.
+      BZ_MEM_ERROR 
+         if insufficient memory was available
+      BZ_STREAM_END 
+         if the logical end of stream was detected.
+      BZ_OK
+         otherwise.
+
+ +

+Possible return values: + +

+      number of bytes read
+         if bzerror is BZ_OK or BZ_STREAM_END
+      undefined
+         otherwise
+
+ +

+Allowable next actions: + +

+      collect data from buf, then BZ2_bzRead or BZ2_bzReadClose
+         if bzerror is BZ_OK 
+      collect data from buf, then BZ2_bzReadClose or BZ2_bzReadGetUnused 
+         if bzerror is BZ_SEQUENCE_END   
+      BZ2_bzReadClose 
+         otherwise
+
+ + + +

BZ2_bzReadGetUnused

+ +
+   void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b, 
+                              void** unused, int* nUnused );
+
+ +

+Returns data which was read from the compressed file but was not needed +to get to the logical end-of-stream. *unused is set to the address +of the data, and *nUnused to the number of bytes. *nUnused will +be set to a value between 0 and BZ_MAX_UNUSED inclusive. + +

+

+This function may only be called once BZ2_bzRead has signalled +BZ_STREAM_END but before BZ2_bzReadClose. + +

+

+Possible assignments to bzerror: + +

+      BZ_PARAM_ERROR 
+         if b is NULL 
+         or unused is NULL or nUnused is NULL
+      BZ_SEQUENCE_ERROR 
+         if BZ_STREAM_END has not been signalled
+         or if b was opened with BZ2_bzWriteOpen
+     BZ_OK
+         otherwise
+
+ +

+Allowable next actions: + +

+      BZ2_bzReadClose
+
+ + + +

BZ2_bzReadClose

+ +
+   void BZ2_bzReadClose ( int *bzerror, BZFILE *b );
+
+ +

+Releases all memory pertaining to the compressed file b. +BZ2_bzReadClose does not call fclose on the underlying file +handle, so you should do that yourself if appropriate. +BZ2_bzReadClose should be called to clean up after all error +situations. + +

+

+Possible assignments to bzerror: + +

+      BZ_SEQUENCE_ERROR 
+         if b was opened with BZ2_bzOpenWrite 
+      BZ_OK 
+         otherwise
+
+ +

+Allowable next actions: + +

+      none
+
+ + + +

BZ2_bzWriteOpen

+ +
+   BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f, 
+                             int blockSize100k, int verbosity,
+                             int workFactor );
+
+ +

+Prepare to write compressed data to file handle f. +f should refer to +a file which has been opened for writing, and for which the error +indicator (ferror(f))is not set. + +

+

+For the meaning of parameters blockSize100k, +verbosity and workFactor, see +
BZ2_bzCompressInit. + +

+

+All required memory is allocated at this stage, so if the call +completes successfully, BZ_MEM_ERROR cannot be signalled by a +subsequent call to BZ2_bzWrite. + +

+

+Possible assignments to bzerror: + +

+      BZ_CONFIG_ERROR
+         if the library has been mis-compiled
+      BZ_PARAM_ERROR 
+         if f is NULL 
+         or blockSize100k < 1 or blockSize100k > 9
+      BZ_IO_ERROR 
+         if ferror(f) is nonzero
+      BZ_MEM_ERROR 
+         if insufficient memory is available
+      BZ_OK 
+         otherwise
+
+ +

+Possible return values: + +

+      Pointer to an abstract BZFILE  
+         if bzerror is BZ_OK   
+      NULL 
+         otherwise
+
+ +

+Allowable next actions: + +

+      BZ2_bzWrite 
+         if bzerror is BZ_OK 
+         (you could go directly to BZ2_bzWriteClose, but this would be pretty pointless)
+      BZ2_bzWriteClose 
+         otherwise
+
+ + + +

BZ2_bzWrite

+ +
+   void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len );
+
+ +

+Absorbs len bytes from the buffer buf, eventually to be +compressed and written to the file. + +

+

+Possible assignments to bzerror: + +

+      BZ_PARAM_ERROR 
+         if b is NULL or buf is NULL or len < 0
+      BZ_SEQUENCE_ERROR 
+         if b was opened with BZ2_bzReadOpen
+      BZ_IO_ERROR 
+         if there is an error writing the compressed file.
+      BZ_OK 
+         otherwise
+
+ + + +

BZ2_bzWriteClose

+ +
+   void BZ2_bzWriteClose ( int *bzerror, BZFILE* f,
+                           int abandon,
+                           unsigned int* nbytes_in,
+                           unsigned int* nbytes_out );
+
+   void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f,
+                             int abandon,
+                             unsigned int* nbytes_in_lo32,
+                             unsigned int* nbytes_in_hi32,
+                             unsigned int* nbytes_out_lo32,
+                             unsigned int* nbytes_out_hi32 );
+
+ +

+Compresses and flushes to the compressed file all data so far supplied +by BZ2_bzWrite. The logical end-of-stream markers are also written, so +subsequent calls to BZ2_bzWrite are illegal. All memory associated +with the compressed file b is released. +fflush is called on the +compressed file, but it is not fclose'd. + +

+

+If BZ2_bzWriteClose is called to clean up after an error, the only +action is to release the memory. The library records the error codes +issued by previous calls, so this situation will be detected +automatically. There is no attempt to complete the compression +operation, nor to fflush the compressed file. You can force this +behaviour to happen even in the case of no error, by passing a nonzero +value to abandon. + +

+

+If nbytes_in is non-null, *nbytes_in will be set to be the +total volume of uncompressed data handled. Similarly, nbytes_out +will be set to the total volume of compressed data written. For +compatibility with older versions of the library, BZ2_bzWriteClose +only yields the lower 32 bits of these counts. Use +BZ2_bzWriteClose64 if you want the full 64 bit counts. These +two functions are otherwise absolutely identical. + +

+ +

+Possible assignments to bzerror: + +

+      BZ_SEQUENCE_ERROR 
+         if b was opened with BZ2_bzReadOpen
+      BZ_IO_ERROR 
+         if there is an error writing the compressed file
+      BZ_OK 
+         otherwise
+
+ + + +

Handling embedded compressed data streams

+ +

+The high-level library facilitates use of +bzip2 data streams which form some part of a surrounding, larger +data stream. + +

    +
  • For writing, the library takes an open file handle, writes + +compressed data to it, fflushes it but does not fclose it. +The calling application can write its own data before and after the +compressed data stream, using that same file handle. +
  • Reading is more complex, and the facilities are not as general + +as they could be since generality is hard to reconcile with efficiency. +BZ2_bzRead reads from the compressed file in blocks of size +BZ_MAX_UNUSED bytes, and in doing so probably will overshoot +the logical end of compressed stream. +To recover this data once decompression has +ended, call BZ2_bzReadGetUnused after the last call of BZ2_bzRead +(the one returning BZ_STREAM_END) but before calling +BZ2_bzReadClose. +
+ +

+This mechanism makes it easy to decompress multiple bzip2 +streams placed end-to-end. As the end of one stream, when BZ2_bzRead +returns BZ_STREAM_END, call BZ2_bzReadGetUnused to collect the +unused data (copy it into your own buffer somewhere). +That data forms the start of the next compressed stream. +To start uncompressing that next stream, call BZ2_bzReadOpen again, +feeding in the unused data via the unused/nUnused +parameters. +Keep doing this until BZ_STREAM_END return coincides with the +physical end of file (feof(f)). In this situation +BZ2_bzReadGetUnused +will of course return no data. + +

+

+This should give some feel for how the high-level interface can be used. +If you require extra flexibility, you'll have to bite the bullet and get +to grips with the low-level interface. + +

+ + +

Standard file-reading/writing code

+

+Here's how you'd write data to a compressed file: + +

+FILE*   f;
+BZFILE* b;
+int     nBuf;
+char    buf[ /* whatever size you like */ ];
+int     bzerror;
+int     nWritten;
+
+f = fopen ( "myfile.bz2", "w" );
+if (!f) {
+   /* handle error */
+}
+b = BZ2_bzWriteOpen ( &bzerror, f, 9 );
+if (bzerror != BZ_OK) {
+   BZ2_bzWriteClose ( b );
+   /* handle error */
+}
+
+while ( /* condition */ ) {
+   /* get data to write into buf, and set nBuf appropriately */
+   nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf );
+   if (bzerror == BZ_IO_ERROR) { 
+      BZ2_bzWriteClose ( &bzerror, b );
+      /* handle error */
+   }
+}
+
+BZ2_bzWriteClose ( &bzerror, b );
+if (bzerror == BZ_IO_ERROR) {
+   /* handle error */
+}
+
+ +

+And to read from a compressed file: + +

+FILE*   f;
+BZFILE* b;
+int     nBuf;
+char    buf[ /* whatever size you like */ ];
+int     bzerror;
+int     nWritten;
+
+f = fopen ( "myfile.bz2", "r" );
+if (!f) {
+   /* handle error */
+}
+b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 );
+if (bzerror != BZ_OK) {
+   BZ2_bzReadClose ( &bzerror, b );
+   /* handle error */
+}
+
+bzerror = BZ_OK;
+while (bzerror == BZ_OK && /* arbitrary other conditions */) {
+   nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ );
+   if (bzerror == BZ_OK) {
+      /* do something with buf[0 .. nBuf-1] */
+   }
+}
+if (bzerror != BZ_STREAM_END) {
+   BZ2_bzReadClose ( &bzerror, b );
+   /* handle error */
+} else {
+   BZ2_bzReadClose ( &bzerror );
+}
+
+ + + +

Utility functions

+ + +

BZ2_bzBuffToBuffCompress

+ +
+   int BZ2_bzBuffToBuffCompress( char*         dest,
+                                 unsigned int* destLen,
+                                 char*         source,
+                                 unsigned int  sourceLen,
+                                 int           blockSize100k,
+                                 int           verbosity,
+                                 int           workFactor );
+
+ +

+Attempts to compress the data in source[0 .. sourceLen-1] +into the destination buffer, dest[0 .. *destLen-1]. +If the destination buffer is big enough, *destLen is +set to the size of the compressed data, and BZ_OK is +returned. If the compressed data won't fit, *destLen +is unchanged, and BZ_OUTBUFF_FULL is returned. + +

+

+Compression in this manner is a one-shot event, done with a single call +to this function. The resulting compressed data is a complete +bzip2 format data stream. There is no mechanism for making +additional calls to provide extra input data. If you want that kind of +mechanism, use the low-level interface. + +

+

+For the meaning of parameters blockSize100k, verbosity +and workFactor,
see BZ2_bzCompressInit. + +

+

+To guarantee that the compressed data will fit in its buffer, allocate +an output buffer of size 1% larger than the uncompressed data, plus +six hundred extra bytes. + +

+

+BZ2_bzBuffToBuffDecompress will not write data at or +beyond dest[*destLen], even in case of buffer overflow. + +

+

+Possible return values: + +

+      BZ_CONFIG_ERROR
+         if the library has been mis-compiled
+      BZ_PARAM_ERROR 
+         if dest is NULL or destLen is NULL
+         or blockSize100k < 1 or blockSize100k > 9
+         or verbosity < 0 or verbosity > 4 
+         or workFactor < 0 or workFactor > 250
+      BZ_MEM_ERROR
+         if insufficient memory is available 
+      BZ_OUTBUFF_FULL
+         if the size of the compressed data exceeds *destLen
+      BZ_OK 
+         otherwise
+
+ + + +

BZ2_bzBuffToBuffDecompress

+ +
+   int BZ2_bzBuffToBuffDecompress ( char*         dest,
+                                    unsigned int* destLen,
+                                    char*         source,
+                                    unsigned int  sourceLen,
+                                    int           small,
+                                    int           verbosity );
+
+ +

+Attempts to decompress the data in source[0 .. sourceLen-1] +into the destination buffer, dest[0 .. *destLen-1]. +If the destination buffer is big enough, *destLen is +set to the size of the uncompressed data, and BZ_OK is +returned. If the compressed data won't fit, *destLen +is unchanged, and BZ_OUTBUFF_FULL is returned. + +

+

+source is assumed to hold a complete bzip2 format +data stream.
BZ2_bzBuffToBuffDecompress tries to decompress +the entirety of the stream into the output buffer. + +

+

+For the meaning of parameters small and verbosity, +see BZ2_bzDecompressInit. + +

+

+Because the compression ratio of the compressed data cannot be known in +advance, there is no easy way to guarantee that the output buffer will +be big enough. You may of course make arrangements in your code to +record the size of the uncompressed data, but such a mechanism is beyond +the scope of this library. + +

+

+BZ2_bzBuffToBuffDecompress will not write data at or +beyond dest[*destLen], even in case of buffer overflow. + +

+

+Possible return values: + +

+      BZ_CONFIG_ERROR
+         if the library has been mis-compiled
+      BZ_PARAM_ERROR 
+         if dest is NULL or destLen is NULL
+         or small != 0 && small != 1
+         or verbosity < 0 or verbosity > 4 
+      BZ_MEM_ERROR
+         if insufficient memory is available 
+      BZ_OUTBUFF_FULL
+         if the size of the compressed data exceeds *destLen
+      BZ_DATA_ERROR
+         if a data integrity error was detected in the compressed data
+      BZ_DATA_ERROR_MAGIC
+         if the compressed data doesn't begin with the right magic bytes
+      BZ_UNEXPECTED_EOF
+         if the compressed data ends unexpectedly
+      BZ_OK 
+         otherwise
+
+ + + +

zlib compatibility functions

+

+Yoshioka Tsuneo has contributed some functions to +give better zlib compatibility. These functions are +BZ2_bzopen, BZ2_bzread, BZ2_bzwrite, BZ2_bzflush, +BZ2_bzclose, +BZ2_bzerror and BZ2_bzlibVersion. +These functions are not (yet) officially part of +the library. If they break, you get to keep all the pieces. +Nevertheless, I think they work ok. + +

+typedef void BZFILE;
+
+const char * BZ2_bzlibVersion ( void );
+
+ +

+Returns a string indicating the library version. + +

+BZFILE * BZ2_bzopen  ( const char *path, const char *mode );
+BZFILE * BZ2_bzdopen ( int        fd,    const char *mode );
+
+ +

+Opens a .bz2 file for reading or writing, using either its name +or a pre-existing file descriptor. +Analogous to fopen and fdopen. + +

+int BZ2_bzread  ( BZFILE* b, void* buf, int len );
+int BZ2_bzwrite ( BZFILE* b, void* buf, int len );
+
+ +

+Reads/writes data from/to a previously opened BZFILE. +Analogous to fread and fwrite. + +

+int  BZ2_bzflush ( BZFILE* b );
+void BZ2_bzclose ( BZFILE* b );
+
+ +

+Flushes/closes a BZFILE. BZ2_bzflush doesn't actually do +anything. Analogous to fflush and fclose. + +

+ +
+const char * BZ2_bzerror ( BZFILE *b, int *errnum )
+
+ +

+Returns a string describing the more recent error status of +b, and also sets *errnum to its numerical value. + +

+ + + +

Using the library in a stdio-free environment

+ + + +

Getting rid of stdio

+ +

+In a deeply embedded application, you might want to use just +the memory-to-memory functions. You can do this conveniently +by compiling the library with preprocessor symbol BZ_NO_STDIO +defined. Doing this gives you a library containing only the following +eight functions: + +

+

+BZ2_bzCompressInit, BZ2_bzCompress, BZ2_bzCompressEnd
+BZ2_bzDecompressInit, BZ2_bzDecompress, BZ2_bzDecompressEnd
+BZ2_bzBuffToBuffCompress, BZ2_bzBuffToBuffDecompress + +

+

+When compiled like this, all functions will ignore verbosity +settings. + +

+ + +

Critical error handling

+

+libbzip2 contains a number of internal assertion checks which +should, needless to say, never be activated. Nevertheless, if an +assertion should fail, behaviour depends on whether or not the library +was compiled with BZ_NO_STDIO set. + +

+

+For a normal compile, an assertion failure yields the message + +

+   bzip2/libbzip2: internal error number N.
+   This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000.
+   Please report it to me at: jseward@acm.org.  If this happened
+   when you were using some program which uses libbzip2 as a
+   component, you should also report this bug to the author(s)
+   of that program.  Please make an effort to report this bug;
+   timely and accurate bug reports eventually lead to higher
+   quality software.  Thanks.  Julian Seward, 21 March 2000.
+
+ +

+where N is some error code number. exit(3) +is then called. + +

+

+For a stdio-free library, assertion failures result +in a call to a function declared as: + +

+   extern void bz_internal_error ( int errcode );
+
+ +

+The relevant code is passed as a parameter. You should supply +such a function. + +

+

+In either case, once an assertion failure has occurred, any +bz_stream records involved can be regarded as invalid. +You should not attempt to resume normal operation with them. + +

+

+You may, of course, change critical error handling to suit +your needs. As I said above, critical errors indicate bugs +in the library and should not occur. All "normal" error +situations are indicated via error return codes from functions, +and can be recovered from. + +

+ + + +

Making a Windows DLL

+

+Everything related to Windows has been contributed by Yoshioka Tsuneo +
(QWF00133@niftyserve.or.jp / +tsuneo-y@is.aist-nara.ac.jp), so you should send your queries to +him (but perhaps Cc: me, jseward@acm.org). + +

+

+My vague understanding of what to do is: using Visual C++ 5.0, +open the project file libbz2.dsp, and build. That's all. + +

+

+If you can't +open the project file for some reason, make a new one, naming these files: +blocksort.c, bzlib.c, compress.c, +crctable.c, decompress.c, huffman.c,
+randtable.c and libbz2.def. You will also need +to name the header files bzlib.h and bzlib_private.h. + +

+

+If you don't use VC++, you may need to define the proprocessor symbol +_WIN32. + +

+

+Finally, dlltest.c is a sample program using the DLL. It has a +project file, dlltest.dsp. + +

+

+If you just want a makefile for Visual C, have a look at +makefile.msc. + +

+

+Be aware that if you compile bzip2 itself on Win32, you must set +BZ_UNIX to 0 and BZ_LCCWIN32 to 1, in the file +bzip2.c, before compiling. Otherwise the resulting binary won't +work correctly. + +

+

+I haven't tried any of this stuff myself, but it all looks plausible. + +

+ +


+

Go to the first, previous, next, last section, table of contents. + + diff --git a/bzip2/manual_4.html b/bzip2/manual_4.html new file mode 100644 index 0000000..9ab7fb2 --- /dev/null +++ b/bzip2/manual_4.html @@ -0,0 +1,528 @@ + + + + +bzip2 and libbzip2 - Miscellanea + + + + + +

Go to the first, previous, next, last section, table of contents. +


+ + +

Miscellanea

+ +

+These are just some random thoughts of mine. Your mileage may +vary. + +

+ + +

Limitations of the compressed file format

+

+bzip2-1.0, 0.9.5 and 0.9.0 +use exactly the same file format as the previous +version, bzip2-0.1. This decision was made in the interests of +stability. Creating yet another incompatible compressed file format +would create further confusion and disruption for users. + +

+

+Nevertheless, this is not a painless decision. Development +work since the release of bzip2-0.1 in August 1997 +has shown complexities in the file format which slow down +decompression and, in retrospect, are unnecessary. These are: + +

    +
  • The run-length encoder, which is the first of the + + compression transformations, is entirely irrelevant. + The original purpose was to protect the sorting algorithm + from the very worst case input: a string of repeated + symbols. But algorithm steps Q6a and Q6b in the original + Burrows-Wheeler technical report (SRC-124) show how + repeats can be handled without difficulty in block + sorting. +
  • The randomisation mechanism doesn't really need to be + + there. Udi Manber and Gene Myers published a suffix + array construction algorithm a few years back, which + can be employed to sort any block, no matter how + repetitive, in O(N log N) time. Subsequent work by + Kunihiko Sadakane has produced a derivative O(N (log N)^2) + algorithm which usually outperforms the Manber-Myers + algorithm. + + I could have changed to Sadakane's algorithm, but I find + it to be slower than bzip2's existing algorithm for + most inputs, and the randomisation mechanism protects + adequately against bad cases. I didn't think it was + a good tradeoff to make. Partly this is due to the fact + that I was not flooded with email complaints about + bzip2-0.1's performance on repetitive data, so + perhaps it isn't a problem for real inputs. + + Probably the best long-term solution, + and the one I have incorporated into 0.9.5 and above, + is to use the existing sorting + algorithm initially, and fall back to a O(N (log N)^2) + algorithm if the standard algorithm gets into difficulties. +
  • The compressed file format was never designed to be + + handled by a library, and I have had to jump though + some hoops to produce an efficient implementation of + decompression. It's a bit hairy. Try passing + decompress.c through the C preprocessor + and you'll see what I mean. Much of this complexity + could have been avoided if the compressed size of + each block of data was recorded in the data stream. +
  • An Adler-32 checksum, rather than a CRC32 checksum, + + would be faster to compute. +
+ +

+It would be fair to say that the bzip2 format was frozen +before I properly and fully understood the performance +consequences of doing so. + +

+

+Improvements which I was able to incorporate into +0.9.0, despite using the same file format, are: + +

    +
  • Single array implementation of the inverse BWT. This + + significantly speeds up decompression, presumably + because it reduces the number of cache misses. +
  • Faster inverse MTF transform for large MTF values. The + + new implementation is based on the notion of sliding blocks + of values. +
  • bzip2-0.9.0 now reads and writes files with fread + + and fwrite; version 0.1 used putc and getc. + Duh! Well, you live and learn. + +
+ +

+Further ahead, it would be nice +to be able to do random access into files. This will +require some careful design of compressed file formats. + +

+ + + +

Portability issues

+

+After some consideration, I have decided not to use +GNU autoconf to configure 0.9.5 or 1.0. + +

+

+autoconf, admirable and wonderful though it is, +mainly assists with portability problems between Unix-like +platforms. But bzip2 doesn't have much in the way +of portability problems on Unix; most of the difficulties appear +when porting to the Mac, or to Microsoft's operating systems. +autoconf doesn't help in those cases, and brings in a +whole load of new complexity. + +

+

+Most people should be able to compile the library and program +under Unix straight out-of-the-box, so to speak, especially +if you have a version of GNU C available. + +

+

+There are a couple of __inline__ directives in the code. GNU C +(gcc) should be able to handle them. If you're not using +GNU C, your C compiler shouldn't see them at all. +If your compiler does, for some reason, see them and doesn't +like them, just #define __inline__ to be /* */. One +easy way to do this is to compile with the flag -D__inline__=, +which should be understood by most Unix compilers. + +

+

+If you still have difficulties, try compiling with the macro +BZ_STRICT_ANSI defined. This should enable you to build the +library in a strictly ANSI compliant environment. Building the program +itself like this is dangerous and not supported, since you remove +bzip2's checks against compressing directories, symbolic links, +devices, and other not-really-a-file entities. This could cause +filesystem corruption! + +

+

+One other thing: if you create a bzip2 binary for public +distribution, please try and link it statically (gcc -s). This +avoids all sorts of library-version issues that others may encounter +later on. + +

+

+If you build bzip2 on Win32, you must set BZ_UNIX to 0 and +BZ_LCCWIN32 to 1, in the file bzip2.c, before compiling. +Otherwise the resulting binary won't work correctly. + +

+ + + +

Reporting bugs

+

+I tried pretty hard to make sure bzip2 is +bug free, both by design and by testing. Hopefully +you'll never need to read this section for real. + +

+

+Nevertheless, if bzip2 dies with a segmentation +fault, a bus error or an internal assertion failure, it +will ask you to email me a bug report. Experience with +version 0.1 shows that almost all these problems can +be traced to either compiler bugs or hardware problems. + +

    +
  • + +Recompile the program with no optimisation, and see if it +works. And/or try a different compiler. +I heard all sorts of stories about various flavours +of GNU C (and other compilers) generating bad code for +bzip2, and I've run across two such examples myself. + +2.7.X versions of GNU C are known to generate bad code from +time to time, at high optimisation levels. +If you get problems, try using the flags +-O2 -fomit-frame-pointer -fno-strength-reduce. +You should specifically not use -funroll-loops. + +You may notice that the Makefile runs six tests as part of +the build process. If the program passes all of these, it's +a pretty good (but not 100%) indication that the compiler has +done its job correctly. +
  • + +If bzip2 crashes randomly, and the crashes are not +repeatable, you may have a flaky memory subsystem. bzip2 +really hammers your memory hierarchy, and if it's a bit marginal, +you may get these problems. Ditto if your disk or I/O subsystem +is slowly failing. Yup, this really does happen. + +Try using a different machine of the same type, and see if +you can repeat the problem. +
  • This isn't really a bug, but ... If bzip2 tells + +you your file is corrupted on decompression, and you +obtained the file via FTP, there is a possibility that you +forgot to tell FTP to do a binary mode transfer. That absolutely +will cause the file to be non-decompressible. You'll have to transfer +it again. +
+ +

+If you've incorporated libbzip2 into your own program +and are getting problems, please, please, please, check that the +parameters you are passing in calls to the library, are +correct, and in accordance with what the documentation says +is allowable. I have tried to make the library robust against +such problems, but I'm sure I haven't succeeded. + +

+

+Finally, if the above comments don't help, you'll have to send +me a bug report. Now, it's just amazing how many people will +send me a bug report saying something like + +

+   bzip2 crashed with segmentation fault on my machine
+
+ +

+and absolutely nothing else. Needless to say, a such a report +is totally, utterly, completely and comprehensively 100% useless; +a waste of your time, my time, and net bandwidth. +With no details at all, there's no way I can possibly begin +to figure out what the problem is. + +

+

+The rules of the game are: facts, facts, facts. Don't omit +them because "oh, they won't be relevant". At the bare +minimum: + +

+   Machine type.  Operating system version.  
+   Exact version of bzip2 (do bzip2 -V).  
+   Exact version of the compiler used.  
+   Flags passed to the compiler.
+
+ +

+However, the most important single thing that will help me is +the file that you were trying to compress or decompress at the +time the problem happened. Without that, my ability to do anything +more than speculate about the cause, is limited. + +

+

+Please remember that I connect to the Internet with a modem, so +you should contact me before mailing me huge files. + +

+ + + +

Did you get the right package?

+ +

+bzip2 is a resource hog. It soaks up large amounts of CPU cycles +and memory. Also, it gives very large latencies. In the worst case, you +can feed many megabytes of uncompressed data into the library before +getting any compressed output, so this probably rules out applications +requiring interactive behaviour. + +

+

+These aren't faults of my implementation, I hope, but more +an intrinsic property of the Burrows-Wheeler transform (unfortunately). +Maybe this isn't what you want. + +

+

+If you want a compressor and/or library which is faster, uses less +memory but gets pretty good compression, and has minimal latency, +consider Jean-loup +Gailly's and Mark Adler's work, zlib-1.1.2 and +gzip-1.2.4. Look for them at + +

+

+http://www.cdrom.com/pub/infozip/zlib and +http://www.gzip.org respectively. + +

+

+For something faster and lighter still, you might try Markus F X J +Oberhumer's LZO real-time compression/decompression library, at +
http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html. + +

+

+If you want to use the bzip2 algorithms to compress small blocks +of data, 64k bytes or smaller, for example on an on-the-fly disk +compressor, you'd be well advised not to use this library. Instead, +I've made a special library tuned for that kind of use. It's part of +e2compr-0.40, an on-the-fly disk compressor for the Linux +ext2 filesystem. Look at +http://www.netspace.net.au/~reiter/e2compr. + +

+ + + +

Testing

+ +

+A record of the tests I've done. + +

+

+First, some data sets: + +

    +
  • B: a directory containing 6001 files, one for every length in the + + range 0 to 6000 bytes. The files contain random lowercase + letters. 18.7 megabytes. +
  • H: my home directory tree. Documents, source code, mail files, + + compressed data. H contains B, and also a directory of + files designed as boundary cases for the sorting; mostly very + repetitive, nasty files. 565 megabytes. +
  • A: directory tree holding various applications built from source: + + egcs, gcc-2.8.1, KDE, GTK, Octave, etc. + 2200 megabytes. +
+ +

+The tests conducted are as follows. Each test means compressing +(a copy of) each file in the data set, decompressing it and +comparing it against the original. + +

+

+First, a bunch of tests with block sizes and internal buffer +sizes set very small, +to detect any problems with the +blocking and buffering mechanisms. +This required modifying the source code so as to try to +break it. + +

    +
  1. Data set H, with + + buffer size of 1 byte, and block size of 23 bytes. +
  2. Data set B, buffer sizes 1 byte, block size 1 byte. + +
  3. As (2) but small-mode decompression. + +
  4. As (2) with block size 2 bytes. + +
  5. As (2) with block size 3 bytes. + +
  6. As (2) with block size 4 bytes. + +
  7. As (2) with block size 5 bytes. + +
  8. As (2) with block size 6 bytes and small-mode decompression. + +
  9. H with buffer size of 1 byte, but normal block + + size (up to 900000 bytes). +
+ +

+Then some tests with unmodified source code. + +

    +
  1. H, all settings normal. + +
  2. As (1), with small-mode decompress. + +
  3. H, compress with flag -1. + +
  4. H, compress with flag -s, decompress with flag -s. + +
  5. Forwards compatibility: H, bzip2-0.1pl2 compressing, + + bzip2-0.9.5 decompressing, all settings normal. +
  6. Backwards compatibility: H, bzip2-0.9.5 compressing, + + bzip2-0.1pl2 decompressing, all settings normal. +
  7. Bigger tests: A, all settings normal. + +
  8. As (7), using the fallback (Sadakane-like) sorting algorithm. + +
  9. As (8), compress with flag -1, decompress with flag + + -s. +
  10. H, using the fallback sorting algorithm. + +
  11. Forwards compatibility: A, bzip2-0.1pl2 compressing, + + bzip2-0.9.5 decompressing, all settings normal. +
  12. Backwards compatibility: A, bzip2-0.9.5 compressing, + + bzip2-0.1pl2 decompressing, all settings normal. +
  13. Misc test: about 400 megabytes of .tar files with + + bzip2 compiled with Checker (a memory access error + detector, like Purify). +
  14. Misc tests to make sure it builds and runs ok on non-Linux/x86 + + platforms. +
+ +

+These tests were conducted on a 225 MHz IDT WinChip machine, running +Linux 2.0.36. They represent nearly a week of continuous computation. +All tests completed successfully. + +

+ + + +

Further reading

+

+bzip2 is not research work, in the sense that it doesn't present +any new ideas. Rather, it's an engineering exercise based on existing +ideas. + +

+

+Four documents describe essentially all the ideas behind bzip2: + +

+Michael Burrows and D. J. Wheeler:
+  "A block-sorting lossless data compression algorithm"
+   10th May 1994. 
+   Digital SRC Research Report 124.
+   ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz
+   If you have trouble finding it, try searching at the
+   New Zealand Digital Library, http://www.nzdl.org.
+
+Daniel S. Hirschberg and Debra A. LeLewer
+  "Efficient Decoding of Prefix Codes"
+   Communications of the ACM, April 1990, Vol 33, Number 4.
+   You might be able to get an electronic copy of this
+      from the ACM Digital Library.
+
+David J. Wheeler
+   Program bred3.c and accompanying document bred3.ps.
+   This contains the idea behind the multi-table Huffman
+   coding scheme.
+   ftp://ftp.cl.cam.ac.uk/users/djw3/
+
+Jon L. Bentley and Robert Sedgewick
+  "Fast Algorithms for Sorting and Searching Strings"
+   Available from Sedgewick's web page,
+   www.cs.princeton.edu/~rs
+
+ +

+The following paper gives valuable additional insights into the +algorithm, but is not immediately the basis of any code +used in bzip2. + +

+Peter Fenwick:
+   Block Sorting Text Compression
+   Proceedings of the 19th Australasian Computer Science Conference,
+     Melbourne, Australia.  Jan 31 - Feb 2, 1996.
+   ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps
+
+ +

+Kunihiko Sadakane's sorting algorithm, mentioned above, +is available from: + +

+http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz
+
+ +

+The Manber-Myers suffix array construction +algorithm is described in a paper +available from: + +

+http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps
+
+ +

+Finally, the following paper documents some recent investigations +I made into the performance of sorting algorithms: + +

+Julian Seward:
+   On the Performance of BWT Sorting Algorithms
+   Proceedings of the IEEE Data Compression Conference 2000
+     Snowbird, Utah.  28-30 March 2000.
+
+ +


+

Go to the first, previous, next, last section, table of contents. + + diff --git a/bzip2/manual_toc.html b/bzip2/manual_toc.html new file mode 100644 index 0000000..d4132c4 --- /dev/null +++ b/bzip2/manual_toc.html @@ -0,0 +1,173 @@ + + + + +bzip2 and libbzip2 - Table of Contents + + + +

bzip2 and libbzip2

+

a program and library for data compression

+

copyright (C) 1996-2000 Julian Seward

+

version 1.0 of 21 March 2000

+
Julian Seward
+

+


+ +

+This program, bzip2, +and associated library libbzip2, are +Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + +

+

+Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: + +

    +
  • + + Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +
  • + + The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. +
  • + + Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. +
  • + + The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. +
+ +

+THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS +OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +

+

+Julian Seward, Cambridge, UK. + +

+

+jseward@acm.org + +

+

+http://sourceware.cygnus.com/bzip2 + +

+

+http://www.cacheprof.org + +

+

+http://www.muraroa.demon.co.uk + +

+

+bzip2/libbzip2 version 1.0 of 21 March 2000. + +

+

+PATENTS: To the best of my knowledge, bzip2 does not use any patented +algorithms. However, I do not have the resources available to carry out +a full patent search. Therefore I cannot give any guarantee of the +above statement. + +

+ + +


+This document was generated on 23 March 2000 using the +texi2html +translator version 1.51a.

+ + diff --git a/bzip2/randtable.c b/bzip2/randtable.c new file mode 100644 index 0000000..983089d --- /dev/null +++ b/bzip2/randtable.c @@ -0,0 +1,124 @@ + +/*-------------------------------------------------------------*/ +/*--- Table for randomising repetitive blocks ---*/ +/*--- randtable.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + + +/*---------------------------------------------*/ +Int32 BZ2_rNums[512] = { + 619, 720, 127, 481, 931, 816, 813, 233, 566, 247, + 985, 724, 205, 454, 863, 491, 741, 242, 949, 214, + 733, 859, 335, 708, 621, 574, 73, 654, 730, 472, + 419, 436, 278, 496, 867, 210, 399, 680, 480, 51, + 878, 465, 811, 169, 869, 675, 611, 697, 867, 561, + 862, 687, 507, 283, 482, 129, 807, 591, 733, 623, + 150, 238, 59, 379, 684, 877, 625, 169, 643, 105, + 170, 607, 520, 932, 727, 476, 693, 425, 174, 647, + 73, 122, 335, 530, 442, 853, 695, 249, 445, 515, + 909, 545, 703, 919, 874, 474, 882, 500, 594, 612, + 641, 801, 220, 162, 819, 984, 589, 513, 495, 799, + 161, 604, 958, 533, 221, 400, 386, 867, 600, 782, + 382, 596, 414, 171, 516, 375, 682, 485, 911, 276, + 98, 553, 163, 354, 666, 933, 424, 341, 533, 870, + 227, 730, 475, 186, 263, 647, 537, 686, 600, 224, + 469, 68, 770, 919, 190, 373, 294, 822, 808, 206, + 184, 943, 795, 384, 383, 461, 404, 758, 839, 887, + 715, 67, 618, 276, 204, 918, 873, 777, 604, 560, + 951, 160, 578, 722, 79, 804, 96, 409, 713, 940, + 652, 934, 970, 447, 318, 353, 859, 672, 112, 785, + 645, 863, 803, 350, 139, 93, 354, 99, 820, 908, + 609, 772, 154, 274, 580, 184, 79, 626, 630, 742, + 653, 282, 762, 623, 680, 81, 927, 626, 789, 125, + 411, 521, 938, 300, 821, 78, 343, 175, 128, 250, + 170, 774, 972, 275, 999, 639, 495, 78, 352, 126, + 857, 956, 358, 619, 580, 124, 737, 594, 701, 612, + 669, 112, 134, 694, 363, 992, 809, 743, 168, 974, + 944, 375, 748, 52, 600, 747, 642, 182, 862, 81, + 344, 805, 988, 739, 511, 655, 814, 334, 249, 515, + 897, 955, 664, 981, 649, 113, 974, 459, 893, 228, + 433, 837, 553, 268, 926, 240, 102, 654, 459, 51, + 686, 754, 806, 760, 493, 403, 415, 394, 687, 700, + 946, 670, 656, 610, 738, 392, 760, 799, 887, 653, + 978, 321, 576, 617, 626, 502, 894, 679, 243, 440, + 680, 879, 194, 572, 640, 724, 926, 56, 204, 700, + 707, 151, 457, 449, 797, 195, 791, 558, 945, 679, + 297, 59, 87, 824, 713, 663, 412, 693, 342, 606, + 134, 108, 571, 364, 631, 212, 174, 643, 304, 329, + 343, 97, 430, 751, 497, 314, 983, 374, 822, 928, + 140, 206, 73, 263, 980, 736, 876, 478, 430, 305, + 170, 514, 364, 692, 829, 82, 855, 953, 676, 246, + 369, 970, 294, 750, 807, 827, 150, 790, 288, 923, + 804, 378, 215, 828, 592, 281, 565, 555, 710, 82, + 896, 831, 547, 261, 524, 462, 293, 465, 502, 56, + 661, 821, 976, 991, 658, 869, 905, 758, 745, 193, + 768, 550, 608, 933, 378, 286, 215, 979, 792, 961, + 61, 688, 793, 644, 986, 403, 106, 366, 905, 644, + 372, 567, 466, 434, 645, 210, 389, 550, 919, 135, + 780, 773, 635, 389, 707, 100, 626, 958, 165, 504, + 920, 176, 193, 713, 857, 265, 203, 50, 668, 108, + 645, 990, 626, 197, 510, 357, 358, 850, 858, 364, + 936, 638 +}; + + +/*-------------------------------------------------------------*/ +/*--- end randtable.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/sample1.bz2 b/bzip2/sample1.bz2 new file mode 100644 index 0000000000000000000000000000000000000000..18dea60043b692c86b095c06123809f10430fd03 GIT binary patch literal 32348 zcmV)SK(fC=T4*sbL0KkKSHmnQ`z4QZpZI}+h=sF(j*~91%1ONfOn1F7* z-MjAAZjVjw=e7&ZO0eVGHukfP%(m-?qk6F|m?^WHU3+(LZMk!&TXMU&b+7@5gab`< z7q4S)tbMg?c{{V{Xb#UU(@DF>wQqPH^-iYauWnxRownZH?;B<8H=gYfalHo!=otk7 zqh5UXX{T)1!hMbKr+dD>>~FR8zWd|RysYa*0YrvL@mvO*9NlZs^pu4Sy!PIoUijPR z*4^(r+uh5rdEHIChQ#};$ z0;lA}%6XwrO*B*RjTHQbk?Dw;iKb6QHkvU{B0P!eZ8T}3W{nYr2B)APAb}tR2_A({ zdP(AXj7AD=Q#CzL)K61t9-sgk0L0J(KmqCidW{-r0iYhB000000009k1nms0;s$v^N)712gfYGO$Y>g-^-n0%PgB!PBgyEdj6?M!)bfGq zHle1PWN7soXg^eGka{MXdVmcL2Gjr^pgm0wP&5Gb2dH|6nrVping9rtiJ=MUFq*0U zny0lenrPBb&@|N9G*2RGdNlNpQ`DFZG|Z-+lhpM#ie&tg)X6rdgomlNk?B1t>TL|l zo67?{( zdTO2x7@AYkf2x}k5k09i@h6ltdNP@m4;1wV(9~^5>P;S#)OkbD(?%hvdYP2dK+`6k zP-Oj0LrjK))XC~Lp{IOiLPQg*Ud^mA%Qk%)b!gYKYinW>KaiO6GBG8Pb`pq&XwlS2 zX24C5aFH}5;D86)jDhz*RDM~m0X;J6kkaKw6}U9}yK?DrQBs;ra6>RLgvd(?Dnm0B zMHQ`SN{a?4i>8W3Fj6dOXt9clqO3$!VVQ;s#4RcG1BggrkU>^%%E3h$yJ421<)R40 zw=P_{O0Bgm3L%!PSfpaB1yvZLsalX+YB^}d7RuU=G*nnDRB@@8Tv0$`F|8YF<*F*K zEefKFnAKGV+QCmj*pX4D3#w76cW_eCDqKZ~u~>+RuvHo&W@5#hecA7bD+UTIRf`Gx zyv#tZxoZ9fbc@1g$|!%C171Nfq8E;Y>QA^<4}5x3qjXk*(wyO*H78L zZWu>4P%}_NfI!qmZ7>e15-A`uBO+*G02h8$09}lc8lWm$A}PL75Ed#Mn2B-%9BdY~ zSOvJsEdokg1SAi{l8hJ&0TBWT83hOm2!Fp}WJpOB?9oW86i{On86gxT2^dJlzu)RGE_0x}LHsWd}JzzIHyF}dN%gk381O_3~PNhoKx ze+&?Rhs$1)`!Bt)PYBkZZRd^R%9%xj>2HWNs|F|bpsB*8wx5%i5r~KGc_3>8Ll!Er zI{s5XX$|k#GP<>Bsef~r2*FfbYAl~_(OH)NFc7p{WwaDTQdTXrYg5jXqOMZ5 zl(B7*QG%DU1i48eXqA>IswyQag;ABMYBUrg#aLTth=rv^YD!dWj8sIGsto8fR9L5= zk|qw7M@>@MRj7?(lvGCB3e_0PVMSCHA}TR0ve+YHwOJG@En>E!6(}o5^~q5ggA{7Y zT2irV3uw}cM6_6?N~kDNgHpw*P*{|Ah9)JnDps^aQGr=YM$l_T1Z1p6+a+M2lr5qq zivgoW;L2rM3ewhwgv|Z5%(kxW5fKp;GRh^btwD@!jioGB+LThI5gN9t)+tz^l!R#% zs@p2rg{g|+65&>ive`yb*0pPWIRgwtYE)5brM6YI6lAjt^HUKuWW7YQ?ryOP+B{{L zoV85<3tQLV?}9@LZ{+*70slp-%<`d2Khg|1*h>c6xeYB}h)4&7{veL|l6qoRKoJjL zK`P3!L+#ORCNQj|W`De}L3?$1u>DzLmoQNrqYcHY@AJ^^FhQ23pU;`HmNQ5h1jPSDjdGX! z`JSJ`<;6g6s1403L@Ibpv(Wh6OwxQAHU9r`zxH9I9(;S0L8;)AMqVD?RSO4UJb7eO z{`oAc2c_j{cIwtKh z?G(JmZ4y-BpfXSVSrugGn=vHPMS~FlL7Pl8B0qqdY?=__cW2cXpCs~SZ%aqvd$e$S ztheBCq9g#220@Wo5e;fVq(YHoRgnRtQbZ^~WCV!835%7u^P!r;&Uk*`<9Yx_5Rjjl zL1K|&!YYES7A%or0c4OEC<6!zDG*i*2&5E>K}akV5EwBKixfdY85B^FKo${VizE>+ znSp?omD?kCu0*#akVS7-PVl_R;CX54`=9Bknz&z}kWxfUfCz;oh+O4U+?jf=UzJV< zr_LvrJvcNj=smymFdGtrPZSh6gLBP152g+dh+D3YSVwxJXiVGu=tprln$iV6~>f|8+F zO2Ann#R#w}q^yLbAj*p+5UdEYuoO^=6h)Fzs*zxbjFc>v5sYF2!4d+5s*12iL|`Z2 z2jcly%F!V>hfksDxUV<2^iC%>TE?LEJ6;ID)=h4Oz7mu)0S(!CpK}bepfucmy2T*N zXtGCtK{=y~`3f1_0*&99 zAtZ^82hE-h9}p;k17*ZUG!D$@>64%Z2L~n9X2^xGxYx=CaWVD}AFD1cb&HWX)l$M`l-q(R)H$aZ#&L&vznyAzTU@mn!Iy%_ewMiUps+x zEU}@|qoLutgF&nWP8mmok_n%R6oL{WG9nTn$w(}Ta~$ss6MS(ewB+~u9>X{D2~_{f zx)ZuzgOG!KUKd%+&IrKu+v}LW3zra17%aJf;*rE z?)rM1{wJGZA9;(8Je6TatM9`5yL+X7QTf{^yj}5+(fC&t@x#fqUp|j@+#R`&UrB+n zWIn#}eXN^VDJ7~Ak<~XvP?bL868SWT%Ia>gUO90N&bzS8d{V|+C82X2AtvItI`5l)UjhOyi^*ZZzGEADmHEUjn$a6R$*yK*Y)4>2)vq-n zS|85;MrZq9e{VYr@-*OG@kZ_+k?Z&jtlc9MF^qmc%ikqmhMf?T^mGEYMpn$q>HN6t5hsfyQwtChKu@>ij*%X(B@%M-Tj}b zuN&|taI3$s)|l~bmFF6WuKa5I;60raqBU%>iMYoMTc$O>y*@uj%SiE>JX);%1TR$3 zF7YHEncVaGJ^B_bb$Y1?Nh7<-CiS$ENm4|VNkpC=)9{%~dgO2<;|WNQr0O3pegAl_ z#_t?$?;|3<25V0~aua2TNXvcwYV@<(P7!TK-^sYc=DRE{QwEtM?9=RjvG4uQ zD80TvEi3F&ALUgHQ^JK?C`7UkmyAI8J9^jTuJF=O87>z~zI^ne?dZJAl=R`C;J!q= zaBT@^UqcD_P%(S;nExtg)(*UbdCwX9o@LdOn4hxfX|&xvP5Qv?j=p&Mx%X$zIFBnL zm40%nd#%_?MFvpgFohwfYF*+=f?oPRkQWEax+EJBgO zAadTWuR&^L?J4xHEc}6vHu2tcUOt>U{j96516 z4{eR4&8?At?fvh+R`++4w%)ov(zRJ|hp(+9%G7IAg3ju-2=cTWQbDTwfSZ^@7vb1o9N`=LRYv@fZI181Y~i}XDlv>7 zAK_rU^*5(T-}-s-gAoC=nzkN1v$Woq<{p1vM}gE7-WWFA%N!1 zPPY)yFN;)E;9eFFan3PRyf4F4#w z50ZO;tmm*WQw0FmSXt{OcEhA!U<@2KSn6tYeN|k}n;531sH<5scsTIJby9QjP)jAt z*`#4jtC8d3jkw@ap5b4cj0J3ds|_4_Q@?+9(@*8={;qA|w)_jf>oM^vNhJ3Os#(b8 zqne)1gD3S*G4MC(`A(bBtX>#cH+Q8NP{xeN#vg$$T%qruEscr7$(vS7*(`CzBE|3W z?!y&n|Tk$&XZOB2Q(c?BVF-BjQQiHjcmQXRuxxIfLe`Z{q zT7_+Qm4VRK*eR1XuT90@Z*nC#M&r8Id)@sG3I{#oJ;eE;mdzu9&o0wiE^?BXL9_|$^3=kcC>=}`^O zkfvdxSKeuDYR2f1JZ#ZwS(`m;iNB6n!IP(ndTI#L&clGiU zFm9md&LxnNNg+f2E*yAY&a|lc-Q@jQllcDMl|J25VEEjTjdD znca6_+c3kz&BlpZv zce_Ff8_j>;z8a_!lHt_Ro*B1SmzcCrxsHb?Wtl{qjN3f*+)rWN4(?~~-qc4rM8v6x zcz0Jr$sbOc4BX_Kp%@TDrxW%?`3bnk?65;;@hJK<|MZhZb1@}95{N=S)!W+qPnuU# zd&`m2m9=Nf0|8xF5@2PGsHe3rX_zN>JS?fKJM@sf zh2E`1*UZ7Rz?vFiQ3sf_Cq^*nVy1T@-1f_Hd z|2cn+!PF}r8heY*>%YI9!;)+QHa0VJHvv8Zfu0rDImWXe zoaS4(v19b?xvQ-}E$i*YLb-3)COJa{%qg(iWN?FR@yUH32CfDrKN{SR4b!QOc)#Su z#<3)x+6ScX$0ppvvTnVtjLm$DQ+*=zjz;;Yrg-X48rHFls*=@A^go}IlLNz4zFvk0 zE{aN$sRy^nmHKFj+wZ`&0hdC9q%+^#L5}}8*hR~kCr*M8D*BUWA$C3FFVrGoLWM-# zT`*wK`yb4@>Ix1DU#a4e{FVo9#?b?nj5uw}!=0?s{@d)m?d!YM+;hfql}-BQ@cd{; zGP>FPois~#v}Z%Yi6d-!E$L?V63N6%Kmpv@dlRBeD54Y?DR!P(zv{Xds-UCg!=GCwba^W@BHUdMBr-E$Qb z^5Oe#X2D%I1$D~O`q7PS;zu5vbLC!21qkm@?18N4p8oRNBn^AzVBfVbIq0Um?s8ae z{yWy?o~lby%Z%i;7Rt!o7e8C;EJ{;AL)Ka=H+(K7l+=;HzGH)KvZ##0Z?1uoVJ}%2 zm^Jx~4WO(Cr-BOEUKBX2Tnuf!O%lS6EE{M1iqDMi;B(r(uBpVY19i#URL|QX4Qt-0(%C(y$ zGE+y3;I*(1@S8Q0izn5yR!XP%@6%kGJ4dOO#1aGkKoNjN+o*&fDiR`r8ZrtAA}9<( zD>pYSm^W8hSz_P8&O_T?qTh@nghONflnytf?HpcPf4#{4zKA{MLtSr&J;r#t-w`+S z!^06D|3dv?>-_@~mBLcOVr_QBs{_6Es3V5=JI)fd;Kuizc4lM3!L!X`@xd>{^oef7 za2*5Xcl4U3lYRcxn@*a!^WWq#`5>L0*$7I5SGmzJ)-cGx8?{kt^s*pRmYqsv0L`F6 zNeE2XQ{I~VobSZtF3C|fzvmbYf8M=cVddFao+%qYmj2{w)&>kuk5bR+qx2Wl9X{a! z(nR|DT`ZDBj{6_ikL}uyu1GEMcqfT`91_6s_&oR(t0H%@M57lf%5+x6ePD2 z&#OzMjX`O!9uIpgllb2D5BOB3RZ~OIskD}y(;mJ-TJ}s2z(`!x>HHX)COq@%oOz(t zCg3!*yEt*{t~ad_^k!gc=SBBUd(x{@{b2!mbC{=a)jsRw`K5pL^LY?_f@Mn^6htU+ z&(8PPV!KtGD8Ayc3cx=QWckb>Z4}yYi#Sn#0{$28KNF|g`-h=BqiAxOW{MXBtcs6n z`xZXZ1)KTAFKJDh?k}+@5af(tSNEh<$AgDDSFfJov_+5CrCq%QOX}$j`xVjhvGdY# zt_@|%YGqm@wK6C_g;ifS-M^+&Emm2 zn83Es42$_mMU;|9Q5A)fN+`%wJElf3ru-?Ev7;_Y2eX9zw!OWCr|n9JTQINE&J z7pi`}mzL%=($Ke;t)@)bQ`pQGx8}04bg1-CVM%9qVKEaXsgGW&{r(ua?hvSh5*_69 z_Joa$bHPLXpTwl-&*IrXTKx3VL1gMGhfDNlh90L*?pjYZmwO!_BgV|vNZwJ*WMV+G z+0?(W@N6HW^H9e2t`{Li<<=gbyPMKqR#zGmrg+YFSJJgtubu9pdDqjp`^;jMy%-b| zX?8OerfKjeZ-35Z9-PgZjwwYP_JXY=A2>z>2F3-3=2*%ml`<#u9lk@70JSKllBe&| z3=jx4c}BeuqUmqQ=vBqjqI6^?Nmz1(exyd~m<6UuqKNXp{lzwD`MjbxH~AToY$L2CjEb&*}w@MGO z6>?)wNv98YJE*xJ+!0ooz*qvyXW(+ScK)63X}eaxtJ=<4>D74-CFuOrZhqV;znDMRqAJ zB~V>d2k*a&zw|6QA0x)6%e>fhnMn6gLex}4B81oo^}eFi0We6N&?D0hbzS)$&Fx-m zM&2FfchMxtL(ZPd2wHt9-h)I?nh%m`!4=6eAT&asVmHYNPMf%}t;NNWlJ2$+#Yx^Rh>c-2}Pb@xmIrKingxDV~i3;1)I1xNrL>Anj+^p)`zQB zBf0gw9qF}*$s~D4U1y?j-34Tte8gG~tv(&4(JQ8AP?$~O9SRddXC~$xq$wJuYO%bc zENHttU<1C22ok1ghQmsbQ3fewNlW!sBF}sehuQ49N5s%|g%TsO4N2u8C6@tn`L#K{4cSoo0uC{PN`@&AcS+;_WTPM#6*UX1HLk7DKy1Iz8p^(_&0G z>%T;Z=(^oxJ9NVqtJFwKSr+0^h3~stu;t_#JQVqdb(5WelN|N~#R3&}Uiuq#)IMgd z+$Pdk(U2l@Y4o-!-&9 zhLr}r7|2HRhuhMMWFXXyGtmtpj6}iqCXMYtfVoa!$@=o6tOR9;7Wo#w`{{dVUMj@$ zA(yRt@~N27Fxq3GDQUx^Vwq#XGCdF@z2e9gH_Gj)3=woOxpgt@nd+^Ar#pn`ENvpt zyBz!ow5LqvcWbIAAQhI?6U|Bh@Nra{9inP*KECni^(OKAgbW@byPNR^^wlqwoIFQ~ z=Q*~Q^!Amv@p!GdxX5K}g%j^d;%XXhl4eh*fF9l1}m$yb*>;{j&8Rblm3JgcMGG)3Q0D)oEvh44lUIzoa0j2O>_ zg1h2!qI@sjJN>(1uhCdsgZxfh{=X=P$hFt?cw(lRSt!9I9#Gc4M2{**lm5_tvomb^ zsd7AW>&kE!{yJT)5Z~0q0c7Ivek9SVexo{vFuJyV5@04E@Z#2?1d}Sx-gFII@eUGW zJenkUtihcqt=`jSFHx2J7PV(|FL=y|Xw(FTXJHHm#6IiS>-SZ?7-0lFB2cOdt_>U? znfc?pTH~)w`!>2L!d(wp*IK~ovgIsGWer1xY~nj6M{-;$X`9eggw*KfOK`G_3~6jj zi;%(=1_eoyTUv>OCryF(y%71EPlVT6ka^K5*bjfGczoMgr`16W8mN*uqbRAROGu?; zH51RMf_2%VZ93)eFBgt+=ybNCs#b`i)avwhDvlz_?RDw7{C;(NL&46F;0MKi|C77o zZ`Szu(mk(ZMYqnTEohWVDyB*KmFDC|gyCzsVA=|XB-Xuj7y5dTXddm1-?A{{SKcZ}ueAosHj zvPhs0u0aUyXgTua9AT&ID)Ce;zWeH$N2a9WeBW6*;k#Fcp55|tclMZuRPAVrpRT0m zEaucv`YSrK4>no*hsZL|EFqo&uL@(41X+_CyLTG?M{1zwM)MK=7eMtVFJHrB*ViDeE;d7;6keI~8pK`UoCdh2yrL1fp z%cYqbFGGGZ$i93S7`HGbjl7*bC+KwXF=cERaYo~)^KDO?_c8kJ&rV2k!sm`6Av3z+ zADB<^zE+3C{&L3HX^j950}~~QkWeGjCgXAFuwquiz91BAeHQ8<&D#|eS>10rr=9NV;xjDO z);hTDTx81^XC`{grj)QC8yM=y_8oW@Z<$>yHdAPv9*a)5D)-rLXuB(7o(xytd4flg z>G)a%uTLMy;EsmAHhm{wrMD~eEG4zaIigqyo~t$y{ZxS?s&tyu3{kjMWk0(ks$v5` zS|aTx(muZFZ9gAzmE2)dR)GTz(rcZRJgEmaOZuvntwsu|d&S-f+>4gNMM=VLbo%et z@~-qxLFA@}&n=d7MKrWrs*~8_La_Udf{`QS`F)o4Od-?>wM4n0fJfTP{V!C5i{c>R zkuXsdn86<@f%X5=AiWShCU;6^dlsq9sx9RnUcL z0tb^zJ`l1VIKy9m3k(Zt3zb?`+1|4#f!}4e6&ri0lfPOZf|RBWGR4%@$;FyYxPYQN zUrJ_f*05d>Z5Ajw?k1Uti_&f}Ly!`NksAXQ(y2?TWvLSC6I17&tlq8FWiv0e(6?Fm zFECtRCocyiQQr)Ri8bd-ItI)NUChfm+Y2VHhV*5kwro`*YqniB6SsPxagUE4 z-E+`V+0r74pd|HOW)z6UxJ}C~5Rg!ARHAmbETD0i@nj6}S~5zpRgkAO zpd0>M)@TrdYEvFzWeKMWJ50%_&feHC%fvF(tb<|JVapMIgt&1x%bXyg)lAoQ2Qv`0 zeT8$Dbj}8|MeSA+UUn^RcR8<2mmGQd4q>^u>bQz_XS;luarghP^XWLePM-pNCue+~ z!gAL+)fkbr#R87@;!zotSH?sCkYt!Jnq+Ad$!|K`bG*jV2<``A?J!QaRn-%v{7>fU!eb3=N z9c)0s@7*5ZkCZRVpf^WE`a{=vB%1dW*^)r=@jee%&imNSZSBPq>7yxNi{ctjox%on zh)9)`67tRT*#UpW8_UgABKyUpJSw&|ZD5XvN>(=1Pgh z8nvE1LaNzIhZ$Il!b8zb(JH}UPULN1m6VoLf*O@AkraJhmJ@8UC~)a>F<`Omg;@s* z6r~_8C@Xj{<#5xL1hFiLRs&wf=X{rovn#AFzo~oREH{I zf@UP+Nm8i-$quHf#X~j4+1?>@QV_jt>-Mjk+2YrfB$tHDrk*Uo?M&D-J}lUVg=zz9 zJivgl7h0`$798Kx_WrM`z1bIDrOyuc_qnA#p0N{bEp?RYhN=iByRzm~G zv)g#MVnVah4-*&jRx@&LWrtBrB#4E!o~8?vD2&J2mG`R)iLxDtVZp$C@*un5L%W?lo)cNRpSr$h_MLh(_ellC1GM3<#~oG<#Gu^c2{c@0^GdCAyU=|h49g)Hef>tKyO5;HWg)N!!*P~5bO&} zxv1+WsA~9?1x3nSfKdwL35rN?NN5dKc1pspeAkz(v6f&D@c)VFD{IzPwnbpLcmjHQ zJcueBDWM{GQDOyp#W6wU)9@!xi@+NU%6v+{5+mnp)X;b<0^o>xI0}M-0t7C6^E1@I zOM6+}$iaSaT6NrROvnmzt zj@crZI1p;3^3~Ed6L!h6Zwz47P5q?{3ug??UqdZ(aFx!yxkLF$n7o6!1eidK#+boH zXjo`0`J$tsfLIXyNT|M5Eel3VBG|)%Rt3s}P>EE43!r5HDAlRfT2CuMj2T_56&s}!Au37}DTPrS)!e=2FFDxf3-qYRj zQfZu7;~u+HwWKbOM%dyZtTV<MZ2bxBSh=zninfIIV=>I zkO@6;RY5?v5eDlF_5Yd1{k|Yn7xPRH-llG$WUtPfoIwr!!}X@HH0lzp z3+piqF``k$`7SY<;d>ccIeB35)<_dbZD7V-63s3-UmEH0;&(}2%hSmwhIW>4awr-Q z+M$kP?(3xfSu(3+RLnkv+zmd-Gysjm+G zLrb&S*eD4)^vG;Os}omYTp%Qhe?j;#-#CrW2{!kQG;mM0D^4Du#S5POU7U{`+38{W zwjF1Xv4h`nRw?+eUewX*x^U7QnhYG8nhtQyC4r09h1{}!HvT)$*md(0HO%go*}I7+ zWc;%sUnHp%kw91|DWoWgOUF5b;gq>Y5wl5(6xFIt0HBGpLBO_GWyLdb?$*%P1>CFu zlEct<*F@-c@pBrLO3Tx=(u@_3=N{eHJMw-vzjfH+;ER&_Lm~U81G$Bec2d1lGNH<3 zzC3ud4T~Y)g$`{XSaZFWS4J^HV2czWprVos77HsNSc(g0zJ=dc)aF@Z6;XAVR|^#q z+iS$P?JVm2N3q=AU7{yHM|Q__tWc>&Ek!8BMX6}jR4cmz=a+3tPEg(TCP?Ax2boE2 zYc2^VZd31_7pp1kqtsm6Y{#4<+jJjfG>>7@wOrBcr6BtB0W60y5Vr6*iV1CtaThAh zJixf1EQlyGpE=o8NdPee)gs>x%|$kYk`NU<-%@RuXnwt}8^TZxIA^dg5bZ?-@$MIhu#$BMWiqGBBm(@qi*p zK0;p7!f!;wH4usm0gCN>ji{BO<{`Ffm_UqR-AZKqSDO*uL1iMkdD^79<)-D~6v0BNxJs5>1)R z>N04sPlw?ZW%m!g5`F_SDHAb!vwjEJw;zdV3d(gyeAZQDD*a-)x7L)rRY5ae8$I!w zq0TdQ#4;kzLLm(J+mCZQ8jL(G9xkYIjQb}fK?TgMfx>i9<^vuQL(t6H+l#7Q+^D}U z%9^Oha+z$g)sCmRr)94Nn4d}Mtk2HPK(H;py5XZzDJzcx>@V9LJS3@pO%*JdSSBgO zM_yhT?#;!O%UpQY$SVK+ru7TJpw9NL|!1&4C0hOB2YLTFq9cU zG)e3nM-#69Kz9xs!p%LWe=2ydYThHJr1JVq;tP~T#5@x7cZ||)`xqOet4#`=R%s^mLS;5ng0Dd}f%6 zdrS{i=Ha`Wc!Wx2Lb5?{VOd*I3|KXG5sRz?Do|vZV3rof$1t{UQgwTEdeb3y1^qQg zXxW%8g2p8W1i-)_cVPQqV_%pNuyl!#lUJMiKA%iIpRWo#WaqDc{uB*ZFbbg62Bu( zzSBkG@G#A}&Wns-6pq6Jty~$bx?^?YK-vC^#n!1B8JV9W@`9?cWZU7NgVSF}OEf>D zWaz2UkLGFrdjODW^&BFaLu1o+JPr3!-kcybAw_&Dkkzkwc41d&$e~s?sf@(H+Z*h8 zA5piS&N9aGr_YE>)VSrxQI3z1Eyj1t6{KHV! zP`UeWS+nK-th7^_P(~%CL2g_X%)cu~rFX5(75cFa!)04XQ0kavSgwj>&rd@{sxp%A z_q{&`N?Fsho3Agbs6{5K<>LgzZGg6M=G>N_>+T0p*Vn%idm5Tmvtn=b!G0dcASVT^XF23D#Lx$3s81(RAnUdsPkH~ z27lO`3Obg*Yl~Ss%Gj%U&GQB10Tdcq*cHC@(P|B=uIQcG!bWa2Q-QX(gASz7f7ezv zBUAi5=`-8wPY=59GhV8_8OsVkPS6z(DiV=9>G!miLN1ihwj4?9YGlxoOArDhLx{0+ zlL4w$PB{LD2PlO5LG~5DBjr&G9aHo;;1=A}bm5JQQ^%3&uw)UP*y| zU#rSgHU09|E84Xn=CX~H;RujmF6Ve$F+#&Y!MY{rf{^%}%`Ddzk3cy=Xo4p1Fsm<) zsEI!uVYOfyWDN>7*MxIT*$Eya?wy?Rtb}*j7MS%3_0azte~bQt5qra zcdjJ8T;0*3u*~5nO(;8q6iKR=GNWyHuop4}Fd2dfvq>wuNNOG8ttUR2jXane9i2L5 z^UU#227OZ?b&2wxu#?_GNT7B)_f$^wsoq~$>yXr?;wu_!LT-|qDecus65XGL&l$j* z3MOdfn+oJPe+n3bXI~X|X>y}hHwaXdDI=n~w_5j^F9Y*QGI4C1VR9kA2+Xm|76c9wl)T|`IO2!d% zoG=?ipO%Ym;E^EHa5{_2^e#(T%(pWU5%s+lsHX@P%?HfzgLpgb^{_Zi!-E=iLoo7azcN1s=)Hh z@&ME&2$WF*!Q4$IG_=wvdjRJXf%w=^%QQ!gS4EU62$q?ZnQ2+J>Z`3dp|T&e{vhM| zW9Ti@bQosKIje#G6#qSj)fHu8@>jJ=zB&beGNd%@4X<|aqWwS3i+R?eEHOyT1PlW6 zS_=$_fGiwT(L;X!*tq={&UfOX!pl?;+H5y_F(VX|Ayr$FNf_u@o~fMCF%@_~P$3M3 zh0k4xrAKQN@w~Ot!tYGuYr}_Ph{7b#1E!|E6HBbz8`d(=z7`~D#ZIGzAqK5PQ396$*tg3=K zX|o{(vfmV-^So{Jo7EXXyMs2RKzhN-7k#C=X1)J|?l}K`V-=8FTJ+>`zJ=b&^-`J^yP1 zWL~Js-l>9Ou~u7Hh^k^1)chjmQnJ|4u+~g!{aw};atC*AsJ_Nm22HVHp))L)$*7Z8 zo>13YtixkD`>W1Ec0#s%nUpcs;+3=#qd07JB=4~TxcEgBn?WMu(*CU;X6EKT?v z9ks;y8G)QE+fxeBo&5@A(h4_((i||HAO`r9SxZ8Nrr9XSq6)`tRaJ^8=(e?xMY4j4 zthqrHEG>n1m6>HAXw{PgAF(Zgn=4BSh#59$nvu|2Fsy5A64I)Qd}>OCrBMV(Z%$GY zz+*6E6yB+o7MWh@Y1e%njS*`U2r6QSSPqQ>na*vfSi(ZmkhCxnB3hoJt4eaSA;gh5 z^1JHslmWCWB{-Hqfr&5h?IiT-P5TXC>_XL63(unHRtq&olnwKg%NgF)+$~bQ8Jyh) zt-6>oTp^7?FwIunG*t4_t!ioGRv2Abkek(*acV;tvQ|lY&wZa#^y$Y27fj@s5lv58 ztH#+EK|tGP{b?oVNy}~Ts38o-Fq(#DF(eykP|Dn->gKh)tD7!6gq<6|K;}1P#mknC z4|Y|_T-{M|HrFl7jun(la9~_siG#&TT@=AbBwXVQyR`@Q6OHR!%+yUySW+H2FzLKb z?O>sY5-mQ9G-`oPoAP_zD>zOH%3+Pfc(#;s)(gW^)ajcwbeQp@A(^%rm6qb>8Ey?R zd>U(5V2xWua;(M~UYRt=RX{Z2L1kpcDjMh;$mRDtgzwtrD*O0*Ie@+IJM3p+M7O9; z;cL>AMTcngFf#~Ch8MYo*0CDN!UiU4`RLXn6t>$PQ!)zrC~eR&*7AlTi_Wg5s%~pZ z>T9k^n90Rg-yIRVw^pK=2uLV^84weppz7fm6H4#}_}c?qOBo7*TGpQ1&n4a8j(kJi z(vKf}pM&!2(iJ`Nc6JEC_6|W*`#rQ6@{9qn6dGlFg$N8M@}PP8mZKiIM-?`|MRcViJ!}%^e?cpp6cZ^Aw;vV(*G__S zU!sre^*f$YvBHO;f#bt-HnBV1y#sFpmWXii&7*xYs1QUq<@#MAp$&TwE(@63^t~R> zw=h*;-I+!#g371`VNyyeITPk&m+QM1B;4l(v$xWF+h!(|VwF)OBuGUW2tr7~f-15G zq3Q9-{804+Hq&|r8;8@OU?kNFXl9u(W^ip;h#xhbV!+v|<4{sGv0H=)uw>I^7|p6= z9h(Qac<gsmY6_o6rf3Nf8fn)^T zJ?#n%(LluIrNkl;O!#`p!2aFbqgXjK-u@(gPQ9hMMV7Y+NdKGA<))TUO`?r%wZPQT zV^ZL*=cPI)gYG283Up%oTFf+BOgnV<2Yb=dc9g@#4WiDrkQ9oDa{Ca>I6U>r14Y7F z5OMZ0)f`Wka>YuuiF6z62_J{j@9{NP_w!E4woc>vFnQ^V(%ia3PM^S=J9N8Y#iUJv z(}rDNmVQQ90UyY}rQv!9*>45?#^plPK>TD?HRy^ zp3g4Wu-Qs{?kINYP4Q(+L#lT$#OBjzaLj8yF0;hv+xu#D9-zPEeJ+A~GVRZVZx(&) zviDQov=h3O0ON4c>Kda1)IQneV;nNCBdLQg6L-Wno?HyM!)eTJ)oi#&V{Y|!?BGvz zMDt@no_c(3KlW92aLPK0;(-ZMMCE~5Vfpq?NB7V!FVhk(0S`X#!I6u5z%bz#qO-k% ztfSRFTz&JsPYA5%JNR+$6j9%Y;<9_EPj|fb-hN7WF;5lmrHRtdFtX1NAI<#V(Rdw> z;!>TxM~qIX_FdB%rlKk(FPN?z_3LKkER7s%S{JN$w(H3f+gh0nA|^pJY25V2MeICA zf!)f@v9m)}Y!u2REn)%fmS}*1I&{p$-Be7;GAscemo7D%0}*7PQb4r`l0k%)Ol>3B z5I7Nup$~1lWW>j#JHD%Osa7Q6z*L6#69#rtHR(d`HyD8YZ%PR8jL2V_ezea1Z%pXY zVm;m-Ea>SnnL!MOyLM*E8#8NxqhgsyL86WbnU{VD22Sx^JZeF`1k&w$$_lXJi1YHJ zj|5GD-bM8af!!ej18YsR0pcgDWg8fXOI*?EMrLaes+7%_obn9>P)JM!lY9c6=O#6$ z5=)XjV=MPwQj$6kOXOM`EmKZq^rb})*}24<=@-en$a&PVV8kWs8Pb%8=F-$-N^shI zDoVTBRuI92{mkxQACFo>7cwY!xhBTD%A^}+T8r)_`UzQjg+0EIzl|po*$@#!Bmh{ay`^@NH2I(w;W|uS)(6r{1=3*^qXE zH|_DuaprEL1XsUuKd_M&29LRA=M%2zGkU}$yZZo1a5|N8-O>E^l~lZ0 z+|W}e5R4%xuMdZ0l>@X&TJz?4!!RDV?ZPhhAxnX7n;qcF5Jn+^7>GoUKJyw-^Px{P zDDB(58pBEIaMUUBnedaT67%+YPrAv5aFU1j52g}j`QIVD0p)3;;`t>TCDu! z57@*HOmnOTOD;1k2$Q&%=4>Dn9}J<@8{^9(A|RiIz2ivOgiJUyCtY>b4^~i9CLw27 z(dUYKd2tB42i76-Q0`(dBA`J@(!)%cf+(LqySt{l7e=+lsqH}d9cMEo zjgFwt$F)?wPA7GKgK+8Eh66R~Q6f(uFB$juA1jq(aL??qno8)ktuJ>}8$E zMGMQ)ibX!D3#b{LC>%XnY+xATLuMHDLq_7nHI=m7gfpNi#7?Yq1gIV9A>`o5V+lb! zm{>ZY>v+%wV4w)Bksf?0gA=P^*TP8;Ppcs)kr)+_sRjCvS?nXji+!x2wDo5n&hd9U z8M+vph6XhZ42;Vw74`HgkzlaPRJNAVq8ClVRa#iG#AgiZqN2`pwwz&R|1QP&Eg1jHzaxm~SD+PpNBjz0sL#<2S-RYW#sp$cp?1zU#qon80v8^DYzsX@kAJ*nzk0%~5&>Chm z(kDzS#*Yo_X}P-a(Soy0hLhqUrhGf+Il_)pmSjPG8doVrE0#hsW_UUp+eyP##NhpI}qj3cSmr`cuYcwSQ*+dkdy4({7ATYyFGh(a_lX-0mV=> z4sTkpDi9(p8U4<%&gBj=os^)V7dKsWe`h3y*}?uw7?}kKK5*R zF3M6eDy#xf&~yV7R$=*YC=|4HG4!54Ck+^BLe4@#l=^gN&>Aj+5$m6sm1Fsus=ne1 zhF4VGN(eoIWek^Y+A3|d17xh|YVD9~gq87EX_AREL+SU(Ry$LH_XR=kdH%>;{ z3EzG_6k*>d+Y5ch&S@4OgSAJ7z(HmR*yB*94}|ct`!CjuT;kHU;5w|3qyudGw?ol; z+JWkr)rA`k_T%WMfl8E>+LlVO3Tt4lixh7T7~ER$q%0wr2PrC?D+)w3-SoBpUun*4 z?cE`OU^v$=Nh1J)4V%L{&g-T7pJ*qz2fTN1F_S<+*a+>`;9_JG9IqwB2GayHCIFkW z>&Wp>YXP5A)sk{UJV4e{sN6e7*q+`|MG-tW=hVZ8Y&q%EikSr^Ed|^(D1w{yXC55$ zwL$DOg_mb;nnFlIfNa}q@=E`u|ANs$B#w{-$(I3}5}PbvD1o|XMePvA*y;K8AiAOR zrr`8V_{N45TqW#LfE5u+)frVlvP!Xta^=H`Di~Wfp8e;i9Eq-N%WEv`O7gYi47Z%*cye|5UhkUi8NTyxEzaGwI92ewC!J9?u6HdZ^bK@yTv zkjK)YZAMx@T(Xv183uP-eu*(&%j3P&G0e$Tf2OJ5qAwguSuUKc(l}m7wvcvYqMnzs zA_*Dni-uEsB%33_kX5q9-OIEYVv?*~+fkd$Zm)jl@4Zuf=?%f1I#*`bak`VrkG$UN z`8}=x^0qqsqlof!hB)xe<)smM8F0&OjoNhprkB*|+usg+VMc2;Hc z`y4GShA_=cHTxiw0v(~%fx>#`o^?P&$^t;TrCQBpepoFL!;lIRhuND{Ui>r`q05`R zrFYlHm?M7+5L_M7rQu~m2I#3H!Z^xowt@>Hgpz}H+`lGt%Sun7Yzd<>0xp&+8tJsR z2$d31H_ckSBN>p$+H}ii)Tt91Ae2JwUBA&!Xc7F0ygbRoyG8f z8QlGLZKvm)4>szw4C_ClQ}t}4X#50}M8 zo8i%pi-=Jh``jEs2e&`L%$-8+0ih#U`Vk5^MBP=pazim5>4NM_{#7rY2>N2|ej{CG z8Pa0=H|8JpUaUp(CsBH$l``B$Q%Wzhf0D{S8KbKIVc=C@<~vlTVU?VS{a>FI;kAJE zR6z+|6jpN?O0X-Cg&7~W=FxJ|v!0+@k99ZjvLV&PUoG^sz`RBs7wnnswQT_QK~1+x zK%@?FVsCwXq}2R( z*{1aqbBpV&Zzp+!S-rYV1*S_(uU*J>vPf(G=cycd7O_a9s7%=(S?d+Tfd(Q@ouKZ_ z@Eim@+lX}JuafX5wM1nd!O(AhO=kEvo7$b4YUZS`i-dzbH9FKIOpeZG#l{*H*h^z< z{_4yb7A~qi$Gxphef@sw&)`$E*;+G+BZvSo8Xco6Lfi*_;z z5KYIaLe@D=D~6I*3Lnor0Ay@q4OnF<41=OsUC<2~U>G1%|D#qdshf#?Qy7yVxlNim zb5pgP@5LMd5rB>eK-i2}13<-IXm!3<^K$oVzd`fzWrw||>xLA54?^L29S^hE{degG zm~A~bG+sM3I=~yfI-b}TR0#mr^oW8{0pB=oMnWO4xnQ>#cb^J5y?(Ubn*TFFEafm+ zDIUNk2JZWZ0FhuNBU&w(Y|q)@V9rTJL9kO_yYh(!Rgi2WNC_@&-KlD*lB7v;U@4U? z2ND*jBG5vTBm!V0xfwNtH<`A(H5Z=wNSd)>m9^50(IK1~CVw#hhcZap-bA9_EE?Mt zIHP~l@6Ay}5kZKLpA_WIduDupEgd`ia@4DY49TgT5}B>0?@K$k=y8G?jB`O;ZV~1* zE^|^-E8b4^`Y+!#%xjp@hOBQ!3?Rhy51dR@*+prgPu!EFyx_E&P+JV}gc9h_G1&=m zkBvT7FJ3_RE@V2mhv(hph@I(D53#)3k&2JVG#Xs(u_}cg&5AF*}6C(3U`C5G}~~dYziq*nMT<9 zsvc=Jr)GOS&@_osg`v-QcBKN2Mxi6L9(ijJhBVDEMP^f8rr7PQ@bfcOSJoelAjccK zy}LX#?HVZ1*^$zfnFlYgzq_Tn-GLK%odanZlgM{`ycJ8>*jt;!Lb|a=8Hk0cnW;-k zq(r_rH*#oR#AJjBFu{YZNKQtZLmJ3JXTUq_c^@VI`1d0;2OwbQs0!SrJ=-DT$4z8@ zmXczen#!BWbt?T~=6S3|vlK;yuMEc{YYi_B7%&FeK)XfWSNWDw2q2Il5RHO%>MANO zh%jx8jEKt$q8i%PngSl(?2!paP#3CrQ~}0g0FCVQqPu?gAF1L|VPPWyOVGqP!&{-G zg2>YLOke`A#kLC56H13NckC#P=FGs8%^*rh5+YKA*(xlYJ+gwM7_d>|mA!4t7_3WF z?`J&T=qbQ(-F4oodSu^pOxe-Nt=_O8rENup0E|EXjEF!0i$_(VOWq0xMJ$h78Vve zck6|+8ew&YAK+^=B!0wb1B>!iXDQE76Jg0Bic;V_1fIiW9Oow3oJqp^oa;72GfTFy zbd~;VM|ti37S4ya?FpU$GrGz#f+Gi1iwi#aOX&`Uhe86a;v8_ER_R`f;Rv#AR|2}KLFhr54 zmV%Ke$fB1bWHXSjt43yQ;*%{gy3FM2O^Z&(>x3zNGiAqy#rK*TJ{@XJD|DAD_^GEu zO+C=}_Cl&{oF911ZJ+V3_M=4^ewfERHrhW8>jts2lK+(((Kv0_=EGl z+I@u-$MuGuN`|u{I4BVM#L~5;t$&5xR(u2haok;2!^vVEtB&YJ94&2*WHH&}~RaHGg&aG;mN4d#j?Go`^+B6?aIY6#jQ z^KNnQrH@3Qyr<`o@6me1v5h-no;>GrPBvjvGc_{WSS!OQ#v7%ZAb8qTv74UY=;)yI z!UO$(vg0sjV|=~YOQO-UQD9zy_aCpvTZ*H}eWs;nZ+M059*+tQ7a+z5GMLj&=V_}X z^DR-2wFi>d_`co|{hz0d*ocOdC=W`WgvZ8wJWq#FsHGbpwBug6CeRDB1o)N5?gco? zBJ@3Rrn^KoksWuq^3@OOks8X|hDbP}S)=7S^eOdUd4D?f?s*Z&(ugJS{(B_Qn4$=x zDkiZRk;1WhGxQ%S&OWEr&qL6T{=u2)>FF$G5|q080(CrK!eiPU7%#WP`+RJ3IZ|hz4Ba=OAmA@?x0vE_CDN!KDJh z21X3Sr|CQ?u;mHQ?lgIRN^v@+>pXn~?9p#V6i`SyWi>v3LcBAO#=BUeS-Xy9hSL*o z8?HjaV$^ZWuut6DSLALluAnV?_y2{vWqj#Lyy?L(PsISy+{j;()O}cM5pV?ax=K~AKh@>F zr2JSX{T!x=M1~Qqn|;3W?~~IhXb{}t#dKOj5ee@ieSMvd(&*QF^L9V4gq|iRie8){ zJ`VbL6clEf^!)oE`QVsLCKCw&N%gh-`C>m}$-)(BhfSeX?tFhojhHl4-w^V!YWFsN zrIJX;AK@ANXrdvWr4bP<0X!4R&1kwFBGlN*JXZs0 zQ? zb%(n12*9Zzq#}ZZP!=o&k}R4@DguRIEkQv>(MW%XujloVzd|_4;UtpHH~UJ|x!yzS z%a8Q!H2T`^gd)oCmzQg{o?!otCq@xuJkXy+%LsrNgcd+iX(6#BHi0f>aX)JN_wZ{Q zE@`-d%+|9{rP;q6GCVC3fTIAWY8eqYtU(tTM^?T^$EMIeXoC|huDw|%)l`CPyu zs`m>lCaU88&_xY{st>OK0ICR#P!BV8bVC!8p@+rDRfs{6WpqG{F>vk&I}V$oXuF@~ z^B)Alae1q~1~uKrvtcg=o)ENH82tn<6~K(pl7B*Q-cGNo;Cdiw6<~ugPr0TAO|OB3aB03bcXkMh!Ue6QsRlX6 zs^FG zI`8J)Hf327kntGeSe-&7RY#+UWOnxEb2(hs*E79CwiW8fWOZq3F7iL3V8=PIsx~VN zHrepO)QY87*~>kqR%mjJh8ZWG)kW2Y(`-8G&kPw8RZTLk7Wzl`zFxg=z{h|eu5*au z$=dXOy*(Q@OlcGznh?W1mH7y>4O2|-dqm%a2>VW1YH4mAWRb_lA^%Wn`LeS@WIrBF~b$p0}`9#9^}-Qd;#1LJR1Zmnf?)gIHP|o#cp8I1d*~RM}Q%gjXPY3&xw$uKH*7OAbX$QyidQ;&(i}>HK zmjT_lK;2{0@nVFEHDkq5n!UWU9&^_K4_C}VN^CJeD8gz_P2c#s?vF3k>?^NEXuR-_ zDxncr3IQXR6i_;7Gz`3RC_<17%n1s>79ogYR7P58kc^6gVHs&@DP$KY0?L7M#nnW| zOG<+iM2&`}13al&Xh;ws5fUj7AOsXticSV7ETVv`AcW%7lV)t1C~%E!XX7D6e28B3~-VdDnv*q0D`bY10(>bVp+qV{HDOI=8bd-DQm%Ouq$G*No!)~;Tv+G{JSvd^8;W9QDRO{b z1G@}hup7D~MIjAfoC9+apuk1uYUieVpO(~wgpD-J2vPzni3A`D!GjQ3GD#H>5mFHb zL`DcLlc6MzfDV_{StQ1r7&O@IA1I&|>+H=#eH8?RuyKl#qzl;eM8U8@O9fKch?4p+ zgjk{oj1h>z6_O~9!%!uV)By>u-MUEwas-`hl$x2LuoX~6V2q3r0c41xBEg7_XqBlI zj1`eZL?L7tR>=awv1KeMpvn{A_*v~lk_1qJ@JS>_x(tjsa8AtMU>r0$ZjT-}*cCp7 zsXC>Bi>~$WvFYI0t%$4B!&Tma$s#;oE*$vOraR@1@sB-`e#II0J#V#YZzE@ba^Fa? z4R2z%th#jLOdb5Z>=yg&j7K%D4*oWu!nN0Y8uUZIiq1FI)`+g*t1k=hY@Ax__&OV} zvZ;!twD;}=ykmcT0yv4A5f^n_Y86FlZT=Pc3GLK+_mHP1yH~E?jsJbt-$q?=CwXii z9oF;I+BdXyR8B{2S*H%}?==PdR`UD&Tn^7aA*6B(Affcbe0%bC%aKmjpok&xAU4MM zwvGZgiE(17MAo!LSagG~#{n-lo%6DQ=@COq6s|SpC^p0ekXD4!iB%M12n>(rl0r#F z5HN!a5fK=IiX@T<1QKgy&)Hpl9+2wnEn8$^B#RiqgV{b#{8WgWxFR)%9tsvEDIzetWgkGVLQx<)Y5!|*I%ym6ejWWjN;#bDcL(7|ZeO~$bc5ZzynPQ2_v}KU z0FVcu+tBE~#g5ztYrx5xRS%Lw9DrD50JxxoS|vY6K~c*!jXf!h4tI%bW6@@}%zdaC zYg)|{4b!HXw899-eCfQ*Q+qlRbk{ExPC2%kyE1D?9Snv>$z?$%B53SQ2xO;4K~ziv z@rSd@p!t_Y)9V8YOr5gCrCFRn-EGo>j7F*eV$PQ!Hc`fNJ_kE1MExgM8>Kf?MC2~` z#;I2n;)aCiV(b8V`OgD;^HQSNro=P43JN%3L8YQSj?%A0M&Ci!R!oew<9}LQiJh$` zscOx3&2&X@7Ts%QzSpZ#k9*eiRJBRVx}bU=2nEfFp}7x^i+kR!Pd7&%t@>6%skaO| z8fg0IgFDPr@fOlHm=PSRcO5w7#`39q-rLCI1K$u#VO~-~x*fAB03D4u27=RQvm)zn z81B(0y_6CZF~%^(3KmKur&a3B7ntR;U^d;FO&nXc#*~mjb-3HX#lzAB8el29(=Aq7 z^REjj$hRkOWF4`w3e{cXP;8X7W)jeYU`D3`qRe3KmxdB}0-upp%J3-kpoJSgq-c^z zgk8FqQ3-OU2%!U6Wi4f+!#bCkmgK1xH3j#2HsuKzN@*T^EltodFo;-s7OF-5qQmT? zB#Td770p!4R}2+%4r%c&{!WgMd2fbhR@RY8V#0lh*4oiG@~MB zQig3xqeyV(vpN|#@850qrW{(z`m`o_-mDqb0a1a@)h(u94-IIr1Di0CNRvz=CD|Er zY#CYC9PfT*%svy7(D{f|sYb{hgYX0;4FRp8MX>~jgtK$WqK?KHG8jHRu4`9vw?}zBvUT!02*ba(UPRYk zqj#Jcqz=qHlTNaf*!Vc4dFJCanB2{@bkoA=G?jws6zh+nyzYRKhy$d$M9Q29ssc?+ zr2qyj2-}K*Rm&5tCQ70hf=g0DGF0;Hh$A-eZN50t17)M&)5~MfclB9ma8Wu`LA^Vt zQ(PMp2rcVKJn*|5TA_Lx>8iu;j1UxtLnbe>J@JVhDyj_ZmFbb#3GEx!72<-RH<{G_ z11{N7+WxAs>rnYDNc9E~U$ScTwHQR~#&6FT7o4$l_$BiY?N|9xSj{RRg8p17WT)j{vP$4_f6Qb`dEfB<$Xb?6CyImf< zwphyw-)O9tWv0xlml@9oLJ9x~$tjDY3xumr8#q)U16fqn7|YbKAXceHE{j6gkjj)S zchX#}x>T??4jmSdF81?Q?u6&4$5FQ%)}*1QsOQif2rL|{s##uynZM(HIQ;c`$WD1) zapsohqrswy8b|6lTZ7tHpDfG?4(U}$+PQU@Yqa!UwlkI3tx||HH;I6VO=o6DLXibv zenRy(n2r!`C*cYkDFJ})-kz~3w^ePA94j<|8|e=54-0_-gMzL~LWdpg+WGE`4)ywK zS1``>jVYBN9=Ue4qHQ!~!wuARR7p0GL<%!V5K;!Kl*=NHs3sB^B8f&ssYt=*t5xWH zL@#4(RWle=JTV>6H%P8Z%I_Bv&}RGZf;4ER)1isXW>CH&4=Ik)xFP^J&x@%<@rYVOq7=Wlg0cc$!{EFz$~ZP6}6(XD#wJjq4}X6l=A&PL|? z%5raj3E0rr^cFzzT4^nH-5rl6)QAa+)mVp_jg{uRTG+JEMB$ip#+8>!D7Jx1warj= zL5iihYS&Rvpk(OGE{U`Xw`tErS)BbB_;e7f(gGV8*x1OX<3VURrS?|nZ$&Ghqb`wb zT(0nid|`OeXNDK+2n5p5woyAEgF_H=J8b(m#kMOR+#p@H>c~c`3!S$MV_mIOTDYkl zGC-KK{ohSr!_5IV#x`ZF&O4(n-c^0U4HybAX+#tmReq^Zc@DDU5lU=#!dB<0wQJ*S ztvoa~SC${TnSqYqrURr?;Y_HZL$(yKv z#=x~^6w1po%G%Jd2nPB}&wREbsK$wBWeikT1g@E(q%x4PbgUbgH5)|LwYB2F=BhHv zMhgVh>n<%RC0j_3cU7%+#5L|{m((q{ifZV)PCj=`GTHkcL)z_`nCS6{*SAo22c3{H zX|P9Rs$rb)*k+bkGF4Ib!eF)ygsZ6Qy%1lHr9ix>31rh)+D6q0LR6fjI;)plM_bx# zGxue4t#HEFm4{1KVczHzl?-*ca7KpiiCSlUDg`Ko0lPI?3E^ipT9Y(PvS+Z3Lz42D z;Rel}(zU#6gchZ?)mT(x6e~T8GmoCagP)>-pwLi^*p2Mssv#f*4Zi$bUF7a0;Nk=b zf-ab_qfa$OiK@B`^U0(>mlHzNOIZb=(t*(dr3og1BCi$4-qUHursDT;;XqAdI7Xd> z@plScEdkgqb9qBT>Y~W^PgG;qTr)1iGznCut6r7q6cQW+G`f(sbtRKlY`{EgjE+b` ze(Gu&nPrx_r035Sps%r6MzyUid#n#O(YMC7NMA4@R@1t7cS$l&R!Z3wWKe5sK61S2 zbv_;KVW{5CTNM0#FCNaO&-N$hC(Y~lRq^v)qQ5*uExn$dQT;t{>h*jMy;6H0#PdC} z&j+4)Q1!R2#?HhBuJ;S`=j5%uGDn4ZItbMfbt9_gy+g0p`P=*RUp2Bp0Ms?Jco!9{ zvebND{Xn=T|8I}b|Hz>G5D;*3tFZ}Q4Ag-Tay7<;&>KYYjA`K{K9rE=yDSbTF=G)U z2*D6eK<6kh$q0CT*U%5UV4*~;l?72`Py&Nk%Gj2bsTQyikzln2m5jAy3dlebP^75= zWQBkTLM&nb4KaVRkBAbpebe!~Nqgw#wiupBVyhGBGEM>lc8kkh>u8WSxd%(Y5~fJ3Aq z5Q*i)~R6ljN;2R$`FTEQ5B)PNfTp01>ZS!5l!P#HQMA)L2^S{J#8%*$ZVPFvH?p*}m{ zJ_4RKDa&vsCL@ygyf*>}5_T@${Dv z`8l+pg7`(iRT4whxv=vWxocFc+Yk2+=880)XtvN^vYDLa*NY;V*|4H*IQB}~Z7*Hh z8Bp(9iHlVh#KAdRlHNT%tzA`fy1CYwcBqlU1kCNt-y7+pP&l2EsV`Y&NRU%13e59t zoMIyZXm)GjLg;nfqUoMAtTn>z^-i^=sm|4RY!6f@>3cDi(>IKyPpHV6?z4`n*)P() zH^(sf*+QYi^9$&KncDGi)Ptl&Y$n!qR|pXf9?MOvJyr6&M5l(r^N+h#y(dXk+X-VI zhg^OgZ~6P6ysiH`m-Dx8UW3~yRlj`A*sc+t51D@$i58L9&8&|$bNT>1$b!_r*n#Uk zz0vHOR%bO_X6^54P2Y%&+HEHO`Ts_*n1eI7>b>c0i$^E*vq4^LG+;hr8T7id3bWFa zu*y4i;?yAItjTWrm|#`e$40$8d8NjR_9DZ4Pvtz2#@YC#zIms}MNFpFL(=5^@K_A! zQ&bgpvg1U}@JM6RQTB>)vS z-N;ZdbU9QQE>PIg`7Pok^fvaw5s5iW=K)xvF+19}FFVb~W1d&QAmsTK%A!`FJ_##C<&Hlo_OA;zJmpcy0 zn7~@p?7@oe<*cKg5($Vc!=@taI+fW+{IDEkB97pf=M)>CEL-euw12xfS@P} zp)DtET{CgD$_n1$%z3CZTX5i4AjzV{T9shfRv>OFCrP9p=5WR1MGr!kzpRGYA|Q8| zvC>FVg(=PsxLS;w0B(cr4Xx(izI$^_rpy_XqsZ^or@*yfw&X$LfjqLKkq=r?3^ULh zf?zNMvoSJYz)B^9X<-GdEUKH@8MA>W0~f zrqI$DFzaj_)#oH4Dw%OcB%%ViNvI~uSQoABEf~dYk#BFGuW;Mm=f9~lj+-!q=)7GZ z=P1LkTwq6EFDmuIL7v8v-JeAZwwBS;?Mla23_#Dug4o+$g$@RY&eig5Om1p%#L=iB zDM3XRziO_Uh~QeV;8TNWWlPl~o3BCCTb`9{Ot7_DgP$Ul>W!-kn57AdD7v%(Bn-sY zUbj=$&LQe=sR~Y+ECLlQCUl_RF+M%I&gx+8f~k)Yky)z1MyQOqgZS;zR*~L4qk=Dp=r{mbzr#(3)%9 zYaCJq_Rt#{gT&lq>1C@hscch(QI=Nc+I~yPO(jL@8p0p$DpnlUs)nTlexu@EkMBjw zxcA2Y5SICB=6L8VwwtE?CQ7)S!u;z1z$k;b9dXFoZ21?iJoQ#N39?d>qJfDd5I5{a zukE_UsCOG3-Yp(jMF=X381x>okvSNs=ouo z1j%zQh!JKa8FXNQNf>h^YgDd>3xv4ml;as_B(uoyA)%TBfu=O-h=_BFtEv;ANNY-^ zJY`~Toy!famO#l!`-x01l|}qOCv!VtSZy~2iGrC4N4f zm^sjll;t?;B(w6%UaX8R<8WaSVs+4>H`y%k~fk1iNBIcJKS z)vBQjO-zN&ODh({)go$I<17)7V@YO0^?#2`ckNykwpL-IKKi2zPi^SUQ6_k+4cQ11 ztVeUndjxic6?7mda)kvz9-mFB-~g7@-pOR+45GyoO0-8x+hhc~MXW$fJv(0{VSUW@b?9&&>u`$bCSdUEuRs6(EX+1cK!=9T+&ybv2yK_3hd0y zi1*f^4Cw;oSq$BUMP13s#3Xv8=S2L+Q=>mq*rOOkO{ScKW-$^1JxuV~``G;ym9EY6 zP#5*rGyv-}E^6Zdl!5mIBu_mJw&8;nQdbs8hslQiyz0`#wre0^lsZ{W2CTqYU&f5s!Yb7LF zHM4|5KDE<0p3_}Q;wZRAA{xW$Rt={eYk4gy!LN606?m2L&J@*Lzb|q^C(wbpm?S=&?j8*t_O` z>347sEj^wgx`4{=4uki5>cu*K+cRraS`d)(K#NSJx-CP&`t|ZP_psxt6RM}6s7B}t zn=R!|)`|v^Nf;SqlEHv12m>G_fI;K!aQnW`OU(_pwOG8^x_{k!c1VgGE_bIwZ&8axPgBzU3s>rW5QG*-8=3SVCtg|7f%>iFG)$-9gGiHW0()VGY4%Df14!H zW>II7a_1Y8fMmrE3J5iluo#g+5~K=}pezc31}a7hLJCqMCntI2I)iccwA;>f%y{~~ z?!E=}HgMO%9mwZxsh+zLCl9mzVhDgo(q*rnJcBa_h*JilJd(X34d2aifwiEY} z?QM2dHQ$#~M}yGTLP86~Iuuj$2~43;5)aS)t;IwX6#TFMSbaMPi3SnZBLw#Je=G61 zz)8e@=MI5idoNjSmknZ?go>(aNZxEq0%b9+i05G#NSxcR`q@019Q6$mDs(fbFChVQ zrg}4Z#Gp=ysKj$&=YA@2CY{idfIpGNacR2VVZ-a6uTsA;^!W?co4kj$$nsxF&Cfh& z3LA#sycXbZTy?E@A5}1E@ZD0vhyB|mpLj5zc!I?wQb9rr0Z=O{kqVFskP3o>KjqJ&P!{C8n&hOcES^|rqx+iEFlT`2qsC^B#3Vg=c(;AN8ot1VhNQ%9}6 z{kjc%Wz5RD>MK+R!%PhG$k?^v$?fgNQ1cT(YYZfN5Ix)WbkRe#`?nWsv-*;hvTA2T z?J9SB?m5cv{O=j;+@SMWM!b!1RIPQVROgpR@MV1YNOA)lKN{F;2saV0Ju&hQ^ zEN!Yb%Tmz_*ersG(5nk!K}CwiVxq7SV+O<-1#4Q1SwW~;4MA&cwOazk3aGSFih$N2 zEU~uLjg_^Hv`Qt7sx)m`Qp9Ysp;VSaq9BNjRbq<80Z4)(ilQijg9H&)AjDKeix?;f zpeUjg6c~&}7>pHEMl53@NU{vJBCt`EN>&4FV`~IUM2OI=i3+wULX=@eNkW55Qj}^4 ziVGA(3RILrl>|!GC{Ppxip2q~5fKq>w56cMSPNiOD*&TqwPmX)khLtdYgH>O6j&oj zdXL}_$P99OXGH_r;}*^yDlh*)<>}<`d+W`Rg6}B9Sz;l=T0PEDghwzaRHJLMnD-Akzp!8 zw4_)CWLX4ORs;u3!b2ng-4U>*KF5eIaGD$Q^4{Nc8)AP(fu%VQBKRRL|H{;*w!}Nm z-uS>q0tRjdTl3Gy{urm$`Mk-_qG~!)e^v4uHy}C=WCa|rf_!3l64B$l*0!TyM)(dN zGHEb-PzFRv^{v80b&-7v2-g(^qe_Yjw1W1c7tvHw-X0y+g1NY*1GMRWjX7Us&V6n( zg<&v=b9>KkTkjju_y*(4Ih?O2rw$Z5f4dYn!WrFeEPXyfrR?27 zAOSI)e>TGJd$G+|gmwKLvy{$tRc)^d>pE8TyD&EWm&M*c%Lw53(Z>>(y@z24y6iN+ zllZ{uBQ1hte|CL;uik%u)RP#WjW`+Kj{K4GHhjy?KfUi*^J-Q7KW#47J2SpB+8g7- zFfDgqXzLwIx6c{w(L~;^!{~6mZ|hL=_EO*RX}PaW|!$#525hQqYM*1Px?_gcysVC z2=!en))|FRH284r9&u_DHkj9@V;Q{uR;a^`(I-*MMuy+7qj^NzbqL4WM;U+>|6S+=vC4>!6)ca@!8 zxwQ30VTydm6iQrfE%MEfl4CA`!~>=WL#1mXkXR`Ns{G{R`V%=h|5*A%k`f(I07RcL z=%7DWUwPa5cBMNBveAPpcTA}J+gRR{ur z6@jVoPKV=um+6l%4*&!3<=Z|0-sQzQL8{(s6(XS$m{ zcgNZ6qR+!#S|cmDj|93#kdi}w^v$vvm`RBm{zi83Q|%plCVSj`15vBvr~DsphtWj& z2N91$R+H@vZzx#;@ECy7z)-}HK+;ggVJ2hb$ll4wemxHPA%{B*76LKq{%2d^%Lqed z3xs3$J{H;=`q(YC6=>xDlH783I$n-V0_0UA`TX7+c8=`-G8{iQnj!h7@-3dC>uc(> zpQ@h+u%W{W?6?!8rg!S%eBt<4I}bn1*_Z^^_|#6zKhb->-ml-bzT-58Kl__QzR-s+)*zYnHMUe>yv4MqE T9V3)BU;ZxSig2MJnd56pDt(C> literal 0 HcmV?d00001 diff --git a/bzip2/sample1.ref b/bzip2/sample1.ref new file mode 100644 index 0000000000000000000000000000000000000000..a56e52b77f90faf637e2c1e87ee60eaffa4c5056 GIT binary patch literal 98696 zcmb5X34ontdGE#+5&Ubl)O~BUYPDb8s_18H_2c_p_x(KYGBZJ> zMUt6!d7k^Zm+M~NpY|X3+MECWvG}KiwWgEV$@%qvSWmAQ zpPc{Hz0LY~QlFTA?cwR9Hh<{i>7>z`Xm6Z*>tp}n69+n@zqt4sJwn&bj<=>JcQ@w$ z_waCdT&M5rXTH2XY`3JFC*}`-v(}t#A6);3jif#ImIF8U{ps@uM_W@}UcRMSYmc=K z&HZ3svbEOUlh&Kfxx;6D`59dF{?pez@YtvR=&Tp_JrXkLUtj;4yIwHUY}6(?mCs(c zy}ob$-5Y9CBXhT|={?j5B%C!|KoZ4i#JVAuU&JrUEjxbFaM3<_TYGJVz4$m zIJ0N&@DqR1;I8ieS3K~H*85(6U*Ac*M*mia$EP;je_4I9HZ^_lgBy$#fAiMqZsnBg zTBFIOt?|j3`LCWjJ^z94*XK|Am#Jj?aHBpkT%UXE$+nDx$3Nr6jrkvaet4RzT2u4S z+TW=4xOc}yV=s@hd*)C0)Asxs-)unlv^AP;t4$0iyOa9-=KI?GDtojM?DxO(TUYOg zWFuO@wXNF7K%(n;)G~MInr&;>B^$1}av<69!oj)2PaEHJ;J|^-*7mm_c;@tqKiZgW z^LTN@hJV`Jd2sh14bA`h3)}N2-aI{38=fAVo9pbq= zmA5wbCiS$I49!3FDqE~>Nx2LX9fTx@Aj#xZeVU7=w9PKJPStOmX-wJnlHuA^eRQS? zW8L$K>DBB|OS2u@Bj$NQYoc4d_A5p{UbFeW*7Tu2yKZ+fo$fva{aRDANo^t>fkO|n zw8lhQcbY=ziDXQ-HlS@=>zlE64kp*_PV33^JWomOe$KI$mUa*p;`@k4t9`IzTdHKB zTY2|q?b*pbt)$sZM&`fp2lc(MZY!PSrFtFbGh_@BUwEvA@-Slpdq%Q5t+kWULuVi_ z&H6+#l-470b~h$i#7M9I#@}zZ;KqHsop=K&WSBYh)l(zH zR7TZwOs6)H8VUUFV;o^|>wcj&p4zShjVA3#bfG;PN;FvWY`1dj=V}RJJj=%U<#4)t zqBZ|-w>Mj3vk5D7S`9aAQ?|ym0ojsf&G>7kHdarDk*r2D{IWHnQ!Bl;<`jm%y4Cr| zw|BGK7BAn|&IoPWYfS8MriFKOBA>k&0>Uog_L47QOs_^7b@1Z#fo|m+pEQ!_0Z}0${>kK2tJC+|IcY=ZYF?!iLLbf#o{V@H zRiyfynFf%JNwK9CqSx9xA{RJKO#odaD+{ld0(k0GwUN{XQL4ri&qPoqNPw6m83_k( za#H6k>S=ohqSO;rt&!oe{t{e55 zuoQGiw|dQ|r(MA|xwL%<)hTgpIun`1atROFtA$EgLn%%j^S5Sj?FP}lx82-{5iAjhnIKz>XCClQWc3N(c_ zQmu6v05O4<2)*H&v8md4JHD|oG2EO9YFOHxuJ@?aVJCFL^ zzAGl?yQ9-nt@)SrjU2qCZzgg3K6m)Z`}_Uo6JPklm(6B&7t=DecFn?dyAK`tM!j1- z`?Zrbtjp=s$;iRaURNKkp}X}{Q+e(Awf8|S&Uu7w&wqHXHvjj17?k-R-aDKimQ$@1 zMPZC``+ed}j_lwL>GR3?vk%ngANh_c<1lW-2?hJbU5~%~n{^meWVzqS|bmW9RCy6x-Tlukz17ZO`yF?0qWb_m!z^A!+^5 zLJ|k{mV-N32y8md`dcuqh}UAZ!`!+jtxa(|M|{T)A*~rKEBhEsuhKF^5Tg()vY*eN zb|ZTXKbj5CYJjzzL{l@YVWQjrk&i$W^x7eIqi2Ycw&t-3-gM*}Gb50^-E6Udeg2jn z_xNM6L*e->q%mbg3uj}enHXjmZrQ8mwLey_mk46bf2}WQsR795#1&5rgatN0UY~hU zQ@d~NfpZ&s#8nT?1xxrwFG)ZifQVW{f&kr<*2#m(<(&tgecOyvEcJ~eaZvQM8{t`& zA=1KiVKI{jm-1Y%^5XXy6HLm|ANj@z2bZou>-uYoypT@Sjh$-4^>i41NoK<}Ljb{< zN!~TW%8X_r(dx#;>Ug~?@~{lCc(?MV_tp1y9=!3sT64y3fi6;QL+NZ{95Xfl?01+P z0me!frd&3V>_dnq;92N;5FX*4vkx>(2I_-)_~uUKO@BUY4+-*EYl^9s$YSHr*$1Fe z+77ETUVsqwUS-D)Bcd_Vgibzb97M3C3MGu_&OqXH-|j{t?%th_G+0P`{wLQ#p}^4m zR`8{b=0R?9vl6t0`6oz4Jq_DzjG)<8Jh|^c=fb|@w$DHqSrATA!XV30x#p@Fd$-tp z5wQT2@lpo|Z4{M}!P%xZaj3j@DJ2Il#z4{z*ly%#T>FF}+J<^p2lD9s{R^iLV+uua zyHdhXJVRDxR7B?BDVWt^E?4PH1#{yQ&Gt3lb}D^+=gRKc!yCv{JDsc{J|aU}-(MS#v;z9VM>>vPS$3|shj3uGX z?u@Td#=YwIo>Xf~U?S_X-N{3cJc%NNf-#Z;4!T?&O%_k$IK&qyVGbVb*`7ob3?`Sj zssW@*gK5Gfe_%DeucEaP0C z?30fJP?I?mxYV-^T-zj(Avd zHC#!hx|B7VpTQO2ny6arVm2Ap6*Q3yAB=R-ZWzlE&c0knrAVn+B(p0>ws_sNgm8-d z1xdSv!{l>#8WUDB_=*e!Da1++AxSJiY>=~;vz(Y~Zf@>R6c6j?--q+hvyT-IySA@y zVL2?=|Mgae1tlvovXBvnYPWc9ra7X>Mgg#(+l+aQ8+1w3vuMO{J}{fh=}0;R33Cl< z3ZpJJ2Yn8_!xJ7OYNX&*hXsz+K!-ba42fAK)SxW$*x?CKW)N$FA1o1vZc<^F#7@CH zh(%;yv}_B=WMm&CVz%$#fljUOxN8mQG;v~A{nJdl2ERH0$oVJJaw83#8A94pI-hG?n1QF0}zhjJV>Sl(=1Q_5hrJt)75&0n`$+}rEF>YR*m zu?oZtQ~d%Q?m&2ICLtCv0gQs~wYEcgXyuDeAqcA63B(`Ja)ih@2XcYiz>&T__||066|y-=2Y9W&aoUn$=ugTfJ9AGSbSn z9}KoVJgbHS;kMn0Qd;W>0-KJtAV!P*zq~bM`kX@qgv)+$5*%V6NWoX>_D`-JwF8i+ z2FnBoWFQfoch7AG=57K*rLMgkh~jtTvcjuR}*tO@TK}10U)X=t{I{9>Ep9NtJ-$2B>Dd3V zW@`wbo!N&}Kmm+rKWLrI{sLSOJq<7jtmwRS9C1m;9>UO|9MrK8@<6vb_MiKp5?-=M zrmcc0AW3cM$yv15V|3;rEP@Rl+?rdj;Fbh@k-p%t!a~sE-Rhs;QnWr6y!FEYp%Kz# z1xu`IR5Fd}5WUUxf+-|k@GL;KIjfu;>PJ+53;QKK-zAhphmT+z*vaA%p>|J zvWzW9_G3!MzE|1&sA<7^k7bJJs)T?$mH%^!ZyxI*yLR`#rR7khNg?#p!tId%QFcj0cGvEzT6D!*&<)bPP~Z%};VwzE7wQEPUpU%B{dIddy6o7&r` z@9Uhf`lG~$j7xjf4L{D&|43tRfE&Ec72Ehhpp27)a}q9+t-#{hxoXtwrH< zg-euw;gazrbDYqYP&xRKb}z?(g4*2X8c2)-W3p}8pQu`se2d|JgFKNaquomX`74My z9g0! z73wzkC$4!sa+3BdsTcxS|$)shB5Ee1v_2?nAhaisGa|n=tS9FQi=2|Ys zE{*cAu<0|Y$p~kYk-_vjBYtWTvMHbzPe^=0I^{r-T5}9k0=-P5jd%Npo;BR8?-irS zWSikNRM_GQ#V5vFXi<@I!bl7vQNBoQG^BiE(w_D0SXNPofc~0wx37VzX1j~sv$Ph0 zfqC7S^?_dht*B8U=NTw&>)T6`%G6CHvMpHb72*aGUXN=_ZDxF9;aC+ybwR za2Js%Zq$1eB)PO%8z%K-#^ai#KIKyXA2Q* zEt4`P6JRt>XdGi5qF+u7^O6WPW+Afp7@&^8v8f+_-?rM+hI8jSr=9X!0|(NrhL$$0 zo$Ea9Nv&N`0fd-O_0b>nG?1AOomVRO<(4fCxGR~;sZ(OB!E|${`sg`BRVZ4_G4O(o zLC*SwbO1mYg(w-&(YQk7mlm*hKOiG}>A@i0^Z!&KK(SQj3uzVNS!eF>=+*>q+oDsF zMxCj!y{i$snFUEW3{52?1B%t!pFKp$$r|S;(NM!|!w%H(7rNE|UhCXWJkEfemR{B| zQa!FO6>heKM>6DFRc=qY1c2CouXS~S?%Ky0`ia5kOL<#5#9XK-a8oSfZ$2`@dyoc~ z9HS?i_EMkB9uvhudw~I5PKC+A`nEaT$VIamqAL+zYLSu@>j&zJ=V}ivo zTNV4T)%k)h-@0L)WaZ3V9st*!VIkMH4uvS3`RstTTC%(8w_QupL^nS5pU!lJ#rt)BO=NaI}xs|C)?5|bpB_{X>}mpY(V7j@J>77=&XopXZahpZWH!->TU1Y z6_#UMBHK`Fwp*yFp#I@N?jjydx&vo=k?^!f#iP8)JTGZfPSu# zPv2;!*6d8~TWc#~cw;T+_>vTf9l{caIIh`l^}PRs1;@AqHYMVyMIs&JEPJ18bCwWL z70I{AW-*=XuDnakAwxWuqOB`&5M6K@c2^2lWy;oHg?3a&veVK{jU+mMBeo>U|mey6Te-gDNC5 zCS=qUsBRMxaCysIKjn>cdbtaur|YPC{ona`zOWDoGJw&rSa1oQ4`h+|^tprSwegI# zgw=%L1Sk`a62ZVjXA(iv8CWaIq#dTFz`QXt`{MJ>?8tDxn1O`kTQzcRkG0*({_X5 zM{!jv9hOEob^X8Z>Q(>g{ZSX;UaM+d)Qze) zQ~=MmCeDhq*=La1{K8K4HS1kGiHPKK)|eoTLeB%K* zkYvtBN<2(TS?0cY6pmALlG-mfmjk3m&YXTmbwy{y3InC5o0?QyQ>oq;x-%8?-Ebiq=fd5?*+pb*pRR)6arXE$3QwkcPAY2y%1f}N0?7xLPT)V=cvv2izMt*UKs)$ZvCX4$N;{(Ck zv$&<6Qie@g^dxm%1>g%hG>C}9F3H?<4bn}uHSM!kZ0;C zg!0HG>=)C<0v&=vg!{jl6V0&b+#N%=$b%CAiaSa78 z7)awv2gWkj2B(Pw%80UB60p>d*iL!2VUlI?3o%t24o50Kq#I=A7bBK|1D*bN{_L6; z82*0qM+Bqa`Lh6{3+Iu0@p<%ovFh^_kVzZZ)}$dwnf`o;{p9EGzmH2q7s(xfBP}^* zE&|ZHAysd#l!C1V0HFviuBWZf_){kni8r3ckdFfc)rdUj9abYkt;;)aQ+&2pdFN4M z5Z=slb-OAA7O`h4=HiN=!4>0?8XKRS4*Jo;wS|HNQ!n5rL07S>aEy$Z#U0U$c93Dy z*MD@AZv`sIp&pC5st|m#axxg*BoNG~TK=GPV#N$7t7!^UN=yy`5NnFEX{e6} zJf+N-Ln}5BOKt+jh*D$lLgWyybSoFURE69@bJ_A%AkKryl^I0CAAAXI4;1(LF&f)&H7WwoRqV zH=6lj8Ftt*Lp;K`$#l~aizPmj6XBqXyyIBi5>>1%ixje>XWnNi@#6X9dLbqro_XI; zQb%>Up6GBBB^P8%*cX9zwCXeOyCN8IhYVI>z_05Ax|sjw=>%ud9zQPU6WC%r&Ti#T zU!+8VOsDucBsSeVTk8Y7eMqWEDY2oH@;G3bVI`A3Ip+6@d%2(BXLjXS~9w z=O#D?F7@i#xTyvYzP3igs_G|$xVn{Rzc4gb7>Izr3Bto$&|6fYc+@e3Z3P*1L&$RH z0fQho!mC9Y35AguU*%0bwlI)1;sR2I@5Jyz>+(fxD5`4Eo89lGt5} z%C66aAt*!#Gq0!*Bp8XPU0r;8)f-0HX8*Sj7B*DeR@^}roF8@-7qq$}t-1SMh}Rky z=6uf%jhQ8nr6Np~P}Z8`*+T=rHS6y7k0{0#YASk_eS0h^>PZPIUSsmHke<)&W{5Gk z8gTg_(*;4nQ>b@KQcJ`w!vUDdg<2O4rd#S6sGLUG1bX%V{u9ut*hM^6nbm*_0-~4g z4)zuk0#YC^g4K=Lksv&%vz_~-(XF_`>l_0BJWIJ%xdTK^_xUT+no7F^U0lmceKyF) z?AVbRgJYxEkzJUX1hAa>8-HiW`qSsCFyBI8 zC%w@tKq=9m|IEiJIsDx|tP}Z;`CIyi=D+wxN!t9qpwE}}wddFLVTjsP?tkfed(K_w z4zBH-{HmXCx6;sq@8=n0ZPj0Qslh|VA>XaG4f^H6Een^D+r+*QY!{PD46&QE*U-4Ux1Q;_xHGMkW+%GEwfPmb)IJISe4He~hW)Dd_L!ro)#!!RG+#`XgzF8CH8Gn?pEw)~qT%t+~- z7D!Ad&kCu}_;Yy#>bp#iUIVJ08L1}=ZcL)ojdG+aykFsc5h%;js+@L7yHk1n{f%)I zrHmj#Y(n?TdcOXC(_6Iq?MsesTL`42ppUSCF_4Oq+=K_V zUbrYMiAyCI-Tsd~LNME51U|Z3%XoYR4~`(day$IQI6L+1YPSC1p5w`Q7B)gh^Xv^H zM4O-u6m0@H99B2@xeU2FmDBGZLVaNvlwk5QdBZXwvD5F5NDN{|7XTF@JkJ8k-jG)j zfu*81q;f(`n311Hdkjaa9~F)=2hE*+e-H)H&k}a%1{2(F|JT1;Ybv2ajiKTPHOg@a z-LMULTJqDRj)K0%1rd1ioPoJ#rgW?U5zrD!@pyGT28w$;pXDj^rDsa-VMgq~X27(d zS~JkgD(7V+qSHq!_2DPJ`<=Aq9_XC=8~u0PL=3NU5#hHOTAV&@S- zq%EdUo)7rIm(iK$rV&~=I?3@z(Fe&5PV_>wdKOjSv2Op)Q6mq9edc0%fnJSnGH{as zWFypa@!HV+5}!7{Jfd7u_#NJ=@^9*o`rmy{u9+6m1osGOwyHUg$BS{SC1LHFHG9+tdx!sw{T|CYAf1C4e}P_ zRu*6eggCJxUx!aR;fsHS>owZ9{@ed}_>otBLWkYociiEhufFJkRd;T#y}j=QfT{kK z{yhIP(w`@7`uY7=Sfjaj8OxG=a6_2F519)_*2D1|*>L}ag9O+T+(eex))?1!LOWf~CV1f$5p-_WzzI5cGp1(GZix)xIR zppw`w1Z;)%Lg<*c?zAE{Ube5>|Dy99c!WwBt2z12PX9GO9wW{w2fzfz1<6&d@W3Xl zrRQWVqf2;0?^eG;M3oX~QzX6#99vS`whyr}iwMP69oQ%AgkLP7&vi;4QdV@&*MqPj zyG48M)<$d_tI~;_JR06NQUx(r6xjpUi{!+uo~(%(p79orzZqcqwS1LWJ1IA9u4wUk zmCt=USUe&WGFYis)~1BpQE=+CQMCo&%7h3`)5)o4pw$=w+(`SxCO9~h-z$PsSM*0I zsIqm`vBve_UH;vx?P|^sJDk&%%#dl^kYZs`8-qC&pTr1?Yg!Muqmd{RK)uVgDJdm; zc4P^+9~_w}aRhD04l_~5SScm+r_KG3*E?>Tng9H$)08|?@z$K}Rsa37UW50D)$RF} z-?Y|8^uvp2XBNP0cTRZTg$vK$ZyYH;hV&2wChS!&`&Ntx$NJCQOK5vEQ8aC42>>#H z+$jWU?-u>2<|~x|T3)tO9lp1yqq_W^5S!kON$c@9A!KTtu2#K{V_!ebz>(J4vCI={ z3OUd?ZWo&~%lnD$=%hto@d*+6$9_1==}my`)PGi}4lbIqKm`W^l{Zehltj@ouJrVf%b00Q5hI9?Z^+m{zD$k)t(Cxw zuPlSrP}BJ`{E?YyS5p8Vnq=fo2qu{O0F4Y`s1h!oez*FzD{G`oJtLH5fP4yqGOZqf z6)UTbLZWVd7Qkvc@pP&CQ7u_z1u!Jfwz++D`;yP8sgc@G$|F>PP=PYKyj$ILRXhqp zQXC##ZCbV&I@>G{4-P5Wk$ncGM;P8v(8I;EP_P&+S`OY?^eJQ>JQ=npvQCtQ-@D2C z9lV}-bx6D6j|pxC2q(cI)UQ|wOiNUTUzvh5Kfp+21%Do~6vep1&U3)6cX?x;T`NZ{ zqEh0(tP?R5hVON&A+^3ZgAC>nSa5E(@=k%oz$Y-QXHH=p5VLoDsF4I!sK6LrDM5_c zEW65@0oSaWisgo54a-8a9Q^ik<+op|2>4fD&_v|$+q?Mf#O$bqRU%N|1TK*`d=187M?m~&AKgj*T+s_qtdDs05 zE4N*qY-z8exPwa0SmswRKEt(ZaJ|?DEl^fvFP1g-qRv1>XFv=(_;Y_US!-CrA$j1D zC*Lx3aWU>U-dMZljxEW8>~f4MDx~*o)nTVGU&8-Daf+sHlh4?XJ#$=(9 zDG16P`#rY!)al>Z`LWFX6^v?J@DWHpJ=b~EoljaIQ8s)|NR;WPDV3*A_z?d%GPmP5lj1#r=*qE_mMrM_yf6kas#&U%iyr zQYRMTbbd<0!`?S>`*Wy>dQ9ilpt|d=16@H#CE+m&rde`D?;g6?q}%`Bn@5H2vtbSf z*$C-rXNxzP+_67dFqMnj2n=8{P62Qj&|wlcfRJi&LduacX*<)u*~oj zxhu;;#CjHBVYkx$GN!HtCE>|72;8#cQD3yb47p(LbQ<@#{pBkFuhwo6ox^wDEG&0?HdTp$89N1xT2FM3S7^oo`HzrMl+H87p(BubX{L8vJyq1+w_A&yE4|UNa z@A>?~z7zbC=b`-jR`{Q_+QScgYedg}&zt`G2+KTh^Kln^tbGruo|})mgGYVK0~; zOTWh5psG*2^!4lpCeUtlVJaiVf0o@_daT!D))ofCny<*5Kijk*rER-={CQugjp51V zyNrqljL~`I&<9z`@!xu3TuE0;hKcUDa5+Zcrw_3hz00&@_6CYWvp2;3^Hy14(Il+> z7%E6oa#5LOODDf()hgS4C;`9h)O^fCNekr~-bdz1ZGrezmW4{f4@bYZhNwGuLBl>DI2z&52S+{cUljP$@ygv7sG?u+KoR;aaxFYiQO>OZGcenL)ET7Ro$+8?q}(BuAU(*v$e- zWUAOW!~n9A%Tr4de_?}KC1{&Kz*2iyDz2(Xm>;PGpThAoKb9;!hitn*-U6$2I#LCdozPU(G4 zVa4ssT}c5hEDATXu~rfjz;n{5hfh5Gj$_3?KV$v^vChqkXW~{c!jSfDn+}J+@7T*D zpw#48CfQuQxTbH`^K~tz!H73Z#`(Xf*1xxjJD}gX! zz{N}_7)O&A?F!|!CVKs^ea+Gm)Ivb3*uv_LI)HbW+8Y5;#T7Gu-8#gUmnOf__G2MV zvfJ_qQij01_BHMZ+AJc4Bu!+Y6?4*9V!*l~zDr#pRYXF&w{awAvbvFmL zp~Wj!L0fZq2xS;~MEY?RU@}3?m_s>1IjPWlxe~K<<)xQxZ?6hvv)5+HH0Y#K6WY0? z;aCfdq{N{6w(sVN0^5q8tfP}3>okIFj0^pp$xjx!2}D26ksG%lqZ^c5GY zCKopn7^T#jtwwY_rMv)>rhd#b&zi-7EeCp>UmVq`iLA`O<-(tCb@D?>LAnJnizn|y zrPo+W645?-#WJT-DmohC+GSy0RHI4>_2h?~r&25+6*8<;#vqVXOl4vK&nRRCu*CGN z7z@>Z79xv0Zy9VYB|SRYYK}}TtUjtku1%*4xeJBA^tjG@A@top^{Z3^wsB*!vX-pA zI2p44S(W|qhT1Os^W0l>Hh2Hjo~t`B*vSpMl8b!m>f+z5+`n;udlkPOP4*`%?I!+M zOZZ`YlCLbh{081*FXF$(1$X~6|2vph zoUNsglr4`OV!v0VVXyL+cc6<3kqq>uNtPtcT4O32%fLg|KX$#GbdwYcb0dp`E{G%>ZLeyVWnO4WgEn z{#eP0p)+1&j}tX?WeiJ8G3jUw=wPU$c{B*&fWsRv4Y49B@tg~0HOP&y>cK6Drzhj4 zViT6Yo!@5i>#09SzIoUDVmP%}pW{UCjjc41U zg|1}-WJPVRi-iNtDq5UWGgA~N)#Wk(HZ&#V;s7hQ__+H#J647Yg4IC-s6J91t428Q zW@d1gYi)ZBb>?&qoMh`k^msn=5KRe(jFz-mL7fjbriS(Fabr(7hHN7$D$fBMAj~kx z{_kpk}0pc=N(9~$%_Q5Hsb!hF+#$~S-L0zt}@4n8SkPNC1wLCqL9{&f=?Q) zTkZQZKLf}{85%}ibu_AUkiA28<>G|XG6%5~+J;SxE3Ge9!AcFUk-og(4Fz_*dUdP*GrJvMu(?{igdSfS>A2XA*(L zUR8)_dc~7VulBkkFQqOaXO8UFyHyJ&QKCtWB0SH6f{vsDDN6`)K}0|>Z#GYQV$hrj z+H$w@ivftu46O1DGS0{5Z`Njea0pyOF~L$MwkN1d%ys zl3mG#kKl~7F)wDk*Z-nB)m_16kO{RDm;{Y)OkW7I8!;QTJ#I2yxb;e#;qeD&?eak( ziz^4RoZ@m*KlSiVpO5e25HXg4Wy=hSE|ac|8DZaK*%Cw*lY0-#3{sb}4*A}wST}e2 z-|$gs@^1ed{)++>8EBnGUVvi#6i$H53feG+=tcvCq!nGoIUD3BZ_9 zdXZFg2PqmJ**-kw6FGa8k?YHobTVblBP}w+2~t+IY|B(&aY?Z;9|~x(FAO`V%+Fl#OFpW7rl7*IlQnT1};O10~1x&JbhH}goW`L5q!o3K9A5(cU zm|Vdq_;^#HWxQxV!W#TOF&)!Nde!;=h`TAAWQv1gOOhcIZR|?{*}lvC@Akzc!Ko z^(4nW?r#~{LXjw%OsJS2dBQzHf+EVxh=ibO=W&t|^qQ3?Wo~|?Sa~aU>iLH6X|&S? z4nJ-O6{YP&AqiD)-O7*7%-yVk#Nr|p_#5ZcL6O!W~<>m4A4-k~Vp!nF8%D zp=^)ylSBIIe|t8YpC=)l9}*vg+7rV2#cTM9^3qz!g3lxlD%HzIY0DEG0$tz(PHZ0) zelJs^=lGwj2yY_5u3-8qkVn+bv7tJLz2t5!>wG&`pS0^gkL>MK|Mhp`&qzm{^u$kx zu>C_^7sB=o_GM~7J<%%O@q^&OEgC=-7R{9T>Xt3cXoUW5>0=7f{fRq9yT^}zJ%8mR zK6kH{_FLQUz!CKYv$#im_ye}M9?!~u!A_RBJf;=|0UgeyhfVvDNL|EnQgZ{?Wgc4`IEfXeTNWHlml7n3b zIC2?t(J+4Y7@TUXX)Bc;k`cq}lUxZD1rpaLOgQ5FL}IBj%Td7M=yo6)7#LD0LzvUs z>L6mkR8_MNvm2DlIrVE@m*7nAXIZ%r{k9U4vrf z<|Xa}*!}jNeP;elgCt-<#~RTS1af)U&vmHlKm0bZtEy-KzinHbN=DF{!YPaOX3Wjw z#f4-(!LXo(s{ixU%>TijSuqxj#UH`3>Y&CX78JjLAdyhCMqaEX)TXphLg^4!D;_oi z3lj&7JR)Yw;tJv_5)H%v$zTPyU!X@?zgt~*wIveWQrgBq)I4h}8KW~_Vaa9qP~5E1 z1M9A~LRYd#CpzY4{ssV3BD8Oq`Q|zt zp179$?0m>mS`Z3(V;hUAGB*Ly2~}JvSN@yNAmrZq#pIdX}th11(QXbH5>U|=Lb5W_W4Lvj;3kc=wn!pusM*U@(k%wgY8 zXg|1byTe=Ul*gfWq3=m^l@Jl-cP*M*OEeBDv{>e# zCMF};lIaA|5X_S;Fs#G)e8NIKQb4`x#{agwL6ot&kk+n%XP>@QLFRyjwO_qV3)S>ecwR4O@8Y~8Sl?3Um zE$%3k%Ogiab4To$vW?9e6KH^n4L?T+y?{#de3a zEkj^MHS_VV;l#us(rzpO_GkFS{jRIRG6)s91~W)W(#ezc*yMc^8x=^R23MbQLa*7h zE*nO|F@~5K&_bBB)LB{@0Bb-Knq0bgWJb6D6K}9>NQekaJ1inj<2uxSMPLsH1KtWv zC%PwdK1|h?3(+~a==@05+sV;U?B~%jFIG#A?oJkhrx}I0SVqT2LiN7XS)`k3Y(m#( zFAStd$Ib>!V>HsEyU$)A8}WppuD4B%8 z!9h|8{BP&!cYo)1^lt9SZ`rbPEW1TLX+VJF@(VkUx%;PM;pVaY5y{f~x31j1zuwYP2*U$RWHF;RD z>Y%%kHCYIa^PvP(;Kx*pd-2iKWF@er*4h3$e+E7J@BH+_NXyi@2aQ6fvdt#aSR&1x z3)??>`2q@qm;muZiL~bT8R_C68?#~Z={UXP`n)01t-ha^(vozQ*kU4?udUsVwCSk_*^&ikI3P% z4|jD+U3^s1zo|XrX;-1Z!j{^G67uleV6qKu=iZWsUy)xrqlArBFVU@R+ErYQ=!6Mr zg}}Xp+T4Yx(_A_F!P>RL2n6q&lh!I@v~`f=wj$B?bA7D)4#!IQr(M`jX!3Iwt1+>Kp0APAH3hMk)q?7{p-VDimb82~N$6yZ4bjqCjw(CiX#3f{y6hODz` ztSi8wdN582i>gh8d+6~HXOQ7wq-evba+#w%{Ay{UaAQkR-32vN4Nj~d$BvISwP%| z9svv4G5n;Mw)x!12vHJLY3ciOk-U&qvumt4u=FVaB@aRfl$?b)HjQK|580AeZWBDR zuL0?}m^u>De+tJJSFi7c$)|B=O5iAvAsNovWY{n$haxAelC>gIZ0+@4nn?37{@L?_ zV}vhMyjJQPzt)_pR=4`0f6g^;7RvX@N%|#r4N)f`uBlsjQHc>YlmjRl1)b?x5iFG| zvJ6bnEzx4?=Z3nWIWU7xQm_7^YZ@(R+eQPtmwABEwfwPHTzhd1qKV&xzS$r7f(VpDkm%ChUOuA}34L*N;B(MQFH) zh@0a@%6fIH&wO7_%Hp>1LWgm>EmsvXX^VMSyv;sBM9bLSW|(0k;HsIX3Ny{7$q2YV zrzAz#3>a9G>m{{|jtG7WJC!iGJmmQj2jZUFW87OFG!ff#Tyuwi?M1J*Vyex2?(>b` zV&?bi8)q3w zzHynyN+4`u{KSZ&C8`q9;cUb;bkX>yBSD5ENQ_ zh|B=G00M*(i|Ne3@zmeOuVNX;Vd#xd;j#B>Ddhdz%sY7TdBUsdV57!UjviyRU-J5+y8-a_g)-`WEzYT6EFi= z6AIdpH)dA}vbjgT+71E81I$w^XOE|s(WTGrJUWh;m{%J3-OH?cmF;g|2a#WDsK6~2fXObr(ywjQscaE&wY2%vPLC)tUv zMfum3(PtpZUga^*ph-TjeRoxYtq}!cYJw(p=R(x9PDy1ait_|;>UPVcogh&=PF;bx z7D8B%MP|lyAJ0$-t5BKD>%!_3S>7sI6rYeimluOTmX z17=|+up|XqqRM>vW_EKvrxM308&;(fv>oC5G7K5CY^6QTl)!K;jDofNXY?{PdO#GA z!Xn^^+LR3!JfqBMn-cMr8!Ki#6o?G-y{ecSZOC|{0`fT(jKAnqUV1f^ri9#)&kP(dTe1;F0j3ibEykpA zz|z=KG3cO7z;j?Ao1Y12xBvV9f9RUYLjF8Xu9Yb$blky*&sX{C)^)BBOFtAVW5)KnY~SW_JwIS-wb1QuSTy=6%*L5T)G zT35qmuHe3$EA$ZNumq{ShK(1BiA28vTJeT{l07{k%^Ns0(;HdNw_Ew>4dQT1XXvv6##aO6RirwCYE#C~v@+6{ zjHc8AF7`@XKp-Fotf}BUHKyi-Q-oPA!7=mcf3A~bmfL~hvqtG-u0Wi(v{AN(Sx=Cp?|RgT8!5Btx{qWcV2ocKo+aq za2CVdFdKOMsb*eyW0V>D)`ua;>YB6Viw(v26MwN`W%}BSis1MrbGpYX!52FhnsyH) zQz}MEn$KxkK+jep^`0G%RGO+CFR2Yfa-Xn);&km&P8&eS>NS^CmQ81e}s!rOt8@o3EK8XDk4iDUdJ}Xmm_sNQFS)2t}<% z)_sl)Cq>N=%xJIrrjbl57b+GP#VD8ozTA3IaUe+e*Z9`V0vQ6BJE}e)4S$PXE$YF% zT3oTPlLE3~`@QP=b2E|8`JOK{DixdJ~B!olNXT}zk1%SeDf1!w=;J!VF5&)7(!!$;Hp=U8*;RX zagn&O98_P3u{<;uP{aY_hnBqE<fUxB-Bb!+S-_UouYLkr- zrgr5ezImC2W!Q67D;b`aF}IU2ES;T?^E00ZT~A^#cqn9SXRN1s`;k!l%1jNChMSt6ubSL*FAS}fd^mZ)0}HrZy9oN zlA{_$G^75rSU~0ub^BZICrjU2kx>PVyYzl%Jt#?Gof9`n$=WjS) z)tJF+0DmZohFlfB`#_V{Xs`0YFIf>AfD{%=FIck%WuV#35`!@F>DcbF>9hPzQYA*Z zy+0`|F?KJ7h&PTkZ*r@lxppy$5yQ5Rco;ETE_vli#|Yb6TGt9Az%d_cZ3}U&$gGN~ zT9{InRw<_JILr}`b0*?3*a4`P!LXwOr6vrSA(I`Cvt@u=Xi!DUL~?{^Brhr>j*Z0G zZLqfUi7br}sh;Y~C>MQ)gj@s)EQO&m_|VQ>@)ceAVXEXaNXR8THNK9m^bC!d#~3O*6U_{nJNM{(S zCDPd|MQp+xZ#(0P-2W~#(#C>Ss&JRO(9lb{%;UFy(W^eJDfaA@6RUbueq1Dz zwbNT{)v)W;GAl+ErdTvdklNZ|M=qD*lh3 z#H3-d5x08U(~dsBQ$6)NaSWGzH$MMhOMXrvIpZ7CHe!KMVNJ<`2@$d>)`#ix;V1Tg{kI5Pfu%mRhM^d5#ti@CkaxAxi|%aSzJNIJqYeSh(qWqC(h547rG2iWT9^Hrgo2fXal-uTR3I1prZ$rqPBCl%x`qyTeP z|H#kSDoh#-x%`o(Ef!d~kNoUveV82aa7pJ$*S;BI0vY}N=)Osy=y2U0&{?tW zo0^AYH$3{Df7T68tbU2&D*NUt)H8GAzkk`qYxVox@Aw*t0cr4FWi`Psvt8PM_yD_V zbsYWVMm^J-!nxykw4Ml~JfvV0h*+s`HbMf6c!FopZ5DxA#H!(Bz09dw?O;4(&-e&X zjU8-m4D&4Z^9aIxO71&b4P3whL1gq76lk?;P~rGML@GNHyoqWmR{w~IC9Iz zmfkTDl!04Rh7u9(jzSZb5d~L@RaMGgd6#(=U=jtm3~S(BnyB2A^&y7Fg7R8b;A>zg z-LtqC-1Ivhb~L5o-DCEli3BEj%^wv^VD?r7P`V`6$REq#r?z5(AOIxk7uA{#rdKuU zq)rrDfobAj=zl@HHHe5w2Cw-edvrVxK}u6+-O8JPo(By*v~kr{meK30?gHJI4=>;e z(d>=>oh!>PDkRQMISPIK#poy7gcrxp;0Hs=57jrp%Pml5O9^XJR^;9r%9Dv)duO76 zd!=>(FIhrI-FpKizV}{iy3{K|jJt%s4a1OF(nZ>*@h#;EQstiAhH<%3t-SnbJTKLU zeTyWEQ3@v3eNepS%xA$n+qrrZMb$_um?~x&JXK&16K|RJ3EEsT6;!i10Qpz|y$9A8 zF+<2U=l96Ys&AwRKK9J<{mSesSrMX#Avub81l3eXOLzP4eX>MY7+BJp7KaKg#=v>9 zo==HM6%8E!?xA~cKnbF(o{P}RfKQW==A=!r_E z9lXX-II1U5Xwx`MteQnk@EB|rysxEJ6>$qSkFWlwyydJufg&KZj1n_hOH9xwJS#L} z7+PL_Mg(1Jp7f7|)DF#+2!2HFjzpoC8XPDbZvSWBTmXuI>u0Oc-WMSXJ{(*~;yMFP zjplTHiWz(5uS#3=Qi}_3K5uZ{;B#q0JA9guq>9D#wex$vGjfRV(5PH70nQjY(r<_g zK`6pX(Awq|^Zidort=Y&6Q0n|=P)cg-K#$19g{4^%ULx(#N;N;8+shx-pf%DTg^@!rX0@&J$th$&Jc?iFYR?m=BM`#@i)K_o zY~P+;$?Y9p>X0tvP9RwpgJwy;^=H&p7#sUkGD0FQawJXgb0{%rjBsAc(hek?msj>+ z(pcSosEV6vK@bjn$!uhig`R6eGE@y^_#@$iGrU+~hHUJfs{&R}tJk~VxXi3G)d)s^ zw;WHw#<4IuWmyt=P#d9UaS|k*s_5>6H{LhH%qBFL#nk1wK^M!NY))pzl(jnbcaPuI z;l0$(M83*vXyp2Ls~2ZI9DWK~Ped09FXwX=*~ytPq2ez1h!)}@=G4UVWA;4Y)O8Yn z@uxsw(XqIVz(Ft&G>LZPI#s#Ud)24?c%^10QNY<;Rr;_Kgt5n?5f#mzO=-|`*9ulN zGv;z60Z4{S82EUpV@Eab__buIF+* zHQ62$G2Q-NpS}QXAQnM%93vXYG8^+j^a#=L8K+36Mh-r@axn8x8BRN~z0-f_pKPkO z74D!NWv*7jmGM(KqVjNGpNOezbNzduHVa!F0(HTG376%TZ)GnYjn zm&KGt$_;x+)R&m4Y?F%-CV($QmPs%9V6ZnJI1Ru zM;>QPc^MlD9!kY*-h+7r6joYTsXb}AY}&UlDj|silHRey6V>pPK!PRzQ;3|}Y@8Zg zRU+@Lk2>-B#sH!#%A~M|PPSNg7k3atAHr zvX32-*(C4d*J21%y(hg8htM_5{89y5gnYf~mzb_$l^-E@p00ETg4`rB1@|w7>`evK z0~JrW2?5-23Pcp7)cDw|0Y^JP^bi{; zWlQ0}Y)pvUF26+N_B6&wde4ff_B0h5>0`QWy8|t(fP74;cGkwWN`&iwd^QlJR}lwA7pX9)y!()iYL697xKSb+xOM6J_mpQhN5Hy;~==^nT-qFL_OW+a88A5; zgPhtR`Qwvqy8$9P)M|*rr@X4n?ajA7Gr`TA!>%VUG$Y(rE=awY(PA&z;OxY~&k}e5VO__yL zv!mG~_rP5gX7dOaT!Rh_1|qUVxBrLN7DI6TdIgDaMh6l}30$0P;M-Bo?1eyjk{W16n{d z%1l3pfFYadsp zSMKRA@%ou{{%z%}_o{kEVGb#Uxx-HhzhAgCIyf?=2E(Z6Guyy;Sohtea}>`vy~80EX+BKR#2}%-yePhn#z=Vh+mSM4;m=~5$fAqul4$W z@Hp|i0T2@aMu?OJfP8}M=yH}?Wi8w=ZJ7#yJ$uzM6b+=wHM(;*AF!_+eW~LJbl8|WHf(6^qQQiaNi`37VT}Y%r8TBH zGfh!C!w?$^!52j`6nyXp1*(TtQ3)D)vJ|2V(=t|18UhC)K`2*moyyQDwpM%yR*NGU zhxiVif@Sco7MVZ-)8z(&E_X^RTkJDV(F%!5F#x)FF*z*)=a4`1gkyZiL8)oB2;p4q zO0Ke~+#?@GNRCVXa_AUQIm@K1^Upm3L4XoHs%}*&dd3~?`A4j_z8uba{x46qk3b4& z$biw%_Wn^6DfyYhr)V%gA<>1UhObw>d6nC~sAd*hzqVQD#e^yFS*Cv-Go*QAqi1mB zM~QJVUkX*nS1#$Cp@cuvvSS*3?S15|G;{wD92D$RFG2j!53x;x;Xxc4KsNC8 zt5RX?QdPrj6(t79wIsMZv9?Q7GH1V_8d~+P_=*A9p9o zWb(LuoC2_hFDI%Q!`*sg>M+nR43t*5j>LgwY^@_Bc6Vfyi{erEXopo^NXg`i(S49C z;pU(LGh^tiQ~8&F^%hj^LVr_!gPsHzPfH2#L(97d5wMhQ_{@K+Garv|8R46n0v&s-@r%*eyia2tHX{Ky~P#l7aBX&S?#w}McWI6@`4LJ3jN z*hLkpDsVk*rXF1>ak;8k;L(e!{X)~1)Ve=Hp>t_n7FMX`@~qL*U{xT98J%KtX$rv% z-Fh2@wQAwnd0AyBxQ0RTMm+P0>#;#6%CvwB;oA=&dQ9#RpZO50yw3 zE-eND3c4jM%z8|Pl4aK@u&@VUy+O6+u9P&493?9UWBiAprD(#^7t>H!MPo9qx!$U^ zH=8aM%0Uv;h1sjV>&w6oGqKUf`WgMyFkkT4JJvMJoP|0euBlMDXhcETv-~iDE z7LT#8%|-sO^a~@3CW)ro3HGWtU1yU7?8UM<4$+D_hm=M+aL3n)gP*GLVWBunDhdu@ zg^pG%o`HXAQN~aguiu6<0I`W%L{09D%js60egWEZNo$p=h2(5V4frTS=Ld}`r+fj1 z*#l1ltm@;?RCY75Q6_o?1094@k`YQEzYD8z2%dtaw6!)xE@UIglA zK8}LwN!tzT1$IjJ}uK1}~iyUA({ z1?BiO{WFKn)0Q@H%YMxZl<+>~haaa}b8D@sznp&CmR%B6ZgGYdGwMhPG%-tplj8iP zT!Q9geuxMsW;aEUg9mdLP&ef*1^Wo$`ZROATFp^^huVYwS0Dgw_w0IWI#hYN3);eM@r0h zrU7HSK9ka`esjpmzM!>xB30k9 zV`1#(QY4B&Mug2r4B8X*W;GFfI!yUOG=cHdxS?#*aFX;;s1eo`w05`u$QOQ@;?|6R z%K2b_i+M?ZAQZaO0>_d2OgTyxQ8LccGI6r!^5qPFL{ovrWVaeA9X>C@!4;Xb*ZdEog}v)H4Pu?0)2_4;pqZGc6A>1EP|YN!AUG&5}(OU*%i7TI(QV13n=P_y8; z6n3nDLzZq!Z9I>${FnLRvz*BoY9xTBuh}8mQNwM zINOqP7R@!z_R^_%vc}>eG==-oMIq~B9hR*U4{6B~VYEoBm$Y+-Xn566cnRXJSIPRi zatSJkErPFnG6J?Y!f~&z^N4yiQ zdH-DuRO0hn7JrkUs&cwtLKi+ILr{}kb}{3f-L*K8kk6i+c-FN0KiWXH5K&Nj>sD@g zo;3)VCHBZS+AXV$Nj9a$z)sShO!*k76F7oaQ=rnOLDaDo zVfs?FahYo=qc7Y%1|MdFg-j-+n+&<^P$egeEQ5}IFx{RHy5bD8=$5q#GF2dMUJgG* z^@%-RL6lXVHKu#jO+VmxdEy8!G7q$zHPK)|2YX7hdl=zYv!OARR(4IYmZErCc2cFq z24U$|fA0c04PlunGNo99rIf+}D-slHUSQs~YW4$0qyRw1V>a^wbsH(2y*!+j0)-87 zPef2B99daSRbTyqvYL{u&C8I+mGoErQVkqVBzUT&Pb@nm#}7pPKdeKsXlCZ`+Ojg= z!6HExVIuhu%=h;Cz76M5V7dO=1d?(XojmtK>*a9Z4R>Lp2^cEY2k1=Y#oKa_IRv28P#b7mIGK~!qK!owk6MRLCp{Vubk8deLs^IKU;}lJf zQ~{2hkkm>7%>*6`E-I2tHU%no`J+cT%_GA;;3e~zS9tM7m@T0h zYqZ!;7GD6$ZSHzCf}4WMI%$nljg$6 z+mjz&4&=`NI#v#ZTzh_a3f_jp8|+qo@}_L?vLsp+Ft+oODuIvkg+&J-rUG~#krgX_ z;+qEI`1pv7UtHkf79uwxNx_mP?1Ru&OWdpc^Vby#&MGGer{H>;P7o)=lot%ELBr??0ob@ets<<|>mh8d@g_Ge8BPviYI`8m2}n;}6k4HBg}*E;(C(IG zj8nb%+2hGlDbglxshS#^VW zHl3m}DDb4Qj4*v7N?* zdii7)(9ow#=;)XEPzZ%~)(|w+sfz1HV!bH*if#&z4HOT{9rn6zqGN--%J*M)#l$dO zi0D>3Bq$Jtlh*63P@6U5GKL@$xeCBA{=9INQ6q#jk43W)=8;72DHdjA9~!lf^@bX) z$A2j2yPy}P+RA(s>^8wcXD$K|As9;X7J-vTqrfMI7Gy<=POSn4e8T9wQnyURmhgTs z0+7I_Cog}JW*Fm18p$k@W!{~@AQ^w9l;I*67`@Q;+Qtab(S3jcs>pwR@(Et#MHvby z+3xY5yPlr^Gw!I3tlo~Ku6hdrq zeT1ZT`LS~`DBlo*tNc8bK+3cr7o{L1Hu*oCKG2l^bg*m;7vE-Koc&m%x`YR*5nXQ?*^VH7 zs7l3jz7>PFtSbu?%s>FXpP|4@r~e=RLs7DFewiQI;m3h^<{Y5`qBO_pMJ3zp=V$8K z#-`Rd-r|S6&;n}ZT2>iq6MiI^y`3iwDePxo3zPalh{p(dnT{68LSZpPTjJZDAM+!> z+=X*&Y;-eOq$bn&hi3VmClzh6%a22*Zsq-h-U-jak32+bWiYgAs`nuG#pOG=aH`t_ zg4EQSP;Ttyr^t$3m66%xkxl^B7^d+v-eKTYbWD8w9T!N&XYfToErjfnm1|dd%f9$B zG+Mx2pe3C9%sLp{<_8S=%-RLw90XQ?>m$G)WH6S|$Y!~g1tqVJ$v%`hT7>(>iQ{Gm!WD+*IKBb-wAk*tX}#iTRXtsFexJ5f4^<%p`vfzPpnk8bsfNq~(+UvDL0BP$zY3a;^# zr(N7mV0N?Ac`b|+EDV}i3qj4w>&ukwiZnl8qw5Wwm5=yvve!w}ncSy8yCy+zO&s!+i?{W+~m@y?|7RM$XtteNc zna|#yIAgpWBQh@e^{h#u!<)3DfSLkpqajoU)vZ46l%qAxqu`_o;0q1lF2nEcXFBfW zVh-i#5OaR`dS&=fwZ-6NKV++7aGTyKX$oXp7>t{O+sc2b!C16n84SPn=$f#s1?<@B z`raO01hwWW`)2BWI@X<$0&$QM9d)55;7_6JT$d?skJV96Os>nf9ut|z|a zRz6Af#Z7<4nXTQ$|MS|L`#$~PE$8SPg*)wUci#OT`{kNlou_X4;r1KWWY>N0!FQgc z@oYOgPkYt(&#{YdeelTjJSMwxjX#kqcj`*N=$=itUe9CfhELx87q5(exP%2=y2%vs zLa6BL_J8@bTx0VUM?F0WquFX+8f3Du*tkJjCz>;Zkyac6!NN}@gYx(|3O+w3>ghpy zi2J*=A>)oWqR}>)>sBARD|nHSv9cSEGI=#wFyU2AK1Eej2s;$n4RUaX3w zcsN`scvmCFzyk(c3J0(LW_4|+O)n2&!)d5%M>zLs83<2|0 zz3Q`vtsm5orz-_-LgE7o&H%2gjWP8B7IZrw1`Vf+3e;!0fP27f{Ymb>Spk1uL3!qi zEbJw#P>!soTqEu2&)%qONf($@!;QqtGkuKn^dLBa`@wo3oEbRde!Bt z3Ow!mBAGjQlfP1iVWj~Z!fK!>-rx2~E2@tqm8?ov3yB%(WKLJ#ozP)$H~cq;Z| zUFfzr2Sf6Vos-H8=no{B9NkWAzAR-@x++3^+|w<(9iU*P?>6hor*1}!TfqH(PzNz} zTC)N;eCs3|(E#xDuVY%Kb}+rR-VaIACI@h z__u&(p2_9TFo8j~hYs;&S~qNfI!NZ6qu28<0zb${p{+GfUp+I-f#EMiaD}qqU5Cwq zxW*TPel(RFIeLAky7D#fJFn9N`E$74dMmhHNCaN8NNJe8ZK-lBs_>5w{arS(N_9V_ z4<7novZfGz#8%5Hi!n07rGzk|TFePpX|H#b!dF0A9?x!DPD2}yr9N@1=ofh`dWr$f z^vcYjdO*?-9a8`p3!_-L*kX`8t9-hxaZJ8ZEr|&{NL9IWCXyBjPVR_kn*lzW8e^shZ*qMVtF{=g|IOWRJ=Zk5W28!Q23W-xgJ{Z+wV$$LlCOa6p zP!Ag3o9#@_k}081rG3A);H|u*t=ji*wwP9s82l!25>-8+kz1icucx(k8U&i^uMt?X zeg83=TjFF_{B%1B3kgw1W3t2J!|IG%&BdiMtY@cC260L9_Lg{xuLZvPvuGqj3BLRYB5b(|~* z;LSPnAG>XGCYjb%1!6BsRtE=VX|m}J*U|k%L_pA!G&I+#55hc)or|6kD7d(LxLbY6 z(_;hiSy}bD0y^FcXQ7>-e|QhZ7q@(zQ_E^wvV;Qp8aXfKNeB341q9N2;q6pSsR@+@ z#?HL^-VY?OTU6CJknQn(@urVx1Fn`VeUCPW|2>NEDI{r6=G{gOWC3XNo3z32Gou=%ZiM(E=7M9wXB0=i>9X# z=hya!HNZ!(yw`up6OYjz90c48>AdwmSPsgfI5@|y$FedZ4icYD?JycOBtaFCDh=ee z!Y9@gbr12qKap#xBj-pN8n9CqUA&p?*@8Y842zPo99Y|tK%Qb(LOx@UWx5J@q*qCNhd1QmiGZf)_0rEp>ugD=GouB|MBBaUA}v54>7DWtc@mQNP`)|++IWT* zjL~GLtL`A!4@JCyCKQi})m@^u?Z8yS$m)El5=`kFvuYgNB1qb;{QCb$PuT%j0Whnl z^1E;bD&}C#IeVMVgPclRxn)rtGaH{84!|Uw>SFe)j7iLIyc`P=nJCWn-mwEGgY_SgiwjHCgB6v;su6Y z%Kxz-iWlWtaJx1hhnH$O#xR`k(!mo_!Yq;J8+`VLO6aR1x9|VNm{oj`Y-=<_dC2Om z=x*SNKGN&JH7SnlhzhgWTrGj}gDeS+fhgNifIK#U*EWR-H}SJrt*H!gaJTx{&Eo_H z-LY^`=3q%5oih7HR|U)w!h5cjqkG}@Ed&su7zO{Me4|dW=%BAChhvX<#ZYLTirWh^ z5jH7%J>IF@u#Tt+r5K7aIYt7}qF!%UR})O3KKnvTqi?h!!o>Tm<}!j2qxmP{&pH zvJdE1PyTp(hVjbcO%%Af_%&yl>!KL zT@NW=FIiVA7ZU%QlC+P?+uvmG^!ad!olzFWroPGS)0w7)XF}Ufr}~n0NPcMVNon}& z@spt5fC8C8HO(+pkGn8Ux!)8_w|f4;p!u`*Vpr*VTfvr$GG$! z)|hW-Cf(v}H+WC6vyp@@mTehID(pCRe2HQ^ zgiGjQB#kb3bg4#)EmD?HC@F`;co;kk)`Fo8mn1Y4!vO+qmT)hG;s9G{3C^~4H$9v} zA#S@Y4e9>=&-1?D_szw@?4FcFGxL4#`@GNf|6JZsG=irP13Y>A4ml)>$i!HEMbaix z!MNX46o2v(zrz3r+?6W}vKua?{1Mo!uHcv!6S2*lNQMNrpOU49e z$-@bR*^i*pwRS(4a){pS6pV4Do8xq2=#La=GK_@4hA(?iKo1+L*R6MQM5@*BZc%a& zrh;WW^=nNdkK$&vvT+EO>1hTVb{QEAz~PvjUKEFQ{P2K~-sJ4#=${Z6#bi#J?ezoJ z9ZNb)uw8S(ZS0C|m4_uMY-2dJuteT9O^`b6)m;8S;NP%O^d8<1{=S7AR*$FI1M8=# zgf{s21whC8nE*)4Hdtd?ITFD^lMQ`YJt&&cKb}sJaVtGEE`K z6`$^o`1Hl+hfhD=elC2P^yX*wa2u%wh}GPsob4ZYeHgE2*b-G?$%qaEdyjsv?;!ue z`IbAzzk1RG$@{L5!3aqXTVcf-SJSCh>0K8R$ZGq2SKyS(l}SreRrb#zMm!R5_VI)d zoeCeU{EwqY^iGs_Y>Vb zI#uLPG@$7B{P)Gi)ZykWCH0s!f-nY$C9Q=t=4Bl*??NnzX!1TrJDA=`TzkXZ)K=NG zn&6jEo^K`;4Ng6?J=~iQ?pYGSPK2=wNrShYxr0a6Ig;UYWCR~6=B6EftaiNrDZi~( z*--a)N{i2MEfM|GIhR&D0rLSST(Yx?Pn{)^4;z$1b8jn>C!MJXat=l+Efbuz?9^2| zS?P!6+@Idn7*WCct;%KfO{Z#zc~ZenXedf2Txq$Hz(eBF6dcokb-FlV8a(qaCpa(^ zr?=cO_g&+C>VPpUF^VNtBw^~#F7YspOlidD*aZ<@HfXG!Gota<}wl9y4 zLQrZEik{|L)5jGj_u8i~<0_;XV|jE97oG&@kQ1PJO$%=k1{xVc1oyL%(aGAVw7K+8~7T^Z3 z%Q8MLLeh0%ZAm|+JX(;e6wj@UEm;gYZGvufGqI4toiCN&qfa>aY(R#?RY`qHttaSK zw~=YC#fuf(QZbf7W3+LC?pgi0vsMk@%{V#$ww5>^%k780Xq3#l9#Ql{F>E{qd=r&w zVVDD5B6HKL0&53JbIo9u-`sDMmt7i5ZwimC1RA#$)p# z!JcTE>h3(F*xnu^ovDr= z#T(p`$>ZGOPSeDq=ZHquY-&0Q?P-HNmCOvLWHircYbrq~KebmmEyH5uxPJRT0s~`! zIx7Y@A3`>x-HLz}cN7NX!?+hlXl+H|a1evj<_B>X*L(hR z33ojSz9PnDh!ERPyuZ|ENS6?T7qfZrg%qYJ;O;Zhl zKp`u?-2SbV(-j{l4Ao=Cy2bq~_70P}Y$DOGEl-IGuM^&BFhV$Z2pqi?Lprfbbfo203oWs6> z@Ls9fcnxwyIPj@NWc=GX_gO)HtSj(^Z7Z&|?lf3y#Wm2+yhlugFVhXIPJ@Srfk&RO zDf4x{RzWmYTywrY-im7!)rQ~^lDcC=M7QD^sXOOmby4!2up9K-gd*vCZQEkKrAmp? zc7{wuLez1#ggJE$y%Jv{$NIf|OsB2q@j7`m<^~n#RH*LJgE7^u!f}*sr3_a>to%)C zZs&Zsxy!-39#0uX>rR%Hh7fgm7(Lp*DXr(}Me;MPu$wKBFh;EU!20o>URD>u4w zKm(By4=`q_?)|Y5$Id)mUU%h&#tS!Xx2s8PQyS|?ux(@fVSP#adCUYFJRU;2 zxSITU!7_VRG)J91IRnPI_eZr}AycPu5y;_hE~Yx}NmieEgyWqW~F&?xfqn3Sa0T1*o4FdB2o z6AOt#{M0p+?r`rLy-cIY7i|HmTTz}-D)5$>$oWPaN3USsv9-W8Uwy*hngnb^erhpX zsBi%TPZ$Gmk%$whn6WX#7c5*JfXmF3Vjg#cn4h6G3NLM&bBV&FTWyzzsODNlA6*q< zf3x}IECu9$^GcOu$;gU7V+A6dtP3Q;>&!@!6Sb`sY<{ik{`|!4MP1>(y|`*kDwHE_ z(4Vt?ZFJt}Oodc^;4lYln<^Jb(wgzsab)gxepOw%T~jNu zl=F&F)~6g;%_Y!D=>ZGx4VXZZjQ8WwTgXSmK7PxrPEMf??fGF3_PprgTKl?8ff?M2 zCMMCEV~ z>Uaejp@)vjgAcGbfe0pYlkc(kAM%hVxFo$y~GM47&$uJ8m_50F9q^}kU70;{jL zNC;vv5cyXmF@h%h56>spw5&qFM#2YS~~6yM;}vq1v(b`=;m;aMzgm&}?yr4A9!|r`yHY1SPJhH9;57 zMK?N^3_dSeO`cwdmTv_&grzB2TUakxi(m#NE^mh|*iPlyNR)9^;<3~lS&$~>rG&W^ z$8oo)+yOt8-Pg9n zs^<@GiUM*Dw&5FLsg*V{kvBx_6ZK0r7Ugd8dR@j zHvQRillTN0f(H_#@;4{~w3&bff?Ff8QlBNwOt}gWmq1|Wfhq1BeDbq-rXpZT&viL7 z->_XvAmDUek8*Jy9i5DW@#~a>04DdFBY{1!0I;*UL#!jV(Akq6 zC}_X&0eKH;U|fS&kzap~+JOTw5O9*N63lI<4$lOdq)`{t0)a3Vg?dvH+>xTRXZ;#$ zJi@z1SsE2Uye-gaZvGfNWjd2NrzE`FKlLV~9l;b3joW*$lbEVR(}(3`;MQvHw;qX_+O$n;7r#++FY~i8 z-(?+4fKm*uEkF)b41u9{dm%ZPp8~ z_ba5_v{F+SR^J#3DJ+0Mt(WB5C&+;7(!_b(LcXrC>YN~`an}zO3$*-DQfxhGQ{y24 zkSrxwXy!D1?P+k8riRjxz^?e?2~q=4&s9L~vx-4Y`jqzwUMN$KYYT`1!S=j&_p(XN zLaxQ>dd5oC+-nyNaLfkLmWi6j>K}rGiP%FsC|*paSW5l|G*IV$7vWMDQLm){P;=f4 zLa?CQO=4AQX!5q`#|Ulj_qYyWj7n>0`<}Z_Jo!8S@zJY~lvn-n(UXG%N6PE|*Q;I? zryyOY=_quJS934Ex|PVs^te$*fD7qQ~Y@`gP13dE95XMaW^X=|UU_?{uXX zC4N1grW!~L*O5DDunhfHFY;y*y`0NFGsTf8pHPuNoHT)pTA4tV>~!TOcsw9*wFR5Q ztp%G}daaMpuKaQcc35Mbk5uj0{^rsommkRLhB7SNWoTomF$zP8{-{{f_d?C9BAz5U z0b|)9EKAyl-pu;qAz{}J*?_-UC5XVE}&{n!@l5W~c5zGwq>k;Y6fU1gYP?Hn`HERI16RDz76D^ew~Rx0OW zXIhtOLmLe4KtraI4|b7`by((ynW80Zy88kRbJc1Sq4z_hT^k+6lu|MRHi$HkDjm@! zGbMfiFsQZ{b_9crh9%rN97g=aq-&g$Vo6sO>_wE)Oh<;TLVHL6r;?F%o<+@6K%!#d zw1mfWM*$|o#;ydGsJ4Iq82XNA&+333kuI9vN7TsZpqd0&x(-v#t|#y<{D)^Xk)~8> zby1quKu9IRX+WGVCx&fzH);)Mw#u64S zxYQ_#6xLy}C5l_Ozsx%|i%yo!tRqI>235v4fTIU_C&^Xxfn=wU3g1I1BYNf_ zz(Nu(-~!EHk*~p|v}7=<`%A|D&@^RLO1tO~c*MI?Hu&X&J6UIdY;?<@%+RM_2M<&EAHI1qPSMzS z$PN&SaPK@kHaoH8N>hGo;!By?#a*`oSkD+zig<{HQKO8N@yb5oAVFi*2CF|Jtd=z4XNT*#fq{cHMrz!CEC#)itlF0?7}_7rjp zf)FN}#b?*6tYAFCQQNb^46x6-?+nk{IW&!9S)16SP)%Vd$46W?oUba*I#Yw-YZg6=-oAZBM2mTp#wmBBCQcSHfR8|bN} zB9cSpr~dw~m+oeeBIWz*H*CNVAX#Fvt6G(OKSciruUT$?*|+H-CQN3_Gj{nlR)2m; z6M~*rcWh-bVAT5JEqc^i_rndX_1+Zolh^n6_R_Q*AimZs86RI@zbh~Ju@N$i(jDg* z1r-@Xu&HqQCRk8Sb8mK_om4KUtObr68KmaAhZv8V;FZpZGyzC2f=eRk!m zAWdJd4u{48A>hG7Y`wCnvAmzeelrv{4$#CldPKbgU2}`CeXVZvvW8gKq4mr2g;dsW z>f5X{$-MEzukJZx_>vz6&d8p3Jp?s0-$kBUl#7&vQBSht$q+D z_}BGv{e2ka+|(oS*_P_*j7a4r=Y>?Rxa>{MNaa(n`Fz`5C*FPM*AcT5XRdjQ|9N}c zJMVk*Bk-80GtQSzrB{6I6Q_pV7cO_~xZ^}__cz|uW|Mx$$IC0;bv*fx zBfRG5E!6{HRSyng%o@I{k3Ti>Fuu;vmrF;lJTrw=Z1_sk;~u^Hr%(5|pa04Ozs%!S zJn!0nc$&wp7`o>Jna3SDQhs@1_(bkw18>1#kFRLEX~l^PKGqAF%k2jXj|NqCq`dy& zl}|^L@(W-3>QjT=1Dl(6dju)%{EOa!-VIG3H4);D_k6CWyRX0Liz4cW*Z$kt{y%$7 z`GK|z;U@jFa&&rOYVdUL;HIV@G(Gv@Yd&&{M>l^{kN)xJ|NeAePtOsghizZ@hA%xT zW%!Ht+;{odss4e%?!KO;1+eSix$|qiy?s5+yJ=b++wSY`>22{4wmtpvjeX5jZF&Y9 z?CWkpiMYRwy#rx?&p2Iv6#evzx3}>VBd7W{cW>I*VqxWxzj)s1-VK}1Z+E9QcK0{$ zK}-AKYo2+YkI@NkKG$RZ>7su>-8;~?A+tra?)hzTu&?LpRy(};l@|+kVH5E= zz`^eRz7|gjJKWSa(DY%`Q?$cP-J4o5)7#r@hnxD@A^-2hmXGyY4*U_*a(Q&%$kD(3 zco9qat8eb5?cl?YofORP zK`|~Z9Oa1>xh-HGn?kmp}ST*;N=}V?oGcO&}zptK=KDMkIucx%6fKSd9F??OyMH9~)eQXVBiAk-( z-d)i)>@COMP3#`%1w3zGnUOJ7R|gcRBiVBM4`0l~pqln55*yX*L7sk?w|w!CjalGp za`Jd}2>%)_SM3z8Jm;fnrK}Pf07N|s`_@j4O=%wAf_HQM!$(2f^~SI+t|wu|M9h~R zz%?7#py^5z02DQ+z3h+9Tdn#~Zmt`)S^F$%o!QdK0AUeOOfI*-@YWDRCe!#7XskA; z%?o5aEuO$TDtwiHq7UceEO^CaN@#{Y_3#E>pGn}z?MhN-@_AIJ4!vj7Rv%jm@8{x+ zGn-liosF56D&OR+@yQG$=b~hH{r&D8h52Dnro5(Psy|bGr*yd<-;SAIVuk>#n1>{6 zD7vg(E5`Z zE5j)qV`aY;mRGn(Z+^7W+w+3{UVc`avBI42n*BzR8}?T_Ze0mj)7{^_+;Qs-Lowl? z;K-tP@xR5TfUff+DrHHFxfPGi6QxoUlg3biT|(i=TucNQr^J9Zl3frCtx8LXf#M|} z+-g3yB{3@Dm5@z{kVZTh6u^H9zrp2JuFNA1yB4*#=Qri@^DyH&%WZJ~o!}A67iw1u zC^_g@d*i^6l%4*{%8^2lIir_v>%yCNMF>!1s!)W8Xl9uo z2=A23uOAD>AT4--XP+&7ABK`@uZvJu_yFaXMC3@QH^&3OsWteZ{asH~q#dah;D-pO zO095Rd~V`Bg173m4O+sgIWu+lJaUFYWp8|;j4Eml1D&9mjT@B4@9X)^B!er}!585V za>d2&z&d`LC7*eNkJ1Fan#bd1rBl2riqSP=BvqY2dP|iCkpY0{ z!GXsdgBSdOXo-Vl9C&lGzY?&)<;x$!)x4|R_uK8CxebF}{;jsQFmYeuNgTMZxV5~7 z1|+E#;Tjt603X{ySTU$wLLDyPPQZlBi!ligY6~9rmib_f`yqJ6j!u2T`EXbQr zGyKg}tLQ$QRrcvB*P zl%^N!K_^i{bb=k73OZ(19FB_9r}l5%L0h_BoL<@>G(tZS0+IK|;80~*<_Goks7(d< zSRZ8&WJ3IP2g7jo@J33KRR9B@1iZxpbVp*6BH9{P!uvWs!;l?oxMn}nXE|i6Vvf}` zaT=|zz zIIBoPKLE36>W4lOZJaaMa)vf>1L`rteH4|d?O$GqoDI1WzJ@5sE$>gug~IG><=2c! zGFLkIiha6^{8I8r=w|^x0(R9I(Bxc5E{s{@8RMDhy4&RPA^j&Cxkaso;RO5`*SZ{r zVyED|xcYXb!LQ<(C1*o+<+6Wy(7d^8y%D_JUcIz6d8>S)abD0x0wsLZsg-&ax~3pH zD5#HE?+nGLe57-^PEeET2Ke3Y3*dXPN?Sm4(7Lcewf%ms!%awB_YzS|jAd3YX&-SZ zqQZ;0`y#rPr)LBk`gkJKo5o~#Fp=Y}lXtOJ)m52oeH21aOpKoMB3Sbo1JM%*EWSey zn43Kb6;2dK?C`Rj93m-YHzVwARU34vc#29kQn2Lg$S z8Qp5+>Q}}5m68{Dx}Gfab<5zQX8hl%)b3i-MBa*5YX&J}V2JECoQ_V3J)r#3n2Z|@2)z~HTV6NRKB+oEdQU@0RRAETS%DH3)i202px;{d ztuWEdAMVUlF_zvpAnk2czVEr@JBdtohyPST@k-9U%2(0~Wj;IdN(D+R34D^Ekwt%efk< zEHvMFZ%rCfn6sqt3iI`lgSqBw2B_T_QDf-r=QA7=iDrLd4oEy~QeVdYknV?)9848x9MCA(`E ztv2ii##bMlMo)#sq(qkNoMAy2 zY>ld_F|_DCV)FEQWd#}Fcg7wZd9cIg@Sli_-SA zvoFkAu= zw~>I84-H#3xxh3~E3Tv2029PUeVB_Y>#)1*M5ZE%_IayU!`n3yF6Vasv^X^~?@l&A z6v`A`%yUeUnM!teMG}deDkGy>1RWIH)A!R`H(3Oyrm6$)Jo6$F^&{COebT*#V=m`D zd7q)3`{lQKkcC*(b`HOcjDYvA<6VqVQ%t{r^m&jDq$!FTC|3gmnG-B$7iXcI`((Kh z(+mVrh0Dl+KJa?&f!frO3Wz;?B(^H^k@6O*%cAUiRjmGnk2MJcbN&V}Iz5Os&EbY)q$b3@lp?geSWiUoI z3apqDH}tLdmz+TYGsiC93IZGK0a)c&cdc*0l(0Vs57ex-*(!HNjpcMb06+tfCk)^? z6jvo!A+c)DDp2^s&*`FvN9CG%rXaxn$Yu#s)!lz#Lyz= z&`ud05TO~5ev3(7g5%KHd7K_UWcAV0vC86V$HcRWUbPJVAj=j8BUW^GAM}}u4o1Bz zNh<>eNv7PGMaUfvTA8QSvmP*=icw)aKH@7zAO%t>Tv@qcBreH49Tx5}wWJ6g2v6wLJPzk;6q0(Q zfnb1!LL!~yRvY~!Buw0Z+g?!>p!1e22+S=DFIRuOt^>TaJL^ObAVPRvSc)H7z^!E5 z1Srb1(RpoP2WsOp8+@?*R>sy9foayC;X9P}CeC*(*nRb9&NG|W!8g5fs*c1s3vy6| zVA*H_M&c4?Ow-)JpS5oD`ovGxs)V^v+C<2m{ckX+VQ2MPg9jNSF6SSmhrNX@DrXdd`7-X8Y6u$+n?-FUdl754m&6Vd z*@hecTy_>lq5m7Rx;Rf*KWdJUd1aNM#9@cWO>Y`u^h0}mE598fI>dL;)J%2IwPZ4# zfCWCgB6^Kzf+!{oEs@!??^WCHd>bh-u5OKXB^511UlN_IhBb5)%1X#@ENhPS1kSE&4n=+Eq{&EK6NHC#h^zE^y#*(9PB$LKfwVLFNxifo~UMNscG?as7 zloRLKdQ$4uQNty+Vi1DOFEaz!gt_^FMuyC_w9Js49YOnYNcAq0Aa8RoR{f&alKR*{nXJKXNp3kz0>*V#53&16@beDBYws6GQ_4ijk}^J zsQ!v5+&|XnZ#P)$6@%b>?s3?0t-;MUPYA<7T3CpUZ?jyppPF(P;Ggivl zw)ydIoVaNB*Og~)Z(DKV$*$k}wpixEYo0u{jSG@gfwoNX)Q(vSyuceeYugGs&x#>^ zlx<1%Dr#Ol{@5Cw1ceVOw%UnlR5==TUq{y+CIQRkSVt+&Di$>AU^n$I6tDs3M}+v& z^FxS-E<6`POo_+0_7%7z>0D7u16?}|c+5)g z;NSr9EIZx0M;ysGG9rFg`+d(60uO2uMOe&%~wVz zrxx%}7wDWR@Y&3G!K)nDE4&KbHGOCAi?+_v@HI0D$(gH(^iAjI4?=sy>H0;^*lRbT zYJY}yFUij*bi1xVjps-pF;%EVGKit9vrumT;&=HjeOKM(+>;ZhwXl)Wf({)Ox}00t z%k88E>TtLzIpG z#)@mHu=I*e>KESe8?HTSrU-Rf_+X|z*j`d7TG>zK7$V$RxoKufDQ_u}RqwF!RMmnd z#}m*w6ca?+^Z0INSd4&mSFR&+x5`)Ckp$eouD7qU`NkW0=&sHn$40Hls{IJg=f;P^ z_ILGc${y5? zq0Odoc=UDMyQx2(`IO2{t~`VO*vcR97-vY-OF8h|vC4i9s;$kqALws7=nnq)=+&03 zH4@k4(Tj>+t1Mlss$eq`syycSrEId5vw^pf*yY@>zs|bp5T0WYxl1D`sS@^XIv9?Y zPgEG8Dzth21}T+hfvM*9T_Q+evQW8scK%>#5+*h+ld2PhYTqUKsBX697xLxYnI~=- zc})SmG`b-Dl6&B$Ir!e{aX0kcwh>%-+s<7#K^YmIIkXLep*Up5zANF-rsmNH())1gF@OmyI7j#D!0#G8qUW5z*+ok>wcBCQG<=w4dGG75HMk76seZ!pF47=0nYph zcSc{w-w1`21s&@oO%MK>JHs`a<3C-_U3T-$wpcV%y3 zagrC94WlMZ59Brr5r$fk(hU4RRf>sr0Q@Ek19Clk%evo#sO;FE2vGpWJVDC2yuv zxo0~m=VP{6IDQUJ)^o_cF_O&;A;1wb>U70jvw|G62+47{JvWxN*WTne>mZSgQGNFT zlW}u-CWGoC!svM26)!ilOkq|_eWVZJR&$G5E4JgI0zOr2`*i~}ktF6jx=9JY4)$hf zxP3>W-G{iRgraV=n-j1ydr_)?g24WlBK|bju&+ixXUwj#wE#OiNGv@aH>cDlPTI+wKi|V(TPj zF@^b36T_8rZ@YI-VPTS7+$>1-gw;q%U(O%LH(8t`wfU)=r(~xpd#G$(z+g*vy#6)y zUPnLn{idJziJ(2AtEw-uf^*s%kn@T7 z!heFls2$tIoHbst1K$wWph2&QJm?lTwTH?b)u*B*2rm$D{OtFc?m4#`B`@>ahs*_r zr_k$!X6P|iF=zYb^>%c}a1{ueD+C&Re`pD{wttjp^xX#-r>3P{zv#tv9HTi)I=QFS z{@HWdk*KWw=1t*3K{ioU^C9l~^bYsLq*shETe+-3Mi+ND7;sMU_IGiGsMHo22dSas zd|jTaOtDP+I6s+(j`rNdzuAIcVHji*Iz@@2PzVD^^v^P2K&0&A&!4^?)Dw5Kn(NsQ z1D*$Q|K-cQ>wB--GT6(7l=R#+`s!J=V{ODibq~`Iq0T26Rq@9TZeDu)r)o>ay~f*R zQDe1Tvs$6?&vo70)jUHuh_ObF?eDDk!c{N9sjEz;c3Z(>nMVnzGbdi-=8Ul7Siu|7 zWdQN*SU;|jp!DVPV969>LUuagFSMpd0v3_QG* zVhG&3pXwiYK&p~lQ?>mE54v6@+>+Z0ZSlC5rb`}PzWbek_{op}o76r<` zoU21d)W=X0=ulR`WfU*LxL`U} zwFJX34lHQ1Bk zwB=mwe~8mqU+_s*zHgOIi5bOR2skIvxCTX?w8xu>^D}gSEm7HCLp4#Z?_0$hw`qLt zn9gxX3lM5xGVcME*-2>ESzUSdBE34}0q;||U1C(9!t(0MA0IxjOmsgxH#KTTbbIY- zEEI1)d(qGsotLP4a+TrDH!sWhi;1}rvzq(Rw&4bEGMIC1-7LUT&G@W`=Y8Y;?KbAY z_(1E10XJ`|yc{o%hD63K$t}0NE0%zFB2UW~F~YJ>ASaKGQ-8!_o5OkRvg0SJW`drC zm#!Q6sP5!M@|LDgzsk?R#FwR}4^H_=Un7Lj@u_FGfDr2KQU+AoqVe0;-^&iC;{i?< zg*CS)loG)Mw6NT<<_lm!E^*@Zd=Z>Qn#lmi znusNRS4mwrZjt6kkQXpgw!;&Nx7yA!V;kaT`QL49FnVY1x*qvr}`+Pa5-YX^liabX2>I%T1e)!esUK(LVl zlFse5+1dn0ZzyDCH~V!I5;u^z0Ku8;KO03k@T_YH2mt-r?< z`sR&+)j5k-LT>lO`92`698I0Yuvxn0_WO48g;ZhXo_NPFssd#NM-?0nDpFSz926@c z@J4KNSVYMAB?d&{-_Zis5_;s3!98ItS8z@w0jwthkg6S*erMmluEBx9mhQ@>-)VGL z)RvxxmvsTFHd7a}Sip*9{f=7?JKJJd0o)(aMGv)*;{&iK7@!9E$>!%f_SmF85i2eavPw}Qw8NT-}z*r=38WlF&O zhPRy_V*ZyroT&x8n`-X;(+WqqKwBU?|4YvWN`O$_jP6iPP&9u*-v@dIQzBjBcr-R( z)gN6V8<6|a`&-(8+>gHh%i92cl(7NCjxvM}x4~(UC%V!i5981haiCw2n{12>sPO}D zw^3<`$Tweqdi&ITX@NAYHl*`9h1z1>?FaI$)?M?Y(`((;;c6nN>_8O(hgmMCc+|H{ zyE6%vpPxOuy?c|R+ipC%m!u+IO0{F#e-0SYj_!Q`g#Kqt>U*Edfxxr8M@hxN_|(y0 z5a};b0A_Cf>TE3QNtP5+OBj=7^9xS@_dd|1->SJg8C@UHae=y-I4G;S0*uC^B4~p~ zxpQJDKR=0|Oa*Q9dYTnl;G246ScbrYHP4JhtiSF|XW95@ViK;MKdx{dSGnB&SCzf? zA+A`m6w9Ks6eYRTDcnk^w_+@%kvOT!9@6EW9a-#aS z4{seB?1w0pEs}JEd=ZrUh4~_}@G!a{Bjh(T0Cc(I1@9jg(;>dxQUzm-USTsBADx*U zpBky1GK{i5cBh!m8AqB-BbH;fvEf%^AEj0I#MkKgJBW@~@x!Tlzi*|biK zBI}YsS$iVM2VbjC*_GSh^YsRQJJ6YYZpXe?Z!18(QA*=0=%8B*8P6L-(b03TP6ox> zdJ9XzzK>ZuApFU-H0~o{Jn^N|_|kL(qc?Q@5w{Fw(4pSmXc1+J1jv{(wqfIKeH+OJ zUt8oUhLx!yny4IS56Dh2PsT?ZzCMvhW6<2pb21EyWv2YlPPw+*s5x9Igk!F8%r2B1 z=h|!c;CfgfMKhpWSWrXaAR=zq9RQg@Jyz-#igl7OSeb#ZAB}#UM`$t41yg?t~rxa_+aE9}(7SZt+-j5R_~C1#)w$v(|*F zLV810ff03HDo2pasA9#4v*1zQSeFNJ+qkB%b(;cC<1}~>}j0B>EYcwcMq={ z>~9$@^!LkK8VJ!bSUfjJcUG=7SBX$*)@mE-_gtH3N+U`yDU-OVH^L&?{QknB#A^VX zCYoOExcXcC)pYI{y7J~vo5du$!=YlVGuL@>=vmJ+H8iPT8u`qEkVFS>sSR5#4oIH7 zF(6i6W;}1zpMkScal)k8S+(QXqxG2sqWj7x_c*gh^3wid&u}*(MBQb6Duc`)qyE5c zAg(_4C_WXJM(D6yKmu%~@5P8Fn=1>eYSKy7-15UoHGug$<(2ooc_>NCBY>Wm*X)b> zrJ!ZB7=@JQT1lF^KUW-PNuNDi_je8Ub@Bf*DoTfHz#v|tA8I*w{3`xx_LW0j`Tn~b zG&VhGyBjq27B#_qrRzpYW*4U9=c1^GN~J=nG))MN%ga-69Rqpn1ftG~MHRWWyPq!i z7!NQF4u5GfbyjXTjQ4KchKd8Z6WDNPkrftJKp-b59I-IZ+MeG2+Tif+&KkuQwV0Pz zi0ANhRysn>Q)0b`l}V!ELnK!HLc9U1S8^-rs8YPFY(PpL<%5Pob$b_8~8>>3QYMN=6yML|402~ z8jW*bCu8Eh%%aw}5u3beKs+t%AzEgy_H*M5Qbj7ZwtHc$yR){HD|T>;{lxhsIdKze zH!+}C;)B|Lf=tmD&3?GEcCGnSpjyZVw>G)4Ke4NS!q725BY6aJ6YxM`Z+i{dcAzf$ zQ)0nG@<26DT}CV*0e43&Xr{{UyH5Q4?7&^+C-1xC+e4sjZTCFm)PcLoPc06eSn<#Q zaqW?Eu6E*Obl1QOfNRv}|DOG|@iuX3JXim8j84yQJiGpLf3;T+Z?k_^jZTjo?(IAK{DswT*^>SF$l<}Wzd8Hyw|+VK zqkcYk_PGnMyXC8G7w~iaWAi^Zo&EKnx2@aKb`gKjKRk0`s<-Ft<&XW~MThJDy1-wb z_1q`czBKz+-rsZfk`;gYPrKTlIX-Ux_^LLXz4&=+JCA3-TUz3~t8aMT-~B;$38ke? zXD@ojdq-ZJ{pz%qaA8m3o%7kRPETz*d%>=sym~45DqEQ6o2&l1^4@*PH?`MIXWM@E Z(Zy#cUu01QmiqtNR=obJ?T`8Y`~PZf1y}$8 literal 0 HcmV?d00001 diff --git a/bzip2/sample2.bz2 b/bzip2/sample2.bz2 new file mode 100644 index 0000000000000000000000000000000000000000..d5a6160ba20903121617cb8bf4fbdb71ba1ca1e7 GIT binary patch literal 73732 zcmV)TK(W6j z=mz($IRF3D~7DKKplvdh?qbZ1(QhI9Rx~Z1p{DCd^Xz zojo_ckC1Y&vKrdobKpMjyd_=W0B1SA-uI(m*;Q=V34(&jfH%3``*(J}ybeGV0O%87 z1poy*dwXUC${pK$02m$Y9{`_weHyzkOYL!- z?y7HE@O-qSeU-TyCu8L~yz4fc_c6SD}pczr1 z2EF&U#SgykJoUZp-o==^bam$XW$0005qfz24!-5S0o`ReX> zLZ~!e^Y5c@J!5tEx4Y}M)vowV?t17w3Io*xweMJnh-j*P?>@cON79|p*j+jui&gc@ zIq$T(_R{_1o>;>)lpJXaE2JdMbbcKy)U+9XbF20CWJLqd))(00xu*0000004&!UKmd;S z-+TZ70001#_4jn&BLjo$Pz4`pvElD*IpE>)KHnV0KmaM~t0m?Y-~a#s5dZ)H5z#?F z0I&c7gd?DRUUIsC00o|gnnD5q2mli%hJXTK1k(UaA(JLXfHcU-rj0byO#?=N0iXaW z?EnA)l+6K<4Kx4~0GI#*gHy;5Ap{^G5iv3W8Z^;86DiUkj1=#4W;M34L&|=n^)z~(ll4zg0MH($)HL*(Y3d%KqbHM44E0B; z>ODrAP-1A%(V&ynDHKgap3Yk_RPe}D1k)|WmG&BQE02@i_WEu?tkO80u zfB*mipa28Z27m)bnE(cW000005hR2l2pFaW(9&i@KobA~8VxiuO@%NTY8z8%O{RgW zeuGUlQ}7z6lLm!PdKo8?FrKHTlLXo{(w~&g6I0q1KhT>>d8I!|iHv|6s3g=#AV4OD ziG&kFO*GR@Ocd~%X^Bnb!f3@b^*tIiCecl)>Ys|Asp_5@W{phMJur#-X)&p^nu+gJ z)P70m#8cQK)HP4k^qz)KL?)Xmex8**H9yj)0cphO52k|fHPGHmJeDAK1< zQ&m@4TU}98RaaSCU0GdPfe;|qp?o-S-!O*$t*bW87iS)Xtho%Nj~NF{&8C^FS~ZW>uYyYVkwxwqKs~-V;MR&1s=8%INo+h z1Ymss)zY5=Cpi%9yf$xd@^9w1L{Te~l6%in>TRu`+(T2}(7MPg%9Zjot9!=#ufggv zC4o_fkF%G+YsGO3{>7oe3on z_z*zM{O1v6L{|6?C<2M9ii31kuGr$ZNjP}tkxzdE6b^bnwkCAA?ct4qIa-BI`kEj_ z`q(@Oit)hDwePP6OJOB2)33fT~`JE#SsJO8B!G?MW)%d%xJ$lssw-{!D0Kr z`>X&JM0!^?H5aA*znxgP7fW7w)x2nmsxp`wp<=LHG@pW;G@#M6$t|F&DUDE2F#al1 z4YT7meseIFvH!EXgjfHBC!$1d{C|Cww(-wWlkzj>v;Q``-nMX(Hq$3vtYsW;${-X_ zb+-ltlTI=^9`BLu3&(z|MxxSGWKb#Ugo!I|3s&Hx2GH5-smhV3k-4%Gh4aj@xfv6z zmPpicIc!50dm>=Wk&KQK5w{|O8{pvHLSvFa4^n;mAlk-A;MaEeUxcTEM|yWqKidD<>U6Op<;9lOh|*E{%Mi%ZcukdPVyZLWuA?9~%xqeVvNU{IzsQ*7I0*rJYfw2;{$ zE_1r(xm=>9E+7Xa&x7PbGg))=#Ap>a=I9?0#Xs3x_58>T*;3Y zcO1kKqLN+Pn20;Oo0GVXlu`@2=~oVpI?m|K(Xw2scSgjPoVzKx!|Ju?oqkDp-T;UK zHuSm)lmf==xhWam6`5M|=(W^&}1 zg?DyRUEI64Ns$yN$1cnyL>SmMNQg0nk@=Dk5)JwCqVv0yV-O>|U6PVcT#4Pegpm?4 zj5JteO!>QR#R5+|yzWeb_1q>!86lPFaz@T^A$N3PQ3%Tv`)5%~7@4cZ%XeCmy7ThBdc91C?wwrUS=-ll&)rWuPU0s!oe7CEM48Tx>zF0;u4gxm z;pcr9oPih#FH4E>^RF2iMA7tjBJ-{zyKpqh?&j8_w3}--ZAoIqZfjeLCW{*snlVHr z5i=!7iMEnL=TO>ou1duzZAg~qDU%?GrOmCt&Jsi z0Uz}KC(k`C(?!l&SFvnF5RvN`fEep$dLDZ4ra%YkkCtHE@sBVK!$0dTYvrKdPco9Nlhv$_7hgoLFKJjd<=f3ct5bx ze<>!PexsTHGx=T;&U!xR7w0KFnTWnQaR>z?D4=jCBYY@AL3-(jl`A?aAfm%3L(`lk zndL@lXeCG_KGjF_u4lq(WUmMc2nfl13K(<75xDg}bHDtTu+Gbo!E#HROUTCgvaqZ? zas^`Yef7)<6g=B`>7oZXL(Et#aRHDJk(4B42&(@gVskt)%RZ5_?w)0QwM6?Yvh13; z=tAFcHAVaX7ujNQO%ZUQlG>DUew+7eE)!l%@FE~mM0E0fo+j`6hcCor&vL#l7Rn9s zi%46O)u<_}N1K4Gi48KaL3Y^cs*b;^OsS2 zXHzTffFPuW_o@iCvqS4!phQA(^eudxSto0_^FPBd5cb_PDUlg7pq{a3zj`Bt&o1iK zO#c07%JZ=;FBpgz;sWGb<1{p|6eMU1XpKU3ttrLo_4ng3P<^jMRrP(JFK}X+vHu7j zas>9sLGzFU$UA(tjj5xUj|jn5o0`?{*tU4k)g-Aj)-CefIoYo!})SI-Q~Lm z&(5#W4G@F^OdF^{EL6;c5i=jP-nnlBSxLnd8R(G}y-H+}Nx+)cCpY(f(7f-D)6(Jk z&wzM9B0nzJ#1~tcz&3RcHjf9M*V$6<|9JZ>tsh&x;dXTZKx!tgJ+(Bx%Eb<-UpPGo zfQ1bl4r1r??sdE<1DeIik@RZ$@A15(I*Ti%R%WGr!*$k*sT#|8Cx+K#zC4%!0PP`q zO3B0IH}A>QGOziYrwMR~C_$|7@qL{|5#3PjA+It51j&$|Z05yVN5cWVg=B8WxNOW9hmUKl_S2nYj}k^eHImt?-?7z$K`M+lnLo@v(xnPLAknN?F76_rgeQ@%EX6o0>j03rYpcz-RGEX02DJ-&mffiXw?5|i7X zyK_I2?+S#Z$B*`ft1kumM%%`=|KIywm!DxIO(6_uB^uoS4(5@1OIAW)p}t2>7M27M z9OATo&c<(<{H|Kk3zpk5%xAMBBQz_O01Mfbiz36g1vd^Z>AZJlqX?#M=E;-@%WHzjl>b$Z!5d zu2GW(`%5Kl^8Ej{(>eNiUsjeDIZ5fV#tzyRFn<2MI|T);3n1**flw2$n)iF}{j&bY zM}|a124R#8{L&yEfD8a6G$c@g7uZvi7Ad^Zx#(Y`;%Vt1`_8Ku+N+lBFPojPK+eyG zh(e>7ybr7x9Y(eY8YZ8QuFdSa*9ZU!h9Uf)O*&TF6|C9eL_9v#_Kw`q2!LXnj)x$K z0263GR4CTqQJ^v4C$WU_FZyNR8sVYka^3gi<9Qc73f;P1bM#}eq6@ZXjWhXr2|)pp zWugSRhUpN=sr7icHs3#O=(cyi;QV2&lA=;1^$Z959>7kspy&2CI3e2g$8ytG@AC6t zL*a|X?~{4J?Ij~H?e6`i=Cq12-}{NZ+5Whv#}(A-`Rcy5fD_;+0I7fUiFPfe5CsCW z|6Krg|3&|^UbiFm>Nm#83)?39f+p{O>!q`){~jLznt5AIBGK zyJn{!*8@JLjZI(;cqeq-%)dLtek~VmSDWtg+pZ%2&UK#$olf>rfd907j;4*=KbeEJ zFg1P72ICtSQ+IF0o|3!&jk!qdF4!a#Z~Lg=?*LI7&&abX0+ARO?~Eq3yPs8A+J^NK zkvR@EuSw>G$cb#Sdq8eY3g3w8umUQ8z70tp0~ z(SiHZe7Vo43=*fw7np^UJ`0e#5C|UJq9jm5(u&cwlwEeG^=KpK(EqWtOooG&dK1phwpVZLR`bRv z!Qz@|#8|sUHi=monrOP37%`w{p;Ic4(6wm=f`Th2xBq4(fr5|k{3ZO8?Tmbs>3Kxh zr?N^P>H>I0*83<-(#sfQg!Y>Ad!!x%pBG?Q)hFtiFROojOtKJBhnamT?88r%O`jX? zO21}yxA^mP;4o~WDdrHhu@>=a8XHE|)%zzt!Gs5dvkpc?MNpaU%4?0xJwucY>N-f+ zKp`G+DIo>YxgDyre5F?o?8#3nq)|A3-ua#+khMm&Z8@1iezGhJ0N-C`bvuBNX z&W^Gj`>OU%%TQqg;-m^9@tO05$-4UQpX5WzoZe9T`Krh3mKV^y0g~2eO9GLS1S|Kj z|C(B^=@|zpCGgT9wRA0TS1fJbOm0A#e7gwT)Jfj&m-97}2g3htc2J^{gC-_CvqK*e z0BzKTmu^E6>Nl?Kj!S|%ZAN*57mMn$ZR|Sg&sIIlo8Y{sg%M(a%2XgmK95%$z3GG^ z=0sjKTN`BQ0qZBT8>P*FRlY9s)HM
gnIFfvi(O?e$J0;1+%xLGi@k}ivMjcJIU z56!wg8~L|@YCfSrCeTBA%(dcD|9QwmT-P79U319B7S_g9zlH1d{C)kWEmx&SG3OIS z*QPdI=0<_SWGW+$Her%@aUx|n(!8VqfS+O#E1{wFbM*Z?9({nhPS!fffzkqV*!I)$_5X3lx&8RXb@zv#mVNd$D7jKoxhl`4vKWwAa*MuS0l{=PDJee1QhuOWidNDkwK*lk;wlWh7 z7|`F7)xsoh+~@kkQcH5j`d9vh$5J@g8UCojYOTQA_iWt6pX=56QI0=q9GhYnU*DNv z_RDZC`L{i)T+d4-G&4X%KahXWe)b!UC?1&EBE+S8+Fb2d*7Y|(QkW89M0>#c#)lENHLndZPq$q=Tbt|e67 z8$9Z|F|3wv1&xluJZpS$6N0aru75rSM`p7RTw&rRkj%bMYM6AClT;Z%6)whQq^?+e zAKi><;O1DRaHVTXuYKN6y_)JSHGG^4vY7!!H4g}PLaHS)XLn{|@-Nz9{Bz^IdNyBE zokQzA?``6z0nQ2}BhN7X(cUe=7y0j3o$1o1^`5B;?WUoUh8Je0eup4__T9YPe%Qrf zGa%X2M$(bGWFK`Ae&@~Z4EWV#O@^}$uV{eEJM#OXI5*c6;|1r^BT^y|8Zf@&ycm_ z?)*0!8qe*ar%v3--QTn$Vt)5DwvD_mUO=$>d;7gkfD~={zV>dyf4NRw4#UHz1te&= z^+FGcuY1vO@WaV{M0z>Jt%O*RrnpkIAXA2jdYOmeSl)&%x=lfS;Hpi|3N#*|riPd= z$?5HzeP;3P?#3e#pQbVPBssGo$Z}qenhtV+%YAo$#Q1CFF)bluKKs3DKBvShvN^j3 zT_DPQy4bm!E(6zeIF=8#jsG@&^x|gz0POu;tgDZTV9Rw2QM|7yft(fC+mHx8*W%A_^k48h z;xfOV^A5|fjO7x4A0_)j*IqB2@%x~BDC_e#ef9o7w-O#xV5B>YkEgU(K}IoS10FAi zStH+nr(Hn`)s=02^<2DL(NeJI!`UVbr@6@U6`1j$Y{#i{2z6p3r)a0MhqX3z2_TY5 zA99d=mPKQj^&bIfJ}M{bSN1Gx3P+>{I1EavKS%Puha5Ya}9Xvz{7+n1`whdZs`bb z^q#IoBrkXCwJ+-Dxr4m%H=SvTztzPu-ZdFAnoWviYAKf2%jx)2H#iXv1DMQR{xEGp zu{>epPZ^2kql|GzLB3n~IK$nJA<&Rq5ll>#VPyi=s}TxuP-uWb08CIq^K}en-`U-s zl^KFSux7CkgIb=6ja2J3NjyIfta3ca4+#qamd|8d}c|6jXr7gkrw^?MRdVm=X7>35cP^l#ro#$%ZN zEQpoYH*Ri`^ZZOtUNzeJVK=;4x%gQ{KtRYfwnR5NRFQ?U6DjK1rZxZv~h9bbL3Se(!7Z|;BKe;9b}n8(ZW@5g_mt$brm z*M2F77OCbF;Z)2)kk9(J%&+ikBjroe9Zrbsx^4Y0g3j8Jp1r1l9Up^o(rq7|4X#jM zxLx1fJ)L-IZ(UxuJfBa!rWn>To%Ny0`>*L2H$N=kDXiGXt%dElE+AW=F!F0Z%@WgQt{RLU2^b5;vz+3C%|vk@ zLn~wEy1>xBuG1Q4aSIn<8rSC1SpXOnz^Q(&DZtKqQ`mD0= zt_2OezCCa&e&tvhOBaVY#Eh*p^haD2UmAW+v!++Z9At-l`DcXbptFO1l5a>4BfnJ~ z86FO~T=tOvZA^ROp3IJgm!zA;%t}fr_Z4HjgJfSP1v3&j!!B8 z!gy~x8;m@l1Jd1Hsl5Eq&Ez%QZtd}2?D;&)_VW0F!{Rtr%p#Cl)nhj3xwPSk7mkZ$ zbGl+K1HK`r7Mo9{!xk>rr-HVpKyKV!5u_rDB@#*bI7X$I>$?7+X%-D_eezu+K6LaP z6}@!=o3>u66px@3@hxyNAp>*`dFRIVAQsrX+XWs*;hVSvm;??WfyT}(->cmd3Ikbv z^O7v#V|86UJB?w8)%gLo;6Sp*KyTthfX>PnxI8yCjAv77c#NB0Aeq!vo+i!YYD<}% zzCb_Urf6v-H_7T=eg|=!Y@3c&4w?0tYW+i&Yo0kr3d&NLIL!H!ApvP7z zx!{-q7h5H{qe7dQa(G{y9ajTu0s?I8>~g&C;aG?TX|Xnzk@g#R1gJoll?blIn3^bE z8&ZxUM2k2J!3P5PeiQ=8jWwbKzkwkS5GsJO7`$AdA235akY@C=1d!x?!ibs`>{GPZ zV1Qtp+7TTi^dXx?>C~dX2x`NCco2w1Od^#SLRd;-LZ}j6ft?%4P~D z&<08nVI?RCFL+?h?8Y8wW5iDbVz=kY5}1{GOpp!{kK4EjK^`L!h@pv>5+xaS_(r6m zTY6;E5lCgMxq?hKVkSu9gSVaO5KW~7)RlTrfOME^QvN%wvv&IAQW&>pDXUdaV*?8s zQH$zxYSIiavhRh(O}rEx{cwjj-&EJ`evCXAKmhH4-eba0k(z>xk>S7h^ZtDsPxCqW zc6eV)5zHS7XT{ZCuQ*C*aut;=K|v5(sI9PW4UgdQj4#5$i@e<3VgLY3SlvP0o9xi@ zxL)#mqePX1QA8f9y5X`YpZ(hC^j#pb zL2pq`QdW>McIt!B_wlqgLocvmk*`(81WR?g-+9Sf3z)x6yAjJ#Pz6rCSo(ma3Y4k5 zIl>mzvwgd$x?4dGLtW{0eq};_84fF`tF00!T<0XfDXqzsRWIDz5Z|jIWs$0(%P$j0 z4{h{7AR0a17MfC}3PfkNc)Ct-c}wcGO-NaBO}2zpRjAi>b9yT*Gd~|8ewwNmic2I- z6qGV+c^hP>Alh0mFiGKZ_;)9&p5cGNxR+xxg{1oWGk>`nEo%J{i?br=-q}UsSEXiC|xx9_g=GdPw4d#-8!>U~1{tqFHn= z@9IT6xTqg4D1iH~gF>k3XV8f|?kgS0s_>niC=YWKP%%VQ14o+IYI@4o?rTbKxm(1j z+0tsM;tNO0UK~J40?%BiP$5ohgAePsUpjv$&3HdpyVPmJ(?=OmZE@M&6}9_RF95A!?a0b}C?oz>@6dei^YtKqCg{!@h_fC8hIeGU;Qu`V zAK^y*tUZE3SPbRs9;D&o{-5_f#F9Wecn`=`5d=YuvKtaifQk~qEM|%siW5ZUg*r0prm;|?BNynR`B9`0B$Xjm3L)8g(Zdbgp-jyxmCgGe1RNK%=64sWq7{Q3@K z0}+BvC9r;i}1kG*8`YLHnH-ee$Y0 z)6cmq8y0Q93^()Ze^}Sbx*Efdw^-vX3cX$&s#w{#0_c5*_=jQxwTtmYG|sKSjn~Iv zV=k(Hi9Opox_h(D`)@1o{$Ie*`IrX;_bJ08*H{^}WoPSj#&rM3jrIiL=6+KCUk;Bb z&sv>bMbv}@0)PZz83qwTL^>?1=F82Z)ww$V#kvps>ixf{>ijpf%J(q%nO)Rx`Yaa; zI6=D+Ugv1Yc+nCG_wS>102|oga`t1f)5Cy`PJvnIqht5HtQRx<`TLGTt^IV{9BjcX zOYc2T_O7Ot`S>(Lq(t5?<9JbvRSFeVA*tjX;N=4>xq=vDR|a{%9_}0*9IupB-9U$A z;P7fhWIjATe&q^PEh4SrYJBT1!vKxXdy%EjZXXj_tBRpUs4G(X-_gI`zpoDWYQ+g5{qE04hG8K|Cpb*q^WyeL5V2pEqmDvl4Rtr-=9yT z{wg9isv`hWM9gmoy-=hmD4?Jv30HA-^*4(Sb6Y4t2u`L|JN|rHUI~9)`&d>8cQKCD z{ZD-X<(nA($lck7_?0*(mno~}Z@v|zMx%%v4=X@tfg97XQ;0HL}6H>aNSsnkLH{L7@@s*!~}xHAH? z33;@2N^qU8VHlx720{+5zl35}Xl?a0v;JQV&DHkLP8?2q&ie2+{&WmK9PyJJK*3nv z+AlY-)vY+LQ$hOa!jCd5B5ql*$h@1L@cnQuU<-I93?UU!fPla_8>>(-1?p9?sQ(|} zVz~?Q4E}F#@a~a;HZe3Y2ONc^3M9o2D20v+g)BuUyo%3MKN|SI^Re{oWXSW4SwxaX zJCBr#sITuEi^hI^8$kmtBvp3{_Hz6M`Jv_Fd%LgT@=Eg7ryFQg(HCuilR#P^rH}%n zC?tSNS1N@Dz2pjR1YV5HH*+DlNd9 z%YIuJz)4^NK|z`9X+eaudXA!j1sE9+ViehO|LYJu2f32`sbZ34JE-dS`-3qXfO&~_ zqWO8mL2%ZeZVEg<;zr+u3R}{Nh)uZ)?bR9WGlZzB9b90B-(+TV%A-7i zLrEFd@`*nXNO*OBfAb$@=vM9ie+u!~R^!J5j{bgowcL&NQbSEhPgeq|qVIIm@68>`U3fywRqH4WW0g7dD-Ua1NQ>T(!8?@P7j`p`R^KLz#rfAaX7A1F`T>|qQLphdFOH3p6j2966=`pSbR%Q6vL zIxPSnTbd5Va&NxnRTIGJaJ#NT&9(0vAyW32#`p z;2oa_?lzuRjpK1~H|#UNg^D|$%3FiJj1e8L(L@7xhDe_R@`VF}fPmoyTgZYA>t6cG zmH!;>xVYEfud%vvbO;@+QTP!HyA43~(LqI0Lmm%ifC;&f6HmbPIPWmWs^#-vU$ZsU z6(+2*FF)t&@#XlrqwD%kQyG3WK=ZH!^s#>QP=Ha1cjAJXK#6#&!UPuAOJz*Yl!SP@ zC$A*DJj3O2vZHI`qYBWOvWbmIh(!exLr6Rz$#;*`VbMPehJi%*C*b_9w~1+#w(2~b zb`vS@&%R6HB?&^XHs|Qzz)6v0n1hxf5eY975_u z1L{5PK{wJJz=80meOr3H6XPfgyu}dTb3i?Np`pF;`;~P2j{|Xa=-sj3>~R|i-^$oi z8h=Hb*Yl~$d+y+2K|21ZKdauS9jC44BNwr97fPXa)Sy5c>mj(reg`Q_v(<}gXaEr9 z&}BJZF+j!`@QoH%E$0u5$ZKUw3?qK#?suHEjgbYX*I)R@zxg;mD|?1Ye-`jyqUqnQ zM+W1x7ixJb^hRPljEujJpoB)=GhjF$AGCiL%)k3~&H^K{^|&@Rro9PC{g05|D%s(! z@tt9i9Toy^1;Xxqj~j)-N1`D%h@dK|Ae1NoLQsG~LUd&%0Kw8;CrRSt+idA4^Qg;A z{%kBSWa+z|%JplLFI?df^LTD^i_?A_Jby$w`yrG6dt0w~`hIM*1ZVvZw?!gIFoe0N zX9xx1fvQvnuqfn8D#(8*0L!z3k${-q1Gr`LO~LUUM(Xq^by|!kt-w7;fy~qijdfg` zzoRni$iMvDXf!mOGZ-H~Y1i;P#s=QA-@47y_hPINq;S(H+jay7m`G*}cI12eo&WBK zFc{s))5hC&W(9>W~yw4u%%PF~ueO-M;Qs?TA2O2abps;+c^bu<_lUfd+iQQpN!+ z79t?zN+7T4cPq9%zCr!<_K<;`=Y5_#*s;9nw4JuQ-;x38ve*t&uGipvxt(oKuOxS6 zGF^Tvwy@|uKKmcnPyTZlKg$`^e}4}#mE?Nc-`~_l-0@r9X9c3u_1zz#di^xHU1#x# z&*mk3S9@E3WA*Pa-Pb>Vw8QWkf0wn`&h&w#lvcj=NCT-4QD9RY_$#==trXDY%a7 zG4Lk8XY@FHH6imJ_K)q=L+AdDRUh_tP_VMD?Xe36B1WZcl8~(bv-aPy_V{zZg|f`U z`4ZqS!O`_i8vH|AUU?`eQd5kRIJGkTo>xC|_xT-$N6))-)WF2bMuG&ssMMp^4}s>i z+gk&alh{LI6&LhYU_(+dy}r<@^UDBHJFt;`^6s^{jSeNEE0}na2)6_+&?r*IGK)}= zT>z9BM4&nIw$G>25?*a0wu(@jO_ZQC4;qaI@HTQ^tn(Wce=GApBAPyX?ly}2ln2J% zL3wV|M%y~&ZHnzFB(=dVEVe9KG;bA`*w6frw_w%u}IEK z#lSv$Xu2*qS5Y5PbVs7t-Yb`LQ_yd` zTsqxP@GQ~}2>aU|M_F>$Vjs-$z1LCjeEZfPd&+#jjsyD7=X|S5CfI(uEN=GRLy_}6 z&b!0475s;-vS%6ayv|=hgB}Px0`S>pssv)}Seb$V=+1%r=g`K1)*LU7?|Kau@}=OD z=2qE|;Kdrt(`LAAyB(*GPh;%&okqXhxplr*87^m{h!gH*w2#)`16SvBNd>)zlC{5~ znd3HRA&u7Cz%tt&gj3~pn$-Nef6u3+H<|J){Q2Fw&Zv}u{Zc0vJ*a`{HJk8bW4sRd z5I{mm%1!W!i0V^&-Ab?|=)#gR>CZTy#eUwXGHizCLhTh5HhK?FXAe51`V`aq9;aro z;}#}Qv`P|rJObhtR7c^_Ay0D>f-Bp_foT}2(1B>XJahS2m=zGrG9Fqga${@GnkcG% zH^i%lf}3{H*dJk>soPErzOy92InP7WoY+-Cp{tFl7f?H85(=i?yAQrCjtGT+ zW>hflL*WDuOKb((*A4dC)9i+z1P~NHymF88wr`Hs2}2&M-*~?a&Nm&zZms!qQs|Hq zYP>v(ZN@I=pjvat42KgQ6-{HiJnCMLGAhzTUy zEoEwu)f(-l7tOirkMoa)7}h|2_I%!{P|F;*%=DE;*kZ6wYW zQPot%QWS)JjFeGZ95q0Kmnu%U(_dLIm*SK{%XFDeVUq*Uaoa3t&$VUXlCgxd_$r>} z_sG1B$#P!5A*_fQS*B{?yg6uSTYq_Pd=|Ui?vEIFJIZiuY;WpW-N?JE<$k9>zuh&x znm!tUH2~dwsw1D*l^Q;ucBL5Y)hv`5EQ5bg4gBuxQUD>0R1sFIL$0kke5zf_4Xo8YvskX= z?^Ohs?@yV%&9;+gue0%T?f(g$$=-BI2gDzTtdWv1+dnd385e>2f1~0qM!5mYge<$m zS^74E!S*i@-M!y}?E9}I4;IpEI9yvag;+Grw_lsf7MO^M42FFaG2wq>1t3?Bc%q9n}4>H$n-?Maw6}hjA3pgLFgBwogtW z%60I-zM{$YKN^6;l6w?6&w=zeu`EMM>c55bALy{3+3>a=Nv%N>xn&Bj!jh^Ytu^yk zT-?49xclBs+KB_i8R2KG`&A6#SynPyFe!XcGi*|+XsIBMT;9#_&#z+<iTCl~%^X zB*r$+A2Q}a{v~wN9BW3V!tB-15s;9Kd!%={wjhmdu_m&FVY^-~(iZXuU4M9YIZ>xz zZSq`|iHH~ikVtfBEiIW=Mwq@YhL5sJC!G{TRtG~v1D)z5`%a@z*!#Nr&OZwC*(Y=N zH-VQo_UNZ$KJomH@#29qKoxu$>JGt6e-*LDg?=U&?9H-HooUwc)tqL3tTaA0Pp z4J;dC#KPDahQvR}%2en*OE;ZIAqs&-4?UZx-MStgSlyOTwUkwQtHvQnDhQnIF7BP7 zL?c(jLIolfulN=yca;i127jAt06&{=pU(TwI<>jw&y%oVHa_3I={8B=B=uY5;R4Zj zG8J~#+yx>M7=m%2sUaTwpI{TFDT-o*M+5;a7BZqaOmt;WvDvKc$nwGZHTYklosci&sO=L+AE zZgXFyHO`n#;R--fN)&!RN1jUaNO!mr8RTNuILgQ5u|}e8sEaJ2FEf{RYY1XN6<`4adsC>}davj{7LASc zY%0X7TfMf&PBCkH^t##L^{m5cW=xsYc6VfrxZQMI+m1BN6>@2r2`Y1lF$PPs-q2!; zgBX{grFR62f&2>;;`j`*Lc~K`&lI*q3$x+HMTDr_L@gkQ^b=rUa}Q_M@e{k=;?f18 z!C(dwbn6IOdMxMv!r6j?p1Tw%Qx!}X@Y({=HS^aKV#9%?_kMpKUt3!nRGzkfe*SM{ z#@YC77LWY;`Ub`A8T?1|+5Ay3!=|zMZlL8VfRH`3Pj$iLv-PK6I7sqS@kjcg<-Up; z4MS%)<_^H5b}^_Cx6RchB_b?Hu)JmG2v<{(WOM1Y#6=wI7KK4%{WOegC|7 zQ;Mz(>$_!Vb^O)oEmwZ>;2FLS$6Choa4FV&EW4OBze7|T8|g+tBqSL+OetP!MrBoT zHQ}vS)ip!kW?N#8bU_5&|;NsxyAka7ocIra5Pv ze00vLAARCuh8~d^QX2wV!<*+agRUUw-&Y9({Xb3rS6!6ouz-e?9ARKJjb}qF(yeTz z40JO`f#GMCStq}$RmL;r)TLmrNsily<(gDt_>|>2)SuOAI_junin0=`&e7>$+4{D; z_v&52f2&aI?84k=V@*J(yoJT1uh-8rr8G-x^*z5d_L&~7H@mxH8+)ebBr`6&3&uNH zb!pn*W}4M<&QfqF?eP+mH)esS2&)Dw1x9QdKF1Cf8)Vb{w)?c-(|$DhIi19L*#GUt z*HGZ8_|VJ(glYy~A@aOj^9Cs1mw5@K6!eY6zK%&iiC7GSpPT~u*n}~8vRr{6FUfdj1HsU zQHBvsbV2SsrEwGUM+aGtiU~dKQG81fZ3XzGn`#P-j|tWA8H6}pZwJB^w6;eUo_T>W z#b%#BSsFoSa#bJo-5dAn3ZkErQ&X+#K2pxp9cte;3LGG6__;qqW6fm=F(O4hQWU3R zk4?&84^)Ry*ytKZ2DW6b0meI8Wv2gA&DE7!wMuj(94pr3HYqP&HB~BrOQr zLvO~tK?f!gh{lDaH))2jsvT;>*Tu>;U_Ex+TgJ_ks=@?bhWByHghgSvIM>4;kip8o^1%xk5vB1*u;b2 zzG2O`&2{t9z&4$RVJ8G=tb1Zk8QX%XW>Iw}9J3_tOd;9AA_;UvrVhYPW?+zuHX3G` zK%)-wW<1e2w=*=fLOX8Rym=uacsM;4!!TuOdq992P@W4iLo&{8V7!t;79_giv^A$0 zwxg#lm_W{)5Hk^1Km^!Hq1-S5^9MUA_xx>_^DSiIBo>VGU3^>^>p|V6BKKFJ*`Z znPcxaVDmk`jj{-V=}->C0{;@U4fEC$h+cJlb;Iu2t@)q7^l{A#*@2!8HoB}e)XCc5 ze60o*{{BEPeGp!e{8e0Ky> zK6}1~n?d#d8lP`H1m|acHE_q>)7ITd@2Zb84t@^#FrLJE@@|jehRvj{rG9#=mu!rK8mA(>5XI zr9wqAyp$aqJl+r!V7B6m>%jVdHw`-1nZ~mWMNG(s6@ zc!&$nt)g(g5d4zRz@;f(>%Z^M-q$`FpZ(gUdt)OsQbHgi`bW}73P8eBbo~pN5)~yD zm=r2N8YgcMs+Ig+IfYbx2Q`hnMeVlpfg1yBqb(sbs|!wFj)~~08XaGi-$(QLl8*n zqGejWj0;%n?CZAPKflv@&Xa}zKmTR%Mo0Vb^>{9~oW2(@u@8&ZCG(alvK#~Yu$n&Pk?Z|7|ozef_mHtCU`-+Qv^PHb!RVLn$1rU@P0zZPB zp+WN+&}V%&h8~fh0sgky{`Pv^BJALSP@njw59QEfpP(+CJatewcpV%AuZLScyhkc0 z-h!O3)uT(=QaEP}0!PIhx1GHBUQ7-op?@bg|fA4^Tv4j)-b z$VWmPj03Hi^E@)SnIOm#S$9n8gao2xr`}5%$_X{0Ae8@tdNzCv8+`&xW!y2=GcOJteG@T_ZCFG;tQhCl=lrm$bJm1ol< zed)1*r!GWnNY@kzDmk~np`sppooyr((d9pJO8N>hJI5&O>r{Z4B@11=&2)ZR0c+vVM$eCRsOT^wHR^hp=_@7Sg3Q*+Z0>&=oK^s=1U^GQPh zfciNA_nz)v4!NkLQ>2Im`8u}$XPF|iSj z8WDXSGYW9^ZPc_ek6*(XXv6;aw3yEY2i1Fs6zKU91DtB+KwZ5-;>~)4#xO2 zcG%NtjH3%+<2hB0uPnK({e0Ri@jm1F#uluC%U2Zc;EC#+fZ6c{AfhY+8`A zD38GHLBAYaT-&H5HaVOmqetvc0Cm`L;K?>}?Fw+AbDsk@`*cHJ>~aPe8yZ>;4$o(u zcL_Gpb-Z0)B*ma5L#^b)j1Ta&nJ?)=a#Py&m7{iLjOkHxVrgo^q3z&dG$qCmaYA~U zaEC`KAIfHQ6x{=O@wNW2H6mV|$bIq_&K{zy6U?WpK*&S!zmazw&(*WUdf3T{_r$0J zK{vOUmE<(`mz@!w)Q?K3u4R>YSg!gWu)4)Db#jr7$}wn z2MSnGE$Y!wVoE}Dg*|fl0+Z^;lqo^XpPLe>9(XFBF1`+VsX6`lZKwzPZin5ZwgsU= zPyY-L&|&nc|7v({pVCeRom6!^`1PWt(?#voVTN&q>50FRabg^D2SUcC6|?S^=92Ng;=BYhEXIuS({`dRx-nD~8=g-=m-* zMX(k^mL^P=f`!D%f#z28o2KU^w0Enk7W25LtE-E+TN=NATPT4 zqq(_nk3RdJq$ZLAw1KoDtU|j%Ywz9}5 zO$zT-R^3fEnU3U?D4GD$MPQ2663TADxec~P%_wtWS>(vif-EN~oN!4eQN9$&H8b@D z*1Xi3Sb6iGKl1r5!>}}L(|cJ5T61?focGn|5!ZbzyqYrC>95B3Gp4GQGAys+Xm)ye z7Wi(dvxV9syegOq?M_rPJmM3CI@9NR_`xF(K_JZ9t=o5C;h5qWJPv|*_hGwNL9w&j zeWANnka8y5D^{r4BZV)Q6l)Y}HVzUE#|JV2QW%?iz}v&Fmm2NlwKO7 zW-HV~Lbc9g9ndgpCa46Y_*4(m7OAQrHWZ}?);$YM`q$da@D3iJacjEw>sjqrlz;Aat4t&?rcyrWNb_22i`;I^$D^Av4 zzLeq%jf^bV zwpm3cv)_jm<@_HCx}O*fEnl^NV(6Ld*h6eEq}Xw1M+w7=L7hcHYaOYR4?pu1MHqnO zF-RnL3bLh&1lU@LqQsZ8OAFE1c0VGa_^ddemrrDqW|ieL@tgZ<)rVmx4P%SB9xgi= zAZLy{G#t6*n(57~Jz$-;`0V!bKF3P-k?sBF;_^RXnK)vY1o9e0QS0n9!9spTazl=*ZBQfk-+&lQt4ynzZ|rV?x}a1MiVamn zL}DPc(yNLoiFe6z(6<@1M2Nl7Y_Piju5}Fb1%I=iXW>LN?Rv)Kxm=WsDoH;bj1s z)F~YEyG3aRf}5w!=SHa2xm=@Y)b#ZHAnA6iuPH z$W5slsiqOfXBS3;6i;1xyt?AAa708s`ttGX*LrKxFhWrG)yba+k0`VyM%=B- z8z(h$c=$Hm=Il|DuYJiGEp^;?UhjJtykp0@4DPeYiUdXr6a|n`MOBJ-!>=^M;nxzE zcO;>coSVpRCd?y~jUrqaL8rTb#~an7Yo!!xmDq?Xr7+LvP@tMYhIVIWloBzlm5k9h zsum1rlY}VQjyJP|2&lF1u50%;_3zbqo4cXocPvdJoFIHglU|g-8t1qVg;qe|*r|U% z;T>lzw51Sg*cBF#dkxnXW1r?lnkygED%- zGi&&@f2Hv6b2ygt`py{?i!v^UW%kreg1^Njkv=G1dUwq48vB}V{9ht2D9V^&g#r_Y zT!t6B#OO;LpHhY|{*j1wGC<^r1ve{A$i%0fe=;0~weaoVO7xj`+rEK_%d~2lsN1iN zDK4XI=71nmcN$JAQ5>sSN#-c)TBV;Fadb$z4K&1N>?IIKVxU)9)K*&&wqgzoYHJNs zo#R24aV}@f<=<)a=Gko1%eFTkdedqUJlolbKiE%!!5%$qEBh-swxs#vmh6eAe-+)F z=*zIa{3>F$WWyHL*$X}0#mmwz%lC3w;-R*?4L3m3L0a0PEU2K|5xqD6Q9g4YLLTLa zQhnvdrfxYNQoon+TLN3=X?(XWt;1o#pT8{@#@*|lR0fii*c}p)FKe!!AXfQp`##g61LXu zc2!EF&0^!rIXqvs{}(+l(=a#la}t_BMlT{%cLqXn$v&?dXjLO^W4N;4VWV?nW zV2wUUP|^pQT>ido2JMWDaGk-Ok+HLZwxE*W#;h&~Wsz7|xN0I(ZDt0WYilm~w#e9U z1D6bD_g}NQ=V;R3D&6rjhKyxSf!x9oNjSpeGSx1K#9 zc=5|vW_*uKj;YM{tBSOtjPHqjbBp$zc6`d&mI$S+ELqebv`HNKjBXC!lU+(7vZ#V{ z(zL`gbm5C3Cgd*TZpn78v{+A+IYSy1{ocS z9omnH=Hl704Fw($dl7;LNKGQzBD|#{h+xNMTLfTRX33hmEb-=9`Ru`sq}!8jVhd>q zH1b0_1CLa9cn&FI{6&v$pN}#tA?UsiFTNiJp_o?;W*2D>baxF^7aW?Gj(r<=UX8Lv z`@q947Ru~{^l;o1&V?IWSK2lm5DCF@rUpY}2(ZxS%7_XX?Pof+&$X>=m{TJNwkytP zWp}T7NFOJQL_4iBY9j-3D5G#gd0-8g_`}YSGt|T-`5k0T?CgrM$Tm*!{&UICO&xD; zen6Whhs4~aHlWGPb=Zkt zOS>~L@^5zM#pGY$d&(qCOVIRkYxWsGhLB{-)#l-%z})V^E{xw#$@x&|Ki558Jx(@sQc^bvf=LNk z%>7-=i&{Er;NG1{yBltmwIEq_qpES=%)@oD-`eQSwBV%qKGNV{w{ji-ruZ#>pyVB0 zD=Q8NAD*q#SSrpvVtAXTtl#71;HT*FSqrGw2;B57V?v6H)Z%qxw|s#=NJvAYOxdu{ zydICQk<3Uxg7W-o_zB7A_;p4ohXfhKC91AwS7(7U@akrGCtKMRT_ptcp5~$9czuej z?%oNAoOs+D_)@`D6Rc~8!V?)kCv@)e_w^canWG}WPCAWeeEVu{ZoCTvN3PVnj^Y-x zx#4j*WR#hUE;)p9t03i^5P~R}uqM#W2qFtC<5jSEwpE~km^Lchm0dM}Z{~l_|BJ=7 z*G$(L0~Q(#I0g6c`)Eg7w@}DO)M^ezB+Pi@(ZTUzBNTVYQ@nTufw&9A8}p7x0^|}% z9a+$#O*J=?fv1MDC8qKlW-da(X`EW*!tsM|SgjaXp)-LKBvG;`gl$B@Ryr!y^)<&u zeZS7v{tMf})90h2_uPtv#*+GH*mkrj5T9z*g?3TO;*jWiUze(bA05W|ss+$NC-5`l zHg)tjn8wTOe@n)0@YL~(xGT51BQu|I84xe zPIg)&5t-du8$JFw_Q}7~X)biEA(id6dLaj4T^rWLzf%pGGilk( zjjo(xyk8;uCb;(>*}Gsy7swgew(xA+;PlKkT#KE?Ask7#f$EisHX|%-8S$0cy*3k$ z#F0a3nyW7n7c2}XXy*{iOtDEr4s29W4)yQtR zoEz68Z9Y%91EI+RH-bpQ;FUG3KB=1VCy`(Vrv^ufDJp~}=NzF#=O(mz=w}5>s4n94-YlA~)herucR}G}`xps%5>;~dVerFDx zI+t^K-p@Bb4>Hu_jEY~cUsOdadOmQngi9) z%SVS(9L*8S%RN4C7P$m)oD1B`_QXmeQVVs|yzVnKtDWHED?8;2>#VfiFRRTkpN}nZ z2}Fg7;9e=tV5eB)F{HtWCi2`w^&DK|g{TPXOX}WUp|;I- zWYC27^{}_IpSjrd()t z=k~+f+u{V5kkrsHuoer5Y`hGPt1BXE=i!AO-NQKILfx075Z{xRM4k`01b$ zgOH#njyfnr@9k`;K>%!Go0%kS#eBaEe~2T2!nSe(zBWdvMZQ9S;`)J5E%g}q;Clak zd87gBu-RRo&Z?IIr0TU5h@^dXt6X(+F?_CV8Tzt{;C}VI{LF!Te{?>a9w3VQiSXuG z0?3Y3f#eqI9pC;tyV@cHiXovh{>|r}K_H+mDy8sDl`+ZPB3RF^ldmGzy*1{Bhgv?$ zN3&6oFSKD@)w%=%)5F`X#&h2nkLM%17aGv( zm3Q;hz%`w?@1<^<9=RK*AZK-e_Q=vD9Ew)IG;GAzY*a<4_q*|jPXn~;hoft2M>;}p zqj7PE!vPdCmfpFcnaRQEpCN?ggIzH<-DJ*b5}@O zha?>{Ct;uOl~6jQF1calw%X{}Nx8I}FoLo&Z8LVOv_tXe-FEUvsO?vNI~Os$DkZ6L z3aeNb$0pGpowF3f1Y)~CcMvx5r{N1Kkco|1nzXz1v7H@)C`oFgIwV_45A_eIw6>G6BIymYg=Sl$N*Grth2sBhIW8WYcUY~$za4f z6x%$IfuV#M1SbVr!U$chdJZ#{Y<1ULGjaghlb0hGQ6TJmi&3*|(9CmjL7uD2iXovR zOp&nF^$ub}UWu7Kk9;+AX?Frmt#0PSgJMOw;cHIqhqewG-ou8sLQIbNv!15mt-3&D zhd~>&TGg9vHGt;UHmkzYRjoOpYe_a?(#=%66pfuLo*M0#M|M3(4mJzz3rBvT$Y{Xl zo$BLcRvm&cq_7lr$P0}jS$3jE2M+FEcXK0r<7ahCw)xCnMeByr3gjRQbEe*-1D#Ev z+lV*Pv;~>L5h7*77c{%^hRyCUb6s1S#|49uOrm2qVnZ8Pa6y)fFyaNRf|}`|frj4g zR*SN(jgZ#zX0O@!xDI#9!M4GI2^*4-W({Pe@*U|}N+Fa+OPN${;!UcPeeZ0U=~HCa zWf&72j5fS@$yp98ySHE^v2M`GBcdi1M$9^>B;>-e)8SkTAlpIVa8oYz3 z#oe5#)1jMhqm{;r*6<@MH@x+LVGkY}Fo3pijJO%hwZlW+03q_%WNbu;Om2o595&jF zVS`%2K>}S1$``YtXEMkGpA0TQ8N`q-uUp+!xZ|EU&WaqAcx2^aahIrpSxyU^rqP&3 zDLhhXP=JlVdz7IzQyInNG+?v1B$jSkvJRx(28~GwqOPxID1nQ`6E~qL27O3UOhp*V zz}o1rBYV+o`wLD;6p*wKjGHc7P7R5afn<^l*3|@hI?%@f!K8!prf0!$&0(G_J@vuG zRbja$?Bowhw8{_MA`I;_*pduL#rr;0jLl(bcPYCL4e+M8R0enidRyAs4Q-BEv^bYz zY&=^Q#$LnIqy^{Zz}kd7ZFVm1!=;A06>4E*BT4a)PQ-`gGXf70aV;5}kU>tQJvnxS zVWuFE4m$=6ZKc*WGa@;7aobzgQ8=8NG$G2Sv*(1{%TU;hcQ#`w2AOL?VlYR2WwH$1 zYEg*LGuyvIQ14qceAUjq;jI6M`DD z$m4{@8CW2}U(g{Y$5;n^rH-dJ3PxLl!IQznB2$#7CLN&>AzabKGczlc!2!(19~i?c z;I%1fA=Sm-)axE1TKuq6tMqK-YZz;nA(4(#xw(Qlc4{RVTKLnVBBT|P3dcG zIDsXpYpz-jO=E%W9@g_^=L~3F2mpo_>>w^im-H9(dy(h6yhWeW9$U_@o3Rd9k0rE) zv?_8RmmXL<({WJvYjGh15Uj*(hkNDJyF{KfVD5G+hOO^TBylSb#6voP@9y0>gfeK6 zjyIBYYo_KSHq|pB7IV_T=EL7nd7lVpN8S*N!L z1_2~xCb3ri-CX;Z3tPhzZVTyb*n=0V{;!l;(12fC-)HG`qfP|bgOC8@%Yso>4%vb9 z`ff--N&}a`7^xUf6i`hDhOOiu0&n)Srm*C9u^(iJRqF5Cj38E?lEE2&@1I6%qG=a4x zB%-K`F=3IMIQ7O9nSM$4z#9WIy=($EkOU-UkEEjJY=d(1b%ykJU1xi%_~*%thKp>a zQ))6-Tf77mLwQ6fseMowQ5f}Vr`2qzJ#*yso?`>#AbVz^hSFu^NJ>OoJpF)0AONLA zL`ooY@0%sls1s4Sg_72a5EzKV>MI3ItcaOWSZMVqW|$Ks-Bf1JcT^c}scOI0`V9+E zan4v~5($tPMvsMH83BcuHVlM}8_1yTd5+DK`g{WdN93v?@yG*vBZ55n7t^pPgZv^v z0A~9}K-AyWoa;r<&*$!&7T6Gi077vDbKDw_2U@A_N&COXrzwY{nEdflW((rqW$s*wLXCHeb56ypHd~IAyELr@ZC6Q2$%v9 z_!TRrWge1>R;5SK?Q5SpvLG!Xb$HeD^B%~h-J;qa;w__b0qUTAUY@bUF}M^O5IZO~@kH}7FHAR4d(MPo$;w{n3&YA~g0 zssier23ec8YlQ!vxSlAR0GsorGM@m-6|$Y(eqjEm``)p0tS6~7-l%_*2TAY{z!JSJ z27FcM@2q4s>@;+(VY(2DY+8{*-r=5j8@A5t zqH2J|rjZDK22^H%q4xarb!_=-IE65@o3UoV*dTJ}peZDv7m_b#@GJc&(n$~~SOF}kK>0`hTb$(HIl0qnh;#|umVFpkgGv^g=ivk? z`lEizeh6)0%4L+uy(UgKHtD3PU!PGz>jf^w3d+;~r|_wEAPhM6HL!unG$o9SAQ_B% ze%L60in1W#%8U*u*9?cJ@;Awo43b1h2*jxaGlxCE#MF&JeH>`Qjx?VSE5zA9To=5D zEwK#$Yd{(CKB4z}oAWnk10+)@G<#d>9VOeYrYpoSh^&Jnrg(wE5?gqAZhvLMYlA0= z(FJo%kP|)#9Rzlfvm*NwnyD*m>b5LxuP-}QZ=JOz#8r^9bdjfn;;N!6u!xq3p~;L9 zv=-2Jf3f@m2@8)Fe~fhbL*Ou+j`zk~Xig&dRXHM6y`IsXZPVU+@5bpkdVP3_ID~=3 zcMb*(Od-aZIZjc<0?W7F&LJJj4mZ-~UkMiLT3cGoIz%*)jHXBZgQC5;sEa%8d^ z!eI1!DN%m+p2A!IAD#M}Hyil*6WG+DVf{5D3uIE2RT;JgB!r~W=T;1tJI=Mph}4$G z#=Psc#aqtpYgM3Gv}zHwNiDsm`=EmurYiGaL$JBJUV#p0KG-TU>zD2Ssrak?YoC@ohRBiV$o zZ|d}7LD5$fP{e*Lm5K(B6;i1NiH#i?70s^JYhtmN)av(35d{hZ0hCij7IJq}4&Fpw=kWC8(_%8%3hg z8qr$CMY3%bMOuoDuxwf=)s3jpX+{YkXoe^eqee&)0+vY(%!G(SViZUsO9CiCLJJfU zd+v_;%o`vABpAqoMGTHJGbvuCIa4^iudxGlgMVpQVO(BXHp^ttVlfR~HrNSftXFMPMR;p%r8iMMXi``yFEwZt5oR&lpit z(;j|6v7A|kmkZ*SOd&%g7(@+-WDGOZ$o?a#`L2`dSQ}F>?mHIXWZy>WhOlBnuw&X)0MRy2uL;#Kx0EgvV&A(ZV2pUGD(rvOw7!6 z)|p&#DF`;~og-LE?o5oC2_$5a8kaJWjXKn6Nlb;U#f4S4oQ~$@xs#q{>3k1-)Vr>| zE}bGJW3tv-OCxs5+}0GZZVv`Z$Tr%Da!Dgdg!KtTGI=ytEU= zcK&^0D3N zJ=c}2H!?s_SbcR(IJ#s4h}lXDC>lUSi%OFtjZBez+x3_;(E+111qM<&O0HwE04_k| z%MQR3zJbouRXkP=<87tL7}$WUDx9SEOC9BB!z};)^=h5HhO|}9v3d-kmBPx`KQDG1?kW`D53FPH%XVlueQV?lExx(x$>I~ zoOSL_KKaPq_&OO#yXRn(C#z?zWa2O{Qd8zxNg%&wAAA?hA>arjPw(}bbCnE=sztF! zyHldYnhoT#xtglGuFsdAUFbbBABC{ji!U5C{NM|K!W$SBdDe)ErB;<)bHYE02(^r1 zQU-%prN6ZA4>2-_giyT|KGyD|qm+@%t(+8IMMj9AKw1&&WB4Pm`S3H^x@eZ>esR!R zLGgSD1^#r)9ghXK%tg#{<9sO`-Q?etD5Gl2nCYzJ5(IJ z%J6;8P(3<%l!t?pL0+vmom>LR-)Q}JUY}1#jU+?COG=9aw3BaJ`qWY)u|X6QWoQIM zNR@T_*wjn3Yc~{^9g{>-=rBak@IV|u;+%tG_2fL^vfpA)E-!*KQDkG81e*!+-@ERI z^HZ@$RjL}J$j*l|BeO2OLnu4}`yUsO|7spf*QSH`L^y%q5l&E%Z(L3EhS@Cad=%KN z1g%TV54E9?7OKNRexK|mu(v2)5eXLjt|0QmL>^7Ku(j@2xk=g4uoPJ}-pf~I@jO;r zGg9)wS58-)Sxz)734Hx8IT0IJL|g8g?g`K80&@e*-eJLxP}2O-AD?bOc@{2_tR zmxviVHmTvRhZtwpVvf{in$1NEy5e~f{8hQ!a_YFAUuM?HWu9e2_ST$W+OvFDB<67~ zaYt{byG-K~p~hryitOx0DTGKl!{bhyZ*9{UL# z63uez^-d)CHMmSAuHnZIw#~-ti05+!d56ZY+v7E#T*4g*}Z4y(u3sD@=|D@ z5#Vt%#b6e8l7UeDYB`G)^Y&ZoO0MO1Di`2Uh;U)A>9kBpowN<^V-K0gA+qby0sNO2 z>#HYa2dDlu8~*;aG@_&M9wP+;_0azsPqj&po1->$C+#LeoJm@GI-HNN$SNTAzKiWF z!k-4IC*rc8pVCe)v5(gKAK=yYjV}ftsoq`?ug^I8F^y{o_J_z|S~iKoRWIL_3!;0; z-@yNAr9bK&Z8Hw0FQv+h_ukVMXoB|{N}teAJ9NWRr<2cwb*e=Sp-|TnL-UZ!iH2czhwz!BF--N$ zrYUgDyHHF02mYoWm#snWy~PHh<0e*qiw=GWJRVK_X%CvdQ8JlMm&?<@w3K9fzg@gPhV&q*gf=D3N z6>pNQYetyhW4ng#9UEm zixQ}zlO$+o8f2N_;jGQ8k;y%IKK2Gy|EHh$=fb)yikt3J6Yd%mAII}_LjBE1eo|To z=>1;bmT=MCU61iCSO4cV^IT2TdyFevewJygBTV{s92km&)bKe5v;rOX5p2B4B9NJ5fNsMclp`no0z zV`Lm@goKSZ1~y3>PC$bligt+4yqNWsQLxdWFqESDcJ#>q-K?~T)}F5~T|H~U^s1C= zC$EDES#;D3Vg}#PLz}!Jb~3`Uo$fdFTC@U7Ng|AdlQj-e z7<`-1uDUA7pgH+MU7sf}JY9IA;M|<*gwu;Nq__$fw9pgT247wV_2@f8(nKUKfM`eZ z%VEshU}fm!C^SXIL{QIk9S{U-5^}0n8cYcbeVZUlvF7(B<{Bc#~ zf-Xr938n4@)XO3kUXJ1RLl5fu#+^Nevjen|(t}xiE=t$~%aE&jCT&X7AQ= zQe$`O30w162ro+EKB-q`0O^{Hx!#fKOW>$cZ4!ki+uF<#l=UC48R1OM@7#9&o5$kM z;!h{2@hnIQFE8GlB}0O`(QTSux;_%MnG!6swP``4Kw!HlPNVsSl$KIywbQ_1APX4H z2C=GpS>iG0+8|O$WbgsK#>SFDtGx{EhBoCWLPW~sQ8TxogGka&XRwWxzdY(MXU4^x z3Cm!)+V_i-YD@^B7O8Olip)pWKreDx2TPF7ZZKys$9U0;RqbxvfHkFv!}ktg+e1@k z_nU!^kWhY(P||?EyvtZt((jk%G3`sm03>y0BEwTO0HB3plx?B*HbBNI*kjYK>SGmQ zRw&6*u}x8xRLK@aQ2`bZLLVlgW!=!qdpJX%nD3dGn5KAa6UW_WL+84^9i6@hF*iy4 zJc;#QC46`JC~@hpM2}u2AfhpOs*h?(kZCvu1}jE=G=Dc=2r~ytmfdN1C1z;rI`tWs zsqB6I*J`%zwk%di31eWkmd5A_Xd7w9@)}+{YsSAB`3KU3VdA~77dJ8D=EV;#zBk}q zdcC<-0)_G83vRvrM8On>N;{U{vWv+3&jIU+5vf@34>>%;oMiXSDp1JseU zcf~e^b>H+1s6C~q>A0DX$Vv!d!07`^50gchqZ$5MfPIN5Eie{6iVj!ZT+#$2A z@P`j|i?fuR))2k?1Aa@*Na~D`8dmC{x`NQMFjA_TqQ1M^Ymo+Q@{e#cgrKj6(PuE3 zkX}wrqIMkn8sq#uQQI5%2t_T zgL--j4U>j&+QPWHvA) zN{C)=lwAaii3&(LUA-svMCjl-#+jaH0j}e&7XvT2sq??#_jzvCYU~yvx*}4b!Hgtq zV?8wz$yNVnxdwwwj0_}8UQIi5P(}@escWn^m%iBA#<8}e7mppwyYt=R<=2Lx6cl7e zP=uB_SQ$}ljEP1`2H2V+VBN7O(u`4o6_UZ_wnRpwP8gZQ*l=l2scKeEiQPV9*MUAa35nQ@jml2iNs6iByIHJ zLfE!?fz|Vvz#;H=sCNE4KD`sGMzD@EeIHZ_Ge_W^-N|KlIF(=nD-tK&9Ul2Z!)>1tA&^{ zxWH%yuZj%l)-VGbg-vj2Dv})%;VaY@C-#)pLN7udMVLbtDT}k+GgOJDW|`-f3(g%U z9nC0ER_c+8D%C)wZi2IG%j;c|2y=QHGeZfDF2zBL2$QpJ)!Lc`H=Sp0i@SWh=Pg{O zBOzW>c=0K5@a^X{>0U2Yi00z%TEgH9BBK#TDu{+LcZrmcB$a#fjb3%vrt{lwF&PlR zgrQRvS6VknX2{~E6ht9=?q%tD=Lw;dJnq2WmE#Rjdm1ezD3w%bg(`|7XX|>`lMUZx z-1a%?>YV58Ng>ua1KHeDd)u~BorG(Ya+J*s?Ak_#RvNM9J-2zV8K`5j6{6~5Sz*bz z^Z(NKm|>+PW?XiD#-D98J)EaRPZp63QOZaRj3H7-yN@M?#=@Ix6c?A$U{zFj4I*j7 zE!1t9|3BhSdw8D*5S#Bi!nFY%h=rtvc8(T7x;H2sJZ%etr-4-W7Zmu}>8vUc5Ns}w zvQbXV159;_nL&0?(A5nFf#EP}5~h3@vZ|qtu-^16#LNl=(if&sB@BO>%jsu+x|B4E z1l;Bc5=fjUdQLqBquibrI}7&RUO1+!)g2^JMXE6ZCaaPi$XecH`X?tgTMiRaac2y~|3pLA&_wafBaN2i*8?48f0ummvt_Fv(a!B%r?kW0!m|(p$H=BpgkS z&}zmEgK=0(8y$AX6HUu1U`9t@2}bDC9FUkgq*kG^l3Lq*rz3NK#pdO|6ef+~yBOLi z;a16M;dDTpVZ_T;Qz!mi55@iw3*#1UJa7Pq8*2|j1O8tS#=?6Xb-62KGz?w$ZeR>E z<#pPe$@YL{3 zBM|S^VIyq#)DdYjF3%X-K(;yMq9p($Vj_Z2(^Dzma)h{qh4BQK5sX%Qd{IaU?hgi7f+23p6xh78g}2lVTXsD-?3m!Y0|HrBccj5}Fm1SZP=$82<63x1HRK z``gb8#|L)nmu{V$-9jcvrRn8(VquHXjP{Jkg}@>0WvE^QnHPJ&SGsl+uOFo!%jRbERPw5BW!p$GbNDXHCdX3 zjMg&YyAt0c)Q0YF5`z%gGa|-%KiFl|HsI;Be0GZu3mJTb(>W#}pJ|SRls#WR>)Bg% z(E8pRxv+8FRw=R@D6E=_CDsqaZQTq}gX>o8YR?};wO7QV9%54{5zLB61weqRzsbc) z9whoCNT5zaP_C{r#RjTOV;JD=(Ko^gC-ZKLKS3!p!U%{+T7+m{sq_sFx7dPG0^m(2 zuQfWtKRA_?G@zNYMXHj!bvTxs?d!P%cha42eR|CDHOzBs;$^5LgiRrCF%x4Z${NF3 z)QnRuQze98NZ}b7T8%fSB#yY_C&h{sh{D+l6)0M%(gDd*NjiM@$lLH(I~n%&UEg6( z;~hfgjchh3_xo=E%)~-453_%B>s;Eag{>Ra>QSMdrES}TBpM?LG=H?t9&w(`D)X@U zk6*{(*VQ=d&Vqny1<(m>W~6bB5LpK4{ge-0h?5{?Cn!>>qSXktsX&)-F^oV^6&S0H zV{hQfW)Y#+1~l3$B^E%1Xp%9KLcC>f9I^>PqOaDq3$P$cEf||)O&gJS_(T)}FE~O{gKbOlvMNtMwQ~WHiM`Ni^H?3KW7-gWM%!;WBaOA?(fTkG;p^$)Ng^AX4K+VY{PzzycGsQqQ44Ggn zh>eY`7=kfoGbsxMYiMn)s@aW+vk7d+l{OK9S^%s;S`}h6)-T66GAzj$Y32z= zVFWg#k8HIA8d%0_d8E_X$qcX=(RO>EOILeY{7Jt0XAo*Yk-^qMzB%Ar-3t(@d3FPp z3Amu_zU3bp2jA$aKZHCdk*`CmGXnj0kFfiqP-KKa$YxVU)cM%Bis{7g z#Z}dnXEi9h6l0DD5&3-PEXeD&SzPzql1VQuK}uZ#L-X#Ps#6G;~u{DsMKc zK{oP9ScKHHDBO%;em1mW2z|Q{y%Ahm-u1TTi|hO~)5$X2rBQC0w`(@swu_ZTw-T!r zwHr~jV{K8kqZ_8%T&-T#i7h4%9DU86Zf8b%%i+@PKbyA+rhU(-c9PkEIMFz6;jJLU zh-d~+1Uw@&!vqh}xR80Zi;g;I2KO|QIHmMP;6rAV8O>MNJ~+PipV9kWK4n@@4wzrp*bt-&7Qb{aYc8mdZImSqAfb7 z&|xI-d%ERv9?JT zz+j3muFNn@6c%5nZ~%;gNSsJeN~pZ-1PY0Pj}TaRxSN*OZ*JEkM)uosy*yicz4y1Z zbIs2V^t~jPo!;AcqidDpP(=qX8LJf5NM^vyWP&&_NFKu<)BBv|8M^@u?P37^YyduI zLy@p9z80blHl{tZ9ej7ANk8f^|FV+J+hv{^PoyU#nj zl)2{ex_DC|Xvo@dWFsQ-{(oA;lh|Dz`O>`y!(_=|<4eDuKINw^+YTnv{%Ocrv4J&U zIW&>O_0S{e&UP-YJ?1VNjS@&GE-qC$jNEv3YATlOQjN{YIYQGUA{>$?{4!jtmlcf_ zZKg3$P%Uv)N(wBrgM<|+j#G~l_k4H(w$PihSYMNfj4MoiI8Ri2=@F+HHoWS}HEpah z){c=w9C>AAYC_01Hr(jhRqD<>4Hq{ytlpX|de&SkoE%iz#@OCuYy(XqFd)I>9lChT zd9jY>V7XHPl*m{OENJB05VXOK4d|LiwWXY1sjcnJMhq)A#Ty-HvgL(XI5x8)&mpX+ z3=2!F7F=q#8EjTC{}(eJCnberNjB6gv(G1V6t`W{CC?rn`&*{omvePKZsMdyjCt2w zJ8BxRjk7VWRT$Fb&56n^+m%%|G^>}w-xnxXj`WSor0$C0+sSqI+F6Y=A;!^_v7541 zL5(r88i#4trAFOb_l=TCwzlB*VMal?(Yz|g$&?tFJb^5OD=62m#c(HW+~%(V=D7G`Ls%*{^Mb|h&wn+-oR%Q2U0j|Y*uFtRQd8KMIk zj0onitn9SIEU!~(4Ar$f%2@mL4ouTy9^-&Fvm0708xw7{>S`V%Hg%aJYD+0xjw0J2 zMQbCBRx&E~WoAN1V~A;mais{@Ky6hL7dMDP>eVZ3d}MpzjmExCMO4`+{>&9orj8{IIfY=;FU15x6Y z1x&ZqgjYTwtjoz6IVzQ5?G=zrId1i3#)J0+jFxr|799VLt6Dyv=|4g6ZGbR@#5DZG z-3ZIP4{@!-4;S2e?wkbU*cy;H5aZh}!2l@uXxySukdzogB@|D^tL5yvui6k30+j;= zZh{_0u5%M(SfMzw=ueSBQDhke$sa*HuJcEPj+|aK)wUzC|Z%6z3uNKZOqiKdL7u;8J!w zYDP%?#XLfTN_?YiZiic!tYQy%q^fEVPa`5n8R4i*@k;8YL+DT89-1etoKJ5`8-2|^ zgh%(p_;5pf?ddycpVtxps29&`ICvh;2NgXp6XY%P=1)gJ`MCZle&`0~c}cUKyiAjg zmq9bKsi-Lkcy$j;5#Q$s13A~oFF1!Vs&mvF5Oc-Y^5G2ybZ(s=h8^A>&rWKO@l;2^BzAht)44E&akUGpHDB5l^_$&(o+CWe# zB_a?!9MfMLIdLRR_Xv!IDB39^F@PjvBAMAykrEIF5lU?^+H~2aC|bTs^s42GzFM!_ z)N6O0U8Q5jwHXH_xp84bAO>^-(J^XLWL0&zfYSto)*A6t*u(Vx>n@B2Q7UxB6qvYu zB3lLMWHk}4=KpItnS3We^l?g!coWmrOJaML4Gtsj^%ggjf`e+PsKRq92LiyT8b}0Q zp=W!gr$sxQf}p`g4)FE74d;-afspz(9@Rfx^4aJ9{)1-zUQpLMAnz)A2oig^>VREy zt}2R)1fZ|I4v^mBS6soQW{0Fp6=d2l~?OsJ8rDYudb1Ip|>QAw-4_NTUD~ zB`##b$Y=UY54lm`pvzmAj<|u^L+PGOX!`bk@q1FXIzeUg>y=Yps{al2tLwWy4p95| zG7}^ynd*iS(tNp}?txM_B|?}ZR8S%m!KJ04G_E`vZU1U~ zvp+YNlK8kju%68D(C5*LA0ahmqKdKXSU2Wd&=)RA1SDXJNQmnJb;t$zs0ObnN#Ul= zLoqBnhsChqI@zma!UW~%;lBdq>%~5I9Y=!-o$NW&HpchN{e&^28Vo^owh2N9dG;xr zGeTvy?iUnU6%?7|V6!0H)1STmOw-RJDNp8bCkLT~X0j=eD|~4{F@R4|#Kr^YL$ItM za*-dCAe&g!-d0IC&sQ*{E!CD8+i8PlTT2Moc|QsUZb!eI_L`0`^%q^A9j$1Ik03Bk z9(zk6nkp(xT*!Mcl=lV`#1y~PhjXkD)tg#$+k`ATX%t38S0U?Fdm8b-YQNOv&sjl7 z`4dvb-4kjI-C_c)E?ra&{+i{T9!=5#f$))s!-8R_-1HyNvE*1I1M2!_6{NF}jyz@j0tD ze~JGZepBFQT`9=IspJ&8L7}7+#o1I;^~s4X%}UFm7cIwNo-bMIWO}Qg5{x;pwv6gd z!-U-ul`D^3yS4$OHktK|`!a?b#A;0lMC_ru8j#;N$rVkwh-d(CFfP`*9|>VOso3@bW;uJ*gI3L#E)L(|V?)lCbO3Th}I zT3aMp#?b6xOcp@8Gq8r?UW75`rqiDU*g9`21CdZtMoC3OL<*`6P}qgBWWs5s)Wyl2 z8Y?uzW)@^BM(c*M;A}`F#-nP(hCGd#&waZ$TUEk!Z-xyE7%UX~K2EW6*iGjhLq<*r zQYot;l@g~4pcX+wm;|KDF)sGeQYcdjc%A=`J;;AdYWreDTfLnm<3O_yK*4y5BK!_x>CJk8C*QkHCc0m$rtxv=;KA$g#C3LeJZ z9dm0uMy`ClRj(ecjC0jyJut>;ovlWn7-@%~X6#$FA4}YDBs0PI9IQszyY?4ip^tZF zWq821l=hM}#W1yrjc1VAGA+P16KF1qpM6}xatP7oCvfd7o!q!SAre)CJ3j~}4!2Uo zp;K=`vTAFneHH(Yh|K0V&P$TF@&?_3zHAxv{)kZZ_^ILF%g#b1-zG=S_1K0EEa-#^W(-V_E1L%fHs zjwCUvz%N3@WfONDd>rctmva8rlYfWUgV%hS#o0Z_*XVdlq+IB5(6j?rI7F6${mZ!RZ^G;MHUTrUUo``t z**AiQXF=-1b23C`^Km#%nzLqX5h9W?fG@P{_%O7jGP>uUi6Pao2fg*ifDAwLx)S-}yujdt0qkr+)Ds%%{n zkl#7>>A$Q{bw3%cAz%F;%;o_W1tAT|JKM+@nI#GUqf>%bwOo)J zzoP6EPXyDy`#Ai)#RTdW0k?IL8pRecIzQb-Kc|T81 z5Pn?XaTJr9&i{LzViO(}Anc&j+5gQQ0e0@QiU`IRWu5uj*kxx-?_g#r=; z0%mjG^v`p<+-K#q)_1E-YXWRxhE%|q^8$HlH|LZmC`jGUVN8|LHUq+@L zi_|Z0_K$HX)U|Xsrc3DS$zCYsGT)R$hwMYhN) z%4MaXvQ<=kI9V_$SPRaszKQMb1o9r6E5>4ZT%M@Tf@2H}bqdBYV<%g);?Gl82}qn7|Q zaxM8yBqn0<_;HNEBs*6nK7lAVheK?nYh{pFHc@FapACWdKX>_G6Wew+Y&Nhr1HFX^ zxg@^K%0qRw#0yd7WadCen-#ZK%|4M32YTw?_?)scckj zRKaWx;(x)fRB>O_xJO-@yDg%M7^L)kuMrXZ&sKbNVcFxw|3!u{I@o^6tB~_Qcz%}* zg!S)-mSQwXQiA$3KGyoM71(=6&XSAFq zuwxBS4H6GUMKw9oSu%Ktelu|r(ZNSrMMFVL$18`g=!vt33$b&2jlrriQTF*Csd&-< zE&VeBalgZU6EjWKtfOLY9!JxOr|jnJsi0 z9cZaA#zq;CjkD1pKTfDtHaQ|`q3q=#$jG)<4b&?DjJYdSh?5edP7Px+#QsbIvZe%a z;u#uYCY6RY9#tt_9ch)S!ptNpZMbx}dT5?ks%t}Jpn}f!E)P~lbtHBsM|$tbq%SuZ;xAY4KXy86lpYA<#ftQW)e`C#@T*h zx{5}ay|(CYl_0~}&{U1o$Sp!ei~~fenE~cWIY{NHK^io;DuCNA?}0Ce?^ejPU` z4iYjkRb#SDu3X%li8F&RkiuBWn+w>`Pt5$>wqk5^PM{6K6KD|LebsT<3?WnnQRXnI z21c{#DQya4z}AI$_@J)z#bY{>7XaTo5Q?2ntCBlCt8`*^@+Swdu#4 z8+?1GopOsIZf=<|dhN#bDm8Yb4k_Ba)y2Hl-fHWka(79hRPODUcQ;z0(uyezTigvz zR~v7SR2pT~CARdO1U+oghs}@sM?wdEqhklru(VRyMo2XZ5j3^8!4pr#Dm)WsMJUor*MQDTZB zwr)!^$Ixkkx>=PqOEOAET2ndKb*FNCd#`P`Eh9agd-CJdi7|;bC)E|mj8Vb1^vf7Q zX?T~S8wJ8I<-sXnsf6MJjlUi;Ui=ImZiOUjeZo!E*i z5N+LVb6n+fT`RY4@#l`|z@c=eChX?AsSJDKL=LkqK^)Gi4jx_ej7(nl z5RfFku+=eY;AaRL9{B-;w6l(;KQD0eo4$c1#0|Dx*oP%Wj*Z$&K}0;OH#D8;j#b@W zXHgF2o54n+naQ-0@X5SG5@@|h$>6BOU7CdL&~FJF8`dXMq##w&YBtXbBN2FQR&H*$ zcZTCF%IlV?b8+FC44z>R6z~n*ZFlUUibqAXbXp3cfk*||)yM_!*Y(+>AH1*w{b%%v z9yjRs|EGJs5Z(>rz|72bej7|USa1;k8K*ReW7f(8uZkGVWykvEnENVn7VonhT+)E zqb9lNk_RdCze~t*eWTzATt~^nu=_g;?had0);2IbR9~YPf1kz~kUp=r?lOl!G`#3+ z^uIXA=UH2=II^bYkMppASQ;Z5E2x8wS0%Ca2khVQz7#(FpZv44uj}YWpJZM zPIr14@6i1H=E!c_y->}UbW=8NNx31!!_roAWA(bGv5zR5v~pbESvIOYFne5a4(Z*@ zyS|2qAJ_l%Zrs;239%&DL|gSgDY>}6B{H`c){bREu1?pb9)}HLY%7WO#d8y__hC14 z9_{TJVY>&Y5v;m|lItEr20awh)FU-59dsNt4m>uSu?0_CLX^8(W(~Z$x_?cyy0KCq zYR$M@)78@Jivk)UV>sXNM%b=vzs1R1XOT@78}{d-;qFu3cx5}!cAT;->!%YU@-Vcs zPA8ti88g9as=6b2W}4NvY?%_k`6-u&Us^JCp7I|ypQoimh~TDu`_m7E4MG zpaJGxF8)RrnSX>bM1&t}7>E9UScZm_9IB}nCrrSg^a{G4IYS91rC-tho<~7?c{x4P z8~W{@uYBr0TY3$}`vT?_i&j2T9hUT0uqPg3+mbvj#I-w!z6?yesW5@c&nceO4M=xT!3?l-d4(>3=F(-~b=RM_ zIW!2ll~RwzJMr7{!_ZXdIWHGnA4@u~Zd`iW5?jYa_DSw=gizL*w^yCsKD= z_Pxxk`efUl+kO=WF-G{tS^%H|GEiUCkoyKLKgM8emv@aF=Tz}W0uRd}f%%2+Lj7iZx{c;tf5E2~3;5K!^`C=dN>lW_yH%1+p)NRDG){ z@zZ_y*E%$4;`Oz6G)e~%!b9<}ZCIb9!}c!dPLPEAi(eHuB&q;0$N??gg5pi2HVGN+ z$>RIhB;dVHDLNV4Gi#Q1t|Qz zax*dL=Iu%T6r73jAHPm!PnF|8XQOuMOycgsq#QcVB|{kTWooHI(l+7#4YM5yg8hk! zOgKqMws4Nss~!7O;EL@m^k<5x7M#y43*Evpy5xS6w>Y!{L~ER7zg;_Z$w#eevVzIz zhHXPTmhDX$l_l^A3$qG1)U?85tMT7GrpChZOK9WpD5GW zmv3`gfe^KX!+7DT5r!U_wffar$dwGN4;EGr55r;U!-B||T6N|m%b6~0#`x;7hhES& z#rq?S)MU#WRj4zhAaKn$wIIkV6+4v&)4T7aI}paKtg(06S}(Vzikk9LI~CQ@GP*Ls zQc#L@^sLa$9J?DZW;jVYH62=fY&p0+MA+m8Hq3Rd_~pyClWl0?ZEkPLnX95enBlho zaSlU5T)v2BDMT35kM!4yxEV4)R|u9`+wyJ1#JOa|Z-vG;#fu+DkCVq*k0q>ptnqNS zQawu2#%%R6qrvXhWYb4v>U0N$4=XujH*vz?umpfXg#ip>Y&>0SDnVB~sB zwf8NExJd>O>=<>!d>*bdlm;|HLM^E)Hfg?AHfL-KF^_$?)J!6xE6s%GwAD+iOQ8@` zLhiv@=G};CJu?tV&kT(cbr#bL!A0(aSdx4fEP`Ftfd2R5dmUt7m|gH>E`IzD(uu+D zX*Nz^CS{C^&Y52H!NHbQj4*jAFh*EA(pWEZEG|4{4#a{4=}t@N2ymg`Zyq|mui~$U z%Cqo>%a8{q5^~!}i)Nj;IX5}NCQX^J7>qTT4G~bRC6`1wu^K=lOER-@nq#(hwPD2) zI(CmjAmrgGIymOJshK`*fTO{(O(5*R20a;EAQPaEa-})2XrS>HQ29*G6EHn?!g69! z0!kuY@az%74Q5jc&|Rh^L!7V<9veA&d2KrbNe5+)9)Rit;l@pai#-%@q3Pb^f}k?a zETEt^Q{o+!#tM@hK59Y|krZeW4q6y2D7!-dTA-AR$RV(%Rf(|SG(SK;B@Od4Z6x5$ z^Ra`tH&bUpDXqdc2f+<$g{@~a&bWKkoLyUQT6gzXstB)xc1!q3oO?y^bgm7DU}&CV zq;*nA=o(5dcTWN%(kQ=^J>9fs?ix;73uTboW*+F7EDJJN_E8X=iY{Kz#9)dKNKQzD zXeY|9lo%t|OdAZCaJbw=7~@EA>$dJg-sqoS_tM#nUxNt_@bBSxzYH(Nn!~ZoP1SF< zemD{imSx2j!nY4Zr5oo}+=w8aDX*^_Q1g59q|ywAVxZ@z&XrD2I)KIqrVX6H-X{EC zuWwKry|aVPRe@Vg(xBVv2Wpo*aL2mNQVdtFMBLMPq-eWYvdv(`5JB|wEujP6M)=xk z*+$2btbGv9&~w(=h|D(*B=Tng369wrj2Uomoy0vBoOx-8ByLni1l(4d=C4TJL=QFo zz;o4=bmMuD78}TH$0^2+UjY{bK3v2~vWd;enBdc3wrugZ>mD6mbxiW%xbqy~dY&v? zm*@xX?AykghZZEgSfN44JL|Jr2p_O_gyHD5`b{s*&dlGzH+3vvIh=hgFGbNznwqo$ zy-C3i(O~1j4a5}~!7-g1#%*DYR*EkK93ZChl)?>ST5RA)-CSZWZqdxKaO7N6CS#+l zUKPaE^_HB6AsIIhWTJzau|KZA;U7-ij~*>y>fkE_9lK+C_SXUV?K?e&2d01^IRJL+ z@_p|!>-vEApWI}mZ-k_eC9 zwK$x;JukI}SWk})f1`#Fc3kkuU059}9OZz)4r$P0r2uH-65=#uvQk{++6|*ArF|Nv zBok{F(*Pc9fVl@NWy|jyXSE#RuG1&_G{f?uhwvuMtNyc9Z&hg6tR0M#er>?8x+mKshOkcL5gX6z(b-nu!y!EzDh6eQA4?VWKXLeErLymUH zEQq3_qdexPk2_Pp-=NW&zAFNl3T(xAjvo)r_pQoMxX99sVSK_ZNI>kG9Y%(>sM}DD zXzaW@b)$seP`S2GiqMBD2fOwEVS^CPJ6Yi}?^}Q)grre-bnJ{cNX8Gwh@(VS3ba1h z+LX%H^5q_Pn)TPGn=0rq07Oh^lBC4VF1vd3%Ju8SQ{N1-Pn4t&WlaMP?d+G_wb>TJX~$k4&5k~+sC?QnJLQH;SHBDZyNP|K_ZlWgD~ z+u{FrKFx}b>K*R$UAtt zs3%R?cfWV+U)KMn53Kb)Z|w3uuLRVO#G2@GvQ+|*2O36v@GvS1(WuBTT1Ba|0=(B9 zghI@`QSKBc{J9T54yp!BPWp$vy3k=C;{m_4+gaj$X8Y+1tB#@rmN3Q_=0AMAHW*?8 zv3Uoj5fMcA{8jA!g%Zy)L*w})>h-1!A7R`!%FgeqR1o*Tca2weDv#x#=zb za6XK>AbwfF$DW%Q5;-E{fzRWj`TwYk|H*VNo}0b3k3G9keu#(u`^tGpJk(DqGDZ1N zPSd^D{M(*dFCz!qbyS=DL(+NL4!$R+f_+bK@~pd0<4KMnbsF`aLRuQa0C@7hYM@OC zOmPF0AbVGh(}U=pX|wSd2j{%hfM`K|hVMq#=kl6&CwUJ7De33jih3x%3^woyWDn?$ zq>iYkv(4(6gFX=-3F@O!WM~wsC^^4DQ+gwvAu*?-pMH0+Pni!%$9_yAJGoqSw}Dbngc=s@!`!wz=5AR zh@bg_{7H22vFhQqi|r=$y?Uz#gg(^qS#qDH9~B4m&enT~cQHL*!T7Wv2fUzsArop_q2m5W|F#k1h+g4T6e}p75 zLEAy~EGa$=3c81lf@%L6JBS@r=;8Wc{CwIvDWl&|>>>Q1dbsrapDogGevbj>XX=Bg z&C&Pc!9#%h)b#Ua^z$I`8i;?E2wm{|T`PzZCDM=coOE%Cy)7ozE@WR*IGYnHt!beT zIEeioRrsloprTjI)P*$}hSiW*EU9i*3gld^?XNuJdTvpp-a~P{r}pSx9bZT{QJ=xi z6q+}@HK$4Yrfjfr;*O2$0&)J-X3g@Ox!z{<=)Pmt98t}rx8H&pMKpsaPUBX%BiSSh zvdXj6kzjy8iIVt(&(17W?hB<+NV+o{J~A$3d*lfRl^`|rZSe%jqLm%kpKniq?Zr$~ zO~W`fhLioYBcFIre_ktP?R8=GFYm@ zJ)#ZQQO`Km>kPRLT@kd*_{f7V4G;}hqHK&JjX{ikQZ}_GHZ5jz(dxN|@wmb{PTO-; zc~6hV_+I@%NM7F$E{WrHjp=nKcOWFBX);4fS(&4kThp88Ui`bA9P_-3->!JNVAOA! zU6diP_1?T?(`uD`J5K2_T;1v08YD-@w^1-OtYMy)o&_0I6;OC3AX616siV8NjoErx z+q=3~op8Ind8i?SY+)i%@W@Luj9H11vNs;AVA%@_q*5|B9y&Kj5rmLwmSsd{oY|XJ z^N@1v*BVi+kj`f?2rLdDwD%Rcr4w9Hv6!}sU@@kIqlAIJVAz~%L5^V&4|xvd!K$KJ6~FQcl;XY(263(BFr zDJ=ylgBeXHtk_|aNEi_bAqc{mvbNB`)bQwJz2p~t!dHiiGME4;MSyK!e71EahWfZ_ zz7-$CYUuNP*9yu+alGo-5u+hABzEW6IY0#EngtY9<<@CTwq+4QFy~#3dpijOxQ3a3 zR)}>sgIlHtw{~R`uua`oU`?9c#qO-#056-B(RU2n*X`9!9`;RZy6|@Y(Q}xL;I){C zY_JYuFu~{ULjTaMSOJ`hc|43szO1pD2JOu>(28a@G&RIG{%WvKG9OVzkh*n(SqdhS zWyQ{n!#GL0$m?=hAn?|o*^}#5 zz}sk1PK^pMVmFyn#t8b5FvW9rZOnJ31Gc=nM!8owbE^y=yxe1DGLi|3g^lbg7NRLm z;K@`&*f1&xF3cN)lVt*mPuu;%cVJG1^gy9xSKbrP3n>#k7Ne=zd{`<%eO)Lfu+nOZ zwQ?iFI9LtD6f50{E;~JZzIu5C*#e_~OsUfy{bk+QM3%Y=c$959YP$rflgJD%!2`p# zqSnvZ8O)e1lM7R&ei)j?Sn$V%v--G5yJ)>ULuh_4KVd&i?=RZ0UuTotb|66S)B6t% ze;*Bp{x}~0f5EM5fwRv8-rU#6H@k3+-lpOlW(@PPL`=8kRxo4^JR6}TGhxRL_GGPc z{5&{R^jZO#FF@k{=UDDpJJvCkA(Zz>??gT%nIkd3Dy)VnK}vU=0F z$`4N}AXC|ySer5n2P`iVChP3$Ehhl&tk?o;A;l9Qht`{bkec4hQaD!2 z=$q3?S2h+}gPV+oxJwx9M%efwv>Wu}I1>bRI7z&Y0 z;ac%o+YN05fp~Wz^sF2-m-%7|WY<@|K#~wS<63OJ@pi2>5cNbW+pz&WiMJ4(7=~LS@Wr^(J;<`- zw;aF{q;-x9fcgl*7F6MdI@Xji7seQ zd0>s>ULW4!5HhiMMTuZ+TojFgYN{n%qyUt&?Ee-9lY3r>rEF0NQW~YQUU};Zwmcq! zwY2_Db9uu!oLs%&GVg)=d_Dbds)m>2Rh?D=+_%288JU`>aLE5zJ|ETz90~l-3%Eyk}JKw9Q1m6#+er7~C-3ZB?=3=B9O|mYB*e#25Bv?RL zwSY923|j%LGp(~;HqXR;Y|fPs4+(|h<9HE9ZO!IR^JjY8qDK`c53aVZ25by#2--L( zF$Wg4P9sJ5-WLGO)>I@iVJw`ebgAqLWBxAI`C0mgAKiZ&4RqXGw5ff06Wmd z%LFO`0s{nC2uQ(uwi+iv9}yZ;s^?0v5mibQ%ZOpJnu|N%b@X=$$m+-_8=H{sH6{e4 z=1Pnuu%s3*J0!+;VMu?{!zN5s0!RcPDN!D>B4&9#9UPoP+maGY&@YMjO(48rskJbJ z8)qhQ$Kn|PkxI?EM>8(tEN&!UZ4D%~0mN!y*hE0W1LYzhQKS^*RhhcAs)6=0>qi9xQqI=Z zt%i&}?AX0YN6+!ci955lvw7IZa}!|CgZ_Rhj;gL1j*yhcl=&kBh`e5*Q`S{`AC zXhPG9x&Cy$If{!v@h&hEh~o`F<|)hkfNxJ7Awu1 zMg~!5`u`ht@@?E{G_B)mrL=TXl`O$!s#`g7X}C&L&aRME-P=RQj3G%yEe%lJ)5w)1 zW$m(}{UZAsgn9IQZGDxq2qvZwTW=JrLTjg>o);eqeXD49{;T`?H3K&f)%lk$!3rW? z0!tsq&}oi%@Mf`Wkn=eC_*qN>rx9Blv-a}{Y0IG&q<%61ACW+rvY(J(Sp;2>ViCpD zxuZcA;!y@;Dg{*)abTpgX)rk+lE%VtK0xe!mYxrN`Zr!LZh2FAL&rJU&~pVsDFrbO zmRxn~<&7u;QSuNWB=+rw$FH%6dyc3{#KfXNN0mMA7R7=Hy|_{`fjEUp6olvUbt-64 zPv2IT-hxWXr7-q>>+SFB(;VohoStfUG3ot<4r`i}!eoGF5lVrrh)>bY*gcefggRKE zlqONc>%)R~L@$_TK(wg+*z%D7rXL&4)|=?n4~uxes$pl09DZku>TqUy1DK%7#9^z+E`4_PUW6ie9ajg zl_o}WIEzA46P89b@nxtYjx$XWV~w^p^HxagZKepM$sTKmC7F%D+4Q$Iw#+a?V*t#$ z3Sh8Ri;J9k-2ETuea+%${B1AU_20zjE0?HZdIV$KKMRLrPLIR7C4A6?PT$tBglR&> zRs{@!pav{B%${C|V%PqH!}~HAX7qs!;s@l5(DwXIgKzffd`u5(4WY7(F+4-_Vz2B2 zl4kX+YBDE*SX>l`dt?R>Pm5T<2Y&yg#CUfm!0KcS3q9ihs-vFDstL?096GizLK+OO zgQE4>w3XqpJ=hbqBVizKB|K7_LoBBnQu;?eQ@$W)2pw4o=H#U_#MyUWh1K1u{jAh_ zr*{052N?q!OPy!1anBB#$4biYa|OkGF%GLDAOq+q)73nw`&57R{45g3`sp;fm#*El_5!J%P@fiPaHE?c=hS#O~R=enBn-ur)teuANAKxKs%Q8Y1 zWsYmk^*NZYdR#5sRnQhlZ<2sNHBgtpXo!jVeb4>5%o*_t$LxRGcBrVqin9~-w)x{C zHp!z-W5y})yIM9~kGtkXboxFT#gmE4Kc17v_O<4F)E~@$O`a#4{mvXyf6{1jU-YiT zHdiWj%)whMq5iLpmtgwHW{OfP9vCe4xd!YMF2pTT7BwAn97oXQ2*Qd<^DceMK+m1N zk3auC__sdAWTYyARa7Zi%h<6DV7h9%jsJFo{rOLoNvjqaghbXk+9HU>ja3VYJ&r~@ zT6fI*U-Q}Lao`uatg!>Q?#hf}|1SQsFIQoghsQZY+MiICrl9f8P(&H7BrW2NtVnalg>vn|)wuGY`^VCOyD>jo&}_)0A2$n?6JoaVepW}72y##zq*Z`>`jr$xk7$N~ zIO1hRIq$PUXdo9w6gr=|^L#(b&kWMXSy`&cTjljTB#5)@tWWMIYThk)@~OTmQ4H#! zw4!QQqijpK%CTkNI~%hEID0?&RM%WyL0}JE6Z>A}oa@7V=7A#Li4rFeO-fwc_)u3i z%0k#+UTRPSO_l(9xhBu3;tqSRG%gV-Pc{oySEc3ZpSI3AVe@_iU_X1j;|hF{)cV!>@F&T zh_QWmXM3IYz?{q>!GxrN7{e(cr#70J-Gvm-g?SF1Z=(^$gZA%dA6uUVx_qg<+tKBw z?P;$wTjViW4iFyIQyHqIfV~I2sJ~JJ1KCNra1YWExOYU5An1lnBE>arm`O}DW=Ld~ z;elxjWf;l|XZX(#ONkqKauKmEYHtm8k4a$JKY$P}KS%JOI<54F^LTIgK9eTIm(T@+ z4nwL42W1uynfMP?l0rQ3#p3YV*#`D)HylC2#Yo`tD&FVf>R{cmv^SCsk~s!rZCmNM zI%f=qMwuauE8$^e6Md}HuY+9c%ULAaS~&?dP2M)~i{tG}Bgo3*-PUFhZq1};k7cZT zGh1b{cM$5v%wj7b$k8KlopW|KyLlDVRjUX&8kRZLkSiP7YXco|vOG~nFm`2`j=i#( zXehBvQADMX@ze`J0m!;Sr7(g+dq3+uFhJYhWY{$!zQVwH0f`rqMN_5ykE7h${45z1 zZ+jUk+X$P+8LWka)6*_(lOwz=w;`g^o2#b5w)jKIVilZB&FL2X;6H#PX}pFfH%ioX`n3hK&C0yV~QNIf%d*jMfK~{qS~@ z`hQ2xh$eDHc(YK#SkMGmYWk0>34NF{UY++F0C%gdkd-c+5KJLMD->rtlxS^isJ zq2?aeH2;8s`V2q{D1$Gg$e6thaSx+mpt2{gXa*+62mQ>R!}KWik9qt@=RU{a`n^k% zgzXCe#1O<7ZceaiY0J;)FF7A)VcdB@&o6%y?JHq<3?xWv)u#5V%aGHZ+$%#=dXky6@ukD) zZ`-BPo{F|J#%(`Y{%g0%n_TBSDgtTpf~g+pre~{nAo6O6lw9`b>DzCA^S
    oa|c zlc@c;QSZ$6NO~>84z;6nG*5H(j<4_t0$GI9^b$lJY6ILT=C_X_-@IJUwE}W~p8F8`P zZ?f|*@LnY*|F{PN({P*(fZe`ATNYJiJX{$sCQ-FcXM<* zSNZ;ldG8UtCef2~VqZ%qH^8DOdD-F^S@NZZ%#{R!RDi*A&O9|=-p%Z8w~C_!mgPgE zpy4~j86brT1Q0<&P=XX%@IhT4NX4OS$7}Jr*tfn8{Zo>{)nJ<$&`lDOStkFPK6ex0 z9Mao3W^*Dj?;}W0ICZVB-KI$axhn25efx2j*Gd=bqvA=n9(T{zc5LpaMPZ`;HX27A1+neWQN zQv;|umfrm`8iAUQB_-Cmnr!>^8$27x8}{frKPj>Cpv{`I2mXxwAI}wi@?IZN9Q-Oj zlP*Pgt|-Enxj36xsGj)aa}P_kxORRzhc3^I5Xg{hJ50*z!U4{C&cCgCYt!W3C!OtnSIe1tl1b=s*UODXXT8EI!ZI{6 zLybKyfHfM8UN_aJo!aK!+KU{-yNM`b$W=$sWrqbn-)#k0vyFz#t4bWL`ehKhsgSC# zCE(ey_a*j+>-RNuJv@N z0d=AY00F%D``0Dyc02Evt=hv3FvAQm!wfLP3^2nGK$wCM0n_Ehu}rtD^GDCN+^EcruVQ%9(ga%Zb63e z+-i3>w+HNqdideUY6Obb+S=yXYSm$LRoWo<=&h>jqJ+XkY>l?b5>;0~E~oLX*Rz6c zjLVx$&*YUV#3+!($YiKCY{E=|5(m@tJ9A!}zH9}iLr7V@enk|7mL@JgYCjZz3;A*4 z9~V+CvycJIkcf(H$g_IR#<`@ln)=<9*}%EQguL#?q^ zlDk&=_;e#WPF6#m@&2#Ux8om9*__+Li?oNJu24cCu^a)R4mRyyC_<89KUDB81-|h9B`CO!CJorN@n_u8qruT^S6|95*p}L9)TCo5)Z;qMHe{ z2)fqyah}_*nlGKm9L9(gF*C-d*6yXbz^8>RcAzh%ttKzer!fFBRwepC1ztD(b!WeB zu-y@Y&50)N%5GuCWv4?uQ)Z1YRIM}9E~F;6!K?J#S+MNKzn6o=3=s|!D|xyNO>N#? z)K_1|?d6sH?&R5;P5!vft{_-~0koW#^TglLNdk?WlO57-_<9iv9bZ^nL|WYJ+g8>1 zsoEFrp7|^Qi0o5k(6VGHGhMi0VCrzu=w{izT@i8#!RT{CO+3nsXy3BZCAWLP(+98t zGc}VwIGF7}otkT!I8Ik%Yb!d*qcy1S7#--G@rUfPV8&sQ=z zN+Th~<|QPEqpl{+q)j?_7KRI8(NvWL_ir*onDf+TDv?rII#sbY)EJe?K+~kiDtC0% z>gu<~uy*hY7;E^7Y6jESH=f#N+o0yz&6zHX^qGmf&i2Y>PzD$QOoNi`_xHR+Rz69M zO2XLYph4`CgK+kICi|JgB;clH?oR!y>D<@}>!o}fjHd)ED!oAmyslfE3*ZoG1)g2( zA3U(_l^eKV7?xTz&cWH8z_`vQfuVK}q!U^AwqRi<~vx!%1s} zWamUbfb2&dX|F89E{`175#^^<0gIMpYdIX<`s2)o>iXO{w#}Hq0Ai!GX!=xl7teh5 zhKNohZ>|6|K+C`1oawQNsTgh}$?hXs&$D$X0#TXFH_$dhGbU9nv^CZSJF zcgIz|RF0y}@Amcj|3^O#$I=&e_WC@}pR?|Z;SJJ0isOCx_I@a@><^mvPr4u9tswK+ zK-LE8CWCSLy~pVm1cUSO@GWuge{XUXL(Pd7wZ4uGgLn4%cz;-m%~0sm-GU)|o&|6%?zbh@nXb=SBGVU|E@qbwkKMs4B_bt~)eyR4%Hb#*l!ULbpyFa9Xd+l$1v-wg>WHD8 zP$ig{+vEvT%li}U9OgaL4<7Cxg?C>;&)Aii{;%qOyPn@J-R#bNGYFT-wt8QI7Yw5? zUc{C*|wsu?%1dQ%+TsLLRq`4&1xyxETCu=+BHg)=X zuLobCT!6(9;P8HC$mbL-f-DESA4jZT z1E79S?;@%lmNnp2e180K@2Won@VjAwAb#EDK!0NZpOKS?I8W!SQOyJ?v<;x$(KKce z9fxZkk7>`BR=D7HwsrLTcAxcUM)~M9tR2EM}BNiYgS?ni`r~jTVe)vX-O;Mmu(`m9BQK z>Dy_Qw<}#CK!O8ENYtn(R?4zj3O`}{3}E%TbQq5F;)fFUHTA;xcpNz4?{m%;@Q4|N zl{`=k1Stx7Q+hz`q)3bQ{>UF5^df;IiZD?vK2X}s@ZClQ^_4C{DirZ0y1LoRRMUq7(#;7Pr(Of4SI7-Q_AZei~I>f(7&<5LU zx&*}oYX~tp2RDTs!qJx9vKf>c2GyKV*LKh0`+lds-!!e8m=Iz)qH+MQ7oV$~WSoz8 z$E$SGiquMrc9t<2+C--CJ*FNVaeae8abYY#ysaxuQbi_dDeziJJx|I}3rPEl(SnlF zO&}wn3IGq0p4~T`I@hB!?l#5eo4in=b)IHbRZD#;**h%gLrg8sPM3&dZj$YYG9s5s zWY&k??^FwCqRNBGd^Qt% zS`>0T?`aJ3sIx9Jhi_9(Jpj=SiK`E2!0^-Ch-cgZ8?y5XOL?m__i z7YpBW4)0!g@;TV2;$3*US(^UM()=%WMA+_CWYQ&6DHK`5Wfs#+-&Ha~kwD%qMl;7) zjBZCL3WcUbNGP&lpi74>)v!i97n1PI3{_QyCs;meMHvVTTH?dcd98C?)tJ`c8i7uz zY1TL7o?4?9WJG#oI*~gj@w!HzW1Yy~KOFrD?(*%3=4`cBZB?gU=|tjb5eIcrL03wt zoi$hw5#h~$y!2c_`|jrad#>;zzEwq>h0t*lih5UwEHZAWK`@4k%OQ@^zR9h@)Uh{; z7C~fAN2rH_WZ8CW(LNQQm&|tb&%B+)RTN`8ts=arQ1`11hpyYEUDeVfA8~fM6JD;j z54qZ=%Xv-eizFg&TP_EIF5uG)X^);AUbGFiyE|o|Z!mlOk#<Ukkb^% z9;-2!;3&9fUZ}P#Rl-SZBUDLuiy=Xm`og^` z^v1MXV_DdQL&e;et@G>H_I<9*Un}5wN>k!EkCZ>nd+qLKsx37Ekw-R=7Xoic&xrCJ&kHc%Cn=z$Q^>T1sI2O?xaCyK(O#CAGP;d&fghlpG}=PA?ZuOiqW zYrxWM6B2qP)gY=Mqhc*@6XXFoNK}zid0N?|cCrUSF1PJLK{S|c4}tFa&qliYd%gxt z>E!fxbPlx=N!zMXfzd(H*5*ChL$1!Y&UE7I{P&#V4iI>BG#qwKecG$U*kcV0{QV3U zA0vhrFFab>*K2xg+1=F(xVv5mbiXc>?t7WpvO4Dl6rBslK z9ih99d9mDG;V(Y~J)|*gsZT|(p!-lVa~O`7KuEm?=FP{={~1jymeyB$?}lkJErm1)eP&VTU~K=eq$_g@g;FF zd_xzK$-|tnqobLcILqd((Rp4|CK;DY5P+gka1H{1%FTelR%P5`VLEY}6|z9Piihb! z3Mxb^@|j8b1Oq6cXw);)5il4Yzp;prg7XP>1$lx5l(ngu-6B`mKH=W97PEg07SpS#6UDH!2vfR zzTkuDsq3WbZ&1zwSqNDYBe6APJ`IZ3+2!U)uz*cSxM3m@M;1fGu&Q#t+psHdv`Ul|9wobR_w=emg zI|(DufsOk3Mt?KY#i8TJ9eK7#r&_zRULl;gYx6gw!X6V)lxMiHnfi1M!4?O@%F)oP zgM0^X3Ox(@Y3pU?(sSeBB!Eo8DN}opt(wvIoRgKHrkO(2*oTfWFmf?xe=MZe9!D*3 z?dq1y`7060Ds0)aCA~7aY6J5iiT6>TUk$|wr$d!7AhRXHvEeFdG`<{Qc*)6b=T5EF zv$3?<1HvCPhTEPGgtkLo$Wl6qb7`^C-975^g|-4^iX}MRL|3Y#s)OJPL0r&?2SO=$5tGi}U(N4@4<$a%J0voSJWWAXApA7@w!o3q&A-_du zDPaYBd6pPnrqhOyG*jIOz4`hO(X@Vud^*g zV()mo{OPguLN)*pZpz$8*;>A+CnM>k&y)o2;k7pS{jaAJVzHi`Otpk8#veU`tgaY7 zSgXI(B?0-MeS`Vu;K%5A&~E$=IKmCcG2L080Np2|8Jb`hbB!4pxx<0szGQs9L@hvx zHIbQ9fEB8iq01sgabSW??Uqb&wF0I2lZkPnXi;dM+J81tKRUOcq|{-i?eY0j9uBla z{Jzk>R-Bg2(+&~@kU}cyI$ZX0;^;||wBUyE^;i)IOqf@|}dqtRe>mX{F)$8EW> zvo>b;{H@H=Lgl^-I4$xXrHplx`tkGzeRbOn-XI)3Kh?_+JzwnwoU;>??_MVnX^4h< z-TeK#=x)#$aq}N{&@DXRV0Q1u{tpDTJBCT(TZo42Y+zKnh-e*Lioq=xWr}73ZQ*?K zu@x>Lmx9THlZ(Df>s*#&TN9_-hL@GPcRSO8ceTy7Qi^+8GO|W3g#=2(jXX)Wp_B3o z8vu?ImKf8p%WHd3%*>RQ6_!-?;k9|VRaF6Iu}mGZ%MOWUM}kW9{E_PYiW9EM34_#p&`-swQ`^eYT=?#Qo~wuYeJ1F<|3MW5W_XEFX7 zA{W4;ethRopKdduhqJ3pWg-f|%|P#Cv3nja9i43GBYKVy zZi;q$mB>cf;xY ztWJdS7m-d~qT5t%zYo+g91Y_M^fk*J-^s)h3JrYnwK=&9KOVI%7_E_hH)XUd^lsN2 zVwNuU;-4YqxDgEjECywkwhk{<#B;aXj5@wIa%U<8jBe$ergyKgUOMu^X_%01&yJvP z5dqC-g^TN*PUvhwFZ(&v5qX&1^L+7@Aq!?uL{?44--bHAwG*=dsz(0pYA`XvXFEN} z*eKbI2pZEIL)(D1;ZQcnm1Zsv<`x9uaXjVb(*zLi_u7ZGj7Hh&Z(zoi>rI%zrwIHA zrbl0Q(pPxY)%$yfIj}Wun)f3)ojC3CkkW3= zYiIG}a7Z0qj*Hv3R43Lii;jKmUMO^1>z26(XeeS;ZUM9XE2j@2H&9|B0m%VHu9}Q- zH^@f8sZKe{VX_-heYL^GT9D@Lr-5J9U8cC3UTzPMKflan8D8PWSoYIhOzorF82r|k zix&31?YNr`O&yoNk%Rg^1_B1m8@_Jh=N;nDc56ec2_FMF-3*r(1vA5jh-_lRs0Tf6;0*}m^`O76qe+whN1W7vH?nY=ECga@NT62biXfNf(h8$pw~kE#}7Mh#|J~Ng|OuIHzE&> z+h=j|=e~KR^y68`A3mT?HE$$iQci<`-Gkq=i4kKwRU( zwTuhZKWat=*&3C@REX4t2Ht#=o|&=nYg3oCuLI9JrpecMEp@%*(R3#5k|`7-f-5sh zn$)PE!)hEI{x@n*0VCf$F26U0+o{rZvb>A~^L&l<(`o78dYogPj-JizJ}AaBid>F9 zu;_VnDbTPYH~|j)D|1(n3#OJAE+E+wN7RMADzNtrhGEZ^4Q&FC*Soa0+V${KBpaB- z2Y5(5@X@)rRdM^CMa3NB+0iFO;Tyt4Fgh$#1!iQ{!!a!Y<&hzh!VueAce2lJyI~nd zOqeJ~9skB>CHPj8U{1$`{Y3FQYKkPeYs7|u3vFe;uiyDZ{tw1So7|1{-H_=oDueez zUdSH1HVgR5WEB4#3@-Q$2?LS`*^uGgh#7R(rW|4N@>owCT)~rU zJ2itCHf)GygqmN7X3J@Tc4M0OGtU6)>;29*W9{wF&fPfOt?6<`Bo6>EmFg)3uLuBH zF-)UMfS`9N!l2Km8I;wK309->KD4>jm!-pBQX7LB{42oEaumL6Gq+bXG=o$E!i2ff z3PiBQz$gaAFt^o(?TfHPl1Wh9?$)rwwCzto%tj_Ev6*_0KTJ-!)~@aj%nzh_`+NMg zZ%)bBF1;O~VRr8;4XsQowBb{;43+RVJB9Hx??WXsd!O4_I9xMIxPETl`*rQ=_MQ;) zZUzS%E*s&`k1tFqy3H2Fy4#h$1{{%_y<0&?hnDO{RN<4yz8sH4LwPCNcl?83jJS;xErbY zVL8ot_Ba=cO2cBByrGF45CuqP3p`cp2Zw^*sTsgT z14{Td%JHk-)HX>DWyc?{%j>H7wb+rQOG;Ty*!VPIF&_y5Mwx>_X(`WqAoZ>11H6hE zAcLi4l7UOaKM?@11;a65#SgO`O-z89f)cMtE`!;OqOMdA1`FO7 zcE@AB)n6lQc*gc9OP0e}s=F>?{1searVL3$U7Iq&p#rVi(W-D~tL+CGNGK3=H$g3ytc9MZ z4Y=FK)u_egm!&vsRjdl`7#M6HT_`s6B$KXCzLv`bp)0zyTtje`tZYFvZF6@O`ZeTB zkTdShhrcQhy|$Zh6n?z_Avhk!-x}Tf>Gc(FMct7i4;XeOhLwRJIk#_Mu5Sa;tRz0i zEvzM@7^&SeFJILb<}riE=A?U*lsH=<8|)C=0N^l4Viywz_NE$LobfGsDsA#(`Ce>b zGB!USOU1DEYy*4ib6gh%H8jp?hHxa4c3MPpeRiF+$iuD$>Tx3-`%~bL7ESi%uAa5y zmJCtk{e67n7#7H^thBH~{3vU~KWTQnEMcYMF;!D+95)$u%9I&3n>c`9hK{28*4ulF z=rPJ;*|Y9a3?Nq@H=@Sehv-$lk3pcvjmpC&il_VMVWxu{7k!Z3GT}I5G8msgJMVx3I)OBz519N2)?du6;+S58TVk6JTs_ z9nHNnnSS0_7S{FRQ{d2=iC9eW4g7Muh!R12!e41&a^>=K{YAzp#J9;e9yM&?ICgWk zWqO4j$qQw+!!v`!Ml(^IuR{DG4uw_P!XD3Mx3rjbi7q1v!~`{z?ne_MwHWc1@xzVBtUic1 z_yJi)VorG87+#+DIe{+W$?-n?I43JD)%WaBb#`qe^j@5GGRiG1xGsA#e=w+y)8y3s zl7_V}Fgu13m4i}cg_zoE99{w;xMn1oP8djL)j4I1n>I{q$$-gNqZ0>#$F>=B6OYB; z<%4W^zJm^?(j_=fN#%u_QcB9f^iI>m8KkkT#d)G zQ0lF0kRl}8zt1Op@mR3;TkITt=y;SNJHLuF zz?++!1qKYPK-tN&kv$h#kR9~A%E7B1T8Rw~p2qOD%67(NGRhv+CW6Z~Nf{z6%`q6g zU(()yOIsX;VBVebH6M$7UHN5q9iwnM_o;tWk}J&J-88ib_nG#T*y%q@IGU8Z$dGR+db*)Zn`Xgf z<)$p3^GXaZkdmGY4|U*n@eBdfATYZ)bHPGV>$(K>d9O(H(itN5tg^RN`Xb()#iUP5 z%@yN`VCZM8^gdRmlsu$C7i%zX+FJ7+-KtxI;EY|e=BEO@#p%jLgIHDZG9VM$8>gHL z*pVQEq|Uo@RRS@n)2K+uYOx+Gk{DtKJ&1^tlIo6lrgC|Z!puvG=HeTKi{(^B?D&Z? z=yRHzp42&&yaaHQp0XA`vzkTr758NPWH8Cop=cunV(H8q6DMU5NEyU}z>*q8U_prC zzW*PdXp#ZPd2JE79qGe~HU=4#)-mhyjn5mG1KaL~T@^A%#SA$24>tWD&qaa^%eS2m zfjOxDffL)Q)FLUY2s0LI zaB+vsUy6LIy=Eae%*?(>)$#-oA-&T?H;tj4J{HzOn;p|M2Ib-L>{^eJXl*4CvpooG2lK zx(C09hDiu4f_~L2E$fV2XyoLLYoBEVT*0tK6z%1|l>Be6HQOr}Z2@%W58bW~dh)`u ztS&(AM_te*f-CDaJN0I~cXniw?ySwxV6tDm!5(Nqa;eG^xHaKi>G4^M;&GDCQke{p zd>&L8}_!(&Kr=2`u_&H&z-V>WE|699j7+^}6BJydOGVyHQw&*X+ry<*m40 zzgFkeMA{Fk9p|Qx4IVs3DtCZmr&m21{Y*8=d%G~z@k3ID^G@tS2Nc%Oy3C?(-7u~$ zO=1IGV<7^gJ#jYISKjQR>rfXOh@437?GKJKbUKt9a^TXtYiyt#%$5#y23Dseu+%JY zHO@3$UkJGrSRh6EeiqrpYdeNKV#M!E*+YCwKJIONZee9L+Hdt^Pl^){LN0?dIbni% zc{jW?UQNU>iYlc8E-Ot}oI|CX-wwj$&jKGXaM^QA3I-;5eO1oPk%lh8+Y`OdO*?%Y zvIhttZfu1~Xl#h8xZW{>F20kDfyQpAj$l;jWhVsT#KS)j(Zc3+iW@wUQu9$b#)!eg zw)ovlYWrH#=C7Ph1$U{Vd$fwV)kfeQpyWvyx{z&YF?wT2MgIi|`MBp7y;y4FEM6*I zHN=D@5_wF-$+@LKwgNoU*xgD~5fKd6STNU|vS;Tb`AvJ1jF*^p&7IpW&mLl)10oWp znARvI4cV_GJU&Ihcef&PBYw?c4WDDpv5;JrmyY5=?X6eRzb(*@1wZ<_l;rTIMf)&fFo-fUIHXEtY2@_Ww%vqwJ z&nOrdZH_AF<0j1wkI+_bHGK1RlM2jHtg3d0Byr;pHNz^-B0(L86evj*EN-$5x{e{8 z#7K5qAQQP(G*k->n|xk0t-$5_YK4EqFg~#?KGzS8+E=#&o|B(6IdUFbma~9MV5vRW zhG4==N&(NYK$1tMY2yer{TUnOTP)-(r#{}0>B`e+jZ%S?`bj<;PKX4hIU(+p>=2ll z;_ncX6qsWP*cAVk?`)cpjrNBSQrT?12W&;b62%e?_cY-^<(4pT%tZ&a)Ml7zNeOo? zdIyy3v%EdE38vw=L7H<-Qgu~|id~xQl|lRKc|@6z#TA^h2x8Y{P9jP-Hz386Y_My} zI98(Z2Fe39p4>{ta4jej6j7GE5-`9Wf<}RN(#SUt%ub4ZOHf#s= zX2PXqj#@}DLf@`-x3k=B0#(u~ArXS_JTzU|`KBC5#W*JSMv;uRCpfUSL9n(@Y+drq z70}59qKp`1Jm#2UeF$i-`>46Cm2E^d`%{XDA;{Uy*BcCU9IP{{L11I-3?d4Tm_FjshTd-?blvEcF|%&v&Yw-J zT(%2bZL>YtK|BRV2JHm*#637n7#yTpLL8Atn(i#_Dr&Fe+qXNd0?o<8BM%C7>wKMw;g4(vocW^u48$um9bWH3+{D$wRD7E^aR`%p zUhK~yiI=vB?ESHa#mF6i{Ii~PK32EL5si8$=KoKb{4QkR5+A2=Trl}Per=I2;c3{ofngHw4T*aWEiWdN9yw5*a zn_IALo`Ci!G$are?sd zR@)%67o&5on?9y1J1V!r+$$~-v6Pf0ve;zflVq}Dj6m3BT*YXRmbT2f z=!P)b(3unxa1h!WyWMSUyLxk6C7Ot)hnAqsqD3l_B?%0zr30!Uf(Co9hq$ch<1h#o z==~?){U4)umD{rT{)B8#$o2Zr{(Pv3_!u9zGTBB37C}=`Uw(KgHia5h^?HbJ6C$lO zwC2mCD&A;vs4z{UV19&`#g!?rQ+l0*Fvmq}rYV#aOzJF>*sJU7UZYCJoB8_qubzEZ zp!fN4^>POKDe&Jq^F5-gl;2i8^Y9WQynFAy+0yOd!4uab=<7nu9e;Y5_ODUB^1V`S zBVCur^sn^47(bc$Es^YgE8D&VdnF{w5kE(xi1_0J+61zEQ?#DV6;@G3A;~a;vYXMl zc1ZzA0%s27zu!zXn9c7ro-^pMK~g6y!j0tzcp!A&MtKMKd%YsCTLGg8-%N8Oz zx^a9wTO2c75QrT!z=#x)f)<8w7)Ds$uSzo^+LXxv#^{KW-80NT32LZNP?r_WRE!F7x$BoQglMz`Ep`1~0ng?VNdZhCR!78QIw}EkY z14XB>>1aiFu`xa%WMb3#rnejbzetF3p* z8f1W~5^U;m4B}rDztjy(5Edy^ihzYs6sZId3Lq%3>bKXKQ-rF}Nrn9{72Q1io1nES za0CeAl|5Z})EuPk&OLU%S77u9nBQlYd0S~%^6ydlonrKE z->Z4d8o}4=2pGQLeIgNFVeZ_1q`OqVs$p=-b5*Ae71;$;FNk>k0>r;&3u4;;nRm^BaQHHk$N;qSpBCI8xp8gVMmnCfPT}q4ht+3hj&~9*^tg+ zTqly>w5T`-DQ-d_l4=-hFVvXX&5Wc3Ib=&+nbCVM4%B8TsHRL>?C>E5R|s(w<( z63%;EM)F1Q^p)*5g{jscF-i0vREAqH>hgu$L-580(+TsPK@mIo_pQ#(_{CQ*`@c)^ zjENoknVenwxO6yc^Tk)~)EFc>;@Xd~qB2=!iPo;yImeB25pC&~!T(Qa1aEZ4j1(E-KM)?R;E`QTq? znB|ANENzqERXlNUi6H44>hU2~p6z+Rg;AQP#N@O>$ZXx7Bww7zSsEd-wS$cqS}qAW z@tn3XeBnb$TTPpf2{WE9wW_tqygJEXjSM2qmb@Xx#Ble7oRKsge&ga*|8wv3oZNWiE|Ttb+q6^mpPla)@1LOK9{NRHqAx9Y+pt^5 zz48voxY1YlHjD3~%s8fF+}~4AiaG0Xt`}bef-;BiyP+fCd(R`8hJyjRhj;JO!^PT< z?ye`Z&Kx`4eLYtX=Q!cg66vEy;x`fHu=Jw*DI@4TizKg0_wKkV*HFMI%!FJ#Tjt=u z&?HPa1OcQRkp8WItGjb3G2e$w7byH`-`sY~Sw2~DPtKiz_&M$CW$nDnra~W}m(T8!(-z6CBrBi{9)6N97 z+9?8U#x#F(tIOwj^~ZlX&u7N7)Ui8m$=zw)_y@d)X+5yf#9pO>rQK&uerMd*ZJn_h z;Xf%ctj`U*%OZvdcUI)&cV!pe1Da3Wne#$pGr@T2vy5O-V{7S~lR8b8d&i#WY>CQb zt7Jgo@NsymPl0{oGmMLotgKYc-Uc?UHtM~y9w;M^kaLZL_>S&sS{Z z*9huO@89OG@lROYcfSXDcwCnPmJJNMbiPdl!o}n=b=$LHnj&WHxkG~-XAjdo#brGA z&L=T#UxB{H^XCXV@Z4p`chzM^#3uF2>oUWPy9`nF)J~@tyoQOui3Qv%)5Y&zAG<8& zt9K8aHO0tIg7{(EcT(qXCeM=w8N8pYj`+WxG9`A}nw+Nhb2y@>(@Fh%XJ1cwbaF-T z_m|7&{PB2x6~scj>$k@5)hw%ySy(&^$}16K+A{7FtznzQWuCs?W3hexXz!;t zhYE(&Ii=2K3V}#HX=0DEi~^ujdU^@TC1&%j7 z>(qP3oLkf`<&FJ)y+_jEPs6{=V8x0ae%ci9ytX_AzltLO>^EEC?QrVt?b|7OQo!LEt-ygOFp6)gRG2R9v7hQ@e=v37 z+}qYIYcJqCo*&#l-7{X+h6XqFv;1&tc!M})`=B^>pPYXH8vrpDv=DH|_T1}0INXd{ z!w=^R}5y+ zT%R9rA*9<)=cxWHj1gRMb%kjo5fQtFfDn?4AL)-dk6&2+)3+JYF?_A-PU2sV|3LqL z7ron9L4o%1?}$Dpk_Sfxk6}Z0=T;6*OkVF%>K()GVLT_W;QDP1y!)$2B5e7{ZKh?f zG)#KaT7aZ&188m(Q=Qnsj6u`KwZ=9r(Ex~SRw&w0mu#(s853-MB23b(p^J#uXFGfN z^XCqS4&MI0{u*B6&OV;ev$va1tfj5H2<&inSldGG+_|Dyyzac@zXJ2uZhD)p5fhIi zby*xFYBXTR(8i#`$&Mxt)?smK?7oi3`SN4OX?y!!{GWBg1o+At!unuq8|iq2_{1F; zaq50Ej{LSrj8bhxw(W=#IuJ1(UD>^tXVYJtf2(I<+G|A%^G!=7g6Y^(up$FwT9A&4 z5oF}c_I4r5wv)n^KgR6N<22RY%)wY&`ks&uKz>Nh2KsUQ4(qoyPMr?FlFo6=hr|X3 z?Dp^?H>kDV1>QUI!kl*I@U#cS!Hnv^=`6PMEN-W2m=qa&ZoVSi3jx5l$QH8(9OfKn<7~z_%aea4Z8qlsW@(YBsSV{?xO7kM?)JwQqYzv)TxE zJ?>^a81z+9#aT}v30^sYJ}0e?z=`Ib>A3u4Zaz*&n6xC+g~;oA91y;xjuH}G|<>-f_1ktbs3VjV)f+fR~HNt@^jS@jg<(Dq+qfs77Ha6HRk8NyEf^u z+xkgXvAqm3KAla5b>XdH$+d?d5opygg)FhooyfZ1PVH2Vr#9ipFo4rQbBp1Zko&eg zbV(?cJ^rJxj3Z8Bg9hD9vO35W5gNi)+{+YglNsHUQfiU1S(Lj8=Pguc4o*0TndEt$M#fvLnOs7d^C~5Dw{a#XTwI2U7K88;I$r1K^ zqwWs))F4W#9XncpQ@%;dBsC)ps`A&7fII_ffPtxjI8m7<(%8vdOm&PBBvmS;5M*hf zD3lBb*`F7&`aR8?J)c|GbN3{n=&dtzeKhE%NOW!cQW}pWF}E+2)VoXLYz6ks#r`+_+zL6?a?ML~5H-QF7_P*w z=qih*Hkp)KVvT8`lQrvt*NgQuWbR{rSn=X@ZOX^AXMu{r?62RSbrsOZhAJcHm^3@k z%I^1+2p{xFhW!u8jQ^b1MX7_V%4#fozas)7oA6uwvR~RzqfBWO3S>`XD^UOep0A_i zKdSPzUgnmKtFJh}cg)yGqC~^1okEcOnBWO~t5i6rXxrf&Uz67KJco}8#d#TBUhN|k z+P{AtvpnyU#mNs!MdS(jKhUA&$;^>F;Rm2#^L<%QypPj7RT+`~+2$u%e>7=()ZeTB zRodZV+w%nk%3XvZ0|r0}L1vU6gHc=D;&{Uc*TY{k{^!c}v(54@`2QN|u;Dlk6QZf> zY^qgO!IkIFV_530d&@urQ>Yj_svzp+N{LobkZ7;L-hO{3_hZ?5*MEBFdHgTk?|riU z@q2$aDZ*_ku6dO}iF~ZX{hZrj{_QtA?6Arewz8^vN7@q6i{ugQ2biSXv`#h)0@;u)lQO7(S@-QS74sI(50VI%(hEf%+ zt0`+(i7{lP(>DAQpwiacXpn;xObl#dX;!GUWY(ex61NJdh>1`>hWbseyKjF-f%3CU z%jxx2QgIg?De><;2Gr8PbwA#3`0`~-z*{o>+x68#B43JJx+SX9<{@uY9@?kGr>`S9 z0^ITlg6XCOg%BV$QSlK66mw|r7DZhi!=~fzX11`0853;-!^|NeBctqP3z-M~Vz!Op z21WQ#6ZvKPY%8&a;07om7{VgRs@-B4H(%fNw_Tt3W@~znAMG=HJ>NZvxlCgXfM8|; zy?>z(E|?GI;{j8UO+1HntD5?Ridj-^l0sZ=*%{{rUb2XIp#C-~6ht2fw+|(bW{)O+t7s`Y{^sCmZ^H zJePyqZ`}{&Yv@Z8a-MA_xBI+=K!eK+$7|!uHcfag^Up|*{=yhJ4`WwUCm>i=;A`RcMQC`(LpaK9l0iWiEwT?tV@emOP-p9FO z01$t;{Ie2Gw)nA&@d|901+CznzHePy`Cfh27O-ANTLU#K-3peCFf%)=jt7m;b`jKg zU(Vag&v;#(mw5lDKL3vGDm)hnyON6EiLAe>EB%7$wF~d&xi3%TvK)WEuKlhvk4@6+ zG3=o+X75UWp*>o(G zwd5E*4>|9h+vCGU?r^Ig$#}zg1KkxAZkf&xzS-P`_5S{Ef!OPP&)cZbx2xPkShc>E zG-+(v=~h4kcAMDE0ZPNp>n1h`X0z@5aF^^r$^H+Bucc-Y(GUBQb8=;7RrU;T)Hx<< zaoZP%x$XWN8rtn6ht%8iemU`rAYbC(SRWY!<(7))u*V05J4n@ zkVwaF-jg!(hsVKUZ?7a=;T}38R;z0e_HM2{`&c~PXP^1iLFa1o(*3S`XZA(%I^J$> za*Zhw=iZwW^L?q@co1V=jrHUF&C40zcesDT8e8=aj#TS5y_JWP;QV|XRAnfMm_z3< zD|{tI7(Ne12PKcbF*_14Wf3S8{!j2@Jb=WxTz5fB--f%m(C|B@!hL=qP)&|& zBdoHaCco_Xwy)>6)_U#zm(hXO!CRv|t&AENTkPuC9g|`%A;evH{Y_hQ z-+XWmAocHFh+z;%9`1FLU;UuS-8U|6sm_r=lR%Ep+7Kh*KQ%|%fl4a>Zm0eU^-2DO z4-xsq@L22(khp#eFUhIls|M*dzpry_*96WeP)R^du}=(!0wF8I6+l2Eh}2Zh%?|%6 z{V*jENtQ{W6p0CDQb98bh>}JWMIn(8hDjL|hKQ3*1d)jtgeioRVWKdR2-;Ez0WgA^ zMo^JVB&cGFDG>}YsV2(?!6YRbNlhV}5ug-6M3P`AhLoff!Z5^urW#1iqZNrX6r_j= zu|Zi3Kp@BpFvclKl)}h~g()U7Nlh666w!$#0|_Yv$|9P=Nh2vhLNSmeA*dr5p^~AR zN?C&dVG$9br5F<_u@e}8OvI2OvSVPzi8M&WY?zEll0_9UBP9${Y%*eqQfZ+X6vEKc z25F2kh)iS|4Ff1B!x9JrsEtYnF{K2VEFqM_Nl7#i%`j%q={2`=WX#4Hh>}5)5;jTEVn}4#`BF4`0S9Au&UYBtHh8iPUT&4cMHMZwcQk+`#s?2CTFo7$BlB8jJ^IoEk~J1bRLfa>>qpt z?biy2bwWV|lnOyAN(GyvR_$>)xeKMn?%|!=w>xPa+nVO&iA=g&(mSro=DM4ya+2pr zu5+BxbCQxQrguATjKFqwTMeKgrp8E`DPamIOw43TWus!ml@f(6+jZQ#w^hW4Zn@2N z>h3P$xs=@MB1|ZVNT{PEAPAC|H)PQ%f@YU(6)wAV*hHBZUAsp&PIBi9ous4-yKux2 zjorArU2djFWKOQ4!ls16cXA_|=@`T&%1CI8peY3~(8S9wuI*jil0`eaFiJ;VPUUrx z$ptH>g`@s^+D{LC)=6!y%yV zxbC~1Af`;ZyMwmYoJ*HFbaQk}f|o9&Zkp_AP1Sd4+i1I?cJ8}X+UiRccFrBwVsdrN z$&r9jV;13Jt_70>BQk~)UEMNDGa#86Qh`LmDVm7@lpvB-JDA|n9is$4=i`UW_FdM0 z;QM;tm)PBQ66KT>uf6!C$$NTnNg<$; zb6j2H&h$jV1N#iZ2#2uQ2g^7U1Ks);uNZEB+SKZxe`U-1l14UEuj|p%Fj~9KsI!P2 z<3af9U6CTO=q{MuMe-lD*_SsuvB}n0 zOXl0WWJv^(#8pC$Fe)qph?+fJbDrz3{h#aF?%N*A-FvFke_Z?8zrI+%O>;KVt13B< zqwT{GAlq-1-%r=I_;5S*c8{^-X^7=4qfu7Y0vL7|j?iK**&&9~_!n6dKd&1D+wI#lOu&Ow7*MX3_M^hg$D~exf=PDs%f)|T#$J!PhVKCCIm$dN zPtgNIX+n9}V~%cn*cDRUMOoaJEA?Ek_fMyP!FgU!46`ldpul6*p!^AKV#_P=LP02q zNI|fzw1yNNzbm|TjTW`njDzLDAzpLI?VLPck(i1pQ3dKYf))1!uy}`;FGU zqyBm0*<)?)CJdz3kr1FkRhCp5&@ZYOPvh=A?p~d-Y{)Mq9NLB>2ln!Y4~yzu(^snB zd+&3U!+u$bwNfsZ>8u8W-+NSX*30jKsM70upCh*JvR`I`qX6np`?)FfrvjjN1Sq{| zfBJVB)Zn1+{d-1Xdi#xhzgCjIE=3*eHJeqTwf#8;RPo-w=b8SbMZBL+ZMX2G`kZH@ z{7sR-kw+*Yb;DRji+`2qV% z>*_@I;gGNw+WSLBKZwA+dG|0_C!w|aS^vYW+`49TQxXw1K`IRI{J!7=)ZBQww`dL5 zd)=wucs<)#-U=DfPoCdR%7()aC7^D^X=(L+w`+v?8QpL^%&5fKgLY*11#-B0ba@Py z9dylpc*tY}AwrT)FT}cTH+|o42WWiDm;ZlRG!;Ed|B#w9=o#F+tt09IS^4yw!y(PV z%vyUruM_C@R(YwK5f~hqWR+4)1osOVF|5z|4!d(X-jCw!{4b+(zy7&+ud6$C&)MNY z-+RGiJ^m_E(LQ8Wpm_?WL6Sfuq^LA#*fuNRw=`{%v|ISL<*GJ=Z^${aQTKhu(MHKh zsx9}cZOdfZG?(O7<)YDJQMSg2Esw{oxr7US!rJ8)`%djaSk)8mU9q7xqhGTsu zG+H%-6%<-X+Qulcw#L+LqM)`l5m*gIHn3>4l^Tt#1w}=oBT0)zsKrE7MX5HyMWoSU zCQwF-v}!S{`ws1B#;B_%#TcU2EMse5&#k$!sI?Z+WQ}7&WY~zc@4Hc0)Dc=S7}RgF zxuT*H!L=0?M$y0SZTPR{duqP7)9tms4Y6dZOl)jaZH;Kv7Aq8ETN`X_ZBe_!=DrMn*Qo;Arod$3KkN!>v6kQGfmZnL2o~=N;yC~`@4zO} zjm$?;oZY+Ln-si`##Z3@UPfC=+A^pj8SNJhLmKp82ml+13qKFqtWM@LvBs7HVxKz<#tBCfbZuMD?|}LE zzuViC0PVNSmuDB-la?(|nLKD8KEhQG+?v{fHFWr z6jF*}2onJ`)fSqdS+$vl=X&2)lw=c#fTSjy&0idSqhP*RXYt;Yd{lA}Q z&S<`uq)HP3C4dscK`D7YUU{~!Z}D_lUrIPPPKig8cwY{wWY6?e239Pwt`AZeEjSfU z|IOgpMMwS37O6MN7lY6e1E5CU*sVr@r28tHxoz#`5D<;xi2n!> zlqIAg;gomhBYIJ%eQZeWSU9Z^JTr?;nbmp<$W4PQ>X_J_N@8_GCqvshjLu2SFtvse3gfXO?Ru=qBe1859 zx_*T}Vb%YWhQeVMRtp*6SL)sve(NR~-9Y2l`w3vD#7ZaAn4>!SL(KHFd}(=!D=I9F zs)-h?6d#rcA|JS)&vQfM=_w!C#e7sh#^nD6CP+U?`ji$KTZP*ksY}tG_+PJd?wFd3 zAGP#vI$Fuzc^jLy1vIg!@!kqV3Q`o6RX~)B`EJzya%96MnC`E#Lgqfc_}cYPT=IDp zPb-hAVBhjgWRjhHrPP_^ZhTwf2i$;rgdlvl5~J& zx1|flswlA`;+$E^6sZtWW5)yt5Z(S(b>H-a5R?Eget+HXIklwrzcIakze}W*Mxc94;|Z1nX-@v>Uf_f||c4!t&j--}=gLZu?f%cumgnkNEQ_Y{Ib1B!ul; zZ+Zkl`(BrMeRgFB^Lpd)qW&lR+)PtIe=T6% zf@Lfh_g};IY+kma8m<5SuvIx-8L4wq!XN1*269zy47)8~VVw7@znbn>Y1C*L{7C)3 zZnLd9A3Mq8qLZkOwB5L6p~3~MHHc8HZbO5!)9s{I{~C!N9LYdnw4Fl}2oMAai8=-m zxcMnD&L1Y|yx#w&eZJmRsl{wRolL#khvk+;f`Hh2%#abOv!dH#FMAH(=fHPajn;p& z;MY}rQ=&^8rxi}*lBiNJp&7b%%x-L`dqekfTTBn*^>%=5e3!Ybl?i;_igEzJJA^Zg z@!`CnFmf`5u@@L^PHwaM>7rT7t+_0y+2}MvZ@K5+f6oti`nBX=^YOu3-d~x3i<9Ox z)I+(?QUNr`%LDKZz!A_nqY>I*!6cGN1d=VoZlFD1LA*)k{jFbD(EC2DaHPDr|9a=7 zzAoH-Q$+BA00%0^m}&;!w+RcmtsnaX$5f$Cn}56hen)WlnK%VSGK$RzmO-ZWffE7A zd+=KFnN1@vU8KFrKtK}|m+6C-lZV7BQxVxiOoot16EfkCk}oUL@#Y6y@4u_{t=T;Q z;EI$R(o{@fY=#JfkEqXsplCeQXimW>>DXW=rAZ_af{2SF2_M%KkVTS+15px0Ti|*h zN5I{2{`!8K@aXf{u?JChcQM+3ei|?x7z~2QszM0KQdd^gTNPlF6&o0~DnS_u5i(-c zoWn;6+u!wWOEhQRNw_pwK`N1PP|6 zkVMhsiRx*CLU{;gr>3TlN#z=CMt}oA8fXT902%?H(000dD4FEJ600u#!>Hq)$000Jn000dD2m?T9 z00000&;S4c000dD0009(007Vc0000000Te(01SWtBuJSFkr^Y(6C>1Sq}pW~4LwGU z0MkQ9q|-oQ9;Sc+p`$<=0000q&;S4c0004?00000a*uh%#kXIChGUviR!U`#VsFZo zLR>a4R(RDz1p5H)_n8H#*`N@=Ff^t`&aR~WxGS=(L7nHJ=xoG$-|WbuF~0!FS4w08 zfG}7Z_CBw4o6{ppScpRdi;=4;pwF`kTICRgxJc5d(jx{cMkAft#e_vh`GPGa3N%@u zS!o5ZNYbjJisgv1%n?KtSNKS_Nf<<90w~k-O13^+R9aHfq>}DJ%vB~L)^buP)zDwd z6w^+XD3qglA}NKE*I{c`E)u{oZaF&;vnjYS(_R%Va;4R->|8BBFYHHDz^XOjvX>zQ z2>^_Tv`(^bR37ej91K^G9W)Y(E#B(?vw)5{eyW(GBZEr*u!u|#m0G~tR|~=|ie$Ic z_wWWtkO?HpN+^hcf}nt)(k&xGl#MF1&?2-7qSBzyA}XpVW@biVK#0GMoQXKHF;dBl zoyeg{b6xWd)Ik@c+WOM=qOCK!IlE?6-`{Y;tL=F@Nvt zRQ~vBklS8u$ALzE4{o2={S36@rK;Q~@$23sd>1?mtk)NyH*qv4#6(*4WULjRWjc0( zoE)Hf!&5kTnZ;o@8u+E7u6(MeySh2!1D8YAJzL@P=jt0edQ+y9CSyL!}1Rt40ag?YaAZ%Qxy#7gRKAwrIr(jAC6t=)zPA5|aes3YsYtz0zx5(x#C^+?cnmrzcaSbhb?NtV2XLqAow@(BP>`f43-8PENMMm}Omm1Ab z{gq2ZHY#{%f~hr$wlo>WC#}N{qG#%L2?ncYOnZG9(f3yuWZcxsTH!j_iPl^`m5STf zReto%B>@ee^H9s=DP%iGEOnwl5w6)wiC<%M>l(N0a;)kV6b*V=t)9?i*YSRbY4b5o`2FL2H5+PM*wNE z-MR}*Y{+4wrz!?b=f8*?Vpt|4jc(v{JYEd%D$@Pw(J(V8#A+Th>~;$$3ks@7Y{5FD zq*`Z8OV9h%){FvRFoZptZ|=phYEorGL&}7a;WmOVYdXb#ay45bOPUBG=gdT_$aXbZ z&~rL&B2Mbw_jd!i?w~+FseUhxNQ6P!f+7uIcveZ812AJdhumA-xY}`~jfINg{Fzsy>T0*UZ$)E#!Uv_g(gckk zF##ufjjcoF=!Y^^L6IowDG~2^JnMNm3N0v#Qt-9-#t-1S=CCR%NY**fTq}HPXNKC^r8bz zHJd4`>)D0KZhVb+Xht{26AxhZvH|FzWCYGB{ns{P>sWIuncaWk2O)B;ng# zZ*afg^}D6xc^w&V;XO@scjqxoHuBKv93)U=_H=b2OGuFYEs(idN>!8A8shpOM!zm+ zyWHGz_h#v5#Ji!>$+NjMaFs*d)&q@vvFx4w{-wG?z<&};#n#R|HlP@b-g1M7=0ssf zFV@z3t5Wsw2KNhHJPUR~q%>zf+LBU-UH)|ryN1MY*Yq*MY^Tl8GxU+gF+6Qr$H9(* zC4tcQ5FZ$IjDT4O#ej|mxiEL@aNp45D4?;Wy}^q)nYH7lf?k%D+q|+PQeGGXq+|f% zd`)3Bf7Fi)Gfu%YlqW%2u%jD82r~b*NeLK;2~Pfmw0tnZ4 z&;jaqjpH}$tTTRw&B@(|qVJ*f8wSQPqVVNQevM40#rL+yJ(XyAx<8O$L9L97M6Yd? zWp9}ziAxBR8k-_;u%-6vxi;K9NkWDYFBcH?@RgIBhPr;w5_mW%yT5R*Df8IinQuEZ z0!Br^K7+I63AfWiywOw&Z~>DI#nU49jYdLF9Bwo;Yt%U661?J2mrutq%_|0^*jlI{ zz4eup4ZI+X7kWgX0jq+;77DB%Im}IsjEo^*6-LnEx6r|RZ%!vC4XvOwG;ubO-qyK7 z25F%N%?*#rxVlDc>ImXF+AOl67SXVJy^WHNr!UV#eW)?y=0X{Qt|ZXFJ`q4PZ}R*Z z4kMZ}7gZ9vaU-g0*`+UUPl+*j=CaTTPdiZeix+N<&y;8=T}pF(lrsmIl#_dZ$4gm% z#?WgcGS|$Klp%ptuV53fKlcv$SPmFSK)r?)7zI$2f`wTq(pMZAh^2{{hbZZCD7^mo z7;&*nnA^tF30yH2OKQN&K&G_;@GTUk-NbI1S1~4-!Gmv>za_!5+#wu~AsFM3LsQdQ z{OB=*6w!g9&x}&$;kF4zd2U&cTH3z$M~c)}?kb0dX-ut_3nbmv?hGeF8S~>Xdcw@+ zc|}M=!!U+(zeMFK41lW5uxBl(vYy*iKNlb-4kksWWegrP#7MCafWj!E0(lUlQhA9K z(xI|d&xYx5t*Q&Q%X2n^O_$#r6PlDbO(QNkq}cOYgr;j&ZXuRICnt=vndTb$HQl&0 zHVIk-U_`*No5MgeBB~%tRKbmoXEy;|nx!MQ%lTi2h=uqJ+I#w}wuEu$F#{+fS$u15 zSAfox!31s^OO8ND2!$Jf8^1S>d@G?%xn}xMVNVN0)q~cG9zA%oG3^OCP>0{oKX+T@9$yR76HVwDU ztKHqRDO<7?9lUs7W)Yl;HfI5^Ap)d9#%5*=WO67&%a-zD4a0aaLhH<(*=1ZE&t=$qMxLRHha;yz!C<#B zO7u#e0|3fku?IOuH4z3h+Gvk6RTY>5ip7IOz2g6)qlUOCV@S0bLn}!p!42;X&U(Dj zx~{`Yv;$*>GR2?wNGQ|8ZHb%B@N+4=hg#!}jbOwB1l=u49*Jn_E6#_i@NspE$;Z)9 z2q4I6k$YThCESDn>=>GtBoT&7OssFlGMEZD?4ENk0QSRrLCdQN>tafV;D&NjgV-y> zfVi_WY38Jr=G!gC1;Aont!GR`I~fq^BK~4(@M2e4Su2`^LN!9zLL%8B5hbCjH=|dY z23_slaWok(hq;HdaQF13xi=(>SkT#`O>9phro##?@jHdaObq4h79;r6(A26oOSyDJ4OCqiYCQ4mT*>>^Wuu~^e^Gce^fLtxru*A^9VxqUtqsIyEYdG*DHaXKIfL)W5 zznNAFgr5eaG_SzK=-h$#uMHGgjE63$Lk)OBl+TaFQS6yiLxj#oa^o`KP1$gWa*qPg zC@2ezQrhGY2AL@*bnjVoOTg_9A`D@-0Nk&&y&OQLwGknUfrK(3iX&LFr=}X&2?Ec- zc#3yiuW8NnUYd@g%D=8eAE!YRUx8RF87Rg=K+p{H1`Wv7xB*3E1ae9}?bxkn*C?t(XFqIp$GRVO~{Kp47<+ssl~} zp#!PF+AWe=`IVBG%R37ybqghfRt!Weq~Ma9AxDQNvonQl`6w1KHX-Q}y?yyp zB_azVrJDzLyC*ud-)dJ43nIwzW)s6Ao%cnJrn2ou_V>q|GR8%a)S#$TEKq_;4qcH! zV{qTqH*ri;Y|Tmn#6*mRK#qMDRbLLO&}|0lLNk!a%PfedOF8R?_R`Spc_lO@VuS=x zI+P(i_YGi#_JCH7G1c0kr5BV9@+aBmUzc4esi?YdYTrT$(*kr=@F#%fayIF_Bh=_I z4>}Ud4%HD^Q4wsQLI`#g6AI-K1B4)OBXdaJQzNvg9=_>MiHT7?5zu4?mvy{oYt zr>;R{q$G1-u{4OJDb&*(K!c6iHC%&aqLz8|YF<&eaW`k#}&0DD3 zp}_hs8Ek=wgEz6$4I&qrIv``HY*Sm>&n03D)KQWwCs%-^O%Sk|i+o(Ri_I%Hn!y_G zG+Xb4uKB8%aYs^l7$hI<&H+RV5=sd9)-e)00DFCfiYFn_b4;=d)KL~lBLOOjd*fj- zyPhxm#c6xTwfSVscYA$UV+XAPsQ)XFU^pQmwGAl=1wNV!7zwnLl2DpRfJWtrN=$eo0iie>n58W&bUEZTTOhrqi7FvK}_{(Z6WeC z6)F+!P**S}RIDgwnGu~HFwH1{V8M`p<(80`8b(V&af~QTGYK#dj$4^2om3YW8sL#b zsZMGtWF`P=1W+0g4BjdtYm}TTgPw@Su;g-Zd*--Z5yFtexYZJ86o8AyQBzD(WfQC_ z+}4^Rsw2oNZh<13q6~k_@C)f^vG5A?E*nUK2DH!uR1cdGeJbmb$(Ea#L@ofAxLHP) zmGZ)p76K^Pvm0hfS>*35u*Sy24-V-zS+`zf_B_iG8*ne!R+ak(@7N#!r4JY zW;SZH8&%aBYmw7bSy~Zv@wzz}odfrb4~~P(%~s7($C+IBFp?+~^O+qHgVCv6ky{fJ zTW068YLbgy^NNTutP?a6rOa!ddWlq}ZfP)5^`y}#N3kHTW(7(kHo=sfW0OV7dv*+T8Qv%@T4u=N{F$INOTRV`Ef| zWK8E%kx?v8TO$MjU~_R^5CT^_xFpI4B0K+fPzhxtxMjft6*|aqM zI~1%dtL%BL*ai{fKB42OeSH(MQJsgCv{FIHX^)q6_5W}nLf4*5xYm{C!?mn-$+8~F zt^?%lSEPkDdMZm#JIhFq1Kdlu+<G7(Tb zK$Jw9lG=t*gNV4ED}o>+Uf>EU2p%k;tRg5V5p)H`KPvn`-`{($syYd->>|lb)vNb@ z_x+wK?C{=8zO~=0rtweo+kFq}FTe4i`gm(>ymiq0MT?G@JAdBX`HPO8fB3?AAL5A} z^w|IP&$Ik2 z-G_#z&0xLh1EZ_g&tGuUidLgC(5jW2&7@~&XmPDnooH5??Vgh^+pGQ8=Vv1z zzV?Y(um9h-O-$S6iG}u{?PK0gUN>H?lxpqh>Y)|obr*m6C8fsTrcGDvcG+bc+5GI+ z9bX}#Gl@|TakdVRVZw%uyYpZ8$1ypA2b{j~$lxud1p+|t0@ z@im-8|6H-d)1Zcbu6X8P;pnlc2cOvef7dKtHf?8r_MJF;6SU8}aq;SAt5F(gZTid$ z&%e$+x<~!G58Y~y>hU62STxl?QfVep^&4ZQv5Obq%8AArlF^YpUzxM%D&TJ47%ep_)rq7yeqp6{Ict=mtiiZdk4sI6t`%2mwkQxS zRjcJ{rRj)=)t8l;Yrtz&B*VGJ8uj5uX|y@F9sTCX{*iK0c*g_jH;2o$a-#&fvb$EP zQson6sPSwT_0-7GYt1=+Ek}__^xz?tn*Qv**&MI5N~^2om>ovcXfl{*! zyq6uq>XpIjMElvJKiAui`hUI-XqDp^; z%YxCmg%vh52EO1-D2qd%b|I# z(x?ZVIxLQL>J?*xc-=@DkyEJ+)EoQ|s?z~0f~|N2!uAV_eg(g3HHl{S`;#}l)qcpW5Do{Vles60AWt;Z9P&S+(Qd9VYD*MZc*4s_62 zT^fkj*k7Cc9W4>y4&y>X)!o*OR0ddSWU_e3d*I%Bysp_9Z+2Ss&S1U6*=$>7;}W+3 zFLuh%YOPZN10$vljI||U2Fgiv(^ANCq%sVM<9cI|{~a2y*#aWSJx_2NB0b5&1;-`L zdQ~ivtq5(7S4~kxci-434~!#+*9sZ&V0{$O#pQQ6xd8b$g+D}DeGJJ5vmizW15K10 zqe)@EYZ^iC#mxx>_-JoZSYFlX!Nf=}qD&7Bl^Xm>x+q=)8rJo;d1!>6lvY=&Ah_K0 ztMXtHEjo9##Onkrpz|bT*H+*^i(XDyUG2+`D>UJ`>0R(2l{ywWY!hmz>*C%X{gm+#-n=s}~RLb@+8XL3mR^U)A-YE}5*|5UCb6$+P zg*tAWzp4HAkDPZ>t<|VsymZKm-Az~9FQ=B-(sPVhfcTsLR;${eIkWJS9U;a6akP-r97p(P4B%mEWHVB7LO+Qf zdLE?FC|B9%T2?B9jAjL{mQhsdOo&lmc&9D2i_YLP0Ik3+G^H^ zS{)9}U!CP5dc^1oQbuOY5uY@rz=oV|VlO65=Tyt3L2ucBp>xhM3^mzYUGll=Ox*hT z@JJ_YO$^GuUVLw`hiW-}w@#`DN-zzD%!$PbEQ0yd>+#5zlfoNL8!fFdn!+*+mI34l zGEHJgpbP;H{nu%VW(5lcLOD;x>uNCu zd()dBv1uO}PI+a~udO7--k(+m(cjQd<2uMoWG7_@jv%;Y<(mA5iTK}Q*$AZ;_-kVG zuiUuo)J5|)wO_d5=~ca(#J!t${MNJ!r%l5JdF!)RY~E?%;TWs!T@GEn`R{*gJhAJS z?w?ni)`RV7|H@21;(Dy~_U>=`*b~$5i?29++K&8E|H?Q$@|wPhq;Sq#N@JHFxnI3n zA4XuAv8H1W)`#abgrT@~@of)Hz@5!i=35v>-nk1F z8am7yEvu0XS~Vy}KIRF{gs+Ut&bS!cmZ>@UBGz8H@ziBtXW^#yOTY5hRiNrrcxBOo zP3;$5aO;&xV&-^?y?RqB*-+VLYaprZely{dSU_`o&ye&7vKH$Zq z_>o^`HW767zlBBn!ge}?_ugQ~0qKz*G{9cU= znx!mz27-p|O7V*ETD*dz49uB74~zJ7JD1{D&Ogdb`LL3wk|a9kjqAj-0Zf-``|hgM>i1p<2x>Qp#;+VkyDZ38Rw7tf-84a_l$dCW|HX>epl>Q=>- z(QIc8?_;rG+?tE&VK9(PNeXY=A@!6?jbRxT;AzO|XE3Y>5W}VIDje@;bVkCq#U{~} z?+|x|6Cl045h7_`mT7?1<#Fc>n$CzfXLvnb$=l7PYEt-Rp^9TTUPAdpYrCAWxLx?g zlbP3m6M&iOEE4>ep|aP*B99aX&@rK${Ys7@p4d;j2dCu+Xp<*pN%awuJAL*v}AWHoo zpRa?$0Z77p%_c`^VBb6Bvls9Iip-3LS9E~p`0C)Bz{Pj3@0Y}@hwX{*ljvhVAXLE# zzWLjn=L`=7!|P)|Fk49!Q8GUdtjp=u`q)b~iwF??kbh~XR(L_%o!Ji}mk~iKSEVmc zmI$8tRCSd}x>L=dk$1O^fc8|kV%!Yar1+XImf(Ensbbtoy8wGUTmoU7Sv~^B9)N}# z2U=i$$H{XuDU-s`iJNwG_aojb{Lg{G3TzQ8rXaQ+DR*SKbtK*#C3fmH@6Qo+Fw~nj zVyBe+mC=<%FTKgEvu0eYJ2$+B4r{u27-R-8WKLM@0TGX4!BdQ9L z$j!Rwt`Q71;0xSK&E_~UKMZpzVbJc(W;TpV0grIx=OCu~_^>C}^kYuObvARN%QRz7@qH zY?P47trn~@$~FUWRBF%_6j814-2r^_XHJ9!5UH|PJGLGY?5Ou@Zyjy6gDX8S-s%u3 zP2Di_@5742ve(fYGy5@2>J4Z?f(~C(d+3&QwE?)64F|!t0!&v+jo>>*BVQ1b>(vQ% zEGKz1iQZU1UPyhnobq-!5IhGO>8 za|V%BhuwgJHODv{OGH|4AQKwR-pS~)F;qcyTxV)W@9G(i5mVKn-i{{?{J0)*a~u?2 zeAa5nhac634-PBNYL+o}zWG6TaT$ue{h|Ypb-cK8BjI1!OM4%-=c?I|;9b|s7{Mt_ zogckd-nHJyqCcoZL|JV(tZqOLkQ+#%J+Dk1>CrNtR0m0lO@SrGr(eA58JHEteUEsP znP84>hRV1!gW#|;n34%6}SA~1vt%gqkV2O`FZ z7}i*M+9&%gCMUl~s!<^cCz8cONn!HUeMqeMb#<(JXIRW%IB(uOvm>(ToEQ7?JDo5^ z%bAm93k?{h<3IEt53&vT-ppw5JjmojkPW{n;Skjj&qTwJ%@gRIbp7u~p#Tf90Q7Y?IhhhT|XaR;t5AgyzC5 z#S?EhWo@~!wo+b)Ve&(eB|~iK5KhPD=a25=!bAN^6r6uj1G@>M1sEAoNRDriRG;s7apA_ z&DHA{ZCSp!Rx3?;mrDmCtf?&|QT&kwCRLGGgjp1al1J98y6>Pki*le0p+k)F#3eAv+CN@|qvH8&l zIFXB4A@;)#SnZjc9lk|Yl~Dtv)S-DJ($}_LIB{4YiFQ3atbuIb`*|1}&GE6Z>V#f- z`#52va?K(lXX&%Hn}Y#0e+f&u%vVyVJ`TOM#v2Ha5O4Q5she9B50IiEY(!9M1Cb?k z;iix2{NeNdkTM7m2DeTloUcF?et^i>g@5O470}1FeqxQ$FT@S$NzjCS3G_~?Aiwil zY7&%+2TLtWJ(7S^7Ag=`%0+*<^>A?un-Km{7{$Y0hBcLsUF0KLV6ia@=la~XKZ^^c zC((ITBSqkonyB!I8AMKqq%0Nk3<{Q7mcg%-<{Bh9GP5!>nR09(t6g@aLQalV%w*3w zb3<2p^=mox)E_AfU0JPz_WEiZHH!?&&OygI-6l8(QbdFmHhfU%^D7yPd7lkcRdXs( zHk_nS$;1!1OoRMcexyEGEI$(VfUQBYQjva#>Q0I{SabJT5_%moTq-S+MCdm{1|CEq zxtT=on_k`()`K`UUz>hV^eo4VWK@hV_`d0gR*ZdiM^qyBMI)7N8Y;}J@UU57O^cn% zd4K~l+Qmz__24CzlifD;)V)|VaCRD)K<1am$TG=?$)vE9FCq(p;i*BfzG&U_regX2 zu=p|2@cyY)(vIGFu?!PZ>7)haJfp3Az=4En&z`rRpp=>3!5o6NT(ZV}DM)>ky$q`) zI`w5jEK0wGguy2=xmGnzW|7+gXTp&Clm|*?Y2`+X_mu|ahwl5$4z{nkB_^^%`G$;@ zxsyG!KfByTol$jV1(G@2`_GfZnMC!yvMiELfWDpEfhF@0ObR#GkC1ILFy1739&=hV zbdWWkJ7uH(&;=m*E&H!p0Deupx=|_bhOuZiu?J*k+CcLuzvR+hF#eZ`@V!5|U#{;kB2P!tSL)z_NhtB*h^vLZ3yD z5Rz*Sl>KSMAUX+YMSdtzFf=YOHq1G}r6I<=_s@1pEgZ11t%ak{Ihk8-@Ie9&H3|8_ zoW&zHON!ISFlX>I&9Kd)u7TrGImg{VCYh*@MF`lU(H0UTBoxf>Pog9DcI5z*#q+*- ziu3iI)5iKP(KNTCPl9q$obsr02lSzUc_l%TXvsvd3o)n%(TpG+R|*O`r64G|wH^DE z*OMp-xiymlVJ-dMr7M!c*Z$Y9=*1WSzvIVa#DHYlNo0_eSEdS@2^Ik%q#(LGnLLC- z=9@aVs3sDIXb^<>j^FqcYRo2&Qf@`h<$~P#AT!`dMSI}$+MtqS+L81S)e(8?XX5G* zlq26WP#%-nX*eS|Mdm_Oli>|9aMDm;1qsHna0ml9O#dZ?J@yyvmUQq5b8cmRl65le z>#W#ny(BLg7%lm*v*2Cn7HPmnLy5vrD{vesH#8o8@?>_^5m}s0mer$erW|qp@qO3I3YRfVrpDvow6ge8N16a)Z%Qat+(i2(D!27ydX zCO+XDw=*QBOaMLMDOq6zl<(<36N~zNQJlcn*CF!W_9o7&SO}?L1$f{Uy(^@u@QP*2 z#8yCm)Z9lbs$cRWZ`u>q@++EgkreKJz7Y(VZVA-&xMq=L@W|%5wEI{NQ1{2^QZ82vRV)V`rl>Cf87v9puH2`};?iCM?$$CEtre}4P8 zdcCUPMY?}z$x)~!E0gG$$5Km+?+lDILfiw3JDz&(^_P%BZ}WB+X!OJE?36d&F$D)2 zV3d}Ibf__Kbk%d$&xl4`{b?s%t5lVE8jeXp;(a)0BrS+qjR!6wE_`hd#5g;ZjW8vt zz5i-RZ@lJ>7?enk1TBYd56NVNUC4i$VDQj(4!M(k=H`l-gQPv4ofBwIik0uVx67qr zB;`PzT0`^iBp49TMnpOq7ESRR51T@>BA%3)J%c2Lp&p;hH+EP(Ua7X`V7_R_1{*Az z;A^w%3tyN9C}9H%M<_JFfAV{G_O&a2X!a&i|NEp}YQu!_RJaF=p7<+cym4hZ;FIfK zw79DB3$olU%s(o`$e**^w1r44aE6X$H&nsg|25QwsfnObjJ2gNMx8!km%rUj+~^e# zEJ4Je8JozkI!?D@Jt-c&#EIk~_*jXaIdVno4Jt%D;?43kyMkDYMYt@4R9>$t*skz& zscK6p98ZLr!ia`DQP<0ojV?u+OHZGQuw!ZbfZ^HNwyguT1?8(!HNw0;F!GRqNT1=u(oYZQV+bkhiBN7=r+bjm7f+6(qx0X}DkYEc^lRhD;cI` z*icP-r#p#(e+?4;me}Qub`$yivOXJn* zoF>F>bxX2H4ScHCg`se7EQ$@VRJ9vy-J>^ce!*R*sABz+9in}H{luxCx#r^U=i{Tz ziA7sZ-2-uU$qqA)esIbqERjfTL`6(V@t9o%CidGDc@mu;1~0|)pUUbDU?~KW)g&1u zX(5~jqiQV?&3h<~EI41n?1}*l;R=Ec%0<%F_XmU!4P0qQ(;_7BP$mB}v1R!Z9C0*P z&nZ}*SYQqo(HW<%ofl@8$*$r(W(M-$v_0+-dRt*N?j36itZ9>JIR)!?~U2a#lysb*KeNQVsbA*?tF=EDjw-1($#_>#R z1GFnF-!GHPBjiToChr(HvKPj1fFcDa{yg z?b-i4p-a^PDIit18X}0G5y97YthbmxudvMaZiJPo|r4Whyw8!WS%6z;f4)|y4>oHiZDCrr;MfnP+Cebca;c$@IjC%zRovBr6(MDq-RcTMm7!DYo4B%GUFe&VH zv;}7It4Os+-`z|4gj7s*%zQ^vXrRc5*4Lm=c-l0HC&Gozan^8x=6F`|0)$9XyZHCN z!TrXVFoZXtB#ikYVlV6iP$z{~eSEOIn!?(kEJJvPJ^kbtUM(Rl{TZ~Tw|v7YQ=o5FJTogA$wx0f$%%@vac?6CMx>N$NuhlsjEIB_`jTyZenu7pFj6#Q+8H_~bpUPHkY|^q zu>T9Q*s@}P#DEaD-amHHa1{;IQc$jT9WNQm$i02)`KjL!eXn2y)v8pT(sEHph=q(i~E{Xral%h0kBPk>`&(g4&1g zEF!s8_|!|tn5&yu^@k`>K(SAk$Oty#3!e4k%-i5 z1N)SXfG8-xC%P%^%pDN@L3tO7^{Y*=H%p=&Anr1Pe{DVS!F+ z)hR;+Us$w7D^3#a^(wRl>~2;4CSGMd;XtccgGgjc4PEM!D(;Ii^sbx=baG0*O8O^> z4j{n+)SWm5R$hjATTIbWodV%`(6wqlf@TP*Lyn{nBxJ(2Qlga94;XSev+W6b;V61$ zxoj(|P{Oa0J>ZG}hybMt0ZDo6uA?sU`IqoLOY$YfnNJ33VOl^ecmH-rfrsT$(RJn_Ms|#DX1^rlnldj?y3Ww zjLu%4Px<0T-UB*)@-RN4m&z(t&CB47rRfG-y3~{_3L4{Z`eg%s*4gsAPgRCYz)IM7 zHImOqDG+HtXEE%u)Xu?ZPNLH;^PGTN zjs8jf2KkM@?elAATeOR^@N@YZl71_YGfDK`shpI^r+JhR8~%i;dNVQbXI-l)OR1d? zLW6}1n>1Ub#gn>;tz^fw_;$#?_vgfoX+UoSHB>Ksv>}D%F zDW@hgi7)0dQ%@+?63*hn=zPJ8@3SDY5lr#?PYPdVUB?zXQFl$|s>1SOJAKrdC!VOZ zr~=ilq*~nyM-V1b|03?gV1>xMZ+T=XLisYBLoy;waX{9HwzS>++E$AR? zHR9+ik8XJDBePGzyz}d%QIl=#`I!1f2|$G!5vicBK8|%G|MJE6%7)#F%uX)J%*ts# z^8{Zs=FJaps0K65QfqR`P&9PRtPN-_Q{GTG^LKvxt@@aL2~f&awC33sv?&de1|xyh zaIM1>`Qa@A^ZTEA17Q&t423{k4d`Uy%GE*hm>X55pixPh8{bOAjQGe{Tt{_qFqPM@ zK{AxfW0aGsGgCqYe>=WLTC8rz)Oey-Vid<-pd0sT3^yhKzsbE$j+E1XU;U7mYh z99iB{^(UNijmO(4smkZwvwk~JUY1M7C&l@#=TZV@##;5Ccu|#WsSzvg$;(iDF*2pT z2{h{)%Qw!zQ>bJF*jA|tRei75SGQxTatl zMsbLsU53~BCYheOXF3-P4M3Z}>KUEO?F>cpvM@*jghh14^WT^iN13yf3U}q>ttpK(G03*!R;m-Lc0>J z7593h+u62N9Cl7MP0)-*4~zt??;i)NELa&+>4g^Qxo3Cq`cFXG+n#>G*(9d14C~_o z2&vxmG%v90AR0oDw)zwB(I-MHkPKVN;o}JUyG+J6zpbN5#UflJ+H_!{zy;n&GOm$n zhK|7jSHvFHzUvp^BrGK-cbu33S&^;9liXm8DS*R!LQK9T!4w)=DO`$Wuh6Lp@KO!!*Hb?in2*$K7;n5 zJQP{YGIWmyMdkwQYUyya>kZUg=M!li^S!i5bgfb>Q%3-|q&T#5NFBL!1(cVCR_#k_ z`(I6d8YzKO6udc7fVmaRR2O{WI$Ztks2EK0?Tb%Rb1b?cB(RW#-?^Ow5U>#6x(0d| z3OCANi|a;!4kw=3Z>a-Rs%v4eRF83YecLcyPVfBn!UN{d#e$L`TP(7m((w_2UT9Yb z6Ep!$+2V$u;c?XnJ@X-ig&u<*)WPPaIIspIPv-Oc1OGci9SyP3{x_u z^A^mOL17UTEN3KJML|$!)?itw9>HSm-ZZ7;Ra&K5AM?#kp9zwkb1VqwIK$c#D%Hv2 z@KWqVr4#~{6~A^1yT(JbUa|(Yrln@bn_e*{MTdSO^cP6~+AU4XXLBarND5Ei7;IE) zIl_y{!tGgDF_;GGpp!ImwgGF{J|q{|3CB`imKt{#z-qJkg<oDn7J@V-nh!fqM&CL}Py^;wkf5xb{)2%@OhwH+9SKu>ZAUg*Q+b+9Crmu5 z*CAM?{!`kLd=o50xH49;2N5tqS`g;JoA7Hm*RL@8NyPDJiAwSo#RDRBHVlL+tvPVYU%kc1FUo=1dk3cvMPN5__;bgZ;~Mpoog13LR16 zi>SSbt)BLexnKiF*mq|cojh|Rm0Qd!Ae_^CdwIYWZ?~h9e>isOjhDd}OxWS8!fEtM625YH^;(m3E1cqy4cm9jo~QFtGr#(KIZytt5psj!RM`QSx8S ziQ2{2Eoqh3VRQ{yD=|s6hfv%a%fB;cw1Hqa?klRQflX zBz=Z;P+U{6zdBiX_Hscbo^l~Ge$VejLkMD3HA_-ha*hqOql>=pDi*0wk=%rG#Fy5p z%lV~o-Le+{CYoncY3y|%siGzcTUgh)kc{@s{RUNQlqmvwpeEf~eGC zVm;*!g>qqP5H*iii>NA%)}7%eNNsK3nJ0q>UzK3C*o^7Yr1-!YR!c7HL7d)QD~?!9 zjorEJozH1^a0u5OMkpi#DLlcE};_{;H%F1>DvACVKbfkiWN zA!Db?O*pOitE&kiCB^qAJ}WJSj9OMnnic15S&jv0l(@bXPr1=TMm#3n?Of*m;TZqu z``+h>{@xIWU~Zc{3%!NFEUTMIV?A5?0B{R`G@de^PjFsC$!|J7GgjJKyZAETx_6%f?urIp>k9OlpD zasSa3i^|U-vSoa~g0!Zp2DWXHEu3)Q+DSKy4egC?fpnKhlZV}6=-hK6WEyq_^OGa- z1V?wEaZ@<8@06uDf_ebOzyEuvi4gkF@3C1jYb@iaU26pRL;KLDi+-XT`E;6|4a){q zA~gWBeP>6|O;Py$={B5OPaMEFucbcIU??DKFirV>SS%b&vT;k_o8u{rzfgg`aPBMT z&d-nA$Q?W>d|==1v-=r#(&&vc<$_mf2#0)G$|-w0uq3t#gp(C7Qe^C9{Rv1XRO)2m zlgEK^jL-EJQDW2=+QZ1B;p0Nespo4Uy3a?P99M#L9tDB^^-^N;?s#N#WU}gqF1Y-f}nSB)>7=P(yg3ICIY+ zib6F}O1#M2B-(Jh7BatiyWnZ}oP1B3c@fRHGdkyWTjDM5GwyvwjE$P20lq{ILVD8}#1+p5Icmr*6kJ6p#ks}aN`y9a#Hhcd@ zex#bL6K^=)(S>?$hw7K()8LUc>TmaFa?S}vU_H3@>J&x7uRYLdImqj^ukbC7?4J*N zZ^pbX0GH-1d~90!KM=aBzQE>q+Ne)G@Giudo6^ZBPEiP|0rc*8`nE~+2d|b%!ct*X zPv=Q-(Y0xFmqdt(NMf++|5aNoOi}XN3#m$xHKzzGb=#;(;lbZ^MRvC`*EGgrB4(P9 zMt!&uLv4*1V&A)739V#1WH-XwcHj54Sr+$55rsE-$qvtd`my7vTrzj^;u|kR`_UWS zg%|xgDSYY!PJ4)f;Ct1+hx&1n=c*+K7+G&HK=777bpju-v6yj7e{^sRu-MYKKvm?& z#P6KP)ZTL>MSgaaOx`5=^1WO7=EYN9GsI`nsDjC#xA1W;p!tJMN^I$yAJz=7pn`57 ziRWz!Okpeu80KI&Rn zh2!sLQ{KeSH%7~Abb_-2a`IJUkhOgv6>|0^Mg$y}A(*n`+xzH60LfU(HzxddHs)>5 z%UYBVmC>|(qya=WV+fpC zKF0^yA*kGLMeP{I0@gqk6_w6TW_T`SbM6)%7nL#FLt}F|ngVgOC-N6XMQs?9i?XT1 zVr^xR2m|oc)^ezkLoNeqm%CTgCkqd}j|dvtL(%`$K}gMp zc=;uBJ6HYNpFfaFP2Wf*ZbkspRYX{$TIG{_-qX(sT_YMl0jZ(SIqPKec^Ei%OW(;< zCP{kCS`a%dXOnSVM7_B531jjM%F1 zN#T*-@Rk~u&=4|ptP(&)R_=Q?M~V~e_IjO&j*b>%P!*DN3wRJwT3eiXy|C&UtBiz+ zP|dvF2}x~LaT!XuOs&*te!*~SVz0=FJ>!R4`rfM8)&8pE4r{U;jX5{nFofG@_H|f6 z$l_Dd<-qQYmFtbOCsu`cf_}-*{W?=Bs+7fj)|t|xXARdwm866F)WH}X=bb47&Aqrj zXoCr-3iQ)ls#S3FOT)HA$Hlgj(f(f(>B%FsNRSBc2*QO-r?$aTPyvDH(1jyEq>HQ+ zRP>9sRD(W_VgKec!-2Q-z4NU!dEJsq<9c|Prk4mN65ijpw_2A z+$!y`d@cbm$~E~u8NGZDDP-^6zNTG#{gqCZS7p!6dd3BHU7dsL+u{jKvX}3gUmIbN zX(#Pj>jNY=HY6!*`YxMvN3pL6i6p&NjLuo z&2h}qipr^dt5n*ctDYg}p~G7+1w0JpeB?wo1;O=8yEzW-sY*J^B1e*lVO41@Jg}cH zD_3^wCetx4LoV~rO-bMnI>GRG#oPm3X21_@HjwrTjWS>N<}B7P`C{=ONet&wAS}%I z41THu84Ek7kr^Z$NZcAgYJp>7#IO8=*^?f6TZK#8#q$>TLlt_=b_MKx=1NjYe5;L* zji;wKL5MXMz5fM3+_E@UN+RN-pG*mlCNlvvl0zOQ9zv(ZGGq!HDydrYCGTX#ZXlx_ z-{w#%L`bO(lu)i6EgJsYBUf$dQ&d$9xU{bGua1w2`_}kB>!6GJk2_nx?pw3i6})6W zI4)kj=@UG{GGUPu8}&7|%7Cqt{Z&hycwW(#(ogGyR8Ac)Q3*)x|5o$ufxua%r01G* zQ)gYaIi>=;(oSU5%GS{%Q=(*iDRG|&Y&!}^kwJq&ZE$k>iZ8H^zMosj7VDt+Y5tV9 zik+(R>Z-llJ!khJ%l#^ngua3@*>TTz${wbKJMK=|G4WcSJ!r<7hT#f#=!h|cRX@7nv9 zw^GcxbI<1BxxX41FwQcyeG=vEPrn|(yN*E$p`6B(E|S==n1X1!))^n|Sk;crYD(ou z9vXRD6At|c%UV`Npv%?}NZh=qQ1_VUNmU`d=+n}2Znmtjts)HtKo0ogc#S_{v>JKX zl1SLxY_J2q2z8}+B=Ct*E(=11hKgAQ#Az@S1*R*pOPqAAlhy6n>-~t|;iXwXMCw`U z1cic*b;bWW3`vko`gkO$ZD-%FJU7+@QuUNMOr)`kv*+j3tCM=!!hFfE%}JB!hO^C7 z?b`D6!Xy1e8yLOzKo4O&XKayU?CV=2ilaMu>-GJLS}KX&d4x(>C@^r6xo7!ar|_x9 zI>;Rr^^q^IUd|PO3b*ua#qVizHL>2}zn!r4*Ic!ftLDhif(3QT@!qc?^@%wuRBB6p zcYaqO4)Ub`PNKk_$k{yMao*EK3no#v+L&KyN<&?~I!I*Jsl!a5>&ICYnsz`=*)r^= zN)($4bSw8WV8T?dNLUt2o^aJlUZSDgTYY3`p)vDkVKb(q&O~uN0jT|>ldg!#%EO(x!%yX#1 zdt`#fN2R{<;r7%Duo#dv)RkwHt26;bM}1NJgwnzyH|-t3V~NND!4GzZS44o$d@oB7 zSzZVg%y*zFS0$F4bECR`n{&hDn`Ji9>zX3-ubsfB0HL_{tI(rnCJOu-c2&G{Pf>!_ z11)|<=OBOut5!e+5f^b2d~h|xxH^l-q}Wp|D=ED0ZsBBG>ABgPp0N3sN`>6ukJspO>3GpDr5=76C`Q8EckFWz5O(inI3V zLCsq;D@&`eKvv4AzhsBGqmP>5QHqa_`9%muPpLAxeK7Hl)h=ks+kMRR9}*T%FADgU6kF+J}d-xR3eL zd+)1VxSfePjGW;VYH}2Ke8VL1s`mPa>2>`BmuS7+gTU<^X2ESV)>pQOm#2+ z`~PQHv%t-BE)VJtrtLZ{5;337Z!B#LYT70iY7^F-Zd^%XsL&tWawznjFHzZ;t2gQr z(#|ZXQPLFbdRMBLLoAAqrvgc_?WFL`u5hQ~HH0!I5esL$HH2A!=lc1bxpU`s*4H3j zH0uk#09JUk>o;MwDbFPm>u7^hCOt{#KJN@{70}WimPZ6~=qMv(SdRb-0xsw3S8u#{=0W}2?czHu%OW%4Txi9>@7R(k(z3gpP zLR`pN8q4NNdq)ZgUb{qGUwqpJ6d`j)+dKZ_L2vn4ewFqW8oRPKufuhPg&BldzLLeI z@d%z`vwcj42ic{%m2}I#$7buozZXSaLdvt0q>!16N#Wx!^+L{!8(OHRl7aj*;MmWiEPRydR?a6$XHn*{PyXY{16Onp?=DaE-9qqkmb3 z92v%&9vWr5V#h)yy2`;FpUAL;FJ-5+gVrgD{o|1$+Kz-BN?61yzZiOr9lhp8wLrE> zacYkcU?Bxq8>rBb*E`ws(qrq53YD#ZRUrxUwVY-#w3%YERydq^GWzUVZ;1$HvvMB$Y%@yk z{DzRKK|19Q9h&S&Op^EQGGoxd=E9+?lERlZ%gixwTTKeJkQVduV!bj23Xir8^>U>-q*$v1!A;EcbpRA?YjFl_&u zUD;iIwKYKcE@lT$8Al#m{wRv)I&+P4q|1flB!zu{se|Mdb{#LN(Dxll(BLjG9EFoR z$rmUbzWm-vZ|FL15J#D8cw96zb5RE&`R-?bAYp~2?ygc zaP+Ycz7e(|Pv+zPhA|UO+?GDqN%^b(M3v7JUgkgQc0qE?zF9_&vuUy$vjKy>cWJ&T7X?q8DAf z6;O;rEPl0a#BN@aeTcerOM_H5s@}?WQzgd-CZnP6RYN(sNj?Rgm5yK+{w770a_VA4 z`%!=;w_z~Y2^c-^&P-l~U8;k_+7U2AKeEEY`>rona?UAZ8G4Qm0Rb$F>5$%mb{6J& zSgInOe)WBMQ6mU@8FR2TC@Y{H(zXu&7C-dP!qH(V0=EBtg#k*RM3i)WR4#!aA1a&k zNDgiUxDSgtmQJGMFYV@Ph}65{ZkHVm_&l}jI&O&^5g>64)yRDy#YjsD#gpFU5}d{w zdFpqqdou<+0MMPnKy>f9P$}d@b4{vX!Zx$43JI?jKV^3=4ChktsW|lkJV4;WkD@*o zeoRfe)VH)6hQeEHSW^JjoRo&<2ppoJNgkmNHN~sRu8wuyXrdETfLcutp7z^0_gq0p zH$aJkC**l*Hl;ODmK`WOe^#iQLNHQQw)6*{%`Dr4#ZzkPiWCWE2##2)&9)*=K`bnQ zNEUJ7k2_~XWxxC+^;o&UFYcQ-OorX9vy}L?n|YEHetU-`FX4)gCddI-%N(d{Bq@CRK+y~Ehv!B$T3G#|QqHv0 z4uY{CJ*DW5xT%+XyDlwNrgYj{miRglF5kAaq-9-DVpUVz>yKXFoK2`=ebaw!>LjAV z-+YS`(UOhoTQLbZAK{mi*J5QwIcI4t84nwprul#OfULz8sS+z*rP7@B||%I(Q$W%`JV}5UvFY zcMTsb=_W_`anv$ZZkT<(X|N+0p$ClrW{@|9DX=@g1a!v zbtw6biO7@a0nNS@R?Ot$QxvM8yAU3feL6cQ2N{4WYr?_Cz>Dgche;M_LGg%}KhBLU z%5CCDXzONs6D*M!lS?2TSMw=1<%qFz%R7yM;n4*?6MvXEhx$`#cfpGgR;Yv}PI-5eJU;z(KrtQ3bIww5B7 zVQbPaY&608{J!5+SnvQW7S;Fc!bEgj;^cUub zMkwXam@);)6YrJ0wCDYmDB>xP9%P}s*KEf1mOg&8!1ck<-l|cd!i}0?*}sPV#E^r$ zW}-e)9pSQbWQ*`ewY=`)@TCLBqxyz;bmc0Q1RN93(-HVh`1vg3-S*DSUf4H26z_yR ziI3CATyay=yn@0m%Xx8j zNRcvS_g7E&)E4!L(*|j9QIVA+X)J8Js@TMo(TfT+eZo<4gNgTw-*~JD3(@Oe3mu_- zL|+y<%Af=Veq$k-uGcTf{URkHeH8ZfYsnH9$s~pE9-AY5Q(Zoc1#*ltyxpX`Xx#7s z1b^2nx$PBa9AZ-Z|A>mUizoeDM!a2ohWDeA2@(M_)HIkT$Bd|w=tFx+y3{JvHT9hH z*=4E+%#N%>;i6l$yQ|X=_t1&O?MlCtNgV5&U4V`B!kOw~nEANOYsFBlo!8-DI~Wj^ zT79Twsfba94xG$8ZjiV(l$=|`h8Jk#0Z2S4zSi-Ghrz9)q<8hI^2>+eRkz? zWk{M$`6IrYMs>S86DN1-{Z_u(iS}13SC$Pz-*}T7scaODb3iQ;KHC!LNIj1+OPXP? zxOCR!&NnU&&4#!xyRJT3Mz|LYW{g|;I8~5@CR}veuang$Xmm1qaw!6@9G@NcH^$2< z8GQAtPg%`40IO<9qVJoRi};p5>^5dWd*(c+$g+#i29oH*Pr?QQg0F#{)CTE1oCCPJo;8cm1WC@IACsz9Rm{`%6ISV=QoCW%y`TWm3{?&i=gN1s)Z$oh$BO3Nn zK7?LC=!oKYEQoCEC#fw>kDcS=MZnviREMmzUXtbcon88|hkzYUh+P(EMujntuc^Zb z7biee21&mZOf*j3JheO|Xb|?-pR4^9KF-CHz!5Dh;O7`F)SIgol9n8Wz<%!oe{4>g zCd@YX=XIY;iXZ!cXV*b|{Y~V0po-mT81pAUSrgVrdtv zmeY@%HDTdpjNK++$TxOncpJIi74kf(ENrQYWR3X$7Z*8@4fjL zsYDm)nyv5f>*Hq$hqFxycl|c}I-FL&WXHx%Y}el3(Y)>{j#F=9QDFQ2-Hwt=hny{D&QBjTBrwVw)t9y zKk-wO(MZ%qDeXpw${>FbBVgnEczC>!3I!?_UUEgQ!({F&UFH1g-qgmhApXJSZZ+|| zb34gaY`=D1=P6!(GeKEKh+?gi>130xkH`BCvQ?B+7S(!90x~3=tT;IwCJnz9KK@FR zT(}$l(7_4N48Q2fuVJocu`h|MT|lhYu4YH3kzt^y%3DQ}CkywU8&no;s{B7~s;)o= zK})C|BVa-Uo86gJGgRDZHq{j#soq5OZ33qUzZ-KUTUkpHE+W=E?nf zkP1OT)(Beqb@9pNk{iYdiCdC=@$x!pX$jd`xtC_^&F-J1X?WiXmqdT8K)7ZyrD$DBFS0RKL7$O*w9ZKP))TybcvwtT&>CnDd`(GVD3x`Xer|Eb;bXwji!-A8ZQ(Br~|_*#I{GUN_{z4+HSh zhb5Z?bih12Iq>VV6vK!1QstfA7@1`rXf#{}9El+KQ)msnulVhke_6r~;sNL-jULG~ zjS=#~1BQeF0s|EC3^;<7NHCi=xS-R**t(e=25&SLb}k;~qP1^EVn36<>X!;nUt-poxFi3%Jfi$szy zY&3*-&o7)ggsPRSWIx=#6{2dc>s04g)<#qpV1j}&vkX|T@&Il2+};RxE1&BV@Y2>Q8bV?VP4AqT}Dq ztPBGJvn%TE(xR*c$~eY~Qz+53tFYl1Mjm9y87|>BO)uWzOf>SW2l(mK0IAecec@fm zn?NRJiR8qLZg90aLa7qDj{#aaS&6DXvUBFqGq zN&Ayb6U3|`w6k*K>$!A%{-*Z+vwlk5Tek*Y=z2WasMPKf>+eL;Q|@gfO9x@TvC|$q z;`!cTwGk@#4VZe^0=UKLO<*=I-Esh7YPE)UTJ*^vt^TQxUI?3H4bZOHF`XA9!IY*^ z=UA@GmFJ>g5Io;F(=xTG41iPQT1lG~9=iq3G1oh_Zh&bRnSg5D1_mz$d zh;w%XKw4KUwRkS9ik$S@0Exr`zJ4Om$X^3vlScxho9h!+(}byC{XPxqqgI&X>@+e_ z?O**~#x*Tergl?#>8UOICaS9N`@YZMq+E z4adlG-s%@8S6X@;eH4~)DsJ(ZLSec-GVBoXl>b}zZR_4 z#ncf#V=?_-NLTR4hClz4j0G;jmOi)nCD;^-;B{>{*1niQVB7K@FYmZF7*wkLs}`~A zr4S*^VJsXC0JMW!GOLs#EX9|6p4@Bx%Ui!Si%)jHJDYhhJ3eSWrgIi<+tmunIkGu(l#{NPySfu%)kGl&BZq_&oatJ9B+ff#bHS+gzgA4sJEABFF=VN>j}>vZNfu z%o-bvZE-bEd}gdDFT>s#9>}?jL#nOy5mv{RiLXB0+#^JsacaGA%+C&611ai z>X^M#zmexTbSR(^o{@4&7O*8DA%yo7!+iggs%2f8qIOz!0~d?Ddv{8a4#R%X&9^{O=+Al^19XJP z^5A4~V7`X!3qWN7sCfN<=nPCVqBnFy`AnvEYYzCXc zpQzOrA8%^aFXlgy6j%J(I~j1lNRsOcG-!b6C7{drbilwQnFBKj zWsL>k%I*Ps-H$k4JTj@rG?vP`4sc#Hcq(j@k>XW$_|a>isjYd3?|kC}`5$(fwoV>} zz!;HqV*E4{QsY~gT&u{jKsQId-`F-b)BA}Z!Td5aB!k>6XalPWIu(TYP4P)by7H40 zwswUE1J-dbAC0a;`k8TsRcs)lU#vdJ%a0s`2$9Ew*1swpuBovSmwc9cC9HZTy;VZe zPSZI;IN5(3t8aXC%ve2%=Ik3nv$lqqF0AJ*UZ`l`yE>Mi-5Er&MOMQM&!o`%X^9#W z-y(nKYEi!Cq2TyQgKP>b=Y^+&QSCRTMv4oEAdIvUL-zooVTd7tsjJsGgy77vuHUSiXWY8vV)lu3KUCzOfP)J_oRBTh6Rh8d-#?cEU57PJ2-(x>d(>4J_MM%b2bP^ zB(wz*{6(&VX?$JZNs6296KC0!Y>N*GKdE7Eht^NBBNrb#n)m#UT2jE{&BflvKkygnl-U&ADB%pk4e2fg?SdTuTrbIk+`E+UDiqda0^{G?DITiD{RW zrcrt6TuZpyw6jXpdZu&r5O`P99$QReRHHK?Vc!ZZ0f6eQxIwtA*c_KnzuF=0pbv7Jc zLLn3~P=CAZr4;id{NAWY03;QV-pC^6)m&948dD^RYkSsziW?j>0RqLOD@=qo9n&iP zxV^(N?EGC-f~rNB+un8Q>LsplQ?Qf{U^v9(%`AeC(5bqGRBXn&SRX2d@DdxIl)=Ke zF?_wj>k-r4Mm$+qa8Xw$acn)r7OYk5kbh^B$W4Lm7m?}kg~vmzU)_icK;y&5u1Kqa zeDX{^s{2HKYal-!N3c=YDen$w zkPRzd_W$bK@*2SILIaOHDokZBSp*FM?^z3JFA|sZ;xRV`5pLYAPmMr_1Y4RdDTRB% zheZ_{?rp&asMJQfxm*K621a7+9wIW0{eYE2QMt&9ZfBeHP{0gz~T&)p9z4~GUI^} zXCYJl=ZBo6Zu5>SR1}@5axIDG-oklA%Oqrc4pBHe;y|{kyq4(7>K!anW}4C{*p6lA z3zbn>|Dx_|YXpnKvdG1~zdl}5hkVmT-+h~a2)MK>_M$U6If|tnEe54eIU_U>4VF4v zLE9yT8}@QVxOw=SEUQ}aP)bPR7B#-fMkMH4Ze@u%7YWsLmxJ$j!q3-nIYAj4-)7|3 ztuIOOp0HCtRVx_wL%3SyTCR~30!s=%c-+yL9WhlplIlS%$^bVvOnjn*T%e3>23@V5 z6t;Xl+X=NyzMBDa&$EhdmV0s!qx~>B-f9;3lG#T*CK|HXoK!0sWKBt*(kr3pHE@a2 zetOMuiDw;aD1+3~Wdbc0zwkL%dm#~*L??VbHOMf=>m=vw@TozKSY}fQbc{JzK3xvp zXRP34Vd3+}YZZc~OmKhOX-MB**>$pS5r~?9UiRb8t&0U0$_9mT>#X9e%r&w(Np?(Y zM@XW>@2=oOM6bSH1DD#-;di+6%+3i3IZ4QcVDdwAwnx|!61LWITX1-sfzUe6y7I7JSDQ>4+o3ygwIzC;UynBZ8OSE~-u73#YGo|cTuSL!Sg3t~w zv1FzrB4^thL>Noh(NIEo{{^pda0zS4dtf91wgf)N^k2DA1Bfj#NYzB9qe1#cXTH+1 z%T6yLad-YNigo=|y0DxZPRG!R?*r3O&!jwi_OPrKn}O%ngASknBdn?l*G;&KXiI}B zf4MM@bC-wV)B6zHPBwsGd`u%&*P83fjX|v>BD9uf>C-0mur*YFbzI>G+K7MJvOCSq zgbMn{WmZI1h-?VT>F{)!cH#67=nN>iuwqLUR2mNTA6Ht>!#da=15sPTOj4@M1e4R( zaT6TSI>EvJd*ul=@n3pgyJg&G3@4*Myv$wg08`xZ5erJtmoh{RPR?jo#;ubl5R zHye~l3p=#Dp-cNCZ6*ufOl(|s%p`rfOahm8WY?|57 zyTBOT@Nc4K3lBJV3%_ZH-<%$9=+FZ!n%4kaxHSyB%IeGQ5_*2=Pt=D_)*&}o5s5GF zEK{qJt}|LTM#v#kGx>^(REQa-Du#n=PRT!B54DhgGL*^_4b5|;lX?frCl<>bAtle3YM*o830o9wo%MtPWgt%6mhR0g4ADt<<#3m13^E09RL za6Sh#tuJw=eJjM9HhC;=PoMi2e_e7i{jl#CpIF2X!N|kgv*ifgR43qt6lB!k4J17m zd?EO-geG@wp6yHIe07XB3)q6nH8Oeaz#KrerH}S~L=~t0?2M_f9-`&WqjQa{Hu%`k z9zww-N+%pEb8>`cwlz!#Jhk_44k=aE`ouNDKJWW$r?699R|9{rGH=T=WTe5`+5W8K z%i8#o!ilfwnxqpVW9cC%=M$CH=2($t*g>|I>#ww!JRZ)fc+Ro0`;mD(tEOJl-m&!P zit*ibC3x>SU>*tBbR8bztSpUe6{5~S)BHIIvjl2Cslip)hPLfE}6l z$FFPaqz*+px{|32Dz3D^d=a1wfw`=8GoM7Ja;T(;q4naK6oLA~9TbFYke6m%VL*m2 z;dBnbU1KSkqFcq^EyUT?;ME1;~E8<#Cp=J`bj9=nR>m&acb{6lWt zL|cV3lAS2LHgU5pQbz;M7l_mElNq@C{Jx3psqz)&b^6NQhwYipgz%wq4G4ef7yLbj z=~9-d01m!vn=3dl?i>c>#Bak-&Cy=*GNzK$iSy?bz798=!^|r;Y7-3L(I!%cUT)zB zMEavQlA$U*u$TD6Ghag-Z3HpQ@GT}{`Ads~rDUc)?mb#48zq3s<;IF%YnfcYW_yH? z3k)#A9{*L}z>v-Q?gR8CxM!~pI@u-h+aQ6%PJvKF$Ret^m<2rr2>NBkb9y84NO>K?OdRPCD$b|We9}b zVeuq|e?LpbAPRpuuR?}BhtwSN=ub^9alp*xkXD7+E_`W|!-&ZuD%WWA#Z%zqVa+f) z#v6a_=mTGJfP=O_bph<$8xtuYjJ zC||BQSQ$zeoI!)K+EMp@6{kz07dN%l08HYhFue~sVKLc_a}bqZ%_cJ7oJnbOtw{i) zLe5FyvM*{Sph0X-6W@H?KolL82UnuHZWLSNFKzBt%5Ahme@=V7$cesKv-ZP>}?R;@w@Zo-CKhv{Hecd z+1hYvSjaIl3%5@b{7$cZ%!`W@!@eH2*!g^S5`?~U?nxA~a5Ar6kCSQXO3uy=Kg!L+ zS?MB8HzzYG-1ZAa@w3EI_o;McDTcA<**N{6c`o6Avs5n;hGWf6iqXgOS5NDF0q93? zW|Sx~j?{^S%~CAB0h1z$ivN~h4}m8xvjiV7Qv^1I+x4gm?3=`}_<|E{VQ0aP5UJhr z0in;`RLj?Ki$x~g#|_V`>gXrGhJnIDO(RElr7EV-?ymx>qj70~5(v3^p$fBjaw{v1 zwYfx|V#$GP(AON*<7~=CbidNq+VAS{?z~4y zYxWy5*BKR?U^SuRhrL@ns@eTni;6^^##I!KIx}k+1aL@Zs_+Ct({QrbSucYVm8x zL7F8aR&kCG56hRslGdPRNJbB3hn9rWj!~XmSLe%{f%~~(rsv0-sv%2dUw_HNB427@`xUyZN)E)Adr>Ec8BV^EDtFa zHxw1&n}{f`+gh`ZpW6>1KkaO4g%XD5U(%iRwnv@Hcj?MNvbkzMUu+2kh7_%k(y3?o z^gUgZ(NEV7lt#xGoY`~vwa5o2Ema%QVGpst@C! z)B*K;@2ZnRW{%=W(p}Mgmpi|65TR7u<@2`F00({7r*-pyc;fV%-rl}(+RjK7{o6Az z+Nvzta=L(7YFvE5zJu~>jId-X+9mLx{YoGtgh$W)u@5Ec)AIRKio-fEv1u$U#mF3b z3?Lp0v|zunF_uYm*9~k}_h>3u9Rn(UAbAle1L{;2hO74uwwj_u3X8$_Qdb6M)8@L7 zH2U(DS=O1IKDqJ~$Qz$;~(4sCp(2CH2_E_Tncgfx;{)f%?OQ zj8szi(bFlV0zm2mM56fcCX$6)8M`?O-HM{Zfr8Xe3d=4s!fF@ZaUQf4digfcLdFRZ zqei+em6VYz**as|E)MW}?dAjZ%I*EX{idaNqvIV&?{Owor#aZbVY}TEfMa~-=~Lee z8+NCfEPV0sEvK)(^n!gQ@-Qd|o3zS0f+U6ECr@BZKmEMpa$oSp50pHp&cN@}YQst5 zZni!bOlSEaxFCadH2GUKenLbt!7E^Kf{0X;mJ7Q>Rh|UI;hZU7t&tW5rLOF6&I5}{ z;l7Kop)j4ol}OZbDI7e4BE)4eD;m{efW&KnF!}m#&ZF`%6iazyhWlT~mElrootiQ9 zrg)Qj3UQk0fXotgf*}t`;u+)NbbIJgtl6};-{`r@z&)R?5oN= zdFiNlxizC2FQ&Cu6KEDeb-2S4Au>{0%a!PwbmLFVGn3JdA5-N%#K)waPNp3 z{0DacbxzEBPxmE9I3z)xw|KYS`#mU#B4omwrm2l%qtRFm{*HsK_NB<)!o!m zVXLm~auo>%M@Usn)xp^E`iwA(UEpP^FfU`8Nzc7=w+izpy5k1Bn^7vK1S;O@mVxwe zQizIYyp`*OEwc+$j5xcnNjat0Kcd?}g;r{(IHAGa>w4&MzcI%|f*H1$EeETs<|1cq z(d(npIJDj6hU(al6y_bGh4+}4|MkmHo#?MUNTQJ^&4co}ZOEw9`4X9*inTNN*LRMTheq#kY7)9jy6GPPZoalmEBYuN3ttV z>9nrwL`}0xWb+4hm$R)q{uRHRhZ?xG=z%1pnw+d$I9D>lJr_)y{G5+jP^X~GrV3}2 zOAysjoJPe&P@iy~%BHNj$$to7Lta7P!0OcQX3=Z!kyL?v2UOjF(m&75N4JvkK`t{e>^Pb&BxaP--B>|6in5SV1{{1m`Gm%P+fvllIsE9c{nJ#04=f6oK!u@l+?g(V>sG|w z3e7$aJh*yQt;XIL$>awX=$5})nyH~dPRy7Vn>0#CF{xmmqnE704F>qs*a(?WrXUI$ zY}vrN?dVOWiSDX-dAIrM0!Nvs8)v`fM`Qv7{+=3e@(`-UE)p;%*fnhL%e! zP^II16jIHc+ESM4XL9ts+0A;de&QhSqXnk|8z(SQ*-{d-S65*qU9(0A>C zOL5*k+vqw$o;K?x-wJpN?%9AcmgY3P%f69DRV8{b%~v}U!>{Boh_>;z7SlyNyy(Ie?s`fJEIv*p zVz3O5A;NkVckm)~7GL9#DI|4TqIahqW}@F3`%+PXyu51%pH8KNP_b33McZoWfMJ%^ zd3i*-3Ytg(m1c=n5YoZ$+~xaL>E)kRh*I{S>ur$rCW!kP4|A^YNrW8H zpzCJ>6-tZLTI^V zo%qRZs66|$SQfQlqP(G^J}1ZC%dFu zd{%h)RaT^k$_}btlmfBO_KTL33wsZH>FTCUL{M0yzg*k>po1$aZn3{F0uNZeT#iG+bi=J`CKOw_|?jw`q zWQsS1QSgW`WI{F&1e$x>H(gJfX%V$jII&u|{dfU1rMDoBOcbZ#blkX~{R*B*ubXpB z8{n?o`O}YXqp_WcaC4?S2+|cn@bkGHR{oQhdttF~A1YezLnTkA-Mf)SGNRGWiOZ@0 z#e_hP6%g|&W6IH?q3V|(mkutz_b(O+@+*h0Zwmpp<6cacOn?RgQ?}ub>(j%K;VrhE z?37$7+`qGnBjPB>R=L1HR+2+5HyF~L;k=cW8EI5zxtBD#$*crJ>ilhnRiWF|P-%FC zLz2Sn|DzY{4U8t4S#B1yf)vQYPJK*;eGr2y8n*dYamaNz<&)yx8mhN<+r#oDpz^vU zrYyJlI+*lxSWiFniXbT- z`q6srU}rG{N>_jHElN4Y^d_LYaUjuKO{}_f4Y#R-DQUP1b##_jO{~Q(clm>nE1zL^ zL>#g7pesF^t4j+j`Joa?^rP>(n32_|KyxK57Fpt|26gM`nN$QS$RRl%)}izoK{uiX zTRtq?2K3MP+vA7`V7MebGC{e<86r2agmDXk+_Ir5fm;iQ6eGF9GA_7fzO)M5TRis3 zTn=vm9(Q}k%T5b->4^gZ2Ij`CB#8AHQnmtA@}&Qhb?=1nG8 z)U4=8n`2@bAtYsD9=_B9P)bX=7|s^Tq@UgI_VMKwn&w7zn%4r&tA%wR933WX@HpE` zcjrY{Quxn>DHjC^nsZ#u-`dhQ5Z=$^6uBmedtpI&hDEzLB>=fy&|ap16tvJ9ffE)# zuhj~dw)XFkQ3j3j}PCN?6Wu(nlB3)2A?$8{5J-r#RU zRS#JxfOnt~YfLf+uN0$q(y}Pm;e;&z+S@2&SDl?7`K|RZ zuqjgflAj+bQWQgl*5xgIFIB(l*pFqx85k&DP{0e8o z-*DtMsq-uT@#m`tH*UVU`a|eip|;K6SaJA;)20m#?eLe|Z@+5#v(IeYc>gY}`!Z0?-g`C;zzzrMP>4m^^ zY>HSAmBu_^uHkGGm--*wP2<^GCY`PA|L$y)WUZaa4`H&xjl|KxN!U8Yi5h^{@csV< zecq6Gfs&M7dH3CNk&W)tYEcK(ndnv*+WuEzSE*TG5^wIjib@+;5}F4ne9dAoMVxGp zc6KIC%7?=zOiS!m%>A0uZs%Sp9pjp(_klByRF3;;ZthhU9c~J8e8qgLD?ohb;>~n5 zBD=wrQg6bd3sDJ{B0rVl(CNqgu3_x0QKzPwVX@C8bpM5ShiQ$bID+oN4Pm_Zxn~_Y z{+MrhtcN%4`b162V|RZu=#=CCMiGkwqYK zjzJR_`y|3NtR;i}m{;bA8~oPMLt#bxpAq@+LyeK!1v=H$B-cMfSQVm7SgQX!SZ%nJPuV(Ehg%*9wz*}aGtDm z+fzBW!(ufPtq~XKyM!9}jUlBSQ}g38EC$`qjLytbORRBMK{#q{Aa}jveK&-3usGvbrQPThszx?)ZXI=c|l^B7o0-HZCaq z{9|G;@fzg8x#>!C5`^SS+loS@2B=n>ZwfKgG0Mx2|Kq71g)pz|D69R)BM=g%oOQ&r zY?ZKbEj5NmwPX|Erq~#fM86t-6O#H0nNT!rnp4Z3_o09CaF&HYM5w9$CSFf)f{RLH zBaH1Ux@>L(k-$6(U6SCI6CRs?Nn@!A=$ndwVr9*qI4_b(QD#vjEVXtA_{0=LhIz+=#!us z!H~`8LB1P7{{yyu-1>jx_&DGE9>iSRQdXs3VR`L;xIfmiJ@A|Wtl;h7V1K@CIrmKd zjogys#rO=z?fa1swo4Dl&6h|0?QzQcUk~CJSWD!_tXsa<)-?$D>2m;cFJ^xmAX5Gn z@szCcrtiud!~3+Il+(+{&YMVfuRb0^Q?;s^ozSYH3q&>_P9gUS9H7ES%^kSvS--WI z!XyvzdmBlCGoxM_0Tr8K{_S*5PC+!h=v|j1HYo z05Y-ZB84N7THL=`KJ@zF{2uj|AJ%Kx&;dowfTpifUOYmdF9KwvaB)QOZRE;yX8$elY3QnSjcaa6o|WzdritC`oy2F4xX~H(nFs# zXBpchgDr)97DWLCPH5? z`KiFS31*iUY(iPZf<_9U1#hCKjLazYwHiu%wpIFr!Zbg+&k)-o+^zfxqtAHooR3K| znwwN<4HoXo%I99~2|q4E8%KUxFvtoWdCP^Lq+1CEBWklImBfOo@#rEYxzNaM8AMky zsn;G8Hj{@l=tn|aO#mGRt* z8=Axmp}u{iYVGPudQc7$q^+Q;>#dkbnv@u5V(li;1RQM3Mj~v2k0N;yILg`u0z?G< z;Zg}hdtfrWMVtDmMP-u66SVj=t`&clm4AIj16AvnftNYfNT3uI2C`tjq%c#R0^CH} zvb$$z<-YqBFe669-f~80>@Uy*mxL}q{fH-8)Zr?Y!w8XT zHvOnsIm$`Z);=ucK^Rs8$+ZuiRM=0UM=tU6LjMHC>2LoaNS`3h!bxc68CGtwCn(ku z{08vByz~f@tO-MeJvk1=ncx#~hV#$-`#&#FL?qhFre9I=yraZ>hlFOl z>>(?dq5J`QlnKV+(KFYppe63gwTj@TjJTXtc6oKMF>Q0|I}Yl~Aw>i?;DuBcUZ^mZ z+d3u>0dF?_j83cgcHk};+3l_m1|&5WV+A}Q2xK%)g#wNZz+W^4;@-M?$EL6N=mcB{ zl#2c{{Rdyv&9H}!mgyOi;c06XJsi@T;$nVK;na%_;`JBT+uG*B310Ys=agzk4S~}9 za84ZLCB?{3m)@XA#xrOKcd3pp*fiXH%t7I)r8G*-m+9y!>d-IeEGgR0{54^qFlyoF=Sa^$PiM2w2UvqvnnkpiijVV;+@J!-Kw{e ztqu!0@F6hUtT((1p`PEvwmjP@>>sxAEC&G?oGRSsR^4l~0bCJOo*M~jrANQxd{fyJ zN}r~X4RBi#g(a`(-O3YA13(+uEJ-s8ijT~A(|N7{|KvJBI3&VqO_~?UD56(Oejyyq5E{m#Ion5vxjPhG-#ZepY>oGg}&zMBhtHFy#RW}as3 zOc$RsT}kATV_Q$$k>Iw-R7<_O&_wsNE3bH`ejC?lt_PVu?dJIx7n!9kyZH-0F35RX zsaY%4tBa8NSMOiG&|ISK70jle+Q~(55Ae2czl`g0eJUx{$pu!pNoS*~71J?r8A7aC z`GCdZ{C(C-i#90G+Ym{E-F>5dn^08UJ|C&PXudN=&EBi7qfeanKlBTgF&;u=$eU|g|;sKU=Cm+(*!@tlE&0Yu%O{jUU>kyxM#@*M z1RCgeff)gcNq7`cY69*ELQ<}>@`Dp18%0`*{37ZgrfU`G#kWGUiSp=HI|+oG`v;20 zfsNjJBKA|%e9^+GwsP67UxriVd?za{*@M-r0iQd^Oh4;wL$4^`^J@H0mIh{cRzNL& zV!q9IZyS`(mzBQR8~IzvXfN)Kgv9Av3kiw;eYAK)!jps-VUGbbv+^%~XDr(Ut+n^| zOra@$88IrP@AO;W3Eg67z>t+cdK()IphvEj?|rW<34>{Rf4wOxbsBjLZTRbD2+uXy zG8|8Begh>Q-~8J3l3TV#aX zDl}Ch^#SkJ0Octp^5_=u>%ZP|b|J8)dqM59+E%$AbsVv&NQqs)PQ|@&556m8-vQfx~3|p02q$`82=8 z*8=z@8IRaodknCOe&=8*=iH7X9eHuhLI;J%lbHgHgDWzuyvm$kaUYd;>?(yEZNXBK zD=ilX04TUg=@EEs>;_>95L=FnflIh$SZ|yPcR1D-48Wd$X@lR?w;@cDk*7{-nE9=DqEs3i)El0Y zsu;Awkwyj39X%p{9|m~Pr9B;HztWefX6e@iy{!z)%gZ8eLi_TQiT*XN2E{NO6`QDZ z;pw_KRmc&~6j2XGPMHutw!ct?lH2cjAzcg#&^c@2pWTU>l@`6+{7;^)Z&tpv4KWSZ zHSCtT2g=L_qeISEl#aD=Pr6eLrDIlqu5@tua97iv^N2*Xz1=iBl_=XS*PD*O_Ny-p#5j)6w6y)G zkaN&g!^@rTgrKAWAy+GKxW&s!j3crhKnzvw^%AZHuXuTnSDUnRlFNJJOZ3Zv1Kp2s z3)6dQ;OAGJF`v`MB^(ttCw^9b(HdQ~kU1EXfnanvQ<@dV#PLq=5q9vmS6St5hyZmB zCY<3W4%xFKb|zXtZz4vfFsNRAh`c`$LsG0-H-%g*@48UYuAoHexW0yRY=y zs0x`fS}U8J@^9Ef*pO%W;^OS)t=zcv1~wcyOh z|LIGOx10E-7^V~%ec9p>)_PoDuIV&CQ12YjVDIH#h>=DJudiuzo_&#i8Gfk6S&T`7 zjNaOc$7|6Jnxvk=$=K{jtRZ9r)W*$3+;fuseRJQa5~ebp29s z(Tq?0780ZrjJi(8hQm3QA|Wqzj~Y{3j&bUQN?06Q@wj%yL zEbaQmwmq}9kTP8)359*AK_;lEj7(&OR3MPD^s&tpLGddWr)=2D@4U)PaZj)+D}DOX zbcrz!N@{__)RZ-0YkizNEK2BYX{@*>FM+3khIDuES|6>qeTC>&%uhO*__DD|!H}#W zV&5^(3+{J79u2i0aYMb#=LBbrt}zNJD$p(4e>Sb1D-MXLHgeLq)Z(uqI_>0FfkBAr zNNw-`Gyy4;(5!sH8Y!V;knavO>I9WYZ^W(BKwkBIev|y#NYwsXQ9C0e}QC5TaV| zU=R{*I{5VbszLxAqTxK8D;%U4pQ)up+!gKcJ~Sc9Zu;Hi1|or^+=)3>8T|H+8;9(A z+#{|=YS<(S1?-)@46AooA3a)Jz3{Oi4Z~+l`9P)4D)+q%lAT)ZNrtfU9=r}3JxKbr zW`spZqq&MP;UAhG?kOuD_mZey;#sgrPOv<=qweZZKWDg3%be}H{>Y%{)Ex~TCc4W^M(XOZ@W z6}h3|LcBlA()yY%dLehUuO)J-STA{W(!$jy$QGnA8)_#vI!U;=WTY32JB*B3D(N#^ zxVVQ&9PtX#vV!e-Y#tBAwhvJqz~jvg?)|7AAR_e3)Z^TZvIoE1u{#$ZrRnw+){rIz zvCNM_#vTq6s9Rh~(gyXrO0We-R$x4WDQP>8O15%MS6^N1aF7l<7V4G#pvo^*6H`*v z!wfeASX{CTA*Nm=m`fct;ScyL-3UDel-UA^mA7TkBGFLhlMPMufeK=w5%I%~aK*L3 z;-yFf)4gc8b^p6xWZw(E!_JGBEJCF&#&pJy4M82NOMCXf&ck2XNl-^daY)ShoSjbK@ z2?}qGE19rSt2APylp{vgtQilKzkKGe_$_oVN_nVIw_z?g>PuKji@3rleTcU+X9!}j zgIceN#G&G%O2XXlyeEQlW5?vOZi*P#Bq9kJnXM3OWzo!`ejGPOBuF-P23qpJL5G@3 z+ZKxZIM}dfjwwzD7nf~Ynf9RwS6iupqv2Z&$t}*D;*((|aiqI$kI;eI9y>VYk2A-q zx6Q_I!cu84%Ddpt)$YCx;F8C9IY3y5ya-JJyzCXO=}^22y6xIEYkA1v7fNc9edr>H zi45BO=nvI2(kr?Ex-D&$JDx8!O?+Xjbkhh!H-qx(`3j<9ljjkMN7Kde-tyy@wE|Wi z4ZBl(MjSu~MIg&23KOb{y~ao(X$Z=xm20#@QQp}FxG zAE00QD5%jYi7g;J?f4OfFs6>~XobscMxu1n>ypMp5eBZNXXPUgm;D@Wn@iwmmF{1z zR@KMg5RSvx9e<>J^bgRA*@4$;IMomNTwHHTBviK&3xfh;G=Rd)==ylUW;fwPOMlrI zv8jLV42t%5ivvRN)%bTY@>PR<{R_hfZ_o#;`xlPPI`^_Q;aLd_J#63U;YGy{R!{sV zADDhS@z-Lj=%ZR0{pV~%SK3QqeYrgg_I&Y85_c^{Yr62WmeaViDPOAtwIpLY-&FC( zgTqDtfSpylZ5bTS-2-W}4vX-;y9dH|lMbYZ5SOc?oj=7I`g*lCE)AsuvH9k)xH+bt#u8X{Vt48P2g~$<7xoxvo4f-kvPG8lKHpP^5 zOaUV&>s=k_NH1Uu*cd~Y1grb`c;Y@r(+<$itrPEPc(*DW!$CGKWf$u#yDkUxgl%P| zLk}MhF|sgO)!}TfoCs*x^PQhDlQM!={PUkXk`bJ4Kgz24iMO{GF@YPq;pND4c_fEw zGNG|*92u}TW#DDyQ!k{E98ml8ry4_LtB>5iLRdLgK6P!d$_z6Z3#=M1#&u&q(oS1)Xq`<+RfWn7>{ba5o1hQW$n^&#+K5i4qJvzBBMQ1-Hze% zpC(eW&hW}&V#jfs;dDv#N>s)y7^|HG43wV9Z#Sxwg~=+hz{AzR7@K2*#s?vT>EENu z)wy3b{qz{Z;sZ15(X(+vV=gp=q(oyDFy)1> z0Da7m*6cPzg0d*jR|p;kgL1*cAWbe`IywT|%?-Bz10m*VnQ`Q6}CLnKM+h#|zy(r5E`&kv5TWKP4ib4V7W zj0iZ3mJ+&v9~8!=v9wYWZ00S>){H+jHPfMa=HJ!Sfe{AW@|mi)P7a$!Q3zNy+4;X;w~b@+gOnbAq0KcFzeQKIF z0VRLnB3{Vd{vtTu#;ve- z)-S*aj%N03NLN#2yw6e?!c{mv(`H?IsvbXXWX2K7N672&z-uOx66^lb9FWZu2LdQd zU)mQ`;lctW^?f}_S|T-S01INm3qtRSeAytptz9Afe58ER4AURLVfl*~>peruDGLBV zDL;1&+A~2od!YehG<=fiHr`s1+`))M?v)$o4-_#t3OQgj ziKik$veI{7B{G))wtB%(6{ydF5{^|JQ!JoIwdy%1;_~@kp4zy5o}pji8@WeHh0uf0 zL;{s4Bj2!Gd?2`0+@os?1BZXQ6Xg?Pom8PA1%kbkfZ+~_sF3CwKhW(d9N$=tNWrtn zxmme(G#Zva$#xPT>Hq;fWs*1}DS6WK6F$&kce$9%^CCbC#erB9+a3(jY1~wv`mQh={PYEI>*$9_y(NSQbTl{rv4K8uvC% zKg$_w)=E%1W$2{=dci_5RmPk9<7a#?uam0J3t^vIJ%Atscc-w15pVq!=n}UkSA6{q zaBFG*1;J}a#w$l7SJQNW!>49o39&q0DDRR7ca)zvuc-(Fpyh3QdQRTy`zY`9-4c~Q zOQ#8QBg~FM+W~7eFMiy_~js!F+xwoxA3cUO86^9m1JO4G_SIKf!? z#NQeL%0Es{L^TaPzC);hYC^o8*M*M*_mNqOZNUO$_HNXd(b4$#%xhdVYDG$KQq zr#_{4c?fA3m$6$aP?el|LfXNt{T(aGimq>VZ^h%$L`M_@8F4D_8fbbn1}P^tMHu?t&#UN zzgMft;ik8*h-VT%{``k5}FK@I>}SOL%m}7V-xF?9vBuK z1sP~@edT%rD1WG>SB{#>=Uc@VMEypGP=)Zq4Ny-)!|(Bzr`RIk^yQhY?3 zq2XX&6)DavtV9ip3p#Gotd~RnaSxveDl+XLu>k^IdjRPG91A(cQ;As` za)K~tb)Y2#I0*>nzJo^#T6qDT8^K6j{Rg(Mkgu6@_u@S=g>Cx^{xq$vcQpC_!}6wl z2gM^r(~FCOu(SH}d?)YQZfKUy=ymy??Hf5p^Vz3U5s9)0^{v;tVlbfj^p2`cc9O$i z*F#W@nHyast`vVlIahuC#LuF87?@g{ZJ?iGQS$OkpXxR8@WU+q2q9L!qt#W#Ml|B$}na+WWNY?ry4r2w{oAiu*-%fcK7F*qXcH zj7@#;Yx*6ga`Z`=>YpqC+~IQK_-Nw>>a=ooW2P~)+bzM+M;H()t2E>a8oP!xOnYcY z|4^F){W#qRGnwClSsf<*Sv{BDEUpG;LOvFS3voW>E(WWf%&y3XiA1AXKNwht01h|{ ztwp2^QThASzsGxvBfJxH3mJ4SeG1H>^weT?11qq`Vr!Jh9yKc+O5VR?A|;QMOEU?X zLj>k430y&i?U=uZ>gR;p8u>e4*c12(j@u>%&)zC;w_7Ea&lf zCp}W>pQk{G1_4WlDBxRQ^$d>?|M$cr>Xbc^KqwW!ScOO+rmS-LThmVne!qFf@U@{cz@-ykU{6(}IeK*{4II;NN zch-6RSdfe`xOMMpR;n6-gp;o|m_)rN>N~~4j<6CQ>78R<+_MmKcF)$?=1ZB))@IME z&*uF4PmTY?aP?B*=o&paPlo4&M;vAIHLLa6?R^_&>&Z3GzG!%>ev!X*;*#s@vk@gb zUvm0+-wgX~Jcxd{Hp(m9JBj}C9e3jd9+oFuw3mN8;2($7730+eg#xb*zMXn4G)@bb zDQ^qL{8DZ(d@?%V|CFk;0CS)rz|krP#Y^sr)}of-#%)IY=-CR7ZI0IP7~b?ZUHDHVO#DFFW>j?WWWU7 z+;vX=Nicyn1{%{1rwN)qrZ=rtsZ+lnMDtuBc$&`jG340r{ z!qD47IaWNOM<)KPz5|TUogqQQF!_2nR;M`8eM#I28ZgdJ@3VvW7`VmMZcv3?;j5Eg zL0ATfqw%g{GDM~@+at7KVnpHbkTD2=z8O(m+oga<@QG~Dt+z5tDubt z4{IV^dh^Y(1u-krf`d8A*l$Pv3^`TflRK5pI z$TrioZ0<up<`o&-FWcTrR(s3Gox6^&Hc+;}tK6x`ZCK7*6;7`em_PgQ@bZ%}U zQKonYg>`pw4!t{7D?ImAr#@xORc^cz;M33uF1%$h?+zx)GTi>aTdYFn1OFntHtmUw zQp;0@+4R7cOowVnF16AO$LxsrFqiQK!g*ui=31Z7Q-WoZa-XQg9ESRB!TF}0J-6$T zrUG^7;Wc*6fjaE(!p$_S_$(I_B12Oy7sEou)ES*wM-%igN07=Sz>p7y0Z7op0swhn z1C3G&!zQX-y>m*=67;AJV$sQsC*_TPyaq#Zsl`s(AAFDf3ww0u0~>2jN8ERGKk8Wv zjr9lTV}EaawpVWydyb7*Uj0%FQeo)U5XDGX$qYnFQ4Cvf9hZYLkWsIduK)9&>!RcB z%PCIMJxj=&oEHf6TLYqA$`1yS-%`@0k0jR^Swce_(4>@Zn)>X)=riV_S~KfnhzRF- z@O|5K@-`_BGVg(V9N!#sU*ooNG|MU%ywF_cdEOkqL^+`kV?lE%s?X+Qk1P3AGHPZH z`A`CcD!%bcmmmGi@?MX61yvs(KxzCgb~VPsSUEI^%ZAcl!7(Hh!#E{UK^G58-*V4wa^4nL$BoB;kYw?6T9YK2W zdCf%F0bEKkX{Y<9loNz9ilQf;$74%R!S>nrZe2=c-$VEGnVRwetd~mz?_>^R0P676 z4Huvk7ZZ|Pa}|wVaJ14`Ehz*+r`yvKhU8xWG?r^rsGgJ5wcCn|6)w%^1M7C>gQ0UP61%U^N6X zDR_j}Rl2AKV*nLm7X|76FcgoY4@cD7fV3P!Jy@`~uT)@V4lRwBrgy7?E?@_9rr~6o zHhKO29UDV&0LzGzEv=s~LrP4_6U^5PQ_Cm8N8o*}S(B_ko>z@AE0JCpVMovbbOR!Q zDN|Z2?q5e)Ztv(U)M-!xV404kD?Y?`O4!HMYo5Mt$o2QfK(1kyFob&J-NA1q-+`&< z^K&1TS0}nttYxG;(=w~F^31;mt3{kpVGi%nDet}J1<(9z@;*1U2n?yPaBiKZ@`Kf( z+_x!CXVODi9vVv=AWY{z_0Q+hTCfH%b8^^*j-dXw0%$utAl15`pgAJ(qpyF2#loo+&)zhQ! zpoJCLjxY_k57b8N`Qb>Qq#MXZhe7$NF)?Zxj(Tyi=au^>$jAOb|S zxpV8XCmL~XP13Sq4B<*ziLKtWQ*cBHD%=)lARSui&?$q z*#vQu{H0GP`UIYR2RY#;jFO3;EV~OQa4bV`{;rpr z{~+x+td=g9hRAP}MkFaiEO`CMv`e>LsAD!nI;8wc(+NOt2y1XEIiE=uFeis0m_T6g z%F3DO)Ytnrpgcxt6&vB)!SFrti$52j7ofS)pGZX^j-mL)d4ypls z=bCePX;!-Qz$q?dk~k7Dim(o#Fd22gX>p*3-H>w!m-abvBmZN;J*^z_zmwFm3)Qmt zUQHyOpQ0s5JAHv?*VKvd_Zq#(U(+>ji>a8MZx-OE@mvK-LN<5Qnw}|rShiAKh;a!IQlhy ztyE&DHKmbRq5{gyy{AQ&W9jIhChk#cdyTFs+#P6?lnH&T31ULUc#DalDc+6=2f`%G z1DW6>f-fqZI12x1;=l9skGXP4;yFOaPCjf;&TN`DH)PrC-+qb8g|_Q^*DibJ_h2Vfid76HH201s?zwY4ZqvtAoaT=ijEccbUBO5iG|zD>mxgf;7Q zb{-1ULEDefAu)L-9z*6b(Fsr~hy|#ikxQS}!+M1*XJeGFJj|%OO}6kA_pdUyzY8af z<+37q#0OTHG#Wx4?{&raH` zgpRAOiKMYxv|Ja69xRnn70OQUJa0LRGF}j*j+i1>x=_WMghib%7=j(c8@ov4b)~Yw z6Vo6U45Pe-%Q9tb+xRTjYZ^XoxHfl;s#O1&M4tNaXyNa4qKp6M|6}`qX2D*oSFc&U zX6@RMlYev<{~bB;@Fn4s!UOBpGGX-5bt8ZOzSr>OIz#Mf`t7=r3*LB(eZDR}zHX%L z*p=a<=qRI`-CwAi2n&;;_GRfCz}+s~0=cR)4#i6*SK}31WCsN`d2k}!)l_j_zo=TF zFjUP&$4Ghy4&scL{!OR^c;~#^7>uU+WtxnJ#saF)O6~39vMP{7FCRV3v*(7RP7wBP zF+{!8;!Nl)aRX?H*MA2THQOOBM#)x>fyme!OI5NcdqCx1SYKCf%HAM{R zCcq${zO{HI+m!@08W3V4>TB>Rb>_E-JTimJrV|;yCBj zl_$?*ztvRx)Fr=9>Fpe0o;5pVTGIX8OZ14K-_gtl^Ip=nHagS~{Pw?cRp03AItB>q zvvci|$xrnZu`;yIN_RXJ&nFKFMg}aKi~@6si?oQ*u~zBnRSjjQBc=OK)Y2kDX^t!& z51y7YFRAI(6P^@pKy^kj#EEie=yHDY%58c-8Z*LM{oH$vY0#+f9e<-M%irg#;BisX zo2mH06pR~Tovi$TnnFbEExfmmXH)H3>%jpdh>w&XI5?P$8mC#=Yd3d3HZ1t!Ig_?v zJ0N3w>-cQpFz65q9;HyM!CGU>@)`_VqrmV|D`b zaXZrU2PmqbUnRtYD+s@u`VkfPR~eYr-Zz8`bbdFsi3#+|oiEe7$u5>pOo}-h^d{PI z_?oo$9!jOtuIP*HJc@&a3v@H6k1R^T^Yd zhZHzrs!mZEKaVJkEkn-2L&1~?KOd!#bO1%2rlH4^rOg*vD4>u`4c*uF4b zY4Wcd!P;!yK&;j{EC2I*gcxBYDH&gd^jQo_k~iQjB+gmXn&~k^BqBx#oZ=P5#Bfg7 zC3j6)J}W2`Ssb`U`{d(qHW=liUMQCmimO)slm~pqDyv=sr`eHbl3G&n#=yX+U9s`PZ;b#M*Kp$0$u)g-1B=r zHy8cVr*`b3cP~}7%kE9L7%nsrh?N149Ms&@)j6dr6BXCIlUR&q!8mQ;@bC-A65H`_ zm4|0;P#%G@wS#AOgEqYA|LQ%`5TRU49}oV{tM|Kgj+v2OBXUs}UXhT1i~z7SXGs7N zQ&r8ucI;aMS!Irn2W=2JOJJau?Rxra;}vuFTdbW7cn&H!gA6zYBBUPVVI{pPs`5#X zSB~U|UQk;bVhh05rYet6VC%Z1evGqVr#fVKrb`OqRLoKfbnDB2B)YP6(R^2J{NbV; z3;1$<t+gX7=DPqzFw1r&^@dGbM};(oZ;phAchU`;>DhK*BarQe+^B~w>4a2#Z@RI`nFEDYxrO5w_?B9?& zc~+h|#&9=qMDbP=Bn9jhi44!vTeez=rzyEe5c=h^@+$JM9AprdLbbW~tMSfV)1+WG zYV2G2!%_&E3}3Z+knK2L?)|D*eoi&%k${-)n~@%&i^=r}oAZ|EdbjG|Bt&Y$fZ~Lu z4Vz6jx8*Dy%l=wDR@!jdM2)~>2wr#N^4fNu_JqKuP3jLPNbCVsrm`=OnD0ig%k(nRD{QrXxZmTrxU;e|Ox>yxV`#m-&OyOD2 zFxSbhR#yfFBk7Uu2(fI;N{@UWngnN($oC_LS}eGN%H=uf&_Y zI)N#gsZ&+NLy+HtATbI1y45WYOVn~P!+I*rG>ey#V=^9p9vF{UNW|%29TqTN-xdxN zx8{nG>_*-E1&hJ$vGN($n3hoAf_GH9M^8s=8Ah`>Wl*adTF2=6IypDQ(WLT=aBX@R zL&MnqtbWueE?;^2Foub6B6(Dj(D;NvC=#oYt`UoLJefveszzl=ZY`2-^gh1RQ!ynN zCBAg}ttWv7^G8EI8GV%dfr zCg?nh!mzGZ*|DlJQO$vDn^8WV^>?n~go87zo0QFlz2{!ao#9x}-n|h*&d&r5yT8bU zxxNsQq_hjd(1-$+Z zL)hAmt}A@KHEpf&VAmh~$W=w3@RHyY-m$cR%b9m@$L?UcHtu;eCgo5=O(hzwL=jy+ z#3WakVZHLO8JjO;pXoMa*F|=V>Rs8ik8@aQS~#HO5E4f*{!Vx!Ps+j$KlFxBQC<1M z8>?}#+R%F9&hStANaUj(g9Go@lizde`)G2mu0<3dj3Frd>xg6eF-bsZQf4@}CZ#JE zO#cp|t3J?Bpq^NB>8O{Qf|Vp((Ut@Y8kujNLo-sUKFQhQ#+8j^c4t;Tg^d)losL?t z$g}|q`q1Hh3h)x=!B&z@u#978bed_T)i+@pz0Gconv)aqqkSjjbZ2%;6cGmC{sM zPHAKqN4z!3+JgXE0L-?`4XlnjhynPN=)SE^LcW~wJqX%X|Ei-sk-nuUaC#= zUW-#Us7ZQk(mS0%c;}*d;EY}ox3jS)3%T;@MX`6o7)x%*(_n>ReRna-|T5_ z&-tZcSvzM+am~G2O!+>WMgA9i!=8tpos@rXH> zOm)TxZ-Z-qJHI~jkt5q2HvDBf7l0K|^$S=Wf2Vu$=j|!I(Vogwf5FrBwk6WG(o=0m zB~Y@%wTy_`d%NA^t*d45%fglfAYjl_E#yBpD+=;CTDXAGTVyMS@>l-Sk;6J0>+zHr@5XRa6?n1zSYz=ta0jG^W;1Nj4$nM#+PbRpJa9^ zfFa|YQFL530J`*ZwtUY!XrYNa%I_`uu$bI<8H!X#FB{z4MK?J7kagbs{L8kl&>6Wv zA1EK|L&(;sqBMEwMKR+)+@%YWTHK3 zo(|KErm8UF?76o?K9L>P7X>l0(prvUz^!@@LIg04RrdQm=EO>&BjJ#j!-TAX8Lz1t4Swf(?~^^)VIxh!4fI(<&;r%4$o3T+NSsYc z^Hf4vA*LvhRpjoo5r428vzUZ+>{q=k$mPwU<#vc5vqna?p>cA^!UlsM2*}1Kd!~3& z+J*#`J?($S$I<0jxYriO;1hw&l^C3~Fr{3RpG5CSjt~p>Mc2v9WlL%1!|5!8d5Xp% z^G0?(!$wi`4Rmdg5zbXne*iv*q6$;wLXmb>x#!OTyCMDR&<3l)!g=jw!jsUuo}4Bi zxD+z&jmym{M;=n-c&s(qv1OReRYuDY4B32lD8qG!pDkzmN%sroS+l9V{?Tu@wEfED zK;tdkE;E1JmB554QmG7KB4NfYrk`Y`UtESY$(E;V8;ZXF`~6`vJ8E|=Q)Y2!cx{_y zQ(5_uQ+s8c69Y+z+vp!I;BOw|u2nlp1&BK|drPCFw|rGhFY+ zl1PymebAL|M79>)pRtd!@`5FWK(#urZP9!rm*e4f@oQ8r z`d-)`Bb~ncc%QO=xSH6JscOo_ zxPJe9C|Rz8*#^8a$M@pNXDYu8n$Xd7qj&9CcC5{Q(VNL3E$nfiV^3^jnaKcBeq|#K z)3`&Xt?0^4q^x}ZzFfPhP?A8(YVB6m5I!0X<64eqP1G#^g)<{Z1npy^0gb5VOf)YJrrGNjp2-7+rvXqXc?)$OYR7;?&SYpMf?B|9=wz!_k{e}`PB2!i|NzR|6^yg%bBIu~P9M})UP+*Z@!6VnMlFuNqRTWoqAL5x~ z<-Xgh)bElYX!?k~a&(+t9#9ImNNTKi@u`ia3cYCLTK*1hMj(3 zQ}amqgsY68l+C9vQ+!RVoJ7m6wk{=Gv9nR2ARLX02IUjJ|I3>=Nju3<#>}B$ODPOJ zs>HI!{1MloinyZ(<9a!~m>zJ9%Y`Z3#WSuw#C1;Hvaz3nJrY-AqjD4!Hj%VA7(Hkw z-L74Pu^ym?%&XyiS!|hgO8R@^s5L zwWA&AIqP!nVOTu2gVwuFhPe>|K~u8DPV!7aZIZsYW;?!Zw8QT4_${*ONH~_nu_=|sn7L`~5TS)?hw#@e{Kc+aFK3878UZ;uyqJ`wGdrYm%9N79a#0o8n zCI<)K1f_>uD#dep9-17c2~G^Lvgk5^;a#?0vJPR!mZmY#3DDt0;XdgV4sp{s0XaPV zspHg%y!`3+3RMc^HO5DfaI}*~y9UXL{^5;*G%?rZ)9@jabi4^G$8BVl-S6VZLG40} zE#CkVdC&4Xc^dR!3u7_dk4}X`+W@SJ`SQsLTN^ULnUxQn5q%ilw1+cu0B$d094mvl z2#)a2)#D55%@mCf4t9&PDM}=c4VchQFtg(>Dc9V(%pAH1=)fX@#Hq)(8nu`_DoDqv zz#NwnsA1|1GP4gtP(T;7g;u{DLYp`xB zPk~(Kv+|fxIt*)gk$&7Gz2r)dALX>_SpiTC}Ij8LQ{(V z(14MQG|l)V#~yjgB2(dXf*5*cty5F&WNN7%1knBAMye4ab0KE8l(gxa<8i zM<#g7I6){L$L5I@YD?0xF4w|xrXRC0l(S-&elqdIc{F&VAow&w6d_S;bfZL#5AE}j zdhpTbBDzUis{8*(6~sN`f13!kMpyK(w_@>GkKe8uoe}=Kb2<6k9&&$@GGNC_U;Lyr za1=}XiSaApOC;H55^W6s2YpftM311+`(NK&wJzcd$Pzw+T9pK&H_s zzv)(I4&~0)FXXRYy6eV!*LPVsGjKLMODtgd73AD9X+}yE=orpZ>vHi)u7tFvd7H&&v@-7J zqJnm0_-vwjrs2c7w(%Cc5Cd`aROy*bG+f6?m4_0u(qI2z`K>xlQM=;vXywatv2tjI zQT987Ix=f{8OhU=B|fr8LMLmVs~IB(q97i_0HB~Y1HOjV3Q{SX3Jq#4EVAqnZOVTy zM9LY5*49ZZUQ!${7+Nx@|3c-)FQUq)O+u$x<%hqQS8@rr7ZWVZoYQL*D^{o-^`7@g z6uJFuJvmL@go~9ei~(-ON{DspZTsH8(i%j8#ZRvkepzOaIM-vBC&+;8{x0h_WImv{ zLGw}ZTA0yI58&O)-^Q>QfPRRpjX)yJFc2wh@-|2anyskuNW?RB`u=BAH+ zuO+(q#7xWYRu52F*GfM}|M=9mJ#j;(3FS(KWRxZIMzMgaD6q?&Az7qsHW z6fB{dsl1p0cf5`)>`3am?$kkTFVQ;)hZlryV~Bg6;_DjW8TO)|n}GKah95-F}Ih_0C z%McGu%z+VRjL!`^Xe31STvfKPmED4|H$8KP*W-&(bPTBU5JPCz4??okuMby!XmPT( zcNbOBu5<#gk^I#kcppa`pKHGra=Gv#A9MfcWE6KmeJ^y;ezL?jZ+f z+?hh?gwl2zpxipzA|GS! z4TjUb^_M1sSc*Dk(}BRdiBF_5k!n`@$2WVOwPzWy!u21MYUYZj8?TANCI}kgSsM4b zAd%mBD8;O%Z9dsniX57 z=>+TX>~3OcDIL_*A}{I*U{I*Ol$SIs|KL8w{~#Bxd$UX??}MnOD}*ed-8~1nfwA%r zu8q|$KGV*`wtEV~9-|XnPf*xR43!XuukGk2#tmvvN^RnF$f{)cN{6 z#e7MV5KkwTNjH-le(Vmu;jH|r)k>j@j+StZW99GP=V=rAN@yY+`H+1JVcjW`8V=bvL~z=a)C@Qn97)_PEv~09?*{VPa4$&8%5S^G z&!7p|>B#s{#DdBE#X&kUec%!IqdRvrH1}JJo69dRD}8n^mkl)Sfn4wWjb80_>R}W| z44X)X=*yTk8o27@HSrHB1m`>sB?m*#ewe?tU>K0NHGiKx@f}yNC%zlYb(%W;>t_3( zH);6Tai5Fqt}w`uXVtEri^C)4sH`Rr$&@g#IyB?fQRe2G(cl$l3b^_enX}rR{^v>S zP!=P-Wlrb1dgm(3NG{){c?TM0_IbGIY{`;PM@km^3tFSMS&XS`U^HD_Z8W$s>h!s% zgM?O?{6=NGZZ5o0$v>OZ%bE-QT(im>{~{J-Fp&S#a?B*TA<9i*YT2&mpBoeNzkjvi zS|Fqdk+eO6K#v3yFG(kW+U7oTC~f3SO9SyNhpMV6UU+_SMagahNm`Olz5P_39mz6A zY&KTbHDVvl&D2gX@$q|vLfn>j5p}hox<0KJDgU=K)5=lKhwK7LTrtW#)}EtF=%iu} z`LIEDt($l8w1azKhIS_dnRWF#SL)>7yuQX)O=^_gTyHv$hj@Z6g#3wR#h>Y}7^2O- zM8oZ{nJ2e`r#QF5jm4BeUDs&5tQq(GH`PzD`_z7|jcmGxF|_a^ZQTJ83ioz!0^YCI zs8b!n+kE@z={iH0TBy>p-LK;x?nVpquG?tSX|XZu0M6kx8eB?!I`Fz`c!21K#mx;| z1ULZ3x;8z#RB)-kept0`EDqSx;ujSk4r#>s!@N%9P`xO@v>C~G;I585CWKrG5HGA8 zcKLE_yr52c(3dtF5>U<@K*p4#6Hzr{dRBhlhYO|`9<*Q^Hl07b04z{Cg>ao`+*69- zn8Ze03`=rBR_S`x_=#Z*W$MVum9n5Y&d6yti`{&stjgpg@L~doRV;0++;JyyJOF0! zM%uPv&X1J0{>q>%QCuBGg6}~88I{XO1QmD3npx$VX>4*{EDLU9Q_yBOn21Prr`g0E z3+m&mCZCyK$MyJSR(byobk>&6#E-WsV@}Gg1Y+g=&0dU%)I&kFbkC8>6OV^jj_!E8 zknu%CJ+2#6gRJy>%C`75Fw#-kw23!Np|R4Vzq3z;OvbDeKA{`KOY~cN5hshwa&tjf zAt~T>oKdG%)n{M5otjfVa))HZ2t?c7IAD~eYED}{VlQp8*|U4^5qA?`;4aV!+nJcH zReI#KASNRYE2L>&tbnRsAjICL;9$lWOhV?jAcOF>PwOyK{J@^oRVtz=DkymO!9v}c z-mfrR>T-jYX%0>QtwsG%qk=-$V`hzw-vb!BD!z%Au#Sr*zaC~IBQ)Fzc{;k*Am01PP6#&$H#kq&&IG{@ts8)BiY%c{|7O498g`6($gd+(ye= zRC6AF!U#Ug82h`WOylGK^)jb+c!m`a_2nYX^O~~C-=5`^1Kkm~cH&_X!+LZ=QYV?} z7bwDeUy#Gb;Z&pBi!sm;ojNK+r=I`ZqEm1D)3ZdUHg|PwVd~b~0%bG^UttN5=5p9B zY^n0wRVLW=ypS$X~AoFsTZ6q4Zhrb0P|X;YC-v&#A>5={Mai))il zG`(}xpyu<*VIZ|D_4i4~OIr~@O@s0%Fm+z%?;Rs#x~Npm6@EHy`F^5IVgg-gks{}z zu5PQF#trD~$%yIvwuO@1oeNzxxPUqWXfHIOpf`6@=pruZj#gA>qRS%t0kbirOI*;@ zJD*V+ZHqkk=D#p+FTZdK9yzx4#D>50;=+2pwjNyoZM}u{Hpp5B8JKw*Z?_aMo<_A& zRJ^JRUsmIh4;d7Ixwqua%Jcu|Z2E#Ou_@S*$HVgrlx=LI`K1u?Ki+Xc; z*k%lkN(N-*3$Kg0sMwFX@VMNCmycV-40ac2NP<0l?OSNO&}uUV;)=XhXFsBTp<1B# z){m$!l+gd&$r5Yj_aA@-X-)xmHk(FiX$?edO;40q%dsO#yw}VM63;;tw^P8kVh#by z)RX_E^n|by^lSE6<;*LLx@6QrLSjxPRY+_zTnA7tPCzGkKgap8FY{n5^ zw9ssd3QB+KA@BE(7&CGvV?r`P&;N{e_MYo*X_lgue2M5j(;vJegy(@`r!hZPx$b&* z9kXGQr(iw;bqHkPuGr(cuZCRu09rIWpKm}>n5wqew`F~%Kg`7sL5j4BVYVO z)-J*{!q^E}hVDD@7lA6N*@BWHRZeWQyp~l148!)tZ`iwcXwCN?j?lz^y{~U!CgqeT z_+K2rPF@epC9#zW2UywHi)W->=mhVbBd@X)JO41i{zob2j@AN*_X21aP_ydnBUhqe>mMotLs-qgAfN3d?-YRjF&gQCwDPSeh>A$R8tO%`D_-7 zf=JLuue={=Pkh$VUF*6-nl<(|qHx%-*FZq#Ny%kCu$wh&pzlNG{QIRTU&EjZs1{T&?%8 zYz<%YBDAjLgthXRQ;CsqykpNmLD$7)7EGdTgf!l@;BdD zwFyhI|GH`fo665DXP3#mwU?Rc=3A5c6*?qxC8pb(?U$9G_l;EgQaGlWk-7DUOgZR% z?sE@NGTSrHVu_39WW<&(xz1#1vl$f*+D-Eev{UxQkpq(iGXoDoS0|Qv8kZjIGlymH zz3K`~WnZ+wvzb6-yS}1P952m{V!rYC3MNaTLZg9-3y!0NgSq=C#9bN1LSG#Jex13H zj6Lnr+CR>AClK54*uDEea=C!Gh)Ho0p zAqfXhe7XcNtPg)8QHJoj=*G)^$GoEa&6#LCiX%!COA~AB>rReAHC)X~pMSwnzY#%> ze4z^hI!1JLV8@S?zPVa2JHOg)UTTW9`tZgeuV=@-1ruiGhhWXBEkG@q@o;}D1ZL?* zs69%`mm#elTtXma)~U`=1fKR~`5TqZALn^XT8KJiVK?YICtMtS_XfF~5GF5GdR&=E zHDa1ck&H$}Auq)~f6b4yl>$Rx z{}fLUSv6)Hfo2qHs!4Q#I`&DY+x<*{msQ#yVWCN+gge5zXmG1L*kJe8fK|LXH10?+ z6*54L5qGSk@Rv^1X+f8`w@|x850Cq7r76$Ebq1ESuG8FJ9KU6Wkj^Zk;^rdQv(iJv zUF}2`dG(Yk#2hPWuOuAsmzl^$-NL><|8sDH>&IaujVM!kaJ8J2hK2lG3R4RX7^4uJ zc}flg(>Qn9E-(3&becE^3DwNf+1iw_7aZt@NGIrQiGM8pH8H9E0`=&6HOmct&8jbCf>K1JQL;a0KhXLO=Rd0-h~W>&_asn+DapBC&O^ra!GCY+dqXvs1VnjNd>07_G4eM;=Nst`N;vfk16O8Kb#%!x3+~eeUoek}+IW*lb2Ob>*}37sqrqVn1mxL;xF5sh zuQ1VPi7K9~OW-1kK5>vK>jGgkr!lN4DJWjem`y+YrpU}2iW*0DJM$73%UJtSCTne3 z!s;uyYsw4wEX65ZG8gU{o6(6Dsk;30H@VEPrzfmdS$|~Wz$)1l zLW&>Nw!k@CqO@>E=*pj^tc7w>pG;JXw~!1VNTf?7!i+fSE%JEW-LKrA@(1tXPN?{G zCmY};fyq*RgQ}M@{!D4nYov^1mE*3qXbTwwp1N!($w{R$Sa!yxe-wjvaYlL!e+!VY zcU9bBx8>r{Qy?qIOX9pzB6_m<>%bOEKC3v#(Q6qXA@@J%c)IUYO>v!U; z7*LB3JDIs&HG!lO4nYyvarso*qLG2{txak~8GT_KB>G7$Kq*V95h%+Pw#X{G63?69 z;+^rxeEg>je#hS!;D?|cyF#0COf+?r`96q96KSpp8x}=1*qlX%mc1Q@mDZHQ8glS@ zyaEcoBpA7vN7?m=rWauHy{TWvZM%Ah_C|}XQE#(QbwR|$&Rdf`2aREa@r6f+xWPWp zEpG7sckVcDV1Bk+muwq(^4)K0m7;(8*UfJ?v2*{ns}FeV&F*tqqN%53-r+KWtDoFS zNwS=c1!qg_K2dqu-XIs3ywMYrq6q;P?OUqrjM^F33)n(RoC%9i>6~{?#%Wx-_9PHb zA?9x4Ex1w%E&TZl=;YSmT$Btuz=!8Lx4BwF!EAjG8$O4DFq)d|f{}2o`4`3UG^5^IU*L<(PsgJK)6`pX zj1GKx3b%Ack8n?@6d=3fUaPuHNhm|Ta42}L)KtFN)WB9*8Ez92aM0MpS&cbY2eQ)V z-p!fvsJR>y@{$bng=>$)^cX=TCDKD9eY;z9B*HB#&3&Z3s&3?c^k+GPLl$9yEzF^yA3jWyt`^Y&sA@0di~7wdJMX?nbc^7KvII3!ZL8|b16LuN zcdI*o*IcoxW6QDN_rWjUhc;N1$`5>JV!oV3oJV(!Q{Ec?AeqL>%a2nzGxsrS?G8o* zv`EGhy795!xs2np7b8hV6EfCA7*|Vf?ds@mhjD-E<+@p0sR8(6mE7&4yDX2a2%jNK zexI4SLffud+mPk_vDLUsD@M!8=iFFrtCIWM)yDH1UsZGY461svFKT|5OzTifL@`Gn zy|sy8fxNMSgLc?}jHrz_tu|gt9yD;bGWw{8QW&EJBx!Y+aDJ*kRGAxLNN|s=S+1u4 zkFQ58=}8TtR^bbGOh*3Oz89l`>c~Xz8tR)!l5l=Pc)=2J^3$4eVo^2fQIwDichO9Z z52+?u`)`H4l}6?k*c%Ci9m8g%8$#Q3lc<5_?u#Dcw{n8Ujf34>MkI4`Dk`sTci%#~ z*il_9TE%ZJ3arp_um=LClF$)%iqyo(X>L&(f7ntbzBUuaLozqkqsh09s%~Q*>F~*= zBCAY*btWy2RDSx*l^vVo4m$?;R#m$wmSbX_@CT>1xC!Ru)DaF zXDMfu&VK~SVp$nnwpL?*w7kSwXD!y1T{eE7-MBGcfsAglaTsR6NOB)4r=6H&3%_~q zMXtK)Fa(p$J%3e$R`FumSs2B4?TeI1W$m zt%2E;oriWbd4;|%C2Tb4$yw=37irKMh4Q4m@*kMexAp=D(FtX;!!VHv+_n;b$(9EP z1OL*7?H7?4@e?qt;SbsZH)rnO!n(A3{pXXG5%~5Vs3=WE#;Yrd>nMrmmEUI#*npEA zO0iWTyQ*bNKzt32&&+LOQ{KIV3Tj}5ta8ws3VT2ep83+pP9C%AJoSwT4Co`22OGMM zRL(tps24B{4pFM3nvEQTwXNY@#RZf}i{H7rzKcvx2*qm0)B+=D>>E+O#T_6c`R4FB zEqi-IIz2lZ=-@5v?}caQW>dq4q9(zsCbeG*R~U@ItaRZGM{#YJ-zh|caT{^r2BZmI zXv-nqS8y>iQW1m;w;mSL-NW+c-p3zyfs+VEgko~vv=2*abJ(S=Mqs6)a%t((KDb_L ztZCU<0Ih7*d1%heFLyTP7~U!#cF#{5c^HtiYE$f21ARw#6$dUx3V61)Hi-W-y@g{& z3X&B=)96xlUJ(aEVwn8KTXjo9@2y_W3y$aH<44WOy1e;cJ>rXuI$`}emh((QBc-D! zk_+HTQHdB&iGUGGmRJ1T4kwXDa|kzejDty77j}vk_Laj<3N##NK~&AvEM{L20bszl z8uuVL6$?bQG{n?5Uu4WH178iNv(Zc=Gar6{w}H$6~s##DCboi!Tx0rEdt zU+{wnt;m859t%dE_qkhEIo)TKKOeZ*njeeeQ@fp_ z_vUpB5+_H*mW$-*ivo&H;}LD{6jf;!9q|~Q;%4rDBtAieZ>~D$FI~FyRW>L| zFII4yG?5)X#ONe{2zO{$ioZx(tw#18TTX>XZp4=%uc0J3TcJ;sDRJEIH}4> zK%cN|EvJgjBd(?>&@6<=&3=23haKL6#H61Wj0B|5{#9KIX2qEvj^_hk{M;D}F7bi+Kl z2cPz7CU>frxKgRAFhT~~!A<5vcLCegX{-=i1oy20!KApUfm>7`LS44f zX^h53O20Y=r$7$!LV#FzC8i&ZF{f77yR8{iu`N&0OM7Na-+?7(s~AtWT@Y)SOCto+QcB)(C{ADG+9vJ$E) zj(wxm|mA=v) zEO=Cr6Z>lF6VrW_UfUs-D`s9B+JLRXw&E`33R?fSjpw5|kz_Mh5_b}f6;~d>IVtTZ z=u~gmh=$Tz{$lPHgCa{pmy?#XEAQ#J;)<)EoWJzpm)+W2y>Z$MoNoHRN?Xss(cfOU zZQIDqPixRk;+mlH z5gxh>vure_9avmTfr(7KHIu0Uka363XtL7E8!XZ*`($Vs1BFQ^ z={Q)?-#^+kSHy2_y?~?84V!{{#pTpsdcz~0idxV~Eosc~P1cz)j4p8u75?piMk{_A z{VW(Ja@iz4CEtxi`wz|u?ZZiz#>k(%Nt=f;unA_?I~;urjyg0A3?eA*l8dEK;-iPj zj)s@QmeC}^i->a3GQrn!&wWAlB`^g1LPP()0l6OHa-KOS^ut1eeS!}=z(YKlX}MO= ziimZH!G#=^a@W&6RXixv+ZQfXEE61f<6OXPHj!@4U!zUo^Yt=K3P51_iD~sfr9-e| zy0hG)7@0h#HS4*Df8j-cPy(){1VeKEMjatG{eczecbuhB7R64B$h}LbI;hr=2(WNo zHAv0i(eH_YIX?}4;8K7datG)Yq67jHja4N`A+T2HC-BJ?)vfD0>iR&eQoaLp zm&V@1?bSgm%JWAx@OUNq9(%99p?;bYfowLkb@fv%)2f|qS!J{FZ`o>W~a@2dXthf_?$$jBrG6&MKu_lXWdZ zm6t{w6pw9NsKB4`^J@xFt-NaAYF#f8Gqo-&b|*%wf!&*zW~}tkHnA*Wp*3c!S%Tl- z0I^Rx=_%5~2nskL%^=y^pWkd9q2tz0fu(LREq|>1-W$@H)?9JsX~&YhzW?ca5Nj&m zavWi2Ooh>y12JmZY+f&#t|+cadkLwm+gBJ_6Z7s9j|0AjcyzhwCqP|?hVkW&pct; zKTVs~**R_9GuK?b>vwm*f{5{M0~cNWv(w>j{gtX_q&b{j2 z&gcc1rX3XoL~Uc0&Mn8xf-ce4Qj{*LE4Y$yE^HX6_DG3FKkeyx=N&&Af(`9DZQ2zC zkKTXB&p6LC@a6PP-wbyDu2U&>G4!O-}tcjvbw2V64k)INSr z72T|tx~~8+K13J{{%!_@DrfK}p~Md{Dj^KaX5UK75@u@&NEQl0naN7czuus@8XH1s zQuDh3jF0x?3B&zi`ADhxZm)`io1rk^LqHC!w{E9cpJ6e6vYFp^(0C3P`=Q4f!P%zF zISj$Umc?&4U85!(7QisN<7YCA*v-EN^w8x-&J2)U7F+b`)%yj8h}A9T$(McB7hVU` zr6}lf$Ir;(ee4R3-Q3$-B?xO#H0vcCUT~JOonY$ceYkG`hYPeRe;lWbFcQ2*roH3P z!?s;JF}vZIklnB^X!7j;v&$#%*l~7)oNCO5F$qKh{gsBrMfoimEC3n@Gi%iZc|l`= zDi+kGej4TzTlLZLEG!YD?&2atZq7!-i4!-vQ^QYn87d7CTdcKVOF&OegX`?Z*6Eq4 z${LE_Yk`;lNLFDmYV0U=1DO; zJvL}Xi}?W;r4k!!pb>PKvC7de;SR^u>*`6=_~5d%*rM3HG~Ib}hCLwd7HK)c3Q|c=cQp8 zQZ=1S3?(>0>3tv73FHA8E4}VZWM&R*Le34+)(YvMd3Bl{^Df|0@Ze^^J9m9^H=irMqMNmA@XVnjMXEau96&{_E}`{|6_0D}Qkf+aR!!&&qWEiQ{w zt)X82W<2b?PhRbingkT+?Gg5-w`P?&9U#ymQoLuLb=^vz!J!XAfd%P{_*g@^u>v%j z8L2SwWK${bF~5P&{E!>a+-n$YP^gFu4w7qV#g84RAL^_st;uhJzOE0`rqXYfkHbdg zs*%>9U2#5K#xiMHbV#Wzj5+3NgL24akD?#eH_79eBNxVessL{Vo2S31rx)>Py1cG9 ze==}PpbDEMwMX{DXa`eobY*g>hdl+%%gQ%hW_zE=kZn#W*o!N_hGooBef-HqCyRmGH{WTK{6{~(|-Q^Nu&-qJVXt;$?}WWNHj zCJS%IEg#R-;79gLYOwqs+J6p(`nZBPVZ}x=W3uZi-GYk3Qout|VD4o=;X5_-1DihG zGr>L*Cvob@N=Mur5)l1Tu?R5uJXIK3Edd8Xef^!vjqq=Rr&iu8Lvg+cy9?ROb?bM=E;mn>Mk&07yzUaN8@4TY%MTd#absd2b)0*cDd zAAGs`HNpf5@SCfPu}X8JQ4I;(oqoY5?O#-U1z)K-PX|2VQMd`WA~bAz6w6sMVD|s0 zdlN9ZsxtpSsj5!cL>Oe#s0acbvXFEVAW_5+2!tWPk2E4Ah@IZj(CH3c-C0037hEur zqVU?%XmA%4WfP@cK->lVGoypzHmInKQB+hERQP|s?|aUsUBncqCm|M|}|GjytM zoqNuE-hFL)@EC`>tAm~mAU`RYQ-xa1-u5Aak`xr0xg%YHU_e}H(8iF=uI>7+!z_=c z=_N0E26ULK8<_8IJhgs7b&KOlPmhlg>uPw1lJIIqm#D5Jz1qK~F(OWa{TTJQ= zHLv`|W;Ah*ay#|M-EG}or?g=o>qPGGn6mke=J3dxe)O>N6y&lqpHn=bs8Y=-j{Pr@ zsou7_mmH|h0cKjDeT7K{i)y=Ucy9+04C&>`!JPJFfN$=cxqc=Q@$zfmua-GD*Ls<~ zLl_sgorH|WFq#z+2yZ>T^mh&GdA5ZD^e<*5RwerbtuUf95-(;+2@EB77hPvS# z^*{%ls+%1bBUbeWnia#?rrXDzl>q8wmU7j)hk{p)NK)3I;9;Q9uBEEn2yi!d067IX z=Ht17#b1%z!C48OGIJL zl@eK()>6`I(D|cpeO5W9KcB#6`PNtk9m+uk@-V1M@$WETbD+PM>|OIZaV;c`!O7z8ln3$8??>s+ z#!7G3#!$YhozOhWXOJL)euBYaq~gxDxYBFHTw}*Y6Sk0(fg_}r^_xIKgIL$-&ek(x z-P~wh>^n31g>KPk&EI^|D}DbLQYMY> zqw7fu5?z<`%iVpo%GAHCFjt5Cgz&V6DS9&W=)ZBkmT}RRm&3?5f-v9y1r9q>e#9N4 zk@5&ucu%{&;n@Bd2d)$%_)zGC6}QR4IHvEUZ#}0i|LAn#Qz8pdLxVwr#eUnJrdg@2 z8`%BV_a94^i_A51)gW9LMwXn^dKZ73M>JBcTInyhdN(DWmX!C- z?`~Fs4^ToKMJ6=Vj(eBowCNT0T}(A#ODDb@m{@)~To8(+{5DLG<=T~ayj@<8gtnn= z6~<-1AEz#Kig;4tMpi0>Z0}aMMVCqZ5P)qDxm>d zh;HXDlhfm7byw5ct&6TLtld)YR9~>GCsQRncJ-Egd4GnV=If^)7z3#Df@+$7H7du% z<6pM2Z|&AR5VQlrQ~+t5+MMa3GC)nzx3M?H0DNykpeH{eL=eZ0w~31(E6;qqM};oY z$z;o0C{>6K$?+rUlwvk$>TT6oJxZ)hsJB+Z4QH>o>p zAMduAteVOum<7V=QKItpJv^*HIIA3eCHw}BR_#4Rw*_cc-b$ncZ9)CwSx%5`Lt9Yy z=;-S}K1cXKhm|7^x4TY?poI6OrSU3lt)c%VT}JNpRmi^H{PMgp_}7lh6Xy?KYl%qji*4CatVnlwzw1MqO6%AK2(P9i0NC5W1J zfG5UBu+?2{l(y&%3}e`Jcy+Nvm(`{EU^PKmI}J^vozGi;5d0%qKEo6qUDbTFl6wMENISV1w68Gg-au;D%y5k0MX_;TfYe52b>RlStIkMYI^Mo126eMw8`2kaK z%QUrJZwX!eP(}*xZL6=g#>UUv+UNfDti0#)x6NSVodQ)4*ZkVkpvC<&*;haQQWe;q}c8fbF3N ze(c+hEdKfr&y=R42njlj)lGn+e(zbidVO(nr|76)xhdRIzH(mdyicd79;sA16OOp_ z5_S@fo4^4pc>PCE?#eUw;HsmIW1e(l_TDIfml>lC4!`o;y9~j6Z}qS-33H*V(!{g! zT_ftoCS}L9Ll5bRW09{DJ7|bCut7zdg3;wqrzv*fM69Hc@p~RrL;mvT)*IzTP9NWI z>FEF_I0Z2R$*S`=Xiln3bfYFYmHx|Y64y~26)|DdaRXCO0Uiq^V7(2$Jm!nW5)ZN? z=i}v2HyW7)T2bK(`TLC3h$>8{H+0KcV&aY4bIKHgb&3j#P*$3GuhCnPi|EJtLN=>8 z{ez|F$c=)aEX73KSb$mS@He?#w}OIsby+Q)bK&+D z!52_gY_w^PaZ#YkuGYY(xr%MCq;Ksx*rw%&_X|qAz?gW^xi24=V(bk)WS^1-%9SKq?z%Opb_cQWNDacMZXwm)sltKig{F8J+f1im7I z+k`f7y!7|qa=Z!lY8>JWyc541)#WJTDJMk3GTmRqNowo+yZeWz4;G&+1Pddf(rBSw zm)_W!+x+b2)o9}c_R5iR^XrPEgVj90zN$Na7apg<199UY^Vs5A)4c}-tt4x@_q#l( zIuyv!#xUah<=^1B+X3X{=%;bVBbA5lmxQxeg%IAnJH%p6+E$f0MT}e1oX|MNkHBg^ z6Ip7Tlm<2yuV|quT}=|g!?W(-cdYVp5FB?s7*sj%fYXr+?mqUgn9B}a%bOxQc3WUd z+W^fr8Tv^IWt#Pa{$5#dYcZxqk$04MaqvWK$^%y{j+^ASN-~vSTwEzDedx>>z%X5` zzrLHA-B|1%1g$q~CvIqzMqi!?V>-a>VVbP-rvL!c#o)QIhX(kvOCb#{fnUf^qXu_8&hjsan zZ`qEgmp-)uuXAi*6Zfbp-gH>$&C+XvHk?O=l8#4*G@6227jgJoqb0fkv?LS zyrendq$k^iFZxtQTt$q2X&B_|ML;{&_$YN{>J6M9Pc0iBiSe1^lt%KtR}Y#8(eI^= za*FbwdqRxeE~(9ZCDHAkoVu_WZx9(SDb);T8jC47-Gmpth)v z4m*}>LAxe1Dfk{~YHCsBJ7Iii5}&fB@+@Ie(BRZ|ejk+i+~-GkL1D4fxbXlK;bUR# z^2LL`O&sG2WZQMaAyTXUf{AR#XT0)=NQSrH#VCl1O5v{IWUsj(m@$6Gq>1v9fJdM} z>3jZmYj)X`A-S4MlQ?omTg33(FW{DuUIEiC|LH{vUX1CVY@0-j77}IUPkc3pg(r{3 z9Tqdc6!_?AH&0q{JQhMNA!TXmf_s7$TY2%<;G^=N;{#-?xGCCG$dWH31}iZi*P)n* z%OiMz4_h{W)Or2X9=ND@?PsLFDNTS=^=t-lgT~&D*`HvF%Mny?C#LnF0J6Wj8X~YC zVf%1d!P8YKU*0<;VRb$wWStwh+hcak0fD$8$B1}P>a&!Bq1voAvZ&Vdw{O9#bJwq1 z(<7Bvo#z8g(Q)y%Amc>uE!cZLXVm{|&G=3I97ajP-xW|FRxE{d>U(ZmCW5ow^2)6A zh3{Ec3NH-Osg;HEoww#h8)I1J5%+9_xL5N)7gsCqzmt{0j6CxOyfLzY?Lha?%_mxlNn9LkCC;*&?+P5~?FU5TnV(26i@Eny zkEu1C@ZKfrytmGa9Zg4x3))IqdFsJY`l_2SNf{;p2IYDz7XigJ=Q2s(R8df_AuZhY+v345Ycx2hx%_M~TAwf7FKtwsa*>`J(;XfgLu zDVT(-dX0i5T$;;aPENxcF+_vO)hDfRLkYVF0g$?k=+7>gN z;=(d5NP{8^CQ{Xgfi@**Xh4~C0zq)3{OBcazZnt?PiT}*$?A*q;+sLBnw73T+%sA& zDhJ#kt1!!|ODV&7QJFmuXVVv`BW~6Al9i7=Q5ZQ=J{Hk!`@v)&h@fV5K5`P|_z=~4bUjwbE?4%mc*$4D1JmFsH=0pqU4z4Xu}ghVbg{7;BA15i z8|O8)y2e`IX-+9=9<|m8UHR!{ccfPqA6u>UtiUmL)bkj-PffB8P;{Rd|8R1s$6rT& zcgSSz*acY>1GUO|GlK#lJOScS7nIXVnMUqFYD)rmEdRG4RFWCR-8{Fp8+W)^m5W*V zI~R-e)`g(Q>1)OJzOQHO3^czRV0;gFGvjwZxm3>clbOT zT%UI6R5YPgLT!jeS&DjjJ(8H|$Q$9CE0SXP8aR@wu)-Ie|fNdWN~4OJLt zO+adn4*`1Yhz1XBqGSM)Tpl7nz*Je-KbBs4I$uT(Kso_U zd5BP#Km?mgKROXknw9SRs@XU=BUl-FpmN2-mP#$>GaxK!YG_g`-FK^4Py{GCtx&*B zzh(?!(9v7pp;b(uY1@+BqUuG|QOrpQZ3EkEgLL&jg%I1q5Mq15j)mABt3GFlEx)sf z;^SVH2g_7aHQ{v?@I2gFjk!npr4?}85x^U9nGZzT)_X4nuIOD@7f-#N(ihj?a2j=6 zu70kk31boRKAbkH*izo)Pic*LARv8==+kCXsoSBeRGZRwa~UQCe)brEVt{%`J5@r> zlS|#T%B4v?qAs_ncbOsWPVb__pjLYN7s9;Y?x5I{CqdHgIyTX zdj(4=S%!O?_0*Qy^LN^B+iB}J*P1Tu=1^N|yUhFNXw1bHWt4x_EUQ5a1^K|zz+M|S zuFPdwaA87~k6my1EgGMe_d6U7F{rG3$O|k}MxsWy{_G3E0S{XOvB%Sdh*DT|`?zja z-tS>@GX(77mqk&l#K+2^F9?@*#why2eh;Ir^Q!&7Vo`r#MW;1Lr^S8w%ulM{uEhlS z;pcB$(LYi?saqMT>Vrl4pxx)NTm#D8=;$97j*>j+4nT4UqifY3R6<==+4&2C2f2FI z9Tn9Otm`KiIW)Ocp^*Y$7)sDZG?^3v2q!PPFg(WV2%$i)b?(s_sPtH{MU@`K3=nZ8 z9Op~BQ2hFgVVaeykX_M(83tZvQ|8~{wrni?0+~oB!J_G-Y(l)&nslMhukUGN!@NX{zFa+B1f{`^L2jH;8s&#? zlItMs#!^A~u#a&BYLvF>D*?|(%ByY(IXLFvc8q&E~`fQAsAaOADCm#lQ- z=OnxA>?uB92;RsmEWYWR3jW~~2&@8X*kU3)>-rcfR|iPxPTat&=z>`1BG=~p z-1lzUv;WDxuckp>$8<7Zy6TopAzvyIO|Rq6{1=Q655HOM4_h&?0s;9m44=_5<9x&P zUH>LX4PZt|_Jt99<)c=~3tV#8n_US7ge$SbHxD3!sxNF% z)7(g8u~=)VyQ5$YoL0#iIqmX=2LN*yS!L?IhP;plYBXr{r|&J3GDC6;j67UZx*&9; zsqZv=fJ~2D)40vBs!bEmnjZVFV%!(EgY8x4)U7d)@*~UX)nwUNc6vwVcuY%3X!`my z>fPpsCgIPy1Ix$&(9#P|1D5U0XZTH*tgE4ww=EE-EV!7xJ|vYrXN)k=_oP= zt!I^`55{DeqTy&v%i!joJmV>FpPN;EF`(A)F{!~a{08VUvgvHPaKQWO^oLRYm^v0v z&P**t8>T{Oc(Yx(u_+b5;t9aXSjW*p1enfzdNSm8ggXt+oUHVZdl}|RIW$QzVy^Hn zB@MwxCf{a05qK}3bXZzJXD@B2)IeFlC2^*$TBR^mi2zYYNfa)}e$PV+jUIkrNTu>D zSyd~z;~SO7gT+&rW$kdwVT@~o9>GR(q%+)l1T8Q!5)`~QS%wP-&I}2D8b`#!3 z)VWQRHvu|Lxj0MJNR_=_jxRbjAqxwHsjWd5^BZ zK*&$~oJzr2nXO?-H8Y?0O5JL#Ko-q_66+5&pEFnl*_i)0kgUWUh)wf$$tkn zsbzj-9|{R^(}n=R!yfhAR@HvPYNVi|8IVTV)~j|q1j|i~HY!C&m{LTXYvz5M*1daa z7lpS}7PR;5)~<+dNF492-%0kHI<8sLUO_i%6{voDK#Hy>KS;IS9DiILRc{EHKHO*D ztl0a77pX|nJE4h17%7FLue{+lz3 zCuzf`EC2c7Jo=(e+e2MwQ}QfJ$wYMskP$uQ(Fv^IhH0kq{1S(FHK4<36?1^X(A?44 zBbC?AGjxG!$x^^!__Y)(PoT3n zV!>*kHxqsta(X0H`95#28DcOWnJr<1@+lEioJ5GCym4SIyURXV07=-txlR7slQlwXMJLW57Bch3MA?Q==>CWz% z9ECk|-hP=%<_8XJ)0P9Mv`~G2bh2`%5Rn}*K~o%*y>D<;Pj#n=Y^C#9*#qYjaN_nt z0uf(krB5~anK;QkpB4+TCQECdzF$t@mWyG!2gY3oj=^OK$1 z*X-|VZX@F1icjI7h6ZhzMmN0R$g9WtwB0WohZm{ZsO{YL!Hwqz&>tOc*w)q-8q14( zd@&6rDW%v{_+4{x5ie-MW6qvzvay~&mww?xo#Q_jryVyF43(~neggwu?M97KSdt@g z`!}0zd~#3MpnN{f$IWH#tFl`*){pZU_IYL1_P^!v>GeYnu^$|ANIdO$&-Lxl78rc| z|J??Tt7@kCan^Uo4=oSiQWOvnGx%Zii`a3n1YJYXd-KoJd!7R} z;)Mz!?8sZ9!&EFMtF*pH>`Lu!aAS26f&XwfdJWywsx`i|T3(m|Wu*KoD9*x)SaaWAe> z0&?ChRr+aDL!yXv)Hs3$7uQ4CfFoLggx<(DU{P^P?1Pe2t9nDB*!Qx$Kk|`YX@kOf zt?Fddj439E!OW=bLF)K;4S@xIXtgPe=(B{ewOA(9@vX&v$ssK+E5Bk8xeD|VEcofs zYGxI(m!ejol#t{8At)uCM4qEKkSv}}-Lb1#(}ovFQB^Cq;C!Sebtum3CK*TL6?AHF zmPIHZQ;K!rwQ)JYhs3j=+;hCOh%zlHE1h)`2XxR`NO!zRBGDgSjZ3wSlpd`HJ6S%o z_Mt)iX!Q-eUnYjN`j##6ybD)YLMyk3zs*bRf)72XaBfZL|f8LlpekVJJR6e zjR7R!eBN_N%dMZ)l0gNQ1e3NVic-_ZlrCc#GW8Sy z7*{9`KN(C_5JlTT+!f|Hdk>Gir$Md!_&-(*Sz>U1-h$Z;h436`ZsrXD2?>NjDf#*`{|tHEw$E4Uu?rt01BTHl3An?tPj3zv_y;_l98D z1?Q{6XNCA#%bXBD+k1!NXQiDV+%A50{nH=2^y$slKhtyBWOe++EW7@h&aQ521v>eO z`|jI1<(a29Z@%ij`>&ro{kHjUo;>Ha7Ig{TeErjp@CCN~JVtg@FF3BJEA(He?flzs zS=hK)*phOQo0pt)>atS+dF^#ip3xlG{y}quZcAs-Aj0LqL38U%4-4a5gfL4q-i7}e z|97+U-_05ScmB)6@7&b9s?Cz_(2CN&tOsG**VU6g@Y1*E`*@a(wYT_=#{0$iTe4sH zUM~30o7hXty>3nl)j2w*QHx+2Aqu#50Gt=uk(QW>H^X4ne(SbKZ^c&_WC5D1AoZ2! zOs|LE)-O8D7Fi4&sh})8aoELL5he01@11bTC2<0eF6(0cH{4foW3&E;8)HAu`Tm9t z+tZh}>}B|4?5u!D+T4E^DZ(kVR1T#X<3efDM;?0VxKP?rFi(1B>*8@2u+!9qNEaJ; z4f)31*{uKB&H|jDbps7>j(097UqB&6n|3r<^yi1D@o z?gVlL&TB>yT-f8rV^lavaL1H1{UP6=Rg&^V)Fo+4d-dcey1Ejx+Op;P$%pNKZQ^NS zqSsG;?PVo69*pcOFhDWBAfU7Ijgt|%<_OuSl;m~Dk{@o2J`JP=S`O@rUQ!YyK_uh9 zP%00m0IuLviaWF}E1z<|xwFjOfl?+hjHm%8MX!>3g)R+p*jenEazqy?!Iz-@c~Tv^ zj*U}4m3+qCkCIqn-}NAmqHM_(LrU$fAC#$m4HGq0OtJs#6qS=Yi1C76(68DrtE_0N z4$8|E(l$9~7z8et8jqpnNQ2e3ly3Iny?%I4$T|qOAZo#H;_^K_N&h^h2Oe~gs*Rm|7B`F9V?f`j{Kp<-Re&-8!TZ%S=G#MwmVK>B0}Ansgu@gs)xhdFdKOR9^Y@ zwqA|inq60~rRATN&u%99*Io3OO$u7RP}sNTKbC%fBBEIF8S{CQ986w8L<4!$eYOF+ z%W*>b=M#@uims{P5nvb(BjxKJbu18|Cf13F*EiiZW7*(vFn!2+92}Nj5!NEef!080 zpEq8j5Qj24rH+K0Cz%lA8VdmEJc6L=4NB89(mwTMSTYe(t#b6WVOI0h?9io|N~hEO z$U4!ox9uX|Km9>|g?g1d(n~P({ZkgcEai3yTpny85rVm;Z{-y1TOS$_FhTrbr@Xw5pqMB#TU}*&k!?6==FgLTxQOjIcu6EW}!IT&_)7Pz9pwL;(;^6Z14v;=N^)08KDVC4}P!?cT z{>{N5$S`2(Iv@r*IRTq~_0$#%m;mR*aDeSg&rYcmioA|7kSXl+=w_0 zQooZ`9YZu$H_Ms599SgJC|r)Goy$P3iTgi`%D5A^YRJo%{6qRE*TXC@$lrLM=K@$A zftk`^Q0}^Qo_W@qWv~^^iNHE}ZzW} zmnGJvhJBW-wl-ia9$4!+H&R}DfC+=F{L0sDTkdDFTW0!j9v=)9eX>@&hiHZ-i;b7& zNU8!Kl5ii-EAa$v`Q0@Q=+2YOLxJa>-+=glBqT0{SeRSAVyS|0*dtb#?l9k#g}Sva zZF&NB7Sj+wkkJw?l^?s=@Fy_ZTKTaJqn_+R*sAawEFSvot5gGOi*de# zrwD}kBvFf_f?Wq#lBw75@_>hGOq!*MXwiNQ6Sy@?{Z-#u9HoFtKNN;)Q`~W8-K9HO zqR_LfV@H=Lo;YxH(L@Q42PlaU7xiL{8%aq%y5798KBK;AdL7GPV|^BXA-|*GHhYWs zyb?Z6{*GDd@@<1&0#29dvmsZ#(_+1#k34i!Prv*W zD`in2m6uQf>s?PfNwRI3PQupNdTCsXC(xCOPh{o4^xIyPS+CAlILx=5)|386);V{$v*j@R(6e1^kK-1dkC}ybl>7Q)A(v4SxEmKk%TlaUV=*Y*jj zwi2(*N~>Ov#|XLX9b*b4B;U>DuM>f;C5$*g?TYjYymmkRR;;{*WriWU;7o+Cnt>hr z#YjnkiHAh`@Lv;Vr>dV7@n9-i1=<>CTGwU@3zWLk zr@I!17G3Bqac^NUIPmfNTT!D&kK_>trRCIfk5K~*;KQ|D$O+_YQC(aMr0#*k9d}t9 zDG^+UCq>8&Mt6D3CN2O0)^Wq1TNTEY4AtPrJUAH_)Epd7|JQUDKUKA7U zd(o^kux|kt-80-H|mY)sUQOaCaSdW~^t+)_tzHJvg%$SoF2U^Rwf4Ou0=?6Y`$ntR1S@^n^@dZ;Ik2B&SL30Y0@djh~mS1N7kT zm;crXFps@v^eIz!E ztic&jn|9WlkG6CTa}73p+q`kn#_Dvr36Dmp-&iL}mgV@ftFkljFI;b8Y@Pg)+kMJWP3 zHa$p|Fm7(o0g-IY6)j~i%(@O(fSOi2j3OG8Yw~lb!;?-^={!-cQfweTv!Z8f>I~5V zN9_Y3nyKfpc3zZcYXoK1(1DyF`tqxchM#JKJgE#0V|FG?yA+9j-utH6a>fDZz>1GL z#u7jtdfkoinT@Kb4qGXVp$>xb=+E&JGk=ueB|C=;j|nnx!K|{!){xAVuGczwdd;6h zbj-FmAzhGFO_G{a2rz8KKr{7$HySf0rZ`ghKWA&k!YMt(sPXel;>EvLZa(D{&4b$a zrLQ_C;&`>KE80|PzH3%~;=P_`R)A8}>1j-%?*Wv~<-}k`?z*EXcfaZk)qBO`4h|^~ zEh%-L8}n@mx<+bFu7n zr0#dzAp`t0Bc1DYMw)X`O)1n8Tn}dTLJC6Y*hCUZuQjFzt2~!hMb%JT@N5){J0%32 za7_foGx90xU3+lC?7$uMs1S~s&aoH<>q2CKqW1Z-kcw`043iuxNtL=TsSzUpp)b@% zcO%uE$Ii0u$%&r;?HB&ou+vCQ_)8ffs3_i~bB1^wwAK104n({zC;=TbaU_Nqiaq*Q zS7F*FrX%iciUrXL+j0ex38Tlb_sHIhT+I{>l~PBUoIoPlity6WDtD}LJ;df^tlYfq zlw-Eknx1`kmF@4dCI-@wkxPBuThFLAr>v~n&0V6XNfYD^QIAAlw z;xQ+5stx-v3nM9uF9?JNt!CxBr^$~JkJyMVvTj|Sizl~Pwo|5kBPhQ$elBw@;*QKV zx-0J)^$b%eO23;Fmrs7lSPVhNx2Az}gAI~69yrQlXyir9#NZL1vg{pA_9kh{@EjwVk^=_34fbbXHA&!j0}PSnxhiV$q&G0tJ2CQ~Fp4~gIxdkf zBbf(uO@6wR5d?DigI%2xn>cqE}89c?z3+Q){|u?L=R$K*5Q1hj$k?MNAUt0X-C2+ zk^#3>P`JszKKF|uqbMBI&=aPqN|CF(Y!EAS^vTR+uFBZ_;=Dtp(n!Z&IxLqGx%dCo zr5=yHbAj3~QOUHONux%#$~!clOL0z3Orfbf-ELrJccz2E?l*pnG(QwQoLNzd;u;YD zrFushBXPaRwNG%{!mP12`s5?9&^RI&i2u~ znx;B-tNLCWB|lDwvF+570dc!;21P3YF5V8J&b1w8g4}orDSR zcw5?$%>VLFzbCCHWWGsjRzGl30*7#6O_{W7E9^7vuU|ThttE5s-%m?YDDJZ!yP(=s z68GLncSu%qlPQK zS}Daf+CKysK3Gj=`hb1P}5T~qFX8dP#(nX(gt^A^Ucs3DyTviMihpT(nsqqrn z%m*L`Pt{V@)e|l6kx%Habop%-`m2?;F7oR$VS%fWW4VbEy}H_81Y?7k5Q8+BuOLL? zo~m5Ev8-_;WcZBLojKJuI$*}s(x>OmGJ7svTv0w*zqNFSzQ3QmBqsdkZr_5hN&EP3++Tg{=@d-#}9aMfH-w=#9z-PW8z&WW@;Pze!6+Bez4 zX*yYCljau4c{_L9Uk`SXUaaU&1X`+J5z0xkOq05>a%XAxI{3P=+^%j?zfTnF?e5Lo zQ9SIz=!M;+f1q!4^Zz&Mb$Sp70Qm&<)iQ|Ws#S?_n?1x|iT>NN(yzW3=8A9Mp%Y?N zJ_Mj7avn|(pq#OG>nn49kG)L6mD-uAjJ-T;6TrbWeCDF0p9QqgqA{qhdx$U#aV-2H zwB@^~YxX=u@|{`t?70^!A7amp9;01PI6_Fst_htm^t}6aAq2}vX3aFSN8-oXG(45Q zns^#buzPNKRC^V$q)Ta`4NL^QgI%Vg@(&t;9sJ@&5HE4em&rd;S^N8NPDCktVgfya z#@K+3dsFam*do`&x-4-ap-&8%W~F;ywS8t(@OmgMMUBSsC_pP4K&bMU3U7CY$bygSfyG(rkE_S$Oweqi#-xZi4=mzA zPI++_pt#gO_g>=O*{uATE4`JI{Rp2Fq8htJVJ)miI-03vwSI7>%8@^FrB^P*9V(B( zZXdhH0%qHBa8YLgFM{-{uSRfFPNF6VnwN)r!e#&z5Jc%gpl4SKp{%6%#StWZRg}w$ zpDa?EhaxFxN8wp|8=j(d`uGs@N#8fmsP|1T%5CQorUdIaqDZ%)gvqkv1lCYSs@50~ z9QC9*6WRV9QJs&w;I&bkh(=GtapIT712u1)!8Ywkak;2yL_wdGe{_WeDMr4H?PU~9 zx646e<0x!>rX^9Z-$~_;X@%RChs_{ufsrC`LTcs%p65DSwC!=fvi2C&)`oG~NJmVo zj<#8=xxze%-Y`ipEB)K&0+JTpeS)bs#$8ri^8VM;BD*L<=gwnJA8*%f0uBDJ)HfYQD@7En6sJ!?(|N^S0^@d;M~6^OBFA5@a3Z&v+>uB&Yqr+#-0>P_}ybQ~;p(m<@uZ5=+E6fYC(VOVApNkTNn2ni{*%4Z*v zO}3U?g0PgD#my+-t|!V5^{>Tx+n3TbbAwixgWuKkJ10eD48XV1-B%O zJ+f-ai;@w+#lY)C@S8mF+AVUY25}SQs-un`C!dp;hauPEVK@LXGXwyrF#P zV~SMvFtNN%O~htilP;?9D#YIblm!J`spNfO<#fiZ^qs4spm!aVL%n*=Z4`;>FePE~$tQ;w`aOL5)ge zr@rqO>>P6=94wb4VX=Zci>H4#AJ%g7ezIS)^3AXA=-D0m85CNv^jdL{SVs#~4Z9H) zV02h4K)3Su`vD6-)DA1xzR~KCix_Ul7ZZeDIyWMPcraW|SSexZuEel%yq1||aw?yI zLbi|C7DEdA+Job8$}>kU;|l0;B)6~B7#!AEntyQ26Tcz7hku7Tl&E)R39ca-M2+Tr zG^F7?mn-H)Z~o(#xwF~OIxO2xCt;#-ZqSRc4FL63RdO>2t0e2&tJ>;BGBNBtSsPln z!~}nK5h=$~R831JCVwDq->>f?OUu{P9fwGoRL}Ot?%>s0zFWh+8DD~_#Fu*)qk}S8s6E_bp71H z0{@zLxa(a08XP5?!nF!l4-6MwnA(~~ap|fJo1$14 zbKlmWHMrBboZ8FwdSUTqObd=TV~?e)0XMX7H8~D|)7^|QkQ=`&B1ycv`XXE9ZS!{v zs|Zcx0&s6ZdR=^%|4!MsjtaHiXWnC;foNto{7|?M?d}zZ=;rYXPPYM~HWE&&&cm!Q zKo(KM*n$gr>#S#_R`78=7kxy~XrH82jL8-)dOOA(wE$T^tq{Kemc^~dS~W2Mt2eJ9 zMPPRR*lhJAF#pJea5xc#e&$H&l3k&Ntn}KWd|Cn0(8NDx{cMu^se;nVF?6I=`5VoG zzr4Fg${yFv$Psa@_c_d_yp%rujZ`LvnzR>r4#wSeTqw{VLj+=&Kk4t+?5>v=bNB=2FaP{!+ug31zR|r}Et&ZZOE>Cw?LLRA^#`%{3U1v(alrDISe1gFpXkPzZ#_<@@m=xo5*JbpFptlx#PjUU^ zJ*pPst4@w1P47C^G;C~XpMYs`SSM}8TE}LSM5JFm-NR(?d62-i#)Z^MD|H zy~`^uQR|;;S5Ml>Jg@dx+(%69J5qs_IWH}^*si5jgmv1J=qVsWJEIPvo8*a>+M*^f z-U)DQ&(26D#K@W*SP2-enN25{{T`oCXZpPvNwKSE>%zsv)Ld>z_uo{vY&p{NQaT=j zZ1SVPI>N=wIQp$k1DA_dB%IOTBBFOY99e16dNuo^wsTkb2$phkM4n+ep`;>ZrR+a^ zv$h%Y6_}^I19Ki79rgC+162ZQ-2p|xG)eYpcC0UdPTZXLy3wVj*Rjb?Qkqm9Eoao2 z3?1uagbs_d%sBO=XJ+rdZFzx)==l#8Ti*lvx{51rTC{OfF^zu_A8&HcZ3};*%-FcX zt0#~7>A5v?n8*_>R_otd69fHd%)$zhEaKy^@Lc}nqlSgkPYVmfSUEtW4CF=lFW1uc z5V^9hegW!_q_)XG=G@JwucO%gu=)ii1h($;z^SU}zIyVcx4&d`t`s9?fG_&FI*1d; zyB!tN9VICy8x-GK<^0`bf$#uLLix5xxyBDzB{E@MP_8qH4Hm5kNazLk-OmTE7RLl&wU@!fdt z=GwmqKb9y)s9Og%TDa;C5JDk zFI`)1`eXMm_KY}f9VI~C6ZfR)T8nx@G7!Sa3~SAZw(XwMxj`?s--n$Fm!*t4KI^aI zcIL`o#Jm(e(i4p?EZ9au zC&48L)~T+j^-7_r?fbGtRbXR*Q#K+fS_?!OcNZBOo9TQ^96?WO2mVxWtGnHJ(Yl%S z3wVZyxRKM{5w>G*z(!^`hnS`Qdd~Oo5U=9@7w>aHywB4+t>!!{-$a>G(sb+syxz^E zpFlqL8jNTI$O1d&8o2DQVU);cC-9VR8O)v5?zV-B*i3=0>?b++-3!x)Zj5KMo`VM0rGn+Ob1Dq&b#a){g~BqPr-NO6NXUMXU%Iq2CFFvJP~#;1yf#CoAFQ*J_<$ z5RkcK!p2tstxsB>z3KP0?!h_Yo?=&xODTs-t3X`izw6xi z4wB@ke?YCG2T0+F0799`cPDM}4-9jq|Rt8_Q+FkrDk86V6I!ccWQy z-wb#Z`4-%xV^A^pVzf7I$ee3gdGhB;7m*tQ5^DOW6FgI6gskevGttrwr0;b&kbYLF zcOe8M0PvggdUN=ghGiqJ+*)c-$t)Pmb`}qHhs1VKY;?dACX8d@LR>-tRTE&k@Vt^o z5QYm^$8ca}A0HaA!1kdB*~UdlAH#4K;5wZMytI+TA^$PfeR1U94Q6A7+uQT9`hu4kC~q zbI>EO4X^D{sd{{#h@bbXmTH~?SExmM?st^*7#wen?>pYvS62RTZ@xw@2*gS9*JE!o z|2a)!2Y|L|*kxHQv@ITMnPKw&M}9{_+k|R}O;fftQ1C$3-QQpZEhtdN76m|em=Cng za(ob{gw@%dnt83Tp5Sh)D846L*91lqcnEWcK2lz{srDyYvvAU&Hf2p#Fw}j#eL>w$cD-0v6x? zwjiQWmUL!~$Md{8{EmnIFjUnFv@supTO->r1hWt+>S`ENJj$H0o#Qf==tbTKa%t~Y z6^i#;V=7q~)_TE$egG;&-&G^^=?)iZZAw-O$JY^dATBKQJzITb16+ zF7#tVFB66EgH*pd#-5z$nzT^qSgICN`-qec7jj2K{I{4EX_gHIv#~>oQB6P|@WfdI zN&vI$u%-%(Tx!$ws8Y-Fm=Jw}o{%;D=tyoH1fciWn1$jxYBW0Kou7uCc?|^=Bt(zF%4Dl*cz}$jbkDIDL*?)$ zyeer>x`tXP{tle61X*(E0#U4r%mf7qDYGSoJchP%=bBe5t5oN4!7BOS6z7M8!kv!T zt+j6P4Er8j=H}y6DzT7!{I(fYf`yj!=E}T|@$#$3WiPNQoDM0RW;>%}gE_g>Z6NK= zEnNkLU(65>u<_AHPoz@_n`Bb85;?uh!=-m@@}!mGYRlt^O`Sv)vRi z;JNjMhkYn?zrf))-yMES%#gROpZuM$b*wXa|IGfvtnQ@!+t$3L3-ttl`KTwZW~IM; zDkiN4)>!Q22Y@L(Q_q1te*tI5xQnbVDy0TJQt3+P|33n+GgT4Z>MAkyc6@5mS+p9pJ^Moud+rEvyrDHIYvMs+IFoc~iV#MEDTbjc6g)(wiU@+)#VPrR*1x zYe?b;&xUP&`%NIr;;O7*qEh$e$XqAM00-+bwS7YJy2lBJHI?lJ8H)QEVaYThyHMbU zm$<8dR7b<)-6;Gc^8M_pxoUF`D4mv=lgCRe% z`Ud=dV1eAm?~g&}9NQ~}EiwYh9d8|0IX=|b7Q1r%w?rTjISXxq>~bQMP0R!yS|3`c z!7C2O2)G9IVAURC08t@GX#~c3QkxRM`iGA!COw-QTzi)`(YZ0PG_KtEi>W{q@P27w z>~12Q@Ys>o-+;Q%iGtxCZm)z`Y98&Q>r3a<&v1YTNRI{h^xIo)?iH6(fVKf0zgZ#| zvlsp1X4bj3nf35=_&YA^pX+yl5>E&lIU#Lio?p4Gj>6pFrJWzVwEORvm$qlx#9mqz zxHErJ45IODY|dNkX|iefTICb@iC_l-@n}@j!EKf~G&>I9&KUEMtIER>MlY zz^XI0Tiy}hU+d2|Y=})5Y~$9#OTe|-w5Pr#3NjDpv%p_FKOyY=gtYT92TgbBTL5Sg zWbwt}y8Qj)Y;=MJ)AKjHVE?n+<~!c{9>F(<#6+k>VfYi69K&K1#NyCdO(#ht69jS5 z9U&|)x+q#-MtLF=8Ggo2O}03%k^&QhW^h;WA5UKaVk6X`(A^FP6SuOaZ9OTU8nQAh zV2%TAy#W{kqW|d+=S}=W2U~ar#I(at{_J0BG$n&`D9^EcgMxFX}?UKnrVW$R+G__e+l>zN+qWS!vs4W`91% zu6ax|53TeqAr&QXE@i&;-XsG}sMCrhBy=KfesC92OP6^n${4VuZh+X~?Ge){+Xl(6 z`1T)>v03SJuN69zUShLV%}xq|f3vnsm9uucvz>ENpfbjnO$LFbo|S2^T0}9vqP5+A(ffg- zXDP=zY|;&-8fqgEvc}se)UK7Eyd`WjXErP+>l@0p1)3gmyB>#sb4z&+XWC|xb-lL zR|z`q$@H4FbZpa_@^&jyKHv2~w7|=+_!fjOdkztCe3$FB1ri6{XV$~6FJ?f_w{#;7 z!{!9VfFov(F-CsM?nVh0#os{@Qyyc$S-MpcH1K;nE7GRpjle2R%@f0W2 zV2gbp#}gXbAIJ@)dLBRZ1l%@kjc>J4Ony*T_e7>Irs$p@NgYpocJpc4*T8yF4H+nd zYIkBSMR^A(=1DSchT7Gy@WjXNJ*=aZ_GOcxEOi;`$}MYt3KlO>@_3#{Y?(M($Iv+| ze~tdXj_chd?8w~{3ud8irTg+(UKAwU_FY9H5L?F)HmiG3nKAubbjOX04a-d?zz%>Z zK%9pogKM-=ul%RSBF?gD%&^BlpqW(pO{}$Mr#@3TD=l3UHTb%9#>D4=(t+b609TvL zOC2~)d_0|21q@_sf9u*jWCy5}!eRzO!;gcw&>@5})ZSzuYP<72^BE3nBb&z}v1NaN6jBoS3v{$cB_E=v*@u5&=e z_=tY({PgK$=;0m7_XUz$p@#ISlm;j+6nYa#QcPRd$~_JuARJpT0%;1v9N7WG(mtii z7PKz)W)MqSM2M+PjigrF|C^rvT-kPx{T=zp30}h0m#v(BvM{EY(JYq^kj15wRbF=0 zm>o9Hm@$3C-?Xy*oZ(ro8qWWteBF+%i3x{musX_uD?j)iAiZ|gP$E91chbXCOH=ZP z3zhU4cM=qHU2>Tq)fIe_!W11D6E&v@9)2uddq)hkF@?I28A^mMG|SQVV0@t%cDrrb zBkXc(zRTs@y9y0ndj)|RVUsX2VR6A=#Ru-!S@o)Vjo3~5(rM(cL%YkS_Prh(7L(f4 zvh*_^UoD7n!SOCp!=@%GtkpJH>o{=IDoCGiH;0;-s5GVNTccVk3^nAYH66F znbV7qF{d}3D2a`@q6$&fkGeMX-}c$I92|)IYBxmF2UC9fMeBzx)DKL-T#6=dJr0vL zC?3VE)G5EXDJcxnP>~3|xLd0;N2Y%NSZce%OB}n&mj%!@ej`t|)xryYye(_`!11a2 zfT#zWj2dI}4j_0@T!lT(bVA{;i}f3t%m+F(s1=xdHs$ea?APhKpwj2xK1W)b9cmRQzZth9dS-S zg&TF3U+Pd-XK*f>1ClWA$C87}f4^DKimq+xS`Li$J)IkrC(Bk8i>NF(ftHU}LZ0y( z7Xi%V;w^DK=U+z9SyT4~_>^|rsB_@t%Gm<8RNli5s)==nF=TBgRajY9ML+HG!&}cB zv3VHhXQehqplGXcezQL5v_igi3egahcmaCQne4KM?Z*I(Mgm}OXc1}ahh`3(PCX*m zOm3rO-A$EYEHnJGw5A-6AR&S*>`)f4xDd|DAQuz%sV9~$Q+kl)UdZ2?r?aEo*{S1B zm1zedG$a5Y;qidw6^e@}U7koprQ-&XnA#793qk64+#vNL zvJh!P*wyR>hrljPR~w1zwbP7N84q9neh9$OkZuSE&Q@>k6dkdvn25nmO6*pasS*808E@$8XUuY6!SZ&Z^m*>L?2m4<`LrRal%j^QrMkdQ&?N6;+8ZX7gS2tH5WEF zTp|1W^OAyq&#jH=LDG9$NYi{(F`K9XXF*n8@}Bs9sRkYy71guXj~yi(vqlqc*W^pX zaoAhzz!SHZlV5xAOc;W!Fq^6A*j*gg>!WMsn+O3~d#g?M4hj_bdjAnB(Ncp23zwjF ztEavtXgZffG$Ro{bRidDwnae^09h=%Co$xU+dHgwLI8*V&aB zN32b~{au3eZs5L5b_7_$r)st}V#`y9X0 z;);NnW8Yieu8gP-gVeS+c~FD2c}U0l-=+=NulYhfaO2-(G%F{)593RU#nDK1%AmrU z@gW!>Ws%hE#>ZYyWy9Ln7nq0kwe)#ESa~LW5G-po4o6Q zLxg5Qh|s)n$09VB-196EnnTw926YX$iRcxUuN?1~l1egqb>`v@Ag%h~5V7G0X^RGo z{(5r*K&0T5oq--62yw#*EP z`l0QI7GKW^EZPzCdQ|Zu!ouOw%|somriRbsTQjdcK0Ebn34*tF*4Gb=sGH_YUGm@l z9~~1X&_x&5E_~>fE1R`@qg}X?4>h-M{d1j2pI=;C`k&uk+1x|552xo7Dd+ma^7hx? z{cv;FOw|@IVJNqL!?*f#!u4kQdijsEUi`)8+T(*83-1aG+CD5%R=aQ9Usx~fPYdnf zg0_FXF5gOV{}+#WpLm=d+xBmWIN@H?(uG|W*G}J0^y;k%Yt2Vgp88%e71<>xg~fgn zW(29w(;+)&-yetCP2p4SZI?Zf&yv83as4_g-TqD)&Zs2ODMn&&75^111a&}n9pXX; z)?mt-3khAd#?Ng6Mm>6EJNg4gl|Eu^63XA5osy}P{FiSUmM$GdK0AwUwDoSPrijBj zOipxPexVYErw*X)M&;av_#WhP0AFvp)!nixn?p0`?ME8xyy|+&AMit}T~aHgP;iER zJvdT+_34B4;4ZQ30`%9OZW41X0Hn@_j3?I_REy|yt@KSG8&q<&{HHm>ExeZI*E0Ui zK8urZay>+uc+zE>-gkxZ9k3EM78c6u_e+nyQ#;pK9W^iyY3G?fMkkl&07&t_{43dQ zc2>VMGp^gb>Ice5eq;L8_1OYC3olMzcy1anSA!bUZPKtH!$}sgR()CN$$x5Nu8F#{ zG*mLR%x;;z09@N^MXMo>?ZK6lsOv}?VEwoQMJy%wTr8C+)KD0h8+9a9xBVaAmfYk= zs5SVmsP-5Z$OhGEVp%Y_sI%Y}ck=l7qrj-Etw-(Gg7yaJzdz&nFxn%^DuJ?ND5P03 zst}u|?q+YenTVn2Fh9OS%2igr{Xt9pz|57_uGDC&5n}zP{?aO}3vw{Fxt5lzGjpLM zm4jBroMGV+6Yu4>r3)flemE}}aBRc>sy_;EOJg+jMu2y2OWdDDTB6g})5vgWl`pu_ zWhKXi@MaFjW+ZV>j93yA;r5zVv3K&&9@t;k96EHfWqlHZ%zQC{G7D1KaSXNM;?7i9 z;n%-N?lB0w;XFp}goD`y16REA6k|OeD}XK@dsPU6x7JXXLZR(jLO^5F( zPLNf;@)oXES)f)sIIIwXXW?1=UCf+Ivz#T_>(T}ZZRHo#(>GFX`6_M$aYL+}I-D;a zgN(U|%1Yu`bb#@W5Na82*nGrr+9Cbv6MAD@L&(Lw!0PRCj5Szlo&0?^=;yQRLq0*9 zCS57H*wjQPnE+=zI|p{SdDT0#cAa1yq8;>DG$UQU7=3KLPx9WL32yNqS^1eOLyn~d zZKHnj;v|_w>n$lG#<>dUm!_b@Bpl)YlGEoj#!S!b%BevG4(Ub%8#6H(Y<`GXAodq z@_us#HH$TU^Tl<(Um;Nru1JA+6sZFu ziiYyg#c7;A-)B~OoT!8~kK(*x@(NXZG7|N=!ZNxX24N-;40fWx4b6nax^(pzp55Lx z8$YxC486&87eZK}>+UO_JfmuvZ*}vNA1a<}uuWrL#cg0q^Fabs#%V$%n5h!DywUp!|F`1G{roC84Xb>fOKZvn^}N~RWZ z8hDO-P~Mtolo{lFvj}bTydzr`A?;i=-zEJ=6?us9RVr zn#%*ybZXN+v&!qO519;OZ>WAD3Ax$RR@@a01*7G%cD4@xQ(oCsJ10-=xW zOE}(id0~Oa|13DCq$v|eap*2AQxX}%uo8{9DnG!MeabaO0VEv_y1ey679l{K#>rzc za2W~OLq}=w8IhjHOIJbb7B=WOaHKqZUs?xD_~`ekn;gDT4@kj_Un$V0%>G&Ee|70~ zogIs6O$VK8v)BzWgG!NAS{|2HVPG-SlVcV*xD?uA*^5wAj&yfC22m5)10lg}_pR`m zrdjDt-93US0JD}W+PW{0ex2$>Ki$SRjV<>x5G!;Ow| zW{w(3#}?=ILfp312_{uZc%;pvBrfH*E2N+D?hi}j6F0F|jaKST{Kn{y{iCUw4uv`t zx8$zeti0hye~T~9g%wxkrbEV=#kEZ>U^)iu#PY_jVpe2aPc(ySAcYnDC#JB+V}lbF zGmbPJ^nQ1ZDAGL3`!w&?P7}1ntE;bR>m4R+W`pOdSTtd%Vu#|)hzEm4u`F*s;l(Xm zpMUJqao@JMR=IQ=xucwF0~%E~gnijENP&(;8s)X5zt3c8d?EKtu?Jk_oYR)6fX~IV zzb-VBtz5Fu_`?yq<@pj(ikfE_9v~zqTfux`hw z@=hj^&{y)n$^7FavJ4n;wr%+e4CJ}P^7HYG{?Rh(fd*FOjNhB0S$bXSQuMt|;@~<4 z@feOByat;iLrM}dD()@3UQW=Jv>2<~i|YJ!j#8xUU%KQ`%k)C!BpNH*IogRAr!OH+FKe;u$;KKUBr4)w@sIgaX`SE=oJex&^Z%nZ{=3};6~xxMv=x7 z_2ukQnswmPt&*?IL;R#K&?qy<6OT9_ETr$uKCQD1vHSZUT5D8mlYlzwt{HM6Eyc5- zRYUrE8y+gSUs2x*bGiPw(MFfbVKy9PSPFvLOl^H*oLz41wN)zC@M0)^5&xOom?q3} zzerYj%{75g1sr~jgCbuMSp&@ib_sJuLTz`{xP!rQu_`@{d&Li%{_Qf{(dCa-d7z#!s@}36$jnQ4At$y z+OY`XaL0BL!t0;j`J)}1w|=hoJ8(=n9Jb!RV*cAFP3r2J{KS3teR#?UHj%qS3fkYuQqSJX5?$%x~{F-O|(d081{A>wtp)g8mDR2t(O*n4%n)X?9X3w2d+wJ0go@Ie8A1-&T z0WN2M^n^DX3$sO^5@Z67E?>Qyb-$*P*J z>A?w?0c7WQAJPgUZTH+32<&~6ez>H!t!M4HUw-=yx35r1`*vS8+@O|uvbJ@iS4^HU zW5xKd7`w{kl}k5FxXMKbKjNN{0%gEs4}OllZTUdL!>xw5|9hx-^`y6a@~H;E3lgI% zU%K6Azk1;AhR?P;_+Hq6x9IWhkyNm{=8AXCojw1k1$tun zcFXCBZ_U4b{*kk7iSxI6pz&}#{nrf#LXSsH_`=Bt-m=r2*$a+3V*D45U2pPPGoG3= zd*Q?fn0)I_|2}u27JF_q+#y=OuxH)8+5vyw<^LAw3nt#P1O3Q_^Tvlk0Qv&_ntEV| zfqtZ(9`}|5(2txm{tL$g`rO%b?CJ5>6VUB-|4TrZa>-1>+O&6nw*l_Q*Izgf+-psO8#Je!_B zF{(_ua%p|;Ts(zy3}3c~gFt`RpFh`f)WRcY+ao&w`^Ufk@|L;JcHff$KKp8!XPjaC zmu?6AQ@1@mcj3a>E%y9`(4YIi0eyohN<~|D%bIHKg&)a38sV z?@0=D3*(cfty_ULpBv<6hu3%OrZ=}|Z*MzgabI5>i(obo$$X-#E7=-bwp>5yov)sh zOcGf@*H3=ptn1|Ax&G;cv0lt>xzln_7)y`W$U-VA(X{GJLSsDQctiT z?tCUG9u}DOpqvNNygSg8A8u@wtw~0|dmeD?E&M*79#fty8|b}Yj5n;PNdk1pIWf%pVw$w3k(}0J z;k^@S^4Zx-^`e>L8sW>h+4FG?DI~UX^NA-fB*ACzzxMK?^6&NqBwr~0sx^+ZZ zEJT}sM+J~L4-PAw*lZdfiv>ce)&7BDyfRdfbP&uUQmheed9`6Ycxt97)BJ6JFhh*m z(}5n`scOU2wwA52r<3~E9ChTD+P+_1c#h0vEH{NYF|8BQOnuE9w_{_DY8b-iwNC`hO7pt=hSi0jp16_VXD|t83lrA*CYDIu&5ZGllsY*7MA*@}s|2*dS!F&~B!?4d*PU zB>$PIoHzj3CHV#Il!vfjfGh2{?)8{&SS;q?WaUdfD6jlRM$2nH0;|cP5!S;Y^4hbA zHeB-77zk3$9V3SaR^uNJON9^+O%%#!em{66Na!XMzlnKrI5~dtH=}Y0#%848{^L;i zhs;Uby=GXsIKBOCpmkVr#Sl)ww|yKVbD+IGch2GS=Hd(d@Vx>@OfE9=GtlSGHjzd2 zq9_|7Zcr&5xMo!$tG~=Yz$T#9f%=lu&QR=@ zhi0-8nNpKQV*UNpl| z5hafY40p~7d5~bi5+y(mf&eqK(jz~us!Rl88l*AEm(9l(_Nelx3vM}~x2@W3ZvF%& z$nu-t)J_6fTMQc5`YX*LsMR^u@TR!Q*izUg`BwJ1Yz3pD%5PGmGH1e^%9*lNV#>i3 z7@OW9N7XPG1)faZ3!W7=r~$!QdDoALs&goUZ&pSozp^7gxV`@ot?ZYC7i0$^`@v4y zOKP4d#JoOk5neP>`o_5p)ooen!6ypYNfxOER;%5wOz6af2iX`QsW|RTj_y6akV0T! zpn_nK>2W_2|G^0vQcUD??(OV`(b5edA_7N9nC*da;k0oH4m@cZep2%Ngc2MZmnQRz z370v^XhBOlRM(l{@U~L{l1~CL=;mdM_m~l5dCooRF{Y8aE^bDO!UI%QX!EkB2zC@RnkgR{5 z1us)r195O_iwT1zqq9M36EShHW|fhiRe9mE@;g7^5fVEn(3zJ@1y`B0C3A5{eWZM2 zRg`&D*qO0?MM~hRS^0Axi1>!2=6ql}f#mjG9q$>V!>JWkR}jD$4(Lnp+6NveWMFqm zRIl{D4?0{B=sak1|4c%SLvj}SkME5T32P-hhnzputPJpx(iPYBRH+2v?_n<5)B;Xv zbWEr}_D1r7JEyIUYysbr#;5Rx#>7G3N`pJ`>?wQV$$8y-@Y zlz1=0>Ck;6N=paMN?&|_yy*Vb9_L4t33280UN@|G9e-F_283fcX}WE@t* z<`OT0EsO?4>Cz`1q$sIGG%UlM$MVkK%tr-UN(Y!LEEm5}GB8a$RKZY?Km0@&66Fu4 zu#~^BCSRGnH*v`UjC01TNdbdTU!)}xx|2TeV3VUR+-Bym)#}4et(GUYS@hkZkpL!S zczB;3xe&_y`7`5fF37{UA1Noh-Vl_v`sf;@qq1HTD}yWB7L-@?gSS~wIA1~gl$3Xl zWJSzSW)JA43kR{fo~PRk`;(jeMe_?6LslXIGEsncl9s?X1pxI(chuWaF76Vq5|(KNHLULnX$ zhR}C^+iDTa%IOz#LL1=~qraAf=K*py@qurIMcuNprPSv!t2AH88)J@4&JG(SmsA{O z^=YUTZ#_eS@#c9UxAlUdl*&|0I?E~xf6JcoytDZXMwT*bx}Q}JveY{k#`vDlz-}(} z^MtJ_=Yquk(tAGWth}^wzLYMqq9qBWSsJ*|Uj|5(D?hr&@*xY)TI#<g5nccrCqJ0W>On>t8%dMqaw?Fnh680V5+2`bo{>0QMSbuX&Q8Aq&U{n;|Vb)1kP!td%np0|!$Yn)VI-^r*R-9R7MFN}j1(RY*c42@Dc|Rl^m4CdR z_Y-rL@nfoslsj9^RMD*Tx4l)_A_}(E#NiyEB2vQOrYx{gSERKCwiI;vbVo8i5kFJE zs#nBexGb4Jj%vBfMb`Wu3l;bplVNC3pS``U!vp4dx}6fB*!~|MJ_+%VmEQfKkV;XQ z{#Gk}dKTEgC8unkA$npcnbuEWvC#S`q}i}h(CFIx6SrfR*vb9KAnauquFle=VF(20 zo3xRmA~+{JfkjPH$V(_)J)@!QJK-WSZ+QJCS$QHN_Ju7@60j$2%G~6B1a4r7Az`1v&`dyXpN=E{+_s& z?ooOk%3I(E#vG+ynlD0o?dY+}TTmI0*vALXLbTpc}g&ifP~$R zRHpwq6!Cg zPJ}8ahY4F3`B}bDplP{>_PAHY0h&-RIRPXYYG_uP5we}P_6VufW~fV+CL0zZ+|9^K z^IitMQp=bC#^GYU9gMOE5+e^HP(>l-^&5F%rz$-(H?uCiaXdVRdmi(XR@=L0fk@oj z-qxxZannfYsLz7BIf6>ctm`4cRwZd<^ntSi1AaEjQ81jW;n`|z)b4(Dtf{MxD9=NY zKEkq{BjtA-M0+8wi7wlygb;+hi80$OCs;uEu`@}0AsrVHi5`GfP9<-VNXqv-YCvJ8 zMCiby(db-DKRm^IY|F3&*0Hc`Y$3wjxd+EnHy6lvls-cwgg|$=>kqE;mHWhOc8|d* z4n*DQi+lJ1wsVK_0ep3>=SGoSF)Pw@Iza=YJ^3Uf=M42i$T z%~zF-ghqJ9XO9H~j{0(eo@?dB*BJzmWjNtb#9cMDQdKxdVyfJ4V!3W3P!(~l^5nuV z@VJ>~R@|XrWRIi_eG<{qGFIZ1Rc74+{tvYaqrqDtmp9yl&^oWM;xBYWW;-ZpaMmr_ zEZX`SjVHGu+2U`)w0Kx_{?boxGt)9w?bk~Gb-jy~c0{B+A3?h)XgDlqs-)JBGCVFR z>5-LA`aKNIr@WdEV@$FwBCEnZa!<~(DAedg|{^di*d z05He6b`!Y({9+spI_^=5G-nW)xamvoMv#?{*x&UkcmnpE`QZHI97HxQEmqiT7%D(# z;J6lyF)Ls93#(KH7_bP#DjRea>@D#WNBU+#O;0xh5; z$m&K_=#YdaUD6a#LejknAxY^#VdOTsZ9}uvn}iYyDu}|MEnKd=69}7%0{#_5U=*eb ziVNf5f^5p_2>#`7sR~u8fH>dZbIy71dqZ6Qh4$0ly!X84Jm)#j@_Uw(n3xGG9IZ2h zNrbB*yUPSis8>qPNb1P(5^9bfcIo8KdqZu%^ssrwu9<|(0d!e+1r;nizLZ{Y9o7U< z1p;!u!N)#*n(wRE&l07h#`%c(B64}*P@X$&1TO1(kJ9jv(~od9nY#SgZZpUiHc+u2 zM#Z8b;-YuQ(MzXu#Qi1YekP`OB&U3{$%!CY7zW!^H5M=pSB@iU1eCeJfyb051m9{E zMyp6AZ1Aashy7!zgm--W4XK2R$Nl*uQ>G;GIAT)7<2syAqFV6HSKM_aMN=D7(YMyo z?!w?Y^?A#@^tR;gIDsMbN+r6(&lk+zRy^cu=bmoS1-1CoMg=qz!nj5WNsEmH){HZ+ z{(ut#-4h;?qzWe_^FuSc6So)VL5M3?HhaU&5nicCfvR%CrKd-SX(SMI4K zJTw%YhSq{1YGkZ^+dY+EwRM*JvTI(izHcQ5!XkK~%1Kq|7H;%&vZ4NY>Ip!AHA`~? z8+!+8n%1f&ks9jqE}XEmX#p*8-}c3|rw1fWxS6}{$B$&zSe)Je!XUeCzX+N3YYRZ{ zt@aV7G#7|H#KrGwm(X$=h6aQM6EPxHm~I?B@X(sA{sD#g4!vj0O#u$spi`=f#U2+} zQR52lulEpx!KEeEfx+V^C{HlXW@~Z9YX;X*Am$?u2otCCa7{6Xpa1hRX>U8ggGBoH zMn7?^QaJEMJ}|pj^K{qD#hDupr~n_dyH1?sOXdKZGu{hWk6+|3i2}#IdwV~qc#hgs zycP)>4H=XT$64lLrvG`E*w*7ZERGV7n|KQhcZp4i>HzulZHUH8Jndvhp1eDLngXc3eQHFIHdQpmY(C_s*f0l z1pY=@Ws3J}T`({*7&+`m3l?-7een-z=5{uqL!=VRH!#8w25*G+YB>7hl4CHnvbjY1grpK9N&wvfP)A%9!6GRSNh`M!m2x{VJ`6dw^ zdtvogd-Np-Q0GGtfTLuMWH^I z^|$0AYPV1Z!I)aLM!Lh%53y4#{_}r_qUzYyLr`nTE53ALt#L=&xO?Fg+66&M+oMH&ZIrki@kx2_0@A3CZy|d(zRP|MXe=laI8d(8wL(fu^|YQi(bbz|Z-;=@va9{dSsLW=w4ryVYz*jw)M zM~Tkpzs<$Q^+ZRla|Q?1zN6Y$f$D{v%$q|NHbd*^PqkhEIQt5T(%;KfWPXl;E#m0+ z=O+H5C9R12=ukzSx0p)jtl~DrwY@@%lao+!2IHvn5`D?RBn7XR)N0W2f$<(v2*2{N ze`=u&P@W1r1InW^s9X@6<;fL}(&X$ExdWRr9%{^ZFq4yq`ao%w2|&?W618LUq=-G2 z5?`gzmsj*-?qeHmtqJ=gJ$A0>0Io;4hidE04Yj6{JmsW$WYk;A!UHFHSXC8?`Srqs z2Dt{53?nWOB~+Ps2 z9O2g;yc+pt#z|$O`HnNKc?-&FGo}QI&b+$k%iO-7W`GR5Gip}El2A=U$cWrDf7q>0haO^aCC~Zf1HUeA~}gQ zB2Ca!I!&H1TnR9k8wS=1@YK-Zr6ZeLI)}I+VC#;y_irm!O&hw~8vDtTLW=?PH++nj zG?U@g(wvU(z?QBUKN*fr__8W5%3u|Q8OkXRgToDC zc_w2W6H-;}9QGIfvf3r`Buq{W`ch0#El5`+sd*N5I~tM&5kcuS%RTXuT<3-IU8T%E zOiV=rxLsARqezV(*|@yAiu|U3QBFy;hOYX!t&FbrVLF32)p`9V|RV+gmS*?2PzNY9KaD~1kgS>+?CBk~z(;zU!|sOruMoM5Zx zMvI1-Wy7#~Jp198#8DTGs2-bawc>SAJvo;UYM4E=@sbP++Gn2PL&cKx$z~ybuKw_{ zfepES?%;^ z7)F2_cPF#MW#+(Q%%BHL6Aw_c&@QhU*{YVwpSV+ z=PgM;GGHRLm+j56$KKj_DXe^5>Vg95Ron#yi@`Zv%7dYvr84Ge@4H*U5)jX9+c(^b z5wRRMVqeew5^<53-rw9?&N+ z6t_j0WHUKF!F@IeUvGzxdk6SSLKA`+=J=iPGf6tv7$6Cdm2xA)Gy^q2Px6?UCk+&Y zF7X|mjAR(gVZb=In~X?097h^>`=8h@_!FuB0f#WeZA?98Web{J2pEO6IAU!j)RvrI zv>ZR=xgG8MarCW&#*Vf{1NhM00_?83qnYG^GxO*=kDi(bp)AJ39zbc`e|jK&=HNpu zJwbAW_D7cSYr~mJyoIh_p%0(-1ah-T=Z=^pfvgh^1Bb|IOVrmR=u^OuYo16faY!i* z>8R;ac9l#Y{r(#8lxx18TyiTNEGs39#woRHYq%DxmFe(yHK$VW7*0T$(SeDCqn}=2 z00TBeH_AVxv{@z~kA<-Ya;^;)$l7MPB;3hPK7lm@5|qTLF=HahywTg%k8reH@X@-T zhL-pX4~xpxj_) zvmSg%*&RN=K!dpz!(X8dG4K1yS^hSu`GUct=oGW49Re&vg6JQn{)nj?PV&UAI&}E@z4`~wM;h%q$!yIY0q1;A zyv(|}oZ52j(9Vu=EvD&G!^AE=Udi`g`ll5mYkPAW8S|1n-|d@VP{4*{C<)wz4i>Nu zBrIz+$JYqnH_w^-_vFE4k_XYg>!H@B%T{bJHzS01Uj7+vs88KUkN5{7MkrWhuh6mNx9>X)=2m|F3=%S!_z@Pat<5` zL2OZtmE}k-B$RZhh!RnLbFa`x;f*@8T-B@eKV?f!z3I+nm8p8LC03Um93*5IOPbeu zWNC?udtGZ#XR}F;W> z%@N^xw~(#UQ@UFwp!3{xcbQvyKie*=o9WtDX=m&eB0CA6r-+%)k+rZAgBA6z*=mQ&$)QtpxtooP%9 z=_G6?>t{UkxqB+RcqK}bf)Y@h{?drMlN*Gqd!&HyCQr*KD`P0ECNaG+vG4qDm*{`Z zcS++G6heBj4|Ql3^eSBMad;>nzQ2TYlcAdB0DTHCTzHdun<^yaf+)f2$1{M!WYFdY z@`w$S897VA6?dlQkUeMTGRB$vkdek+(imGz(vTOLPEqqq#}>YiQ*Xf3}jGhV65TTn?r8J27e zL*BczX`SE{Z7S$^?QdpShh{r^skgH$adh@xsGJe9<*dcEunH*Oa+wD?Fz!s-+42b- zfa{p`Z6YhqyyH5Tl!S2FgkgwAr1TIX*z|oSi&4m>t{|w>d}#ilMuJ75#zwJm`sZdp zC0t~{NiEiIMfS!5pS|(6e=K|B$p`;N_6GSIuLcvFM%%yG(bfX8Bq~*%|9OMLXoJ6E zdyl%xaf8KP^UiNI*3!S@?ER-oQ@{fw1DMdrWS5x1I119i03ZLJ_8ff5JRTioXMKWc zifHQ$JaOEi*uGNIENG}>rs?2y#M!f39Y8C46=mnMZygv!9ps|Zmf@4ghz@=F9-Qua z_lHs3WcPc}h1Zl5lqzG2jRJDHX6q@a*#(Wj05v}mRM7RUCO=&Hn{l?-mF~M}Ycj_W3(bL-2J)@%8zj+( zY5M#U=A`@*_T#MG5C?X{KzO=3Bu&Y-uOyRcbn|l@{=)zsOM3VDI(Cj;&M`+KnRl6d9T^ZML_|YLvdm&!gMK;h!lcR{cH%6(G2nX$ECeOn9!9K6!$u&x~nXZ ztYs^ci36?7^PxedY{)5>z2v=c@hVQZ%_5E- z+w2Tem0`O29uA*O3H|_iuxpL4ZW1)jyKkI~g85N9(&Q5#-i~FU&hRk|tbT zt|44L{(he_!c;897?j_9{W$ZV>r57!rp4S^Cs^CLkKQ0P9Ws!gF>K;jYQ@jTc{qw; z#nB*FXec*<>cL|4@#EEQ6_KJ7fHUjuAd@WV!{EnBOAaLd%{O(9*lgnH%I&Vb%@=k)Cb85rcIJ_)vJcPael`e6pBb6V+1p(sh%@?{7KzVrL8lP2!PGW*O-U+^} zTqXFWEJhfj2O~VU4?LkKflaOF0mFn!Th_E$9OmF1s6O|FqcGBgG!oaL?aLeK=oX0T0jTUXw+0ec5)DbW=bh*4+=kQ<9aXucK9ayRgqg?L zycpS}ng*{hco*W=&RC+PYRP3HseH9_k*PX4QZSbQc+a?%clUe}lMgf3? zL$18jG7j!)>ZSyPh9|DWEp#3pa+g6U){oCik{@TLQK^w9fE#iJuuEGOYHNzG=PXcW zSueu(t)fQqfT^U5ZH?#mzQBtUIAF#X#U2_oM>X+iX=!htm68!#GHoiJPjYvZ2n{%I z7P=P3%#t`733rzc;_a$@7~*%Wh-djk}csk0j~L zGY3u+%rTx_@F;njR+;1?=iwY-kziDl5KuD7Iz)@P zO7f1lgj!o;(;Ck_aeJ502(@(a~&z&rZPdJ62wG(V;4*#VlI>1%Iy;cG*hEV@qZj z;8U&&fP?xjZ^tGrM(aMZY?K4=oc5Z(I!IeS-tJngY=kLX@s8HY zcuPMVzj{VyaJ^Lx4)*0JZ9brD$%n~f%o}4D)>n^pn(s`pdG%Ob6D)|Af;fOQY!s^OJSv9{~Hb7IFAMEI8FI;ia zp@XIF5>6e4^}u=@gQi7Z^Gu*rd*L#k4Wq5sH)-v|cg8bUoUxK~;mBvXsiHg#Rv2r# z?7nUE#Mq#=M5*%buRu?XwfTS;c zc3%A)q+w|#LXPT(lJFFnIqGl`w$^qoj<&>|GVN*KG9F#=Ub{u3G-rOpmN^Xzs>hmh zLL}A}dVAJWqu-jd0ujw%$hB&gm>MQASBJfR{+2njOO9!^i*>Xp*R3DiFH&=|vbrc3 z%+bSN=lZ&;`#xhW#HM`UFV|nU=VQ~g-Fp|#yY97D3tyI~+4q!dZtGNB<2LI&;8JPH zRc|DBr`v%cIVD7yG_XbwhfTo&f864!kMH&;uDVp$u%)gso_g?4Po$?c!GZ#t zMzhTD%}Mr7yS%ckxwBMXXA#0fhfc&=h$v~& zO<%HEv$z^lN0dx5QwSzcq#_Z?;!qnX*LT_3&-LX&k6(Xb(OJ1ZpRWzkCY~J#5+oCn zeCo;ng(MH7cxfJIKl~$PsME{JX>4e3mYD!&msSn9YD@4xB{&iVT}h1)Y1Uy33>-@U zk(uWNxFl4v_Qu&2Y!{t(pIdv?NmV4fo_A9^d(PRIN&Xxc6y28+UCG+h0xZsK+#>Ca z%AG7%6&hz>LUirusB0MBP|SQ~mdNb`gs{>8)#7oq_^}|C7C+KC+P?`!IXKiy{0-9* z5|!FHtKGdMxtVX)PD*Domy{MLM%y-)wSYLV?=!}MgLU_E_Gszutmz` zEKh?lX!jsrfP!MZ(sHv3iDiyTT+HS)jy1PB(O)L4WPggOMh87p9s1=R9bVVRnQy!@ zksn|ur>7Pcqupx*_l?1OVMjgx!8o1+<4oyT5!sm&#+0y9=7$G%V7Y|t&n$bmm0Lek zlp#3?ZF=Y-2v^;(g>r(Y1O)YzT5$hee>^v;#S4-H*4{geT^whgx}UG+uxH>*u9LEu zy}^2|%eso0r)WZsR}KFD{4Y(Y7NdKbT^FaY5>ON|b4H|5$^&CsZ-z3= zl2AzN!M57-?Rsk*?R}15li^a^s!rI1_u6$&%4su-C38s@N5t^hb5rLQHMMxLJDs&g z@j*j2XrMA;P2EVyajchLTNp`Zp`I0XbWuxYTsRK1G@!s?n0m@bimP`1$fd{B7H53w z7Gq$F_}SL_K1X)j zrjff+80i#M7pFEJ)*>ft*c^(uYHSTcFfkB<1`l)Tq|QEXn%kt^q$^jBWmtK;>AxD; z*QbuTR86+*`32b4czwuh)kt-NNpN}Fv%GaJ*%#PDvZ1f}L8rO=~dI1Kp zLsn{c)aD(fl}aU1)>h`r_f8P<2=@7D?r7m0kdPdxv?AXdXTG?q#T8mRq`RFQVLBC* zOXeWqz)hV=!697jps=ttoPo?|o}8;RlMghQ%w9&2>X$P%y}?A67Lr1gY#ej#yf%+D zjk>virz%qD@F;{f@Z88I_WiEa zJcJgc8EDzbz|iwC7G90qQtAd*Nz2tCVus$N7IU<|c6N;+D8sqxF=q*C`t|AAs4gx{ zrZZ0#82o}#@ z$-?5aZvr3bn&C}KW-r(kMnql}O5f|^qjz*HC!>pPDP~`J&4>6z&I*UIn0cw@4eUu$ z&v$0m9a%SPVPhSZ>3g@(?qGKH7^69mk zOX2hdf(VE|<(W!W!mwiC6e&fg_Z;cX_ILfcZtgscrg<2luKS1NUtdnFOJzZy*-M?> zgTsB02cvxs&!(KLii56pz=681fp9!^^~Fo&^{9=oY1kE(EHqGBB0}SvVdWAYO^lKg z5TK&HoN{P7KK0+;PCAV*zct&$as<_}%xpdB?zmIfJDeSaORh_<`9v>rn@UdLe-w% zD-Yn^+hWznK3l0;V;*CVoB9djmz|EDT)z>$g-}^phss2SmG$eow^LMq`IKKC@?3qR zkMr`$KkzH_`lWv>&g%d#60>zgR~b6dZLY%-+zj z%u|0bG%N&p8N!_W@v8H#k_jw6Ok*?)i+f&sPgAk#yy+*=hLGk+(D5v~)F5{_`nm26 zrjRw0*1>{o$7s&{6}b_Ke~evkz+eT$(ZXAn4RqI<-CyJ(b|r7uNa?%HO)0H(vr7}x zQrB?oD;7FugA)W8-8Wy-Ug7GvDCGp`#`)ypK)uGro=!S4C|rcb0|$8p8%G~&2>xsd zEMoZ=42vj9L=~ft&6=~IFR**N>r(_nFDK5(!%^X$`4C8w^0ZE6p=)53}O)C?A-s1ST# z;RE>n2{gw7D_J%B^dVu5W1;S_W??B>bC{|Z8&eN{dwJpe9PkbH&6`=q zf`%?#wFhuDwkQYct=Nvr1uc2OgLnmS@-U)arT*V>TXkzi^s}f@EZiO z#Gi=Y)I;ti<(sROO^_ez%a6u;HoclM9D-UWAD%*N7+LZ}!C>`SElTf2L#4~!X(Y3Nl&EB=70m?h3!wMR>> zkMihbG$H9rzF`P+bi$a zgS22OrkzvRc(9^_Gho6BA}^TdsnJy%Ps=ul>@Eti-%nPpbU-QYR*xF>t&>5rusHpd z`Nq1SAVZiY3G^y!CHuX$!16A#=(5j@EFtAep!5;@v8?5_HO@!#TZRRT49<=8RL4~d zvL2lV|M8riT1=e%`QgxA4C%1=Kvxt!2oTQFA0Ge!dV|R_M$al$Zosh>Tky3|IZk!5-WaNV>zBm#mK`%iFQb&fzK z6VBI0gn$qmk$vru@<#0S?VctGIPq2jY(M^=OzuP{&-9z1gQ*lHdKRwlM|V8_TgZ-) zv?8}bytMA*d{3a93k76$zk5=8N7Z+FdcT3Dm1dwPV;c64vkzJ7N+4|+`6r4eB%fr1 zH|(MiELb-4qXUiBG%vomZrl|1%Y6NV^$l~w4oo0vt7DVv zI73LrqxI9%YArhXcD5lQWYA|AH-+9lPkN+xTHaYry+qoKW+NnKJbL#n6U=ED0X&_8bzNoDn4;Zb4A;vi z^SSMlT0pXVOy0VLv#9%5ux^KJMpt?-@rSEUy3z4vNzo#)N1S+^wv^`SrDTTYWXx;s zq6PQN?eS#uSVSDnx-|Gd!jS(CyWbs{&2cFQeNKJ-mN|2g2%Q^8CHAE56x#Jp4!h&A zI^)3B-U0J&q^CPARoNOS5|zA$AC=S)FMk$lVA=KTz!m4|C<}KD`@{rg6oU{D)*J9lyRh({3TK>fiQPelezF!=!%q|aqrzRy#L3=OjF z;^?Tw&9x;y&JCad*34bp%UKBp|Fu|-!}%i5jK~sTD=`NAuqrvuobfR;hu|}p?4un~ zLNSMdd<61klzs(2+xR4hxk!@O&an!+bU;^Aq4yjdUano{WfQ_jCJOKqC&VY$sM3ms zn3KDhQ6AVCs<5=dOKUl@{sRQzu{#%I4AJjQhZ`S6CaTfXYc(v?A`H3nIx-KH97T`Yui}^cm*ktwZ(lO zYT^t~Tre=Wu9pG>+p)@PkisOeovVKGnvxE2E0EK0%&b z*GexB_W!K+vj0le2&*p}w0y0N{*5)#xp(;$Q*pQeL^#VE5NaM@5X z^XCup{;)3gw-;x7_YuGjp~0TS@$4ro;7WrcMW*Yjxr2hNol^bW`CIDem&4SHxbl8T zDD+a-Y{>W04QVzKv}Jb7kES+5`2m?ii`X!=7pRCg?XjbSSrIAA6L&J~%Pm&2H)y#s z9ZXn`XL@d$=vI!UNC2j>WiydH%YY)EkLG@TeZ|ay?_QP)oY3DRk-hKQztch(?Ccw? z7*LBvLN6L}+v{?%3B=gQ#xYH!Jyi!3?_Z zR<8X~ABh|&O6Jz1^vde7734b)fHAr=1uBYw3Rp)xW z-3w$bA6za|SWCCV4hlqXAHOO`D#ndT{f{t2m+@qI*~O^&C_CJ5bbX4MN6_G5$YJg1 z>n*ER&?;^Aa$c5fIg1G9rzP3uPyh;7HN z04wg3p8+H#w1tMhokpQZ3)cskeHDoPM zWoB$7K2zvXK^51>WbfLCHPUYbLx(UXdGa~C)x?d#2hd~rlA6|}!!k3tZDSG*iKDl4 zr}*3102SDE!t(N!9N1rfWc{p#b@dH+c4VHIj)%D_13v06m_&S*kH9^RdW z7){92uBj=z&q%_PX81)jFRuh+;^>`sK?#|1g2J6CN2Xd5el6MqVJ<6ISpYCA(2z+h2C^ec!^XjH()y3|7sY%ceQd5)(k4a=J+*i+txL zDYp$b+7c29GP`V$$yg#0H-4JY!_!mKoZ2xnJ`yPKoYP*XcKj8& z5NBU_jQ!PNk$uY%FXwY8A%=$aPjJlIF+$XuD3y35wP~$b6mKZ4l?Mgln5eR}0w`vO z|A)Qo-9$raoh8iSZ(P#8sJ*ojhli{zdF?(cD^TfgBf4>3wGUoqPP9_NLQ)(*8+)N=9Xs2D5V;rEDSKz zhGy~BAN^c4i8rkZHiuf)PP8+M(GL#r=&d`0E{UM#cN1-n@#u`s#O83?S6*og>7|L4 zVfr4G5<(@J3oFu9k)9!@Zl1r)iqxaV=lD7o#}jz@>j z^4u$MWvruiYal4Hg=^XxsO_7=H7H> zlX6CA&7#D8q@4?pYaa3(&!U(@s$ATUHYaV&)nm1{E-49B%acT*vVyi_>l(rl5QObp zWEh%dkfw@HJ-L?GE`>N>%=yplTBCvO-VfRN0HQ(Zniw{csGu-bXapL}T1+8{gAJnS z?H;fC_LXT(RxjTWTFUYfc22#i|OVD372({&@7BebR%7-7Ec>=*Rb}S|aoO zW^YIpGcS(%%0dX`jU_p&anyAs^GpszVkAX9X9j53Y$9@yffC#$hXJx_HO}#fbYra; zITe7PQwJySo)R_I?(xyf?>+1o@pJTi=8C(2vBxj({>7C2ro3ZU$M!RecTL%gALw^g zcmHs2t^rz=ewG6H%*zUPxzhf?k~*Wb>xZ{&lpXfWJ(1d zeDk*+ZM%NTzU$Uanc=>^_UyX)U2poA|8vsxf1pPW4~rHUu*H&2hw+couPrRzJUOyfiS d*02q`sy-f#pPD?V&*uGUN_5Qb%roxS{{j^3m~8+6 literal 0 HcmV?d00001 diff --git a/bzip2/sample3.bz2 b/bzip2/sample3.bz2 new file mode 100644 index 0000000000000000000000000000000000000000..d90cff9208fe3f15eebd888e978f639248752126 GIT binary patch literal 235 zcmVGUXb&m7Q)GuvY4W7DBi0bybO}v|xtYG6|~5=Sd|%uMPkN zKoB6Yo`4Dni@uED{RR!AUXhJ4Aj_`^@cN^s$CJ95fR!nP>-4u_Z0JO2Gf1zI+FWf9 lNldh8X=%unLauTcBrdZ|@<43xY-0cb literal 0 HcmV?d00001 diff --git a/bzip2/sample3.ref b/bzip2/sample3.ref new file mode 100644 index 0000000..775a2f6 --- /dev/null +++ b/bzip2/sample3.ref @@ -0,0 +1,30007 @@ +This file is exceedingly boring. If you find yourself +reading it, please (1) take it from me that you can safely +guess what the rest of the file says, and (2) seek professional +help. + +ps. there are no further sarcastic remarks in this file. + +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh diff --git a/bzip2/spewG.c b/bzip2/spewG.c new file mode 100644 index 0000000..7934e76 --- /dev/null +++ b/bzip2/spewG.c @@ -0,0 +1,39 @@ + +/* spew out a thoroughly gigantic file designed so that bzip2 + can compress it reasonably rapidly. This is to help test + support for large files (> 2GB) in a reasonable amount of time. + I suggest you use the undocumented --exponential option to + bzip2 when compressing the resulting file; this saves a bit of + time. Note: *don't* bother with --exponential when compressing + Real Files; it'll just waste a lot of CPU time :-) + (but is otherwise harmless). +*/ + +#define _FILE_OFFSET_BITS 64 + +#include +#include + +/* The number of megabytes of junk to spew out (roughly) */ +#define MEGABYTES 5000 + +#define N_BUF 1000000 +char buf[N_BUF]; + +int main ( int argc, char** argv ) +{ + int ii, kk, p; + srandom(1); + setbuffer ( stdout, buf, N_BUF ); + for (kk = 0; kk < MEGABYTES * 515; kk+=3) { + p = 25+random()%50; + for (ii = 0; ii < p; ii++) + printf ( "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" ); + for (ii = 0; ii < p-1; ii++) + printf ( "bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb" ); + for (ii = 0; ii < p+1; ii++) + printf ( "ccccccccccccccccccccccccccccccccccccc" ); + } + fflush(stdout); + return 0; +} diff --git a/bzip2/unzcrash.c b/bzip2/unzcrash.c new file mode 100644 index 0000000..f0f17fc --- /dev/null +++ b/bzip2/unzcrash.c @@ -0,0 +1,126 @@ + +/* A test program written to test robustness to decompression of + corrupted data. Usage is + unzcrash filename + and the program will read the specified file, compress it (in memory), + and then repeatedly decompress it, each time with a different bit of + the compressed data inverted, so as to test all possible one-bit errors. + This should not cause any invalid memory accesses. If it does, + I want to know about it! + + p.s. As you can see from the above description, the process is + incredibly slow. A file of size eg 5KB will cause it to run for + many hours. +*/ + +#include +#include +#include "bzlib.h" + +#define M_BLOCK 1000000 + +typedef unsigned char uchar; + +#define M_BLOCK_OUT (M_BLOCK + 1000000) +uchar inbuf[M_BLOCK]; +uchar outbuf[M_BLOCK_OUT]; +uchar zbuf[M_BLOCK + 600 + (M_BLOCK / 100)]; + +int nIn, nOut, nZ; + +static char *bzerrorstrings[] = { + "OK" + ,"SEQUENCE_ERROR" + ,"PARAM_ERROR" + ,"MEM_ERROR" + ,"DATA_ERROR" + ,"DATA_ERROR_MAGIC" + ,"IO_ERROR" + ,"UNEXPECTED_EOF" + ,"OUTBUFF_FULL" + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ +}; + +void flip_bit ( int bit ) +{ + int byteno = bit / 8; + int bitno = bit % 8; + uchar mask = 1 << bitno; + //fprintf ( stderr, "(byte %d bit %d mask %d)", + // byteno, bitno, (int)mask ); + zbuf[byteno] ^= mask; +} + +int main ( int argc, char** argv ) +{ + FILE* f; + int r; + int bit; + int i; + + if (argc != 2) { + fprintf ( stderr, "usage: unzcrash filename\n" ); + return 1; + } + + f = fopen ( argv[1], "r" ); + if (!f) { + fprintf ( stderr, "unzcrash: can't open %s\n", argv[1] ); + return 1; + } + + nIn = fread ( inbuf, 1, M_BLOCK, f ); + fprintf ( stderr, "%d bytes read\n", nIn ); + + nZ = M_BLOCK; + r = BZ2_bzBuffToBuffCompress ( + zbuf, &nZ, inbuf, nIn, 9, 0, 30 ); + + assert (r == BZ_OK); + fprintf ( stderr, "%d after compression\n", nZ ); + + for (bit = 0; bit < nZ*8; bit++) { + fprintf ( stderr, "bit %d ", bit ); + flip_bit ( bit ); + nOut = M_BLOCK_OUT; + r = BZ2_bzBuffToBuffDecompress ( + outbuf, &nOut, zbuf, nZ, 0, 0 ); + fprintf ( stderr, " %d %s ", r, bzerrorstrings[-r] ); + + if (r != BZ_OK) { + fprintf ( stderr, "\n" ); + } else { + if (nOut != nIn) { + fprintf(stderr, "nIn/nOut mismatch %d %d\n", nIn, nOut ); + return 1; + } else { + for (i = 0; i < nOut; i++) + if (inbuf[i] != outbuf[i]) { + fprintf(stderr, "mismatch at %d\n", i ); + return 1; + } + if (i == nOut) fprintf(stderr, "really ok!\n" ); + } + } + + flip_bit ( bit ); + } + +#if 0 + assert (nOut == nIn); + for (i = 0; i < nOut; i++) { + if (inbuf[i] != outbuf[i]) { + fprintf ( stderr, "difference at %d !\n", i ); + return 1; + } + } +#endif + + fprintf ( stderr, "all ok\n" ); + return 0; +} diff --git a/bzip2/words0 b/bzip2/words0 new file mode 100644 index 0000000..164a8ed --- /dev/null +++ b/bzip2/words0 @@ -0,0 +1,5 @@ + +If compilation produces errors, or a large number of warnings, +please read README.COMPILATION.PROBLEMS -- you might be able to +adjust the flags in this Makefile to improve matters. + diff --git a/bzip2/words1 b/bzip2/words1 new file mode 100644 index 0000000..2e83de9 --- /dev/null +++ b/bzip2/words1 @@ -0,0 +1,4 @@ + +Doing 6 tests (3 compress, 3 uncompress) ... +If there's a problem, things might stop at this point. + diff --git a/bzip2/words2 b/bzip2/words2 new file mode 100644 index 0000000..203ee39 --- /dev/null +++ b/bzip2/words2 @@ -0,0 +1,5 @@ + +Checking test results. If any of the four "cmp"s which follow +report any differences, something is wrong. If you can't easily +figure out what, please let me know (jseward@acm.org). + diff --git a/bzip2/words3 b/bzip2/words3 new file mode 100644 index 0000000..8486a84 --- /dev/null +++ b/bzip2/words3 @@ -0,0 +1,23 @@ + +If you got this far and the "cmp"s didn't complain, it looks +like you're in business. + +To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type + make install +To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type + make install PREFIX=/xxx/yyy +If you are (justifiably) paranoid and want to see what 'make install' +is going to do, you can first do + make -n install or + make -n install PREFIX=/xxx/yyy respectively. +The -n instructs make to show the commands it would execute, but +not actually execute them. + +Instructions for use are in the preformatted manual page, in the file +bzip2.txt. For more detailed documentation, read the full manual. +It is available in Postscript form (manual.ps) and HTML form +(manual_toc.html). + +You can also do "bzip2 --help" to see some helpful information. +"bzip2 -L" displays the software license. + diff --git a/zlib/ChangeLog b/zlib/ChangeLog new file mode 100644 index 0000000..57386a2 --- /dev/null +++ b/zlib/ChangeLog @@ -0,0 +1,471 @@ + + ChangeLog file for zlib + +Changes in 1.1.3 (9 July 1998) +- fix "an inflate input buffer bug that shows up on rare but persistent + occasions" (Mark) +- fix gzread and gztell for concatenated .gz files (Didier Le Botlan) +- fix gzseek(..., SEEK_SET) in write mode +- fix crc check after a gzeek (Frank Faubert) +- fix miniunzip when the last entry in a zip file is itself a zip file + (J Lillge) +- add contrib/asm586 and contrib/asm686 (Brian Raiter) + See http://www.muppetlabs.com/~breadbox/software/assembly.html +- add support for Delphi 3 in contrib/delphi (Bob Dellaca) +- add support for C++Builder 3 and Delphi 3 in contrib/delphi2 (Davide Moretti) +- do not exit prematurely in untgz if 0 at start of block (Magnus Holmgren) +- use macro EXTERN instead of extern to support DLL for BeOS (Sander Stoks) +- added a FAQ file + +- Support gzdopen on Mac with Metrowerks (Jason Linhart) +- Do not redefine Byte on Mac (Brad Pettit & Jason Linhart) +- define SEEK_END too if SEEK_SET is not defined (Albert Chin-A-Young) +- avoid some warnings with Borland C (Tom Tanner) +- fix a problem in contrib/minizip/zip.c for 16-bit MSDOS (Gilles Vollant) +- emulate utime() for WIN32 in contrib/untgz (Gilles Vollant) +- allow several arguments to configure (Tim Mooney, Frodo Looijaard) +- use libdir and includedir in Makefile.in (Tim Mooney) +- support shared libraries on OSF1 V4 (Tim Mooney) +- remove so_locations in "make clean" (Tim Mooney) +- fix maketree.c compilation error (Glenn, Mark) +- Python interface to zlib now in Python 1.5 (Jeremy Hylton) +- new Makefile.riscos (Rich Walker) +- initialize static descriptors in trees.c for embedded targets (Nick Smith) +- use "foo-gz" in example.c for RISCOS and VMS (Nick Smith) +- add the OS/2 files in Makefile.in too (Andrew Zabolotny) +- fix fdopen and halloc macros for Microsoft C 6.0 (Tom Lane) +- fix maketree.c to allow clean compilation of inffixed.h (Mark) +- fix parameter check in deflateCopy (Gunther Nikl) +- cleanup trees.c, use compressed_len only in debug mode (Christian Spieler) +- Many portability patches by Christian Spieler: + . zutil.c, zutil.h: added "const" for zmem* + . Make_vms.com: fixed some typos + . Make_vms.com: msdos/Makefile.*: removed zutil.h from some dependency lists + . msdos/Makefile.msc: remove "default rtl link library" info from obj files + . msdos/Makefile.*: use model-dependent name for the built zlib library + . msdos/Makefile.emx, nt/Makefile.emx, nt/Makefile.gcc: + new makefiles, for emx (DOS/OS2), emx&rsxnt and mingw32 (Windows 9x / NT) +- use define instead of typedef for Bytef also for MSC small/medium (Tom Lane) +- replace __far with _far for better portability (Christian Spieler, Tom Lane) +- fix test for errno.h in configure (Tim Newsham) + +Changes in 1.1.2 (19 March 98) +- added contrib/minzip, mini zip and unzip based on zlib (Gilles Vollant) + See http://www.winimage.com/zLibDll/unzip.html +- preinitialize the inflate tables for fixed codes, to make the code + completely thread safe (Mark) +- some simplifications and slight speed-up to the inflate code (Mark) +- fix gzeof on non-compressed files (Allan Schrum) +- add -std1 option in configure for OSF1 to fix gzprintf (Martin Mokrejs) +- use default value of 4K for Z_BUFSIZE for 16-bit MSDOS (Tim Wegner + Glenn) +- added os2/Makefile.def and os2/zlib.def (Andrew Zabolotny) +- add shared lib support for UNIX_SV4.2MP (MATSUURA Takanori) +- do not wrap extern "C" around system includes (Tom Lane) +- mention zlib binding for TCL in README (Andreas Kupries) +- added amiga/Makefile.pup for Amiga powerUP SAS/C PPC (Andreas Kleinert) +- allow "make install prefix=..." even after configure (Glenn Randers-Pehrson) +- allow "configure --prefix $HOME" (Tim Mooney) +- remove warnings in example.c and gzio.c (Glenn Randers-Pehrson) +- move Makefile.sas to amiga/Makefile.sas + +Changes in 1.1.1 (27 Feb 98) +- fix macros _tr_tally_* in deflate.h for debug mode (Glenn Randers-Pehrson) +- remove block truncation heuristic which had very marginal effect for zlib + (smaller lit_bufsize than in gzip 1.2.4) and degraded a little the + compression ratio on some files. This also allows inlining _tr_tally for + matches in deflate_slow. +- added msdos/Makefile.w32 for WIN32 Microsoft Visual C++ (Bob Frazier) + +Changes in 1.1.0 (24 Feb 98) +- do not return STREAM_END prematurely in inflate (John Bowler) +- revert to the zlib 1.0.8 inflate to avoid the gcc 2.8.0 bug (Jeremy Buhler) +- compile with -DFASTEST to get compression code optimized for speed only +- in minigzip, try mmap'ing the input file first (Miguel Albrecht) +- increase size of I/O buffers in minigzip.c and gzio.c (not a big gain + on Sun but significant on HP) + +- add a pointer to experimental unzip library in README (Gilles Vollant) +- initialize variable gcc in configure (Chris Herborth) + +Changes in 1.0.9 (17 Feb 1998) +- added gzputs and gzgets functions +- do not clear eof flag in gzseek (Mark Diekhans) +- fix gzseek for files in transparent mode (Mark Diekhans) +- do not assume that vsprintf returns the number of bytes written (Jens Krinke) +- replace EXPORT with ZEXPORT to avoid conflict with other programs +- added compress2 in zconf.h, zlib.def, zlib.dnt +- new asm code from Gilles Vollant in contrib/asm386 +- simplify the inflate code (Mark): + . Replace ZALLOC's in huft_build() with single ZALLOC in inflate_blocks_new() + . ZALLOC the length list in inflate_trees_fixed() instead of using stack + . ZALLOC the value area for huft_build() instead of using stack + . Simplify Z_FINISH check in inflate() + +- Avoid gcc 2.8.0 comparison bug a little differently than zlib 1.0.8 +- in inftrees.c, avoid cc -O bug on HP (Farshid Elahi) +- in zconf.h move the ZLIB_DLL stuff earlier to avoid problems with + the declaration of FAR (Gilles VOllant) +- install libz.so* with mode 755 (executable) instead of 644 (Marc Lehmann) +- read_buf buf parameter of type Bytef* instead of charf* +- zmemcpy parameters are of type Bytef*, not charf* (Joseph Strout) +- do not redeclare unlink in minigzip.c for WIN32 (John Bowler) +- fix check for presence of directories in "make install" (Ian Willis) + +Changes in 1.0.8 (27 Jan 1998) +- fixed offsets in contrib/asm386/gvmat32.asm (Gilles Vollant) +- fix gzgetc and gzputc for big endian systems (Markus Oberhumer) +- added compress2() to allow setting the compression level +- include sys/types.h to get off_t on some systems (Marc Lehmann & QingLong) +- use constant arrays for the static trees in trees.c instead of computing + them at run time (thanks to Ken Raeburn for this suggestion). To create + trees.h, compile with GEN_TREES_H and run "make test". +- check return code of example in "make test" and display result +- pass minigzip command line options to file_compress +- simplifying code of inflateSync to avoid gcc 2.8 bug + +- support CC="gcc -Wall" in configure -s (QingLong) +- avoid a flush caused by ftell in gzopen for write mode (Ken Raeburn) +- fix test for shared library support to avoid compiler warnings +- zlib.lib -> zlib.dll in msdos/zlib.rc (Gilles Vollant) +- check for TARGET_OS_MAC in addition to MACOS (Brad Pettit) +- do not use fdopen for Metrowerks on Mac (Brad Pettit)) +- add checks for gzputc and gzputc in example.c +- avoid warnings in gzio.c and deflate.c (Andreas Kleinert) +- use const for the CRC table (Ken Raeburn) +- fixed "make uninstall" for shared libraries +- use Tracev instead of Trace in infblock.c +- in example.c use correct compressed length for test_sync +- suppress +vnocompatwarnings in configure for HPUX (not always supported) + +Changes in 1.0.7 (20 Jan 1998) +- fix gzseek which was broken in write mode +- return error for gzseek to negative absolute position +- fix configure for Linux (Chun-Chung Chen) +- increase stack space for MSC (Tim Wegner) +- get_crc_table and inflateSyncPoint are EXPORTed (Gilles Vollant) +- define EXPORTVA for gzprintf (Gilles Vollant) +- added man page zlib.3 (Rick Rodgers) +- for contrib/untgz, fix makedir() and improve Makefile + +- check gzseek in write mode in example.c +- allocate extra buffer for seeks only if gzseek is actually called +- avoid signed/unsigned comparisons (Tim Wegner, Gilles Vollant) +- add inflateSyncPoint in zconf.h +- fix list of exported functions in nt/zlib.dnt and mdsos/zlib.def + +Changes in 1.0.6 (19 Jan 1998) +- add functions gzprintf, gzputc, gzgetc, gztell, gzeof, gzseek, gzrewind and + gzsetparams (thanks to Roland Giersig and Kevin Ruland for some of this code) +- Fix a deflate bug occuring only with compression level 0 (thanks to + Andy Buckler for finding this one). +- In minigzip, pass transparently also the first byte for .Z files. +- return Z_BUF_ERROR instead of Z_OK if output buffer full in uncompress() +- check Z_FINISH in inflate (thanks to Marc Schluper) +- Implement deflateCopy (thanks to Adam Costello) +- make static libraries by default in configure, add --shared option. +- move MSDOS or Windows specific files to directory msdos +- suppress the notion of partial flush to simplify the interface + (but the symbol Z_PARTIAL_FLUSH is kept for compatibility with 1.0.4) +- suppress history buffer provided by application to simplify the interface + (this feature was not implemented anyway in 1.0.4) +- next_in and avail_in must be initialized before calling inflateInit or + inflateInit2 +- add EXPORT in all exported functions (for Windows DLL) +- added Makefile.nt (thanks to Stephen Williams) +- added the unsupported "contrib" directory: + contrib/asm386/ by Gilles Vollant + 386 asm code replacing longest_match(). + contrib/iostream/ by Kevin Ruland + A C++ I/O streams interface to the zlib gz* functions + contrib/iostream2/ by Tyge Løvset + Another C++ I/O streams interface + contrib/untgz/ by "Pedro A. Aranda Guti\irrez" + A very simple tar.gz file extractor using zlib + contrib/visual-basic.txt by Carlos Rios + How to use compress(), uncompress() and the gz* functions from VB. +- pass params -f (filtered data), -h (huffman only), -1 to -9 (compression + level) in minigzip (thanks to Tom Lane) + +- use const for rommable constants in deflate +- added test for gzseek and gztell in example.c +- add undocumented function inflateSyncPoint() (hack for Paul Mackerras) +- add undocumented function zError to convert error code to string + (for Tim Smithers) +- Allow compilation of gzio with -DNO_DEFLATE to avoid the compression code. +- Use default memcpy for Symantec MSDOS compiler. +- Add EXPORT keyword for check_func (needed for Windows DLL) +- add current directory to LD_LIBRARY_PATH for "make test" +- create also a link for libz.so.1 +- added support for FUJITSU UXP/DS (thanks to Toshiaki Nomura) +- use $(SHAREDLIB) instead of libz.so in Makefile.in (for HPUX) +- added -soname for Linux in configure (Chun-Chung Chen, +- assign numbers to the exported functions in zlib.def (for Windows DLL) +- add advice in zlib.h for best usage of deflateSetDictionary +- work around compiler bug on Atari (cast Z_NULL in call of s->checkfn) +- allow compilation with ANSI keywords only enabled for TurboC in large model +- avoid "versionString"[0] (Borland bug) +- add NEED_DUMMY_RETURN for Borland +- use variable z_verbose for tracing in debug mode (L. Peter Deutsch). +- allow compilation with CC +- defined STDC for OS/2 (David Charlap) +- limit external names to 8 chars for MVS (Thomas Lund) +- in minigzip.c, use static buffers only for 16-bit systems +- fix suffix check for "minigzip -d foo.gz" +- do not return an error for the 2nd of two consecutive gzflush() (Felix Lee) +- use _fdopen instead of fdopen for MSC >= 6.0 (Thomas Fanslau) +- added makelcc.bat for lcc-win32 (Tom St Denis) +- in Makefile.dj2, use copy and del instead of install and rm (Frank Donahoe) +- Avoid expanded $Id$. Use "rcs -kb" or "cvs admin -kb" to avoid Id expansion. +- check for unistd.h in configure (for off_t) +- remove useless check parameter in inflate_blocks_free +- avoid useless assignment of s->check to itself in inflate_blocks_new +- do not flush twice in gzclose (thanks to Ken Raeburn) +- rename FOPEN as F_OPEN to avoid clash with /usr/include/sys/file.h +- use NO_ERRNO_H instead of enumeration of operating systems with errno.h +- work around buggy fclose on pipes for HP/UX +- support zlib DLL with BORLAND C++ 5.0 (thanks to Glenn Randers-Pehrson) +- fix configure if CC is already equal to gcc + +Changes in 1.0.5 (3 Jan 98) +- Fix inflate to terminate gracefully when fed corrupted or invalid data +- Use const for rommable constants in inflate +- Eliminate memory leaks on error conditions in inflate +- Removed some vestigial code in inflate +- Update web address in README + +Changes in 1.0.4 (24 Jul 96) +- In very rare conditions, deflate(s, Z_FINISH) could fail to produce an EOF + bit, so the decompressor could decompress all the correct data but went + on to attempt decompressing extra garbage data. This affected minigzip too. +- zlibVersion and gzerror return const char* (needed for DLL) +- port to RISCOS (no fdopen, no multiple dots, no unlink, no fileno) +- use z_error only for DEBUG (avoid problem with DLLs) + +Changes in 1.0.3 (2 Jul 96) +- use z_streamp instead of z_stream *, which is now a far pointer in MSDOS + small and medium models; this makes the library incompatible with previous + versions for these models. (No effect in large model or on other systems.) +- return OK instead of BUF_ERROR if previous deflate call returned with + avail_out as zero but there is nothing to do +- added memcmp for non STDC compilers +- define NO_DUMMY_DECL for more Mac compilers (.h files merged incorrectly) +- define __32BIT__ if __386__ or i386 is defined (pb. with Watcom and SCO) +- better check for 16-bit mode MSC (avoids problem with Symantec) + +Changes in 1.0.2 (23 May 96) +- added Windows DLL support +- added a function zlibVersion (for the DLL support) +- fixed declarations using Bytef in infutil.c (pb with MSDOS medium model) +- Bytef is define's instead of typedef'd only for Borland C +- avoid reading uninitialized memory in example.c +- mention in README that the zlib format is now RFC1950 +- updated Makefile.dj2 +- added algorithm.doc + +Changes in 1.0.1 (20 May 96) [1.0 skipped to avoid confusion] +- fix array overlay in deflate.c which sometimes caused bad compressed data +- fix inflate bug with empty stored block +- fix MSDOS medium model which was broken in 0.99 +- fix deflateParams() which could generated bad compressed data. +- Bytef is define'd instead of typedef'ed (work around Borland bug) +- added an INDEX file +- new makefiles for DJGPP (Makefile.dj2), 32-bit Borland (Makefile.b32), + Watcom (Makefile.wat), Amiga SAS/C (Makefile.sas) +- speed up adler32 for modern machines without auto-increment +- added -ansi for IRIX in configure +- static_init_done in trees.c is an int +- define unlink as delete for VMS +- fix configure for QNX +- add configure branch for SCO and HPUX +- avoid many warnings (unused variables, dead assignments, etc...) +- no fdopen for BeOS +- fix the Watcom fix for 32 bit mode (define FAR as empty) +- removed redefinition of Byte for MKWERKS +- work around an MWKERKS bug (incorrect merge of all .h files) + +Changes in 0.99 (27 Jan 96) +- allow preset dictionary shared between compressor and decompressor +- allow compression level 0 (no compression) +- add deflateParams in zlib.h: allow dynamic change of compression level + and compression strategy. +- test large buffers and deflateParams in example.c +- add optional "configure" to build zlib as a shared library +- suppress Makefile.qnx, use configure instead +- fixed deflate for 64-bit systems (detected on Cray) +- fixed inflate_blocks for 64-bit systems (detected on Alpha) +- declare Z_DEFLATED in zlib.h (possible parameter for deflateInit2) +- always return Z_BUF_ERROR when deflate() has nothing to do +- deflateInit and inflateInit are now macros to allow version checking +- prefix all global functions and types with z_ with -DZ_PREFIX +- make falloc completely reentrant (inftrees.c) +- fixed very unlikely race condition in ct_static_init +- free in reverse order of allocation to help memory manager +- use zlib-1.0/* instead of zlib/* inside the tar.gz +- make zlib warning-free with "gcc -O3 -Wall -Wwrite-strings -Wpointer-arith + -Wconversion -Wstrict-prototypes -Wmissing-prototypes" +- allow gzread on concatenated .gz files +- deflateEnd now returns Z_DATA_ERROR if it was premature +- deflate is finally (?) fully deterministic (no matches beyond end of input) +- Document Z_SYNC_FLUSH +- add uninstall in Makefile +- Check for __cpluplus in zlib.h +- Better test in ct_align for partial flush +- avoid harmless warnings for Borland C++ +- initialize hash_head in deflate.c +- avoid warning on fdopen (gzio.c) for HP cc -Aa +- include stdlib.h for STDC compilers +- include errno.h for Cray +- ignore error if ranlib doesn't exist +- call ranlib twice for NeXTSTEP +- use exec_prefix instead of prefix for libz.a +- renamed ct_* as _tr_* to avoid conflict with applications +- clear z->msg in inflateInit2 before any error return +- initialize opaque in example.c, gzio.c, deflate.c and inflate.c +- fixed typo in zconf.h (_GNUC__ => __GNUC__) +- check for WIN32 in zconf.h and zutil.c (avoid farmalloc in 32-bit mode) +- fix typo in Make_vms.com (f$trnlnm -> f$getsyi) +- in fcalloc, normalize pointer if size > 65520 bytes +- don't use special fcalloc for 32 bit Borland C++ +- use STDC instead of __GO32__ to avoid redeclaring exit, calloc, etc... +- use Z_BINARY instead of BINARY +- document that gzclose after gzdopen will close the file +- allow "a" as mode in gzopen. +- fix error checking in gzread +- allow skipping .gz extra-field on pipes +- added reference to Perl interface in README +- put the crc table in FAR data (I dislike more and more the medium model :) +- added get_crc_table +- added a dimension to all arrays (Borland C can't count). +- workaround Borland C bug in declaration of inflate_codes_new & inflate_fast +- guard against multiple inclusion of *.h (for precompiled header on Mac) +- Watcom C pretends to be Microsoft C small model even in 32 bit mode. +- don't use unsized arrays to avoid silly warnings by Visual C++: + warning C4746: 'inflate_mask' : unsized array treated as '__far' + (what's wrong with far data in far model?). +- define enum out of inflate_blocks_state to allow compilation with C++ + +Changes in 0.95 (16 Aug 95) +- fix MSDOS small and medium model (now easier to adapt to any compiler) +- inlined send_bits +- fix the final (:-) bug for deflate with flush (output was correct but + not completely flushed in rare occasions). +- default window size is same for compression and decompression + (it's now sufficient to set MAX_WBITS in zconf.h). +- voidp -> voidpf and voidnp -> voidp (for consistency with other + typedefs and because voidnp was not near in large model). + +Changes in 0.94 (13 Aug 95) +- support MSDOS medium model +- fix deflate with flush (could sometimes generate bad output) +- fix deflateReset (zlib header was incorrectly suppressed) +- added support for VMS +- allow a compression level in gzopen() +- gzflush now calls fflush +- For deflate with flush, flush even if no more input is provided. +- rename libgz.a as libz.a +- avoid complex expression in infcodes.c triggering Turbo C bug +- work around a problem with gcc on Alpha (in INSERT_STRING) +- don't use inline functions (problem with some gcc versions) +- allow renaming of Byte, uInt, etc... with #define. +- avoid warning about (unused) pointer before start of array in deflate.c +- avoid various warnings in gzio.c, example.c, infblock.c, adler32.c, zutil.c +- avoid reserved word 'new' in trees.c + +Changes in 0.93 (25 June 95) +- temporarily disable inline functions +- make deflate deterministic +- give enough lookahead for PARTIAL_FLUSH +- Set binary mode for stdin/stdout in minigzip.c for OS/2 +- don't even use signed char in inflate (not portable enough) +- fix inflate memory leak for segmented architectures + +Changes in 0.92 (3 May 95) +- don't assume that char is signed (problem on SGI) +- Clear bit buffer when starting a stored block +- no memcpy on Pyramid +- suppressed inftest.c +- optimized fill_window, put longest_match inline for gcc +- optimized inflate on stored blocks. +- untabify all sources to simplify patches + +Changes in 0.91 (2 May 95) +- Default MEM_LEVEL is 8 (not 9 for Unix) as documented in zlib.h +- Document the memory requirements in zconf.h +- added "make install" +- fix sync search logic in inflateSync +- deflate(Z_FULL_FLUSH) now works even if output buffer too short +- after inflateSync, don't scare people with just "lo world" +- added support for DJGPP + +Changes in 0.9 (1 May 95) +- don't assume that zalloc clears the allocated memory (the TurboC bug + was Mark's bug after all :) +- let again gzread copy uncompressed data unchanged (was working in 0.71) +- deflate(Z_FULL_FLUSH), inflateReset and inflateSync are now fully implemented +- added a test of inflateSync in example.c +- moved MAX_WBITS to zconf.h because users might want to change that. +- document explicitly that zalloc(64K) on MSDOS must return a normalized + pointer (zero offset) +- added Makefiles for Microsoft C, Turbo C, Borland C++ +- faster crc32() + +Changes in 0.8 (29 April 95) +- added fast inflate (inffast.c) +- deflate(Z_FINISH) now returns Z_STREAM_END when done. Warning: this + is incompatible with previous versions of zlib which returned Z_OK. +- work around a TurboC compiler bug (bad code for b << 0, see infutil.h) + (actually that was not a compiler bug, see 0.81 above) +- gzread no longer reads one extra byte in certain cases +- In gzio destroy(), don't reference a freed structure +- avoid many warnings for MSDOS +- avoid the ERROR symbol which is used by MS Windows + +Changes in 0.71 (14 April 95) +- Fixed more MSDOS compilation problems :( There is still a bug with + TurboC large model. + +Changes in 0.7 (14 April 95) +- Added full inflate support. +- Simplified the crc32() interface. The pre- and post-conditioning + (one's complement) is now done inside crc32(). WARNING: this is + incompatible with previous versions; see zlib.h for the new usage. + +Changes in 0.61 (12 April 95) +- workaround for a bug in TurboC. example and minigzip now work on MSDOS. + +Changes in 0.6 (11 April 95) +- added minigzip.c +- added gzdopen to reopen a file descriptor as gzFile +- added transparent reading of non-gziped files in gzread. +- fixed bug in gzread (don't read crc as data) +- fixed bug in destroy (gzio.c) (don't return Z_STREAM_END for gzclose). +- don't allocate big arrays in the stack (for MSDOS) +- fix some MSDOS compilation problems + +Changes in 0.5: +- do real compression in deflate.c. Z_PARTIAL_FLUSH is supported but + not yet Z_FULL_FLUSH. +- support decompression but only in a single step (forced Z_FINISH) +- added opaque object for zalloc and zfree. +- added deflateReset and inflateReset +- added a variable zlib_version for consistency checking. +- renamed the 'filter' parameter of deflateInit2 as 'strategy'. + Added Z_FILTERED and Z_HUFFMAN_ONLY constants. + +Changes in 0.4: +- avoid "zip" everywhere, use zlib instead of ziplib. +- suppress Z_BLOCK_FLUSH, interpret Z_PARTIAL_FLUSH as block flush + if compression method == 8. +- added adler32 and crc32 +- renamed deflateOptions as deflateInit2, call one or the other but not both +- added the method parameter for deflateInit2. +- added inflateInit2 +- simplied considerably deflateInit and inflateInit by not supporting + user-provided history buffer. This is supported only in deflateInit2 + and inflateInit2. + +Changes in 0.3: +- prefix all macro names with Z_ +- use Z_FINISH instead of deflateEnd to finish compression. +- added Z_HUFFMAN_ONLY +- added gzerror() diff --git a/zlib/FAQ b/zlib/FAQ new file mode 100644 index 0000000..0feb6d3 --- /dev/null +++ b/zlib/FAQ @@ -0,0 +1,72 @@ + + Frequently Asked Questions about zlib + + +If your question is not there, please check the zlib home page +http://www.cdrom.com/pub/infozip/zlib/ which may have more recent information. + + +1) I need a Windows DLL +2) I need a Visual Basic interface to zlib +3) compress() returns Z_BUF_ERROR +4) deflate or inflate returns Z_BUF_ERROR +5) Where is the zlib documentation (man pages, etc...)? +6) Why don't you use GNU autoconf, libtool, etc...? +7) There is a bug in zlib. +8) I get "undefined reference to gzputc" + + + +1) I need a Windows DLL + + The zlib sources can be compiled without change to produce a DLL. + If you want a precompiled DLL, see http://www.winimage.com/zLibDll + + +2) I need a Visual Basic interface to zlib + + See http://www.tcfb.com/dowseware/cmp-z-it.zip + http://web2.airmail.net/markn/articles/zlibtool/zlibtool.htm + and contrib/visual-basic.txt + +3) compress() returns Z_BUF_ERROR + + Make sure that before the call of compress, the length of the + compressed buffer is equal to the total size of the compressed buffer + and not zero. For Visual Basic, check that this parameter is passed + by reference ("as any"), not by value ("as long"). + + +4) deflate or inflate returns Z_BUF_ERROR + + Make sure that before the call avail_in and avail_out are not zero. + + +5) Where is the zlib documentation (man pages, etc...)? + + It's in zlib.h for the moment. Volunteers to transform this + to man pages, please contact jloup@gzip.org. Examples of zlib usage + are in the files example.c and minigzip.c. + + +6) Why don't you use GNU autoconf, libtool, etc...? + + Because we would like to keep zlib as a very small and simple package. + zlib is rather portable and doesn't need much configuration. + + +7) There is a bug in zlib. + + Most of the time, such problems are due to an incorrect usage + of zlib. Please try to reproduce the problem with a small + program and send us the corresponding source at zlib@quest.jpl.nasa.gov + Do not send multi-megabyte data files without prior agreement. + + +8) I get "undefined reference to gzputc" + + If "make test" produces something like + example.o(.text+0x174): + check that you don't have old files libz.* in /usr/lib, /usr/local/lib + or /usr/X11R6/lib. Remove old versions then do "make install". + diff --git a/zlib/INDEX b/zlib/INDEX new file mode 100644 index 0000000..8a24576 --- /dev/null +++ b/zlib/INDEX @@ -0,0 +1,86 @@ +ChangeLog history of changes +INDEX this file +FAQ Frequently Asked Questions about zlib +Make_vms.com script for Vax/VMS +Makefile makefile for Unix (generated by configure) +Makefile.in makefile for Unix (template for configure) +Makefile.riscos makefile for RISCOS +README guess what +algorithm.txt description of the (de)compression algorithm +configure configure script for Unix +descrip.mms makefile for Vax/VMS +zlib.3 mini man page for zlib (volunteers to write full + man pages from zlib.h welcome. write to jloup@gzip.org) + +amiga/Makefile.sas makefile for Amiga SAS/C +amiga/Makefile.pup makefile for Amiga powerUP SAS/C PPC + +msdos/Makefile.w32 makefile for Microsoft Visual C++ 32-bit +msdos/Makefile.b32 makefile for Borland C++ 32-bit +msdos/Makefile.bor makefile for Borland C/C++ 16-bit +msdos/Makefile.dj2 makefile for DJGPP 2.x +msdos/Makefile.emx makefile for EMX 0.9c (32-bit DOS/OS2) +msdos/Makefile.msc makefile for Microsoft C 16-bit +msdos/Makefile.tc makefile for Turbo C +msdos/Makefile.wat makefile for Watcom C +msdos/zlib.def definition file for Windows DLL +msdos/zlib.rc definition file for Windows DLL + +nt/Makefile.nt makefile for Windows NT +nt/zlib.dnt definition file for Windows NT DLL +nt/Makefile.emx makefile for EMX 0.9c/RSXNT 1.41 (Win32 Intel) +nt/Makefile.gcc makefile for Windows NT using GCC (mingw32) + + + zlib public header files (must be kept): +zconf.h +zlib.h + + private source files used to build the zlib library: +adler32.c +compress.c +crc32.c +deflate.c +deflate.h +gzio.c +infblock.c +infblock.h +infcodes.c +infcodes.h +inffast.c +inffast.h +inflate.c +inftrees.c +inftrees.h +infutil.c +infutil.h +maketree.c +trees.c +uncompr.c +zutil.c +zutil.h + + source files for sample programs: +example.c +minigzip.c + + unsupported contribution by third parties + +contrib/asm386/ by Gilles Vollant + 386 asm code replacing longest_match(). + +contrib/minizip/ by Gilles Vollant + Mini zip and unzip based on zlib + See http://www.winimage.com/zLibDll/unzip.html + +contrib/iostream/ by Kevin Ruland + A C++ I/O streams interface to the zlib gz* functions + +contrib/iostream2/ by Tyge Løvset + Another C++ I/O streams interface + +contrib/untgz/ by "Pedro A. Aranda Guti\irrez" + A very simple tar.gz extractor using zlib + +contrib/visual-basic.txt by Carlos Rios + How to use compress(), uncompress() and the gz* functions from VB. diff --git a/zlib/Make_vms.com b/zlib/Make_vms.com new file mode 100644 index 0000000..1c57e8f --- /dev/null +++ b/zlib/Make_vms.com @@ -0,0 +1,115 @@ +$! make libz under VMS +$! written by Martin P.J. Zinser +$! +$! Look for the compiler used +$! +$ ccopt = "" +$ if f$getsyi("HW_MODEL").ge.1024 +$ then +$ ccopt = "/prefix=all"+ccopt +$ comp = "__decc__=1" +$ if f$trnlnm("SYS").eqs."" then define sys sys$library: +$ else +$ if f$search("SYS$SYSTEM:DECC$COMPILER.EXE").eqs."" +$ then +$ comp = "__vaxc__=1" +$ if f$trnlnm("SYS").eqs."" then define sys sys$library: +$ else +$ if f$trnlnm("SYS").eqs."" then define sys decc$library_include: +$ ccopt = "/decc/prefix=all"+ccopt +$ comp = "__decc__=1" +$ endif +$ endif +$! +$! Build the thing plain or with mms +$! +$ write sys$output "Compiling Zlib sources ..." +$ if f$search("SYS$SYSTEM:MMS.EXE").eqs."" +$ then +$ dele example.obj;*,minigzip.obj;* +$ CALL MAKE adler32.OBJ "CC ''CCOPT' adler32" - + adler32.c zlib.h zconf.h +$ CALL MAKE compress.OBJ "CC ''CCOPT' compress" - + compress.c zlib.h zconf.h +$ CALL MAKE crc32.OBJ "CC ''CCOPT' crc32" - + crc32.c zlib.h zconf.h +$ CALL MAKE deflate.OBJ "CC ''CCOPT' deflate" - + deflate.c deflate.h zutil.h zlib.h zconf.h +$ CALL MAKE gzio.OBJ "CC ''CCOPT' gzio" - + gzio.c zutil.h zlib.h zconf.h +$ CALL MAKE infblock.OBJ "CC ''CCOPT' infblock" - + infblock.c zutil.h zlib.h zconf.h infblock.h +$ CALL MAKE infcodes.OBJ "CC ''CCOPT' infcodes" - + infcodes.c zutil.h zlib.h zconf.h inftrees.h +$ CALL MAKE inffast.OBJ "CC ''CCOPT' inffast" - + inffast.c zutil.h zlib.h zconf.h inffast.h +$ CALL MAKE inflate.OBJ "CC ''CCOPT' inflate" - + inflate.c zutil.h zlib.h zconf.h infblock.h +$ CALL MAKE inftrees.OBJ "CC ''CCOPT' inftrees" - + inftrees.c zutil.h zlib.h zconf.h inftrees.h +$ CALL MAKE infutil.OBJ "CC ''CCOPT' infutil" - + infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h +$ CALL MAKE trees.OBJ "CC ''CCOPT' trees" - + trees.c deflate.h zutil.h zlib.h zconf.h +$ CALL MAKE uncompr.OBJ "CC ''CCOPT' uncompr" - + uncompr.c zlib.h zconf.h +$ CALL MAKE zutil.OBJ "CC ''CCOPT' zutil" - + zutil.c zutil.h zlib.h zconf.h +$ write sys$output "Building Zlib ..." +$ CALL MAKE libz.OLB "lib/crea libz.olb *.obj" *.OBJ +$ write sys$output "Building example..." +$ CALL MAKE example.OBJ "CC ''CCOPT' example" - + example.c zlib.h zconf.h +$ call make example.exe "LINK example,libz.olb/lib" example.obj libz.olb +$ write sys$output "Building minigzip..." +$ CALL MAKE minigzip.OBJ "CC ''CCOPT' minigzip" - + minigzip.c zlib.h zconf.h +$ call make minigzip.exe - + "LINK minigzip,libz.olb/lib,x11vms:xvmsutils.olb/lib" - + minigzip.obj libz.olb +$ else +$ mms/macro=('comp') +$ endif +$ write sys$output "Zlib build completed" +$ exit +$! +$! +$MAKE: SUBROUTINE !SUBROUTINE TO CHECK DEPENDENCIES +$ V = 'F$Verify(0) +$! P1 = What we are trying to make +$! P2 = Command to make it +$! P3 - P8 What it depends on +$ +$ If F$Search(P1) .Eqs. "" Then Goto Makeit +$ Time = F$CvTime(F$File(P1,"RDT")) +$arg=3 +$Loop: +$ Argument = P'arg +$ If Argument .Eqs. "" Then Goto Exit +$ El=0 +$Loop2: +$ File = F$Element(El," ",Argument) +$ If File .Eqs. " " Then Goto Endl +$ AFile = "" +$Loop3: +$ OFile = AFile +$ AFile = F$Search(File) +$ If AFile .Eqs. "" .Or. AFile .Eqs. OFile Then Goto NextEl +$ If F$CvTime(F$File(AFile,"RDT")) .Ges. Time Then Goto Makeit +$ Goto Loop3 +$NextEL: +$ El = El + 1 +$ Goto Loop2 +$EndL: +$ arg=arg+1 +$ If arg .Le. 8 Then Goto Loop +$ Goto Exit +$ +$Makeit: +$ VV=F$VERIFY(0) +$ write sys$output P2 +$ 'P2 +$ VV='F$Verify(VV) +$Exit: +$ If V Then Set Verify +$ENDSUBROUTINE diff --git a/zlib/Makefile b/zlib/Makefile new file mode 100644 index 0000000..3a3b116 --- /dev/null +++ b/zlib/Makefile @@ -0,0 +1,174 @@ +# Makefile for zlib +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile and test, type: +# ./configure; make test +# The call of configure is optional if you don't have special requirements +# If you wish to build zlib as a shared library, use: ./configure -s + +# To install /usr/local/lib/libz.* and /usr/local/include/zlib.h, type: +# make install +# To install in $HOME instead of /usr/local, use: +# make install prefix=$HOME + +CC=cc + +CFLAGS=-O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-g -DDEBUG +#CFLAGS=-O3 -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ +# -Wstrict-prototypes -Wmissing-prototypes + +LDFLAGS=-L. -lz +LDSHARED=$(CC) +CPP=$(CC) -E + +VER=1.1.3 +LIBS=libz.a +SHAREDLIB=libz.so + +AR=ar rc +RANLIB=ranlib +TAR=tar +SHELL=/bin/sh + +prefix = /usr/local +exec_prefix = ${prefix} +libdir = ${exec_prefix}/lib +includedir = ${prefix}/include + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +OBJA = +# to use the asm code: make OBJA=match.o + +TEST_OBJS = example.o minigzip.o + +DISTFILES = README FAQ INDEX ChangeLog configure Make*[a-z0-9] *.[ch] *.mms \ + algorithm.txt zlib.3 msdos/Make*[a-z0-9] msdos/zlib.def msdos/zlib.rc \ + nt/Make*[a-z0-9] nt/zlib.dnt amiga/Make*.??? os2/M*.os2 os2/zlib.def \ + contrib/RE*.contrib contrib/*.txt contrib/asm386/*.asm contrib/asm386/*.c \ + contrib/asm386/*.bat contrib/asm386/zlibvc.d?? contrib/asm[56]86/*.?86 \ + contrib/asm[56]86/*.S contrib/iostream/*.cpp \ + contrib/iostream/*.h contrib/iostream2/*.h contrib/iostream2/*.cpp \ + contrib/untgz/Makefile contrib/untgz/*.c contrib/untgz/*.w32 \ + contrib/minizip/[CM]*[pe] contrib/minizip/*.[ch] contrib/minizip/*.[td]?? \ + contrib/delphi*/*.??? + +all: example minigzip + +test: all + @LD_LIBRARY_PATH=.:$(LD_LIBRARY_PATH) ; export LD_LIBRARY_PATH; \ + echo hello world | ./minigzip | ./minigzip -d || \ + echo ' *** minigzip test FAILED ***' ; \ + if ./example; then \ + echo ' *** zlib test OK ***'; \ + else \ + echo ' *** zlib test FAILED ***'; \ + fi + +libz.a: $(OBJS) $(OBJA) + $(AR) $@ $(OBJS) $(OBJA) + -@ ($(RANLIB) $@ || true) >/dev/null 2>&1 + +match.o: match.S + $(CPP) match.S > _match.s + $(CC) -c _match.s + mv _match.o match.o + rm -f _match.s + +$(SHAREDLIB).$(VER): $(OBJS) + $(LDSHARED) -o $@ $(OBJS) + rm -f $(SHAREDLIB) $(SHAREDLIB).1 + ln -s $@ $(SHAREDLIB) + ln -s $@ $(SHAREDLIB).1 + +example: example.o $(LIBS) + $(CC) $(CFLAGS) -o $@ example.o $(LDFLAGS) + +minigzip: minigzip.o $(LIBS) + $(CC) $(CFLAGS) -o $@ minigzip.o $(LDFLAGS) + +install: $(LIBS) + -@if [ ! -d $(includedir) ]; then mkdir $(includedir); fi + -@if [ ! -d $(libdir) ]; then mkdir $(libdir); fi + cp zlib.h zconf.h $(includedir) + chmod 644 $(includedir)/zlib.h $(includedir)/zconf.h + cp $(LIBS) $(libdir) + cd $(libdir); chmod 755 $(LIBS) + -@(cd $(libdir); $(RANLIB) libz.a || true) >/dev/null 2>&1 + cd $(libdir); if test -f $(SHAREDLIB).$(VER); then \ + rm -f $(SHAREDLIB) $(SHAREDLIB).1; \ + ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB); \ + ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB).1; \ + (ldconfig || true) >/dev/null 2>&1; \ + fi +# The ranlib in install is needed on NeXTSTEP which checks file times +# ldconfig is for Linux + +uninstall: + cd $(includedir); \ + v=$(VER); \ + if test -f zlib.h; then \ + v=`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`; \ + rm -f zlib.h zconf.h; \ + fi; \ + cd $(libdir); rm -f libz.a; \ + if test -f $(SHAREDLIB).$$v; then \ + rm -f $(SHAREDLIB).$$v $(SHAREDLIB) $(SHAREDLIB).1; \ + fi + +clean: + rm -f *.o *~ example minigzip libz.a libz.so* foo.gz so_locations \ + _match.s maketree + +distclean: clean + +zip: + mv Makefile Makefile~; cp -p Makefile.in Makefile + rm -f test.c ztest*.c contrib/minizip/test.zip + v=`sed -n -e 's/\.//g' -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\ + zip -ul9 zlib$$v $(DISTFILES) + mv Makefile~ Makefile + +dist: + mv Makefile Makefile~; cp -p Makefile.in Makefile + rm -f test.c ztest*.c contrib/minizip/test.zip + d=zlib-`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\ + rm -f $$d.tar.gz; \ + if test ! -d ../$$d; then rm -f ../$$d; ln -s `pwd` ../$$d; fi; \ + files=""; \ + for f in $(DISTFILES); do files="$$files $$d/$$f"; done; \ + cd ..; \ + GZIP=-9 $(TAR) chofz $$d/$$d.tar.gz $$files; \ + if test ! -d $$d; then rm -f $$d; fi + mv Makefile~ Makefile + +tags: + etags *.[ch] + +depend: + makedepend -- $(CFLAGS) -- *.[ch] + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +adler32.o: zlib.h zconf.h +compress.o: zlib.h zconf.h +crc32.o: zlib.h zconf.h +deflate.o: deflate.h zutil.h zlib.h zconf.h +example.o: zlib.h zconf.h +gzio.o: zutil.h zlib.h zconf.h +infblock.o: infblock.h inftrees.h infcodes.h infutil.h zutil.h zlib.h zconf.h +infcodes.o: zutil.h zlib.h zconf.h +infcodes.o: inftrees.h infblock.h infcodes.h infutil.h inffast.h +inffast.o: zutil.h zlib.h zconf.h inftrees.h +inffast.o: infblock.h infcodes.h infutil.h inffast.h +inflate.o: zutil.h zlib.h zconf.h infblock.h +inftrees.o: zutil.h zlib.h zconf.h inftrees.h +infutil.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h +minigzip.o: zlib.h zconf.h +trees.o: deflate.h zutil.h zlib.h zconf.h trees.h +uncompr.o: zlib.h zconf.h +zutil.o: zutil.h zlib.h zconf.h diff --git a/zlib/Makefile.in b/zlib/Makefile.in new file mode 100644 index 0000000..3a3b116 --- /dev/null +++ b/zlib/Makefile.in @@ -0,0 +1,174 @@ +# Makefile for zlib +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile and test, type: +# ./configure; make test +# The call of configure is optional if you don't have special requirements +# If you wish to build zlib as a shared library, use: ./configure -s + +# To install /usr/local/lib/libz.* and /usr/local/include/zlib.h, type: +# make install +# To install in $HOME instead of /usr/local, use: +# make install prefix=$HOME + +CC=cc + +CFLAGS=-O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-g -DDEBUG +#CFLAGS=-O3 -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ +# -Wstrict-prototypes -Wmissing-prototypes + +LDFLAGS=-L. -lz +LDSHARED=$(CC) +CPP=$(CC) -E + +VER=1.1.3 +LIBS=libz.a +SHAREDLIB=libz.so + +AR=ar rc +RANLIB=ranlib +TAR=tar +SHELL=/bin/sh + +prefix = /usr/local +exec_prefix = ${prefix} +libdir = ${exec_prefix}/lib +includedir = ${prefix}/include + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +OBJA = +# to use the asm code: make OBJA=match.o + +TEST_OBJS = example.o minigzip.o + +DISTFILES = README FAQ INDEX ChangeLog configure Make*[a-z0-9] *.[ch] *.mms \ + algorithm.txt zlib.3 msdos/Make*[a-z0-9] msdos/zlib.def msdos/zlib.rc \ + nt/Make*[a-z0-9] nt/zlib.dnt amiga/Make*.??? os2/M*.os2 os2/zlib.def \ + contrib/RE*.contrib contrib/*.txt contrib/asm386/*.asm contrib/asm386/*.c \ + contrib/asm386/*.bat contrib/asm386/zlibvc.d?? contrib/asm[56]86/*.?86 \ + contrib/asm[56]86/*.S contrib/iostream/*.cpp \ + contrib/iostream/*.h contrib/iostream2/*.h contrib/iostream2/*.cpp \ + contrib/untgz/Makefile contrib/untgz/*.c contrib/untgz/*.w32 \ + contrib/minizip/[CM]*[pe] contrib/minizip/*.[ch] contrib/minizip/*.[td]?? \ + contrib/delphi*/*.??? + +all: example minigzip + +test: all + @LD_LIBRARY_PATH=.:$(LD_LIBRARY_PATH) ; export LD_LIBRARY_PATH; \ + echo hello world | ./minigzip | ./minigzip -d || \ + echo ' *** minigzip test FAILED ***' ; \ + if ./example; then \ + echo ' *** zlib test OK ***'; \ + else \ + echo ' *** zlib test FAILED ***'; \ + fi + +libz.a: $(OBJS) $(OBJA) + $(AR) $@ $(OBJS) $(OBJA) + -@ ($(RANLIB) $@ || true) >/dev/null 2>&1 + +match.o: match.S + $(CPP) match.S > _match.s + $(CC) -c _match.s + mv _match.o match.o + rm -f _match.s + +$(SHAREDLIB).$(VER): $(OBJS) + $(LDSHARED) -o $@ $(OBJS) + rm -f $(SHAREDLIB) $(SHAREDLIB).1 + ln -s $@ $(SHAREDLIB) + ln -s $@ $(SHAREDLIB).1 + +example: example.o $(LIBS) + $(CC) $(CFLAGS) -o $@ example.o $(LDFLAGS) + +minigzip: minigzip.o $(LIBS) + $(CC) $(CFLAGS) -o $@ minigzip.o $(LDFLAGS) + +install: $(LIBS) + -@if [ ! -d $(includedir) ]; then mkdir $(includedir); fi + -@if [ ! -d $(libdir) ]; then mkdir $(libdir); fi + cp zlib.h zconf.h $(includedir) + chmod 644 $(includedir)/zlib.h $(includedir)/zconf.h + cp $(LIBS) $(libdir) + cd $(libdir); chmod 755 $(LIBS) + -@(cd $(libdir); $(RANLIB) libz.a || true) >/dev/null 2>&1 + cd $(libdir); if test -f $(SHAREDLIB).$(VER); then \ + rm -f $(SHAREDLIB) $(SHAREDLIB).1; \ + ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB); \ + ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB).1; \ + (ldconfig || true) >/dev/null 2>&1; \ + fi +# The ranlib in install is needed on NeXTSTEP which checks file times +# ldconfig is for Linux + +uninstall: + cd $(includedir); \ + v=$(VER); \ + if test -f zlib.h; then \ + v=`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`; \ + rm -f zlib.h zconf.h; \ + fi; \ + cd $(libdir); rm -f libz.a; \ + if test -f $(SHAREDLIB).$$v; then \ + rm -f $(SHAREDLIB).$$v $(SHAREDLIB) $(SHAREDLIB).1; \ + fi + +clean: + rm -f *.o *~ example minigzip libz.a libz.so* foo.gz so_locations \ + _match.s maketree + +distclean: clean + +zip: + mv Makefile Makefile~; cp -p Makefile.in Makefile + rm -f test.c ztest*.c contrib/minizip/test.zip + v=`sed -n -e 's/\.//g' -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\ + zip -ul9 zlib$$v $(DISTFILES) + mv Makefile~ Makefile + +dist: + mv Makefile Makefile~; cp -p Makefile.in Makefile + rm -f test.c ztest*.c contrib/minizip/test.zip + d=zlib-`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\ + rm -f $$d.tar.gz; \ + if test ! -d ../$$d; then rm -f ../$$d; ln -s `pwd` ../$$d; fi; \ + files=""; \ + for f in $(DISTFILES); do files="$$files $$d/$$f"; done; \ + cd ..; \ + GZIP=-9 $(TAR) chofz $$d/$$d.tar.gz $$files; \ + if test ! -d $$d; then rm -f $$d; fi + mv Makefile~ Makefile + +tags: + etags *.[ch] + +depend: + makedepend -- $(CFLAGS) -- *.[ch] + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +adler32.o: zlib.h zconf.h +compress.o: zlib.h zconf.h +crc32.o: zlib.h zconf.h +deflate.o: deflate.h zutil.h zlib.h zconf.h +example.o: zlib.h zconf.h +gzio.o: zutil.h zlib.h zconf.h +infblock.o: infblock.h inftrees.h infcodes.h infutil.h zutil.h zlib.h zconf.h +infcodes.o: zutil.h zlib.h zconf.h +infcodes.o: inftrees.h infblock.h infcodes.h infutil.h inffast.h +inffast.o: zutil.h zlib.h zconf.h inftrees.h +inffast.o: infblock.h infcodes.h infutil.h inffast.h +inflate.o: zutil.h zlib.h zconf.h infblock.h +inftrees.o: zutil.h zlib.h zconf.h inftrees.h +infutil.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h +minigzip.o: zlib.h zconf.h +trees.o: deflate.h zutil.h zlib.h zconf.h trees.h +uncompr.o: zlib.h zconf.h +zutil.o: zutil.h zlib.h zconf.h diff --git a/zlib/Makefile.riscos b/zlib/Makefile.riscos new file mode 100644 index 0000000..d97f449 --- /dev/null +++ b/zlib/Makefile.riscos @@ -0,0 +1,151 @@ +# Project: zlib_1_03 +# Patched for zlib 1.1.2 rw@shadow.org.uk 19980430 +# test works out-of-the-box, installs `somewhere' on demand + +# Toolflags: +CCflags = -c -depend !Depend -IC: -g -throwback -DRISCOS -fah +C++flags = -c -depend !Depend -IC: -throwback +Linkflags = -aif -c++ -o $@ +ObjAsmflags = -throwback -NoCache -depend !Depend +CMHGflags = +LibFileflags = -c -l -o $@ +Squeezeflags = -o $@ + +# change the line below to where _you_ want the library installed. +libdest = lib:zlib + +# Final targets: +@.lib: @.o.adler32 @.o.compress @.o.crc32 @.o.deflate @.o.gzio \ + @.o.infblock @.o.infcodes @.o.inffast @.o.inflate @.o.inftrees @.o.infutil @.o.trees \ + @.o.uncompr @.o.zutil + LibFile $(LibFileflags) @.o.adler32 @.o.compress @.o.crc32 @.o.deflate \ + @.o.gzio @.o.infblock @.o.infcodes @.o.inffast @.o.inflate @.o.inftrees @.o.infutil \ + @.o.trees @.o.uncompr @.o.zutil +test: @.minigzip @.example @.lib + @copy @.lib @.libc A~C~DF~L~N~P~Q~RS~TV + @echo running tests: hang on. + @/@.minigzip -f -9 libc + @/@.minigzip -d libc-gz + @/@.minigzip -f -1 libc + @/@.minigzip -d libc-gz + @/@.minigzip -h -9 libc + @/@.minigzip -d libc-gz + @/@.minigzip -h -1 libc + @/@.minigzip -d libc-gz + @/@.minigzip -9 libc + @/@.minigzip -d libc-gz + @/@.minigzip -1 libc + @/@.minigzip -d libc-gz + @diff @.lib @.libc + @echo that should have reported '@.lib and @.libc identical' if you have diff. + @/@.example @.fred @.fred + @echo that will have given lots of hello!'s. + +@.minigzip: @.o.minigzip @.lib C:o.Stubs + Link $(Linkflags) @.o.minigzip @.lib C:o.Stubs +@.example: @.o.example @.lib C:o.Stubs + Link $(Linkflags) @.o.example @.lib C:o.Stubs + +install: @.lib + cdir $(libdest) + cdir $(libdest).h + @copy @.h.zlib $(libdest).h.zlib A~C~DF~L~N~P~Q~RS~TV + @copy @.h.zconf $(libdest).h.zconf A~C~DF~L~N~P~Q~RS~TV + @copy @.lib $(libdest).lib A~C~DF~L~N~P~Q~RS~TV + @echo okay, installed zlib in $(libdest) + +clean:; remove @.minigzip + remove @.example + remove @.libc + -wipe @.o.* F~r~cV + remove @.fred + +# User-editable dependencies: +.c.o: + cc $(ccflags) -o $@ $< + +# Static dependencies: + +# Dynamic dependencies: +o.example: c.example +o.example: h.zlib +o.example: h.zconf +o.minigzip: c.minigzip +o.minigzip: h.zlib +o.minigzip: h.zconf +o.adler32: c.adler32 +o.adler32: h.zlib +o.adler32: h.zconf +o.compress: c.compress +o.compress: h.zlib +o.compress: h.zconf +o.crc32: c.crc32 +o.crc32: h.zlib +o.crc32: h.zconf +o.deflate: c.deflate +o.deflate: h.deflate +o.deflate: h.zutil +o.deflate: h.zlib +o.deflate: h.zconf +o.gzio: c.gzio +o.gzio: h.zutil +o.gzio: h.zlib +o.gzio: h.zconf +o.infblock: c.infblock +o.infblock: h.zutil +o.infblock: h.zlib +o.infblock: h.zconf +o.infblock: h.infblock +o.infblock: h.inftrees +o.infblock: h.infcodes +o.infblock: h.infutil +o.infcodes: c.infcodes +o.infcodes: h.zutil +o.infcodes: h.zlib +o.infcodes: h.zconf +o.infcodes: h.inftrees +o.infcodes: h.infblock +o.infcodes: h.infcodes +o.infcodes: h.infutil +o.infcodes: h.inffast +o.inffast: c.inffast +o.inffast: h.zutil +o.inffast: h.zlib +o.inffast: h.zconf +o.inffast: h.inftrees +o.inffast: h.infblock +o.inffast: h.infcodes +o.inffast: h.infutil +o.inffast: h.inffast +o.inflate: c.inflate +o.inflate: h.zutil +o.inflate: h.zlib +o.inflate: h.zconf +o.inflate: h.infblock +o.inftrees: c.inftrees +o.inftrees: h.zutil +o.inftrees: h.zlib +o.inftrees: h.zconf +o.inftrees: h.inftrees +o.inftrees: h.inffixed +o.infutil: c.infutil +o.infutil: h.zutil +o.infutil: h.zlib +o.infutil: h.zconf +o.infutil: h.infblock +o.infutil: h.inftrees +o.infutil: h.infcodes +o.infutil: h.infutil +o.trees: c.trees +o.trees: h.deflate +o.trees: h.zutil +o.trees: h.zlib +o.trees: h.zconf +o.trees: h.trees +o.uncompr: c.uncompr +o.uncompr: h.zlib +o.uncompr: h.zconf +o.zutil: c.zutil +o.zutil: h.zutil +o.zutil: h.zlib +o.zutil: h.zconf diff --git a/zlib/README b/zlib/README new file mode 100644 index 0000000..8ff4587 --- /dev/null +++ b/zlib/README @@ -0,0 +1,148 @@ +zlib 1.1.3 is a general purpose data compression library. All the code +is thread safe. The data format used by the zlib library +is described by RFCs (Request for Comments) 1950 to 1952 in the files +ftp://ds.internic.net/rfc/rfc1950.txt (zlib format), rfc1951.txt (deflate +format) and rfc1952.txt (gzip format). These documents are also available in +other formats from ftp://ftp.uu.net/graphics/png/documents/zlib/zdoc-index.html + +All functions of the compression library are documented in the file zlib.h +(volunteer to write man pages welcome, contact jloup@gzip.org). A usage +example of the library is given in the file example.c which also tests that +the library is working correctly. Another example is given in the file +minigzip.c. The compression library itself is composed of all source files +except example.c and minigzip.c. + +To compile all files and run the test program, follow the instructions +given at the top of Makefile. In short "make test; make install" +should work for most machines. For Unix: "configure; make test; make install" +For MSDOS, use one of the special makefiles such as Makefile.msc. +For VMS, use Make_vms.com or descrip.mms. + +Questions about zlib should be sent to , or to +Gilles Vollant for the Windows DLL version. +The zlib home page is http://www.cdrom.com/pub/infozip/zlib/ +The official zlib ftp site is ftp://ftp.cdrom.com/pub/infozip/zlib/ +Before reporting a problem, please check those sites to verify that +you have the latest version of zlib; otherwise get the latest version and +check whether the problem still exists or not. + +Mark Nelson wrote an article about zlib for the Jan. 1997 +issue of Dr. Dobb's Journal; a copy of the article is available in +http://web2.airmail.net/markn/articles/zlibtool/zlibtool.htm + +The changes made in version 1.1.3 are documented in the file ChangeLog. +The main changes since 1.1.2 are: + +- fix "an inflate input buffer bug that shows up on rare but persistent + occasions" (Mark) +- fix gzread and gztell for concatenated .gz files (Didier Le Botlan) +- fix gzseek(..., SEEK_SET) in write mode +- fix crc check after a gzeek (Frank Faubert) +- fix miniunzip when the last entry in a zip file is itself a zip file + (J Lillge) +- add contrib/asm586 and contrib/asm686 (Brian Raiter) + See http://www.muppetlabs.com/~breadbox/software/assembly.html +- add support for Delphi 3 in contrib/delphi (Bob Dellaca) +- add support for C++Builder 3 and Delphi 3 in contrib/delphi2 (Davide Moretti) +- do not exit prematurely in untgz if 0 at start of block (Magnus Holmgren) +- use macro EXTERN instead of extern to support DLL for BeOS (Sander Stoks) +- added a FAQ file + +plus many changes for portability. + +Unsupported third party contributions are provided in directory "contrib". + +A Java implementation of zlib is available in the Java Development Kit 1.1 +http://www.javasoft.com/products/JDK/1.1/docs/api/Package-java.util.zip.html +See the zlib home page http://www.cdrom.com/pub/infozip/zlib/ for details. + +A Perl interface to zlib written by Paul Marquess +is in the CPAN (Comprehensive Perl Archive Network) sites, such as: +ftp://ftp.cis.ufl.edu/pub/perl/CPAN/modules/by-module/Compress/Compress-Zlib* + +A Python interface to zlib written by A.M. Kuchling +is available in Python 1.5 and later versions, see +http://www.python.org/doc/lib/module-zlib.html + +A zlib binding for TCL written by Andreas Kupries +is availlable at http://www.westend.com/~kupries/doc/trf/man/man.html + +An experimental package to read and write files in .zip format, +written on top of zlib by Gilles Vollant , is +available at http://www.winimage.com/zLibDll/unzip.html +and also in the contrib/minizip directory of zlib. + + +Notes for some targets: + +- To build a Windows DLL version, include in a DLL project zlib.def, zlib.rc + and all .c files except example.c and minigzip.c; compile with -DZLIB_DLL + The zlib DLL support was initially done by Alessandro Iacopetti and is + now maintained by Gilles Vollant . Check the zlib DLL + home page at http://www.winimage.com/zLibDll + + From Visual Basic, you can call the DLL functions which do not take + a structure as argument: compress, uncompress and all gz* functions. + See contrib/visual-basic.txt for more information, or get + http://www.tcfb.com/dowseware/cmp-z-it.zip + +- For 64-bit Irix, deflate.c must be compiled without any optimization. + With -O, one libpng test fails. The test works in 32 bit mode (with + the -n32 compiler flag). The compiler bug has been reported to SGI. + +- zlib doesn't work with gcc 2.6.3 on a DEC 3000/300LX under OSF/1 2.1 + it works when compiled with cc. + +- on Digital Unix 4.0D (formely OSF/1) on AlphaServer, the cc option -std1 + is necessary to get gzprintf working correctly. This is done by configure. + +- zlib doesn't work on HP-UX 9.05 with some versions of /bin/cc. It works + with other compilers. Use "make test" to check your compiler. + +- gzdopen is not supported on RISCOS, BEOS and by some Mac compilers. + +- For Turbo C the small model is supported only with reduced performance to + avoid any far allocation; it was tested with -DMAX_WBITS=11 -DMAX_MEM_LEVEL=3 + +- For PalmOs, see http://www.cs.uit.no/~perm/PASTA/pilot/software.html + Per Harald Myrvang + + +Acknowledgments: + + The deflate format used by zlib was defined by Phil Katz. The deflate + and zlib specifications were written by L. Peter Deutsch. Thanks to all the + people who reported problems and suggested various improvements in zlib; + they are too numerous to cite here. + +Copyright notice: + + (C) 1995-1998 Jean-loup Gailly and Mark Adler + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + Jean-loup Gailly Mark Adler + jloup@gzip.org madler@alumni.caltech.edu + +If you use the zlib library in a product, we would appreciate *not* +receiving lengthy legal documents to sign. The sources are provided +for free but without warranty of any kind. The library has been +entirely written by Jean-loup Gailly and Mark Adler; it does not +include third-party code. + +If you redistribute modified sources, we would appreciate that you include +in the file ChangeLog history information documenting your changes. diff --git a/zlib/adler32.c b/zlib/adler32.c new file mode 100644 index 0000000..16cf9a7 --- /dev/null +++ b/zlib/adler32.c @@ -0,0 +1,48 @@ +/* adler32.c -- compute the Adler-32 checksum of a data stream + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include "zlib.h" + +#define BASE 65521L /* largest prime smaller than 65536 */ +#define NMAX 5552 +/* NMAX is the largest n such that 255n(n+1)/2 + (n+1)(BASE-1) <= 2^32-1 */ + +#define DO1(buf,i) {s1 += buf[i]; s2 += s1;} +#define DO2(buf,i) DO1(buf,i); DO1(buf,i+1); +#define DO4(buf,i) DO2(buf,i); DO2(buf,i+2); +#define DO8(buf,i) DO4(buf,i); DO4(buf,i+4); +#define DO16(buf) DO8(buf,0); DO8(buf,8); + +/* ========================================================================= */ +uLong ZEXPORT adler32(adler, buf, len) + uLong adler; + const Bytef *buf; + uInt len; +{ + unsigned long s1 = adler & 0xffff; + unsigned long s2 = (adler >> 16) & 0xffff; + int k; + + if (buf == Z_NULL) return 1L; + + while (len > 0) { + k = len < NMAX ? len : NMAX; + len -= k; + while (k >= 16) { + DO16(buf); + buf += 16; + k -= 16; + } + if (k != 0) do { + s1 += *buf++; + s2 += s1; + } while (--k); + s1 %= BASE; + s2 %= BASE; + } + return (s2 << 16) | s1; +} diff --git a/zlib/algorithm.txt b/zlib/algorithm.txt new file mode 100644 index 0000000..cdc830b --- /dev/null +++ b/zlib/algorithm.txt @@ -0,0 +1,213 @@ +1. Compression algorithm (deflate) + +The deflation algorithm used by gzip (also zip and zlib) is a variation of +LZ77 (Lempel-Ziv 1977, see reference below). It finds duplicated strings in +the input data. The second occurrence of a string is replaced by a +pointer to the previous string, in the form of a pair (distance, +length). Distances are limited to 32K bytes, and lengths are limited +to 258 bytes. When a string does not occur anywhere in the previous +32K bytes, it is emitted as a sequence of literal bytes. (In this +description, `string' must be taken as an arbitrary sequence of bytes, +and is not restricted to printable characters.) + +Literals or match lengths are compressed with one Huffman tree, and +match distances are compressed with another tree. The trees are stored +in a compact form at the start of each block. The blocks can have any +size (except that the compressed data for one block must fit in +available memory). A block is terminated when deflate() determines that +it would be useful to start another block with fresh trees. (This is +somewhat similar to the behavior of LZW-based _compress_.) + +Duplicated strings are found using a hash table. All input strings of +length 3 are inserted in the hash table. A hash index is computed for +the next 3 bytes. If the hash chain for this index is not empty, all +strings in the chain are compared with the current input string, and +the longest match is selected. + +The hash chains are searched starting with the most recent strings, to +favor small distances and thus take advantage of the Huffman encoding. +The hash chains are singly linked. There are no deletions from the +hash chains, the algorithm simply discards matches that are too old. + +To avoid a worst-case situation, very long hash chains are arbitrarily +truncated at a certain length, determined by a runtime option (level +parameter of deflateInit). So deflate() does not always find the longest +possible match but generally finds a match which is long enough. + +deflate() also defers the selection of matches with a lazy evaluation +mechanism. After a match of length N has been found, deflate() searches for +a longer match at the next input byte. If a longer match is found, the +previous match is truncated to a length of one (thus producing a single +literal byte) and the process of lazy evaluation begins again. Otherwise, +the original match is kept, and the next match search is attempted only N +steps later. + +The lazy match evaluation is also subject to a runtime parameter. If +the current match is long enough, deflate() reduces the search for a longer +match, thus speeding up the whole process. If compression ratio is more +important than speed, deflate() attempts a complete second search even if +the first match is already long enough. + +The lazy match evaluation is not performed for the fastest compression +modes (level parameter 1 to 3). For these fast modes, new strings +are inserted in the hash table only when no match was found, or +when the match is not too long. This degrades the compression ratio +but saves time since there are both fewer insertions and fewer searches. + + +2. Decompression algorithm (inflate) + +2.1 Introduction + +The real question is, given a Huffman tree, how to decode fast. The most +important realization is that shorter codes are much more common than +longer codes, so pay attention to decoding the short codes fast, and let +the long codes take longer to decode. + +inflate() sets up a first level table that covers some number of bits of +input less than the length of longest code. It gets that many bits from the +stream, and looks it up in the table. The table will tell if the next +code is that many bits or less and how many, and if it is, it will tell +the value, else it will point to the next level table for which inflate() +grabs more bits and tries to decode a longer code. + +How many bits to make the first lookup is a tradeoff between the time it +takes to decode and the time it takes to build the table. If building the +table took no time (and if you had infinite memory), then there would only +be a first level table to cover all the way to the longest code. However, +building the table ends up taking a lot longer for more bits since short +codes are replicated many times in such a table. What inflate() does is +simply to make the number of bits in the first table a variable, and set it +for the maximum speed. + +inflate() sends new trees relatively often, so it is possibly set for a +smaller first level table than an application that has only one tree for +all the data. For inflate, which has 286 possible codes for the +literal/length tree, the size of the first table is nine bits. Also the +distance trees have 30 possible values, and the size of the first table is +six bits. Note that for each of those cases, the table ended up one bit +longer than the ``average'' code length, i.e. the code length of an +approximately flat code which would be a little more than eight bits for +286 symbols and a little less than five bits for 30 symbols. It would be +interesting to see if optimizing the first level table for other +applications gave values within a bit or two of the flat code size. + + +2.2 More details on the inflate table lookup + +Ok, you want to know what this cleverly obfuscated inflate tree actually +looks like. You are correct that it's not a Huffman tree. It is simply a +lookup table for the first, let's say, nine bits of a Huffman symbol. The +symbol could be as short as one bit or as long as 15 bits. If a particular +symbol is shorter than nine bits, then that symbol's translation is duplicated +in all those entries that start with that symbol's bits. For example, if the +symbol is four bits, then it's duplicated 32 times in a nine-bit table. If a +symbol is nine bits long, it appears in the table once. + +If the symbol is longer than nine bits, then that entry in the table points +to another similar table for the remaining bits. Again, there are duplicated +entries as needed. The idea is that most of the time the symbol will be short +and there will only be one table look up. (That's whole idea behind data +compression in the first place.) For the less frequent long symbols, there +will be two lookups. If you had a compression method with really long +symbols, you could have as many levels of lookups as is efficient. For +inflate, two is enough. + +So a table entry either points to another table (in which case nine bits in +the above example are gobbled), or it contains the translation for the symbol +and the number of bits to gobble. Then you start again with the next +ungobbled bit. + +You may wonder: why not just have one lookup table for how ever many bits the +longest symbol is? The reason is that if you do that, you end up spending +more time filling in duplicate symbol entries than you do actually decoding. +At least for deflate's output that generates new trees every several 10's of +kbytes. You can imagine that filling in a 2^15 entry table for a 15-bit code +would take too long if you're only decoding several thousand symbols. At the +other extreme, you could make a new table for every bit in the code. In fact, +that's essentially a Huffman tree. But then you spend two much time +traversing the tree while decoding, even for short symbols. + +So the number of bits for the first lookup table is a trade of the time to +fill out the table vs. the time spent looking at the second level and above of +the table. + +Here is an example, scaled down: + +The code being decoded, with 10 symbols, from 1 to 6 bits long: + +A: 0 +B: 10 +C: 1100 +D: 11010 +E: 11011 +F: 11100 +G: 11101 +H: 11110 +I: 111110 +J: 111111 + +Let's make the first table three bits long (eight entries): + +000: A,1 +001: A,1 +010: A,1 +011: A,1 +100: B,2 +101: B,2 +110: -> table X (gobble 3 bits) +111: -> table Y (gobble 3 bits) + +Each entry is what the bits decode to and how many bits that is, i.e. how +many bits to gobble. Or the entry points to another table, with the number of +bits to gobble implicit in the size of the table. + +Table X is two bits long since the longest code starting with 110 is five bits +long: + +00: C,1 +01: C,1 +10: D,2 +11: E,2 + +Table Y is three bits long since the longest code starting with 111 is six +bits long: + +000: F,2 +001: F,2 +010: G,2 +011: G,2 +100: H,2 +101: H,2 +110: I,3 +111: J,3 + +So what we have here are three tables with a total of 20 entries that had to +be constructed. That's compared to 64 entries for a single table. Or +compared to 16 entries for a Huffman tree (six two entry tables and one four +entry table). Assuming that the code ideally represents the probability of +the symbols, it takes on the average 1.25 lookups per symbol. That's compared +to one lookup for the single table, or 1.66 lookups per symbol for the +Huffman tree. + +There, I think that gives you a picture of what's going on. For inflate, the +meaning of a particular symbol is often more than just a letter. It can be a +byte (a "literal"), or it can be either a length or a distance which +indicates a base value and a number of bits to fetch after the code that is +added to the base value. Or it might be the special end-of-block code. The +data structures created in inftrees.c try to encode all that information +compactly in the tables. + + +Jean-loup Gailly Mark Adler +jloup@gzip.org madler@alumni.caltech.edu + + +References: + +[LZ77] Ziv J., Lempel A., ``A Universal Algorithm for Sequential Data +Compression,'' IEEE Transactions on Information Theory, Vol. 23, No. 3, +pp. 337-343. + +``DEFLATE Compressed Data Format Specification'' available in +ftp://ds.internic.net/rfc/rfc1951.txt diff --git a/zlib/amiga/Makefile.pup b/zlib/amiga/Makefile.pup new file mode 100644 index 0000000..6cfad1d --- /dev/null +++ b/zlib/amiga/Makefile.pup @@ -0,0 +1,66 @@ +# Amiga powerUP (TM) Makefile +# makefile for libpng and SAS C V6.58/7.00 PPC compiler +# Copyright (C) 1998 by Andreas R. Kleinert + +CC = scppc +CFLAGS = NOSTKCHK NOSINT OPTIMIZE OPTGO OPTPEEP OPTINLOCAL OPTINL \ + OPTLOOP OPTRDEP=8 OPTDEP=8 OPTCOMP=8 +LIBNAME = libzip.a +AR = ppc-amigaos-ar +AR_FLAGS = cr +RANLIB = ppc-amigaos-ranlib +LDFLAGS = -r -o +LDLIBS = LIB:scppc.a +LN = ppc-amigaos-ld +RM = delete quiet + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: example minigzip + +test: all + example + echo hello world | minigzip | minigzip -d + +$(LIBNAME): $(OBJS) + $(AR) $(AR_FLAGS) $@ $(OBJS) + $(RANLIB) $@ + +example: example.o $(LIBNAME) + $(LN) $(LDFLAGS) example LIB:c_ppc.o example.o $(LIBNAME) $(LDLIBS) LIB:end.o + +minigzip: minigzip.o $(LIBNAME) + $(LN) $(LDFLAGS) minigzip LIB:c_ppc.o minigzip.o $(LIBNAME) $(LDLIBS) LIB:end.o + +clean: + $(RM) *.o example minigzip $(LIBNAME) foo.gz + +zip: + zip -ul9 zlib README ChangeLog Makefile Make????.??? Makefile.?? \ + descrip.mms *.[ch] + +tgz: + cd ..; tar cfz zlib/zlib.tgz zlib/README zlib/ChangeLog zlib/Makefile \ + zlib/Make????.??? zlib/Makefile.?? zlib/descrip.mms zlib/*.[ch] + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +adler32.o: zutil.h zlib.h zconf.h +compress.o: zlib.h zconf.h +crc32.o: zutil.h zlib.h zconf.h +deflate.o: deflate.h zutil.h zlib.h zconf.h +example.o: zlib.h zconf.h +gzio.o: zutil.h zlib.h zconf.h +infblock.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h +infcodes.o: zutil.h zlib.h zconf.h inftrees.h infutil.h infcodes.h inffast.h +inffast.o: zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h +inflate.o: zutil.h zlib.h zconf.h infblock.h +inftrees.o: zutil.h zlib.h zconf.h inftrees.h +infutil.o: zutil.h zlib.h zconf.h inftrees.h infutil.h +minigzip.o: zlib.h zconf.h +trees.o: deflate.h zutil.h zlib.h zconf.h +uncompr.o: zlib.h zconf.h +zutil.o: zutil.h zlib.h zconf.h diff --git a/zlib/amiga/Makefile.sas b/zlib/amiga/Makefile.sas new file mode 100644 index 0000000..5323e82 --- /dev/null +++ b/zlib/amiga/Makefile.sas @@ -0,0 +1,64 @@ +# SMakefile for zlib +# Modified from the standard UNIX Makefile Copyright Jean-loup Gailly +# Osma Ahvenlampi +# Amiga, SAS/C 6.56 & Smake + +CC=sc +CFLAGS=OPT +#CFLAGS=OPT CPU=68030 +#CFLAGS=DEBUG=LINE +LDFLAGS=LIB z.lib + +SCOPTIONS=OPTSCHED OPTINLINE OPTALIAS OPTTIME OPTINLOCAL STRMERGE \ + NOICONS PARMS=BOTH NOSTACKCHECK UTILLIB NOVERSION ERRORREXX + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: SCOPTIONS example minigzip + +test: all + `cd`/example + echo hello world | minigzip | minigzip -d + +install: z.lib + copy zlib.h zconf.h INCLUDE: clone + copy z.lib LIB: clone + +z.lib: $(OBJS) + oml z.lib r $(OBJS) + +example: example.o z.lib + $(CC) $(CFLAGS) LINK TO $@ example.o $(LDFLAGS) + +minigzip: minigzip.o z.lib + $(CC) $(CFLAGS) LINK TO $@ minigzip.o $(LDFLAGS) + +clean: + -delete force quiet *.o example minigzip z.lib foo.gz *.lnk SCOPTIONS + +SCOPTIONS: Smakefile + copy to $@ 64K on 16-bit machine: */ + if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR; +#endif + stream.next_out = dest; + stream.avail_out = (uInt)*destLen; + if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR; + + stream.zalloc = (alloc_func)0; + stream.zfree = (free_func)0; + stream.opaque = (voidpf)0; + + err = deflateInit(&stream, level); + if (err != Z_OK) return err; + + err = deflate(&stream, Z_FINISH); + if (err != Z_STREAM_END) { + deflateEnd(&stream); + return err == Z_OK ? Z_BUF_ERROR : err; + } + *destLen = stream.total_out; + + err = deflateEnd(&stream); + return err; +} + +/* =========================================================================== + */ +int ZEXPORT compress (dest, destLen, source, sourceLen) + Bytef *dest; + uLongf *destLen; + const Bytef *source; + uLong sourceLen; +{ + return compress2(dest, destLen, source, sourceLen, Z_DEFAULT_COMPRESSION); +} diff --git a/zlib/configure b/zlib/configure new file mode 100755 index 0000000..e894235 --- /dev/null +++ b/zlib/configure @@ -0,0 +1,212 @@ +#!/bin/sh +# configure script for zlib. This script is needed only if +# you wish to build a shared library and your system supports them, +# of if you need special compiler, flags or install directory. +# Otherwise, you can just use directly "make test; make install" +# +# To create a shared library, use "configure --shared"; by default a static +# library is created. If the primitive shared library support provided here +# does not work, use ftp://prep.ai.mit.edu/pub/gnu/libtool-*.tar.gz +# +# To impose specific compiler or flags or install directory, use for example: +# prefix=$HOME CC=cc CFLAGS="-O4" ./configure +# or for csh/tcsh users: +# (setenv prefix $HOME; setenv CC cc; setenv CFLAGS "-O4"; ./configure) +# LDSHARED is the command to be used to create a shared library + +# Incorrect settings of CC or CFLAGS may prevent creating a shared library. +# If you have problems, try without defining CC and CFLAGS before reporting +# an error. + +LIBS=libz.a +SHAREDLIB=libz.so +VER=`sed -n -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h` +AR=${AR-"ar rc"} +RANLIB=${RANLIB-"ranlib"} +prefix=${prefix-/usr/local} +exec_prefix=${exec_prefix-'${prefix}'} +libdir=${libdir-'${exec_prefix}/lib'} +includedir=${includedir-'${prefix}/include'} +shared_ext='.so' +shared=0 +gcc=0 +old_cc="$CC" +old_cflags="$CFLAGS" + +while test $# -ge 1 +do +case "$1" in + -h* | --h*) + echo 'usage:' + echo ' configure [--shared] [--prefix=PREFIX] [--exec_prefix=EXPREFIX]' + echo ' [--libdir=LIBDIR] [--includedir=INCLUDEDIR]' + exit 0;; + -p*=* | --p*=*) prefix=`echo $1 | sed 's/[-a-z_]*=//'`; shift;; + -e*=* | --e*=*) exec_prefix=`echo $1 | sed 's/[-a-z_]*=//'`; shift;; + -l*=* | --libdir=*) libdir=`echo $1 | sed 's/[-a-z_]*=//'`; shift;; + -i*=* | --includedir=*) includedir=`echo $1 | sed 's/[-a-z_]*=//'`;shift;; + -p* | --p*) prefix="$2"; shift; shift;; + -e* | --e*) exec_prefix="$2"; shift; shift;; + -l* | --l*) libdir="$2"; shift; shift;; + -i* | --i*) includedir="$2"; shift; shift;; + -s* | --s*) shared=1; shift;; + esac +done + +test=ztest$$ +cat > $test.c </dev/null; then + CC="$cc" + SFLAGS=${CFLAGS-"-fPIC -O3"} + CFLAGS="$cflags" + case `(uname -s || echo unknown) 2>/dev/null` in + Linux | linux) LDSHARED=${LDSHARED-"gcc -shared -Wl,-soname,libz.so.1"};; + *) LDSHARED=${LDSHARED-"gcc -shared"};; + esac +else + # find system name and corresponding cc options + CC=${CC-cc} + case `(uname -sr || echo unknown) 2>/dev/null` in + HP-UX*) SFLAGS=${CFLAGS-"-O +z"} + CFLAGS=${CFLAGS-"-O"} +# LDSHARED=${LDSHARED-"ld -b +vnocompatwarnings"} + LDSHARED=${LDSHARED-"ld -b"} + shared_ext='.sl' + SHAREDLIB='libz.sl';; + IRIX*) SFLAGS=${CFLAGS-"-ansi -O2 -rpath ."} + CFLAGS=${CFLAGS-"-ansi -O2"} + LDSHARED=${LDSHARED-"cc -shared"};; + OSF1\ V4*) SFLAGS=${CFLAGS-"-O -std1"} + CFLAGS=${CFLAGS-"-O -std1"} + LDSHARED=${LDSHARED-"cc -shared -Wl,-soname,$SHAREDLIB -Wl,-msym -Wl,-rpath,$(libdir) -Wl,-set_version,${VER}:1.0"};; + OSF1*) SFLAGS=${CFLAGS-"-O -std1"} + CFLAGS=${CFLAGS-"-O -std1"} + LDSHARED=${LDSHARED-"cc -shared"};; + QNX*) SFLAGS=${CFLAGS-"-4 -O"} + CFLAGS=${CFLAGS-"-4 -O"} + LDSHARED=${LDSHARED-"cc"} + RANLIB=${RANLIB-"true"} + AR="cc -A";; + SCO_SV\ 3.2*) SFLAGS=${CFLAGS-"-O3 -dy -KPIC "} + CFLAGS=${CFLAGS-"-O3"} + LDSHARED=${LDSHARED-"cc -dy -KPIC -G"};; + SunOS\ 5*) SFLAGS=${CFLAGS-"-fast -xcg89 -KPIC -R."} + CFLAGS=${CFLAGS-"-fast -xcg89"} + LDSHARED=${LDSHARED-"cc -G"};; + SunOS\ 4*) SFLAGS=${CFLAGS-"-O2 -PIC"} + CFLAGS=${CFLAGS-"-O2"} + LDSHARED=${LDSHARED-"ld"};; + UNIX_System_V\ 4.2.0) + SFLAGS=${CFLAGS-"-KPIC -O"} + CFLAGS=${CFLAGS-"-O"} + LDSHARED=${LDSHARED-"cc -G"};; + UNIX_SV\ 4.2MP) + SFLAGS=${CFLAGS-"-Kconform_pic -O"} + CFLAGS=${CFLAGS-"-O"} + LDSHARED=${LDSHARED-"cc -G"};; + # send working options for other systems to support@gzip.org + *) SFLAGS=${CFLAGS-"-O"} + CFLAGS=${CFLAGS-"-O"} + LDSHARED=${LDSHARED-"cc -shared"};; + esac +fi + +if test $shared -eq 1; then + echo Checking for shared library support... + # we must test in two steps (cc then ld), required at least on SunOS 4.x + if test "`($CC -c $SFLAGS $test.c) 2>&1`" = "" && + test "`($LDSHARED -o $test$shared_ext $test.o) 2>&1`" = ""; then + CFLAGS="$SFLAGS" + LIBS="$SHAREDLIB.$VER" + echo Building shared library $SHAREDLIB.$VER with $CC. + elif test -z "$old_cc" -a -z "$old_cflags"; then + echo No shared library suppport. + shared=0; + else + echo 'No shared library suppport; try without defining CC and CFLAGS' + shared=0; + fi +fi +if test $shared -eq 0; then + LDSHARED="$CC" + echo Building static library $LIBS version $VER with $CC. +fi + +cat > $test.c < +int main() { return 0; } +EOF +if test "`($CC -c $CFLAGS $test.c) 2>&1`" = ""; then + CFLAGS="$CFLAGS -DHAVE_UNISTD_H" + echo "Checking for unistd.h... Yes." +else + echo "Checking for unistd.h... No." +fi + +cat > $test.c < +int main() { return 0; } +EOF +if test "`($CC -c $CFLAGS $test.c) 2>&1`" = ""; then + echo "Checking for errno.h... Yes." +else + echo "Checking for errno.h... No." + CFLAGS="$CFLAGS -DNO_ERRNO_H" +fi + +cat > $test.c < +#include +#include +caddr_t hello() { + return mmap((caddr_t)0, (off_t)0, PROT_READ, MAP_SHARED, 0, (off_t)0); +} +EOF +if test "`($CC -c $CFLAGS $test.c) 2>&1`" = ""; then + CFLAGS="$CFLAGS -DUSE_MMAP" + echo Checking for mmap support... Yes. +else + echo Checking for mmap support... No. +fi + +CPP=${CPP-"$CC -E"} +case $CFLAGS in + *ASMV*) + if test "`nm $test.o | grep _hello`" = ""; then + CPP="$CPP -DNO_UNDERLINE" + echo Checking for underline in external names... No. + else + echo Checking for underline in external names... Yes. + fi;; +esac + +rm -f $test.[co] $test$shared_ext + +# udpate Makefile +sed < Makefile.in " +/^CC *=/s%=.*%=$CC% +/^CFLAGS *=/s%=.*%=$CFLAGS% +/^CPP *=/s%=.*%=$CPP% +/^LDSHARED *=/s%=.*%=$LDSHARED% +/^LIBS *=/s%=.*%=$LIBS% +/^SHAREDLIB *=/s%=.*%=$SHAREDLIB% +/^AR *=/s%=.*%=$AR% +/^RANLIB *=/s%=.*%=$RANLIB% +/^VER *=/s%=.*%=$VER% +/^prefix *=/s%=.*%=$prefix% +/^exec_prefix *=/s%=.*%=$exec_prefix% +/^libdir *=/s%=.*%=$libdir% +/^includedir *=/s%=.*%=$includedir% +" > Makefile diff --git a/zlib/contrib/README.contrib b/zlib/contrib/README.contrib new file mode 100644 index 0000000..7ad191c --- /dev/null +++ b/zlib/contrib/README.contrib @@ -0,0 +1,34 @@ +All files under this contrib directory are UNSUPPORTED. There were +provided by users of zlib and were not tested by the authors of zlib. +Use at your own risk. Please contact the authors of the contributions +for help about these, not the zlib authors. Thanks. + + +asm386/ by Gilles Vollant + 386 asm code replacing longest_match(), for Visual C++ 4.2 and ML 6.11c + +asm586/ and asm686/ by Brian Raiter + asm code for Pentium and Pentium Pro + See http://www.muppetlabs.com/~breadbox/software/assembly.html + +delphi/ by Bob Dellaca + Support for Delphi + +delphi2/ by Davide Moretti + Another support for C++Builder and Delphi + +minizip/ by Gilles Vollant + Mini zip and unzip based on zlib + See http://www.winimage.com/zLibDll/unzip.html + +iostream/ by Kevin Ruland + A C++ I/O streams interface to the zlib gz* functions + +iostream2/ by Tyge Løvset + Another C++ I/O streams interface + +untgz/ by "Pedro A. Aranda Guti\irrez" + A very simple tar.gz file extractor using zlib + +visual-basic.txt by Carlos Rios + How to use compress(), uncompress() and the gz* functions from VB. diff --git a/zlib/contrib/asm386/gvmat32.asm b/zlib/contrib/asm386/gvmat32.asm new file mode 100644 index 0000000..28d527f --- /dev/null +++ b/zlib/contrib/asm386/gvmat32.asm @@ -0,0 +1,559 @@ +; +; gvmat32.asm -- Asm portion of the optimized longest_match for 32 bits x86 +; Copyright (C) 1995-1996 Jean-loup Gailly and Gilles Vollant. +; File written by Gilles Vollant, by modifiying the longest_match +; from Jean-loup Gailly in deflate.c +; It need wmask == 0x7fff +; (assembly code is faster with a fixed wmask) +; +; For Visual C++ 4.2 and ML 6.11c (version in directory \MASM611C of Win95 DDK) +; I compile with : "ml /coff /Zi /c gvmat32.asm" +; + +;uInt longest_match_7fff(s, cur_match) +; deflate_state *s; +; IPos cur_match; /* current match */ + + NbStack equ 76 + cur_match equ dword ptr[esp+NbStack-0] + str_s equ dword ptr[esp+NbStack-4] +; 5 dword on top (ret,ebp,esi,edi,ebx) + adrret equ dword ptr[esp+NbStack-8] + pushebp equ dword ptr[esp+NbStack-12] + pushedi equ dword ptr[esp+NbStack-16] + pushesi equ dword ptr[esp+NbStack-20] + pushebx equ dword ptr[esp+NbStack-24] + + chain_length equ dword ptr [esp+NbStack-28] + limit equ dword ptr [esp+NbStack-32] + best_len equ dword ptr [esp+NbStack-36] + window equ dword ptr [esp+NbStack-40] + prev equ dword ptr [esp+NbStack-44] + scan_start equ word ptr [esp+NbStack-48] + wmask equ dword ptr [esp+NbStack-52] + match_start_ptr equ dword ptr [esp+NbStack-56] + nice_match equ dword ptr [esp+NbStack-60] + scan equ dword ptr [esp+NbStack-64] + + windowlen equ dword ptr [esp+NbStack-68] + match_start equ dword ptr [esp+NbStack-72] + strend equ dword ptr [esp+NbStack-76] + NbStackAdd equ (NbStack-24) + + .386p + + name gvmatch + .MODEL FLAT + + + +; all the +4 offsets are due to the addition of pending_buf_size (in zlib +; in the deflate_state structure since the asm code was first written +; (if you compile with zlib 1.0.4 or older, remove the +4). +; Note : these value are good with a 8 bytes boundary pack structure + dep_chain_length equ 70h+4 + dep_window equ 2ch+4 + dep_strstart equ 60h+4 + dep_prev_length equ 6ch+4 + dep_nice_match equ 84h+4 + dep_w_size equ 20h+4 + dep_prev equ 34h+4 + dep_w_mask equ 28h+4 + dep_good_match equ 80h+4 + dep_match_start equ 64h+4 + dep_lookahead equ 68h+4 + + +_TEXT segment + +IFDEF NOUNDERLINE + public longest_match_7fff +; public match_init +ELSE + public _longest_match_7fff +; public _match_init +ENDIF + + MAX_MATCH equ 258 + MIN_MATCH equ 3 + MIN_LOOKAHEAD equ (MAX_MATCH+MIN_MATCH+1) + + + +IFDEF NOUNDERLINE +;match_init proc near +; ret +;match_init endp +ELSE +;_match_init proc near +; ret +;_match_init endp +ENDIF + + +IFDEF NOUNDERLINE +longest_match_7fff proc near +ELSE +_longest_match_7fff proc near +ENDIF + + mov edx,[esp+4] + + + + push ebp + push edi + push esi + push ebx + + sub esp,NbStackAdd + +; initialize or check the variables used in match.asm. + mov ebp,edx + +; chain_length = s->max_chain_length +; if (prev_length>=good_match) chain_length >>= 2 + mov edx,[ebp+dep_chain_length] + mov ebx,[ebp+dep_prev_length] + cmp [ebp+dep_good_match],ebx + ja noshr + shr edx,2 +noshr: +; we increment chain_length because in the asm, the --chain_lenght is in the beginning of the loop + inc edx + mov edi,[ebp+dep_nice_match] + mov chain_length,edx + mov eax,[ebp+dep_lookahead] + cmp eax,edi +; if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; + jae nolookaheadnicematch + mov edi,eax +nolookaheadnicematch: +; best_len = s->prev_length + mov best_len,ebx + +; window = s->window + mov esi,[ebp+dep_window] + mov ecx,[ebp+dep_strstart] + mov window,esi + + mov nice_match,edi +; scan = window + strstart + add esi,ecx + mov scan,esi +; dx = *window + mov dx,word ptr [esi] +; bx = *(window+best_len-1) + mov bx,word ptr [esi+ebx-1] + add esi,MAX_MATCH-1 +; scan_start = *scan + mov scan_start,dx +; strend = scan + MAX_MATCH-1 + mov strend,esi +; bx = scan_end = *(window+best_len-1) + +; IPos limit = s->strstart > (IPos)MAX_DIST(s) ? +; s->strstart - (IPos)MAX_DIST(s) : NIL; + + mov esi,[ebp+dep_w_size] + sub esi,MIN_LOOKAHEAD +; here esi = MAX_DIST(s) + sub ecx,esi + ja nodist + xor ecx,ecx +nodist: + mov limit,ecx + +; prev = s->prev + mov edx,[ebp+dep_prev] + mov prev,edx + +; + mov edx,dword ptr [ebp+dep_match_start] + mov bp,scan_start + mov eax,cur_match + mov match_start,edx + + mov edx,window + mov edi,edx + add edi,best_len + mov esi,prev + dec edi +; windowlen = window + best_len -1 + mov windowlen,edi + + jmp beginloop2 + align 4 + +; here, in the loop +; eax = ax = cur_match +; ecx = limit +; bx = scan_end +; bp = scan_start +; edi = windowlen (window + best_len -1) +; esi = prev + + +;// here; chain_length <=16 +normalbeg0add16: + add chain_length,16 + jz exitloop +normalbeg0: + cmp word ptr[edi+eax],bx + je normalbeg2noroll +rcontlabnoroll: +; cur_match = prev[cur_match & wmask] + and eax,7fffh + mov ax,word ptr[esi+eax*2] +; if cur_match > limit, go to exitloop + cmp ecx,eax + jnb exitloop +; if --chain_length != 0, go to exitloop + dec chain_length + jnz normalbeg0 + jmp exitloop + +normalbeg2noroll: +; if (scan_start==*(cur_match+window)) goto normalbeg2 + cmp bp,word ptr[edx+eax] + jne rcontlabnoroll + jmp normalbeg2 + +contloop3: + mov edi,windowlen + +; cur_match = prev[cur_match & wmask] + and eax,7fffh + mov ax,word ptr[esi+eax*2] +; if cur_match > limit, go to exitloop + cmp ecx,eax +jnbexitloopshort1: + jnb exitloop +; if --chain_length != 0, go to exitloop + + +; begin the main loop +beginloop2: + sub chain_length,16+1 +; if chain_length <=16, don't use the unrolled loop + jna normalbeg0add16 + +do16: + cmp word ptr[edi+eax],bx + je normalbeg2dc0 + +maccn MACRO lab + and eax,7fffh + mov ax,word ptr[esi+eax*2] + cmp ecx,eax + jnb exitloop + cmp word ptr[edi+eax],bx + je lab + ENDM + +rcontloop0: + maccn normalbeg2dc1 + +rcontloop1: + maccn normalbeg2dc2 + +rcontloop2: + maccn normalbeg2dc3 + +rcontloop3: + maccn normalbeg2dc4 + +rcontloop4: + maccn normalbeg2dc5 + +rcontloop5: + maccn normalbeg2dc6 + +rcontloop6: + maccn normalbeg2dc7 + +rcontloop7: + maccn normalbeg2dc8 + +rcontloop8: + maccn normalbeg2dc9 + +rcontloop9: + maccn normalbeg2dc10 + +rcontloop10: + maccn short normalbeg2dc11 + +rcontloop11: + maccn short normalbeg2dc12 + +rcontloop12: + maccn short normalbeg2dc13 + +rcontloop13: + maccn short normalbeg2dc14 + +rcontloop14: + maccn short normalbeg2dc15 + +rcontloop15: + and eax,7fffh + mov ax,word ptr[esi+eax*2] + cmp ecx,eax + jnb exitloop + + sub chain_length,16 + ja do16 + jmp normalbeg0add16 + +;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;; + +normbeg MACRO rcontlab,valsub +; if we are here, we know that *(match+best_len-1) == scan_end + cmp bp,word ptr[edx+eax] +; if (match != scan_start) goto rcontlab + jne rcontlab +; calculate the good chain_length, and we'll compare scan and match string + add chain_length,16-valsub + jmp iseq + ENDM + + +normalbeg2dc11: + normbeg rcontloop11,11 + +normalbeg2dc12: + normbeg short rcontloop12,12 + +normalbeg2dc13: + normbeg short rcontloop13,13 + +normalbeg2dc14: + normbeg short rcontloop14,14 + +normalbeg2dc15: + normbeg short rcontloop15,15 + +normalbeg2dc10: + normbeg rcontloop10,10 + +normalbeg2dc9: + normbeg rcontloop9,9 + +normalbeg2dc8: + normbeg rcontloop8,8 + +normalbeg2dc7: + normbeg rcontloop7,7 + +normalbeg2dc6: + normbeg rcontloop6,6 + +normalbeg2dc5: + normbeg rcontloop5,5 + +normalbeg2dc4: + normbeg rcontloop4,4 + +normalbeg2dc3: + normbeg rcontloop3,3 + +normalbeg2dc2: + normbeg rcontloop2,2 + +normalbeg2dc1: + normbeg rcontloop1,1 + +normalbeg2dc0: + normbeg rcontloop0,0 + + +; we go in normalbeg2 because *(ushf*)(match+best_len-1) == scan_end + +normalbeg2: + mov edi,window + + cmp bp,word ptr[edi+eax] + jne contloop3 ; if *(ushf*)match != scan_start, continue + +iseq: +; if we are here, we know that *(match+best_len-1) == scan_end +; and (match == scan_start) + + mov edi,edx + mov esi,scan ; esi = scan + add edi,eax ; edi = window + cur_match = match + + mov edx,[esi+3] ; compare manually dword at match+3 + xor edx,[edi+3] ; and scan +3 + + jz begincompare ; if equal, go to long compare + +; we will determine the unmatch byte and calculate len (in esi) + or dl,dl + je eq1rr + mov esi,3 + jmp trfinval +eq1rr: + or dx,dx + je eq1 + + mov esi,4 + jmp trfinval +eq1: + and edx,0ffffffh + jz eq11 + mov esi,5 + jmp trfinval +eq11: + mov esi,6 + jmp trfinval + +begincompare: + ; here we now scan and match begin same + add edi,6 + add esi,6 + mov ecx,(MAX_MATCH-(2+4))/4 ; scan for at most MAX_MATCH bytes + repe cmpsd ; loop until mismatch + + je trfin ; go to trfin if not unmatch +; we determine the unmatch byte + sub esi,4 + mov edx,[edi-4] + xor edx,[esi] + + or dl,dl + jnz trfin + inc esi + + or dx,dx + jnz trfin + inc esi + + and edx,0ffffffh + jnz trfin + inc esi + +trfin: + sub esi,scan ; esi = len +trfinval: +; here we have finised compare, and esi contain len of equal string + cmp esi,best_len ; if len > best_len, go newbestlen + ja short newbestlen +; now we restore edx, ecx and esi, for the big loop + mov esi,prev + mov ecx,limit + mov edx,window + jmp contloop3 + +newbestlen: + mov best_len,esi ; len become best_len + + mov match_start,eax ; save new position as match_start + cmp esi,nice_match ; if best_len >= nice_match, exit + jae exitloop + mov ecx,scan + mov edx,window ; restore edx=window + add ecx,esi + add esi,edx + + dec esi + mov windowlen,esi ; windowlen = window + best_len-1 + mov bx,[ecx-1] ; bx = *(scan+best_len-1) = scan_end + +; now we restore ecx and esi, for the big loop : + mov esi,prev + mov ecx,limit + jmp contloop3 + +exitloop: +; exit : s->match_start=match_start + mov ebx,match_start + mov ebp,str_s + mov ecx,best_len + mov dword ptr [ebp+dep_match_start],ebx + mov eax,dword ptr [ebp+dep_lookahead] + cmp ecx,eax + ja minexlo + mov eax,ecx +minexlo: +; return min(best_len,s->lookahead) + +; restore stack and register ebx,esi,edi,ebp + add esp,NbStackAdd + + pop ebx + pop esi + pop edi + pop ebp + ret +InfoAuthor: +; please don't remove this string ! +; Your are free use gvmat32 in any fre or commercial apps if you don't remove the string in the binary! + db 0dh,0ah,"GVMat32 optimised assembly code written 1996-98 by Gilles Vollant",0dh,0ah + + + +IFDEF NOUNDERLINE +longest_match_7fff endp +ELSE +_longest_match_7fff endp +ENDIF + + +IFDEF NOUNDERLINE +cpudetect32 proc near +ELSE +_cpudetect32 proc near +ENDIF + + + pushfd ; push original EFLAGS + pop eax ; get original EFLAGS + mov ecx, eax ; save original EFLAGS + xor eax, 40000h ; flip AC bit in EFLAGS + push eax ; save new EFLAGS value on stack + popfd ; replace current EFLAGS value + pushfd ; get new EFLAGS + pop eax ; store new EFLAGS in EAX + xor eax, ecx ; can’t toggle AC bit, processor=80386 + jz end_cpu_is_386 ; jump if 80386 processor + push ecx + popfd ; restore AC bit in EFLAGS first + + pushfd + pushfd + pop ecx + + mov eax, ecx ; get original EFLAGS + xor eax, 200000h ; flip ID bit in EFLAGS + push eax ; save new EFLAGS value on stack + popfd ; replace current EFLAGS value + pushfd ; get new EFLAGS + pop eax ; store new EFLAGS in EAX + popfd ; restore original EFLAGS + xor eax, ecx ; can’t toggle ID bit, + je is_old_486 ; processor=old + + mov eax,1 + db 0fh,0a2h ;CPUID + +exitcpudetect: + ret + +end_cpu_is_386: + mov eax,0300h + jmp exitcpudetect + +is_old_486: + mov eax,0400h + jmp exitcpudetect + +IFDEF NOUNDERLINE +cpudetect32 endp +ELSE +_cpudetect32 endp +ENDIF + +_TEXT ends +end diff --git a/zlib/contrib/asm386/gvmat32c.c b/zlib/contrib/asm386/gvmat32c.c new file mode 100644 index 0000000..d853bb7 --- /dev/null +++ b/zlib/contrib/asm386/gvmat32c.c @@ -0,0 +1,200 @@ +/* gvmat32.c -- C portion of the optimized longest_match for 32 bits x86 + * Copyright (C) 1995-1996 Jean-loup Gailly and Gilles Vollant. + * File written by Gilles Vollant, by modifiying the longest_match + * from Jean-loup Gailly in deflate.c + * it prepare all parameters and call the assembly longest_match_gvasm + * longest_match execute standard C code is wmask != 0x7fff + * (assembly code is faster with a fixed wmask) + * + */ + +#include "deflate.h" + +#undef FAR +#include + +#ifdef ASMV +#define NIL 0 + +#define UNALIGNED_OK + + +/* if your C compiler don't add underline before function name, + define ADD_UNDERLINE_ASMFUNC */ +#ifdef ADD_UNDERLINE_ASMFUNC +#define longest_match_7fff _longest_match_7fff +#endif + + + +void match_init() +{ +} + +unsigned long cpudetect32(); + +uInt longest_match_c( + deflate_state *s, + IPos cur_match); /* current match */ + + +uInt longest_match_7fff( + deflate_state *s, + IPos cur_match); /* current match */ + +uInt longest_match( + deflate_state *s, + IPos cur_match) /* current match */ +{ + static uInt iIsPPro=2; + + if ((s->w_mask == 0x7fff) && (iIsPPro==0)) + return longest_match_7fff(s,cur_match); + + if (iIsPPro==2) + iIsPPro = (((cpudetect32()/0x100)&0xf)>=6) ? 1 : 0; + + return longest_match_c(s,cur_match); +} + + + +uInt longest_match_c(s, cur_match) + deflate_state *s; + IPos cur_match; /* current match */ +{ + unsigned chain_length = s->max_chain_length;/* max hash chain length */ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + int best_len = s->prev_length; /* best match length so far */ + int nice_match = s->nice_match; /* stop if match long enough */ + IPos limit = s->strstart > (IPos)MAX_DIST(s) ? + s->strstart - (IPos)MAX_DIST(s) : NIL; + /* Stop when cur_match becomes <= limit. To simplify the code, + * we prevent matches with the string of window index 0. + */ + Posf *prev = s->prev; + uInt wmask = s->w_mask; + +#ifdef UNALIGNED_OK + /* Compare two bytes at a time. Note: this is not always beneficial. + * Try with and without -DUNALIGNED_OK to check. + */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1; + register ush scan_start = *(ushf*)scan; + register ush scan_end = *(ushf*)(scan+best_len-1); +#else + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + register Byte scan_end1 = scan[best_len-1]; + register Byte scan_end = scan[best_len]; +#endif + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + /* Do not waste too much time if we already have a good match: */ + if (s->prev_length >= s->good_match) { + chain_length >>= 2; + } + /* Do not look for matches beyond the end of the input. This is necessary + * to make deflate deterministic. + */ + if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + do { + Assert(cur_match < s->strstart, "no future"); + match = s->window + cur_match; + + /* Skip to next match if the match length cannot increase + * or if the match length is less than 2: + */ +#if (defined(UNALIGNED_OK) && MAX_MATCH == 258) + /* This code assumes sizeof(unsigned short) == 2. Do not use + * UNALIGNED_OK if your compiler uses a different size. + */ + if (*(ushf*)(match+best_len-1) != scan_end || + *(ushf*)match != scan_start) continue; + + /* It is not necessary to compare scan[2] and match[2] since they are + * always equal when the other bytes match, given that the hash keys + * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at + * strstart+3, +5, ... up to strstart+257. We check for insufficient + * lookahead only every 4th comparison; the 128th check will be made + * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is + * necessary to put more guard bytes at the end of the window, or + * to check more often for insufficient lookahead. + */ + Assert(scan[2] == match[2], "scan[2]?"); + scan++, match++; + do { + } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + scan < strend); + /* The funny "do {}" generates better code on most compilers */ + + /* Here, scan <= window+strstart+257 */ + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + if (*scan == *match) scan++; + + len = (MAX_MATCH - 1) - (int)(strend-scan); + scan = strend - (MAX_MATCH-1); + +#else /* UNALIGNED_OK */ + + if (match[best_len] != scan_end || + match[best_len-1] != scan_end1 || + *match != *scan || + *++match != scan[1]) continue; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match++; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + scan = strend - MAX_MATCH; + +#endif /* UNALIGNED_OK */ + + if (len > best_len) { + s->match_start = cur_match; + best_len = len; + if (len >= nice_match) break; +#ifdef UNALIGNED_OK + scan_end = *(ushf*)(scan+best_len-1); +#else + scan_end1 = scan[best_len-1]; + scan_end = scan[best_len]; +#endif + } + } while ((cur_match = prev[cur_match & wmask]) > limit + && --chain_length != 0); + + if ((uInt)best_len <= s->lookahead) return (uInt)best_len; + return s->lookahead; +} + +#endif /* ASMV */ diff --git a/zlib/contrib/asm386/mkgvmt32.bat b/zlib/contrib/asm386/mkgvmt32.bat new file mode 100644 index 0000000..6c5ffd7 --- /dev/null +++ b/zlib/contrib/asm386/mkgvmt32.bat @@ -0,0 +1 @@ +c:\masm611\bin\ml /coff /Zi /c /Flgvmat32.lst gvmat32.asm diff --git a/zlib/contrib/asm386/zlibvc.def b/zlib/contrib/asm386/zlibvc.def new file mode 100644 index 0000000..7e9d60d --- /dev/null +++ b/zlib/contrib/asm386/zlibvc.def @@ -0,0 +1,74 @@ +LIBRARY "zlib" + +DESCRIPTION '"""zlib data compression library"""' + + +VERSION 1.11 + + +HEAPSIZE 1048576,8192 + +EXPORTS + adler32 @1 + compress @2 + crc32 @3 + deflate @4 + deflateCopy @5 + deflateEnd @6 + deflateInit2_ @7 + deflateInit_ @8 + deflateParams @9 + deflateReset @10 + deflateSetDictionary @11 + gzclose @12 + gzdopen @13 + gzerror @14 + gzflush @15 + gzopen @16 + gzread @17 + gzwrite @18 + inflate @19 + inflateEnd @20 + inflateInit2_ @21 + inflateInit_ @22 + inflateReset @23 + inflateSetDictionary @24 + inflateSync @25 + uncompress @26 + zlibVersion @27 + gzprintf @28 + gzputc @29 + gzgetc @30 + gzseek @31 + gzrewind @32 + gztell @33 + gzeof @34 + gzsetparams @35 + zError @36 + inflateSyncPoint @37 + get_crc_table @38 + compress2 @39 + gzputs @40 + gzgets @41 + + unzOpen @61 + unzClose @62 + unzGetGlobalInfo @63 + unzGetCurrentFileInfo @64 + unzGoToFirstFile @65 + unzGoToNextFile @66 + unzOpenCurrentFile @67 + unzReadCurrentFile @68 + unztell @70 + unzeof @71 + unzCloseCurrentFile @72 + unzGetGlobalComment @73 + unzStringFileNameCompare @74 + unzLocateFile @75 + unzGetLocalExtrafield @76 + + zipOpen @80 + zipOpenNewFileInZip @81 + zipWriteInFileInZip @82 + zipCloseFileInZip @83 + zipClose @84 diff --git a/zlib/contrib/asm386/zlibvc.dsp b/zlib/contrib/asm386/zlibvc.dsp new file mode 100644 index 0000000..a70d4d4 --- /dev/null +++ b/zlib/contrib/asm386/zlibvc.dsp @@ -0,0 +1,651 @@ +# Microsoft Developer Studio Project File - Name="zlibvc" - Package Owner=<4> +# Microsoft Developer Studio Generated Build File, Format Version 5.00 +# ** DO NOT EDIT ** + +# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102 +# TARGTYPE "Win32 (ALPHA) Dynamic-Link Library" 0x0602 + +CFG=zlibvc - Win32 Release +!MESSAGE This is not a valid makefile. To build this project using NMAKE, +!MESSAGE use the Export Makefile command and run +!MESSAGE +!MESSAGE NMAKE /f "zlibvc.mak". +!MESSAGE +!MESSAGE You can specify a configuration when running NMAKE +!MESSAGE by defining the macro CFG on the command line. For example: +!MESSAGE +!MESSAGE NMAKE /f "zlibvc.mak" CFG="zlibvc - Win32 Release" +!MESSAGE +!MESSAGE Possible choices for configuration are: +!MESSAGE +!MESSAGE "zlibvc - Win32 Release" (based on "Win32 (x86) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 Debug" (based on "Win32 (x86) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 ReleaseAxp" (based on\ + "Win32 (ALPHA) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 ReleaseWithoutAsm" (based on\ + "Win32 (x86) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 ReleaseWithoutCrtdll" (based on\ + "Win32 (x86) Dynamic-Link Library") +!MESSAGE + +# Begin Project +# PROP Scc_ProjName "" +# PROP Scc_LocalPath "" + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir ".\Release" +# PROP BASE Intermediate_Dir ".\Release" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir ".\Release" +# PROP Intermediate_Dir ".\Release" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 +# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 1 +# PROP BASE Output_Dir ".\Debug" +# PROP BASE Intermediate_Dir ".\Debug" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 1 +# PROP Output_Dir ".\Debug" +# PROP Intermediate_Dir ".\Debug" +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /c +# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "_DEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "_DEBUG" /win32 +# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "_DEBUG" +# ADD RSC /l 0x40c /d "_DEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:".\Debug\zlib.dll" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "zlibvc__" +# PROP BASE Intermediate_Dir "zlibvc__" +# PROP BASE Ignore_Export_Lib 0 +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "zlibvc__" +# PROP Intermediate_Dir "zlibvc__" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +CPP=cl.exe +# ADD BASE CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c +# ADD CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT BASE LINK32 /pdb:none +# ADD LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:"zlibvc__\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "zlibvc_0" +# PROP BASE Intermediate_Dir "zlibvc_0" +# PROP BASE Ignore_Export_Lib 0 +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "zlibvc_0" +# PROP Intermediate_Dir "zlibvc_0" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT BASE LINK32 /pdb:none +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_0\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "zlibvc_1" +# PROP BASE Intermediate_Dir "zlibvc_1" +# PROP BASE Ignore_Export_Lib 0 +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "zlibvc_1" +# PROP Intermediate_Dir "zlibvc_1" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /YX /FD /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT BASE LINK32 /pdb:none +# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_1\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ENDIF + +# Begin Target + +# Name "zlibvc - Win32 Release" +# Name "zlibvc - Win32 Debug" +# Name "zlibvc - Win32 ReleaseAxp" +# Name "zlibvc - Win32 ReleaseWithoutAsm" +# Name "zlibvc - Win32 ReleaseWithoutCrtdll" +# Begin Group "Source Files" + +# PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;hpj;bat;for;f90" +# Begin Source File + +SOURCE=.\adler32.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_ADLER=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\compress.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_COMPR=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\crc32.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_CRC32=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\deflate.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_DEFLA=\ + ".\deflate.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\gvmat32c.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\gzio.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_GZIO_=\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\infblock.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFBL=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\infcodes.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFCO=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inffast.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\inffast.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFFA=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inffast.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\inflate.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFLA=\ + ".\infblock.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\inftrees.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFTR=\ + ".\inftrees.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\infutil.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFUT=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\trees.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_TREES=\ + ".\deflate.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\uncompr.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_UNCOM=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\unzip.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\zip.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\zlib.rc +# End Source File +# Begin Source File + +SOURCE=.\zlibvc.def +# End Source File +# Begin Source File + +SOURCE=.\zutil.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_ZUTIL=\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# End Group +# Begin Group "Header Files" + +# PROP Default_Filter "h;hpp;hxx;hm;inl;fi;fd" +# Begin Source File + +SOURCE=.\deflate.h +# End Source File +# Begin Source File + +SOURCE=.\infblock.h +# End Source File +# Begin Source File + +SOURCE=.\infcodes.h +# End Source File +# Begin Source File + +SOURCE=.\inffast.h +# End Source File +# Begin Source File + +SOURCE=.\inftrees.h +# End Source File +# Begin Source File + +SOURCE=.\infutil.h +# End Source File +# Begin Source File + +SOURCE=.\zconf.h +# End Source File +# Begin Source File + +SOURCE=.\zlib.h +# End Source File +# Begin Source File + +SOURCE=.\zutil.h +# End Source File +# End Group +# Begin Group "Resource Files" + +# PROP Default_Filter "ico;cur;bmp;dlg;rc2;rct;bin;cnt;rtf;gif;jpg;jpeg;jpe" +# End Group +# End Target +# End Project diff --git a/zlib/contrib/asm386/zlibvc.dsw b/zlib/contrib/asm386/zlibvc.dsw new file mode 100644 index 0000000..493cd87 --- /dev/null +++ b/zlib/contrib/asm386/zlibvc.dsw @@ -0,0 +1,41 @@ +Microsoft Developer Studio Workspace File, Format Version 5.00 +# WARNING: DO NOT EDIT OR DELETE THIS WORKSPACE FILE! + +############################################################################### + +Project: "zlibstat"=.\zlibstat.dsp - Package Owner=<4> + +Package=<5> +{{{ +}}} + +Package=<4> +{{{ +}}} + +############################################################################### + +Project: "zlibvc"=.\zlibvc.dsp - Package Owner=<4> + +Package=<5> +{{{ +}}} + +Package=<4> +{{{ +}}} + +############################################################################### + +Global: + +Package=<5> +{{{ +}}} + +Package=<3> +{{{ +}}} + +############################################################################### + diff --git a/zlib/contrib/asm586/README.586 b/zlib/contrib/asm586/README.586 new file mode 100644 index 0000000..6bb78f3 --- /dev/null +++ b/zlib/contrib/asm586/README.586 @@ -0,0 +1,43 @@ +This is a patched version of zlib modified to use +Pentium-optimized assembly code in the deflation algorithm. The files +changed/added by this patch are: + +README.586 +match.S + +The effectiveness of these modifications is a bit marginal, as the the +program's bottleneck seems to be mostly L1-cache contention, for which +there is no real way to work around without rewriting the basic +algorithm. The speedup on average is around 5-10% (which is generally +less than the amount of variance between subsequent executions). +However, when used at level 9 compression, the cache contention can +drop enough for the assembly version to achieve 10-20% speedup (and +sometimes more, depending on the amount of overall redundancy in the +files). Even here, though, cache contention can still be the limiting +factor, depending on the nature of the program using the zlib library. +This may also mean that better improvements will be seen on a Pentium +with MMX, which suffers much less from L1-cache contention, but I have +not yet verified this. + +Note that this code has been tailored for the Pentium in particular, +and will not perform well on the Pentium Pro (due to the use of a +partial register in the inner loop). + +If you are using an assembler other than GNU as, you will have to +translate match.S to use your assembler's syntax. (Have fun.) + +Brian Raiter +breadbox@muppetlabs.com +April, 1998 + + +Added for zlib 1.1.3: + +The patches come from +http://www.muppetlabs.com/~breadbox/software/assembly.html + +To compile zlib with this asm file, copy match.S to the zlib directory +then do: + +CFLAGS="-O3 -DASMV" ./configure +make OBJA=match.o diff --git a/zlib/contrib/asm586/match.S b/zlib/contrib/asm586/match.S new file mode 100644 index 0000000..8f16140 --- /dev/null +++ b/zlib/contrib/asm586/match.S @@ -0,0 +1,354 @@ +/* match.s -- Pentium-optimized version of longest_match() + * Written for zlib 1.1.2 + * Copyright (C) 1998 Brian Raiter + * + * This is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License. + */ + +#ifndef NO_UNDERLINE +#define match_init _match_init +#define longest_match _longest_match +#endif + +#define MAX_MATCH (258) +#define MIN_MATCH (3) +#define MIN_LOOKAHEAD (MAX_MATCH + MIN_MATCH + 1) +#define MAX_MATCH_8 ((MAX_MATCH + 7) & ~7) + +/* stack frame offsets */ + +#define wmask 0 /* local copy of s->wmask */ +#define window 4 /* local copy of s->window */ +#define windowbestlen 8 /* s->window + bestlen */ +#define chainlenscanend 12 /* high word: current chain len */ + /* low word: last bytes sought */ +#define scanstart 16 /* first two bytes of string */ +#define scanalign 20 /* dword-misalignment of string */ +#define nicematch 24 /* a good enough match size */ +#define bestlen 28 /* size of best match so far */ +#define scan 32 /* ptr to string wanting match */ + +#define LocalVarsSize (36) +/* saved ebx 36 */ +/* saved edi 40 */ +/* saved esi 44 */ +/* saved ebp 48 */ +/* return address 52 */ +#define deflatestate 56 /* the function arguments */ +#define curmatch 60 + +/* Offsets for fields in the deflate_state structure. These numbers + * are calculated from the definition of deflate_state, with the + * assumption that the compiler will dword-align the fields. (Thus, + * changing the definition of deflate_state could easily cause this + * program to crash horribly, without so much as a warning at + * compile time. Sigh.) + */ +#define dsWSize 36 +#define dsWMask 44 +#define dsWindow 48 +#define dsPrev 56 +#define dsMatchLen 88 +#define dsPrevMatch 92 +#define dsStrStart 100 +#define dsMatchStart 104 +#define dsLookahead 108 +#define dsPrevLen 112 +#define dsMaxChainLen 116 +#define dsGoodMatch 132 +#define dsNiceMatch 136 + + +.file "match.S" + +.globl match_init, longest_match + +.text + +/* uInt longest_match(deflate_state *deflatestate, IPos curmatch) */ + +longest_match: + +/* Save registers that the compiler may be using, and adjust %esp to */ +/* make room for our stack frame. */ + + pushl %ebp + pushl %edi + pushl %esi + pushl %ebx + subl $LocalVarsSize, %esp + +/* Retrieve the function arguments. %ecx will hold cur_match */ +/* throughout the entire function. %edx will hold the pointer to the */ +/* deflate_state structure during the function's setup (before */ +/* entering the main loop). */ + + movl deflatestate(%esp), %edx + movl curmatch(%esp), %ecx + +/* if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; */ + + movl dsNiceMatch(%edx), %eax + movl dsLookahead(%edx), %ebx + cmpl %eax, %ebx + jl LookaheadLess + movl %eax, %ebx +LookaheadLess: movl %ebx, nicematch(%esp) + +/* register Bytef *scan = s->window + s->strstart; */ + + movl dsWindow(%edx), %esi + movl %esi, window(%esp) + movl dsStrStart(%edx), %ebp + lea (%esi,%ebp), %edi + movl %edi, scan(%esp) + +/* Determine how many bytes the scan ptr is off from being */ +/* dword-aligned. */ + + movl %edi, %eax + negl %eax + andl $3, %eax + movl %eax, scanalign(%esp) + +/* IPos limit = s->strstart > (IPos)MAX_DIST(s) ? */ +/* s->strstart - (IPos)MAX_DIST(s) : NIL; */ + + movl dsWSize(%edx), %eax + subl $MIN_LOOKAHEAD, %eax + subl %eax, %ebp + jg LimitPositive + xorl %ebp, %ebp +LimitPositive: + +/* unsigned chain_length = s->max_chain_length; */ +/* if (s->prev_length >= s->good_match) { */ +/* chain_length >>= 2; */ +/* } */ + + movl dsPrevLen(%edx), %eax + movl dsGoodMatch(%edx), %ebx + cmpl %ebx, %eax + movl dsMaxChainLen(%edx), %ebx + jl LastMatchGood + shrl $2, %ebx +LastMatchGood: + +/* chainlen is decremented once beforehand so that the function can */ +/* use the sign flag instead of the zero flag for the exit test. */ +/* It is then shifted into the high word, to make room for the scanend */ +/* scanend value, which it will always accompany. */ + + decl %ebx + shll $16, %ebx + +/* int best_len = s->prev_length; */ + + movl dsPrevLen(%edx), %eax + movl %eax, bestlen(%esp) + +/* Store the sum of s->window + best_len in %esi locally, and in %esi. */ + + addl %eax, %esi + movl %esi, windowbestlen(%esp) + +/* register ush scan_start = *(ushf*)scan; */ +/* register ush scan_end = *(ushf*)(scan+best_len-1); */ + + movw (%edi), %bx + movw %bx, scanstart(%esp) + movw -1(%edi,%eax), %bx + movl %ebx, chainlenscanend(%esp) + +/* Posf *prev = s->prev; */ +/* uInt wmask = s->w_mask; */ + + movl dsPrev(%edx), %edi + movl dsWMask(%edx), %edx + mov %edx, wmask(%esp) + +/* Jump into the main loop. */ + + jmp LoopEntry + +.balign 16 + +/* do { + * match = s->window + cur_match; + * if (*(ushf*)(match+best_len-1) != scan_end || + * *(ushf*)match != scan_start) continue; + * [...] + * } while ((cur_match = prev[cur_match & wmask]) > limit + * && --chain_length != 0); + * + * Here is the inner loop of the function. The function will spend the + * majority of its time in this loop, and majority of that time will + * be spent in the first ten instructions. + * + * Within this loop: + * %ebx = chainlenscanend - i.e., ((chainlen << 16) | scanend) + * %ecx = curmatch + * %edx = curmatch & wmask + * %esi = windowbestlen - i.e., (window + bestlen) + * %edi = prev + * %ebp = limit + * + * Two optimization notes on the choice of instructions: + * + * The first instruction uses a 16-bit address, which costs an extra, + * unpairable cycle. This is cheaper than doing a 32-bit access and + * zeroing the high word, due to the 3-cycle misalignment penalty which + * would occur half the time. This also turns out to be cheaper than + * doing two separate 8-bit accesses, as the memory is so rarely in the + * L1 cache. + * + * The window buffer, however, apparently spends a lot of time in the + * cache, and so it is faster to retrieve the word at the end of the + * match string with two 8-bit loads. The instructions that test the + * word at the beginning of the match string, however, are executed + * much less frequently, and there it was cheaper to use 16-bit + * instructions, which avoided the necessity of saving off and + * subsequently reloading one of the other registers. + */ +LookupLoop: + /* 1 U & V */ + movw (%edi,%edx,2), %cx /* 2 U pipe */ + movl wmask(%esp), %edx /* 2 V pipe */ + cmpl %ebp, %ecx /* 3 U pipe */ + jbe LeaveNow /* 3 V pipe */ + subl $0x00010000, %ebx /* 4 U pipe */ + js LeaveNow /* 4 V pipe */ +LoopEntry: movb -1(%esi,%ecx), %al /* 5 U pipe */ + andl %ecx, %edx /* 5 V pipe */ + cmpb %bl, %al /* 6 U pipe */ + jnz LookupLoop /* 6 V pipe */ + movb (%esi,%ecx), %ah + cmpb %bh, %ah + jnz LookupLoop + movl window(%esp), %eax + movw (%eax,%ecx), %ax + cmpw scanstart(%esp), %ax + jnz LookupLoop + +/* Store the current value of chainlen. */ + + movl %ebx, chainlenscanend(%esp) + +/* Point %edi to the string under scrutiny, and %esi to the string we */ +/* are hoping to match it up with. In actuality, %esi and %edi are */ +/* both pointed (MAX_MATCH_8 - scanalign) bytes ahead, and %edx is */ +/* initialized to -(MAX_MATCH_8 - scanalign). */ + + movl window(%esp), %esi + movl scan(%esp), %edi + addl %ecx, %esi + movl scanalign(%esp), %eax + movl $(-MAX_MATCH_8), %edx + lea MAX_MATCH_8(%edi,%eax), %edi + lea MAX_MATCH_8(%esi,%eax), %esi + +/* Test the strings for equality, 8 bytes at a time. At the end, + * adjust %edx so that it is offset to the exact byte that mismatched. + * + * We already know at this point that the first three bytes of the + * strings match each other, and they can be safely passed over before + * starting the compare loop. So what this code does is skip over 0-3 + * bytes, as much as necessary in order to dword-align the %edi + * pointer. (%esi will still be misaligned three times out of four.) + * + * It should be confessed that this loop usually does not represent + * much of the total running time. Replacing it with a more + * straightforward "rep cmpsb" would not drastically degrade + * performance. + */ +LoopCmps: + movl (%esi,%edx), %eax + movl (%edi,%edx), %ebx + xorl %ebx, %eax + jnz LeaveLoopCmps + movl 4(%esi,%edx), %eax + movl 4(%edi,%edx), %ebx + xorl %ebx, %eax + jnz LeaveLoopCmps4 + addl $8, %edx + jnz LoopCmps + jmp LenMaximum +LeaveLoopCmps4: addl $4, %edx +LeaveLoopCmps: testl $0x0000FFFF, %eax + jnz LenLower + addl $2, %edx + shrl $16, %eax +LenLower: subb $1, %al + adcl $0, %edx + +/* Calculate the length of the match. If it is longer than MAX_MATCH, */ +/* then automatically accept it as the best possible match and leave. */ + + lea (%edi,%edx), %eax + movl scan(%esp), %edi + subl %edi, %eax + cmpl $MAX_MATCH, %eax + jge LenMaximum + +/* If the length of the match is not longer than the best match we */ +/* have so far, then forget it and return to the lookup loop. */ + + movl deflatestate(%esp), %edx + movl bestlen(%esp), %ebx + cmpl %ebx, %eax + jg LongerMatch + movl chainlenscanend(%esp), %ebx + movl windowbestlen(%esp), %esi + movl dsPrev(%edx), %edi + movl wmask(%esp), %edx + andl %ecx, %edx + jmp LookupLoop + +/* s->match_start = cur_match; */ +/* best_len = len; */ +/* if (len >= nice_match) break; */ +/* scan_end = *(ushf*)(scan+best_len-1); */ + +LongerMatch: movl nicematch(%esp), %ebx + movl %eax, bestlen(%esp) + movl %ecx, dsMatchStart(%edx) + cmpl %ebx, %eax + jge LeaveNow + movl window(%esp), %esi + addl %eax, %esi + movl %esi, windowbestlen(%esp) + movl chainlenscanend(%esp), %ebx + movw -1(%edi,%eax), %bx + movl dsPrev(%edx), %edi + movl %ebx, chainlenscanend(%esp) + movl wmask(%esp), %edx + andl %ecx, %edx + jmp LookupLoop + +/* Accept the current string, with the maximum possible length. */ + +LenMaximum: movl deflatestate(%esp), %edx + movl $MAX_MATCH, bestlen(%esp) + movl %ecx, dsMatchStart(%edx) + +/* if ((uInt)best_len <= s->lookahead) return (uInt)best_len; */ +/* return s->lookahead; */ + +LeaveNow: + movl deflatestate(%esp), %edx + movl bestlen(%esp), %ebx + movl dsLookahead(%edx), %eax + cmpl %eax, %ebx + jg LookaheadRet + movl %ebx, %eax +LookaheadRet: + +/* Restore the stack and return from whence we came. */ + + addl $LocalVarsSize, %esp + popl %ebx + popl %esi + popl %edi + popl %ebp +match_init: ret diff --git a/zlib/contrib/asm686/README.686 b/zlib/contrib/asm686/README.686 new file mode 100644 index 0000000..a593f23 --- /dev/null +++ b/zlib/contrib/asm686/README.686 @@ -0,0 +1,34 @@ +This is a patched version of zlib, modified to use +Pentium-Pro-optimized assembly code in the deflation algorithm. The +files changed/added by this patch are: + +README.686 +match.S + +The speedup that this patch provides varies, depending on whether the +compiler used to build the original version of zlib falls afoul of the +PPro's speed traps. My own tests show a speedup of around 10-20% at +the default compression level, and 20-30% using -9, against a version +compiled using gcc 2.7.2.3. Your mileage may vary. + +Note that this code has been tailored for the PPro/PII in particular, +and will not perform particuarly well on a Pentium. + +If you are using an assembler other than GNU as, you will have to +translate match.S to use your assembler's syntax. (Have fun.) + +Brian Raiter +breadbox@muppetlabs.com +April, 1998 + + +Added for zlib 1.1.3: + +The patches come from +http://www.muppetlabs.com/~breadbox/software/assembly.html + +To compile zlib with this asm file, copy match.S to the zlib directory +then do: + +CFLAGS="-O3 -DASMV" ./configure +make OBJA=match.o diff --git a/zlib/contrib/asm686/match.S b/zlib/contrib/asm686/match.S new file mode 100644 index 0000000..8e86c33 --- /dev/null +++ b/zlib/contrib/asm686/match.S @@ -0,0 +1,327 @@ +/* match.s -- Pentium-Pro-optimized version of longest_match() + * Written for zlib 1.1.2 + * Copyright (C) 1998 Brian Raiter + * + * This is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License. + */ + +#ifndef NO_UNDERLINE +#define match_init _match_init +#define longest_match _longest_match +#endif + +#define MAX_MATCH (258) +#define MIN_MATCH (3) +#define MIN_LOOKAHEAD (MAX_MATCH + MIN_MATCH + 1) +#define MAX_MATCH_8 ((MAX_MATCH + 7) & ~7) + +/* stack frame offsets */ + +#define chainlenwmask 0 /* high word: current chain len */ + /* low word: s->wmask */ +#define window 4 /* local copy of s->window */ +#define windowbestlen 8 /* s->window + bestlen */ +#define scanstart 16 /* first two bytes of string */ +#define scanend 12 /* last two bytes of string */ +#define scanalign 20 /* dword-misalignment of string */ +#define nicematch 24 /* a good enough match size */ +#define bestlen 28 /* size of best match so far */ +#define scan 32 /* ptr to string wanting match */ + +#define LocalVarsSize (36) +/* saved ebx 36 */ +/* saved edi 40 */ +/* saved esi 44 */ +/* saved ebp 48 */ +/* return address 52 */ +#define deflatestate 56 /* the function arguments */ +#define curmatch 60 + +/* Offsets for fields in the deflate_state structure. These numbers + * are calculated from the definition of deflate_state, with the + * assumption that the compiler will dword-align the fields. (Thus, + * changing the definition of deflate_state could easily cause this + * program to crash horribly, without so much as a warning at + * compile time. Sigh.) + */ +#define dsWSize 36 +#define dsWMask 44 +#define dsWindow 48 +#define dsPrev 56 +#define dsMatchLen 88 +#define dsPrevMatch 92 +#define dsStrStart 100 +#define dsMatchStart 104 +#define dsLookahead 108 +#define dsPrevLen 112 +#define dsMaxChainLen 116 +#define dsGoodMatch 132 +#define dsNiceMatch 136 + + +.file "match.S" + +.globl match_init, longest_match + +.text + +/* uInt longest_match(deflate_state *deflatestate, IPos curmatch) */ + +longest_match: + +/* Save registers that the compiler may be using, and adjust %esp to */ +/* make room for our stack frame. */ + + pushl %ebp + pushl %edi + pushl %esi + pushl %ebx + subl $LocalVarsSize, %esp + +/* Retrieve the function arguments. %ecx will hold cur_match */ +/* throughout the entire function. %edx will hold the pointer to the */ +/* deflate_state structure during the function's setup (before */ +/* entering the main loop). */ + + movl deflatestate(%esp), %edx + movl curmatch(%esp), %ecx + +/* uInt wmask = s->w_mask; */ +/* unsigned chain_length = s->max_chain_length; */ +/* if (s->prev_length >= s->good_match) { */ +/* chain_length >>= 2; */ +/* } */ + + movl dsPrevLen(%edx), %eax + movl dsGoodMatch(%edx), %ebx + cmpl %ebx, %eax + movl dsWMask(%edx), %eax + movl dsMaxChainLen(%edx), %ebx + jl LastMatchGood + shrl $2, %ebx +LastMatchGood: + +/* chainlen is decremented once beforehand so that the function can */ +/* use the sign flag instead of the zero flag for the exit test. */ +/* It is then shifted into the high word, to make room for the wmask */ +/* value, which it will always accompany. */ + + decl %ebx + shll $16, %ebx + orl %eax, %ebx + movl %ebx, chainlenwmask(%esp) + +/* if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; */ + + movl dsNiceMatch(%edx), %eax + movl dsLookahead(%edx), %ebx + cmpl %eax, %ebx + jl LookaheadLess + movl %eax, %ebx +LookaheadLess: movl %ebx, nicematch(%esp) + +/* register Bytef *scan = s->window + s->strstart; */ + + movl dsWindow(%edx), %esi + movl %esi, window(%esp) + movl dsStrStart(%edx), %ebp + lea (%esi,%ebp), %edi + movl %edi, scan(%esp) + +/* Determine how many bytes the scan ptr is off from being */ +/* dword-aligned. */ + + movl %edi, %eax + negl %eax + andl $3, %eax + movl %eax, scanalign(%esp) + +/* IPos limit = s->strstart > (IPos)MAX_DIST(s) ? */ +/* s->strstart - (IPos)MAX_DIST(s) : NIL; */ + + movl dsWSize(%edx), %eax + subl $MIN_LOOKAHEAD, %eax + subl %eax, %ebp + jg LimitPositive + xorl %ebp, %ebp +LimitPositive: + +/* int best_len = s->prev_length; */ + + movl dsPrevLen(%edx), %eax + movl %eax, bestlen(%esp) + +/* Store the sum of s->window + best_len in %esi locally, and in %esi. */ + + addl %eax, %esi + movl %esi, windowbestlen(%esp) + +/* register ush scan_start = *(ushf*)scan; */ +/* register ush scan_end = *(ushf*)(scan+best_len-1); */ +/* Posf *prev = s->prev; */ + + movzwl (%edi), %ebx + movl %ebx, scanstart(%esp) + movzwl -1(%edi,%eax), %ebx + movl %ebx, scanend(%esp) + movl dsPrev(%edx), %edi + +/* Jump into the main loop. */ + + movl chainlenwmask(%esp), %edx + jmp LoopEntry + +.balign 16 + +/* do { + * match = s->window + cur_match; + * if (*(ushf*)(match+best_len-1) != scan_end || + * *(ushf*)match != scan_start) continue; + * [...] + * } while ((cur_match = prev[cur_match & wmask]) > limit + * && --chain_length != 0); + * + * Here is the inner loop of the function. The function will spend the + * majority of its time in this loop, and majority of that time will + * be spent in the first ten instructions. + * + * Within this loop: + * %ebx = scanend + * %ecx = curmatch + * %edx = chainlenwmask - i.e., ((chainlen << 16) | wmask) + * %esi = windowbestlen - i.e., (window + bestlen) + * %edi = prev + * %ebp = limit + */ +LookupLoop: + andl %edx, %ecx + movzwl (%edi,%ecx,2), %ecx + cmpl %ebp, %ecx + jbe LeaveNow + subl $0x00010000, %edx + js LeaveNow +LoopEntry: movzwl -1(%esi,%ecx), %eax + cmpl %ebx, %eax + jnz LookupLoop + movl window(%esp), %eax + movzwl (%eax,%ecx), %eax + cmpl scanstart(%esp), %eax + jnz LookupLoop + +/* Store the current value of chainlen. */ + + movl %edx, chainlenwmask(%esp) + +/* Point %edi to the string under scrutiny, and %esi to the string we */ +/* are hoping to match it up with. In actuality, %esi and %edi are */ +/* both pointed (MAX_MATCH_8 - scanalign) bytes ahead, and %edx is */ +/* initialized to -(MAX_MATCH_8 - scanalign). */ + + movl window(%esp), %esi + movl scan(%esp), %edi + addl %ecx, %esi + movl scanalign(%esp), %eax + movl $(-MAX_MATCH_8), %edx + lea MAX_MATCH_8(%edi,%eax), %edi + lea MAX_MATCH_8(%esi,%eax), %esi + +/* Test the strings for equality, 8 bytes at a time. At the end, + * adjust %edx so that it is offset to the exact byte that mismatched. + * + * We already know at this point that the first three bytes of the + * strings match each other, and they can be safely passed over before + * starting the compare loop. So what this code does is skip over 0-3 + * bytes, as much as necessary in order to dword-align the %edi + * pointer. (%esi will still be misaligned three times out of four.) + * + * It should be confessed that this loop usually does not represent + * much of the total running time. Replacing it with a more + * straightforward "rep cmpsb" would not drastically degrade + * performance. + */ +LoopCmps: + movl (%esi,%edx), %eax + xorl (%edi,%edx), %eax + jnz LeaveLoopCmps + movl 4(%esi,%edx), %eax + xorl 4(%edi,%edx), %eax + jnz LeaveLoopCmps4 + addl $8, %edx + jnz LoopCmps + jmp LenMaximum +LeaveLoopCmps4: addl $4, %edx +LeaveLoopCmps: testl $0x0000FFFF, %eax + jnz LenLower + addl $2, %edx + shrl $16, %eax +LenLower: subb $1, %al + adcl $0, %edx + +/* Calculate the length of the match. If it is longer than MAX_MATCH, */ +/* then automatically accept it as the best possible match and leave. */ + + lea (%edi,%edx), %eax + movl scan(%esp), %edi + subl %edi, %eax + cmpl $MAX_MATCH, %eax + jge LenMaximum + +/* If the length of the match is not longer than the best match we */ +/* have so far, then forget it and return to the lookup loop. */ + + movl deflatestate(%esp), %edx + movl bestlen(%esp), %ebx + cmpl %ebx, %eax + jg LongerMatch + movl windowbestlen(%esp), %esi + movl dsPrev(%edx), %edi + movl scanend(%esp), %ebx + movl chainlenwmask(%esp), %edx + jmp LookupLoop + +/* s->match_start = cur_match; */ +/* best_len = len; */ +/* if (len >= nice_match) break; */ +/* scan_end = *(ushf*)(scan+best_len-1); */ + +LongerMatch: movl nicematch(%esp), %ebx + movl %eax, bestlen(%esp) + movl %ecx, dsMatchStart(%edx) + cmpl %ebx, %eax + jge LeaveNow + movl window(%esp), %esi + addl %eax, %esi + movl %esi, windowbestlen(%esp) + movzwl -1(%edi,%eax), %ebx + movl dsPrev(%edx), %edi + movl %ebx, scanend(%esp) + movl chainlenwmask(%esp), %edx + jmp LookupLoop + +/* Accept the current string, with the maximum possible length. */ + +LenMaximum: movl deflatestate(%esp), %edx + movl $MAX_MATCH, bestlen(%esp) + movl %ecx, dsMatchStart(%edx) + +/* if ((uInt)best_len <= s->lookahead) return (uInt)best_len; */ +/* return s->lookahead; */ + +LeaveNow: + movl deflatestate(%esp), %edx + movl bestlen(%esp), %ebx + movl dsLookahead(%edx), %eax + cmpl %eax, %ebx + jg LookaheadRet + movl %ebx, %eax +LookaheadRet: + +/* Restore the stack and return from whence we came. */ + + addl $LocalVarsSize, %esp + popl %ebx + popl %esi + popl %edi + popl %ebp +match_init: ret diff --git a/zlib/contrib/delphi/zlib.mak b/zlib/contrib/delphi/zlib.mak new file mode 100644 index 0000000..ba557e2 --- /dev/null +++ b/zlib/contrib/delphi/zlib.mak @@ -0,0 +1,36 @@ +# Makefile for zlib32bd.lib +# ------------- Borland C++ 4.5 ------------- + +# The (32-bit) zlib32bd.lib made with this makefile is intended for use +# in making the (32-bit) DLL, png32bd.dll. It uses the "stdcall" calling +# convention. + +CFLAGS= -ps -O2 -C -K -N- -k- -d -3 -r- -w-par -w-aus -WDE +CC=f:\bc45\bin\bcc32 +LIBFLAGS= /C +LIB=f:\bc45\bin\tlib +ZLIB=zlib32bd.lib + +.autodepend +.c.obj: + $(CC) -c $(CFLAGS) $< + +OBJ1=adler32.obj compress.obj crc32.obj deflate.obj gzio.obj infblock.obj +OBJ2=infcodes.obj inflate.obj inftrees.obj infutil.obj inffast.obj +OBJ3=trees.obj uncompr.obj zutil.obj +pOBJ1=+adler32.obj+compress.obj+crc32.obj+deflate.obj+gzio.obj+infblock.obj +pOBJ2=+infcodes.obj+inflate.obj+inftrees.obj+infutil.obj+inffast.obj +pOBJ3=+trees.obj+uncompr.obj+zutil.obj + +all: $(ZLIB) + +$(ZLIB): $(OBJ1) $(OBJ2) $(OBJ3) + @if exist $@ del $@ + $(LIB) @&&| +$@ $(LIBFLAGS) & +$(pOBJ1) & +$(pOBJ2) & +$(pOBJ3) +| + +# End of makefile for zlib32bd.lib diff --git a/zlib/contrib/delphi/zlibdef.pas b/zlib/contrib/delphi/zlibdef.pas new file mode 100644 index 0000000..4f96b7d --- /dev/null +++ b/zlib/contrib/delphi/zlibdef.pas @@ -0,0 +1,169 @@ +unit zlibdef; + +interface + +uses + Windows; + +const + ZLIB_VERSION = '1.1.3'; + +type + voidpf = Pointer; + int = Integer; + uInt = Cardinal; + pBytef = PChar; + uLong = Cardinal; + + alloc_func = function(opaque: voidpf; items, size: uInt): voidpf; + stdcall; + free_func = procedure(opaque, address: voidpf); + stdcall; + + internal_state = Pointer; + + z_streamp = ^z_stream; + z_stream = packed record + next_in: pBytef; // next input byte + avail_in: uInt; // number of bytes available at next_in + total_in: uLong; // total nb of input bytes read so far + + next_out: pBytef; // next output byte should be put there + avail_out: uInt; // remaining free space at next_out + total_out: uLong; // total nb of bytes output so far + + msg: PChar; // last error message, NULL if no error + state: internal_state; // not visible by applications + + zalloc: alloc_func; // used to allocate the internal state + zfree: free_func; // used to free the internal state + opaque: voidpf; // private data object passed to zalloc and zfree + + data_type: int; // best guess about the data type: ascii or binary + adler: uLong; // adler32 value of the uncompressed data + reserved: uLong; // reserved for future use + end; + +const + Z_NO_FLUSH = 0; + Z_SYNC_FLUSH = 2; + Z_FULL_FLUSH = 3; + Z_FINISH = 4; + + Z_OK = 0; + Z_STREAM_END = 1; + + Z_NO_COMPRESSION = 0; + Z_BEST_SPEED = 1; + Z_BEST_COMPRESSION = 9; + Z_DEFAULT_COMPRESSION = -1; + + Z_FILTERED = 1; + Z_HUFFMAN_ONLY = 2; + Z_DEFAULT_STRATEGY = 0; + + Z_BINARY = 0; + Z_ASCII = 1; + Z_UNKNOWN = 2; + + Z_DEFLATED = 8; + + MAX_MEM_LEVEL = 9; + +function adler32(adler: uLong; const buf: pBytef; len: uInt): uLong; + stdcall; +function crc32(crc: uLong; const buf: pBytef; len: uInt): uLong; + stdcall; +function deflate(strm: z_streamp; flush: int): int; + stdcall; +function deflateCopy(dest, source: z_streamp): int; + stdcall; +function deflateEnd(strm: z_streamp): int; + stdcall; +function deflateInit2_(strm: z_streamp; level, method, + windowBits, memLevel, strategy: int; + const version: PChar; stream_size: int): int; + stdcall; +function deflateInit_(strm: z_streamp; level: int; + const version: PChar; stream_size: int): int; + stdcall; +function deflateParams(strm: z_streamp; level, strategy: int): int; + stdcall; +function deflateReset(strm: z_streamp): int; + stdcall; +function deflateSetDictionary(strm: z_streamp; + const dictionary: pBytef; + dictLength: uInt): int; + stdcall; +function inflate(strm: z_streamp; flush: int): int; + stdcall; +function inflateEnd(strm: z_streamp): int; + stdcall; +function inflateInit2_(strm: z_streamp; windowBits: int; + const version: PChar; stream_size: int): int; + stdcall; +function inflateInit_(strm: z_streamp; const version: PChar; + stream_size: int): int; + stdcall; +function inflateReset(strm: z_streamp): int; + stdcall; +function inflateSetDictionary(strm: z_streamp; + const dictionary: pBytef; + dictLength: uInt): int; + stdcall; +function inflateSync(strm: z_streamp): int; + stdcall; + +function deflateInit(strm: z_streamp; level: int): int; +function deflateInit2(strm: z_streamp; level, method, windowBits, + memLevel, strategy: int): int; +function inflateInit(strm: z_streamp): int; +function inflateInit2(strm: z_streamp; windowBits: int): int; + +implementation + +function deflateInit(strm: z_streamp; level: int): int; +begin + Result := deflateInit_(strm, level, ZLIB_VERSION, sizeof(z_stream)); +end; + +function deflateInit2(strm: z_streamp; level, method, windowBits, + memLevel, strategy: int): int; +begin + Result := deflateInit2_(strm, level, method, windowBits, memLevel, + strategy, ZLIB_VERSION, sizeof(z_stream)); +end; + +function inflateInit(strm: z_streamp): int; +begin + Result := inflateInit_(strm, ZLIB_VERSION, sizeof(z_stream)); +end; + +function inflateInit2(strm: z_streamp; windowBits: int): int; +begin + Result := inflateInit2_(strm, windowBits, ZLIB_VERSION, + sizeof(z_stream)); +end; + +const + zlibDLL = 'png32bd.dll'; + +function adler32; external zlibDLL; +function crc32; external zlibDLL; +function deflate; external zlibDLL; +function deflateCopy; external zlibDLL; +function deflateEnd; external zlibDLL; +function deflateInit2_; external zlibDLL; +function deflateInit_; external zlibDLL; +function deflateParams; external zlibDLL; +function deflateReset; external zlibDLL; +function deflateSetDictionary; external zlibDLL; +function inflate; external zlibDLL; +function inflateEnd; external zlibDLL; +function inflateInit2_; external zlibDLL; +function inflateInit_; external zlibDLL; +function inflateReset; external zlibDLL; +function inflateSetDictionary; external zlibDLL; +function inflateSync; external zlibDLL; + +end. diff --git a/zlib/contrib/delphi2/d_zlib.bpr b/zlib/contrib/delphi2/d_zlib.bpr new file mode 100644 index 0000000..78bb254 --- /dev/null +++ b/zlib/contrib/delphi2/d_zlib.bpr @@ -0,0 +1,224 @@ +# --------------------------------------------------------------------------- +!if !$d(BCB) +BCB = $(MAKEDIR)\.. +!endif + +# --------------------------------------------------------------------------- +# IDE SECTION +# --------------------------------------------------------------------------- +# The following section of the project makefile is managed by the BCB IDE. +# It is recommended to use the IDE to change any of the values in this +# section. +# --------------------------------------------------------------------------- + +VERSION = BCB.03 +# --------------------------------------------------------------------------- +PROJECT = d_zlib.lib +OBJFILES = d_zlib.obj adler32.obj deflate.obj infblock.obj infcodes.obj inffast.obj \ + inflate.obj inftrees.obj infutil.obj trees.obj +RESFILES = +RESDEPEN = $(RESFILES) +LIBFILES = +LIBRARIES = VCL35.lib +SPARELIBS = VCL35.lib +DEFFILE = +PACKAGES = VCLX35.bpi VCL35.bpi VCLDB35.bpi VCLDBX35.bpi ibsmp35.bpi bcbsmp35.bpi \ + dclocx35.bpi QRPT35.bpi TEEUI35.bpi TEEDB35.bpi TEE35.bpi DSS35.bpi \ + NMFAST35.bpi INETDB35.bpi INET35.bpi VCLMID35.bpi +# --------------------------------------------------------------------------- +PATHCPP = .; +PATHASM = .; +PATHPAS = .; +PATHRC = .; +DEBUGLIBPATH = $(BCB)\lib\debug +RELEASELIBPATH = $(BCB)\lib\release +# --------------------------------------------------------------------------- +CFLAG1 = -O2 -Ve -d -k- -vi +CFLAG2 = -I$(BCB)\include;$(BCB)\include\vcl -H=$(BCB)\lib\vcl35.csm +CFLAG3 = -ff -pr -5 +PFLAGS = -U;$(DEBUGLIBPATH) -I$(BCB)\include;$(BCB)\include\vcl -H -W -$I- -v -JPHN -M +RFLAGS = -i$(BCB)\include;$(BCB)\include\vcl +AFLAGS = /i$(BCB)\include /i$(BCB)\include\vcl /mx /w2 /zn +LFLAGS = +IFLAGS = -g -Gn +# --------------------------------------------------------------------------- +ALLOBJ = c0w32.obj $(OBJFILES) +ALLRES = $(RESFILES) +ALLLIB = $(LIBFILES) $(LIBRARIES) import32.lib cp32mt.lib +# --------------------------------------------------------------------------- +!!ifdef IDEOPTIONS + +[Version Info] +IncludeVerInfo=0 +AutoIncBuild=0 +MajorVer=1 +MinorVer=0 +Release=0 +Build=0 +Debug=0 +PreRelease=0 +Special=0 +Private=0 +DLL=0 +Locale=1040 +CodePage=1252 + +[Version Info Keys] +CompanyName= +FileDescription= +FileVersion=1.0.0.0 +InternalName= +LegalCopyright= +LegalTrademarks= +OriginalFilename= +ProductName= +ProductVersion=1.0.0.0 +Comments= + +[HistoryLists\hlIncludePath] +Count=2 +Item0=$(BCB)\include +Item1=$(BCB)\include;$(BCB)\include\vcl + +[HistoryLists\hlLibraryPath] +Count=1 +Item0=$(BCB)\lib\obj;$(BCB)\lib + +[HistoryLists\hlDebugSourcePath] +Count=1 +Item0=$(BCB)\source\vcl + +[Debugging] +DebugSourceDirs= + +[Parameters] +RunParams= +HostApplication= + +!endif + + --------------------------------------------------------------------------- +# MAKE SECTION +# --------------------------------------------------------------------------- +# This section of the project file is not used by the BCB IDE. It is for +# the benefit of building from the command-line using the MAKE utility. +# --------------------------------------------------------------------------- + +.autodepend +# --------------------------------------------------------------------------- +!if !$d(BCC32) +BCC32 = bcc32 +!endif + +!if !$d(DCC32) +DCC32 = dcc32 +!endif + +!if !$d(TASM32) +TASM32 = tasm32 +!endif + +!if !$d(LINKER) +LINKER = TLib +!endif + +!if !$d(BRCC32) +BRCC32 = brcc32 +!endif +# --------------------------------------------------------------------------- +!if $d(PATHCPP) +.PATH.CPP = $(PATHCPP) +.PATH.C = $(PATHCPP) +!endif + +!if $d(PATHPAS) +.PATH.PAS = $(PATHPAS) +!endif + +!if $d(PATHASM) +.PATH.ASM = $(PATHASM) +!endif + +!if $d(PATHRC) +.PATH.RC = $(PATHRC) +!endif +# --------------------------------------------------------------------------- +!ifdef IDEOPTIONS + +[Version Info] +IncludeVerInfo=0 +AutoIncBuild=0 +MajorVer=1 +MinorVer=0 +Release=0 +Build=0 +Debug=0 +PreRelease=0 +Special=0 +Private=0 +DLL=0 +Locale=1040 +CodePage=1252 + +[Version Info Keys] +CompanyName= +FileDescription= +FileVersion=1.0.0.0 +InternalName= +LegalCopyright= +LegalTrademarks= +OriginalFilename= +ProductName= +ProductVersion=1.0.0.0 +Comments= + +[HistoryLists\hlIncludePath] +Count=2 +Item0=$(BCB)\include;$(BCB)\include\vcl +Item1=$(BCB)\include + +[HistoryLists\hlLibraryPath] +Count=1 +Item0=$(BCB)\lib\obj;$(BCB)\lib + +[HistoryLists\hlDebugSourcePath] +Count=1 +Item0=$(BCB)\source\vcl + +[Debugging] +DebugSourceDirs= + +[Parameters] +RunParams= +HostApplication= + +!endif + +$(PROJECT): $(OBJFILES) $(RESDEPEN) $(DEFFILE) + $(BCB)\BIN\$(LINKER) @&&! + $(LFLAGS) $(IFLAGS) + + $(ALLOBJ), + + $(PROJECT),, + + $(ALLLIB), + + $(DEFFILE), + + $(ALLRES) +! +# --------------------------------------------------------------------------- +.pas.hpp: + $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< } + +.pas.obj: + $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< } + +.cpp.obj: + $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< } + +.c.obj: + $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< } + +.asm.obj: + $(BCB)\BIN\$(TASM32) $(AFLAGS) $<, $@ + +.rc.res: + $(BCB)\BIN\$(BRCC32) $(RFLAGS) -fo$@ $< +# --------------------------------------------------------------------------- diff --git a/zlib/contrib/delphi2/d_zlib.cpp b/zlib/contrib/delphi2/d_zlib.cpp new file mode 100644 index 0000000..f5dea59 --- /dev/null +++ b/zlib/contrib/delphi2/d_zlib.cpp @@ -0,0 +1,17 @@ +#include +#pragma hdrstop +//--------------------------------------------------------------------------- +USEUNIT("adler32.c"); +USEUNIT("deflate.c"); +USEUNIT("infblock.c"); +USEUNIT("infcodes.c"); +USEUNIT("inffast.c"); +USEUNIT("inflate.c"); +USEUNIT("inftrees.c"); +USEUNIT("infutil.c"); +USEUNIT("trees.c"); +//--------------------------------------------------------------------------- +#define Library + +// To add a file to the library use the Project menu 'Add to Project'. + diff --git a/zlib/contrib/delphi2/readme.txt b/zlib/contrib/delphi2/readme.txt new file mode 100644 index 0000000..cbd3162 --- /dev/null +++ b/zlib/contrib/delphi2/readme.txt @@ -0,0 +1,17 @@ +These are files used to compile zlib under Borland C++ Builder 3. + +zlib.bpg is the main project group that can be loaded in the BCB IDE and +loads all other *.bpr projects + +zlib.bpr is a project used to create a static zlib.lib library with C calling +convention for functions. + +zlib32.bpr creates a zlib32.dll dynamic link library with Windows standard +calling convention. + +d_zlib.bpr creates a set of .obj files with register calling convention. +These files are used by zlib.pas to create a Delphi unit containing zlib. +The d_zlib.lib file generated isn't useful and can be deleted. + +zlib.cpp, zlib32.cpp and d_zlib.cpp are used by the above projects. + diff --git a/zlib/contrib/delphi2/zlib.bpg b/zlib/contrib/delphi2/zlib.bpg new file mode 100644 index 0000000..b6c9acd --- /dev/null +++ b/zlib/contrib/delphi2/zlib.bpg @@ -0,0 +1,26 @@ +#------------------------------------------------------------------------------ +VERSION = BWS.01 +#------------------------------------------------------------------------------ +!ifndef ROOT +ROOT = $(MAKEDIR)\.. +!endif +#------------------------------------------------------------------------------ +MAKE = $(ROOT)\bin\make.exe -$(MAKEFLAGS) -f$** +DCC = $(ROOT)\bin\dcc32.exe $** +BRCC = $(ROOT)\bin\brcc32.exe $** +#------------------------------------------------------------------------------ +PROJECTS = zlib zlib32 d_zlib +#------------------------------------------------------------------------------ +default: $(PROJECTS) +#------------------------------------------------------------------------------ + +zlib: zlib.bpr + $(MAKE) + +zlib32: zlib32.bpr + $(MAKE) + +d_zlib: d_zlib.bpr + $(MAKE) + + diff --git a/zlib/contrib/delphi2/zlib.bpr b/zlib/contrib/delphi2/zlib.bpr new file mode 100644 index 0000000..cf3945b --- /dev/null +++ b/zlib/contrib/delphi2/zlib.bpr @@ -0,0 +1,225 @@ +# --------------------------------------------------------------------------- +!if !$d(BCB) +BCB = $(MAKEDIR)\.. +!endif + +# --------------------------------------------------------------------------- +# IDE SECTION +# --------------------------------------------------------------------------- +# The following section of the project makefile is managed by the BCB IDE. +# It is recommended to use the IDE to change any of the values in this +# section. +# --------------------------------------------------------------------------- + +VERSION = BCB.03 +# --------------------------------------------------------------------------- +PROJECT = zlib.lib +OBJFILES = zlib.obj adler32.obj compress.obj crc32.obj deflate.obj gzio.obj infblock.obj \ + infcodes.obj inffast.obj inflate.obj inftrees.obj infutil.obj trees.obj \ + uncompr.obj zutil.obj +RESFILES = +RESDEPEN = $(RESFILES) +LIBFILES = +LIBRARIES = VCL35.lib +SPARELIBS = VCL35.lib +DEFFILE = +PACKAGES = VCLX35.bpi VCL35.bpi VCLDB35.bpi VCLDBX35.bpi ibsmp35.bpi bcbsmp35.bpi \ + dclocx35.bpi QRPT35.bpi TEEUI35.bpi TEEDB35.bpi TEE35.bpi DSS35.bpi \ + NMFAST35.bpi INETDB35.bpi INET35.bpi VCLMID35.bpi +# --------------------------------------------------------------------------- +PATHCPP = .; +PATHASM = .; +PATHPAS = .; +PATHRC = .; +DEBUGLIBPATH = $(BCB)\lib\debug +RELEASELIBPATH = $(BCB)\lib\release +# --------------------------------------------------------------------------- +CFLAG1 = -O2 -Ve -d -k- -vi +CFLAG2 = -I$(BCB)\include;$(BCB)\include\vcl -H=$(BCB)\lib\vcl35.csm +CFLAG3 = -ff -5 +PFLAGS = -U;$(DEBUGLIBPATH) -I$(BCB)\include;$(BCB)\include\vcl -H -W -$I- -v -JPHN -M +RFLAGS = -i$(BCB)\include;$(BCB)\include\vcl +AFLAGS = /i$(BCB)\include /i$(BCB)\include\vcl /mx /w2 /zn +LFLAGS = +IFLAGS = -g -Gn +# --------------------------------------------------------------------------- +ALLOBJ = c0w32.obj $(OBJFILES) +ALLRES = $(RESFILES) +ALLLIB = $(LIBFILES) $(LIBRARIES) import32.lib cp32mt.lib +# --------------------------------------------------------------------------- +!!ifdef IDEOPTIONS + +[Version Info] +IncludeVerInfo=0 +AutoIncBuild=0 +MajorVer=1 +MinorVer=0 +Release=0 +Build=0 +Debug=0 +PreRelease=0 +Special=0 +Private=0 +DLL=0 +Locale=1040 +CodePage=1252 + +[Version Info Keys] +CompanyName= +FileDescription= +FileVersion=1.0.0.0 +InternalName= +LegalCopyright= +LegalTrademarks= +OriginalFilename= +ProductName= +ProductVersion=1.0.0.0 +Comments= + +[HistoryLists\hlIncludePath] +Count=2 +Item0=$(BCB)\include +Item1=$(BCB)\include;$(BCB)\include\vcl + +[HistoryLists\hlLibraryPath] +Count=1 +Item0=$(BCB)\lib\obj;$(BCB)\lib + +[HistoryLists\hlDebugSourcePath] +Count=1 +Item0=$(BCB)\source\vcl + +[Debugging] +DebugSourceDirs= + +[Parameters] +RunParams= +HostApplication= + +!endif + + --------------------------------------------------------------------------- +# MAKE SECTION +# --------------------------------------------------------------------------- +# This section of the project file is not used by the BCB IDE. It is for +# the benefit of building from the command-line using the MAKE utility. +# --------------------------------------------------------------------------- + +.autodepend +# --------------------------------------------------------------------------- +!if !$d(BCC32) +BCC32 = bcc32 +!endif + +!if !$d(DCC32) +DCC32 = dcc32 +!endif + +!if !$d(TASM32) +TASM32 = tasm32 +!endif + +!if !$d(LINKER) +LINKER = TLib +!endif + +!if !$d(BRCC32) +BRCC32 = brcc32 +!endif +# --------------------------------------------------------------------------- +!if $d(PATHCPP) +.PATH.CPP = $(PATHCPP) +.PATH.C = $(PATHCPP) +!endif + +!if $d(PATHPAS) +.PATH.PAS = $(PATHPAS) +!endif + +!if $d(PATHASM) +.PATH.ASM = $(PATHASM) +!endif + +!if $d(PATHRC) +.PATH.RC = $(PATHRC) +!endif +# --------------------------------------------------------------------------- +!ifdef IDEOPTIONS + +[Version Info] +IncludeVerInfo=0 +AutoIncBuild=0 +MajorVer=1 +MinorVer=0 +Release=0 +Build=0 +Debug=0 +PreRelease=0 +Special=0 +Private=0 +DLL=0 +Locale=1040 +CodePage=1252 + +[Version Info Keys] +CompanyName= +FileDescription= +FileVersion=1.0.0.0 +InternalName= +LegalCopyright= +LegalTrademarks= +OriginalFilename= +ProductName= +ProductVersion=1.0.0.0 +Comments= + +[HistoryLists\hlIncludePath] +Count=2 +Item0=$(BCB)\include;$(BCB)\include\vcl +Item1=$(BCB)\include + +[HistoryLists\hlLibraryPath] +Count=1 +Item0=$(BCB)\lib\obj;$(BCB)\lib + +[HistoryLists\hlDebugSourcePath] +Count=1 +Item0=$(BCB)\source\vcl + +[Debugging] +DebugSourceDirs= + +[Parameters] +RunParams= +HostApplication= + +!endif + +$(PROJECT): $(OBJFILES) $(RESDEPEN) $(DEFFILE) + $(BCB)\BIN\$(LINKER) @&&! + $(LFLAGS) $(IFLAGS) + + $(ALLOBJ), + + $(PROJECT),, + + $(ALLLIB), + + $(DEFFILE), + + $(ALLRES) +! +# --------------------------------------------------------------------------- +.pas.hpp: + $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< } + +.pas.obj: + $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< } + +.cpp.obj: + $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< } + +.c.obj: + $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< } + +.asm.obj: + $(BCB)\BIN\$(TASM32) $(AFLAGS) $<, $@ + +.rc.res: + $(BCB)\BIN\$(BRCC32) $(RFLAGS) -fo$@ $< +# --------------------------------------------------------------------------- diff --git a/zlib/contrib/delphi2/zlib.cpp b/zlib/contrib/delphi2/zlib.cpp new file mode 100644 index 0000000..bf6953b --- /dev/null +++ b/zlib/contrib/delphi2/zlib.cpp @@ -0,0 +1,22 @@ +#include +#pragma hdrstop +//--------------------------------------------------------------------------- +USEUNIT("adler32.c"); +USEUNIT("compress.c"); +USEUNIT("crc32.c"); +USEUNIT("deflate.c"); +USEUNIT("gzio.c"); +USEUNIT("infblock.c"); +USEUNIT("infcodes.c"); +USEUNIT("inffast.c"); +USEUNIT("inflate.c"); +USEUNIT("inftrees.c"); +USEUNIT("infutil.c"); +USEUNIT("trees.c"); +USEUNIT("uncompr.c"); +USEUNIT("zutil.c"); +//--------------------------------------------------------------------------- +#define Library + +// To add a file to the library use the Project menu 'Add to Project'. + diff --git a/zlib/contrib/delphi2/zlib.pas b/zlib/contrib/delphi2/zlib.pas new file mode 100644 index 0000000..10ae4ca --- /dev/null +++ b/zlib/contrib/delphi2/zlib.pas @@ -0,0 +1,534 @@ +{*******************************************************} +{ } +{ Delphi Supplemental Components } +{ ZLIB Data Compression Interface Unit } +{ } +{ Copyright (c) 1997 Borland International } +{ } +{*******************************************************} + +{ Modified for zlib 1.1.3 by Davide Moretti Z_STREAM_END do + begin + P := OutBuf; + Inc(OutBytes, 256); + ReallocMem(OutBuf, OutBytes); + strm.next_out := PChar(Integer(OutBuf) + (Integer(strm.next_out) - Integer(P))); + strm.avail_out := 256; + end; + finally + CCheck(deflateEnd(strm)); + end; + ReallocMem(OutBuf, strm.total_out); + OutBytes := strm.total_out; + except + FreeMem(OutBuf); + raise + end; +end; + + +procedure DecompressBuf(const InBuf: Pointer; InBytes: Integer; + OutEstimate: Integer; out OutBuf: Pointer; out OutBytes: Integer); +var + strm: TZStreamRec; + P: Pointer; + BufInc: Integer; +begin + FillChar(strm, sizeof(strm), 0); + BufInc := (InBytes + 255) and not 255; + if OutEstimate = 0 then + OutBytes := BufInc + else + OutBytes := OutEstimate; + GetMem(OutBuf, OutBytes); + try + strm.next_in := InBuf; + strm.avail_in := InBytes; + strm.next_out := OutBuf; + strm.avail_out := OutBytes; + DCheck(inflateInit_(strm, zlib_version, sizeof(strm))); + try + while DCheck(inflate(strm, Z_FINISH)) <> Z_STREAM_END do + begin + P := OutBuf; + Inc(OutBytes, BufInc); + ReallocMem(OutBuf, OutBytes); + strm.next_out := PChar(Integer(OutBuf) + (Integer(strm.next_out) - Integer(P))); + strm.avail_out := BufInc; + end; + finally + DCheck(inflateEnd(strm)); + end; + ReallocMem(OutBuf, strm.total_out); + OutBytes := strm.total_out; + except + FreeMem(OutBuf); + raise + end; +end; + + +// TCustomZlibStream + +constructor TCustomZLibStream.Create(Strm: TStream); +begin + inherited Create; + FStrm := Strm; + FStrmPos := Strm.Position; +end; + +procedure TCustomZLibStream.Progress(Sender: TObject); +begin + if Assigned(FOnProgress) then FOnProgress(Sender); +end; + + +// TCompressionStream + +constructor TCompressionStream.Create(CompressionLevel: TCompressionLevel; + Dest: TStream); +const + Levels: array [TCompressionLevel] of ShortInt = + (Z_NO_COMPRESSION, Z_BEST_SPEED, Z_DEFAULT_COMPRESSION, Z_BEST_COMPRESSION); +begin + inherited Create(Dest); + FZRec.next_out := FBuffer; + FZRec.avail_out := sizeof(FBuffer); + CCheck(deflateInit_(FZRec, Levels[CompressionLevel], zlib_version, sizeof(FZRec))); +end; + +destructor TCompressionStream.Destroy; +begin + FZRec.next_in := nil; + FZRec.avail_in := 0; + try + if FStrm.Position <> FStrmPos then FStrm.Position := FStrmPos; + while (CCheck(deflate(FZRec, Z_FINISH)) <> Z_STREAM_END) + and (FZRec.avail_out = 0) do + begin + FStrm.WriteBuffer(FBuffer, sizeof(FBuffer)); + FZRec.next_out := FBuffer; + FZRec.avail_out := sizeof(FBuffer); + end; + if FZRec.avail_out < sizeof(FBuffer) then + FStrm.WriteBuffer(FBuffer, sizeof(FBuffer) - FZRec.avail_out); + finally + deflateEnd(FZRec); + end; + inherited Destroy; +end; + +function TCompressionStream.Read(var Buffer; Count: Longint): Longint; +begin + raise ECompressionError.Create('Invalid stream operation'); +end; + +function TCompressionStream.Write(const Buffer; Count: Longint): Longint; +begin + FZRec.next_in := @Buffer; + FZRec.avail_in := Count; + if FStrm.Position <> FStrmPos then FStrm.Position := FStrmPos; + while (FZRec.avail_in > 0) do + begin + CCheck(deflate(FZRec, 0)); + if FZRec.avail_out = 0 then + begin + FStrm.WriteBuffer(FBuffer, sizeof(FBuffer)); + FZRec.next_out := FBuffer; + FZRec.avail_out := sizeof(FBuffer); + FStrmPos := FStrm.Position; + Progress(Self); + end; + end; + Result := Count; +end; + +function TCompressionStream.Seek(Offset: Longint; Origin: Word): Longint; +begin + if (Offset = 0) and (Origin = soFromCurrent) then + Result := FZRec.total_in + else + raise ECompressionError.Create('Invalid stream operation'); +end; + +function TCompressionStream.GetCompressionRate: Single; +begin + if FZRec.total_in = 0 then + Result := 0 + else + Result := (1.0 - (FZRec.total_out / FZRec.total_in)) * 100.0; +end; + + +// TDecompressionStream + +constructor TDecompressionStream.Create(Source: TStream); +begin + inherited Create(Source); + FZRec.next_in := FBuffer; + FZRec.avail_in := 0; + DCheck(inflateInit_(FZRec, zlib_version, sizeof(FZRec))); +end; + +destructor TDecompressionStream.Destroy; +begin + inflateEnd(FZRec); + inherited Destroy; +end; + +function TDecompressionStream.Read(var Buffer; Count: Longint): Longint; +begin + FZRec.next_out := @Buffer; + FZRec.avail_out := Count; + if FStrm.Position <> FStrmPos then FStrm.Position := FStrmPos; + while (FZRec.avail_out > 0) do + begin + if FZRec.avail_in = 0 then + begin + FZRec.avail_in := FStrm.Read(FBuffer, sizeof(FBuffer)); + if FZRec.avail_in = 0 then + begin + Result := Count - FZRec.avail_out; + Exit; + end; + FZRec.next_in := FBuffer; + FStrmPos := FStrm.Position; + Progress(Self); + end; + DCheck(inflate(FZRec, 0)); + end; + Result := Count; +end; + +function TDecompressionStream.Write(const Buffer; Count: Longint): Longint; +begin + raise EDecompressionError.Create('Invalid stream operation'); +end; + +function TDecompressionStream.Seek(Offset: Longint; Origin: Word): Longint; +var + I: Integer; + Buf: array [0..4095] of Char; +begin + if (Offset = 0) and (Origin = soFromBeginning) then + begin + DCheck(inflateReset(FZRec)); + FZRec.next_in := FBuffer; + FZRec.avail_in := 0; + FStrm.Position := 0; + FStrmPos := 0; + end + else if ( (Offset >= 0) and (Origin = soFromCurrent)) or + ( ((Offset - FZRec.total_out) > 0) and (Origin = soFromBeginning)) then + begin + if Origin = soFromBeginning then Dec(Offset, FZRec.total_out); + if Offset > 0 then + begin + for I := 1 to Offset div sizeof(Buf) do + ReadBuffer(Buf, sizeof(Buf)); + ReadBuffer(Buf, Offset mod sizeof(Buf)); + end; + end + else + raise EDecompressionError.Create('Invalid stream operation'); + Result := FZRec.total_out; +end; + +end. diff --git a/zlib/contrib/delphi2/zlib32.bpr b/zlib/contrib/delphi2/zlib32.bpr new file mode 100644 index 0000000..cabcec4 --- /dev/null +++ b/zlib/contrib/delphi2/zlib32.bpr @@ -0,0 +1,174 @@ +# --------------------------------------------------------------------------- +!if !$d(BCB) +BCB = $(MAKEDIR)\.. +!endif + +# --------------------------------------------------------------------------- +# IDE SECTION +# --------------------------------------------------------------------------- +# The following section of the project makefile is managed by the BCB IDE. +# It is recommended to use the IDE to change any of the values in this +# section. +# --------------------------------------------------------------------------- + +VERSION = BCB.03 +# --------------------------------------------------------------------------- +PROJECT = zlib32.dll +OBJFILES = zlib32.obj adler32.obj compress.obj crc32.obj deflate.obj gzio.obj infblock.obj \ + infcodes.obj inffast.obj inflate.obj inftrees.obj infutil.obj trees.obj \ + uncompr.obj zutil.obj +RESFILES = +RESDEPEN = $(RESFILES) +LIBFILES = +LIBRARIES = +SPARELIBS = +DEFFILE = +PACKAGES = VCLX35.bpi VCL35.bpi VCLDB35.bpi VCLDBX35.bpi ibsmp35.bpi bcbsmp35.bpi \ + dclocx35.bpi QRPT35.bpi TEEUI35.bpi TEEDB35.bpi TEE35.bpi DSS35.bpi \ + NMFAST35.bpi INETDB35.bpi INET35.bpi VCLMID35.bpi +# --------------------------------------------------------------------------- +PATHCPP = .; +PATHASM = .; +PATHPAS = .; +PATHRC = .; +DEBUGLIBPATH = $(BCB)\lib\debug +RELEASELIBPATH = $(BCB)\lib\release +# --------------------------------------------------------------------------- +CFLAG1 = -WD -O2 -Ve -d -k- -vi -c -tWD +CFLAG2 = -D_NO_VCL;ZLIB_DLL -I$(BCB)\include +CFLAG3 = -ff -5 +PFLAGS = -D_NO_VCL;ZLIB_DLL -U$(BCB)\lib;$(RELEASELIBPATH) -I$(BCB)\include -$I- -v \ + -JPHN -M +RFLAGS = -D_NO_VCL;ZLIB_DLL -i$(BCB)\include +AFLAGS = /i$(BCB)\include /d_NO_VCL /dZLIB_DLL /mx /w2 /zn +LFLAGS = -L$(BCB)\lib;$(RELEASELIBPATH) -aa -Tpd -x -Gi +IFLAGS = -Gn -g +# --------------------------------------------------------------------------- +ALLOBJ = c0d32.obj $(OBJFILES) +ALLRES = $(RESFILES) +ALLLIB = $(LIBFILES) import32.lib cw32mt.lib +# --------------------------------------------------------------------------- +!ifdef IDEOPTIONS + +[Version Info] +IncludeVerInfo=0 +AutoIncBuild=0 +MajorVer=1 +MinorVer=0 +Release=0 +Build=0 +Debug=0 +PreRelease=0 +Special=0 +Private=0 +DLL=1 +Locale=1040 +CodePage=1252 + +[Version Info Keys] +CompanyName= +FileDescription=DLL (GUI) +FileVersion=1.0.0.0 +InternalName= +LegalCopyright= +LegalTrademarks= +OriginalFilename= +ProductName= +ProductVersion=1.0.0.0 +Comments= + +[HistoryLists\hlIncludePath] +Count=1 +Item0=$(BCB)\include + +[HistoryLists\hlLibraryPath] +Count=1 +Item0=$(BCB)\lib + +[HistoryLists\hlConditionals] +Count=1 +Item0=_NO_VCL;ZLIB_DLL + +[Debugging] +DebugSourceDirs= + +[Parameters] +RunParams= +HostApplication= + +!endif + +# --------------------------------------------------------------------------- +# MAKE SECTION +# --------------------------------------------------------------------------- +# This section of the project file is not used by the BCB IDE. It is for +# the benefit of building from the command-line using the MAKE utility. +# --------------------------------------------------------------------------- + +.autodepend +# --------------------------------------------------------------------------- +!if !$d(BCC32) +BCC32 = bcc32 +!endif + +!if !$d(DCC32) +DCC32 = dcc32 +!endif + +!if !$d(TASM32) +TASM32 = tasm32 +!endif + +!if !$d(LINKER) +LINKER = ilink32 +!endif + +!if !$d(BRCC32) +BRCC32 = brcc32 +!endif +# --------------------------------------------------------------------------- +!if $d(PATHCPP) +.PATH.CPP = $(PATHCPP) +.PATH.C = $(PATHCPP) +!endif + +!if $d(PATHPAS) +.PATH.PAS = $(PATHPAS) +!endif + +!if $d(PATHASM) +.PATH.ASM = $(PATHASM) +!endif + +!if $d(PATHRC) +.PATH.RC = $(PATHRC) +!endif +# --------------------------------------------------------------------------- +$(PROJECT): $(OBJFILES) $(RESDEPEN) $(DEFFILE) + $(BCB)\BIN\$(LINKER) @&&! + $(LFLAGS) $(IFLAGS) + + $(ALLOBJ), + + $(PROJECT),, + + $(ALLLIB), + + $(DEFFILE), + + $(ALLRES) +! +# --------------------------------------------------------------------------- +.pas.hpp: + $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< } + +.pas.obj: + $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< } + +.cpp.obj: + $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< } + +.c.obj: + $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< } + +.asm.obj: + $(BCB)\BIN\$(TASM32) $(AFLAGS) $<, $@ + +.rc.res: + $(BCB)\BIN\$(BRCC32) $(RFLAGS) -fo$@ $< +# --------------------------------------------------------------------------- diff --git a/zlib/contrib/delphi2/zlib32.cpp b/zlib/contrib/delphi2/zlib32.cpp new file mode 100644 index 0000000..7372f6b --- /dev/null +++ b/zlib/contrib/delphi2/zlib32.cpp @@ -0,0 +1,42 @@ + +#include +#pragma hdrstop +#include + + +//--------------------------------------------------------------------------- +// Important note about DLL memory management in a VCL DLL: +// +// +// +// If your DLL uses VCL and exports any functions that pass VCL String objects +// (or structs/classes containing nested Strings) as parameter or function +// results, you will need to build both your DLL project and any EXE projects +// that use your DLL with the dynamic RTL (the RTL DLL). This will change your +// DLL and its calling EXE's to use BORLNDMM.DLL as their memory manager. In +// these cases, the file BORLNDMM.DLL should be deployed along with your DLL +// and the RTL DLL (CP3240MT.DLL). To avoid the requiring BORLNDMM.DLL in +// these situations, pass string information using "char *" or ShortString +// parameters and then link with the static RTL. +// +//--------------------------------------------------------------------------- +USEUNIT("adler32.c"); +USEUNIT("compress.c"); +USEUNIT("crc32.c"); +USEUNIT("deflate.c"); +USEUNIT("gzio.c"); +USEUNIT("infblock.c"); +USEUNIT("infcodes.c"); +USEUNIT("inffast.c"); +USEUNIT("inflate.c"); +USEUNIT("inftrees.c"); +USEUNIT("infutil.c"); +USEUNIT("trees.c"); +USEUNIT("uncompr.c"); +USEUNIT("zutil.c"); +//--------------------------------------------------------------------------- +#pragma argsused +int WINAPI DllEntryPoint(HINSTANCE hinst, unsigned long reason, void*) +{ + return 1; +} diff --git a/zlib/contrib/iostream/test.cpp b/zlib/contrib/iostream/test.cpp new file mode 100644 index 0000000..7d265b3 --- /dev/null +++ b/zlib/contrib/iostream/test.cpp @@ -0,0 +1,24 @@ + +#include "zfstream.h" + +int main() { + + // Construct a stream object with this filebuffer. Anything sent + // to this stream will go to standard out. + gzofstream os( 1, ios::out ); + + // This text is getting compressed and sent to stdout. + // To prove this, run 'test | zcat'. + os << "Hello, Mommy" << endl; + + os << setcompressionlevel( Z_NO_COMPRESSION ); + os << "hello, hello, hi, ho!" << endl; + + setcompressionlevel( os, Z_DEFAULT_COMPRESSION ) + << "I'm compressing again" << endl; + + os.close(); + + return 0; + +} diff --git a/zlib/contrib/iostream/zfstream.cpp b/zlib/contrib/iostream/zfstream.cpp new file mode 100644 index 0000000..a690bbe --- /dev/null +++ b/zlib/contrib/iostream/zfstream.cpp @@ -0,0 +1,329 @@ + +#include +#include "zfstream.h" + +gzfilebuf::gzfilebuf() : + file(NULL), + mode(0), + own_file_descriptor(0) +{ } + +gzfilebuf::~gzfilebuf() { + + sync(); + if ( own_file_descriptor ) + close(); + +} + +gzfilebuf *gzfilebuf::open( const char *name, + int io_mode ) { + + if ( is_open() ) + return NULL; + + char char_mode[10]; + char *p; + memset(char_mode,'\0',10); + p = char_mode; + + if ( io_mode & ios::in ) { + mode = ios::in; + *p++ = 'r'; + } else if ( io_mode & ios::app ) { + mode = ios::app; + *p++ = 'a'; + } else { + mode = ios::out; + *p++ = 'w'; + } + + if ( io_mode & ios::binary ) { + mode |= ios::binary; + *p++ = 'b'; + } + + // Hard code the compression level + if ( io_mode & (ios::out|ios::app )) { + *p++ = '9'; + } + + if ( (file = gzopen(name, char_mode)) == NULL ) + return NULL; + + own_file_descriptor = 1; + + return this; + +} + +gzfilebuf *gzfilebuf::attach( int file_descriptor, + int io_mode ) { + + if ( is_open() ) + return NULL; + + char char_mode[10]; + char *p; + memset(char_mode,'\0',10); + p = char_mode; + + if ( io_mode & ios::in ) { + mode = ios::in; + *p++ = 'r'; + } else if ( io_mode & ios::app ) { + mode = ios::app; + *p++ = 'a'; + } else { + mode = ios::out; + *p++ = 'w'; + } + + if ( io_mode & ios::binary ) { + mode |= ios::binary; + *p++ = 'b'; + } + + // Hard code the compression level + if ( io_mode & (ios::out|ios::app )) { + *p++ = '9'; + } + + if ( (file = gzdopen(file_descriptor, char_mode)) == NULL ) + return NULL; + + own_file_descriptor = 0; + + return this; + +} + +gzfilebuf *gzfilebuf::close() { + + if ( is_open() ) { + + sync(); + gzclose( file ); + file = NULL; + + } + + return this; + +} + +int gzfilebuf::setcompressionlevel( short comp_level ) { + + return gzsetparams(file, comp_level, -2); + +} + +int gzfilebuf::setcompressionstrategy( short comp_strategy ) { + + return gzsetparams(file, -2, comp_strategy); + +} + + +streampos gzfilebuf::seekoff( streamoff off, ios::seek_dir dir, int which ) { + + return streampos(EOF); + +} + +int gzfilebuf::underflow() { + + // If the file hasn't been opened for reading, error. + if ( !is_open() || !(mode & ios::in) ) + return EOF; + + // if a buffer doesn't exists, allocate one. + if ( !base() ) { + + if ( (allocate()) == EOF ) + return EOF; + setp(0,0); + + } else { + + if ( in_avail() ) + return (unsigned char) *gptr(); + + if ( out_waiting() ) { + if ( flushbuf() == EOF ) + return EOF; + } + + } + + // Attempt to fill the buffer. + + int result = fillbuf(); + if ( result == EOF ) { + // disable get area + setg(0,0,0); + return EOF; + } + + return (unsigned char) *gptr(); + +} + +int gzfilebuf::overflow( int c ) { + + if ( !is_open() || !(mode & ios::out) ) + return EOF; + + if ( !base() ) { + if ( allocate() == EOF ) + return EOF; + setg(0,0,0); + } else { + if (in_avail()) { + return EOF; + } + if (out_waiting()) { + if (flushbuf() == EOF) + return EOF; + } + } + + int bl = blen(); + setp( base(), base() + bl); + + if ( c != EOF ) { + + *pptr() = c; + pbump(1); + + } + + return 0; + +} + +int gzfilebuf::sync() { + + if ( !is_open() ) + return EOF; + + if ( out_waiting() ) + return flushbuf(); + + return 0; + +} + +int gzfilebuf::flushbuf() { + + int n; + char *q; + + q = pbase(); + n = pptr() - q; + + if ( gzwrite( file, q, n) < n ) + return EOF; + + setp(0,0); + + return 0; + +} + +int gzfilebuf::fillbuf() { + + int required; + char *p; + + p = base(); + + required = blen(); + + int t = gzread( file, p, required ); + + if ( t <= 0) return EOF; + + setg( base(), base(), base()+t); + + return t; + +} + +gzfilestream_common::gzfilestream_common() : + ios( gzfilestream_common::rdbuf() ) +{ } + +gzfilestream_common::~gzfilestream_common() +{ } + +void gzfilestream_common::attach( int fd, int io_mode ) { + + if ( !buffer.attach( fd, io_mode) ) + clear( ios::failbit | ios::badbit ); + else + clear(); + +} + +void gzfilestream_common::open( const char *name, int io_mode ) { + + if ( !buffer.open( name, io_mode ) ) + clear( ios::failbit | ios::badbit ); + else + clear(); + +} + +void gzfilestream_common::close() { + + if ( !buffer.close() ) + clear( ios::failbit | ios::badbit ); + +} + +gzfilebuf *gzfilestream_common::rdbuf() { + + return &buffer; + +} + +gzifstream::gzifstream() : + ios( gzfilestream_common::rdbuf() ) +{ + clear( ios::badbit ); +} + +gzifstream::gzifstream( const char *name, int io_mode ) : + ios( gzfilestream_common::rdbuf() ) +{ + gzfilestream_common::open( name, io_mode ); +} + +gzifstream::gzifstream( int fd, int io_mode ) : + ios( gzfilestream_common::rdbuf() ) +{ + gzfilestream_common::attach( fd, io_mode ); +} + +gzifstream::~gzifstream() { } + +gzofstream::gzofstream() : + ios( gzfilestream_common::rdbuf() ) +{ + clear( ios::badbit ); +} + +gzofstream::gzofstream( const char *name, int io_mode ) : + ios( gzfilestream_common::rdbuf() ) +{ + gzfilestream_common::open( name, io_mode ); +} + +gzofstream::gzofstream( int fd, int io_mode ) : + ios( gzfilestream_common::rdbuf() ) +{ + gzfilestream_common::attach( fd, io_mode ); +} + +gzofstream::~gzofstream() { } diff --git a/zlib/contrib/iostream/zfstream.h b/zlib/contrib/iostream/zfstream.h new file mode 100644 index 0000000..c87fa08 --- /dev/null +++ b/zlib/contrib/iostream/zfstream.h @@ -0,0 +1,142 @@ + +#ifndef _zfstream_h +#define _zfstream_h + +#include +#include "zlib.h" + +class gzfilebuf : public streambuf { + +public: + + gzfilebuf( ); + virtual ~gzfilebuf(); + + gzfilebuf *open( const char *name, int io_mode ); + gzfilebuf *attach( int file_descriptor, int io_mode ); + gzfilebuf *close(); + + int setcompressionlevel( short comp_level ); + int setcompressionstrategy( short comp_strategy ); + + inline int is_open() const { return (file !=NULL); } + + virtual streampos seekoff( streamoff, ios::seek_dir, int ); + + virtual int sync(); + +protected: + + virtual int underflow(); + virtual int overflow( int = EOF ); + +private: + + gzFile file; + short mode; + short own_file_descriptor; + + int flushbuf(); + int fillbuf(); + +}; + +class gzfilestream_common : virtual public ios { + + friend class gzifstream; + friend class gzofstream; + friend gzofstream &setcompressionlevel( gzofstream &, int ); + friend gzofstream &setcompressionstrategy( gzofstream &, int ); + +public: + virtual ~gzfilestream_common(); + + void attach( int fd, int io_mode ); + void open( const char *name, int io_mode ); + void close(); + +protected: + gzfilestream_common(); + +private: + gzfilebuf *rdbuf(); + + gzfilebuf buffer; + +}; + +class gzifstream : public gzfilestream_common, public istream { + +public: + + gzifstream(); + gzifstream( const char *name, int io_mode = ios::in ); + gzifstream( int fd, int io_mode = ios::in ); + + virtual ~gzifstream(); + +}; + +class gzofstream : public gzfilestream_common, public ostream { + +public: + + gzofstream(); + gzofstream( const char *name, int io_mode = ios::out ); + gzofstream( int fd, int io_mode = ios::out ); + + virtual ~gzofstream(); + +}; + +template class gzomanip { + friend gzofstream &operator<<(gzofstream &, const gzomanip &); +public: + gzomanip(gzofstream &(*f)(gzofstream &, T), T v) : func(f), val(v) { } +private: + gzofstream &(*func)(gzofstream &, T); + T val; +}; + +template gzofstream &operator<<(gzofstream &s, + const gzomanip &m) { + return (*m.func)(s, m.val); + +} + +inline gzofstream &setcompressionlevel( gzofstream &s, int l ) { + (s.rdbuf())->setcompressionlevel(l); + return s; +} + +inline gzofstream &setcompressionstrategy( gzofstream &s, int l ) { + (s.rdbuf())->setcompressionstrategy(l); + return s; +} + +inline gzomanip setcompressionlevel(int l) +{ + return gzomanip(&setcompressionlevel,l); +} + +inline gzomanip setcompressionstrategy(int l) +{ + return gzomanip(&setcompressionstrategy,l); +} + +#endif + + + + + + + + + + + + + + + diff --git a/zlib/contrib/iostream2/zstream.h b/zlib/contrib/iostream2/zstream.h new file mode 100644 index 0000000..8bc9c12 --- /dev/null +++ b/zlib/contrib/iostream2/zstream.h @@ -0,0 +1,307 @@ +/* + * + * Copyright (c) 1997 + * Christian Michelsen Research AS + * Advanced Computing + * Fantoftvegen 38, 5036 BERGEN, Norway + * http://www.cmr.no + * + * Permission to use, copy, modify, distribute and sell this software + * and its documentation for any purpose is hereby granted without fee, + * provided that the above copyright notice appear in all copies and + * that both that copyright notice and this permission notice appear + * in supporting documentation. Christian Michelsen Research AS makes no + * representations about the suitability of this software for any + * purpose. It is provided "as is" without express or implied warranty. + * + */ + +#ifndef ZSTREAM__H +#define ZSTREAM__H + +/* + * zstream.h - C++ interface to the 'zlib' general purpose compression library + * Id: zstream.h 1.1 1997-06-25 12:00:56+02 tyge Exp tyge + */ + +#include +#include +#include +#include "zlib.h" + +#if defined(_WIN32) +# include +# include +# define SET_BINARY_MODE(file) setmode(fileno(file), O_BINARY) +#else +# define SET_BINARY_MODE(file) +#endif + +class zstringlen { +public: + zstringlen(class izstream&); + zstringlen(class ozstream&, const char*); + size_t value() const { return val.word; } +private: + struct Val { unsigned char byte; size_t word; } val; +}; + +// ----------------------------- izstream ----------------------------- + +class izstream +{ + public: + izstream() : m_fp(0) {} + izstream(FILE* fp) : m_fp(0) { open(fp); } + izstream(const char* name) : m_fp(0) { open(name); } + ~izstream() { close(); } + + /* Opens a gzip (.gz) file for reading. + * open() can be used to read a file which is not in gzip format; + * in this case read() will directly read from the file without + * decompression. errno can be checked to distinguish two error + * cases (if errno is zero, the zlib error is Z_MEM_ERROR). + */ + void open(const char* name) { + if (m_fp) close(); + m_fp = ::gzopen(name, "rb"); + } + + void open(FILE* fp) { + SET_BINARY_MODE(fp); + if (m_fp) close(); + m_fp = ::gzdopen(fileno(fp), "rb"); + } + + /* Flushes all pending input if necessary, closes the compressed file + * and deallocates all the (de)compression state. The return value is + * the zlib error number (see function error() below). + */ + int close() { + int r = ::gzclose(m_fp); + m_fp = 0; return r; + } + + /* Binary read the given number of bytes from the compressed file. + */ + int read(void* buf, size_t len) { + return ::gzread(m_fp, buf, len); + } + + /* Returns the error message for the last error which occurred on the + * given compressed file. errnum is set to zlib error number. If an + * error occurred in the file system and not in the compression library, + * errnum is set to Z_ERRNO and the application may consult errno + * to get the exact error code. + */ + const char* error(int* errnum) { + return ::gzerror(m_fp, errnum); + } + + gzFile fp() { return m_fp; } + + private: + gzFile m_fp; +}; + +/* + * Binary read the given (array of) object(s) from the compressed file. + * If the input file was not in gzip format, read() copies the objects number + * of bytes into the buffer. + * returns the number of uncompressed bytes actually read + * (0 for end of file, -1 for error). + */ +template +inline int read(izstream& zs, T* x, Items items) { + return ::gzread(zs.fp(), x, items*sizeof(T)); +} + +/* + * Binary input with the '>' operator. + */ +template +inline izstream& operator>(izstream& zs, T& x) { + ::gzread(zs.fp(), &x, sizeof(T)); + return zs; +} + + +inline zstringlen::zstringlen(izstream& zs) { + zs > val.byte; + if (val.byte == 255) zs > val.word; + else val.word = val.byte; +} + +/* + * Read length of string + the string with the '>' operator. + */ +inline izstream& operator>(izstream& zs, char* x) { + zstringlen len(zs); + ::gzread(zs.fp(), x, len.value()); + x[len.value()] = '\0'; + return zs; +} + +inline char* read_string(izstream& zs) { + zstringlen len(zs); + char* x = new char[len.value()+1]; + ::gzread(zs.fp(), x, len.value()); + x[len.value()] = '\0'; + return x; +} + +// ----------------------------- ozstream ----------------------------- + +class ozstream +{ + public: + ozstream() : m_fp(0), m_os(0) { + } + ozstream(FILE* fp, int level = Z_DEFAULT_COMPRESSION) + : m_fp(0), m_os(0) { + open(fp, level); + } + ozstream(const char* name, int level = Z_DEFAULT_COMPRESSION) + : m_fp(0), m_os(0) { + open(name, level); + } + ~ozstream() { + close(); + } + + /* Opens a gzip (.gz) file for writing. + * The compression level parameter should be in 0..9 + * errno can be checked to distinguish two error cases + * (if errno is zero, the zlib error is Z_MEM_ERROR). + */ + void open(const char* name, int level = Z_DEFAULT_COMPRESSION) { + char mode[4] = "wb\0"; + if (level != Z_DEFAULT_COMPRESSION) mode[2] = '0'+level; + if (m_fp) close(); + m_fp = ::gzopen(name, mode); + } + + /* open from a FILE pointer. + */ + void open(FILE* fp, int level = Z_DEFAULT_COMPRESSION) { + SET_BINARY_MODE(fp); + char mode[4] = "wb\0"; + if (level != Z_DEFAULT_COMPRESSION) mode[2] = '0'+level; + if (m_fp) close(); + m_fp = ::gzdopen(fileno(fp), mode); + } + + /* Flushes all pending output if necessary, closes the compressed file + * and deallocates all the (de)compression state. The return value is + * the zlib error number (see function error() below). + */ + int close() { + if (m_os) { + ::gzwrite(m_fp, m_os->str(), m_os->pcount()); + delete[] m_os->str(); delete m_os; m_os = 0; + } + int r = ::gzclose(m_fp); m_fp = 0; return r; + } + + /* Binary write the given number of bytes into the compressed file. + */ + int write(const void* buf, size_t len) { + return ::gzwrite(m_fp, (voidp) buf, len); + } + + /* Flushes all pending output into the compressed file. The parameter + * _flush is as in the deflate() function. The return value is the zlib + * error number (see function gzerror below). flush() returns Z_OK if + * the flush_ parameter is Z_FINISH and all output could be flushed. + * flush() should be called only when strictly necessary because it can + * degrade compression. + */ + int flush(int _flush) { + os_flush(); + return ::gzflush(m_fp, _flush); + } + + /* Returns the error message for the last error which occurred on the + * given compressed file. errnum is set to zlib error number. If an + * error occurred in the file system and not in the compression library, + * errnum is set to Z_ERRNO and the application may consult errno + * to get the exact error code. + */ + const char* error(int* errnum) { + return ::gzerror(m_fp, errnum); + } + + gzFile fp() { return m_fp; } + + ostream& os() { + if (m_os == 0) m_os = new ostrstream; + return *m_os; + } + + void os_flush() { + if (m_os && m_os->pcount()>0) { + ostrstream* oss = new ostrstream; + oss->fill(m_os->fill()); + oss->flags(m_os->flags()); + oss->precision(m_os->precision()); + oss->width(m_os->width()); + ::gzwrite(m_fp, m_os->str(), m_os->pcount()); + delete[] m_os->str(); delete m_os; m_os = oss; + } + } + + private: + gzFile m_fp; + ostrstream* m_os; +}; + +/* + * Binary write the given (array of) object(s) into the compressed file. + * returns the number of uncompressed bytes actually written + * (0 in case of error). + */ +template +inline int write(ozstream& zs, const T* x, Items items) { + return ::gzwrite(zs.fp(), (voidp) x, items*sizeof(T)); +} + +/* + * Binary output with the '<' operator. + */ +template +inline ozstream& operator<(ozstream& zs, const T& x) { + ::gzwrite(zs.fp(), (voidp) &x, sizeof(T)); + return zs; +} + +inline zstringlen::zstringlen(ozstream& zs, const char* x) { + val.byte = 255; val.word = ::strlen(x); + if (val.word < 255) zs < (val.byte = val.word); + else zs < val; +} + +/* + * Write length of string + the string with the '<' operator. + */ +inline ozstream& operator<(ozstream& zs, const char* x) { + zstringlen len(zs, x); + ::gzwrite(zs.fp(), (voidp) x, len.value()); + return zs; +} + +#ifdef _MSC_VER +inline ozstream& operator<(ozstream& zs, char* const& x) { + return zs < (const char*) x; +} +#endif + +/* + * Ascii write with the << operator; + */ +template +inline ostream& operator<<(ozstream& zs, const T& x) { + zs.os_flush(); + return zs.os() << x; +} + +#endif diff --git a/zlib/contrib/iostream2/zstream_test.cpp b/zlib/contrib/iostream2/zstream_test.cpp new file mode 100644 index 0000000..5bbd56c --- /dev/null +++ b/zlib/contrib/iostream2/zstream_test.cpp @@ -0,0 +1,25 @@ +#include "zstream.h" +#include +#include +#include + +void main() { + char h[256] = "Hello"; + char* g = "Goodbye"; + ozstream out("temp.gz"); + out < "This works well" < h < g; + out.close(); + + izstream in("temp.gz"); // read it back + char *x = read_string(in), *y = new char[256], z[256]; + in > y > z; + in.close(); + cout << x << endl << y << endl << z << endl; + + out.open("temp.gz"); // try ascii output; zcat temp.gz to see the results + out << setw(50) << setfill('#') << setprecision(20) << x << endl << y << endl << z << endl; + out << z << endl << y << endl << x << endl; + out << 1.1234567890123456789 << endl; + + delete[] x; delete[] y; +} diff --git a/zlib/contrib/minizip/ChangeLogUnzip b/zlib/contrib/minizip/ChangeLogUnzip new file mode 100644 index 0000000..9987c54 --- /dev/null +++ b/zlib/contrib/minizip/ChangeLogUnzip @@ -0,0 +1,38 @@ +Change in 0.15: (19 Mar 98) +- fix memory leak in minizip.c + +Change in 0.14: (10 Mar 98) +- fix bugs in minizip.c sample for zipping big file +- fix problem in month in date handling +- fix bug in unzlocal_GetCurrentFileInfoInternal in unzip.c for + comment handling + +Change in 0.13: (6 Mar 98) +- fix bugs in zip.c +- add real minizip sample + +Change in 0.12: (4 Mar 98) +- add zip.c and zip.h for creates .zip file +- fix change_file_date in miniunz.c for Unix (Jean-loup Gailly) +- fix miniunz.c for file without specific record for directory + +Change in 0.11: (3 Mar 98) +- fix bug in unzGetCurrentFileInfo for get extra field and comment +- enhance miniunz sample, remove the bad unztst.c sample + +Change in 0.10: (2 Mar 98) +- fix bug in unzReadCurrentFile +- rename unzip* to unz* function and structure +- remove Windows-like hungary notation variable name +- modify some structure in unzip.h +- add somes comment in source +- remove unzipGetcCurrentFile function +- replace ZUNZEXPORT by ZEXPORT +- add unzGetLocalExtrafield for get the local extrafield info +- add a new sample, miniunz.c + +Change in 0.4: (25 Feb 98) +- suppress the type unzipFileInZip. + Only on file in the zipfile can be open at the same time +- fix somes typo in code +- added tm_unz structure in unzip_file_info (date/time in readable format) diff --git a/zlib/contrib/minizip/Makefile b/zlib/contrib/minizip/Makefile new file mode 100644 index 0000000..a1dfc16 --- /dev/null +++ b/zlib/contrib/minizip/Makefile @@ -0,0 +1,25 @@ +CC=cc +CFLAGS=-O -I../.. + +UNZ_OBJS = miniunz.o unzip.o ../../libz.a +ZIP_OBJS = minizip.o zip.o ../../libz.a + +.c.o: + $(CC) -c $(CFLAGS) $*.c + +all: miniunz minizip + +miniunz: $(UNZ_OBJS) + $(CC) $(CFLAGS) -o $@ $(UNZ_OBJS) + +minizip: $(ZIP_OBJS) + $(CC) $(CFLAGS) -o $@ $(ZIP_OBJS) + +test: miniunz minizip + ./minizip test readme.txt + ./miniunz -l test.zip + mv readme.txt readme.old + ./miniunz test.zip + +clean: + /bin/rm -f *.o *~ minizip miniunz diff --git a/zlib/contrib/minizip/miniunz.c b/zlib/contrib/minizip/miniunz.c new file mode 100644 index 0000000..f3b7832 --- /dev/null +++ b/zlib/contrib/minizip/miniunz.c @@ -0,0 +1,508 @@ +#include +#include +#include +#include +#include +#include + +#ifdef unix +# include +# include +#else +# include +# include +#endif + +#include "unzip.h" + +#define CASESENSITIVITY (0) +#define WRITEBUFFERSIZE (8192) + +/* + mini unzip, demo of unzip package + + usage : + Usage : miniunz [-exvlo] file.zip [file_to_extract] + + list the file in the zipfile, and print the content of FILE_ID.ZIP or README.TXT + if it exists +*/ + + +/* change_file_date : change the date/time of a file + filename : the filename of the file where date/time must be modified + dosdate : the new date at the MSDos format (4 bytes) + tmu_date : the SAME new date at the tm_unz format */ +void change_file_date(filename,dosdate,tmu_date) + const char *filename; + uLong dosdate; + tm_unz tmu_date; +{ +#ifdef WIN32 + HANDLE hFile; + FILETIME ftm,ftLocal,ftCreate,ftLastAcc,ftLastWrite; + + hFile = CreateFile(filename,GENERIC_READ | GENERIC_WRITE, + 0,NULL,OPEN_EXISTING,0,NULL); + GetFileTime(hFile,&ftCreate,&ftLastAcc,&ftLastWrite); + DosDateTimeToFileTime((WORD)(dosdate>>16),(WORD)dosdate,&ftLocal); + LocalFileTimeToFileTime(&ftLocal,&ftm); + SetFileTime(hFile,&ftm,&ftLastAcc,&ftm); + CloseHandle(hFile); +#else +#ifdef unix + struct utimbuf ut; + struct tm newdate; + newdate.tm_sec = tmu_date.tm_sec; + newdate.tm_min=tmu_date.tm_min; + newdate.tm_hour=tmu_date.tm_hour; + newdate.tm_mday=tmu_date.tm_mday; + newdate.tm_mon=tmu_date.tm_mon; + if (tmu_date.tm_year > 1900) + newdate.tm_year=tmu_date.tm_year - 1900; + else + newdate.tm_year=tmu_date.tm_year ; + newdate.tm_isdst=-1; + + ut.actime=ut.modtime=mktime(&newdate); + utime(filename,&ut); +#endif +#endif +} + + +/* mymkdir and change_file_date are not 100 % portable + As I don't know well Unix, I wait feedback for the unix portion */ + +int mymkdir(dirname) + const char* dirname; +{ + int ret=0; +#ifdef WIN32 + ret = mkdir(dirname); +#else +#ifdef unix + ret = mkdir (dirname,0775); +#endif +#endif + return ret; +} + +int makedir (newdir) + char *newdir; +{ + char *buffer ; + char *p; + int len = strlen(newdir); + + if (len <= 0) + return 0; + + buffer = (char*)malloc(len+1); + strcpy(buffer,newdir); + + if (buffer[len-1] == '/') { + buffer[len-1] = '\0'; + } + if (mymkdir(buffer) == 0) + { + free(buffer); + return 1; + } + + p = buffer+1; + while (1) + { + char hold; + + while(*p && *p != '\\' && *p != '/') + p++; + hold = *p; + *p = 0; + if ((mymkdir(buffer) == -1) && (errno == ENOENT)) + { + printf("couldn't create directory %s\n",buffer); + free(buffer); + return 0; + } + if (hold == 0) + break; + *p++ = hold; + } + free(buffer); + return 1; +} + +void do_banner() +{ + printf("MiniUnz 0.15, demo of zLib + Unz package written by Gilles Vollant\n"); + printf("more info at http://wwww.winimage/zLibDll/unzip.htm\n\n"); +} + +void do_help() +{ + printf("Usage : miniunz [-exvlo] file.zip [file_to_extract]\n\n") ; +} + + +int do_list(uf) + unzFile uf; +{ + uLong i; + unz_global_info gi; + int err; + + err = unzGetGlobalInfo (uf,&gi); + if (err!=UNZ_OK) + printf("error %d with zipfile in unzGetGlobalInfo \n",err); + printf(" Length Method Size Ratio Date Time CRC-32 Name\n"); + printf(" ------ ------ ---- ----- ---- ---- ------ ----\n"); + for (i=0;i0) + ratio = (file_info.compressed_size*100)/file_info.uncompressed_size; + + if (file_info.compression_method==0) + string_method="Stored"; + else + if (file_info.compression_method==Z_DEFLATED) + { + uInt iLevel=(uInt)((file_info.flag & 0x6)/2); + if (iLevel==0) + string_method="Defl:N"; + else if (iLevel==1) + string_method="Defl:X"; + else if ((iLevel==2) || (iLevel==3)) + string_method="Defl:F"; /* 2:fast , 3 : extra fast*/ + } + else + string_method="Unkn. "; + + printf("%7lu %6s %7lu %3lu%% %2.2lu-%2.2lu-%2.2lu %2.2lu:%2.2lu %8.8lx %s\n", + file_info.uncompressed_size,string_method,file_info.compressed_size, + ratio, + (uLong)file_info.tmu_date.tm_mon + 1, + (uLong)file_info.tmu_date.tm_mday, + (uLong)file_info.tmu_date.tm_year % 100, + (uLong)file_info.tmu_date.tm_hour,(uLong)file_info.tmu_date.tm_min, + (uLong)file_info.crc,filename_inzip); + if ((i+1)='a') && (rep<='z')) + rep -= 0x20; + } + while ((rep!='Y') && (rep!='N') && (rep!='A')); + } + + if (rep == 'N') + skip = 1; + + if (rep == 'A') + *popt_overwrite=1; + } + + if ((skip==0) && (err==UNZ_OK)) + { + fout=fopen(write_filename,"wb"); + + /* some zipfile don't contain directory alone before file */ + if ((fout==NULL) && ((*popt_extract_without_path)==0) && + (filename_withoutpath!=(char*)filename_inzip)) + { + char c=*(filename_withoutpath-1); + *(filename_withoutpath-1)='\0'; + makedir(write_filename); + *(filename_withoutpath-1)=c; + fout=fopen(write_filename,"wb"); + } + + if (fout==NULL) + { + printf("error opening %s\n",write_filename); + } + } + + if (fout!=NULL) + { + printf(" extracting: %s\n",write_filename); + + do + { + err = unzReadCurrentFile(uf,buf,size_buf); + if (err<0) + { + printf("error %d with zipfile in unzReadCurrentFile\n",err); + break; + } + if (err>0) + if (fwrite(buf,err,1,fout)!=1) + { + printf("error in writing extracted file\n"); + err=UNZ_ERRNO; + break; + } + } + while (err>0); + fclose(fout); + if (err==0) + change_file_date(write_filename,file_info.dosDate, + file_info.tmu_date); + } + + if (err==UNZ_OK) + { + err = unzCloseCurrentFile (uf); + if (err!=UNZ_OK) + { + printf("error %d with zipfile in unzCloseCurrentFile\n",err); + } + } + else + unzCloseCurrentFile(uf); /* don't lose the error */ + } + + free(buf); + return err; +} + + +int do_extract(uf,opt_extract_without_path,opt_overwrite) + unzFile uf; + int opt_extract_without_path; + int opt_overwrite; +{ + uLong i; + unz_global_info gi; + int err; + FILE* fout=NULL; + + err = unzGetGlobalInfo (uf,&gi); + if (err!=UNZ_OK) + printf("error %d with zipfile in unzGetGlobalInfo \n",err); + + for (i=0;i +#include +#include +#include +#include +#include + +#ifdef unix +# include +# include +# include +# include +#else +# include +# include +#endif + +#include "zip.h" + + +#define WRITEBUFFERSIZE (16384) +#define MAXFILENAME (256) + +#ifdef WIN32 +uLong filetime(f, tmzip, dt) + char *f; /* name of file to get info on */ + tm_zip *tmzip; /* return value: access, modific. and creation times */ + uLong *dt; /* dostime */ +{ + int ret = 0; + { + FILETIME ftLocal; + HANDLE hFind; + WIN32_FIND_DATA ff32; + + hFind = FindFirstFile(f,&ff32); + if (hFind != INVALID_HANDLE_VALUE) + { + FileTimeToLocalFileTime(&(ff32.ftLastWriteTime),&ftLocal); + FileTimeToDosDateTime(&ftLocal,((LPWORD)dt)+1,((LPWORD)dt)+0); + FindClose(hFind); + ret = 1; + } + } + return ret; +} +#else +#ifdef unix +uLong filetime(f, tmzip, dt) + char *f; /* name of file to get info on */ + tm_zip *tmzip; /* return value: access, modific. and creation times */ + uLong *dt; /* dostime */ +{ + int ret=0; + struct stat s; /* results of stat() */ + struct tm* filedate; + time_t tm_t=0; + + if (strcmp(f,"-")!=0) + { + char name[MAXFILENAME]; + int len = strlen(f); + strcpy(name, f); + if (name[len - 1] == '/') + name[len - 1] = '\0'; + /* not all systems allow stat'ing a file with / appended */ + if (stat(name,&s)==0) + { + tm_t = s.st_mtime; + ret = 1; + } + } + filedate = localtime(&tm_t); + + tmzip->tm_sec = filedate->tm_sec; + tmzip->tm_min = filedate->tm_min; + tmzip->tm_hour = filedate->tm_hour; + tmzip->tm_mday = filedate->tm_mday; + tmzip->tm_mon = filedate->tm_mon ; + tmzip->tm_year = filedate->tm_year; + + return ret; +} +#else +uLong filetime(f, tmzip, dt) + char *f; /* name of file to get info on */ + tm_zip *tmzip; /* return value: access, modific. and creation times */ + uLong *dt; /* dostime */ +{ + return 0; +} +#endif +#endif + + + + +int check_exist_file(filename) + const char* filename; +{ + FILE* ftestexist; + int ret = 1; + ftestexist = fopen(filename,"rb"); + if (ftestexist==NULL) + ret = 0; + else + fclose(ftestexist); + return ret; +} + +void do_banner() +{ + printf("MiniZip 0.15, demo of zLib + Zip package written by Gilles Vollant\n"); + printf("more info at http://wwww.winimage/zLibDll/unzip.htm\n\n"); +} + +void do_help() +{ + printf("Usage : minizip [-o] file.zip [files_to_add]\n\n") ; +} + +int main(argc,argv) + int argc; + char *argv[]; +{ + int i; + int opt_overwrite=0; + int opt_compress_level=Z_DEFAULT_COMPRESSION; + int zipfilenamearg = 0; + char filename_try[MAXFILENAME]; + int zipok; + int err=0; + int size_buf=0; + void* buf=NULL, + + + do_banner(); + if (argc==1) + { + do_help(); + exit(0); + return 0; + } + else + { + for (i=1;i='0') && (c<='9')) + opt_compress_level = c-'0'; + } + } + else + if (zipfilenamearg == 0) + zipfilenamearg = i ; + } + } + + size_buf = WRITEBUFFERSIZE; + buf = (void*)malloc(size_buf); + if (buf==NULL) + { + printf("Error allocating memory\n"); + return ZIP_INTERNALERROR; + } + + if (zipfilenamearg==0) + zipok=0; + else + { + int i,len; + int dot_found=0; + + zipok = 1 ; + strcpy(filename_try,argv[zipfilenamearg]); + len=strlen(filename_try); + for (i=0;i='a') && (rep<='z')) + rep -= 0x20; + } + while ((rep!='Y') && (rep!='N')); + if (rep=='N') + zipok = 0; + } + } + + if (zipok==1) + { + zipFile zf; + int errclose; + zf = zipOpen(filename_try,0); + if (zf == NULL) + { + printf("error opening %s\n",filename_try); + err= ZIP_ERRNO; + } + else + printf("creating %s\n",filename_try); + + for (i=zipfilenamearg+1;(i0) + { + err = zipWriteInFileInZip (zf,buf,size_read); + if (err<0) + { + printf("error in writing %s in the zipfile\n", + filenameinzip); + } + + } + } while ((err == ZIP_OK) && (size_read>0)); + + fclose(fin); + if (err<0) + err=ZIP_ERRNO; + else + { + err = zipCloseFileInZip(zf); + if (err!=ZIP_OK) + printf("error in closing %s in the zipfile\n", + filenameinzip); + } + } + } + errclose = zipClose(zf,NULL); + if (errclose != ZIP_OK) + printf("error in closing %s\n",filename_try); + } + + free(buf); + exit(0); + return 0; /* to avoid warning */ +} diff --git a/zlib/contrib/minizip/readme.txt b/zlib/contrib/minizip/readme.txt new file mode 100644 index 0000000..1fc023c --- /dev/null +++ b/zlib/contrib/minizip/readme.txt @@ -0,0 +1,37 @@ + +UnZip 0.15 additionnal library + + + This unzip package allow extract file from .ZIP file, compatible with +PKZip 2.04g, WinZip, InfoZip tools and compatible. + + Multi volume ZipFile (span) are not supported, and old compression used by old +PKZip 1.x are not supported. + +See probdesc.zip from PKWare for specification of .ZIP format. + +What is Unzip + The Zlib library support the deflate compression and the creation of gzip (.gz) +file. Zlib is free and small. + The .Zip format, which can contain several compressed files (.gz can containt +only one file) is a very popular format. This is why I've written a package for reading file compressed in Zipfile. + +Using Unzip package + +You need source of Zlib (get zlib111.zip and read zlib.h). +Get unzlb015.zip and read unzip.h (whith documentation of unzip functions) + +The Unzip package is only two file : unzip.h and unzip.c. But it use the Zlib + files. +unztst.c is a simple sample program, which list file in a zipfile and display + README.TXT or FILE_ID.DIZ (if these files are found). +miniunz.c is a mini unzip program. + +I'm also currenlyt writing a zipping portion (zip.h, zip.c and test with minizip.c) + +Please email me for feedback. +I hope my source is compatible with Unix system, but I need your help for be sure + +Latest revision : Mar 04th, 1998 + +Check http://www.winimage.com/zLibDll/unzip.html for up to date info. diff --git a/zlib/contrib/minizip/unzip.c b/zlib/contrib/minizip/unzip.c new file mode 100644 index 0000000..ff71a47 --- /dev/null +++ b/zlib/contrib/minizip/unzip.c @@ -0,0 +1,1294 @@ +/* unzip.c -- IO on .zip files using zlib + Version 0.15 beta, Mar 19th, 1998, + + Read unzip.h for more info +*/ + + +#include +#include +#include +#include "zlib.h" +#include "unzip.h" + +#ifdef STDC +# include +# include +# include +#endif +#ifdef NO_ERRNO_H + extern int errno; +#else +# include +#endif + + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + + + +#if !defined(unix) && !defined(CASESENSITIVITYDEFAULT_YES) && \ + !defined(CASESENSITIVITYDEFAULT_NO) +#define CASESENSITIVITYDEFAULT_NO +#endif + + +#ifndef UNZ_BUFSIZE +#define UNZ_BUFSIZE (16384) +#endif + +#ifndef UNZ_MAXFILENAMEINZIP +#define UNZ_MAXFILENAMEINZIP (256) +#endif + +#ifndef ALLOC +# define ALLOC(size) (malloc(size)) +#endif +#ifndef TRYFREE +# define TRYFREE(p) {if (p) free(p);} +#endif + +#define SIZECENTRALDIRITEM (0x2e) +#define SIZEZIPLOCALHEADER (0x1e) + + +/* I've found an old Unix (a SunOS 4.1.3_U1) without all SEEK_* defined.... */ + +#ifndef SEEK_CUR +#define SEEK_CUR 1 +#endif + +#ifndef SEEK_END +#define SEEK_END 2 +#endif + +#ifndef SEEK_SET +#define SEEK_SET 0 +#endif + +const char unz_copyright[] = + " unzip 0.15 Copyright 1998 Gilles Vollant "; + +/* unz_file_info_interntal contain internal info about a file in zipfile*/ +typedef struct unz_file_info_internal_s +{ + uLong offset_curfile;/* relative offset of local header 4 bytes */ +} unz_file_info_internal; + + +/* file_in_zip_read_info_s contain internal information about a file in zipfile, + when reading and decompress it */ +typedef struct +{ + char *read_buffer; /* internal buffer for compressed data */ + z_stream stream; /* zLib stream structure for inflate */ + + uLong pos_in_zipfile; /* position in byte on the zipfile, for fseek*/ + uLong stream_initialised; /* flag set if stream structure is initialised*/ + + uLong offset_local_extrafield;/* offset of the local extra field */ + uInt size_local_extrafield;/* size of the local extra field */ + uLong pos_local_extrafield; /* position in the local extra field in read*/ + + uLong crc32; /* crc32 of all data uncompressed */ + uLong crc32_wait; /* crc32 we must obtain after decompress all */ + uLong rest_read_compressed; /* number of byte to be decompressed */ + uLong rest_read_uncompressed;/*number of byte to be obtained after decomp*/ + FILE* file; /* io structore of the zipfile */ + uLong compression_method; /* compression method (0==store) */ + uLong byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/ +} file_in_zip_read_info_s; + + +/* unz_s contain internal information about the zipfile +*/ +typedef struct +{ + FILE* file; /* io structore of the zipfile */ + unz_global_info gi; /* public global information */ + uLong byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/ + uLong num_file; /* number of the current file in the zipfile*/ + uLong pos_in_central_dir; /* pos of the current file in the central dir*/ + uLong current_file_ok; /* flag about the usability of the current file*/ + uLong central_pos; /* position of the beginning of the central dir*/ + + uLong size_central_dir; /* size of the central directory */ + uLong offset_central_dir; /* offset of start of central directory with + respect to the starting disk number */ + + unz_file_info cur_file_info; /* public info about the current file in zip*/ + unz_file_info_internal cur_file_info_internal; /* private info about it*/ + file_in_zip_read_info_s* pfile_in_zip_read; /* structure about the current + file if we are decompressing it */ +} unz_s; + + +/* =========================================================================== + Read a byte from a gz_stream; update next_in and avail_in. Return EOF + for end of file. + IN assertion: the stream s has been sucessfully opened for reading. +*/ + + +local int unzlocal_getByte(fin,pi) + FILE *fin; + int *pi; +{ + unsigned char c; + int err = fread(&c, 1, 1, fin); + if (err==1) + { + *pi = (int)c; + return UNZ_OK; + } + else + { + if (ferror(fin)) + return UNZ_ERRNO; + else + return UNZ_EOF; + } +} + + +/* =========================================================================== + Reads a long in LSB order from the given gz_stream. Sets +*/ +local int unzlocal_getShort (fin,pX) + FILE* fin; + uLong *pX; +{ + uLong x ; + int i; + int err; + + err = unzlocal_getByte(fin,&i); + x = (uLong)i; + + if (err==UNZ_OK) + err = unzlocal_getByte(fin,&i); + x += ((uLong)i)<<8; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +local int unzlocal_getLong (fin,pX) + FILE* fin; + uLong *pX; +{ + uLong x ; + int i; + int err; + + err = unzlocal_getByte(fin,&i); + x = (uLong)i; + + if (err==UNZ_OK) + err = unzlocal_getByte(fin,&i); + x += ((uLong)i)<<8; + + if (err==UNZ_OK) + err = unzlocal_getByte(fin,&i); + x += ((uLong)i)<<16; + + if (err==UNZ_OK) + err = unzlocal_getByte(fin,&i); + x += ((uLong)i)<<24; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + + +/* My own strcmpi / strcasecmp */ +local int strcmpcasenosensitive_internal (fileName1,fileName2) + const char* fileName1; + const char* fileName2; +{ + for (;;) + { + char c1=*(fileName1++); + char c2=*(fileName2++); + if ((c1>='a') && (c1<='z')) + c1 -= 0x20; + if ((c2>='a') && (c2<='z')) + c2 -= 0x20; + if (c1=='\0') + return ((c2=='\0') ? 0 : -1); + if (c2=='\0') + return 1; + if (c1c2) + return 1; + } +} + + +#ifdef CASESENSITIVITYDEFAULT_NO +#define CASESENSITIVITYDEFAULTVALUE 2 +#else +#define CASESENSITIVITYDEFAULTVALUE 1 +#endif + +#ifndef STRCMPCASENOSENTIVEFUNCTION +#define STRCMPCASENOSENTIVEFUNCTION strcmpcasenosensitive_internal +#endif + +/* + Compare two filename (fileName1,fileName2). + If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp) + If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi + or strcasecmp) + If iCaseSenisivity = 0, case sensitivity is defaut of your operating system + (like 1 on Unix, 2 on Windows) + +*/ +extern int ZEXPORT unzStringFileNameCompare (fileName1,fileName2,iCaseSensitivity) + const char* fileName1; + const char* fileName2; + int iCaseSensitivity; +{ + if (iCaseSensitivity==0) + iCaseSensitivity=CASESENSITIVITYDEFAULTVALUE; + + if (iCaseSensitivity==1) + return strcmp(fileName1,fileName2); + + return STRCMPCASENOSENTIVEFUNCTION(fileName1,fileName2); +} + +#define BUFREADCOMMENT (0x400) + +/* + Locate the Central directory of a zipfile (at the end, just before + the global comment) +*/ +local uLong unzlocal_SearchCentralDir(fin) + FILE *fin; +{ + unsigned char* buf; + uLong uSizeFile; + uLong uBackRead; + uLong uMaxBack=0xffff; /* maximum size of global comment */ + uLong uPosFound=0; + + if (fseek(fin,0,SEEK_END) != 0) + return 0; + + + uSizeFile = ftell( fin ); + + if (uMaxBack>uSizeFile) + uMaxBack = uSizeFile; + + buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4); + if (buf==NULL) + return 0; + + uBackRead = 4; + while (uBackReaduMaxBack) + uBackRead = uMaxBack; + else + uBackRead+=BUFREADCOMMENT; + uReadPos = uSizeFile-uBackRead ; + + uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ? + (BUFREADCOMMENT+4) : (uSizeFile-uReadPos); + if (fseek(fin,uReadPos,SEEK_SET)!=0) + break; + + if (fread(buf,(uInt)uReadSize,1,fin)!=1) + break; + + for (i=(int)uReadSize-3; (i--)>0;) + if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) && + ((*(buf+i+2))==0x05) && ((*(buf+i+3))==0x06)) + { + uPosFound = uReadPos+i; + break; + } + + if (uPosFound!=0) + break; + } + TRYFREE(buf); + return uPosFound; +} + +/* + Open a Zip file. path contain the full pathname (by example, + on a Windows NT computer "c:\\test\\zlib109.zip" or on an Unix computer + "zlib/zlib109.zip". + If the zipfile cannot be opened (file don't exist or in not valid), the + return value is NULL. + Else, the return value is a unzFile Handle, usable with other function + of this unzip package. +*/ +extern unzFile ZEXPORT unzOpen (path) + const char *path; +{ + unz_s us; + unz_s *s; + uLong central_pos,uL; + FILE * fin ; + + uLong number_disk; /* number of the current dist, used for + spaning ZIP, unsupported, always 0*/ + uLong number_disk_with_CD; /* number the the disk with central dir, used + for spaning ZIP, unsupported, always 0*/ + uLong number_entry_CD; /* total number of entries in + the central dir + (same than number_entry on nospan) */ + + int err=UNZ_OK; + + if (unz_copyright[0]!=' ') + return NULL; + + fin=fopen(path,"rb"); + if (fin==NULL) + return NULL; + + central_pos = unzlocal_SearchCentralDir(fin); + if (central_pos==0) + err=UNZ_ERRNO; + + if (fseek(fin,central_pos,SEEK_SET)!=0) + err=UNZ_ERRNO; + + /* the signature, already checked */ + if (unzlocal_getLong(fin,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of this disk */ + if (unzlocal_getShort(fin,&number_disk)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of the disk with the start of the central directory */ + if (unzlocal_getShort(fin,&number_disk_with_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central dir on this disk */ + if (unzlocal_getShort(fin,&us.gi.number_entry)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central dir */ + if (unzlocal_getShort(fin,&number_entry_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + if ((number_entry_CD!=us.gi.number_entry) || + (number_disk_with_CD!=0) || + (number_disk!=0)) + err=UNZ_BADZIPFILE; + + /* size of the central directory */ + if (unzlocal_getLong(fin,&us.size_central_dir)!=UNZ_OK) + err=UNZ_ERRNO; + + /* offset of start of central directory with respect to the + starting disk number */ + if (unzlocal_getLong(fin,&us.offset_central_dir)!=UNZ_OK) + err=UNZ_ERRNO; + + /* zipfile comment length */ + if (unzlocal_getShort(fin,&us.gi.size_comment)!=UNZ_OK) + err=UNZ_ERRNO; + + if ((central_pospfile_in_zip_read!=NULL) + unzCloseCurrentFile(file); + + fclose(s->file); + TRYFREE(s); + return UNZ_OK; +} + + +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. */ +extern int ZEXPORT unzGetGlobalInfo (file,pglobal_info) + unzFile file; + unz_global_info *pglobal_info; +{ + unz_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + *pglobal_info=s->gi; + return UNZ_OK; +} + + +/* + Translate date/time from Dos format to tm_unz (readable more easilty) +*/ +local void unzlocal_DosDateToTmuDate (ulDosDate, ptm) + uLong ulDosDate; + tm_unz* ptm; +{ + uLong uDate; + uDate = (uLong)(ulDosDate>>16); + ptm->tm_mday = (uInt)(uDate&0x1f) ; + ptm->tm_mon = (uInt)((((uDate)&0x1E0)/0x20)-1) ; + ptm->tm_year = (uInt)(((uDate&0x0FE00)/0x0200)+1980) ; + + ptm->tm_hour = (uInt) ((ulDosDate &0xF800)/0x800); + ptm->tm_min = (uInt) ((ulDosDate&0x7E0)/0x20) ; + ptm->tm_sec = (uInt) (2*(ulDosDate&0x1f)) ; +} + +/* + Get Info about the current file in the zipfile, with internal only info +*/ +local int unzlocal_GetCurrentFileInfoInternal OF((unzFile file, + unz_file_info *pfile_info, + unz_file_info_internal + *pfile_info_internal, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); + +local int unzlocal_GetCurrentFileInfoInternal (file, + pfile_info, + pfile_info_internal, + szFileName, fileNameBufferSize, + extraField, extraFieldBufferSize, + szComment, commentBufferSize) + unzFile file; + unz_file_info *pfile_info; + unz_file_info_internal *pfile_info_internal; + char *szFileName; + uLong fileNameBufferSize; + void *extraField; + uLong extraFieldBufferSize; + char *szComment; + uLong commentBufferSize; +{ + unz_s* s; + unz_file_info file_info; + unz_file_info_internal file_info_internal; + int err=UNZ_OK; + uLong uMagic; + long lSeek=0; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + if (fseek(s->file,s->pos_in_central_dir+s->byte_before_the_zipfile,SEEK_SET)!=0) + err=UNZ_ERRNO; + + + /* we check the magic */ + if (err==UNZ_OK) + if (unzlocal_getLong(s->file,&uMagic) != UNZ_OK) + err=UNZ_ERRNO; + else if (uMagic!=0x02014b50) + err=UNZ_BADZIPFILE; + + if (unzlocal_getShort(s->file,&file_info.version) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.version_needed) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.flag) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.compression_method) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getLong(s->file,&file_info.dosDate) != UNZ_OK) + err=UNZ_ERRNO; + + unzlocal_DosDateToTmuDate(file_info.dosDate,&file_info.tmu_date); + + if (unzlocal_getLong(s->file,&file_info.crc) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getLong(s->file,&file_info.compressed_size) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getLong(s->file,&file_info.uncompressed_size) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.size_filename) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.size_file_extra) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.size_file_comment) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.disk_num_start) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&file_info.internal_fa) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getLong(s->file,&file_info.external_fa) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getLong(s->file,&file_info_internal.offset_curfile) != UNZ_OK) + err=UNZ_ERRNO; + + lSeek+=file_info.size_filename; + if ((err==UNZ_OK) && (szFileName!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_filename0) && (fileNameBufferSize>0)) + if (fread(szFileName,(uInt)uSizeRead,1,s->file)!=1) + err=UNZ_ERRNO; + lSeek -= uSizeRead; + } + + + if ((err==UNZ_OK) && (extraField!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_file_extrafile,lSeek,SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + if ((file_info.size_file_extra>0) && (extraFieldBufferSize>0)) + if (fread(extraField,(uInt)uSizeRead,1,s->file)!=1) + err=UNZ_ERRNO; + lSeek += file_info.size_file_extra - uSizeRead; + } + else + lSeek+=file_info.size_file_extra; + + + if ((err==UNZ_OK) && (szComment!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_file_commentfile,lSeek,SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + if ((file_info.size_file_comment>0) && (commentBufferSize>0)) + if (fread(szComment,(uInt)uSizeRead,1,s->file)!=1) + err=UNZ_ERRNO; + lSeek+=file_info.size_file_comment - uSizeRead; + } + else + lSeek+=file_info.size_file_comment; + + if ((err==UNZ_OK) && (pfile_info!=NULL)) + *pfile_info=file_info; + + if ((err==UNZ_OK) && (pfile_info_internal!=NULL)) + *pfile_info_internal=file_info_internal; + + return err; +} + + + +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. +*/ +extern int ZEXPORT unzGetCurrentFileInfo (file, + pfile_info, + szFileName, fileNameBufferSize, + extraField, extraFieldBufferSize, + szComment, commentBufferSize) + unzFile file; + unz_file_info *pfile_info; + char *szFileName; + uLong fileNameBufferSize; + void *extraField; + uLong extraFieldBufferSize; + char *szComment; + uLong commentBufferSize; +{ + return unzlocal_GetCurrentFileInfoInternal(file,pfile_info,NULL, + szFileName,fileNameBufferSize, + extraField,extraFieldBufferSize, + szComment,commentBufferSize); +} + +/* + Set the current file of the zipfile to the first file. + return UNZ_OK if there is no problem +*/ +extern int ZEXPORT unzGoToFirstFile (file) + unzFile file; +{ + int err=UNZ_OK; + unz_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + s->pos_in_central_dir=s->offset_central_dir; + s->num_file=0; + err=unzlocal_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + + +/* + Set the current file of the zipfile to the next file. + return UNZ_OK if there is no problem + return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest. +*/ +extern int ZEXPORT unzGoToNextFile (file) + unzFile file; +{ + unz_s* s; + int err; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + if (s->num_file+1==s->gi.number_entry) + return UNZ_END_OF_LIST_OF_FILE; + + s->pos_in_central_dir += SIZECENTRALDIRITEM + s->cur_file_info.size_filename + + s->cur_file_info.size_file_extra + s->cur_file_info.size_file_comment ; + s->num_file++; + err = unzlocal_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + + +/* + Try locate the file szFileName in the zipfile. + For the iCaseSensitivity signification, see unzipStringFileNameCompare + + return value : + UNZ_OK if the file is found. It becomes the current file. + UNZ_END_OF_LIST_OF_FILE if the file is not found +*/ +extern int ZEXPORT unzLocateFile (file, szFileName, iCaseSensitivity) + unzFile file; + const char *szFileName; + int iCaseSensitivity; +{ + unz_s* s; + int err; + + + uLong num_fileSaved; + uLong pos_in_central_dirSaved; + + + if (file==NULL) + return UNZ_PARAMERROR; + + if (strlen(szFileName)>=UNZ_MAXFILENAMEINZIP) + return UNZ_PARAMERROR; + + s=(unz_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + + num_fileSaved = s->num_file; + pos_in_central_dirSaved = s->pos_in_central_dir; + + err = unzGoToFirstFile(file); + + while (err == UNZ_OK) + { + char szCurrentFileName[UNZ_MAXFILENAMEINZIP+1]; + unzGetCurrentFileInfo(file,NULL, + szCurrentFileName,sizeof(szCurrentFileName)-1, + NULL,0,NULL,0); + if (unzStringFileNameCompare(szCurrentFileName, + szFileName,iCaseSensitivity)==0) + return UNZ_OK; + err = unzGoToNextFile(file); + } + + s->num_file = num_fileSaved ; + s->pos_in_central_dir = pos_in_central_dirSaved ; + return err; +} + + +/* + Read the local header of the current zipfile + Check the coherency of the local header and info in the end of central + directory about this file + store in *piSizeVar the size of extra info in local header + (filename and size of extra field data) +*/ +local int unzlocal_CheckCurrentFileCoherencyHeader (s,piSizeVar, + poffset_local_extrafield, + psize_local_extrafield) + unz_s* s; + uInt* piSizeVar; + uLong *poffset_local_extrafield; + uInt *psize_local_extrafield; +{ + uLong uMagic,uData,uFlags; + uLong size_filename; + uLong size_extra_field; + int err=UNZ_OK; + + *piSizeVar = 0; + *poffset_local_extrafield = 0; + *psize_local_extrafield = 0; + + if (fseek(s->file,s->cur_file_info_internal.offset_curfile + + s->byte_before_the_zipfile,SEEK_SET)!=0) + return UNZ_ERRNO; + + + if (err==UNZ_OK) + if (unzlocal_getLong(s->file,&uMagic) != UNZ_OK) + err=UNZ_ERRNO; + else if (uMagic!=0x04034b50) + err=UNZ_BADZIPFILE; + + if (unzlocal_getShort(s->file,&uData) != UNZ_OK) + err=UNZ_ERRNO; +/* + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.wVersion)) + err=UNZ_BADZIPFILE; +*/ + if (unzlocal_getShort(s->file,&uFlags) != UNZ_OK) + err=UNZ_ERRNO; + + if (unzlocal_getShort(s->file,&uData) != UNZ_OK) + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compression_method)) + err=UNZ_BADZIPFILE; + + if ((err==UNZ_OK) && (s->cur_file_info.compression_method!=0) && + (s->cur_file_info.compression_method!=Z_DEFLATED)) + err=UNZ_BADZIPFILE; + + if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* date/time */ + err=UNZ_ERRNO; + + if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* crc */ + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.crc) && + ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* size compr */ + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compressed_size) && + ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* size uncompr */ + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.uncompressed_size) && + ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + + if (unzlocal_getShort(s->file,&size_filename) != UNZ_OK) + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (size_filename!=s->cur_file_info.size_filename)) + err=UNZ_BADZIPFILE; + + *piSizeVar += (uInt)size_filename; + + if (unzlocal_getShort(s->file,&size_extra_field) != UNZ_OK) + err=UNZ_ERRNO; + *poffset_local_extrafield= s->cur_file_info_internal.offset_curfile + + SIZEZIPLOCALHEADER + size_filename; + *psize_local_extrafield = (uInt)size_extra_field; + + *piSizeVar += (uInt)size_extra_field; + + return err; +} + +/* + Open for reading data the current file in the zipfile. + If there is no error and the file is opened, the return value is UNZ_OK. +*/ +extern int ZEXPORT unzOpenCurrentFile (file) + unzFile file; +{ + int err=UNZ_OK; + int Store; + uInt iSizeVar; + unz_s* s; + file_in_zip_read_info_s* pfile_in_zip_read_info; + uLong offset_local_extrafield; /* offset of the local extra field */ + uInt size_local_extrafield; /* size of the local extra field */ + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + if (!s->current_file_ok) + return UNZ_PARAMERROR; + + if (s->pfile_in_zip_read != NULL) + unzCloseCurrentFile(file); + + if (unzlocal_CheckCurrentFileCoherencyHeader(s,&iSizeVar, + &offset_local_extrafield,&size_local_extrafield)!=UNZ_OK) + return UNZ_BADZIPFILE; + + pfile_in_zip_read_info = (file_in_zip_read_info_s*) + ALLOC(sizeof(file_in_zip_read_info_s)); + if (pfile_in_zip_read_info==NULL) + return UNZ_INTERNALERROR; + + pfile_in_zip_read_info->read_buffer=(char*)ALLOC(UNZ_BUFSIZE); + pfile_in_zip_read_info->offset_local_extrafield = offset_local_extrafield; + pfile_in_zip_read_info->size_local_extrafield = size_local_extrafield; + pfile_in_zip_read_info->pos_local_extrafield=0; + + if (pfile_in_zip_read_info->read_buffer==NULL) + { + TRYFREE(pfile_in_zip_read_info); + return UNZ_INTERNALERROR; + } + + pfile_in_zip_read_info->stream_initialised=0; + + if ((s->cur_file_info.compression_method!=0) && + (s->cur_file_info.compression_method!=Z_DEFLATED)) + err=UNZ_BADZIPFILE; + Store = s->cur_file_info.compression_method==0; + + pfile_in_zip_read_info->crc32_wait=s->cur_file_info.crc; + pfile_in_zip_read_info->crc32=0; + pfile_in_zip_read_info->compression_method = + s->cur_file_info.compression_method; + pfile_in_zip_read_info->file=s->file; + pfile_in_zip_read_info->byte_before_the_zipfile=s->byte_before_the_zipfile; + + pfile_in_zip_read_info->stream.total_out = 0; + + if (!Store) + { + pfile_in_zip_read_info->stream.zalloc = (alloc_func)0; + pfile_in_zip_read_info->stream.zfree = (free_func)0; + pfile_in_zip_read_info->stream.opaque = (voidpf)0; + + err=inflateInit2(&pfile_in_zip_read_info->stream, -MAX_WBITS); + if (err == Z_OK) + pfile_in_zip_read_info->stream_initialised=1; + /* windowBits is passed < 0 to tell that there is no zlib header. + * Note that in this case inflate *requires* an extra "dummy" byte + * after the compressed stream in order to complete decompression and + * return Z_STREAM_END. + * In unzip, i don't wait absolutely Z_STREAM_END because I known the + * size of both compressed and uncompressed data + */ + } + pfile_in_zip_read_info->rest_read_compressed = + s->cur_file_info.compressed_size ; + pfile_in_zip_read_info->rest_read_uncompressed = + s->cur_file_info.uncompressed_size ; + + + pfile_in_zip_read_info->pos_in_zipfile = + s->cur_file_info_internal.offset_curfile + SIZEZIPLOCALHEADER + + iSizeVar; + + pfile_in_zip_read_info->stream.avail_in = (uInt)0; + + + s->pfile_in_zip_read = pfile_in_zip_read_info; + return UNZ_OK; +} + + +/* + Read bytes from the current file. + buf contain buffer where data must be copied + len the size of buf. + + return the number of byte copied if somes bytes are copied + return 0 if the end of file was reached + return <0 with error code if there is an error + (UNZ_ERRNO for IO error, or zLib error for uncompress error) +*/ +extern int ZEXPORT unzReadCurrentFile (file, buf, len) + unzFile file; + voidp buf; + unsigned len; +{ + int err=UNZ_OK; + uInt iRead = 0; + unz_s* s; + file_in_zip_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + + if ((pfile_in_zip_read_info->read_buffer == NULL)) + return UNZ_END_OF_LIST_OF_FILE; + if (len==0) + return 0; + + pfile_in_zip_read_info->stream.next_out = (Bytef*)buf; + + pfile_in_zip_read_info->stream.avail_out = (uInt)len; + + if (len>pfile_in_zip_read_info->rest_read_uncompressed) + pfile_in_zip_read_info->stream.avail_out = + (uInt)pfile_in_zip_read_info->rest_read_uncompressed; + + while (pfile_in_zip_read_info->stream.avail_out>0) + { + if ((pfile_in_zip_read_info->stream.avail_in==0) && + (pfile_in_zip_read_info->rest_read_compressed>0)) + { + uInt uReadThis = UNZ_BUFSIZE; + if (pfile_in_zip_read_info->rest_read_compressedrest_read_compressed; + if (uReadThis == 0) + return UNZ_EOF; + if (fseek(pfile_in_zip_read_info->file, + pfile_in_zip_read_info->pos_in_zipfile + + pfile_in_zip_read_info->byte_before_the_zipfile,SEEK_SET)!=0) + return UNZ_ERRNO; + if (fread(pfile_in_zip_read_info->read_buffer,uReadThis,1, + pfile_in_zip_read_info->file)!=1) + return UNZ_ERRNO; + pfile_in_zip_read_info->pos_in_zipfile += uReadThis; + + pfile_in_zip_read_info->rest_read_compressed-=uReadThis; + + pfile_in_zip_read_info->stream.next_in = + (Bytef*)pfile_in_zip_read_info->read_buffer; + pfile_in_zip_read_info->stream.avail_in = (uInt)uReadThis; + } + + if (pfile_in_zip_read_info->compression_method==0) + { + uInt uDoCopy,i ; + if (pfile_in_zip_read_info->stream.avail_out < + pfile_in_zip_read_info->stream.avail_in) + uDoCopy = pfile_in_zip_read_info->stream.avail_out ; + else + uDoCopy = pfile_in_zip_read_info->stream.avail_in ; + + for (i=0;istream.next_out+i) = + *(pfile_in_zip_read_info->stream.next_in+i); + + pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32, + pfile_in_zip_read_info->stream.next_out, + uDoCopy); + pfile_in_zip_read_info->rest_read_uncompressed-=uDoCopy; + pfile_in_zip_read_info->stream.avail_in -= uDoCopy; + pfile_in_zip_read_info->stream.avail_out -= uDoCopy; + pfile_in_zip_read_info->stream.next_out += uDoCopy; + pfile_in_zip_read_info->stream.next_in += uDoCopy; + pfile_in_zip_read_info->stream.total_out += uDoCopy; + iRead += uDoCopy; + } + else + { + uLong uTotalOutBefore,uTotalOutAfter; + const Bytef *bufBefore; + uLong uOutThis; + int flush=Z_SYNC_FLUSH; + + uTotalOutBefore = pfile_in_zip_read_info->stream.total_out; + bufBefore = pfile_in_zip_read_info->stream.next_out; + + /* + if ((pfile_in_zip_read_info->rest_read_uncompressed == + pfile_in_zip_read_info->stream.avail_out) && + (pfile_in_zip_read_info->rest_read_compressed == 0)) + flush = Z_FINISH; + */ + err=inflate(&pfile_in_zip_read_info->stream,flush); + + uTotalOutAfter = pfile_in_zip_read_info->stream.total_out; + uOutThis = uTotalOutAfter-uTotalOutBefore; + + pfile_in_zip_read_info->crc32 = + crc32(pfile_in_zip_read_info->crc32,bufBefore, + (uInt)(uOutThis)); + + pfile_in_zip_read_info->rest_read_uncompressed -= + uOutThis; + + iRead += (uInt)(uTotalOutAfter - uTotalOutBefore); + + if (err==Z_STREAM_END) + return (iRead==0) ? UNZ_EOF : iRead; + if (err!=Z_OK) + break; + } + } + + if (err==Z_OK) + return iRead; + return err; +} + + +/* + Give the current position in uncompressed data +*/ +extern z_off_t ZEXPORT unztell (file) + unzFile file; +{ + unz_s* s; + file_in_zip_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + return (z_off_t)pfile_in_zip_read_info->stream.total_out; +} + + +/* + return 1 if the end of file was reached, 0 elsewhere +*/ +extern int ZEXPORT unzeof (file) + unzFile file; +{ + unz_s* s; + file_in_zip_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + if (pfile_in_zip_read_info->rest_read_uncompressed == 0) + return 1; + else + return 0; +} + + + +/* + Read extra field from the current file (opened by unzOpenCurrentFile) + This is the local-header version of the extra field (sometimes, there is + more info in the local-header version than in the central-header) + + if buf==NULL, it return the size of the local extra field that can be read + + if buf!=NULL, len is the size of the buffer, the extra header is copied in + buf. + the return value is the number of bytes copied in buf, or (if <0) + the error code +*/ +extern int ZEXPORT unzGetLocalExtrafield (file,buf,len) + unzFile file; + voidp buf; + unsigned len; +{ + unz_s* s; + file_in_zip_read_info_s* pfile_in_zip_read_info; + uInt read_now; + uLong size_to_read; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + size_to_read = (pfile_in_zip_read_info->size_local_extrafield - + pfile_in_zip_read_info->pos_local_extrafield); + + if (buf==NULL) + return (int)size_to_read; + + if (len>size_to_read) + read_now = (uInt)size_to_read; + else + read_now = (uInt)len ; + + if (read_now==0) + return 0; + + if (fseek(pfile_in_zip_read_info->file, + pfile_in_zip_read_info->offset_local_extrafield + + pfile_in_zip_read_info->pos_local_extrafield,SEEK_SET)!=0) + return UNZ_ERRNO; + + if (fread(buf,(uInt)size_to_read,1,pfile_in_zip_read_info->file)!=1) + return UNZ_ERRNO; + + return (int)read_now; +} + +/* + Close the file in zip opened with unzipOpenCurrentFile + Return UNZ_CRCERROR if all the file was read but the CRC is not good +*/ +extern int ZEXPORT unzCloseCurrentFile (file) + unzFile file; +{ + int err=UNZ_OK; + + unz_s* s; + file_in_zip_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + + if (pfile_in_zip_read_info->rest_read_uncompressed == 0) + { + if (pfile_in_zip_read_info->crc32 != pfile_in_zip_read_info->crc32_wait) + err=UNZ_CRCERROR; + } + + + TRYFREE(pfile_in_zip_read_info->read_buffer); + pfile_in_zip_read_info->read_buffer = NULL; + if (pfile_in_zip_read_info->stream_initialised) + inflateEnd(&pfile_in_zip_read_info->stream); + + pfile_in_zip_read_info->stream_initialised = 0; + TRYFREE(pfile_in_zip_read_info); + + s->pfile_in_zip_read=NULL; + + return err; +} + + +/* + Get the global comment string of the ZipFile, in the szComment buffer. + uSizeBuf is the size of the szComment buffer. + return the number of byte copied or an error code <0 +*/ +extern int ZEXPORT unzGetGlobalComment (file, szComment, uSizeBuf) + unzFile file; + char *szComment; + uLong uSizeBuf; +{ + int err=UNZ_OK; + unz_s* s; + uLong uReadThis ; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz_s*)file; + + uReadThis = uSizeBuf; + if (uReadThis>s->gi.size_comment) + uReadThis = s->gi.size_comment; + + if (fseek(s->file,s->central_pos+22,SEEK_SET)!=0) + return UNZ_ERRNO; + + if (uReadThis>0) + { + *szComment='\0'; + if (fread(szComment,(uInt)uReadThis,1,s->file)!=1) + return UNZ_ERRNO; + } + + if ((szComment != NULL) && (uSizeBuf > s->gi.size_comment)) + *(szComment+s->gi.size_comment)='\0'; + return (int)uReadThis; +} diff --git a/zlib/contrib/minizip/unzip.def b/zlib/contrib/minizip/unzip.def new file mode 100644 index 0000000..f6ede89 --- /dev/null +++ b/zlib/contrib/minizip/unzip.def @@ -0,0 +1,15 @@ + unzOpen @61 + unzClose @62 + unzGetGlobalInfo @63 + unzGetCurrentFileInfo @64 + unzGoToFirstFile @65 + unzGoToNextFile @66 + unzOpenCurrentFile @67 + unzReadCurrentFile @68 + unztell @70 + unzeof @71 + unzCloseCurrentFile @72 + unzGetGlobalComment @73 + unzStringFileNameCompare @74 + unzLocateFile @75 + unzGetLocalExtrafield @76 diff --git a/zlib/contrib/minizip/unzip.h b/zlib/contrib/minizip/unzip.h new file mode 100644 index 0000000..76692cb --- /dev/null +++ b/zlib/contrib/minizip/unzip.h @@ -0,0 +1,275 @@ +/* unzip.h -- IO for uncompress .zip files using zlib + Version 0.15 beta, Mar 19th, 1998, + + Copyright (C) 1998 Gilles Vollant + + This unzip package allow extract file from .ZIP file, compatible with PKZip 2.04g + WinZip, InfoZip tools and compatible. + Encryption and multi volume ZipFile (span) are not supported. + Old compressions used by old PKZip 1.x are not supported + + THIS IS AN ALPHA VERSION. AT THIS STAGE OF DEVELOPPEMENT, SOMES API OR STRUCTURE + CAN CHANGE IN FUTURE VERSION !! + I WAIT FEEDBACK at mail info@winimage.com + Visit also http://www.winimage.com/zLibDll/unzip.htm for evolution + + Condition of use and distribution are the same than zlib : + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + +*/ +/* for more info about .ZIP format, see + ftp://ftp.cdrom.com/pub/infozip/doc/appnote-970311-iz.zip + PkWare has also a specification at : + ftp://ftp.pkware.com/probdesc.zip */ + +#ifndef _unz_H +#define _unz_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef _ZLIB_H +#include "zlib.h" +#endif + +#if defined(STRICTUNZIP) || defined(STRICTZIPUNZIP) +/* like the STRICT of WIN32, we define a pointer that cannot be converted + from (void*) without cast */ +typedef struct TagunzFile__ { int unused; } unzFile__; +typedef unzFile__ *unzFile; +#else +typedef voidp unzFile; +#endif + + +#define UNZ_OK (0) +#define UNZ_END_OF_LIST_OF_FILE (-100) +#define UNZ_ERRNO (Z_ERRNO) +#define UNZ_EOF (0) +#define UNZ_PARAMERROR (-102) +#define UNZ_BADZIPFILE (-103) +#define UNZ_INTERNALERROR (-104) +#define UNZ_CRCERROR (-105) + +/* tm_unz contain date/time info */ +typedef struct tm_unz_s +{ + uInt tm_sec; /* seconds after the minute - [0,59] */ + uInt tm_min; /* minutes after the hour - [0,59] */ + uInt tm_hour; /* hours since midnight - [0,23] */ + uInt tm_mday; /* day of the month - [1,31] */ + uInt tm_mon; /* months since January - [0,11] */ + uInt tm_year; /* years - [1980..2044] */ +} tm_unz; + +/* unz_global_info structure contain global data about the ZIPfile + These data comes from the end of central dir */ +typedef struct unz_global_info_s +{ + uLong number_entry; /* total number of entries in + the central dir on this disk */ + uLong size_comment; /* size of the global comment of the zipfile */ +} unz_global_info; + + +/* unz_file_info contain information about a file in the zipfile */ +typedef struct unz_file_info_s +{ + uLong version; /* version made by 2 bytes */ + uLong version_needed; /* version needed to extract 2 bytes */ + uLong flag; /* general purpose bit flag 2 bytes */ + uLong compression_method; /* compression method 2 bytes */ + uLong dosDate; /* last mod file date in Dos fmt 4 bytes */ + uLong crc; /* crc-32 4 bytes */ + uLong compressed_size; /* compressed size 4 bytes */ + uLong uncompressed_size; /* uncompressed size 4 bytes */ + uLong size_filename; /* filename length 2 bytes */ + uLong size_file_extra; /* extra field length 2 bytes */ + uLong size_file_comment; /* file comment length 2 bytes */ + + uLong disk_num_start; /* disk number start 2 bytes */ + uLong internal_fa; /* internal file attributes 2 bytes */ + uLong external_fa; /* external file attributes 4 bytes */ + + tm_unz tmu_date; +} unz_file_info; + +extern int ZEXPORT unzStringFileNameCompare OF ((const char* fileName1, + const char* fileName2, + int iCaseSensitivity)); +/* + Compare two filename (fileName1,fileName2). + If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp) + If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi + or strcasecmp) + If iCaseSenisivity = 0, case sensitivity is defaut of your operating system + (like 1 on Unix, 2 on Windows) +*/ + + +extern unzFile ZEXPORT unzOpen OF((const char *path)); +/* + Open a Zip file. path contain the full pathname (by example, + on a Windows NT computer "c:\\zlib\\zlib111.zip" or on an Unix computer + "zlib/zlib111.zip". + If the zipfile cannot be opened (file don't exist or in not valid), the + return value is NULL. + Else, the return value is a unzFile Handle, usable with other function + of this unzip package. +*/ + +extern int ZEXPORT unzClose OF((unzFile file)); +/* + Close a ZipFile opened with unzipOpen. + If there is files inside the .Zip opened with unzOpenCurrentFile (see later), + these files MUST be closed with unzipCloseCurrentFile before call unzipClose. + return UNZ_OK if there is no problem. */ + +extern int ZEXPORT unzGetGlobalInfo OF((unzFile file, + unz_global_info *pglobal_info)); +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. */ + + +extern int ZEXPORT unzGetGlobalComment OF((unzFile file, + char *szComment, + uLong uSizeBuf)); +/* + Get the global comment string of the ZipFile, in the szComment buffer. + uSizeBuf is the size of the szComment buffer. + return the number of byte copied or an error code <0 +*/ + + +/***************************************************************************/ +/* Unzip package allow you browse the directory of the zipfile */ + +extern int ZEXPORT unzGoToFirstFile OF((unzFile file)); +/* + Set the current file of the zipfile to the first file. + return UNZ_OK if there is no problem +*/ + +extern int ZEXPORT unzGoToNextFile OF((unzFile file)); +/* + Set the current file of the zipfile to the next file. + return UNZ_OK if there is no problem + return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest. +*/ + +extern int ZEXPORT unzLocateFile OF((unzFile file, + const char *szFileName, + int iCaseSensitivity)); +/* + Try locate the file szFileName in the zipfile. + For the iCaseSensitivity signification, see unzStringFileNameCompare + + return value : + UNZ_OK if the file is found. It becomes the current file. + UNZ_END_OF_LIST_OF_FILE if the file is not found +*/ + + +extern int ZEXPORT unzGetCurrentFileInfo OF((unzFile file, + unz_file_info *pfile_info, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); +/* + Get Info about the current file + if pfile_info!=NULL, the *pfile_info structure will contain somes info about + the current file + if szFileName!=NULL, the filemane string will be copied in szFileName + (fileNameBufferSize is the size of the buffer) + if extraField!=NULL, the extra field information will be copied in extraField + (extraFieldBufferSize is the size of the buffer). + This is the Central-header version of the extra field + if szComment!=NULL, the comment string of the file will be copied in szComment + (commentBufferSize is the size of the buffer) +*/ + +/***************************************************************************/ +/* for reading the content of the current zipfile, you can open it, read data + from it, and close it (you can close it before reading all the file) + */ + +extern int ZEXPORT unzOpenCurrentFile OF((unzFile file)); +/* + Open for reading data the current file in the zipfile. + If there is no error, the return value is UNZ_OK. +*/ + +extern int ZEXPORT unzCloseCurrentFile OF((unzFile file)); +/* + Close the file in zip opened with unzOpenCurrentFile + Return UNZ_CRCERROR if all the file was read but the CRC is not good +*/ + + +extern int ZEXPORT unzReadCurrentFile OF((unzFile file, + voidp buf, + unsigned len)); +/* + Read bytes from the current file (opened by unzOpenCurrentFile) + buf contain buffer where data must be copied + len the size of buf. + + return the number of byte copied if somes bytes are copied + return 0 if the end of file was reached + return <0 with error code if there is an error + (UNZ_ERRNO for IO error, or zLib error for uncompress error) +*/ + +extern z_off_t ZEXPORT unztell OF((unzFile file)); +/* + Give the current position in uncompressed data +*/ + +extern int ZEXPORT unzeof OF((unzFile file)); +/* + return 1 if the end of file was reached, 0 elsewhere +*/ + +extern int ZEXPORT unzGetLocalExtrafield OF((unzFile file, + voidp buf, + unsigned len)); +/* + Read extra field from the current file (opened by unzOpenCurrentFile) + This is the local-header version of the extra field (sometimes, there is + more info in the local-header version than in the central-header) + + if buf==NULL, it return the size of the local extra field + + if buf!=NULL, len is the size of the buffer, the extra header is copied in + buf. + the return value is the number of bytes copied in buf, or (if <0) + the error code +*/ + +#ifdef __cplusplus +} +#endif + +#endif /* _unz_H */ diff --git a/zlib/contrib/minizip/zip.c b/zlib/contrib/minizip/zip.c new file mode 100644 index 0000000..0cae64a --- /dev/null +++ b/zlib/contrib/minizip/zip.c @@ -0,0 +1,718 @@ +/* zip.c -- IO on .zip files using zlib + Version 0.15 beta, Mar 19th, 1998, + + Read zip.h for more info +*/ + + +#include +#include +#include +#include "zlib.h" +#include "zip.h" + +#ifdef STDC +# include +# include +# include +#endif +#ifdef NO_ERRNO_H + extern int errno; +#else +# include +#endif + + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + +#ifndef VERSIONMADEBY +# define VERSIONMADEBY (0x0) /* platform depedent */ +#endif + +#ifndef Z_BUFSIZE +#define Z_BUFSIZE (16384) +#endif + +#ifndef Z_MAXFILENAMEINZIP +#define Z_MAXFILENAMEINZIP (256) +#endif + +#ifndef ALLOC +# define ALLOC(size) (malloc(size)) +#endif +#ifndef TRYFREE +# define TRYFREE(p) {if (p) free(p);} +#endif + +/* +#define SIZECENTRALDIRITEM (0x2e) +#define SIZEZIPLOCALHEADER (0x1e) +*/ + +/* I've found an old Unix (a SunOS 4.1.3_U1) without all SEEK_* defined.... */ + +#ifndef SEEK_CUR +#define SEEK_CUR 1 +#endif + +#ifndef SEEK_END +#define SEEK_END 2 +#endif + +#ifndef SEEK_SET +#define SEEK_SET 0 +#endif + +const char zip_copyright[] = + " zip 0.15 Copyright 1998 Gilles Vollant "; + + +#define SIZEDATA_INDATABLOCK (4096-(4*4)) + +#define LOCALHEADERMAGIC (0x04034b50) +#define CENTRALHEADERMAGIC (0x02014b50) +#define ENDHEADERMAGIC (0x06054b50) + +#define FLAG_LOCALHEADER_OFFSET (0x06) +#define CRC_LOCALHEADER_OFFSET (0x0e) + +#define SIZECENTRALHEADER (0x2e) /* 46 */ + +typedef struct linkedlist_datablock_internal_s +{ + struct linkedlist_datablock_internal_s* next_datablock; + uLong avail_in_this_block; + uLong filled_in_this_block; + uLong unused; /* for future use and alignement */ + unsigned char data[SIZEDATA_INDATABLOCK]; +} linkedlist_datablock_internal; + +typedef struct linkedlist_data_s +{ + linkedlist_datablock_internal* first_block; + linkedlist_datablock_internal* last_block; +} linkedlist_data; + + +typedef struct +{ + z_stream stream; /* zLib stream structure for inflate */ + int stream_initialised; /* 1 is stream is initialised */ + uInt pos_in_buffered_data; /* last written byte in buffered_data */ + + uLong pos_local_header; /* offset of the local header of the file + currenty writing */ + char* central_header; /* central header data for the current file */ + uLong size_centralheader; /* size of the central header for cur file */ + uLong flag; /* flag of the file currently writing */ + + int method; /* compression method of file currenty wr.*/ + Byte buffered_data[Z_BUFSIZE];/* buffer contain compressed data to be writ*/ + uLong dosDate; + uLong crc32; +} curfile_info; + +typedef struct +{ + FILE * filezip; + linkedlist_data central_dir;/* datablock with central dir in construction*/ + int in_opened_file_inzip; /* 1 if a file in the zip is currently writ.*/ + curfile_info ci; /* info on the file curretly writing */ + + uLong begin_pos; /* position of the beginning of the zipfile */ + uLong number_entry; +} zip_internal; + +local linkedlist_datablock_internal* allocate_new_datablock() +{ + linkedlist_datablock_internal* ldi; + ldi = (linkedlist_datablock_internal*) + ALLOC(sizeof(linkedlist_datablock_internal)); + if (ldi!=NULL) + { + ldi->next_datablock = NULL ; + ldi->filled_in_this_block = 0 ; + ldi->avail_in_this_block = SIZEDATA_INDATABLOCK ; + } + return ldi; +} + +local void free_datablock(ldi) + linkedlist_datablock_internal* ldi; +{ + while (ldi!=NULL) + { + linkedlist_datablock_internal* ldinext = ldi->next_datablock; + TRYFREE(ldi); + ldi = ldinext; + } +} + +local void init_linkedlist(ll) + linkedlist_data* ll; +{ + ll->first_block = ll->last_block = NULL; +} + +local void free_linkedlist(ll) + linkedlist_data* ll; +{ + free_datablock(ll->first_block); + ll->first_block = ll->last_block = NULL; +} + + +local int add_data_in_datablock(ll,buf,len) + linkedlist_data* ll; + const void* buf; + uLong len; +{ + linkedlist_datablock_internal* ldi; + const unsigned char* from_copy; + + if (ll==NULL) + return ZIP_INTERNALERROR; + + if (ll->last_block == NULL) + { + ll->first_block = ll->last_block = allocate_new_datablock(); + if (ll->first_block == NULL) + return ZIP_INTERNALERROR; + } + + ldi = ll->last_block; + from_copy = (unsigned char*)buf; + + while (len>0) + { + uInt copy_this; + uInt i; + unsigned char* to_copy; + + if (ldi->avail_in_this_block==0) + { + ldi->next_datablock = allocate_new_datablock(); + if (ldi->next_datablock == NULL) + return ZIP_INTERNALERROR; + ldi = ldi->next_datablock ; + ll->last_block = ldi; + } + + if (ldi->avail_in_this_block < len) + copy_this = (uInt)ldi->avail_in_this_block; + else + copy_this = (uInt)len; + + to_copy = &(ldi->data[ldi->filled_in_this_block]); + + for (i=0;ifilled_in_this_block += copy_this; + ldi->avail_in_this_block -= copy_this; + from_copy += copy_this ; + len -= copy_this; + } + return ZIP_OK; +} + + +local int write_datablock(fout,ll) + FILE * fout; + linkedlist_data* ll; +{ + linkedlist_datablock_internal* ldi; + ldi = ll->first_block; + while (ldi!=NULL) + { + if (ldi->filled_in_this_block > 0) + if (fwrite(ldi->data,(uInt)ldi->filled_in_this_block,1,fout)!=1) + return ZIP_ERRNO; + ldi = ldi->next_datablock; + } + return ZIP_OK; +} + +/****************************************************************************/ + +/* =========================================================================== + Outputs a long in LSB order to the given file + nbByte == 1, 2 or 4 (byte, short or long) +*/ + +local int ziplocal_putValue OF((FILE *file, uLong x, int nbByte)); +local int ziplocal_putValue (file, x, nbByte) + FILE *file; + uLong x; + int nbByte; +{ + unsigned char buf[4]; + int n; + for (n = 0; n < nbByte; n++) { + buf[n] = (unsigned char)(x & 0xff); + x >>= 8; + } + if (fwrite(buf,nbByte,1,file)!=1) + return ZIP_ERRNO; + else + return ZIP_OK; +} + +local void ziplocal_putValue_inmemory OF((void* dest, uLong x, int nbByte)); +local void ziplocal_putValue_inmemory (dest, x, nbByte) + void* dest; + uLong x; + int nbByte; +{ + unsigned char* buf=(unsigned char*)dest; + int n; + for (n = 0; n < nbByte; n++) { + buf[n] = (unsigned char)(x & 0xff); + x >>= 8; + } +} +/****************************************************************************/ + + +local uLong ziplocal_TmzDateToDosDate(ptm,dosDate) + tm_zip* ptm; + uLong dosDate; +{ + uLong year = (uLong)ptm->tm_year; + if (year>1980) + year-=1980; + else if (year>80) + year-=80; + return + (uLong) (((ptm->tm_mday) + (32 * (ptm->tm_mon+1)) + (512 * year)) << 16) | + ((ptm->tm_sec/2) + (32* ptm->tm_min) + (2048 * (uLong)ptm->tm_hour)); +} + + +/****************************************************************************/ + +extern zipFile ZEXPORT zipOpen (pathname, append) + const char *pathname; + int append; +{ + zip_internal ziinit; + zip_internal* zi; + + ziinit.filezip = fopen(pathname,(append == 0) ? "wb" : "ab"); + if (ziinit.filezip == NULL) + return NULL; + ziinit.begin_pos = ftell(ziinit.filezip); + ziinit.in_opened_file_inzip = 0; + ziinit.ci.stream_initialised = 0; + ziinit.number_entry = 0; + init_linkedlist(&(ziinit.central_dir)); + + + zi = (zip_internal*)ALLOC(sizeof(zip_internal)); + if (zi==NULL) + { + fclose(ziinit.filezip); + return NULL; + } + + *zi = ziinit; + return (zipFile)zi; +} + +extern int ZEXPORT zipOpenNewFileInZip (file, filename, zipfi, + extrafield_local, size_extrafield_local, + extrafield_global, size_extrafield_global, + comment, method, level) + zipFile file; + const char* filename; + const zip_fileinfo* zipfi; + const void* extrafield_local; + uInt size_extrafield_local; + const void* extrafield_global; + uInt size_extrafield_global; + const char* comment; + int method; + int level; +{ + zip_internal* zi; + uInt size_filename; + uInt size_comment; + uInt i; + int err = ZIP_OK; + + if (file == NULL) + return ZIP_PARAMERROR; + if ((method!=0) && (method!=Z_DEFLATED)) + return ZIP_PARAMERROR; + + zi = (zip_internal*)file; + + if (zi->in_opened_file_inzip == 1) + { + err = zipCloseFileInZip (file); + if (err != ZIP_OK) + return err; + } + + + if (filename==NULL) + filename="-"; + + if (comment==NULL) + size_comment = 0; + else + size_comment = strlen(comment); + + size_filename = strlen(filename); + + if (zipfi == NULL) + zi->ci.dosDate = 0; + else + { + if (zipfi->dosDate != 0) + zi->ci.dosDate = zipfi->dosDate; + else zi->ci.dosDate = ziplocal_TmzDateToDosDate(&zipfi->tmz_date,zipfi->dosDate); + } + + zi->ci.flag = 0; + if ((level==8) || (level==9)) + zi->ci.flag |= 2; + if ((level==2)) + zi->ci.flag |= 4; + if ((level==1)) + zi->ci.flag |= 6; + + zi->ci.crc32 = 0; + zi->ci.method = method; + zi->ci.stream_initialised = 0; + zi->ci.pos_in_buffered_data = 0; + zi->ci.pos_local_header = ftell(zi->filezip); + zi->ci.size_centralheader = SIZECENTRALHEADER + size_filename + + size_extrafield_global + size_comment; + zi->ci.central_header = (char*)ALLOC((uInt)zi->ci.size_centralheader); + + ziplocal_putValue_inmemory(zi->ci.central_header,(uLong)CENTRALHEADERMAGIC,4); + /* version info */ + ziplocal_putValue_inmemory(zi->ci.central_header+4,(uLong)VERSIONMADEBY,2); + ziplocal_putValue_inmemory(zi->ci.central_header+6,(uLong)20,2); + ziplocal_putValue_inmemory(zi->ci.central_header+8,(uLong)zi->ci.flag,2); + ziplocal_putValue_inmemory(zi->ci.central_header+10,(uLong)zi->ci.method,2); + ziplocal_putValue_inmemory(zi->ci.central_header+12,(uLong)zi->ci.dosDate,4); + ziplocal_putValue_inmemory(zi->ci.central_header+16,(uLong)0,4); /*crc*/ + ziplocal_putValue_inmemory(zi->ci.central_header+20,(uLong)0,4); /*compr size*/ + ziplocal_putValue_inmemory(zi->ci.central_header+24,(uLong)0,4); /*uncompr size*/ + ziplocal_putValue_inmemory(zi->ci.central_header+28,(uLong)size_filename,2); + ziplocal_putValue_inmemory(zi->ci.central_header+30,(uLong)size_extrafield_global,2); + ziplocal_putValue_inmemory(zi->ci.central_header+32,(uLong)size_comment,2); + ziplocal_putValue_inmemory(zi->ci.central_header+34,(uLong)0,2); /*disk nm start*/ + + if (zipfi==NULL) + ziplocal_putValue_inmemory(zi->ci.central_header+36,(uLong)0,2); + else + ziplocal_putValue_inmemory(zi->ci.central_header+36,(uLong)zipfi->internal_fa,2); + + if (zipfi==NULL) + ziplocal_putValue_inmemory(zi->ci.central_header+38,(uLong)0,4); + else + ziplocal_putValue_inmemory(zi->ci.central_header+38,(uLong)zipfi->external_fa,4); + + ziplocal_putValue_inmemory(zi->ci.central_header+42,(uLong)zi->ci.pos_local_header,4); + + for (i=0;ici.central_header+SIZECENTRALHEADER+i) = *(filename+i); + + for (i=0;ici.central_header+SIZECENTRALHEADER+size_filename+i) = + *(((const char*)extrafield_global)+i); + + for (i=0;ici.central_header+SIZECENTRALHEADER+size_filename+ + size_extrafield_global+i) = *(filename+i); + if (zi->ci.central_header == NULL) + return ZIP_INTERNALERROR; + + /* write the local header */ + err = ziplocal_putValue(zi->filezip,(uLong)LOCALHEADERMAGIC,4); + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)20,2);/* version needed to extract */ + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.flag,2); + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.method,2); + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.dosDate,4); + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)0,4); /* crc 32, unknown */ + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)0,4); /* compressed size, unknown */ + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)0,4); /* uncompressed size, unknown */ + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)size_filename,2); + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)size_extrafield_local,2); + + if ((err==ZIP_OK) && (size_filename>0)) + if (fwrite(filename,(uInt)size_filename,1,zi->filezip)!=1) + err = ZIP_ERRNO; + + if ((err==ZIP_OK) && (size_extrafield_local>0)) + if (fwrite(extrafield_local,(uInt)size_extrafield_local,1,zi->filezip) + !=1) + err = ZIP_ERRNO; + + zi->ci.stream.avail_in = (uInt)0; + zi->ci.stream.avail_out = (uInt)Z_BUFSIZE; + zi->ci.stream.next_out = zi->ci.buffered_data; + zi->ci.stream.total_in = 0; + zi->ci.stream.total_out = 0; + + if ((err==ZIP_OK) && (zi->ci.method == Z_DEFLATED)) + { + zi->ci.stream.zalloc = (alloc_func)0; + zi->ci.stream.zfree = (free_func)0; + zi->ci.stream.opaque = (voidpf)0; + + err = deflateInit2(&zi->ci.stream, level, + Z_DEFLATED, -MAX_WBITS, DEF_MEM_LEVEL, 0); + + if (err==Z_OK) + zi->ci.stream_initialised = 1; + } + + + if (err==Z_OK) + zi->in_opened_file_inzip = 1; + return err; +} + +extern int ZEXPORT zipWriteInFileInZip (file, buf, len) + zipFile file; + const voidp buf; + unsigned len; +{ + zip_internal* zi; + int err=ZIP_OK; + + if (file == NULL) + return ZIP_PARAMERROR; + zi = (zip_internal*)file; + + if (zi->in_opened_file_inzip == 0) + return ZIP_PARAMERROR; + + zi->ci.stream.next_in = buf; + zi->ci.stream.avail_in = len; + zi->ci.crc32 = crc32(zi->ci.crc32,buf,len); + + while ((err==ZIP_OK) && (zi->ci.stream.avail_in>0)) + { + if (zi->ci.stream.avail_out == 0) + { + if (fwrite(zi->ci.buffered_data,(uInt)zi->ci.pos_in_buffered_data,1,zi->filezip) + !=1) + err = ZIP_ERRNO; + zi->ci.pos_in_buffered_data = 0; + zi->ci.stream.avail_out = (uInt)Z_BUFSIZE; + zi->ci.stream.next_out = zi->ci.buffered_data; + } + + if (zi->ci.method == Z_DEFLATED) + { + uLong uTotalOutBefore = zi->ci.stream.total_out; + err=deflate(&zi->ci.stream, Z_NO_FLUSH); + zi->ci.pos_in_buffered_data += (uInt)(zi->ci.stream.total_out - uTotalOutBefore) ; + + } + else + { + uInt copy_this,i; + if (zi->ci.stream.avail_in < zi->ci.stream.avail_out) + copy_this = zi->ci.stream.avail_in; + else + copy_this = zi->ci.stream.avail_out; + for (i=0;ici.stream.next_out)+i) = + *(((const char*)zi->ci.stream.next_in)+i); + { + zi->ci.stream.avail_in -= copy_this; + zi->ci.stream.avail_out-= copy_this; + zi->ci.stream.next_in+= copy_this; + zi->ci.stream.next_out+= copy_this; + zi->ci.stream.total_in+= copy_this; + zi->ci.stream.total_out+= copy_this; + zi->ci.pos_in_buffered_data += copy_this; + } + } + } + + return 0; +} + +extern int ZEXPORT zipCloseFileInZip (file) + zipFile file; +{ + zip_internal* zi; + int err=ZIP_OK; + + if (file == NULL) + return ZIP_PARAMERROR; + zi = (zip_internal*)file; + + if (zi->in_opened_file_inzip == 0) + return ZIP_PARAMERROR; + zi->ci.stream.avail_in = 0; + + if (zi->ci.method == Z_DEFLATED) + while (err==ZIP_OK) + { + uLong uTotalOutBefore; + if (zi->ci.stream.avail_out == 0) + { + if (fwrite(zi->ci.buffered_data,(uInt)zi->ci.pos_in_buffered_data,1,zi->filezip) + !=1) + err = ZIP_ERRNO; + zi->ci.pos_in_buffered_data = 0; + zi->ci.stream.avail_out = (uInt)Z_BUFSIZE; + zi->ci.stream.next_out = zi->ci.buffered_data; + } + uTotalOutBefore = zi->ci.stream.total_out; + err=deflate(&zi->ci.stream, Z_FINISH); + zi->ci.pos_in_buffered_data += (uInt)(zi->ci.stream.total_out - uTotalOutBefore) ; + } + + if (err==Z_STREAM_END) + err=ZIP_OK; /* this is normal */ + + if ((zi->ci.pos_in_buffered_data>0) && (err==ZIP_OK)) + if (fwrite(zi->ci.buffered_data,(uInt)zi->ci.pos_in_buffered_data,1,zi->filezip) + !=1) + err = ZIP_ERRNO; + + if ((zi->ci.method == Z_DEFLATED) && (err==ZIP_OK)) + { + err=deflateEnd(&zi->ci.stream); + zi->ci.stream_initialised = 0; + } + + ziplocal_putValue_inmemory(zi->ci.central_header+16,(uLong)zi->ci.crc32,4); /*crc*/ + ziplocal_putValue_inmemory(zi->ci.central_header+20, + (uLong)zi->ci.stream.total_out,4); /*compr size*/ + ziplocal_putValue_inmemory(zi->ci.central_header+24, + (uLong)zi->ci.stream.total_in,4); /*uncompr size*/ + + if (err==ZIP_OK) + err = add_data_in_datablock(&zi->central_dir,zi->ci.central_header, + (uLong)zi->ci.size_centralheader); + free(zi->ci.central_header); + + if (err==ZIP_OK) + { + long cur_pos_inzip = ftell(zi->filezip); + if (fseek(zi->filezip, + zi->ci.pos_local_header + 14,SEEK_SET)!=0) + err = ZIP_ERRNO; + + if (err==ZIP_OK) + err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.crc32,4); /* crc 32, unknown */ + + if (err==ZIP_OK) /* compressed size, unknown */ + err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.stream.total_out,4); + + if (err==ZIP_OK) /* uncompressed size, unknown */ + err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.stream.total_in,4); + + if (fseek(zi->filezip, + cur_pos_inzip,SEEK_SET)!=0) + err = ZIP_ERRNO; + } + + zi->number_entry ++; + zi->in_opened_file_inzip = 0; + + return err; +} + +extern int ZEXPORT zipClose (file, global_comment) + zipFile file; + const char* global_comment; +{ + zip_internal* zi; + int err = 0; + uLong size_centraldir = 0; + uLong centraldir_pos_inzip ; + uInt size_global_comment; + if (file == NULL) + return ZIP_PARAMERROR; + zi = (zip_internal*)file; + + if (zi->in_opened_file_inzip == 1) + { + err = zipCloseFileInZip (file); + } + + if (global_comment==NULL) + size_global_comment = 0; + else + size_global_comment = strlen(global_comment); + + + centraldir_pos_inzip = ftell(zi->filezip); + if (err==ZIP_OK) + { + linkedlist_datablock_internal* ldi = zi->central_dir.first_block ; + while (ldi!=NULL) + { + if ((err==ZIP_OK) && (ldi->filled_in_this_block>0)) + if (fwrite(ldi->data,(uInt)ldi->filled_in_this_block, + 1,zi->filezip) !=1 ) + err = ZIP_ERRNO; + + size_centraldir += ldi->filled_in_this_block; + ldi = ldi->next_datablock; + } + } + free_datablock(zi->central_dir.first_block); + + if (err==ZIP_OK) /* Magic End */ + err = ziplocal_putValue(zi->filezip,(uLong)ENDHEADERMAGIC,4); + + if (err==ZIP_OK) /* number of this disk */ + err = ziplocal_putValue(zi->filezip,(uLong)0,2); + + if (err==ZIP_OK) /* number of the disk with the start of the central directory */ + err = ziplocal_putValue(zi->filezip,(uLong)0,2); + + if (err==ZIP_OK) /* total number of entries in the central dir on this disk */ + err = ziplocal_putValue(zi->filezip,(uLong)zi->number_entry,2); + + if (err==ZIP_OK) /* total number of entries in the central dir */ + err = ziplocal_putValue(zi->filezip,(uLong)zi->number_entry,2); + + if (err==ZIP_OK) /* size of the central directory */ + err = ziplocal_putValue(zi->filezip,(uLong)size_centraldir,4); + + if (err==ZIP_OK) /* offset of start of central directory with respect to the + starting disk number */ + err = ziplocal_putValue(zi->filezip,(uLong)centraldir_pos_inzip ,4); + + if (err==ZIP_OK) /* zipfile comment length */ + err = ziplocal_putValue(zi->filezip,(uLong)size_global_comment,2); + + if ((err==ZIP_OK) && (size_global_comment>0)) + if (fwrite(global_comment,(uInt)size_global_comment,1,zi->filezip) !=1 ) + err = ZIP_ERRNO; + fclose(zi->filezip); + TRYFREE(zi); + + return err; +} diff --git a/zlib/contrib/minizip/zip.def b/zlib/contrib/minizip/zip.def new file mode 100644 index 0000000..5d5079f --- /dev/null +++ b/zlib/contrib/minizip/zip.def @@ -0,0 +1,5 @@ + zipOpen @80 + zipOpenNewFileInZip @81 + zipWriteInFileInZip @82 + zipCloseFileInZip @83 + zipClose @84 diff --git a/zlib/contrib/minizip/zip.h b/zlib/contrib/minizip/zip.h new file mode 100644 index 0000000..678260b --- /dev/null +++ b/zlib/contrib/minizip/zip.h @@ -0,0 +1,150 @@ +/* zip.h -- IO for compress .zip files using zlib + Version 0.15 alpha, Mar 19th, 1998, + + Copyright (C) 1998 Gilles Vollant + + This unzip package allow creates .ZIP file, compatible with PKZip 2.04g + WinZip, InfoZip tools and compatible. + Encryption and multi volume ZipFile (span) are not supported. + Old compressions used by old PKZip 1.x are not supported + + For uncompress .zip file, look at unzip.h + + THIS IS AN ALPHA VERSION. AT THIS STAGE OF DEVELOPPEMENT, SOMES API OR STRUCTURE + CAN CHANGE IN FUTURE VERSION !! + I WAIT FEEDBACK at mail info@winimage.com + Visit also http://www.winimage.com/zLibDll/zip.htm for evolution + + Condition of use and distribution are the same than zlib : + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + +*/ + +/* for more info about .ZIP format, see + ftp://ftp.cdrom.com/pub/infozip/doc/appnote-970311-iz.zip + PkWare has also a specification at : + ftp://ftp.pkware.com/probdesc.zip +*/ + +#ifndef _zip_H +#define _zip_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef _ZLIB_H +#include "zlib.h" +#endif + +#if defined(STRICTZIP) || defined(STRICTZIPUNZIP) +/* like the STRICT of WIN32, we define a pointer that cannot be converted + from (void*) without cast */ +typedef struct TagzipFile__ { int unused; } zipFile__; +typedef zipFile__ *zipFile; +#else +typedef voidp zipFile; +#endif + +#define ZIP_OK (0) +#define ZIP_ERRNO (Z_ERRNO) +#define ZIP_PARAMERROR (-102) +#define ZIP_INTERNALERROR (-104) + +/* tm_zip contain date/time info */ +typedef struct tm_zip_s +{ + uInt tm_sec; /* seconds after the minute - [0,59] */ + uInt tm_min; /* minutes after the hour - [0,59] */ + uInt tm_hour; /* hours since midnight - [0,23] */ + uInt tm_mday; /* day of the month - [1,31] */ + uInt tm_mon; /* months since January - [0,11] */ + uInt tm_year; /* years - [1980..2044] */ +} tm_zip; + +typedef struct +{ + tm_zip tmz_date; /* date in understandable format */ + uLong dosDate; /* if dos_date == 0, tmu_date is used */ +/* uLong flag; */ /* general purpose bit flag 2 bytes */ + + uLong internal_fa; /* internal file attributes 2 bytes */ + uLong external_fa; /* external file attributes 4 bytes */ +} zip_fileinfo; + +extern zipFile ZEXPORT zipOpen OF((const char *pathname, int append)); +/* + Create a zipfile. + pathname contain on Windows NT a filename like "c:\\zlib\\zlib111.zip" or on + an Unix computer "zlib/zlib111.zip". + if the file pathname exist and append=1, the zip will be created at the end + of the file. (useful if the file contain a self extractor code) + If the zipfile cannot be opened, the return value is NULL. + Else, the return value is a zipFile Handle, usable with other function + of this zip package. + + +*/ + +extern int ZEXPORT zipOpenNewFileInZip OF((zipFile file, + const char* filename, + const zip_fileinfo* zipfi, + const void* extrafield_local, + uInt size_extrafield_local, + const void* extrafield_global, + uInt size_extrafield_global, + const char* comment, + int method, + int level)); +/* + Open a file in the ZIP for writing. + filename : the filename in zip (if NULL, '-' without quote will be used + *zipfi contain supplemental information + if extrafield_local!=NULL and size_extrafield_local>0, extrafield_local + contains the extrafield data the the local header + if extrafield_global!=NULL and size_extrafield_global>0, extrafield_global + contains the extrafield data the the local header + if comment != NULL, comment contain the comment string + method contain the compression method (0 for store, Z_DEFLATED for deflate) + level contain the level of compression (can be Z_DEFAULT_COMPRESSION) +*/ + +extern int ZEXPORT zipWriteInFileInZip OF((zipFile file, + const voidp buf, + unsigned len)); +/* + Write data in the zipfile +*/ + +extern int ZEXPORT zipCloseFileInZip OF((zipFile file)); +/* + Close the current file in the zipfile +*/ + +extern int ZEXPORT zipClose OF((zipFile file, + const char* global_comment)); +/* + Close the zipfile +*/ + +#ifdef __cplusplus +} +#endif + +#endif /* _zip_H */ diff --git a/zlib/contrib/minizip/zlibvc.def b/zlib/contrib/minizip/zlibvc.def new file mode 100644 index 0000000..7e9d60d --- /dev/null +++ b/zlib/contrib/minizip/zlibvc.def @@ -0,0 +1,74 @@ +LIBRARY "zlib" + +DESCRIPTION '"""zlib data compression library"""' + + +VERSION 1.11 + + +HEAPSIZE 1048576,8192 + +EXPORTS + adler32 @1 + compress @2 + crc32 @3 + deflate @4 + deflateCopy @5 + deflateEnd @6 + deflateInit2_ @7 + deflateInit_ @8 + deflateParams @9 + deflateReset @10 + deflateSetDictionary @11 + gzclose @12 + gzdopen @13 + gzerror @14 + gzflush @15 + gzopen @16 + gzread @17 + gzwrite @18 + inflate @19 + inflateEnd @20 + inflateInit2_ @21 + inflateInit_ @22 + inflateReset @23 + inflateSetDictionary @24 + inflateSync @25 + uncompress @26 + zlibVersion @27 + gzprintf @28 + gzputc @29 + gzgetc @30 + gzseek @31 + gzrewind @32 + gztell @33 + gzeof @34 + gzsetparams @35 + zError @36 + inflateSyncPoint @37 + get_crc_table @38 + compress2 @39 + gzputs @40 + gzgets @41 + + unzOpen @61 + unzClose @62 + unzGetGlobalInfo @63 + unzGetCurrentFileInfo @64 + unzGoToFirstFile @65 + unzGoToNextFile @66 + unzOpenCurrentFile @67 + unzReadCurrentFile @68 + unztell @70 + unzeof @71 + unzCloseCurrentFile @72 + unzGetGlobalComment @73 + unzStringFileNameCompare @74 + unzLocateFile @75 + unzGetLocalExtrafield @76 + + zipOpen @80 + zipOpenNewFileInZip @81 + zipWriteInFileInZip @82 + zipCloseFileInZip @83 + zipClose @84 diff --git a/zlib/contrib/minizip/zlibvc.dsp b/zlib/contrib/minizip/zlibvc.dsp new file mode 100644 index 0000000..a70d4d4 --- /dev/null +++ b/zlib/contrib/minizip/zlibvc.dsp @@ -0,0 +1,651 @@ +# Microsoft Developer Studio Project File - Name="zlibvc" - Package Owner=<4> +# Microsoft Developer Studio Generated Build File, Format Version 5.00 +# ** DO NOT EDIT ** + +# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102 +# TARGTYPE "Win32 (ALPHA) Dynamic-Link Library" 0x0602 + +CFG=zlibvc - Win32 Release +!MESSAGE This is not a valid makefile. To build this project using NMAKE, +!MESSAGE use the Export Makefile command and run +!MESSAGE +!MESSAGE NMAKE /f "zlibvc.mak". +!MESSAGE +!MESSAGE You can specify a configuration when running NMAKE +!MESSAGE by defining the macro CFG on the command line. For example: +!MESSAGE +!MESSAGE NMAKE /f "zlibvc.mak" CFG="zlibvc - Win32 Release" +!MESSAGE +!MESSAGE Possible choices for configuration are: +!MESSAGE +!MESSAGE "zlibvc - Win32 Release" (based on "Win32 (x86) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 Debug" (based on "Win32 (x86) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 ReleaseAxp" (based on\ + "Win32 (ALPHA) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 ReleaseWithoutAsm" (based on\ + "Win32 (x86) Dynamic-Link Library") +!MESSAGE "zlibvc - Win32 ReleaseWithoutCrtdll" (based on\ + "Win32 (x86) Dynamic-Link Library") +!MESSAGE + +# Begin Project +# PROP Scc_ProjName "" +# PROP Scc_LocalPath "" + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir ".\Release" +# PROP BASE Intermediate_Dir ".\Release" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir ".\Release" +# PROP Intermediate_Dir ".\Release" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 +# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 1 +# PROP BASE Output_Dir ".\Debug" +# PROP BASE Intermediate_Dir ".\Debug" +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 1 +# PROP Output_Dir ".\Debug" +# PROP Intermediate_Dir ".\Debug" +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /c +# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "_DEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "_DEBUG" /win32 +# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "_DEBUG" +# ADD RSC /l 0x40c /d "_DEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:".\Debug\zlib.dll" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "zlibvc__" +# PROP BASE Intermediate_Dir "zlibvc__" +# PROP BASE Ignore_Export_Lib 0 +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "zlibvc__" +# PROP Intermediate_Dir "zlibvc__" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +CPP=cl.exe +# ADD BASE CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c +# ADD CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT BASE LINK32 /pdb:none +# ADD LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:"zlibvc__\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "zlibvc_0" +# PROP BASE Intermediate_Dir "zlibvc_0" +# PROP BASE Ignore_Export_Lib 0 +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "zlibvc_0" +# PROP Intermediate_Dir "zlibvc_0" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT BASE LINK32 /pdb:none +# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_0\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +# PROP BASE Use_MFC 0 +# PROP BASE Use_Debug_Libraries 0 +# PROP BASE Output_Dir "zlibvc_1" +# PROP BASE Intermediate_Dir "zlibvc_1" +# PROP BASE Ignore_Export_Lib 0 +# PROP BASE Target_Dir "" +# PROP Use_MFC 0 +# PROP Use_Debug_Libraries 0 +# PROP Output_Dir "zlibvc_1" +# PROP Intermediate_Dir "zlibvc_1" +# PROP Ignore_Export_Lib 0 +# PROP Target_Dir "" +CPP=cl.exe +# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /YX /FD /c +# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c +# SUBTRACT CPP /YX +MTL=midl.exe +# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32 +RSC=rc.exe +# ADD BASE RSC /l 0x40c /d "NDEBUG" +# ADD RSC /l 0x40c /d "NDEBUG" +BSC32=bscmake.exe +# ADD BASE BSC32 /nologo +# ADD BSC32 /nologo +LINK32=link.exe +# ADD BASE LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll" +# SUBTRACT BASE LINK32 /pdb:none +# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_1\zlib.dll" +# SUBTRACT LINK32 /pdb:none + +!ENDIF + +# Begin Target + +# Name "zlibvc - Win32 Release" +# Name "zlibvc - Win32 Debug" +# Name "zlibvc - Win32 ReleaseAxp" +# Name "zlibvc - Win32 ReleaseWithoutAsm" +# Name "zlibvc - Win32 ReleaseWithoutCrtdll" +# Begin Group "Source Files" + +# PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;hpj;bat;for;f90" +# Begin Source File + +SOURCE=.\adler32.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_ADLER=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\compress.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_COMPR=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\crc32.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_CRC32=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\deflate.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_DEFLA=\ + ".\deflate.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\gvmat32c.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\gzio.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_GZIO_=\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\infblock.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFBL=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\infcodes.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFCO=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inffast.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\inffast.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFFA=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inffast.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\inflate.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFLA=\ + ".\infblock.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\inftrees.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFTR=\ + ".\inftrees.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\infutil.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_INFUT=\ + ".\infblock.h"\ + ".\infcodes.h"\ + ".\inftrees.h"\ + ".\infutil.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\trees.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_TREES=\ + ".\deflate.h"\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\uncompr.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_UNCOM=\ + ".\zconf.h"\ + ".\zlib.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\unzip.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\zip.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# Begin Source File + +SOURCE=.\zlib.rc +# End Source File +# Begin Source File + +SOURCE=.\zlibvc.def +# End Source File +# Begin Source File + +SOURCE=.\zutil.c + +!IF "$(CFG)" == "zlibvc - Win32 Release" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp" + +DEP_CPP_ZUTIL=\ + ".\zconf.h"\ + ".\zlib.h"\ + ".\zutil.h"\ + + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm" + +!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll" + +!ENDIF + +# End Source File +# End Group +# Begin Group "Header Files" + +# PROP Default_Filter "h;hpp;hxx;hm;inl;fi;fd" +# Begin Source File + +SOURCE=.\deflate.h +# End Source File +# Begin Source File + +SOURCE=.\infblock.h +# End Source File +# Begin Source File + +SOURCE=.\infcodes.h +# End Source File +# Begin Source File + +SOURCE=.\inffast.h +# End Source File +# Begin Source File + +SOURCE=.\inftrees.h +# End Source File +# Begin Source File + +SOURCE=.\infutil.h +# End Source File +# Begin Source File + +SOURCE=.\zconf.h +# End Source File +# Begin Source File + +SOURCE=.\zlib.h +# End Source File +# Begin Source File + +SOURCE=.\zutil.h +# End Source File +# End Group +# Begin Group "Resource Files" + +# PROP Default_Filter "ico;cur;bmp;dlg;rc2;rct;bin;cnt;rtf;gif;jpg;jpeg;jpe" +# End Group +# End Target +# End Project diff --git a/zlib/contrib/minizip/zlibvc.dsw b/zlib/contrib/minizip/zlibvc.dsw new file mode 100644 index 0000000..493cd87 --- /dev/null +++ b/zlib/contrib/minizip/zlibvc.dsw @@ -0,0 +1,41 @@ +Microsoft Developer Studio Workspace File, Format Version 5.00 +# WARNING: DO NOT EDIT OR DELETE THIS WORKSPACE FILE! + +############################################################################### + +Project: "zlibstat"=.\zlibstat.dsp - Package Owner=<4> + +Package=<5> +{{{ +}}} + +Package=<4> +{{{ +}}} + +############################################################################### + +Project: "zlibvc"=.\zlibvc.dsp - Package Owner=<4> + +Package=<5> +{{{ +}}} + +Package=<4> +{{{ +}}} + +############################################################################### + +Global: + +Package=<5> +{{{ +}}} + +Package=<3> +{{{ +}}} + +############################################################################### + diff --git a/zlib/contrib/untgz/Makefile b/zlib/contrib/untgz/Makefile new file mode 100644 index 0000000..409b4bd --- /dev/null +++ b/zlib/contrib/untgz/Makefile @@ -0,0 +1,14 @@ +CC=cc +CFLAGS=-g + +untgz: untgz.o ../../libz.a + $(CC) $(CFLAGS) -o untgz untgz.o -L../.. -lz + +untgz.o: untgz.c ../../zlib.h + $(CC) $(CFLAGS) -c -I../.. untgz.c + +../../libz.a: + cd ../..; make + +clean: + rm -f untgz untgz.o *~ diff --git a/zlib/contrib/untgz/makefile.w32 b/zlib/contrib/untgz/makefile.w32 new file mode 100644 index 0000000..c99dc28 --- /dev/null +++ b/zlib/contrib/untgz/makefile.w32 @@ -0,0 +1,63 @@ +# Makefile for zlib. Modified for mingw32 +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile, +# +# make -fmakefile.w32 +# + +CC=gcc + +# Generate dependencies (see end of the file) + +CPPFLAGS=-MMD + +#CFLAGS=-MMD -O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-MMD -g -DDEBUG +CFLAGS=-O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ + -Wstrict-prototypes -Wmissing-prototypes + +# If cp.exe is not found, replace with copy /Y . +CP=cp -f + +# The default value of RM is "rm -f." +# If "rm.exe" is not found, uncomment: +# RM=del + +LD=gcc +LDLIBS=-L. -lz +LDFLAGS=-s + + +INCL=zlib.h zconf.h +LIBS=libz.a + +AR=ar rcs + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o \ + inffast.o + +TEST_OBJS = minigzip.o untgz.o + +all: minigzip.exe untgz.exe + +rebuild: clean all + +libz.a: $(OBJS) + $(AR) $@ $(OBJS) + +%.exe : %.o $(LIBS) + $(LD) $(LDFLAGS) -o $@ $< $(LDLIBS) + +.PHONY : clean + +clean: + $(RM) *.d *.o *.exe libz.a foo.gz + +DEPS := $(wildcard *.d) +ifneq ($(DEPS),) +include $(DEPS) +endif + diff --git a/zlib/contrib/untgz/untgz.c b/zlib/contrib/untgz/untgz.c new file mode 100644 index 0000000..4a431ff --- /dev/null +++ b/zlib/contrib/untgz/untgz.c @@ -0,0 +1,522 @@ +/* + * untgz.c -- Display contents and/or extract file from + * a gzip'd TAR file + * written by "Pedro A. Aranda Guti\irrez" + * adaptation to Unix by Jean-loup Gailly + */ + +#include +#include +#include +#include +#include +#include +#ifdef unix +# include +#else +# include +# include +#endif + +#include "zlib.h" + +#ifdef WIN32 +# ifndef F_OK +# define F_OK (0) +# endif +# ifdef _MSC_VER +# define mkdir(dirname,mode) _mkdir(dirname) +# define strdup(str) _strdup(str) +# define unlink(fn) _unlink(fn) +# define access(path,mode) _access(path,mode) +# else +# define mkdir(dirname,mode) _mkdir(dirname) +# endif +#else +# include +#endif + + +/* Values used in typeflag field. */ + +#define REGTYPE '0' /* regular file */ +#define AREGTYPE '\0' /* regular file */ +#define LNKTYPE '1' /* link */ +#define SYMTYPE '2' /* reserved */ +#define CHRTYPE '3' /* character special */ +#define BLKTYPE '4' /* block special */ +#define DIRTYPE '5' /* directory */ +#define FIFOTYPE '6' /* FIFO special */ +#define CONTTYPE '7' /* reserved */ + +#define BLOCKSIZE 512 + +struct tar_header +{ /* byte offset */ + char name[100]; /* 0 */ + char mode[8]; /* 100 */ + char uid[8]; /* 108 */ + char gid[8]; /* 116 */ + char size[12]; /* 124 */ + char mtime[12]; /* 136 */ + char chksum[8]; /* 148 */ + char typeflag; /* 156 */ + char linkname[100]; /* 157 */ + char magic[6]; /* 257 */ + char version[2]; /* 263 */ + char uname[32]; /* 265 */ + char gname[32]; /* 297 */ + char devmajor[8]; /* 329 */ + char devminor[8]; /* 337 */ + char prefix[155]; /* 345 */ + /* 500 */ +}; + +union tar_buffer { + char buffer[BLOCKSIZE]; + struct tar_header header; +}; + +enum { TGZ_EXTRACT = 0, TGZ_LIST }; + +static char *TGZfname OF((const char *)); +void TGZnotfound OF((const char *)); + +int getoct OF((char *, int)); +char *strtime OF((time_t *)); +int ExprMatch OF((char *,char *)); + +int makedir OF((char *)); +int matchname OF((int,int,char **,char *)); + +void error OF((const char *)); +int tar OF((gzFile, int, int, int, char **)); + +void help OF((int)); +int main OF((int, char **)); + +char *prog; + +/* This will give a benign warning */ + +static char *TGZprefix[] = { "\0", ".tgz", ".tar.gz", ".tar", NULL }; + +/* Return the real name of the TGZ archive */ +/* or NULL if it does not exist. */ + +static char *TGZfname OF((const char *fname)) +{ + static char buffer[1024]; + int origlen,i; + + strcpy(buffer,fname); + origlen = strlen(buffer); + + for (i=0; TGZprefix[i]; i++) + { + strcpy(buffer+origlen,TGZprefix[i]); + if (access(buffer,F_OK) == 0) + return buffer; + } + return NULL; +} + +/* error message for the filename */ + +void TGZnotfound OF((const char *fname)) +{ + int i; + + fprintf(stderr,"%s : couldn't find ",prog); + for (i=0;TGZprefix[i];i++) + fprintf(stderr,(TGZprefix[i+1]) ? "%s%s, " : "or %s%s\n", + fname, + TGZprefix[i]); + exit(1); +} + + +/* help functions */ + +int getoct(char *p,int width) +{ + int result = 0; + char c; + + while (width --) + { + c = *p++; + if (c == ' ') + continue; + if (c == 0) + break; + result = result * 8 + (c - '0'); + } + return result; +} + +char *strtime (time_t *t) +{ + struct tm *local; + static char result[32]; + + local = localtime(t); + sprintf(result,"%2d/%02d/%4d %02d:%02d:%02d", + local->tm_mday, local->tm_mon+1, local->tm_year+1900, + local->tm_hour, local->tm_min, local->tm_sec); + return result; +} + + +/* regular expression matching */ + +#define ISSPECIAL(c) (((c) == '*') || ((c) == '/')) + +int ExprMatch(char *string,char *expr) +{ + while (1) + { + if (ISSPECIAL(*expr)) + { + if (*expr == '/') + { + if (*string != '\\' && *string != '/') + return 0; + string ++; expr++; + } + else if (*expr == '*') + { + if (*expr ++ == 0) + return 1; + while (*++string != *expr) + if (*string == 0) + return 0; + } + } + else + { + if (*string != *expr) + return 0; + if (*expr++ == 0) + return 1; + string++; + } + } +} + +/* recursive make directory */ +/* abort if you get an ENOENT errno somewhere in the middle */ +/* e.g. ignore error "mkdir on existing directory" */ +/* */ +/* return 1 if OK */ +/* 0 on error */ + +int makedir (char *newdir) +{ + char *buffer = strdup(newdir); + char *p; + int len = strlen(buffer); + + if (len <= 0) { + free(buffer); + return 0; + } + if (buffer[len-1] == '/') { + buffer[len-1] = '\0'; + } + if (mkdir(buffer, 0775) == 0) + { + free(buffer); + return 1; + } + + p = buffer+1; + while (1) + { + char hold; + + while(*p && *p != '\\' && *p != '/') + p++; + hold = *p; + *p = 0; + if ((mkdir(buffer, 0775) == -1) && (errno == ENOENT)) + { + fprintf(stderr,"%s: couldn't create directory %s\n",prog,buffer); + free(buffer); + return 0; + } + if (hold == 0) + break; + *p++ = hold; + } + free(buffer); + return 1; +} + +int matchname (int arg,int argc,char **argv,char *fname) +{ + if (arg == argc) /* no arguments given (untgz tgzarchive) */ + return 1; + + while (arg < argc) + if (ExprMatch(fname,argv[arg++])) + return 1; + + return 0; /* ignore this for the moment being */ +} + + +/* Tar file list or extract */ + +int tar (gzFile in,int action,int arg,int argc,char **argv) +{ + union tar_buffer buffer; + int len; + int err; + int getheader = 1; + int remaining = 0; + FILE *outfile = NULL; + char fname[BLOCKSIZE]; + time_t tartime; + + if (action == TGZ_LIST) + printf(" day time size file\n" + " ---------- -------- --------- -------------------------------------\n"); + while (1) + { + len = gzread(in, &buffer, BLOCKSIZE); + if (len < 0) + error (gzerror(in, &err)); + /* + * Always expect complete blocks to process + * the tar information. + */ + if (len != BLOCKSIZE) + error("gzread: incomplete block read"); + + /* + * If we have to get a tar header + */ + if (getheader == 1) + { + /* + * if we met the end of the tar + * or the end-of-tar block, + * we are done + */ + if ((len == 0) || (buffer.header.name[0]== 0)) break; + + tartime = (time_t)getoct(buffer.header.mtime,12); + strcpy(fname,buffer.header.name); + + switch (buffer.header.typeflag) + { + case DIRTYPE: + if (action == TGZ_LIST) + printf(" %s %s\n",strtime(&tartime),fname); + if (action == TGZ_EXTRACT) + makedir(fname); + break; + case REGTYPE: + case AREGTYPE: + remaining = getoct(buffer.header.size,12); + if (action == TGZ_LIST) + printf(" %s %9d %s\n",strtime(&tartime),remaining,fname); + if (action == TGZ_EXTRACT) + { + if ((remaining) && (matchname(arg,argc,argv,fname))) + { + outfile = fopen(fname,"wb"); + if (outfile == NULL) { + /* try creating directory */ + char *p = strrchr(fname, '/'); + if (p != NULL) { + *p = '\0'; + makedir(fname); + *p = '/'; + outfile = fopen(fname,"wb"); + } + } + fprintf(stderr, + "%s %s\n", + (outfile) ? "Extracting" : "Couldn't create", + fname); + } + else + outfile = NULL; + } + /* + * could have no contents + */ + getheader = (remaining) ? 0 : 1; + break; + default: + if (action == TGZ_LIST) + printf(" %s <---> %s\n",strtime(&tartime),fname); + break; + } + } + else + { + unsigned int bytes = (remaining > BLOCKSIZE) ? BLOCKSIZE : remaining; + + if ((action == TGZ_EXTRACT) && (outfile != NULL)) + { + if (fwrite(&buffer,sizeof(char),bytes,outfile) != bytes) + { + fprintf(stderr,"%s : error writing %s skipping...\n",prog,fname); + fclose(outfile); + unlink(fname); + } + } + remaining -= bytes; + if (remaining == 0) + { + getheader = 1; + if ((action == TGZ_EXTRACT) && (outfile != NULL)) + { +#ifdef WIN32 + HANDLE hFile; + FILETIME ftm,ftLocal; + SYSTEMTIME st; + struct tm localt; + + fclose(outfile); + + localt = *localtime(&tartime); + + hFile = CreateFile(fname, GENERIC_READ | GENERIC_WRITE, + 0, NULL, OPEN_EXISTING, 0, NULL); + + st.wYear = (WORD)localt.tm_year+1900; + st.wMonth = (WORD)localt.tm_mon; + st.wDayOfWeek = (WORD)localt.tm_wday; + st.wDay = (WORD)localt.tm_mday; + st.wHour = (WORD)localt.tm_hour; + st.wMinute = (WORD)localt.tm_min; + st.wSecond = (WORD)localt.tm_sec; + st.wMilliseconds = 0; + SystemTimeToFileTime(&st,&ftLocal); + LocalFileTimeToFileTime(&ftLocal,&ftm); + SetFileTime(hFile,&ftm,NULL,&ftm); + CloseHandle(hFile); + + outfile = NULL; +#else + struct utimbuf settime; + + settime.actime = settime.modtime = tartime; + + fclose(outfile); + outfile = NULL; + utime(fname,&settime); +#endif + } + } + } + } + + if (gzclose(in) != Z_OK) + error("failed gzclose"); + + return 0; +} + + +/* =========================================================== */ + +void help(int exitval) +{ + fprintf(stderr, + "untgz v 0.1\n" + " an sample application of zlib 1.0.4\n\n" + "Usage : untgz TGZfile to extract all files\n" + " untgz TGZfile fname ... to extract selected files\n" + " untgz -l TGZfile to list archive contents\n" + " untgz -h to display this help\n\n"); + exit(exitval); +} + +void error(const char *msg) +{ + fprintf(stderr, "%s: %s\n", prog, msg); + exit(1); +} + + +/* ====================================================================== */ + +int _CRT_glob = 0; /* disable globbing of the arguments */ + +int main(int argc,char **argv) +{ + int action = TGZ_EXTRACT; + int arg = 1; + char *TGZfile; + gzFile *f; + + + prog = strrchr(argv[0],'\\'); + if (prog == NULL) + { + prog = strrchr(argv[0],'/'); + if (prog == NULL) + { + prog = strrchr(argv[0],':'); + if (prog == NULL) + prog = argv[0]; + else + prog++; + } + else + prog++; + } + else + prog++; + + if (argc == 1) + help(0); + + if (strcmp(argv[arg],"-l") == 0) + { + action = TGZ_LIST; + if (argc == ++arg) + help(0); + } + else if (strcmp(argv[arg],"-h") == 0) + { + help(0); + } + + if ((TGZfile = TGZfname(argv[arg])) == NULL) + TGZnotfound(argv[arg]); + + ++arg; + if ((action == TGZ_LIST) && (arg != argc)) + help(1); + +/* + * Process the TGZ file + */ + switch(action) + { + case TGZ_LIST: + case TGZ_EXTRACT: + f = gzopen(TGZfile,"rb"); + if (f == NULL) + { + fprintf(stderr,"%s: Couldn't gzopen %s\n", + prog, + TGZfile); + return 1; + } + exit(tar(f, action, arg, argc, argv)); + break; + + default: + error("Unknown option!"); + exit(1); + } + + return 0; +} diff --git a/zlib/contrib/visual-basic.txt b/zlib/contrib/visual-basic.txt new file mode 100644 index 0000000..10fb44b --- /dev/null +++ b/zlib/contrib/visual-basic.txt @@ -0,0 +1,69 @@ +See below some functions declarations for Visual Basic. + +Frequently Asked Question: + +Q: Each time I use the compress function I get the -5 error (not enough + room in the output buffer). + +A: Make sure that the length of the compressed buffer is passed by + reference ("as any"), not by value ("as long"). Also check that + before the call of compress this length is equal to the total size of + the compressed buffer and not zero. + + +From: "Jon Caruana" +Subject: Re: How to port zlib declares to vb? +Date: Mon, 28 Oct 1996 18:33:03 -0600 + +Got the answer! (I haven't had time to check this but it's what I got, and +looks correct): + +He has the following routines working: + compress + uncompress + gzopen + gzwrite + gzread + gzclose + +Declares follow: (Quoted from Carlos Rios , in Vb4 form) + +#If Win16 Then 'Use Win16 calls. +Declare Function compress Lib "ZLIB.DLL" (ByVal compr As + String, comprLen As Any, ByVal buf As String, ByVal buflen + As Long) As Integer +Declare Function uncompress Lib "ZLIB.DLL" (ByVal uncompr + As String, uncomprLen As Any, ByVal compr As String, ByVal + lcompr As Long) As Integer +Declare Function gzopen Lib "ZLIB.DLL" (ByVal filePath As + String, ByVal mode As String) As Long +Declare Function gzread Lib "ZLIB.DLL" (ByVal file As + Long, ByVal uncompr As String, ByVal uncomprLen As Integer) + As Integer +Declare Function gzwrite Lib "ZLIB.DLL" (ByVal file As + Long, ByVal uncompr As String, ByVal uncomprLen As Integer) + As Integer +Declare Function gzclose Lib "ZLIB.DLL" (ByVal file As + Long) As Integer +#Else +Declare Function compress Lib "ZLIB32.DLL" + (ByVal compr As String, comprLen As Any, ByVal buf As + String, ByVal buflen As Long) As Integer +Declare Function uncompress Lib "ZLIB32.DLL" + (ByVal uncompr As String, uncomprLen As Any, ByVal compr As + String, ByVal lcompr As Long) As Long +Declare Function gzopen Lib "ZLIB32.DLL" + (ByVal file As String, ByVal mode As String) As Long +Declare Function gzread Lib "ZLIB32.DLL" + (ByVal file As Long, ByVal uncompr As String, ByVal + uncomprLen As Long) As Long +Declare Function gzwrite Lib "ZLIB32.DLL" + (ByVal file As Long, ByVal uncompr As String, ByVal + uncomprLen As Long) As Long +Declare Function gzclose Lib "ZLIB32.DLL" + (ByVal file As Long) As Long +#End If + +-Jon Caruana +jon-net@usa.net +Microsoft Sitebuilder Network Level 1 Member - HTML Writer's Guild Member diff --git a/zlib/crc32.c b/zlib/crc32.c new file mode 100644 index 0000000..a91101a --- /dev/null +++ b/zlib/crc32.c @@ -0,0 +1,162 @@ +/* crc32.c -- compute the CRC-32 of a data stream + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include "zlib.h" + +#define local static + +#ifdef DYNAMIC_CRC_TABLE + +local int crc_table_empty = 1; +local uLongf crc_table[256]; +local void make_crc_table OF((void)); + +/* + Generate a table for a byte-wise 32-bit CRC calculation on the polynomial: + x^32+x^26+x^23+x^22+x^16+x^12+x^11+x^10+x^8+x^7+x^5+x^4+x^2+x+1. + + Polynomials over GF(2) are represented in binary, one bit per coefficient, + with the lowest powers in the most significant bit. Then adding polynomials + is just exclusive-or, and multiplying a polynomial by x is a right shift by + one. If we call the above polynomial p, and represent a byte as the + polynomial q, also with the lowest power in the most significant bit (so the + byte 0xb1 is the polynomial x^7+x^3+x+1), then the CRC is (q*x^32) mod p, + where a mod b means the remainder after dividing a by b. + + This calculation is done using the shift-register method of multiplying and + taking the remainder. The register is initialized to zero, and for each + incoming bit, x^32 is added mod p to the register if the bit is a one (where + x^32 mod p is p+x^32 = x^26+...+1), and the register is multiplied mod p by + x (which is shifting right by one and adding x^32 mod p if the bit shifted + out is a one). We start with the highest power (least significant bit) of + q and repeat for all eight bits of q. + + The table is simply the CRC of all possible eight bit values. This is all + the information needed to generate CRC's on data a byte at a time for all + combinations of CRC register values and incoming bytes. +*/ +local void make_crc_table() +{ + uLong c; + int n, k; + uLong poly; /* polynomial exclusive-or pattern */ + /* terms of polynomial defining this crc (except x^32): */ + static const Byte p[] = {0,1,2,4,5,7,8,10,11,12,16,22,23,26}; + + /* make exclusive-or pattern from polynomial (0xedb88320L) */ + poly = 0L; + for (n = 0; n < sizeof(p)/sizeof(Byte); n++) + poly |= 1L << (31 - p[n]); + + for (n = 0; n < 256; n++) + { + c = (uLong)n; + for (k = 0; k < 8; k++) + c = c & 1 ? poly ^ (c >> 1) : c >> 1; + crc_table[n] = c; + } + crc_table_empty = 0; +} +#else +/* ======================================================================== + * Table of CRC-32's of all single-byte values (made by make_crc_table) + */ +local const uLongf crc_table[256] = { + 0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L, + 0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L, + 0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L, + 0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL, + 0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L, + 0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L, + 0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L, + 0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL, + 0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L, + 0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL, + 0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L, + 0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L, + 0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L, + 0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL, + 0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL, + 0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L, + 0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL, + 0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L, + 0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L, + 0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L, + 0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL, + 0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L, + 0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L, + 0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL, + 0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L, + 0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L, + 0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L, + 0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L, + 0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L, + 0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL, + 0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL, + 0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L, + 0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L, + 0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL, + 0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL, + 0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L, + 0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL, + 0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L, + 0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL, + 0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L, + 0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL, + 0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L, + 0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L, + 0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL, + 0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L, + 0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L, + 0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L, + 0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L, + 0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L, + 0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L, + 0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL, + 0x2d02ef8dL +}; +#endif + +/* ========================================================================= + * This function can be used by asm versions of crc32() + */ +const uLongf * ZEXPORT get_crc_table() +{ +#ifdef DYNAMIC_CRC_TABLE + if (crc_table_empty) make_crc_table(); +#endif + return (const uLongf *)crc_table; +} + +/* ========================================================================= */ +#define DO1(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8); +#define DO2(buf) DO1(buf); DO1(buf); +#define DO4(buf) DO2(buf); DO2(buf); +#define DO8(buf) DO4(buf); DO4(buf); + +/* ========================================================================= */ +uLong ZEXPORT crc32(crc, buf, len) + uLong crc; + const Bytef *buf; + uInt len; +{ + if (buf == Z_NULL) return 0L; +#ifdef DYNAMIC_CRC_TABLE + if (crc_table_empty) + make_crc_table(); +#endif + crc = crc ^ 0xffffffffL; + while (len >= 8) + { + DO8(buf); + len -= 8; + } + if (len) do { + DO1(buf); + } while (--len); + return crc ^ 0xffffffffL; +} diff --git a/zlib/deflate.c b/zlib/deflate.c new file mode 100644 index 0000000..25d5818 --- /dev/null +++ b/zlib/deflate.c @@ -0,0 +1,1350 @@ +/* deflate.c -- compress data using the deflation algorithm + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * ALGORITHM + * + * The "deflation" process depends on being able to identify portions + * of the input text which are identical to earlier input (within a + * sliding window trailing behind the input currently being processed). + * + * The most straightforward technique turns out to be the fastest for + * most input files: try all possible matches and select the longest. + * The key feature of this algorithm is that insertions into the string + * dictionary are very simple and thus fast, and deletions are avoided + * completely. Insertions are performed at each input character, whereas + * string matches are performed only when the previous match ends. So it + * is preferable to spend more time in matches to allow very fast string + * insertions and avoid deletions. The matching algorithm for small + * strings is inspired from that of Rabin & Karp. A brute force approach + * is used to find longer strings when a small match has been found. + * A similar algorithm is used in comic (by Jan-Mark Wams) and freeze + * (by Leonid Broukhis). + * A previous version of this file used a more sophisticated algorithm + * (by Fiala and Greene) which is guaranteed to run in linear amortized + * time, but has a larger average cost, uses more memory and is patented. + * However the F&G algorithm may be faster for some highly redundant + * files if the parameter max_chain_length (described below) is too large. + * + * ACKNOWLEDGEMENTS + * + * The idea of lazy evaluation of matches is due to Jan-Mark Wams, and + * I found it in 'freeze' written by Leonid Broukhis. + * Thanks to many people for bug reports and testing. + * + * REFERENCES + * + * Deutsch, L.P.,"DEFLATE Compressed Data Format Specification". + * Available in ftp://ds.internic.net/rfc/rfc1951.txt + * + * A description of the Rabin and Karp algorithm is given in the book + * "Algorithms" by R. Sedgewick, Addison-Wesley, p252. + * + * Fiala,E.R., and Greene,D.H. + * Data Compression with Finite Windows, Comm.ACM, 32,4 (1989) 490-595 + * + */ + +/* @(#) $Id$ */ + +#include "deflate.h" + +const char deflate_copyright[] = + " deflate 1.1.3 Copyright 1995-1998 Jean-loup Gailly "; +/* + If you use the zlib library in a product, an acknowledgment is welcome + in the documentation of your product. If for some reason you cannot + include such an acknowledgment, I would appreciate that you keep this + copyright string in the executable of your product. + */ + +/* =========================================================================== + * Function prototypes. + */ +typedef enum { + need_more, /* block not completed, need more input or more output */ + block_done, /* block flush performed */ + finish_started, /* finish started, need only more output at next deflate */ + finish_done /* finish done, accept no more input or output */ +} block_state; + +typedef block_state (*compress_func) OF((deflate_state *s, int flush)); +/* Compression function. Returns the block state after the call. */ + +local void fill_window OF((deflate_state *s)); +local block_state deflate_stored OF((deflate_state *s, int flush)); +local block_state deflate_fast OF((deflate_state *s, int flush)); +local block_state deflate_slow OF((deflate_state *s, int flush)); +local void lm_init OF((deflate_state *s)); +local void putShortMSB OF((deflate_state *s, uInt b)); +local void flush_pending OF((z_streamp strm)); +local int read_buf OF((z_streamp strm, Bytef *buf, unsigned size)); +#ifdef ASMV + void match_init OF((void)); /* asm code initialization */ + uInt longest_match OF((deflate_state *s, IPos cur_match)); +#else +local uInt longest_match OF((deflate_state *s, IPos cur_match)); +#endif + +#ifdef DEBUG +local void check_match OF((deflate_state *s, IPos start, IPos match, + int length)); +#endif + +/* =========================================================================== + * Local data + */ + +#define NIL 0 +/* Tail of hash chains */ + +#ifndef TOO_FAR +# define TOO_FAR 4096 +#endif +/* Matches of length 3 are discarded if their distance exceeds TOO_FAR */ + +#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1) +/* Minimum amount of lookahead, except at the end of the input file. + * See deflate.c for comments about the MIN_MATCH+1. + */ + +/* Values for max_lazy_match, good_match and max_chain_length, depending on + * the desired pack level (0..9). The values given below have been tuned to + * exclude worst case performance for pathological files. Better values may be + * found for specific files. + */ +typedef struct config_s { + ush good_length; /* reduce lazy search above this match length */ + ush max_lazy; /* do not perform lazy search above this match length */ + ush nice_length; /* quit search above this match length */ + ush max_chain; + compress_func func; +} config; + +local const config configuration_table[10] = { +/* good lazy nice chain */ +/* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */ +/* 1 */ {4, 4, 8, 4, deflate_fast}, /* maximum speed, no lazy matches */ +/* 2 */ {4, 5, 16, 8, deflate_fast}, +/* 3 */ {4, 6, 32, 32, deflate_fast}, + +/* 4 */ {4, 4, 16, 16, deflate_slow}, /* lazy matches */ +/* 5 */ {8, 16, 32, 32, deflate_slow}, +/* 6 */ {8, 16, 128, 128, deflate_slow}, +/* 7 */ {8, 32, 128, 256, deflate_slow}, +/* 8 */ {32, 128, 258, 1024, deflate_slow}, +/* 9 */ {32, 258, 258, 4096, deflate_slow}}; /* maximum compression */ + +/* Note: the deflate() code requires max_lazy >= MIN_MATCH and max_chain >= 4 + * For deflate_fast() (levels <= 3) good is ignored and lazy has a different + * meaning. + */ + +#define EQUAL 0 +/* result of memcmp for equal strings */ + +struct static_tree_desc_s {int dummy;}; /* for buggy compilers */ + +/* =========================================================================== + * Update a hash value with the given input byte + * IN assertion: all calls to to UPDATE_HASH are made with consecutive + * input characters, so that a running hash key can be computed from the + * previous key instead of complete recalculation each time. + */ +#define UPDATE_HASH(s,h,c) (h = (((h)<hash_shift) ^ (c)) & s->hash_mask) + + +/* =========================================================================== + * Insert string str in the dictionary and set match_head to the previous head + * of the hash chain (the most recent string with same hash key). Return + * the previous length of the hash chain. + * If this file is compiled with -DFASTEST, the compression level is forced + * to 1, and no hash chains are maintained. + * IN assertion: all calls to to INSERT_STRING are made with consecutive + * input characters and the first MIN_MATCH bytes of str are valid + * (except for the last MIN_MATCH-1 bytes of the input file). + */ +#ifdef FASTEST +#define INSERT_STRING(s, str, match_head) \ + (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \ + match_head = s->head[s->ins_h], \ + s->head[s->ins_h] = (Pos)(str)) +#else +#define INSERT_STRING(s, str, match_head) \ + (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \ + s->prev[(str) & s->w_mask] = match_head = s->head[s->ins_h], \ + s->head[s->ins_h] = (Pos)(str)) +#endif + +/* =========================================================================== + * Initialize the hash table (avoiding 64K overflow for 16 bit systems). + * prev[] will be initialized on the fly. + */ +#define CLEAR_HASH(s) \ + s->head[s->hash_size-1] = NIL; \ + zmemzero((Bytef *)s->head, (unsigned)(s->hash_size-1)*sizeof(*s->head)); + +/* ========================================================================= */ +int ZEXPORT deflateInit_(strm, level, version, stream_size) + z_streamp strm; + int level; + const char *version; + int stream_size; +{ + return deflateInit2_(strm, level, Z_DEFLATED, MAX_WBITS, DEF_MEM_LEVEL, + Z_DEFAULT_STRATEGY, version, stream_size); + /* To do: ignore strm->next_in if we use it as window */ +} + +/* ========================================================================= */ +int ZEXPORT deflateInit2_(strm, level, method, windowBits, memLevel, strategy, + version, stream_size) + z_streamp strm; + int level; + int method; + int windowBits; + int memLevel; + int strategy; + const char *version; + int stream_size; +{ + deflate_state *s; + int noheader = 0; + static const char* my_version = ZLIB_VERSION; + + ushf *overlay; + /* We overlay pending_buf and d_buf+l_buf. This works since the average + * output size for (length,distance) codes is <= 24 bits. + */ + + if (version == Z_NULL || version[0] != my_version[0] || + stream_size != sizeof(z_stream)) { + return Z_VERSION_ERROR; + } + if (strm == Z_NULL) return Z_STREAM_ERROR; + + strm->msg = Z_NULL; + if (strm->zalloc == Z_NULL) { + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; + } + if (strm->zfree == Z_NULL) strm->zfree = zcfree; + + if (level == Z_DEFAULT_COMPRESSION) level = 6; +#ifdef FASTEST + level = 1; +#endif + + if (windowBits < 0) { /* undocumented feature: suppress zlib header */ + noheader = 1; + windowBits = -windowBits; + } + if (memLevel < 1 || memLevel > MAX_MEM_LEVEL || method != Z_DEFLATED || + windowBits < 8 || windowBits > 15 || level < 0 || level > 9 || + strategy < 0 || strategy > Z_HUFFMAN_ONLY) { + return Z_STREAM_ERROR; + } + s = (deflate_state *) ZALLOC(strm, 1, sizeof(deflate_state)); + if (s == Z_NULL) return Z_MEM_ERROR; + strm->state = (struct internal_state FAR *)s; + s->strm = strm; + + s->noheader = noheader; + s->w_bits = windowBits; + s->w_size = 1 << s->w_bits; + s->w_mask = s->w_size - 1; + + s->hash_bits = memLevel + 7; + s->hash_size = 1 << s->hash_bits; + s->hash_mask = s->hash_size - 1; + s->hash_shift = ((s->hash_bits+MIN_MATCH-1)/MIN_MATCH); + + s->window = (Bytef *) ZALLOC(strm, s->w_size, 2*sizeof(Byte)); + s->prev = (Posf *) ZALLOC(strm, s->w_size, sizeof(Pos)); + s->head = (Posf *) ZALLOC(strm, s->hash_size, sizeof(Pos)); + + s->lit_bufsize = 1 << (memLevel + 6); /* 16K elements by default */ + + overlay = (ushf *) ZALLOC(strm, s->lit_bufsize, sizeof(ush)+2); + s->pending_buf = (uchf *) overlay; + s->pending_buf_size = (ulg)s->lit_bufsize * (sizeof(ush)+2L); + + if (s->window == Z_NULL || s->prev == Z_NULL || s->head == Z_NULL || + s->pending_buf == Z_NULL) { + strm->msg = (char*)ERR_MSG(Z_MEM_ERROR); + deflateEnd (strm); + return Z_MEM_ERROR; + } + s->d_buf = overlay + s->lit_bufsize/sizeof(ush); + s->l_buf = s->pending_buf + (1+sizeof(ush))*s->lit_bufsize; + + s->level = level; + s->strategy = strategy; + s->method = (Byte)method; + + return deflateReset(strm); +} + +/* ========================================================================= */ +int ZEXPORT deflateSetDictionary (strm, dictionary, dictLength) + z_streamp strm; + const Bytef *dictionary; + uInt dictLength; +{ + deflate_state *s; + uInt length = dictLength; + uInt n; + IPos hash_head = 0; + + if (strm == Z_NULL || strm->state == Z_NULL || dictionary == Z_NULL || + strm->state->status != INIT_STATE) return Z_STREAM_ERROR; + + s = strm->state; + strm->adler = adler32(strm->adler, dictionary, dictLength); + + if (length < MIN_MATCH) return Z_OK; + if (length > MAX_DIST(s)) { + length = MAX_DIST(s); +#ifndef USE_DICT_HEAD + dictionary += dictLength - length; /* use the tail of the dictionary */ +#endif + } + zmemcpy(s->window, dictionary, length); + s->strstart = length; + s->block_start = (long)length; + + /* Insert all strings in the hash table (except for the last two bytes). + * s->lookahead stays null, so s->ins_h will be recomputed at the next + * call of fill_window. + */ + s->ins_h = s->window[0]; + UPDATE_HASH(s, s->ins_h, s->window[1]); + for (n = 0; n <= length - MIN_MATCH; n++) { + INSERT_STRING(s, n, hash_head); + } + if (hash_head) hash_head = 0; /* to make compiler happy */ + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateReset (strm) + z_streamp strm; +{ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL || + strm->zalloc == Z_NULL || strm->zfree == Z_NULL) return Z_STREAM_ERROR; + + strm->total_in = strm->total_out = 0; + strm->msg = Z_NULL; /* use zfree if we ever allocate msg dynamically */ + strm->data_type = Z_UNKNOWN; + + s = (deflate_state *)strm->state; + s->pending = 0; + s->pending_out = s->pending_buf; + + if (s->noheader < 0) { + s->noheader = 0; /* was set to -1 by deflate(..., Z_FINISH); */ + } + s->status = s->noheader ? BUSY_STATE : INIT_STATE; + strm->adler = 1; + s->last_flush = Z_NO_FLUSH; + + _tr_init(s); + lm_init(s); + + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateParams(strm, level, strategy) + z_streamp strm; + int level; + int strategy; +{ + deflate_state *s; + compress_func func; + int err = Z_OK; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = strm->state; + + if (level == Z_DEFAULT_COMPRESSION) { + level = 6; + } + if (level < 0 || level > 9 || strategy < 0 || strategy > Z_HUFFMAN_ONLY) { + return Z_STREAM_ERROR; + } + func = configuration_table[s->level].func; + + if (func != configuration_table[level].func && strm->total_in != 0) { + /* Flush the last buffer: */ + err = deflate(strm, Z_PARTIAL_FLUSH); + } + if (s->level != level) { + s->level = level; + s->max_lazy_match = configuration_table[level].max_lazy; + s->good_match = configuration_table[level].good_length; + s->nice_match = configuration_table[level].nice_length; + s->max_chain_length = configuration_table[level].max_chain; + } + s->strategy = strategy; + return err; +} + +/* ========================================================================= + * Put a short in the pending buffer. The 16-bit value is put in MSB order. + * IN assertion: the stream state is correct and there is enough room in + * pending_buf. + */ +local void putShortMSB (s, b) + deflate_state *s; + uInt b; +{ + put_byte(s, (Byte)(b >> 8)); + put_byte(s, (Byte)(b & 0xff)); +} + +/* ========================================================================= + * Flush as much pending output as possible. All deflate() output goes + * through this function so some applications may wish to modify it + * to avoid allocating a large strm->next_out buffer and copying into it. + * (See also read_buf()). + */ +local void flush_pending(strm) + z_streamp strm; +{ + unsigned len = strm->state->pending; + + if (len > strm->avail_out) len = strm->avail_out; + if (len == 0) return; + + zmemcpy(strm->next_out, strm->state->pending_out, len); + strm->next_out += len; + strm->state->pending_out += len; + strm->total_out += len; + strm->avail_out -= len; + strm->state->pending -= len; + if (strm->state->pending == 0) { + strm->state->pending_out = strm->state->pending_buf; + } +} + +/* ========================================================================= */ +int ZEXPORT deflate (strm, flush) + z_streamp strm; + int flush; +{ + int old_flush; /* value of flush param for previous deflate call */ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL || + flush > Z_FINISH || flush < 0) { + return Z_STREAM_ERROR; + } + s = strm->state; + + if (strm->next_out == Z_NULL || + (strm->next_in == Z_NULL && strm->avail_in != 0) || + (s->status == FINISH_STATE && flush != Z_FINISH)) { + ERR_RETURN(strm, Z_STREAM_ERROR); + } + if (strm->avail_out == 0) ERR_RETURN(strm, Z_BUF_ERROR); + + s->strm = strm; /* just in case */ + old_flush = s->last_flush; + s->last_flush = flush; + + /* Write the zlib header */ + if (s->status == INIT_STATE) { + + uInt header = (Z_DEFLATED + ((s->w_bits-8)<<4)) << 8; + uInt level_flags = (s->level-1) >> 1; + + if (level_flags > 3) level_flags = 3; + header |= (level_flags << 6); + if (s->strstart != 0) header |= PRESET_DICT; + header += 31 - (header % 31); + + s->status = BUSY_STATE; + putShortMSB(s, header); + + /* Save the adler32 of the preset dictionary: */ + if (s->strstart != 0) { + putShortMSB(s, (uInt)(strm->adler >> 16)); + putShortMSB(s, (uInt)(strm->adler & 0xffff)); + } + strm->adler = 1L; + } + + /* Flush as much pending output as possible */ + if (s->pending != 0) { + flush_pending(strm); + if (strm->avail_out == 0) { + /* Since avail_out is 0, deflate will be called again with + * more output space, but possibly with both pending and + * avail_in equal to zero. There won't be anything to do, + * but this is not an error situation so make sure we + * return OK instead of BUF_ERROR at next call of deflate: + */ + s->last_flush = -1; + return Z_OK; + } + + /* Make sure there is something to do and avoid duplicate consecutive + * flushes. For repeated and useless calls with Z_FINISH, we keep + * returning Z_STREAM_END instead of Z_BUFF_ERROR. + */ + } else if (strm->avail_in == 0 && flush <= old_flush && + flush != Z_FINISH) { + ERR_RETURN(strm, Z_BUF_ERROR); + } + + /* User must not provide more input after the first FINISH: */ + if (s->status == FINISH_STATE && strm->avail_in != 0) { + ERR_RETURN(strm, Z_BUF_ERROR); + } + + /* Start a new block or continue the current one. + */ + if (strm->avail_in != 0 || s->lookahead != 0 || + (flush != Z_NO_FLUSH && s->status != FINISH_STATE)) { + block_state bstate; + + bstate = (*(configuration_table[s->level].func))(s, flush); + + if (bstate == finish_started || bstate == finish_done) { + s->status = FINISH_STATE; + } + if (bstate == need_more || bstate == finish_started) { + if (strm->avail_out == 0) { + s->last_flush = -1; /* avoid BUF_ERROR next call, see above */ + } + return Z_OK; + /* If flush != Z_NO_FLUSH && avail_out == 0, the next call + * of deflate should use the same flush parameter to make sure + * that the flush is complete. So we don't have to output an + * empty block here, this will be done at next call. This also + * ensures that for a very small output buffer, we emit at most + * one empty block. + */ + } + if (bstate == block_done) { + if (flush == Z_PARTIAL_FLUSH) { + _tr_align(s); + } else { /* FULL_FLUSH or SYNC_FLUSH */ + _tr_stored_block(s, (char*)0, 0L, 0); + /* For a full flush, this empty block will be recognized + * as a special marker by inflate_sync(). + */ + if (flush == Z_FULL_FLUSH) { + CLEAR_HASH(s); /* forget history */ + } + } + flush_pending(strm); + if (strm->avail_out == 0) { + s->last_flush = -1; /* avoid BUF_ERROR at next call, see above */ + return Z_OK; + } + } + } + Assert(strm->avail_out > 0, "bug2"); + + if (flush != Z_FINISH) return Z_OK; + if (s->noheader) return Z_STREAM_END; + + /* Write the zlib trailer (adler32) */ + putShortMSB(s, (uInt)(strm->adler >> 16)); + putShortMSB(s, (uInt)(strm->adler & 0xffff)); + flush_pending(strm); + /* If avail_out is zero, the application will call deflate again + * to flush the rest. + */ + s->noheader = -1; /* write the trailer only once! */ + return s->pending != 0 ? Z_OK : Z_STREAM_END; +} + +/* ========================================================================= */ +int ZEXPORT deflateEnd (strm) + z_streamp strm; +{ + int status; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + + status = strm->state->status; + if (status != INIT_STATE && status != BUSY_STATE && + status != FINISH_STATE) { + return Z_STREAM_ERROR; + } + + /* Deallocate in reverse order of allocations: */ + TRY_FREE(strm, strm->state->pending_buf); + TRY_FREE(strm, strm->state->head); + TRY_FREE(strm, strm->state->prev); + TRY_FREE(strm, strm->state->window); + + ZFREE(strm, strm->state); + strm->state = Z_NULL; + + return status == BUSY_STATE ? Z_DATA_ERROR : Z_OK; +} + +/* ========================================================================= + * Copy the source state to the destination state. + * To simplify the source, this is not supported for 16-bit MSDOS (which + * doesn't have enough memory anyway to duplicate compression states). + */ +int ZEXPORT deflateCopy (dest, source) + z_streamp dest; + z_streamp source; +{ +#ifdef MAXSEG_64K + return Z_STREAM_ERROR; +#else + deflate_state *ds; + deflate_state *ss; + ushf *overlay; + + + if (source == Z_NULL || dest == Z_NULL || source->state == Z_NULL) { + return Z_STREAM_ERROR; + } + + ss = source->state; + + *dest = *source; + + ds = (deflate_state *) ZALLOC(dest, 1, sizeof(deflate_state)); + if (ds == Z_NULL) return Z_MEM_ERROR; + dest->state = (struct internal_state FAR *) ds; + *ds = *ss; + ds->strm = dest; + + ds->window = (Bytef *) ZALLOC(dest, ds->w_size, 2*sizeof(Byte)); + ds->prev = (Posf *) ZALLOC(dest, ds->w_size, sizeof(Pos)); + ds->head = (Posf *) ZALLOC(dest, ds->hash_size, sizeof(Pos)); + overlay = (ushf *) ZALLOC(dest, ds->lit_bufsize, sizeof(ush)+2); + ds->pending_buf = (uchf *) overlay; + + if (ds->window == Z_NULL || ds->prev == Z_NULL || ds->head == Z_NULL || + ds->pending_buf == Z_NULL) { + deflateEnd (dest); + return Z_MEM_ERROR; + } + /* following zmemcpy do not work for 16-bit MSDOS */ + zmemcpy(ds->window, ss->window, ds->w_size * 2 * sizeof(Byte)); + zmemcpy(ds->prev, ss->prev, ds->w_size * sizeof(Pos)); + zmemcpy(ds->head, ss->head, ds->hash_size * sizeof(Pos)); + zmemcpy(ds->pending_buf, ss->pending_buf, (uInt)ds->pending_buf_size); + + ds->pending_out = ds->pending_buf + (ss->pending_out - ss->pending_buf); + ds->d_buf = overlay + ds->lit_bufsize/sizeof(ush); + ds->l_buf = ds->pending_buf + (1+sizeof(ush))*ds->lit_bufsize; + + ds->l_desc.dyn_tree = ds->dyn_ltree; + ds->d_desc.dyn_tree = ds->dyn_dtree; + ds->bl_desc.dyn_tree = ds->bl_tree; + + return Z_OK; +#endif +} + +/* =========================================================================== + * Read a new buffer from the current input stream, update the adler32 + * and total number of bytes read. All deflate() input goes through + * this function so some applications may wish to modify it to avoid + * allocating a large strm->next_in buffer and copying from it. + * (See also flush_pending()). + */ +local int read_buf(strm, buf, size) + z_streamp strm; + Bytef *buf; + unsigned size; +{ + unsigned len = strm->avail_in; + + if (len > size) len = size; + if (len == 0) return 0; + + strm->avail_in -= len; + + if (!strm->state->noheader) { + strm->adler = adler32(strm->adler, strm->next_in, len); + } + zmemcpy(buf, strm->next_in, len); + strm->next_in += len; + strm->total_in += len; + + return (int)len; +} + +/* =========================================================================== + * Initialize the "longest match" routines for a new zlib stream + */ +local void lm_init (s) + deflate_state *s; +{ + s->window_size = (ulg)2L*s->w_size; + + CLEAR_HASH(s); + + /* Set the default configuration parameters: + */ + s->max_lazy_match = configuration_table[s->level].max_lazy; + s->good_match = configuration_table[s->level].good_length; + s->nice_match = configuration_table[s->level].nice_length; + s->max_chain_length = configuration_table[s->level].max_chain; + + s->strstart = 0; + s->block_start = 0L; + s->lookahead = 0; + s->match_length = s->prev_length = MIN_MATCH-1; + s->match_available = 0; + s->ins_h = 0; +#ifdef ASMV + match_init(); /* initialize the asm code */ +#endif +} + +/* =========================================================================== + * Set match_start to the longest match starting at the given string and + * return its length. Matches shorter or equal to prev_length are discarded, + * in which case the result is equal to prev_length and match_start is + * garbage. + * IN assertions: cur_match is the head of the hash chain for the current + * string (strstart) and its distance is <= MAX_DIST, and prev_length >= 1 + * OUT assertion: the match length is not greater than s->lookahead. + */ +#ifndef ASMV +/* For 80x86 and 680x0, an optimized version will be provided in match.asm or + * match.S. The code will be functionally equivalent. + */ +#ifndef FASTEST +local uInt longest_match(s, cur_match) + deflate_state *s; + IPos cur_match; /* current match */ +{ + unsigned chain_length = s->max_chain_length;/* max hash chain length */ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + int best_len = s->prev_length; /* best match length so far */ + int nice_match = s->nice_match; /* stop if match long enough */ + IPos limit = s->strstart > (IPos)MAX_DIST(s) ? + s->strstart - (IPos)MAX_DIST(s) : NIL; + /* Stop when cur_match becomes <= limit. To simplify the code, + * we prevent matches with the string of window index 0. + */ + Posf *prev = s->prev; + uInt wmask = s->w_mask; + +#ifdef UNALIGNED_OK + /* Compare two bytes at a time. Note: this is not always beneficial. + * Try with and without -DUNALIGNED_OK to check. + */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1; + register ush scan_start = *(ushf*)scan; + register ush scan_end = *(ushf*)(scan+best_len-1); +#else + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + register Byte scan_end1 = scan[best_len-1]; + register Byte scan_end = scan[best_len]; +#endif + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + /* Do not waste too much time if we already have a good match: */ + if (s->prev_length >= s->good_match) { + chain_length >>= 2; + } + /* Do not look for matches beyond the end of the input. This is necessary + * to make deflate deterministic. + */ + if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + do { + Assert(cur_match < s->strstart, "no future"); + match = s->window + cur_match; + + /* Skip to next match if the match length cannot increase + * or if the match length is less than 2: + */ +#if (defined(UNALIGNED_OK) && MAX_MATCH == 258) + /* This code assumes sizeof(unsigned short) == 2. Do not use + * UNALIGNED_OK if your compiler uses a different size. + */ + if (*(ushf*)(match+best_len-1) != scan_end || + *(ushf*)match != scan_start) continue; + + /* It is not necessary to compare scan[2] and match[2] since they are + * always equal when the other bytes match, given that the hash keys + * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at + * strstart+3, +5, ... up to strstart+257. We check for insufficient + * lookahead only every 4th comparison; the 128th check will be made + * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is + * necessary to put more guard bytes at the end of the window, or + * to check more often for insufficient lookahead. + */ + Assert(scan[2] == match[2], "scan[2]?"); + scan++, match++; + do { + } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + scan < strend); + /* The funny "do {}" generates better code on most compilers */ + + /* Here, scan <= window+strstart+257 */ + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + if (*scan == *match) scan++; + + len = (MAX_MATCH - 1) - (int)(strend-scan); + scan = strend - (MAX_MATCH-1); + +#else /* UNALIGNED_OK */ + + if (match[best_len] != scan_end || + match[best_len-1] != scan_end1 || + *match != *scan || + *++match != scan[1]) continue; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match++; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + scan = strend - MAX_MATCH; + +#endif /* UNALIGNED_OK */ + + if (len > best_len) { + s->match_start = cur_match; + best_len = len; + if (len >= nice_match) break; +#ifdef UNALIGNED_OK + scan_end = *(ushf*)(scan+best_len-1); +#else + scan_end1 = scan[best_len-1]; + scan_end = scan[best_len]; +#endif + } + } while ((cur_match = prev[cur_match & wmask]) > limit + && --chain_length != 0); + + if ((uInt)best_len <= s->lookahead) return (uInt)best_len; + return s->lookahead; +} + +#else /* FASTEST */ +/* --------------------------------------------------------------------------- + * Optimized version for level == 1 only + */ +local uInt longest_match(s, cur_match) + deflate_state *s; + IPos cur_match; /* current match */ +{ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + Assert(cur_match < s->strstart, "no future"); + + match = s->window + cur_match; + + /* Return failure if the match length is less than 2: + */ + if (match[0] != scan[0] || match[1] != scan[1]) return MIN_MATCH-1; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match += 2; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + + if (len < MIN_MATCH) return MIN_MATCH - 1; + + s->match_start = cur_match; + return len <= s->lookahead ? len : s->lookahead; +} +#endif /* FASTEST */ +#endif /* ASMV */ + +#ifdef DEBUG +/* =========================================================================== + * Check that the match at match_start is indeed a match. + */ +local void check_match(s, start, match, length) + deflate_state *s; + IPos start, match; + int length; +{ + /* check that the match is indeed a match */ + if (zmemcmp(s->window + match, + s->window + start, length) != EQUAL) { + fprintf(stderr, " start %u, match %u, length %d\n", + start, match, length); + do { + fprintf(stderr, "%c%c", s->window[match++], s->window[start++]); + } while (--length != 0); + z_error("invalid match"); + } + if (z_verbose > 1) { + fprintf(stderr,"\\[%d,%d]", start-match, length); + do { putc(s->window[start++], stderr); } while (--length != 0); + } +} +#else +# define check_match(s, start, match, length) +#endif + +/* =========================================================================== + * Fill the window when the lookahead becomes insufficient. + * Updates strstart and lookahead. + * + * IN assertion: lookahead < MIN_LOOKAHEAD + * OUT assertions: strstart <= window_size-MIN_LOOKAHEAD + * At least one byte has been read, or avail_in == 0; reads are + * performed for at least two bytes (required for the zip translate_eol + * option -- not supported here). + */ +local void fill_window(s) + deflate_state *s; +{ + register unsigned n, m; + register Posf *p; + unsigned more; /* Amount of free space at the end of the window. */ + uInt wsize = s->w_size; + + do { + more = (unsigned)(s->window_size -(ulg)s->lookahead -(ulg)s->strstart); + + /* Deal with !@#$% 64K limit: */ + if (more == 0 && s->strstart == 0 && s->lookahead == 0) { + more = wsize; + + } else if (more == (unsigned)(-1)) { + /* Very unlikely, but possible on 16 bit machine if strstart == 0 + * and lookahead == 1 (input done one byte at time) + */ + more--; + + /* If the window is almost full and there is insufficient lookahead, + * move the upper half to the lower one to make room in the upper half. + */ + } else if (s->strstart >= wsize+MAX_DIST(s)) { + + zmemcpy(s->window, s->window+wsize, (unsigned)wsize); + s->match_start -= wsize; + s->strstart -= wsize; /* we now have strstart >= MAX_DIST */ + s->block_start -= (long) wsize; + + /* Slide the hash table (could be avoided with 32 bit values + at the expense of memory usage). We slide even when level == 0 + to keep the hash table consistent if we switch back to level > 0 + later. (Using level 0 permanently is not an optimal usage of + zlib, so we don't care about this pathological case.) + */ + n = s->hash_size; + p = &s->head[n]; + do { + m = *--p; + *p = (Pos)(m >= wsize ? m-wsize : NIL); + } while (--n); + + n = wsize; +#ifndef FASTEST + p = &s->prev[n]; + do { + m = *--p; + *p = (Pos)(m >= wsize ? m-wsize : NIL); + /* If n is not on any hash chain, prev[n] is garbage but + * its value will never be used. + */ + } while (--n); +#endif + more += wsize; + } + if (s->strm->avail_in == 0) return; + + /* If there was no sliding: + * strstart <= WSIZE+MAX_DIST-1 && lookahead <= MIN_LOOKAHEAD - 1 && + * more == window_size - lookahead - strstart + * => more >= window_size - (MIN_LOOKAHEAD-1 + WSIZE + MAX_DIST-1) + * => more >= window_size - 2*WSIZE + 2 + * In the BIG_MEM or MMAP case (not yet supported), + * window_size == input_size + MIN_LOOKAHEAD && + * strstart + s->lookahead <= input_size => more >= MIN_LOOKAHEAD. + * Otherwise, window_size == 2*WSIZE so more >= 2. + * If there was sliding, more >= WSIZE. So in all cases, more >= 2. + */ + Assert(more >= 2, "more < 2"); + + n = read_buf(s->strm, s->window + s->strstart + s->lookahead, more); + s->lookahead += n; + + /* Initialize the hash value now that we have some input: */ + if (s->lookahead >= MIN_MATCH) { + s->ins_h = s->window[s->strstart]; + UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]); +#if MIN_MATCH != 3 + Call UPDATE_HASH() MIN_MATCH-3 more times +#endif + } + /* If the whole input has less than MIN_MATCH bytes, ins_h is garbage, + * but this is not important since only literal bytes will be emitted. + */ + + } while (s->lookahead < MIN_LOOKAHEAD && s->strm->avail_in != 0); +} + +/* =========================================================================== + * Flush the current block, with given end-of-file flag. + * IN assertion: strstart is set to the end of the current match. + */ +#define FLUSH_BLOCK_ONLY(s, eof) { \ + _tr_flush_block(s, (s->block_start >= 0L ? \ + (charf *)&s->window[(unsigned)s->block_start] : \ + (charf *)Z_NULL), \ + (ulg)((long)s->strstart - s->block_start), \ + (eof)); \ + s->block_start = s->strstart; \ + flush_pending(s->strm); \ + Tracev((stderr,"[FLUSH]")); \ +} + +/* Same but force premature exit if necessary. */ +#define FLUSH_BLOCK(s, eof) { \ + FLUSH_BLOCK_ONLY(s, eof); \ + if (s->strm->avail_out == 0) return (eof) ? finish_started : need_more; \ +} + +/* =========================================================================== + * Copy without compression as much as possible from the input stream, return + * the current block state. + * This function does not insert new strings in the dictionary since + * uncompressible data is probably not useful. This function is used + * only for the level=0 compression option. + * NOTE: this function should be optimized to avoid extra copying from + * window to pending_buf. + */ +local block_state deflate_stored(s, flush) + deflate_state *s; + int flush; +{ + /* Stored blocks are limited to 0xffff bytes, pending_buf is limited + * to pending_buf_size, and each stored block has a 5 byte header: + */ + ulg max_block_size = 0xffff; + ulg max_start; + + if (max_block_size > s->pending_buf_size - 5) { + max_block_size = s->pending_buf_size - 5; + } + + /* Copy as much as possible from input to output: */ + for (;;) { + /* Fill the window as much as possible: */ + if (s->lookahead <= 1) { + + Assert(s->strstart < s->w_size+MAX_DIST(s) || + s->block_start >= (long)s->w_size, "slide too late"); + + fill_window(s); + if (s->lookahead == 0 && flush == Z_NO_FLUSH) return need_more; + + if (s->lookahead == 0) break; /* flush the current block */ + } + Assert(s->block_start >= 0L, "block gone"); + + s->strstart += s->lookahead; + s->lookahead = 0; + + /* Emit a stored block if pending_buf will be full: */ + max_start = s->block_start + max_block_size; + if (s->strstart == 0 || (ulg)s->strstart >= max_start) { + /* strstart == 0 is possible when wraparound on 16-bit machine */ + s->lookahead = (uInt)(s->strstart - max_start); + s->strstart = (uInt)max_start; + FLUSH_BLOCK(s, 0); + } + /* Flush if we may have to slide, otherwise block_start may become + * negative and the data will be gone: + */ + if (s->strstart - (uInt)s->block_start >= MAX_DIST(s)) { + FLUSH_BLOCK(s, 0); + } + } + FLUSH_BLOCK(s, flush == Z_FINISH); + return flush == Z_FINISH ? finish_done : block_done; +} + +/* =========================================================================== + * Compress as much as possible from the input stream, return the current + * block state. + * This function does not perform lazy evaluation of matches and inserts + * new strings in the dictionary only for unmatched strings or for short + * matches. It is used only for the fast compression options. + */ +local block_state deflate_fast(s, flush) + deflate_state *s; + int flush; +{ + IPos hash_head = NIL; /* head of the hash chain */ + int bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s->lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + if (s->lookahead >= MIN_MATCH) { + INSERT_STRING(s, s->strstart, hash_head); + } + + /* Find the longest match, discarding those <= prev_length. + * At this point we have always match_length < MIN_MATCH + */ + if (hash_head != NIL && s->strstart - hash_head <= MAX_DIST(s)) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + if (s->strategy != Z_HUFFMAN_ONLY) { + s->match_length = longest_match (s, hash_head); + } + /* longest_match() sets match_start */ + } + if (s->match_length >= MIN_MATCH) { + check_match(s, s->strstart, s->match_start, s->match_length); + + _tr_tally_dist(s, s->strstart - s->match_start, + s->match_length - MIN_MATCH, bflush); + + s->lookahead -= s->match_length; + + /* Insert new strings in the hash table only if the match length + * is not too large. This saves time but degrades compression. + */ +#ifndef FASTEST + if (s->match_length <= s->max_insert_length && + s->lookahead >= MIN_MATCH) { + s->match_length--; /* string at strstart already in hash table */ + do { + s->strstart++; + INSERT_STRING(s, s->strstart, hash_head); + /* strstart never exceeds WSIZE-MAX_MATCH, so there are + * always MIN_MATCH bytes ahead. + */ + } while (--s->match_length != 0); + s->strstart++; + } else +#endif + { + s->strstart += s->match_length; + s->match_length = 0; + s->ins_h = s->window[s->strstart]; + UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]); +#if MIN_MATCH != 3 + Call UPDATE_HASH() MIN_MATCH-3 more times +#endif + /* If lookahead < MIN_MATCH, ins_h is garbage, but it does not + * matter since it will be recomputed at next deflate call. + */ + } + } else { + /* No match, output a literal byte */ + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + } + if (bflush) FLUSH_BLOCK(s, 0); + } + FLUSH_BLOCK(s, flush == Z_FINISH); + return flush == Z_FINISH ? finish_done : block_done; +} + +/* =========================================================================== + * Same as above, but achieves better compression. We use a lazy + * evaluation for matches: a match is finally adopted only if there is + * no better match at the next window position. + */ +local block_state deflate_slow(s, flush) + deflate_state *s; + int flush; +{ + IPos hash_head = NIL; /* head of hash chain */ + int bflush; /* set if current block must be flushed */ + + /* Process the input block. */ + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s->lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + if (s->lookahead >= MIN_MATCH) { + INSERT_STRING(s, s->strstart, hash_head); + } + + /* Find the longest match, discarding those <= prev_length. + */ + s->prev_length = s->match_length, s->prev_match = s->match_start; + s->match_length = MIN_MATCH-1; + + if (hash_head != NIL && s->prev_length < s->max_lazy_match && + s->strstart - hash_head <= MAX_DIST(s)) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + if (s->strategy != Z_HUFFMAN_ONLY) { + s->match_length = longest_match (s, hash_head); + } + /* longest_match() sets match_start */ + + if (s->match_length <= 5 && (s->strategy == Z_FILTERED || + (s->match_length == MIN_MATCH && + s->strstart - s->match_start > TOO_FAR))) { + + /* If prev_match is also MIN_MATCH, match_start is garbage + * but we will ignore the current match anyway. + */ + s->match_length = MIN_MATCH-1; + } + } + /* If there was a match at the previous step and the current + * match is not better, output the previous match: + */ + if (s->prev_length >= MIN_MATCH && s->match_length <= s->prev_length) { + uInt max_insert = s->strstart + s->lookahead - MIN_MATCH; + /* Do not insert strings in hash table beyond this. */ + + check_match(s, s->strstart-1, s->prev_match, s->prev_length); + + _tr_tally_dist(s, s->strstart -1 - s->prev_match, + s->prev_length - MIN_MATCH, bflush); + + /* Insert in hash table all strings up to the end of the match. + * strstart-1 and strstart are already inserted. If there is not + * enough lookahead, the last two strings are not inserted in + * the hash table. + */ + s->lookahead -= s->prev_length-1; + s->prev_length -= 2; + do { + if (++s->strstart <= max_insert) { + INSERT_STRING(s, s->strstart, hash_head); + } + } while (--s->prev_length != 0); + s->match_available = 0; + s->match_length = MIN_MATCH-1; + s->strstart++; + + if (bflush) FLUSH_BLOCK(s, 0); + + } else if (s->match_available) { + /* If there was no match at the previous position, output a + * single literal. If there was a match but the current match + * is longer, truncate the previous match to a single literal. + */ + Tracevv((stderr,"%c", s->window[s->strstart-1])); + _tr_tally_lit(s, s->window[s->strstart-1], bflush); + if (bflush) { + FLUSH_BLOCK_ONLY(s, 0); + } + s->strstart++; + s->lookahead--; + if (s->strm->avail_out == 0) return need_more; + } else { + /* There is no previous match to compare with, wait for + * the next step to decide. + */ + s->match_available = 1; + s->strstart++; + s->lookahead--; + } + } + Assert (flush != Z_NO_FLUSH, "no flush?"); + if (s->match_available) { + Tracevv((stderr,"%c", s->window[s->strstart-1])); + _tr_tally_lit(s, s->window[s->strstart-1], bflush); + s->match_available = 0; + } + FLUSH_BLOCK(s, flush == Z_FINISH); + return flush == Z_FINISH ? finish_done : block_done; +} diff --git a/zlib/deflate.h b/zlib/deflate.h new file mode 100644 index 0000000..962676d --- /dev/null +++ b/zlib/deflate.h @@ -0,0 +1,318 @@ +/* deflate.h -- internal compression state + * Copyright (C) 1995-1998 Jean-loup Gailly + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* @(#) $Id$ */ + +#ifndef _DEFLATE_H +#define _DEFLATE_H + +#include "zutil.h" + +/* =========================================================================== + * Internal compression state. + */ + +#define LENGTH_CODES 29 +/* number of length codes, not counting the special END_BLOCK code */ + +#define LITERALS 256 +/* number of literal bytes 0..255 */ + +#define L_CODES (LITERALS+1+LENGTH_CODES) +/* number of Literal or Length codes, including the END_BLOCK code */ + +#define D_CODES 30 +/* number of distance codes */ + +#define BL_CODES 19 +/* number of codes used to transfer the bit lengths */ + +#define HEAP_SIZE (2*L_CODES+1) +/* maximum heap size */ + +#define MAX_BITS 15 +/* All codes must not exceed MAX_BITS bits */ + +#define INIT_STATE 42 +#define BUSY_STATE 113 +#define FINISH_STATE 666 +/* Stream status */ + + +/* Data structure describing a single value and its code string. */ +typedef struct ct_data_s { + union { + ush freq; /* frequency count */ + ush code; /* bit string */ + } fc; + union { + ush dad; /* father node in Huffman tree */ + ush len; /* length of bit string */ + } dl; +} FAR ct_data; + +#define Freq fc.freq +#define Code fc.code +#define Dad dl.dad +#define Len dl.len + +typedef struct static_tree_desc_s static_tree_desc; + +typedef struct tree_desc_s { + ct_data *dyn_tree; /* the dynamic tree */ + int max_code; /* largest code with non zero frequency */ + static_tree_desc *stat_desc; /* the corresponding static tree */ +} FAR tree_desc; + +typedef ush Pos; +typedef Pos FAR Posf; +typedef unsigned IPos; + +/* A Pos is an index in the character window. We use short instead of int to + * save space in the various tables. IPos is used only for parameter passing. + */ + +typedef struct internal_state { + z_streamp strm; /* pointer back to this zlib stream */ + int status; /* as the name implies */ + Bytef *pending_buf; /* output still pending */ + ulg pending_buf_size; /* size of pending_buf */ + Bytef *pending_out; /* next pending byte to output to the stream */ + int pending; /* nb of bytes in the pending buffer */ + int noheader; /* suppress zlib header and adler32 */ + Byte data_type; /* UNKNOWN, BINARY or ASCII */ + Byte method; /* STORED (for zip only) or DEFLATED */ + int last_flush; /* value of flush param for previous deflate call */ + + /* used by deflate.c: */ + + uInt w_size; /* LZ77 window size (32K by default) */ + uInt w_bits; /* log2(w_size) (8..16) */ + uInt w_mask; /* w_size - 1 */ + + Bytef *window; + /* Sliding window. Input bytes are read into the second half of the window, + * and move to the first half later to keep a dictionary of at least wSize + * bytes. With this organization, matches are limited to a distance of + * wSize-MAX_MATCH bytes, but this ensures that IO is always + * performed with a length multiple of the block size. Also, it limits + * the window size to 64K, which is quite useful on MSDOS. + * To do: use the user input buffer as sliding window. + */ + + ulg window_size; + /* Actual size of window: 2*wSize, except when the user input buffer + * is directly used as sliding window. + */ + + Posf *prev; + /* Link to older string with same hash index. To limit the size of this + * array to 64K, this link is maintained only for the last 32K strings. + * An index in this array is thus a window index modulo 32K. + */ + + Posf *head; /* Heads of the hash chains or NIL. */ + + uInt ins_h; /* hash index of string to be inserted */ + uInt hash_size; /* number of elements in hash table */ + uInt hash_bits; /* log2(hash_size) */ + uInt hash_mask; /* hash_size-1 */ + + uInt hash_shift; + /* Number of bits by which ins_h must be shifted at each input + * step. It must be such that after MIN_MATCH steps, the oldest + * byte no longer takes part in the hash key, that is: + * hash_shift * MIN_MATCH >= hash_bits + */ + + long block_start; + /* Window position at the beginning of the current output block. Gets + * negative when the window is moved backwards. + */ + + uInt match_length; /* length of best match */ + IPos prev_match; /* previous match */ + int match_available; /* set if previous match exists */ + uInt strstart; /* start of string to insert */ + uInt match_start; /* start of matching string */ + uInt lookahead; /* number of valid bytes ahead in window */ + + uInt prev_length; + /* Length of the best match at previous step. Matches not greater than this + * are discarded. This is used in the lazy match evaluation. + */ + + uInt max_chain_length; + /* To speed up deflation, hash chains are never searched beyond this + * length. A higher limit improves compression ratio but degrades the + * speed. + */ + + uInt max_lazy_match; + /* Attempt to find a better match only when the current match is strictly + * smaller than this value. This mechanism is used only for compression + * levels >= 4. + */ +# define max_insert_length max_lazy_match + /* Insert new strings in the hash table only if the match length is not + * greater than this length. This saves time but degrades compression. + * max_insert_length is used only for compression levels <= 3. + */ + + int level; /* compression level (1..9) */ + int strategy; /* favor or force Huffman coding*/ + + uInt good_match; + /* Use a faster search when the previous match is longer than this */ + + int nice_match; /* Stop searching when current match exceeds this */ + + /* used by trees.c: */ + /* Didn't use ct_data typedef below to supress compiler warning */ + struct ct_data_s dyn_ltree[HEAP_SIZE]; /* literal and length tree */ + struct ct_data_s dyn_dtree[2*D_CODES+1]; /* distance tree */ + struct ct_data_s bl_tree[2*BL_CODES+1]; /* Huffman tree for bit lengths */ + + struct tree_desc_s l_desc; /* desc. for literal tree */ + struct tree_desc_s d_desc; /* desc. for distance tree */ + struct tree_desc_s bl_desc; /* desc. for bit length tree */ + + ush bl_count[MAX_BITS+1]; + /* number of codes at each bit length for an optimal tree */ + + int heap[2*L_CODES+1]; /* heap used to build the Huffman trees */ + int heap_len; /* number of elements in the heap */ + int heap_max; /* element of largest frequency */ + /* The sons of heap[n] are heap[2*n] and heap[2*n+1]. heap[0] is not used. + * The same heap array is used to build all trees. + */ + + uch depth[2*L_CODES+1]; + /* Depth of each subtree used as tie breaker for trees of equal frequency + */ + + uchf *l_buf; /* buffer for literals or lengths */ + + uInt lit_bufsize; + /* Size of match buffer for literals/lengths. There are 4 reasons for + * limiting lit_bufsize to 64K: + * - frequencies can be kept in 16 bit counters + * - if compression is not successful for the first block, all input + * data is still in the window so we can still emit a stored block even + * when input comes from standard input. (This can also be done for + * all blocks if lit_bufsize is not greater than 32K.) + * - if compression is not successful for a file smaller than 64K, we can + * even emit a stored file instead of a stored block (saving 5 bytes). + * This is applicable only for zip (not gzip or zlib). + * - creating new Huffman trees less frequently may not provide fast + * adaptation to changes in the input data statistics. (Take for + * example a binary file with poorly compressible code followed by + * a highly compressible string table.) Smaller buffer sizes give + * fast adaptation but have of course the overhead of transmitting + * trees more frequently. + * - I can't count above 4 + */ + + uInt last_lit; /* running index in l_buf */ + + ushf *d_buf; + /* Buffer for distances. To simplify the code, d_buf and l_buf have + * the same number of elements. To use different lengths, an extra flag + * array would be necessary. + */ + + ulg opt_len; /* bit length of current block with optimal trees */ + ulg static_len; /* bit length of current block with static trees */ + uInt matches; /* number of string matches in current block */ + int last_eob_len; /* bit length of EOB code for last block */ + +#ifdef DEBUG + ulg compressed_len; /* total bit length of compressed file mod 2^32 */ + ulg bits_sent; /* bit length of compressed data sent mod 2^32 */ +#endif + + ush bi_buf; + /* Output buffer. bits are inserted starting at the bottom (least + * significant bits). + */ + int bi_valid; + /* Number of valid bits in bi_buf. All bits above the last valid bit + * are always zero. + */ + +} FAR deflate_state; + +/* Output a byte on the stream. + * IN assertion: there is enough room in pending_buf. + */ +#define put_byte(s, c) {s->pending_buf[s->pending++] = (c);} + + +#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1) +/* Minimum amount of lookahead, except at the end of the input file. + * See deflate.c for comments about the MIN_MATCH+1. + */ + +#define MAX_DIST(s) ((s)->w_size-MIN_LOOKAHEAD) +/* In order to simplify the code, particularly on 16 bit machines, match + * distances are limited to MAX_DIST instead of WSIZE. + */ + + /* in trees.c */ +void _tr_init OF((deflate_state *s)); +int _tr_tally OF((deflate_state *s, unsigned dist, unsigned lc)); +void _tr_flush_block OF((deflate_state *s, charf *buf, ulg stored_len, + int eof)); +void _tr_align OF((deflate_state *s)); +void _tr_stored_block OF((deflate_state *s, charf *buf, ulg stored_len, + int eof)); + +#define d_code(dist) \ + ((dist) < 256 ? _dist_code[dist] : _dist_code[256+((dist)>>7)]) +/* Mapping from a distance to a distance code. dist is the distance - 1 and + * must not have side effects. _dist_code[256] and _dist_code[257] are never + * used. + */ + +#ifndef DEBUG +/* Inline versions of _tr_tally for speed: */ + +#if defined(GEN_TREES_H) || !defined(STDC) + extern uch _length_code[]; + extern uch _dist_code[]; +#else + extern const uch _length_code[]; + extern const uch _dist_code[]; +#endif + +# define _tr_tally_lit(s, c, flush) \ + { uch cc = (c); \ + s->d_buf[s->last_lit] = 0; \ + s->l_buf[s->last_lit++] = cc; \ + s->dyn_ltree[cc].Freq++; \ + flush = (s->last_lit == s->lit_bufsize-1); \ + } +# define _tr_tally_dist(s, distance, length, flush) \ + { uch len = (length); \ + ush dist = (distance); \ + s->d_buf[s->last_lit] = dist; \ + s->l_buf[s->last_lit++] = len; \ + dist--; \ + s->dyn_ltree[_length_code[len]+LITERALS+1].Freq++; \ + s->dyn_dtree[d_code(dist)].Freq++; \ + flush = (s->last_lit == s->lit_bufsize-1); \ + } +#else +# define _tr_tally_lit(s, c, flush) flush = _tr_tally(s, 0, c) +# define _tr_tally_dist(s, distance, length, flush) \ + flush = _tr_tally(s, distance, length) +#endif + +#endif diff --git a/zlib/descrip.mms b/zlib/descrip.mms new file mode 100644 index 0000000..9d36459 --- /dev/null +++ b/zlib/descrip.mms @@ -0,0 +1,48 @@ +# descrip.mms: MMS description file for building zlib on VMS +# written by Martin P.J. Zinser + +cc_defs = +c_deb = + +.ifdef __DECC__ +pref = /prefix=all +.endif + +OBJS = adler32.obj, compress.obj, crc32.obj, gzio.obj, uncompr.obj,\ + deflate.obj, trees.obj, zutil.obj, inflate.obj, infblock.obj,\ + inftrees.obj, infcodes.obj, infutil.obj, inffast.obj + +CFLAGS= $(C_DEB) $(CC_DEFS) $(PREF) + +all : example.exe minigzip.exe + @ write sys$output " Example applications available" +libz.olb : libz.olb($(OBJS)) + @ write sys$output " libz available" + +example.exe : example.obj libz.olb + link example,libz.olb/lib + +minigzip.exe : minigzip.obj libz.olb + link minigzip,libz.olb/lib,x11vms:xvmsutils.olb/lib + +clean : + delete *.obj;*,libz.olb;* + + +# Other dependencies. +adler32.obj : zutil.h zlib.h zconf.h +compress.obj : zlib.h zconf.h +crc32.obj : zutil.h zlib.h zconf.h +deflate.obj : deflate.h zutil.h zlib.h zconf.h +example.obj : zlib.h zconf.h +gzio.obj : zutil.h zlib.h zconf.h +infblock.obj : zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h +infcodes.obj : zutil.h zlib.h zconf.h inftrees.h infutil.h infcodes.h inffast.h +inffast.obj : zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h +inflate.obj : zutil.h zlib.h zconf.h infblock.h +inftrees.obj : zutil.h zlib.h zconf.h inftrees.h +infutil.obj : zutil.h zlib.h zconf.h inftrees.h infutil.h +minigzip.obj : zlib.h zconf.h +trees.obj : deflate.h zutil.h zlib.h zconf.h +uncompr.obj : zlib.h zconf.h +zutil.obj : zutil.h zlib.h zconf.h diff --git a/zlib/example.c b/zlib/example.c new file mode 100644 index 0000000..8307c84 --- /dev/null +++ b/zlib/example.c @@ -0,0 +1,556 @@ +/* example.c -- usage example of the zlib compression library + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include +#include "zlib.h" + +#ifdef STDC +# include +# include +#else + extern void exit OF((int)); +#endif + +#if defined(VMS) || defined(RISCOS) +# define TESTFILE "foo-gz" +#else +# define TESTFILE "foo.gz" +#endif + +#define CHECK_ERR(err, msg) { \ + if (err != Z_OK) { \ + fprintf(stderr, "%s error: %d\n", msg, err); \ + exit(1); \ + } \ +} + +const char hello[] = "hello, hello!"; +/* "hello world" would be more standard, but the repeated "hello" + * stresses the compression code better, sorry... + */ + +const char dictionary[] = "hello"; +uLong dictId; /* Adler32 value of the dictionary */ + +void test_compress OF((Byte *compr, uLong comprLen, + Byte *uncompr, uLong uncomprLen)); +void test_gzio OF((const char *out, const char *in, + Byte *uncompr, int uncomprLen)); +void test_deflate OF((Byte *compr, uLong comprLen)); +void test_inflate OF((Byte *compr, uLong comprLen, + Byte *uncompr, uLong uncomprLen)); +void test_large_deflate OF((Byte *compr, uLong comprLen, + Byte *uncompr, uLong uncomprLen)); +void test_large_inflate OF((Byte *compr, uLong comprLen, + Byte *uncompr, uLong uncomprLen)); +void test_flush OF((Byte *compr, uLong *comprLen)); +void test_sync OF((Byte *compr, uLong comprLen, + Byte *uncompr, uLong uncomprLen)); +void test_dict_deflate OF((Byte *compr, uLong comprLen)); +void test_dict_inflate OF((Byte *compr, uLong comprLen, + Byte *uncompr, uLong uncomprLen)); +int main OF((int argc, char *argv[])); + +/* =========================================================================== + * Test compress() and uncompress() + */ +void test_compress(compr, comprLen, uncompr, uncomprLen) + Byte *compr, *uncompr; + uLong comprLen, uncomprLen; +{ + int err; + uLong len = strlen(hello)+1; + + err = compress(compr, &comprLen, (const Bytef*)hello, len); + CHECK_ERR(err, "compress"); + + strcpy((char*)uncompr, "garbage"); + + err = uncompress(uncompr, &uncomprLen, compr, comprLen); + CHECK_ERR(err, "uncompress"); + + if (strcmp((char*)uncompr, hello)) { + fprintf(stderr, "bad uncompress\n"); + exit(1); + } else { + printf("uncompress(): %s\n", (char *)uncompr); + } +} + +/* =========================================================================== + * Test read/write of .gz files + */ +void test_gzio(out, in, uncompr, uncomprLen) + const char *out; /* compressed output file */ + const char *in; /* compressed input file */ + Byte *uncompr; + int uncomprLen; +{ + int err; + int len = strlen(hello)+1; + gzFile file; + z_off_t pos; + + file = gzopen(out, "wb"); + if (file == NULL) { + fprintf(stderr, "gzopen error\n"); + exit(1); + } + gzputc(file, 'h'); + if (gzputs(file, "ello") != 4) { + fprintf(stderr, "gzputs err: %s\n", gzerror(file, &err)); + exit(1); + } + if (gzprintf(file, ", %s!", "hello") != 8) { + fprintf(stderr, "gzprintf err: %s\n", gzerror(file, &err)); + exit(1); + } + gzseek(file, 1L, SEEK_CUR); /* add one zero byte */ + gzclose(file); + + file = gzopen(in, "rb"); + if (file == NULL) { + fprintf(stderr, "gzopen error\n"); + } + strcpy((char*)uncompr, "garbage"); + + uncomprLen = gzread(file, uncompr, (unsigned)uncomprLen); + if (uncomprLen != len) { + fprintf(stderr, "gzread err: %s\n", gzerror(file, &err)); + exit(1); + } + if (strcmp((char*)uncompr, hello)) { + fprintf(stderr, "bad gzread: %s\n", (char*)uncompr); + exit(1); + } else { + printf("gzread(): %s\n", (char *)uncompr); + } + + pos = gzseek(file, -8L, SEEK_CUR); + if (pos != 6 || gztell(file) != pos) { + fprintf(stderr, "gzseek error, pos=%ld, gztell=%ld\n", + (long)pos, (long)gztell(file)); + exit(1); + } + + if (gzgetc(file) != ' ') { + fprintf(stderr, "gzgetc error\n"); + exit(1); + } + + gzgets(file, (char*)uncompr, uncomprLen); + uncomprLen = strlen((char*)uncompr); + if (uncomprLen != 6) { /* "hello!" */ + fprintf(stderr, "gzgets err after gzseek: %s\n", gzerror(file, &err)); + exit(1); + } + if (strcmp((char*)uncompr, hello+7)) { + fprintf(stderr, "bad gzgets after gzseek\n"); + exit(1); + } else { + printf("gzgets() after gzseek: %s\n", (char *)uncompr); + } + + gzclose(file); +} + +/* =========================================================================== + * Test deflate() with small buffers + */ +void test_deflate(compr, comprLen) + Byte *compr; + uLong comprLen; +{ + z_stream c_stream; /* compression stream */ + int err; + int len = strlen(hello)+1; + + c_stream.zalloc = (alloc_func)0; + c_stream.zfree = (free_func)0; + c_stream.opaque = (voidpf)0; + + err = deflateInit(&c_stream, Z_DEFAULT_COMPRESSION); + CHECK_ERR(err, "deflateInit"); + + c_stream.next_in = (Bytef*)hello; + c_stream.next_out = compr; + + while (c_stream.total_in != (uLong)len && c_stream.total_out < comprLen) { + c_stream.avail_in = c_stream.avail_out = 1; /* force small buffers */ + err = deflate(&c_stream, Z_NO_FLUSH); + CHECK_ERR(err, "deflate"); + } + /* Finish the stream, still forcing small buffers: */ + for (;;) { + c_stream.avail_out = 1; + err = deflate(&c_stream, Z_FINISH); + if (err == Z_STREAM_END) break; + CHECK_ERR(err, "deflate"); + } + + err = deflateEnd(&c_stream); + CHECK_ERR(err, "deflateEnd"); +} + +/* =========================================================================== + * Test inflate() with small buffers + */ +void test_inflate(compr, comprLen, uncompr, uncomprLen) + Byte *compr, *uncompr; + uLong comprLen, uncomprLen; +{ + int err; + z_stream d_stream; /* decompression stream */ + + strcpy((char*)uncompr, "garbage"); + + d_stream.zalloc = (alloc_func)0; + d_stream.zfree = (free_func)0; + d_stream.opaque = (voidpf)0; + + d_stream.next_in = compr; + d_stream.avail_in = 0; + d_stream.next_out = uncompr; + + err = inflateInit(&d_stream); + CHECK_ERR(err, "inflateInit"); + + while (d_stream.total_out < uncomprLen && d_stream.total_in < comprLen) { + d_stream.avail_in = d_stream.avail_out = 1; /* force small buffers */ + err = inflate(&d_stream, Z_NO_FLUSH); + if (err == Z_STREAM_END) break; + CHECK_ERR(err, "inflate"); + } + + err = inflateEnd(&d_stream); + CHECK_ERR(err, "inflateEnd"); + + if (strcmp((char*)uncompr, hello)) { + fprintf(stderr, "bad inflate\n"); + exit(1); + } else { + printf("inflate(): %s\n", (char *)uncompr); + } +} + +/* =========================================================================== + * Test deflate() with large buffers and dynamic change of compression level + */ +void test_large_deflate(compr, comprLen, uncompr, uncomprLen) + Byte *compr, *uncompr; + uLong comprLen, uncomprLen; +{ + z_stream c_stream; /* compression stream */ + int err; + + c_stream.zalloc = (alloc_func)0; + c_stream.zfree = (free_func)0; + c_stream.opaque = (voidpf)0; + + err = deflateInit(&c_stream, Z_BEST_SPEED); + CHECK_ERR(err, "deflateInit"); + + c_stream.next_out = compr; + c_stream.avail_out = (uInt)comprLen; + + /* At this point, uncompr is still mostly zeroes, so it should compress + * very well: + */ + c_stream.next_in = uncompr; + c_stream.avail_in = (uInt)uncomprLen; + err = deflate(&c_stream, Z_NO_FLUSH); + CHECK_ERR(err, "deflate"); + if (c_stream.avail_in != 0) { + fprintf(stderr, "deflate not greedy\n"); + exit(1); + } + + /* Feed in already compressed data and switch to no compression: */ + deflateParams(&c_stream, Z_NO_COMPRESSION, Z_DEFAULT_STRATEGY); + c_stream.next_in = compr; + c_stream.avail_in = (uInt)comprLen/2; + err = deflate(&c_stream, Z_NO_FLUSH); + CHECK_ERR(err, "deflate"); + + /* Switch back to compressing mode: */ + deflateParams(&c_stream, Z_BEST_COMPRESSION, Z_FILTERED); + c_stream.next_in = uncompr; + c_stream.avail_in = (uInt)uncomprLen; + err = deflate(&c_stream, Z_NO_FLUSH); + CHECK_ERR(err, "deflate"); + + err = deflate(&c_stream, Z_FINISH); + if (err != Z_STREAM_END) { + fprintf(stderr, "deflate should report Z_STREAM_END\n"); + exit(1); + } + err = deflateEnd(&c_stream); + CHECK_ERR(err, "deflateEnd"); +} + +/* =========================================================================== + * Test inflate() with large buffers + */ +void test_large_inflate(compr, comprLen, uncompr, uncomprLen) + Byte *compr, *uncompr; + uLong comprLen, uncomprLen; +{ + int err; + z_stream d_stream; /* decompression stream */ + + strcpy((char*)uncompr, "garbage"); + + d_stream.zalloc = (alloc_func)0; + d_stream.zfree = (free_func)0; + d_stream.opaque = (voidpf)0; + + d_stream.next_in = compr; + d_stream.avail_in = (uInt)comprLen; + + err = inflateInit(&d_stream); + CHECK_ERR(err, "inflateInit"); + + for (;;) { + d_stream.next_out = uncompr; /* discard the output */ + d_stream.avail_out = (uInt)uncomprLen; + err = inflate(&d_stream, Z_NO_FLUSH); + if (err == Z_STREAM_END) break; + CHECK_ERR(err, "large inflate"); + } + + err = inflateEnd(&d_stream); + CHECK_ERR(err, "inflateEnd"); + + if (d_stream.total_out != 2*uncomprLen + comprLen/2) { + fprintf(stderr, "bad large inflate: %ld\n", d_stream.total_out); + exit(1); + } else { + printf("large_inflate(): OK\n"); + } +} + +/* =========================================================================== + * Test deflate() with full flush + */ +void test_flush(compr, comprLen) + Byte *compr; + uLong *comprLen; +{ + z_stream c_stream; /* compression stream */ + int err; + int len = strlen(hello)+1; + + c_stream.zalloc = (alloc_func)0; + c_stream.zfree = (free_func)0; + c_stream.opaque = (voidpf)0; + + err = deflateInit(&c_stream, Z_DEFAULT_COMPRESSION); + CHECK_ERR(err, "deflateInit"); + + c_stream.next_in = (Bytef*)hello; + c_stream.next_out = compr; + c_stream.avail_in = 3; + c_stream.avail_out = (uInt)*comprLen; + err = deflate(&c_stream, Z_FULL_FLUSH); + CHECK_ERR(err, "deflate"); + + compr[3]++; /* force an error in first compressed block */ + c_stream.avail_in = len - 3; + + err = deflate(&c_stream, Z_FINISH); + if (err != Z_STREAM_END) { + CHECK_ERR(err, "deflate"); + } + err = deflateEnd(&c_stream); + CHECK_ERR(err, "deflateEnd"); + + *comprLen = c_stream.total_out; +} + +/* =========================================================================== + * Test inflateSync() + */ +void test_sync(compr, comprLen, uncompr, uncomprLen) + Byte *compr, *uncompr; + uLong comprLen, uncomprLen; +{ + int err; + z_stream d_stream; /* decompression stream */ + + strcpy((char*)uncompr, "garbage"); + + d_stream.zalloc = (alloc_func)0; + d_stream.zfree = (free_func)0; + d_stream.opaque = (voidpf)0; + + d_stream.next_in = compr; + d_stream.avail_in = 2; /* just read the zlib header */ + + err = inflateInit(&d_stream); + CHECK_ERR(err, "inflateInit"); + + d_stream.next_out = uncompr; + d_stream.avail_out = (uInt)uncomprLen; + + inflate(&d_stream, Z_NO_FLUSH); + CHECK_ERR(err, "inflate"); + + d_stream.avail_in = (uInt)comprLen-2; /* read all compressed data */ + err = inflateSync(&d_stream); /* but skip the damaged part */ + CHECK_ERR(err, "inflateSync"); + + err = inflate(&d_stream, Z_FINISH); + if (err != Z_DATA_ERROR) { + fprintf(stderr, "inflate should report DATA_ERROR\n"); + /* Because of incorrect adler32 */ + exit(1); + } + err = inflateEnd(&d_stream); + CHECK_ERR(err, "inflateEnd"); + + printf("after inflateSync(): hel%s\n", (char *)uncompr); +} + +/* =========================================================================== + * Test deflate() with preset dictionary + */ +void test_dict_deflate(compr, comprLen) + Byte *compr; + uLong comprLen; +{ + z_stream c_stream; /* compression stream */ + int err; + + c_stream.zalloc = (alloc_func)0; + c_stream.zfree = (free_func)0; + c_stream.opaque = (voidpf)0; + + err = deflateInit(&c_stream, Z_BEST_COMPRESSION); + CHECK_ERR(err, "deflateInit"); + + err = deflateSetDictionary(&c_stream, + (const Bytef*)dictionary, sizeof(dictionary)); + CHECK_ERR(err, "deflateSetDictionary"); + + dictId = c_stream.adler; + c_stream.next_out = compr; + c_stream.avail_out = (uInt)comprLen; + + c_stream.next_in = (Bytef*)hello; + c_stream.avail_in = (uInt)strlen(hello)+1; + + err = deflate(&c_stream, Z_FINISH); + if (err != Z_STREAM_END) { + fprintf(stderr, "deflate should report Z_STREAM_END\n"); + exit(1); + } + err = deflateEnd(&c_stream); + CHECK_ERR(err, "deflateEnd"); +} + +/* =========================================================================== + * Test inflate() with a preset dictionary + */ +void test_dict_inflate(compr, comprLen, uncompr, uncomprLen) + Byte *compr, *uncompr; + uLong comprLen, uncomprLen; +{ + int err; + z_stream d_stream; /* decompression stream */ + + strcpy((char*)uncompr, "garbage"); + + d_stream.zalloc = (alloc_func)0; + d_stream.zfree = (free_func)0; + d_stream.opaque = (voidpf)0; + + d_stream.next_in = compr; + d_stream.avail_in = (uInt)comprLen; + + err = inflateInit(&d_stream); + CHECK_ERR(err, "inflateInit"); + + d_stream.next_out = uncompr; + d_stream.avail_out = (uInt)uncomprLen; + + for (;;) { + err = inflate(&d_stream, Z_NO_FLUSH); + if (err == Z_STREAM_END) break; + if (err == Z_NEED_DICT) { + if (d_stream.adler != dictId) { + fprintf(stderr, "unexpected dictionary"); + exit(1); + } + err = inflateSetDictionary(&d_stream, (const Bytef*)dictionary, + sizeof(dictionary)); + } + CHECK_ERR(err, "inflate with dict"); + } + + err = inflateEnd(&d_stream); + CHECK_ERR(err, "inflateEnd"); + + if (strcmp((char*)uncompr, hello)) { + fprintf(stderr, "bad inflate with dict\n"); + exit(1); + } else { + printf("inflate with dictionary: %s\n", (char *)uncompr); + } +} + +/* =========================================================================== + * Usage: example [output.gz [input.gz]] + */ + +int main(argc, argv) + int argc; + char *argv[]; +{ + Byte *compr, *uncompr; + uLong comprLen = 10000*sizeof(int); /* don't overflow on MSDOS */ + uLong uncomprLen = comprLen; + static const char* myVersion = ZLIB_VERSION; + + if (zlibVersion()[0] != myVersion[0]) { + fprintf(stderr, "incompatible zlib version\n"); + exit(1); + + } else if (strcmp(zlibVersion(), ZLIB_VERSION) != 0) { + fprintf(stderr, "warning: different zlib version\n"); + } + + compr = (Byte*)calloc((uInt)comprLen, 1); + uncompr = (Byte*)calloc((uInt)uncomprLen, 1); + /* compr and uncompr are cleared to avoid reading uninitialized + * data and to ensure that uncompr compresses well. + */ + if (compr == Z_NULL || uncompr == Z_NULL) { + printf("out of memory\n"); + exit(1); + } + test_compress(compr, comprLen, uncompr, uncomprLen); + + test_gzio((argc > 1 ? argv[1] : TESTFILE), + (argc > 2 ? argv[2] : TESTFILE), + uncompr, (int)uncomprLen); + + test_deflate(compr, comprLen); + test_inflate(compr, comprLen, uncompr, uncomprLen); + + test_large_deflate(compr, comprLen, uncompr, uncomprLen); + test_large_inflate(compr, comprLen, uncompr, uncomprLen); + + test_flush(compr, &comprLen); + test_sync(compr, comprLen, uncompr, uncomprLen); + comprLen = uncomprLen; + + test_dict_deflate(compr, comprLen); + test_dict_inflate(compr, comprLen, uncompr, uncomprLen); + + exit(0); + return 0; /* to avoid warning */ +} diff --git a/zlib/gzio.c b/zlib/gzio.c new file mode 100644 index 0000000..f7c336a --- /dev/null +++ b/zlib/gzio.c @@ -0,0 +1,875 @@ +/* gzio.c -- IO on .gz files + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + * + * Compile this file with -DNO_DEFLATE to avoid the compression code. + */ + +/* @(#) $Id$ */ + +#include + +#include "zutil.h" + +struct internal_state {int dummy;}; /* for buggy compilers */ + +#ifndef Z_BUFSIZE +# ifdef MAXSEG_64K +# define Z_BUFSIZE 4096 /* minimize memory usage for 16-bit DOS */ +# else +# define Z_BUFSIZE 16384 +# endif +#endif +#ifndef Z_PRINTF_BUFSIZE +# define Z_PRINTF_BUFSIZE 4096 +#endif + +#define ALLOC(size) malloc(size) +#define TRYFREE(p) {if (p) free(p);} + +static int gz_magic[2] = {0x1f, 0x8b}; /* gzip magic header */ + +/* gzip flag byte */ +#define ASCII_FLAG 0x01 /* bit 0 set: file probably ascii text */ +#define HEAD_CRC 0x02 /* bit 1 set: header CRC present */ +#define EXTRA_FIELD 0x04 /* bit 2 set: extra field present */ +#define ORIG_NAME 0x08 /* bit 3 set: original file name present */ +#define COMMENT 0x10 /* bit 4 set: file comment present */ +#define RESERVED 0xE0 /* bits 5..7: reserved */ + +typedef struct gz_stream { + z_stream stream; + int z_err; /* error code for last stream operation */ + int z_eof; /* set if end of input file */ + FILE *file; /* .gz file */ + Byte *inbuf; /* input buffer */ + Byte *outbuf; /* output buffer */ + uLong crc; /* crc32 of uncompressed data */ + char *msg; /* error message */ + char *path; /* path name for debugging only */ + int transparent; /* 1 if input file is not a .gz file */ + char mode; /* 'w' or 'r' */ + long startpos; /* start of compressed data in file (header skipped) */ +} gz_stream; + + +local gzFile gz_open OF((const char *path, const char *mode, int fd)); +local int do_flush OF((gzFile file, int flush)); +local int get_byte OF((gz_stream *s)); +local void check_header OF((gz_stream *s)); +local int destroy OF((gz_stream *s)); +local void putLong OF((FILE *file, uLong x)); +local uLong getLong OF((gz_stream *s)); + +/* =========================================================================== + Opens a gzip (.gz) file for reading or writing. The mode parameter + is as in fopen ("rb" or "wb"). The file is given either by file descriptor + or path name (if fd == -1). + gz_open return NULL if the file could not be opened or if there was + insufficient memory to allocate the (de)compression state; errno + can be checked to distinguish the two cases (if errno is zero, the + zlib error is Z_MEM_ERROR). +*/ +local gzFile gz_open (path, mode, fd) + const char *path; + const char *mode; + int fd; +{ + int err; + int level = Z_DEFAULT_COMPRESSION; /* compression level */ + int strategy = Z_DEFAULT_STRATEGY; /* compression strategy */ + char *p = (char*)mode; + gz_stream *s; + char fmode[80]; /* copy of mode, without the compression level */ + char *m = fmode; + + if (!path || !mode) return Z_NULL; + + s = (gz_stream *)ALLOC(sizeof(gz_stream)); + if (!s) return Z_NULL; + + s->stream.zalloc = (alloc_func)0; + s->stream.zfree = (free_func)0; + s->stream.opaque = (voidpf)0; + s->stream.next_in = s->inbuf = Z_NULL; + s->stream.next_out = s->outbuf = Z_NULL; + s->stream.avail_in = s->stream.avail_out = 0; + s->file = NULL; + s->z_err = Z_OK; + s->z_eof = 0; + s->crc = crc32(0L, Z_NULL, 0); + s->msg = NULL; + s->transparent = 0; + + s->path = (char*)ALLOC(strlen(path)+1); + if (s->path == NULL) { + return destroy(s), (gzFile)Z_NULL; + } + strcpy(s->path, path); /* do this early for debugging */ + + s->mode = '\0'; + do { + if (*p == 'r') s->mode = 'r'; + if (*p == 'w' || *p == 'a') s->mode = 'w'; + if (*p >= '0' && *p <= '9') { + level = *p - '0'; + } else if (*p == 'f') { + strategy = Z_FILTERED; + } else if (*p == 'h') { + strategy = Z_HUFFMAN_ONLY; + } else { + *m++ = *p; /* copy the mode */ + } + } while (*p++ && m != fmode + sizeof(fmode)); + if (s->mode == '\0') return destroy(s), (gzFile)Z_NULL; + + if (s->mode == 'w') { +#ifdef NO_DEFLATE + err = Z_STREAM_ERROR; +#else + err = deflateInit2(&(s->stream), level, + Z_DEFLATED, -MAX_WBITS, DEF_MEM_LEVEL, strategy); + /* windowBits is passed < 0 to suppress zlib header */ + + s->stream.next_out = s->outbuf = (Byte*)ALLOC(Z_BUFSIZE); +#endif + if (err != Z_OK || s->outbuf == Z_NULL) { + return destroy(s), (gzFile)Z_NULL; + } + } else { + s->stream.next_in = s->inbuf = (Byte*)ALLOC(Z_BUFSIZE); + + err = inflateInit2(&(s->stream), -MAX_WBITS); + /* windowBits is passed < 0 to tell that there is no zlib header. + * Note that in this case inflate *requires* an extra "dummy" byte + * after the compressed stream in order to complete decompression and + * return Z_STREAM_END. Here the gzip CRC32 ensures that 4 bytes are + * present after the compressed stream. + */ + if (err != Z_OK || s->inbuf == Z_NULL) { + return destroy(s), (gzFile)Z_NULL; + } + } + s->stream.avail_out = Z_BUFSIZE; + + errno = 0; + s->file = fd < 0 ? F_OPEN(path, fmode) : (FILE*)fdopen(fd, fmode); + + if (s->file == NULL) { + return destroy(s), (gzFile)Z_NULL; + } + if (s->mode == 'w') { + /* Write a very simple .gz header: + */ + fprintf(s->file, "%c%c%c%c%c%c%c%c%c%c", gz_magic[0], gz_magic[1], + Z_DEFLATED, 0 /*flags*/, 0,0,0,0 /*time*/, 0 /*xflags*/, OS_CODE); + s->startpos = 10L; + /* We use 10L instead of ftell(s->file) to because ftell causes an + * fflush on some systems. This version of the library doesn't use + * startpos anyway in write mode, so this initialization is not + * necessary. + */ + } else { + check_header(s); /* skip the .gz header */ + s->startpos = (ftell(s->file) - s->stream.avail_in); + } + + return (gzFile)s; +} + +/* =========================================================================== + Opens a gzip (.gz) file for reading or writing. +*/ +gzFile ZEXPORT gzopen (path, mode) + const char *path; + const char *mode; +{ + return gz_open (path, mode, -1); +} + +/* =========================================================================== + Associate a gzFile with the file descriptor fd. fd is not dup'ed here + to mimic the behavio(u)r of fdopen. +*/ +gzFile ZEXPORT gzdopen (fd, mode) + int fd; + const char *mode; +{ + char name[20]; + + if (fd < 0) return (gzFile)Z_NULL; + sprintf(name, "", fd); /* for debugging */ + + return gz_open (name, mode, fd); +} + +/* =========================================================================== + * Update the compression level and strategy + */ +int ZEXPORT gzsetparams (file, level, strategy) + gzFile file; + int level; + int strategy; +{ + gz_stream *s = (gz_stream*)file; + + if (s == NULL || s->mode != 'w') return Z_STREAM_ERROR; + + /* Make room to allow flushing */ + if (s->stream.avail_out == 0) { + + s->stream.next_out = s->outbuf; + if (fwrite(s->outbuf, 1, Z_BUFSIZE, s->file) != Z_BUFSIZE) { + s->z_err = Z_ERRNO; + } + s->stream.avail_out = Z_BUFSIZE; + } + + return deflateParams (&(s->stream), level, strategy); +} + +/* =========================================================================== + Read a byte from a gz_stream; update next_in and avail_in. Return EOF + for end of file. + IN assertion: the stream s has been sucessfully opened for reading. +*/ +local int get_byte(s) + gz_stream *s; +{ + if (s->z_eof) return EOF; + if (s->stream.avail_in == 0) { + errno = 0; + s->stream.avail_in = fread(s->inbuf, 1, Z_BUFSIZE, s->file); + if (s->stream.avail_in == 0) { + s->z_eof = 1; + if (ferror(s->file)) s->z_err = Z_ERRNO; + return EOF; + } + s->stream.next_in = s->inbuf; + } + s->stream.avail_in--; + return *(s->stream.next_in)++; +} + +/* =========================================================================== + Check the gzip header of a gz_stream opened for reading. Set the stream + mode to transparent if the gzip magic header is not present; set s->err + to Z_DATA_ERROR if the magic header is present but the rest of the header + is incorrect. + IN assertion: the stream s has already been created sucessfully; + s->stream.avail_in is zero for the first time, but may be non-zero + for concatenated .gz files. +*/ +local void check_header(s) + gz_stream *s; +{ + int method; /* method byte */ + int flags; /* flags byte */ + uInt len; + int c; + + /* Check the gzip magic header */ + for (len = 0; len < 2; len++) { + c = get_byte(s); + if (c != gz_magic[len]) { + if (len != 0) s->stream.avail_in++, s->stream.next_in--; + if (c != EOF) { + s->stream.avail_in++, s->stream.next_in--; + s->transparent = 1; + } + s->z_err = s->stream.avail_in != 0 ? Z_OK : Z_STREAM_END; + return; + } + } + method = get_byte(s); + flags = get_byte(s); + if (method != Z_DEFLATED || (flags & RESERVED) != 0) { + s->z_err = Z_DATA_ERROR; + return; + } + + /* Discard time, xflags and OS code: */ + for (len = 0; len < 6; len++) (void)get_byte(s); + + if ((flags & EXTRA_FIELD) != 0) { /* skip the extra field */ + len = (uInt)get_byte(s); + len += ((uInt)get_byte(s))<<8; + /* len is garbage if EOF but the loop below will quit anyway */ + while (len-- != 0 && get_byte(s) != EOF) ; + } + if ((flags & ORIG_NAME) != 0) { /* skip the original file name */ + while ((c = get_byte(s)) != 0 && c != EOF) ; + } + if ((flags & COMMENT) != 0) { /* skip the .gz file comment */ + while ((c = get_byte(s)) != 0 && c != EOF) ; + } + if ((flags & HEAD_CRC) != 0) { /* skip the header crc */ + for (len = 0; len < 2; len++) (void)get_byte(s); + } + s->z_err = s->z_eof ? Z_DATA_ERROR : Z_OK; +} + + /* =========================================================================== + * Cleanup then free the given gz_stream. Return a zlib error code. + Try freeing in the reverse order of allocations. + */ +local int destroy (s) + gz_stream *s; +{ + int err = Z_OK; + + if (!s) return Z_STREAM_ERROR; + + TRYFREE(s->msg); + + if (s->stream.state != NULL) { + if (s->mode == 'w') { +#ifdef NO_DEFLATE + err = Z_STREAM_ERROR; +#else + err = deflateEnd(&(s->stream)); +#endif + } else if (s->mode == 'r') { + err = inflateEnd(&(s->stream)); + } + } + if (s->file != NULL && fclose(s->file)) { +#ifdef ESPIPE + if (errno != ESPIPE) /* fclose is broken for pipes in HP/UX */ +#endif + err = Z_ERRNO; + } + if (s->z_err < 0) err = s->z_err; + + TRYFREE(s->inbuf); + TRYFREE(s->outbuf); + TRYFREE(s->path); + TRYFREE(s); + return err; +} + +/* =========================================================================== + Reads the given number of uncompressed bytes from the compressed file. + gzread returns the number of bytes actually read (0 for end of file). +*/ +int ZEXPORT gzread (file, buf, len) + gzFile file; + voidp buf; + unsigned len; +{ + gz_stream *s = (gz_stream*)file; + Bytef *start = (Bytef*)buf; /* starting point for crc computation */ + Byte *next_out; /* == stream.next_out but not forced far (for MSDOS) */ + + if (s == NULL || s->mode != 'r') return Z_STREAM_ERROR; + + if (s->z_err == Z_DATA_ERROR || s->z_err == Z_ERRNO) return -1; + if (s->z_err == Z_STREAM_END) return 0; /* EOF */ + + next_out = (Byte*)buf; + s->stream.next_out = (Bytef*)buf; + s->stream.avail_out = len; + + while (s->stream.avail_out != 0) { + + if (s->transparent) { + /* Copy first the lookahead bytes: */ + uInt n = s->stream.avail_in; + if (n > s->stream.avail_out) n = s->stream.avail_out; + if (n > 0) { + zmemcpy(s->stream.next_out, s->stream.next_in, n); + next_out += n; + s->stream.next_out = next_out; + s->stream.next_in += n; + s->stream.avail_out -= n; + s->stream.avail_in -= n; + } + if (s->stream.avail_out > 0) { + s->stream.avail_out -= fread(next_out, 1, s->stream.avail_out, + s->file); + } + len -= s->stream.avail_out; + s->stream.total_in += (uLong)len; + s->stream.total_out += (uLong)len; + if (len == 0) s->z_eof = 1; + return (int)len; + } + if (s->stream.avail_in == 0 && !s->z_eof) { + + errno = 0; + s->stream.avail_in = fread(s->inbuf, 1, Z_BUFSIZE, s->file); + if (s->stream.avail_in == 0) { + s->z_eof = 1; + if (ferror(s->file)) { + s->z_err = Z_ERRNO; + break; + } + } + s->stream.next_in = s->inbuf; + } + s->z_err = inflate(&(s->stream), Z_NO_FLUSH); + + if (s->z_err == Z_STREAM_END) { + /* Check CRC and original size */ + s->crc = crc32(s->crc, start, (uInt)(s->stream.next_out - start)); + start = s->stream.next_out; + + if (getLong(s) != s->crc) { + s->z_err = Z_DATA_ERROR; + } else { + (void)getLong(s); + /* The uncompressed length returned by above getlong() may + * be different from s->stream.total_out) in case of + * concatenated .gz files. Check for such files: + */ + check_header(s); + if (s->z_err == Z_OK) { + uLong total_in = s->stream.total_in; + uLong total_out = s->stream.total_out; + + inflateReset(&(s->stream)); + s->stream.total_in = total_in; + s->stream.total_out = total_out; + s->crc = crc32(0L, Z_NULL, 0); + } + } + } + if (s->z_err != Z_OK || s->z_eof) break; + } + s->crc = crc32(s->crc, start, (uInt)(s->stream.next_out - start)); + + return (int)(len - s->stream.avail_out); +} + + +/* =========================================================================== + Reads one byte from the compressed file. gzgetc returns this byte + or -1 in case of end of file or error. +*/ +int ZEXPORT gzgetc(file) + gzFile file; +{ + unsigned char c; + + return gzread(file, &c, 1) == 1 ? c : -1; +} + + +/* =========================================================================== + Reads bytes from the compressed file until len-1 characters are + read, or a newline character is read and transferred to buf, or an + end-of-file condition is encountered. The string is then terminated + with a null character. + gzgets returns buf, or Z_NULL in case of error. + + The current implementation is not optimized at all. +*/ +char * ZEXPORT gzgets(file, buf, len) + gzFile file; + char *buf; + int len; +{ + char *b = buf; + if (buf == Z_NULL || len <= 0) return Z_NULL; + + while (--len > 0 && gzread(file, buf, 1) == 1 && *buf++ != '\n') ; + *buf = '\0'; + return b == buf && len > 0 ? Z_NULL : b; +} + + +#ifndef NO_DEFLATE +/* =========================================================================== + Writes the given number of uncompressed bytes into the compressed file. + gzwrite returns the number of bytes actually written (0 in case of error). +*/ +int ZEXPORT gzwrite (file, buf, len) + gzFile file; + const voidp buf; + unsigned len; +{ + gz_stream *s = (gz_stream*)file; + + if (s == NULL || s->mode != 'w') return Z_STREAM_ERROR; + + s->stream.next_in = (Bytef*)buf; + s->stream.avail_in = len; + + while (s->stream.avail_in != 0) { + + if (s->stream.avail_out == 0) { + + s->stream.next_out = s->outbuf; + if (fwrite(s->outbuf, 1, Z_BUFSIZE, s->file) != Z_BUFSIZE) { + s->z_err = Z_ERRNO; + break; + } + s->stream.avail_out = Z_BUFSIZE; + } + s->z_err = deflate(&(s->stream), Z_NO_FLUSH); + if (s->z_err != Z_OK) break; + } + s->crc = crc32(s->crc, (const Bytef *)buf, len); + + return (int)(len - s->stream.avail_in); +} + +/* =========================================================================== + Converts, formats, and writes the args to the compressed file under + control of the format string, as in fprintf. gzprintf returns the number of + uncompressed bytes actually written (0 in case of error). +*/ +#ifdef STDC +#include + +int ZEXPORTVA gzprintf (gzFile file, const char *format, /* args */ ...) +{ + char buf[Z_PRINTF_BUFSIZE]; + va_list va; + int len; + + va_start(va, format); +#ifdef HAS_vsnprintf + (void)vsnprintf(buf, sizeof(buf), format, va); +#else + (void)vsprintf(buf, format, va); +#endif + va_end(va); + len = strlen(buf); /* some *sprintf don't return the nb of bytes written */ + if (len <= 0) return 0; + + return gzwrite(file, buf, (unsigned)len); +} +#else /* not ANSI C */ + +int ZEXPORTVA gzprintf (file, format, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, + a11, a12, a13, a14, a15, a16, a17, a18, a19, a20) + gzFile file; + const char *format; + int a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, + a11, a12, a13, a14, a15, a16, a17, a18, a19, a20; +{ + char buf[Z_PRINTF_BUFSIZE]; + int len; + +#ifdef HAS_snprintf + snprintf(buf, sizeof(buf), format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); +#else + sprintf(buf, format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); +#endif + len = strlen(buf); /* old sprintf doesn't return the nb of bytes written */ + if (len <= 0) return 0; + + return gzwrite(file, buf, len); +} +#endif + +/* =========================================================================== + Writes c, converted to an unsigned char, into the compressed file. + gzputc returns the value that was written, or -1 in case of error. +*/ +int ZEXPORT gzputc(file, c) + gzFile file; + int c; +{ + unsigned char cc = (unsigned char) c; /* required for big endian systems */ + + return gzwrite(file, &cc, 1) == 1 ? (int)cc : -1; +} + + +/* =========================================================================== + Writes the given null-terminated string to the compressed file, excluding + the terminating null character. + gzputs returns the number of characters written, or -1 in case of error. +*/ +int ZEXPORT gzputs(file, s) + gzFile file; + const char *s; +{ + return gzwrite(file, (char*)s, (unsigned)strlen(s)); +} + + +/* =========================================================================== + Flushes all pending output into the compressed file. The parameter + flush is as in the deflate() function. +*/ +local int do_flush (file, flush) + gzFile file; + int flush; +{ + uInt len; + int done = 0; + gz_stream *s = (gz_stream*)file; + + if (s == NULL || s->mode != 'w') return Z_STREAM_ERROR; + + s->stream.avail_in = 0; /* should be zero already anyway */ + + for (;;) { + len = Z_BUFSIZE - s->stream.avail_out; + + if (len != 0) { + if ((uInt)fwrite(s->outbuf, 1, len, s->file) != len) { + s->z_err = Z_ERRNO; + return Z_ERRNO; + } + s->stream.next_out = s->outbuf; + s->stream.avail_out = Z_BUFSIZE; + } + if (done) break; + s->z_err = deflate(&(s->stream), flush); + + /* Ignore the second of two consecutive flushes: */ + if (len == 0 && s->z_err == Z_BUF_ERROR) s->z_err = Z_OK; + + /* deflate has finished flushing only when it hasn't used up + * all the available space in the output buffer: + */ + done = (s->stream.avail_out != 0 || s->z_err == Z_STREAM_END); + + if (s->z_err != Z_OK && s->z_err != Z_STREAM_END) break; + } + return s->z_err == Z_STREAM_END ? Z_OK : s->z_err; +} + +int ZEXPORT gzflush (file, flush) + gzFile file; + int flush; +{ + gz_stream *s = (gz_stream*)file; + int err = do_flush (file, flush); + + if (err) return err; + fflush(s->file); + return s->z_err == Z_STREAM_END ? Z_OK : s->z_err; +} +#endif /* NO_DEFLATE */ + +/* =========================================================================== + Sets the starting position for the next gzread or gzwrite on the given + compressed file. The offset represents a number of bytes in the + gzseek returns the resulting offset location as measured in bytes from + the beginning of the uncompressed stream, or -1 in case of error. + SEEK_END is not implemented, returns error. + In this version of the library, gzseek can be extremely slow. +*/ +z_off_t ZEXPORT gzseek (file, offset, whence) + gzFile file; + z_off_t offset; + int whence; +{ + gz_stream *s = (gz_stream*)file; + + if (s == NULL || whence == SEEK_END || + s->z_err == Z_ERRNO || s->z_err == Z_DATA_ERROR) { + return -1L; + } + + if (s->mode == 'w') { +#ifdef NO_DEFLATE + return -1L; +#else + if (whence == SEEK_SET) { + offset -= s->stream.total_in; + } + if (offset < 0) return -1L; + + /* At this point, offset is the number of zero bytes to write. */ + if (s->inbuf == Z_NULL) { + s->inbuf = (Byte*)ALLOC(Z_BUFSIZE); /* for seeking */ + zmemzero(s->inbuf, Z_BUFSIZE); + } + while (offset > 0) { + uInt size = Z_BUFSIZE; + if (offset < Z_BUFSIZE) size = (uInt)offset; + + size = gzwrite(file, s->inbuf, size); + if (size == 0) return -1L; + + offset -= size; + } + return (z_off_t)s->stream.total_in; +#endif + } + /* Rest of function is for reading only */ + + /* compute absolute position */ + if (whence == SEEK_CUR) { + offset += s->stream.total_out; + } + if (offset < 0) return -1L; + + if (s->transparent) { + /* map to fseek */ + s->stream.avail_in = 0; + s->stream.next_in = s->inbuf; + if (fseek(s->file, offset, SEEK_SET) < 0) return -1L; + + s->stream.total_in = s->stream.total_out = (uLong)offset; + return offset; + } + + /* For a negative seek, rewind and use positive seek */ + if ((uLong)offset >= s->stream.total_out) { + offset -= s->stream.total_out; + } else if (gzrewind(file) < 0) { + return -1L; + } + /* offset is now the number of bytes to skip. */ + + if (offset != 0 && s->outbuf == Z_NULL) { + s->outbuf = (Byte*)ALLOC(Z_BUFSIZE); + } + while (offset > 0) { + int size = Z_BUFSIZE; + if (offset < Z_BUFSIZE) size = (int)offset; + + size = gzread(file, s->outbuf, (uInt)size); + if (size <= 0) return -1L; + offset -= size; + } + return (z_off_t)s->stream.total_out; +} + +/* =========================================================================== + Rewinds input file. +*/ +int ZEXPORT gzrewind (file) + gzFile file; +{ + gz_stream *s = (gz_stream*)file; + + if (s == NULL || s->mode != 'r') return -1; + + s->z_err = Z_OK; + s->z_eof = 0; + s->stream.avail_in = 0; + s->stream.next_in = s->inbuf; + s->crc = crc32(0L, Z_NULL, 0); + + if (s->startpos == 0) { /* not a compressed file */ + rewind(s->file); + return 0; + } + + (void) inflateReset(&s->stream); + return fseek(s->file, s->startpos, SEEK_SET); +} + +/* =========================================================================== + Returns the starting position for the next gzread or gzwrite on the + given compressed file. This position represents a number of bytes in the + uncompressed data stream. +*/ +z_off_t ZEXPORT gztell (file) + gzFile file; +{ + return gzseek(file, 0L, SEEK_CUR); +} + +/* =========================================================================== + Returns 1 when EOF has previously been detected reading the given + input stream, otherwise zero. +*/ +int ZEXPORT gzeof (file) + gzFile file; +{ + gz_stream *s = (gz_stream*)file; + + return (s == NULL || s->mode != 'r') ? 0 : s->z_eof; +} + +/* =========================================================================== + Outputs a long in LSB order to the given file +*/ +local void putLong (file, x) + FILE *file; + uLong x; +{ + int n; + for (n = 0; n < 4; n++) { + fputc((int)(x & 0xff), file); + x >>= 8; + } +} + +/* =========================================================================== + Reads a long in LSB order from the given gz_stream. Sets z_err in case + of error. +*/ +local uLong getLong (s) + gz_stream *s; +{ + uLong x = (uLong)get_byte(s); + int c; + + x += ((uLong)get_byte(s))<<8; + x += ((uLong)get_byte(s))<<16; + c = get_byte(s); + if (c == EOF) s->z_err = Z_DATA_ERROR; + x += ((uLong)c)<<24; + return x; +} + +/* =========================================================================== + Flushes all pending output if necessary, closes the compressed file + and deallocates all the (de)compression state. +*/ +int ZEXPORT gzclose (file) + gzFile file; +{ + int err; + gz_stream *s = (gz_stream*)file; + + if (s == NULL) return Z_STREAM_ERROR; + + if (s->mode == 'w') { +#ifdef NO_DEFLATE + return Z_STREAM_ERROR; +#else + err = do_flush (file, Z_FINISH); + if (err != Z_OK) return destroy((gz_stream*)file); + + putLong (s->file, s->crc); + putLong (s->file, s->stream.total_in); +#endif + } + return destroy((gz_stream*)file); +} + +/* =========================================================================== + Returns the error message for the last error which occured on the + given compressed file. errnum is set to zlib error number. If an + error occured in the file system and not in the compression library, + errnum is set to Z_ERRNO and the application may consult errno + to get the exact error code. +*/ +const char* ZEXPORT gzerror (file, errnum) + gzFile file; + int *errnum; +{ + char *m; + gz_stream *s = (gz_stream*)file; + + if (s == NULL) { + *errnum = Z_STREAM_ERROR; + return (const char*)ERR_MSG(Z_STREAM_ERROR); + } + *errnum = s->z_err; + if (*errnum == Z_OK) return (const char*)""; + + m = (char*)(*errnum == Z_ERRNO ? zstrerror(errno) : s->stream.msg); + + if (m == NULL || *m == '\0') m = (char*)ERR_MSG(s->z_err); + + TRYFREE(s->msg); + s->msg = (char*)ALLOC(strlen(s->path) + strlen(m) + 3); + strcpy(s->msg, s->path); + strcat(s->msg, ": "); + strcat(s->msg, m); + return (const char*)s->msg; +} diff --git a/zlib/infblock.c b/zlib/infblock.c new file mode 100644 index 0000000..f4920fa --- /dev/null +++ b/zlib/infblock.c @@ -0,0 +1,398 @@ +/* infblock.c -- interpret and process block types to last block + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "infblock.h" +#include "inftrees.h" +#include "infcodes.h" +#include "infutil.h" + +struct inflate_codes_state {int dummy;}; /* for buggy compilers */ + +/* simplify the use of the inflate_huft type with some defines */ +#define exop word.what.Exop +#define bits word.what.Bits + +/* Table for deflate from PKZIP's appnote.txt. */ +local const uInt border[] = { /* Order of the bit length code lengths */ + 16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15}; + +/* + Notes beyond the 1.93a appnote.txt: + + 1. Distance pointers never point before the beginning of the output + stream. + 2. Distance pointers can point back across blocks, up to 32k away. + 3. There is an implied maximum of 7 bits for the bit length table and + 15 bits for the actual data. + 4. If only one code exists, then it is encoded using one bit. (Zero + would be more efficient, but perhaps a little confusing.) If two + codes exist, they are coded using one bit each (0 and 1). + 5. There is no way of sending zero distance codes--a dummy must be + sent if there are none. (History: a pre 2.0 version of PKZIP would + store blocks with no distance codes, but this was discovered to be + too harsh a criterion.) Valid only for 1.93a. 2.04c does allow + zero distance codes, which is sent as one code of zero bits in + length. + 6. There are up to 286 literal/length codes. Code 256 represents the + end-of-block. Note however that the static length tree defines + 288 codes just to fill out the Huffman codes. Codes 286 and 287 + cannot be used though, since there is no length base or extra bits + defined for them. Similarily, there are up to 30 distance codes. + However, static trees define 32 codes (all 5 bits) to fill out the + Huffman codes, but the last two had better not show up in the data. + 7. Unzip can check dynamic Huffman blocks for complete code sets. + The exception is that a single code would not be complete (see #4). + 8. The five bits following the block type is really the number of + literal codes sent minus 257. + 9. Length codes 8,16,16 are interpreted as 13 length codes of 8 bits + (1+6+6). Therefore, to output three times the length, you output + three codes (1+1+1), whereas to output four times the same length, + you only need two codes (1+3). Hmm. + 10. In the tree reconstruction algorithm, Code = Code + Increment + only if BitLength(i) is not zero. (Pretty obvious.) + 11. Correction: 4 Bits: # of Bit Length codes - 4 (4 - 19) + 12. Note: length code 284 can represent 227-258, but length code 285 + really is 258. The last length deserves its own, short code + since it gets used a lot in very redundant files. The length + 258 is special since 258 - 3 (the min match length) is 255. + 13. The literal/length and distance code bit lengths are read as a + single stream of lengths. It is possible (and advantageous) for + a repeat code (16, 17, or 18) to go across the boundary between + the two sets of lengths. + */ + + +void inflate_blocks_reset(s, z, c) +inflate_blocks_statef *s; +z_streamp z; +uLongf *c; +{ + if (c != Z_NULL) + *c = s->check; + if (s->mode == BTREE || s->mode == DTREE) + ZFREE(z, s->sub.trees.blens); + if (s->mode == CODES) + inflate_codes_free(s->sub.decode.codes, z); + s->mode = TYPE; + s->bitk = 0; + s->bitb = 0; + s->read = s->write = s->window; + if (s->checkfn != Z_NULL) + z->adler = s->check = (*s->checkfn)(0L, (const Bytef *)Z_NULL, 0); + Tracev((stderr, "inflate: blocks reset\n")); +} + + +inflate_blocks_statef *inflate_blocks_new(z, c, w) +z_streamp z; +check_func c; +uInt w; +{ + inflate_blocks_statef *s; + + if ((s = (inflate_blocks_statef *)ZALLOC + (z,1,sizeof(struct inflate_blocks_state))) == Z_NULL) + return s; + if ((s->hufts = + (inflate_huft *)ZALLOC(z, sizeof(inflate_huft), MANY)) == Z_NULL) + { + ZFREE(z, s); + return Z_NULL; + } + if ((s->window = (Bytef *)ZALLOC(z, 1, w)) == Z_NULL) + { + ZFREE(z, s->hufts); + ZFREE(z, s); + return Z_NULL; + } + s->end = s->window + w; + s->checkfn = c; + s->mode = TYPE; + Tracev((stderr, "inflate: blocks allocated\n")); + inflate_blocks_reset(s, z, Z_NULL); + return s; +} + + +int inflate_blocks(s, z, r) +inflate_blocks_statef *s; +z_streamp z; +int r; +{ + uInt t; /* temporary storage */ + uLong b; /* bit buffer */ + uInt k; /* bits in bit buffer */ + Bytef *p; /* input data pointer */ + uInt n; /* bytes available there */ + Bytef *q; /* output window write pointer */ + uInt m; /* bytes to end of window or read pointer */ + + /* copy input/output information to locals (UPDATE macro restores) */ + LOAD + + /* process input based on current state */ + while (1) switch (s->mode) + { + case TYPE: + NEEDBITS(3) + t = (uInt)b & 7; + s->last = t & 1; + switch (t >> 1) + { + case 0: /* stored */ + Tracev((stderr, "inflate: stored block%s\n", + s->last ? " (last)" : "")); + DUMPBITS(3) + t = k & 7; /* go to byte boundary */ + DUMPBITS(t) + s->mode = LENS; /* get length of stored block */ + break; + case 1: /* fixed */ + Tracev((stderr, "inflate: fixed codes block%s\n", + s->last ? " (last)" : "")); + { + uInt bl, bd; + inflate_huft *tl, *td; + + inflate_trees_fixed(&bl, &bd, &tl, &td, z); + s->sub.decode.codes = inflate_codes_new(bl, bd, tl, td, z); + if (s->sub.decode.codes == Z_NULL) + { + r = Z_MEM_ERROR; + LEAVE + } + } + DUMPBITS(3) + s->mode = CODES; + break; + case 2: /* dynamic */ + Tracev((stderr, "inflate: dynamic codes block%s\n", + s->last ? " (last)" : "")); + DUMPBITS(3) + s->mode = TABLE; + break; + case 3: /* illegal */ + DUMPBITS(3) + s->mode = BAD; + z->msg = (char*)"invalid block type"; + r = Z_DATA_ERROR; + LEAVE + } + break; + case LENS: + NEEDBITS(32) + if ((((~b) >> 16) & 0xffff) != (b & 0xffff)) + { + s->mode = BAD; + z->msg = (char*)"invalid stored block lengths"; + r = Z_DATA_ERROR; + LEAVE + } + s->sub.left = (uInt)b & 0xffff; + b = k = 0; /* dump bits */ + Tracev((stderr, "inflate: stored length %u\n", s->sub.left)); + s->mode = s->sub.left ? STORED : (s->last ? DRY : TYPE); + break; + case STORED: + if (n == 0) + LEAVE + NEEDOUT + t = s->sub.left; + if (t > n) t = n; + if (t > m) t = m; + zmemcpy(q, p, t); + p += t; n -= t; + q += t; m -= t; + if ((s->sub.left -= t) != 0) + break; + Tracev((stderr, "inflate: stored end, %lu total out\n", + z->total_out + (q >= s->read ? q - s->read : + (s->end - s->read) + (q - s->window)))); + s->mode = s->last ? DRY : TYPE; + break; + case TABLE: + NEEDBITS(14) + s->sub.trees.table = t = (uInt)b & 0x3fff; +#ifndef PKZIP_BUG_WORKAROUND + if ((t & 0x1f) > 29 || ((t >> 5) & 0x1f) > 29) + { + s->mode = BAD; + z->msg = (char*)"too many length or distance symbols"; + r = Z_DATA_ERROR; + LEAVE + } +#endif + t = 258 + (t & 0x1f) + ((t >> 5) & 0x1f); + if ((s->sub.trees.blens = (uIntf*)ZALLOC(z, t, sizeof(uInt))) == Z_NULL) + { + r = Z_MEM_ERROR; + LEAVE + } + DUMPBITS(14) + s->sub.trees.index = 0; + Tracev((stderr, "inflate: table sizes ok\n")); + s->mode = BTREE; + case BTREE: + while (s->sub.trees.index < 4 + (s->sub.trees.table >> 10)) + { + NEEDBITS(3) + s->sub.trees.blens[border[s->sub.trees.index++]] = (uInt)b & 7; + DUMPBITS(3) + } + while (s->sub.trees.index < 19) + s->sub.trees.blens[border[s->sub.trees.index++]] = 0; + s->sub.trees.bb = 7; + t = inflate_trees_bits(s->sub.trees.blens, &s->sub.trees.bb, + &s->sub.trees.tb, s->hufts, z); + if (t != Z_OK) + { + ZFREE(z, s->sub.trees.blens); + r = t; + if (r == Z_DATA_ERROR) + s->mode = BAD; + LEAVE + } + s->sub.trees.index = 0; + Tracev((stderr, "inflate: bits tree ok\n")); + s->mode = DTREE; + case DTREE: + while (t = s->sub.trees.table, + s->sub.trees.index < 258 + (t & 0x1f) + ((t >> 5) & 0x1f)) + { + inflate_huft *h; + uInt i, j, c; + + t = s->sub.trees.bb; + NEEDBITS(t) + h = s->sub.trees.tb + ((uInt)b & inflate_mask[t]); + t = h->bits; + c = h->base; + if (c < 16) + { + DUMPBITS(t) + s->sub.trees.blens[s->sub.trees.index++] = c; + } + else /* c == 16..18 */ + { + i = c == 18 ? 7 : c - 14; + j = c == 18 ? 11 : 3; + NEEDBITS(t + i) + DUMPBITS(t) + j += (uInt)b & inflate_mask[i]; + DUMPBITS(i) + i = s->sub.trees.index; + t = s->sub.trees.table; + if (i + j > 258 + (t & 0x1f) + ((t >> 5) & 0x1f) || + (c == 16 && i < 1)) + { + ZFREE(z, s->sub.trees.blens); + s->mode = BAD; + z->msg = (char*)"invalid bit length repeat"; + r = Z_DATA_ERROR; + LEAVE + } + c = c == 16 ? s->sub.trees.blens[i - 1] : 0; + do { + s->sub.trees.blens[i++] = c; + } while (--j); + s->sub.trees.index = i; + } + } + s->sub.trees.tb = Z_NULL; + { + uInt bl, bd; + inflate_huft *tl, *td; + inflate_codes_statef *c; + + bl = 9; /* must be <= 9 for lookahead assumptions */ + bd = 6; /* must be <= 9 for lookahead assumptions */ + t = s->sub.trees.table; + t = inflate_trees_dynamic(257 + (t & 0x1f), 1 + ((t >> 5) & 0x1f), + s->sub.trees.blens, &bl, &bd, &tl, &td, + s->hufts, z); + ZFREE(z, s->sub.trees.blens); + if (t != Z_OK) + { + if (t == (uInt)Z_DATA_ERROR) + s->mode = BAD; + r = t; + LEAVE + } + Tracev((stderr, "inflate: trees ok\n")); + if ((c = inflate_codes_new(bl, bd, tl, td, z)) == Z_NULL) + { + r = Z_MEM_ERROR; + LEAVE + } + s->sub.decode.codes = c; + } + s->mode = CODES; + case CODES: + UPDATE + if ((r = inflate_codes(s, z, r)) != Z_STREAM_END) + return inflate_flush(s, z, r); + r = Z_OK; + inflate_codes_free(s->sub.decode.codes, z); + LOAD + Tracev((stderr, "inflate: codes end, %lu total out\n", + z->total_out + (q >= s->read ? q - s->read : + (s->end - s->read) + (q - s->window)))); + if (!s->last) + { + s->mode = TYPE; + break; + } + s->mode = DRY; + case DRY: + FLUSH + if (s->read != s->write) + LEAVE + s->mode = DONE; + case DONE: + r = Z_STREAM_END; + LEAVE + case BAD: + r = Z_DATA_ERROR; + LEAVE + default: + r = Z_STREAM_ERROR; + LEAVE + } +} + + +int inflate_blocks_free(s, z) +inflate_blocks_statef *s; +z_streamp z; +{ + inflate_blocks_reset(s, z, Z_NULL); + ZFREE(z, s->window); + ZFREE(z, s->hufts); + ZFREE(z, s); + Tracev((stderr, "inflate: blocks freed\n")); + return Z_OK; +} + + +void inflate_set_dictionary(s, d, n) +inflate_blocks_statef *s; +const Bytef *d; +uInt n; +{ + zmemcpy(s->window, d, n); + s->read = s->write = s->window + n; +} + + +/* Returns true if inflate is currently at the end of a block generated + * by Z_SYNC_FLUSH or Z_FULL_FLUSH. + * IN assertion: s != Z_NULL + */ +int inflate_blocks_sync_point(s) +inflate_blocks_statef *s; +{ + return s->mode == LENS; +} diff --git a/zlib/infblock.h b/zlib/infblock.h new file mode 100644 index 0000000..bd25c80 --- /dev/null +++ b/zlib/infblock.h @@ -0,0 +1,39 @@ +/* infblock.h -- header to use infblock.c + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +struct inflate_blocks_state; +typedef struct inflate_blocks_state FAR inflate_blocks_statef; + +extern inflate_blocks_statef * inflate_blocks_new OF(( + z_streamp z, + check_func c, /* check function */ + uInt w)); /* window size */ + +extern int inflate_blocks OF(( + inflate_blocks_statef *, + z_streamp , + int)); /* initial return code */ + +extern void inflate_blocks_reset OF(( + inflate_blocks_statef *, + z_streamp , + uLongf *)); /* check value on output */ + +extern int inflate_blocks_free OF(( + inflate_blocks_statef *, + z_streamp)); + +extern void inflate_set_dictionary OF(( + inflate_blocks_statef *s, + const Bytef *d, /* dictionary */ + uInt n)); /* dictionary length */ + +extern int inflate_blocks_sync_point OF(( + inflate_blocks_statef *s)); diff --git a/zlib/infcodes.c b/zlib/infcodes.c new file mode 100644 index 0000000..d4e5ee9 --- /dev/null +++ b/zlib/infcodes.c @@ -0,0 +1,257 @@ +/* infcodes.c -- process literals and length/distance pairs + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" +#include "infblock.h" +#include "infcodes.h" +#include "infutil.h" +#include "inffast.h" + +/* simplify the use of the inflate_huft type with some defines */ +#define exop word.what.Exop +#define bits word.what.Bits + +typedef enum { /* waiting for "i:"=input, "o:"=output, "x:"=nothing */ + START, /* x: set up for LEN */ + LEN, /* i: get length/literal/eob next */ + LENEXT, /* i: getting length extra (have base) */ + DIST, /* i: get distance next */ + DISTEXT, /* i: getting distance extra */ + COPY, /* o: copying bytes in window, waiting for space */ + LIT, /* o: got literal, waiting for output space */ + WASH, /* o: got eob, possibly still output waiting */ + END, /* x: got eob and all data flushed */ + BADCODE} /* x: got error */ +inflate_codes_mode; + +/* inflate codes private state */ +struct inflate_codes_state { + + /* mode */ + inflate_codes_mode mode; /* current inflate_codes mode */ + + /* mode dependent information */ + uInt len; + union { + struct { + inflate_huft *tree; /* pointer into tree */ + uInt need; /* bits needed */ + } code; /* if LEN or DIST, where in tree */ + uInt lit; /* if LIT, literal */ + struct { + uInt get; /* bits to get for extra */ + uInt dist; /* distance back to copy from */ + } copy; /* if EXT or COPY, where and how much */ + } sub; /* submode */ + + /* mode independent information */ + Byte lbits; /* ltree bits decoded per branch */ + Byte dbits; /* dtree bits decoder per branch */ + inflate_huft *ltree; /* literal/length/eob tree */ + inflate_huft *dtree; /* distance tree */ + +}; + + +inflate_codes_statef *inflate_codes_new(bl, bd, tl, td, z) +uInt bl, bd; +inflate_huft *tl; +inflate_huft *td; /* need separate declaration for Borland C++ */ +z_streamp z; +{ + inflate_codes_statef *c; + + if ((c = (inflate_codes_statef *) + ZALLOC(z,1,sizeof(struct inflate_codes_state))) != Z_NULL) + { + c->mode = START; + c->lbits = (Byte)bl; + c->dbits = (Byte)bd; + c->ltree = tl; + c->dtree = td; + Tracev((stderr, "inflate: codes new\n")); + } + return c; +} + + +int inflate_codes(s, z, r) +inflate_blocks_statef *s; +z_streamp z; +int r; +{ + uInt j; /* temporary storage */ + inflate_huft *t; /* temporary pointer */ + uInt e; /* extra bits or operation */ + uLong b; /* bit buffer */ + uInt k; /* bits in bit buffer */ + Bytef *p; /* input data pointer */ + uInt n; /* bytes available there */ + Bytef *q; /* output window write pointer */ + uInt m; /* bytes to end of window or read pointer */ + Bytef *f; /* pointer to copy strings from */ + inflate_codes_statef *c = s->sub.decode.codes; /* codes state */ + + /* copy input/output information to locals (UPDATE macro restores) */ + LOAD + + /* process input and output based on current state */ + while (1) switch (c->mode) + { /* waiting for "i:"=input, "o:"=output, "x:"=nothing */ + case START: /* x: set up for LEN */ +#ifndef SLOW + if (m >= 258 && n >= 10) + { + UPDATE + r = inflate_fast(c->lbits, c->dbits, c->ltree, c->dtree, s, z); + LOAD + if (r != Z_OK) + { + c->mode = r == Z_STREAM_END ? WASH : BADCODE; + break; + } + } +#endif /* !SLOW */ + c->sub.code.need = c->lbits; + c->sub.code.tree = c->ltree; + c->mode = LEN; + case LEN: /* i: get length/literal/eob next */ + j = c->sub.code.need; + NEEDBITS(j) + t = c->sub.code.tree + ((uInt)b & inflate_mask[j]); + DUMPBITS(t->bits) + e = (uInt)(t->exop); + if (e == 0) /* literal */ + { + c->sub.lit = t->base; + Tracevv((stderr, t->base >= 0x20 && t->base < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", t->base)); + c->mode = LIT; + break; + } + if (e & 16) /* length */ + { + c->sub.copy.get = e & 15; + c->len = t->base; + c->mode = LENEXT; + break; + } + if ((e & 64) == 0) /* next table */ + { + c->sub.code.need = e; + c->sub.code.tree = t + t->base; + break; + } + if (e & 32) /* end of block */ + { + Tracevv((stderr, "inflate: end of block\n")); + c->mode = WASH; + break; + } + c->mode = BADCODE; /* invalid code */ + z->msg = (char*)"invalid literal/length code"; + r = Z_DATA_ERROR; + LEAVE + case LENEXT: /* i: getting length extra (have base) */ + j = c->sub.copy.get; + NEEDBITS(j) + c->len += (uInt)b & inflate_mask[j]; + DUMPBITS(j) + c->sub.code.need = c->dbits; + c->sub.code.tree = c->dtree; + Tracevv((stderr, "inflate: length %u\n", c->len)); + c->mode = DIST; + case DIST: /* i: get distance next */ + j = c->sub.code.need; + NEEDBITS(j) + t = c->sub.code.tree + ((uInt)b & inflate_mask[j]); + DUMPBITS(t->bits) + e = (uInt)(t->exop); + if (e & 16) /* distance */ + { + c->sub.copy.get = e & 15; + c->sub.copy.dist = t->base; + c->mode = DISTEXT; + break; + } + if ((e & 64) == 0) /* next table */ + { + c->sub.code.need = e; + c->sub.code.tree = t + t->base; + break; + } + c->mode = BADCODE; /* invalid code */ + z->msg = (char*)"invalid distance code"; + r = Z_DATA_ERROR; + LEAVE + case DISTEXT: /* i: getting distance extra */ + j = c->sub.copy.get; + NEEDBITS(j) + c->sub.copy.dist += (uInt)b & inflate_mask[j]; + DUMPBITS(j) + Tracevv((stderr, "inflate: distance %u\n", c->sub.copy.dist)); + c->mode = COPY; + case COPY: /* o: copying bytes in window, waiting for space */ +#ifndef __TURBOC__ /* Turbo C bug for following expression */ + f = (uInt)(q - s->window) < c->sub.copy.dist ? + s->end - (c->sub.copy.dist - (q - s->window)) : + q - c->sub.copy.dist; +#else + f = q - c->sub.copy.dist; + if ((uInt)(q - s->window) < c->sub.copy.dist) + f = s->end - (c->sub.copy.dist - (uInt)(q - s->window)); +#endif + while (c->len) + { + NEEDOUT + OUTBYTE(*f++) + if (f == s->end) + f = s->window; + c->len--; + } + c->mode = START; + break; + case LIT: /* o: got literal, waiting for output space */ + NEEDOUT + OUTBYTE(c->sub.lit) + c->mode = START; + break; + case WASH: /* o: got eob, possibly more output */ + if (k > 7) /* return unused byte, if any */ + { + Assert(k < 16, "inflate_codes grabbed too many bytes") + k -= 8; + n++; + p--; /* can always return one */ + } + FLUSH + if (s->read != s->write) + LEAVE + c->mode = END; + case END: + r = Z_STREAM_END; + LEAVE + case BADCODE: /* x: got error */ + r = Z_DATA_ERROR; + LEAVE + default: + r = Z_STREAM_ERROR; + LEAVE + } +#ifdef NEED_DUMMY_RETURN + return Z_STREAM_ERROR; /* Some dumb compilers complain without this */ +#endif +} + + +void inflate_codes_free(c, z) +inflate_codes_statef *c; +z_streamp z; +{ + ZFREE(z, c); + Tracev((stderr, "inflate: codes free\n")); +} diff --git a/zlib/infcodes.h b/zlib/infcodes.h new file mode 100644 index 0000000..6c750d8 --- /dev/null +++ b/zlib/infcodes.h @@ -0,0 +1,27 @@ +/* infcodes.h -- header to use infcodes.c + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +struct inflate_codes_state; +typedef struct inflate_codes_state FAR inflate_codes_statef; + +extern inflate_codes_statef *inflate_codes_new OF(( + uInt, uInt, + inflate_huft *, inflate_huft *, + z_streamp )); + +extern int inflate_codes OF(( + inflate_blocks_statef *, + z_streamp , + int)); + +extern void inflate_codes_free OF(( + inflate_codes_statef *, + z_streamp )); + diff --git a/zlib/inffast.c b/zlib/inffast.c new file mode 100644 index 0000000..61a78ee --- /dev/null +++ b/zlib/inffast.c @@ -0,0 +1,170 @@ +/* inffast.c -- process literals and length/distance pairs fast + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" +#include "infblock.h" +#include "infcodes.h" +#include "infutil.h" +#include "inffast.h" + +struct inflate_codes_state {int dummy;}; /* for buggy compilers */ + +/* simplify the use of the inflate_huft type with some defines */ +#define exop word.what.Exop +#define bits word.what.Bits + +/* macros for bit input with no checking and for returning unused bytes */ +#define GRABBITS(j) {while(k<(j)){b|=((uLong)NEXTBYTE)<avail_in-n;c=(k>>3)>3:c;n+=c;p-=c;k-=c<<3;} + +/* Called with number of bytes left to write in window at least 258 + (the maximum string length) and number of input bytes available + at least ten. The ten bytes are six bytes for the longest length/ + distance pair plus four bytes for overloading the bit buffer. */ + +int inflate_fast(bl, bd, tl, td, s, z) +uInt bl, bd; +inflate_huft *tl; +inflate_huft *td; /* need separate declaration for Borland C++ */ +inflate_blocks_statef *s; +z_streamp z; +{ + inflate_huft *t; /* temporary pointer */ + uInt e; /* extra bits or operation */ + uLong b; /* bit buffer */ + uInt k; /* bits in bit buffer */ + Bytef *p; /* input data pointer */ + uInt n; /* bytes available there */ + Bytef *q; /* output window write pointer */ + uInt m; /* bytes to end of window or read pointer */ + uInt ml; /* mask for literal/length tree */ + uInt md; /* mask for distance tree */ + uInt c; /* bytes to copy */ + uInt d; /* distance back to copy from */ + Bytef *r; /* copy source pointer */ + + /* load input, output, bit values */ + LOAD + + /* initialize masks */ + ml = inflate_mask[bl]; + md = inflate_mask[bd]; + + /* do until not enough input or output space for fast loop */ + do { /* assume called with m >= 258 && n >= 10 */ + /* get literal/length code */ + GRABBITS(20) /* max bits for literal/length code */ + if ((e = (t = tl + ((uInt)b & ml))->exop) == 0) + { + DUMPBITS(t->bits) + Tracevv((stderr, t->base >= 0x20 && t->base < 0x7f ? + "inflate: * literal '%c'\n" : + "inflate: * literal 0x%02x\n", t->base)); + *q++ = (Byte)t->base; + m--; + continue; + } + do { + DUMPBITS(t->bits) + if (e & 16) + { + /* get extra bits for length */ + e &= 15; + c = t->base + ((uInt)b & inflate_mask[e]); + DUMPBITS(e) + Tracevv((stderr, "inflate: * length %u\n", c)); + + /* decode distance base of block to copy */ + GRABBITS(15); /* max bits for distance code */ + e = (t = td + ((uInt)b & md))->exop; + do { + DUMPBITS(t->bits) + if (e & 16) + { + /* get extra bits to add to distance base */ + e &= 15; + GRABBITS(e) /* get extra bits (up to 13) */ + d = t->base + ((uInt)b & inflate_mask[e]); + DUMPBITS(e) + Tracevv((stderr, "inflate: * distance %u\n", d)); + + /* do the copy */ + m -= c; + if ((uInt)(q - s->window) >= d) /* offset before dest */ + { /* just copy */ + r = q - d; + *q++ = *r++; c--; /* minimum count is three, */ + *q++ = *r++; c--; /* so unroll loop a little */ + } + else /* else offset after destination */ + { + e = d - (uInt)(q - s->window); /* bytes from offset to end */ + r = s->end - e; /* pointer to offset */ + if (c > e) /* if source crosses, */ + { + c -= e; /* copy to end of window */ + do { + *q++ = *r++; + } while (--e); + r = s->window; /* copy rest from start of window */ + } + } + do { /* copy all or what's left */ + *q++ = *r++; + } while (--c); + break; + } + else if ((e & 64) == 0) + { + t += t->base; + e = (t += ((uInt)b & inflate_mask[e]))->exop; + } + else + { + z->msg = (char*)"invalid distance code"; + UNGRAB + UPDATE + return Z_DATA_ERROR; + } + } while (1); + break; + } + if ((e & 64) == 0) + { + t += t->base; + if ((e = (t += ((uInt)b & inflate_mask[e]))->exop) == 0) + { + DUMPBITS(t->bits) + Tracevv((stderr, t->base >= 0x20 && t->base < 0x7f ? + "inflate: * literal '%c'\n" : + "inflate: * literal 0x%02x\n", t->base)); + *q++ = (Byte)t->base; + m--; + break; + } + } + else if (e & 32) + { + Tracevv((stderr, "inflate: * end of block\n")); + UNGRAB + UPDATE + return Z_STREAM_END; + } + else + { + z->msg = (char*)"invalid literal/length code"; + UNGRAB + UPDATE + return Z_DATA_ERROR; + } + } while (1); + } while (m >= 258 && n >= 10); + + /* not enough input or output--restore pointers and return */ + UNGRAB + UPDATE + return Z_OK; +} diff --git a/zlib/inffast.h b/zlib/inffast.h new file mode 100644 index 0000000..8facec5 --- /dev/null +++ b/zlib/inffast.h @@ -0,0 +1,17 @@ +/* inffast.h -- header to use inffast.c + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +extern int inflate_fast OF(( + uInt, + uInt, + inflate_huft *, + inflate_huft *, + inflate_blocks_statef *, + z_streamp )); diff --git a/zlib/inffixed.h b/zlib/inffixed.h new file mode 100644 index 0000000..77f7e76 --- /dev/null +++ b/zlib/inffixed.h @@ -0,0 +1,151 @@ +/* inffixed.h -- table for decoding fixed codes + * Generated automatically by the maketree.c program + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +local uInt fixed_bl = 9; +local uInt fixed_bd = 5; +local inflate_huft fixed_tl[] = { + {{{96,7}},256}, {{{0,8}},80}, {{{0,8}},16}, {{{84,8}},115}, + {{{82,7}},31}, {{{0,8}},112}, {{{0,8}},48}, {{{0,9}},192}, + {{{80,7}},10}, {{{0,8}},96}, {{{0,8}},32}, {{{0,9}},160}, + {{{0,8}},0}, {{{0,8}},128}, {{{0,8}},64}, {{{0,9}},224}, + {{{80,7}},6}, {{{0,8}},88}, {{{0,8}},24}, {{{0,9}},144}, + {{{83,7}},59}, {{{0,8}},120}, {{{0,8}},56}, {{{0,9}},208}, + {{{81,7}},17}, {{{0,8}},104}, {{{0,8}},40}, {{{0,9}},176}, + {{{0,8}},8}, {{{0,8}},136}, {{{0,8}},72}, {{{0,9}},240}, + {{{80,7}},4}, {{{0,8}},84}, {{{0,8}},20}, {{{85,8}},227}, + {{{83,7}},43}, {{{0,8}},116}, {{{0,8}},52}, {{{0,9}},200}, + {{{81,7}},13}, {{{0,8}},100}, {{{0,8}},36}, {{{0,9}},168}, + {{{0,8}},4}, {{{0,8}},132}, {{{0,8}},68}, {{{0,9}},232}, + {{{80,7}},8}, {{{0,8}},92}, {{{0,8}},28}, {{{0,9}},152}, + {{{84,7}},83}, {{{0,8}},124}, {{{0,8}},60}, {{{0,9}},216}, + {{{82,7}},23}, {{{0,8}},108}, {{{0,8}},44}, {{{0,9}},184}, + {{{0,8}},12}, {{{0,8}},140}, {{{0,8}},76}, {{{0,9}},248}, + {{{80,7}},3}, {{{0,8}},82}, {{{0,8}},18}, {{{85,8}},163}, + {{{83,7}},35}, {{{0,8}},114}, {{{0,8}},50}, {{{0,9}},196}, + {{{81,7}},11}, {{{0,8}},98}, {{{0,8}},34}, {{{0,9}},164}, + {{{0,8}},2}, {{{0,8}},130}, {{{0,8}},66}, {{{0,9}},228}, + {{{80,7}},7}, {{{0,8}},90}, {{{0,8}},26}, {{{0,9}},148}, + {{{84,7}},67}, {{{0,8}},122}, {{{0,8}},58}, {{{0,9}},212}, + {{{82,7}},19}, {{{0,8}},106}, {{{0,8}},42}, {{{0,9}},180}, + {{{0,8}},10}, {{{0,8}},138}, {{{0,8}},74}, {{{0,9}},244}, + {{{80,7}},5}, {{{0,8}},86}, {{{0,8}},22}, {{{192,8}},0}, + {{{83,7}},51}, {{{0,8}},118}, {{{0,8}},54}, {{{0,9}},204}, + {{{81,7}},15}, {{{0,8}},102}, {{{0,8}},38}, {{{0,9}},172}, + {{{0,8}},6}, {{{0,8}},134}, {{{0,8}},70}, {{{0,9}},236}, + {{{80,7}},9}, {{{0,8}},94}, {{{0,8}},30}, {{{0,9}},156}, + {{{84,7}},99}, {{{0,8}},126}, {{{0,8}},62}, {{{0,9}},220}, + {{{82,7}},27}, {{{0,8}},110}, {{{0,8}},46}, {{{0,9}},188}, + {{{0,8}},14}, {{{0,8}},142}, {{{0,8}},78}, {{{0,9}},252}, + {{{96,7}},256}, {{{0,8}},81}, {{{0,8}},17}, {{{85,8}},131}, + {{{82,7}},31}, {{{0,8}},113}, {{{0,8}},49}, {{{0,9}},194}, + {{{80,7}},10}, {{{0,8}},97}, {{{0,8}},33}, {{{0,9}},162}, + {{{0,8}},1}, {{{0,8}},129}, {{{0,8}},65}, {{{0,9}},226}, + {{{80,7}},6}, {{{0,8}},89}, {{{0,8}},25}, {{{0,9}},146}, + {{{83,7}},59}, {{{0,8}},121}, {{{0,8}},57}, {{{0,9}},210}, + {{{81,7}},17}, {{{0,8}},105}, {{{0,8}},41}, {{{0,9}},178}, + {{{0,8}},9}, {{{0,8}},137}, {{{0,8}},73}, {{{0,9}},242}, + {{{80,7}},4}, {{{0,8}},85}, {{{0,8}},21}, {{{80,8}},258}, + {{{83,7}},43}, {{{0,8}},117}, {{{0,8}},53}, {{{0,9}},202}, + {{{81,7}},13}, {{{0,8}},101}, {{{0,8}},37}, {{{0,9}},170}, + {{{0,8}},5}, {{{0,8}},133}, {{{0,8}},69}, {{{0,9}},234}, + {{{80,7}},8}, {{{0,8}},93}, {{{0,8}},29}, {{{0,9}},154}, + {{{84,7}},83}, {{{0,8}},125}, {{{0,8}},61}, {{{0,9}},218}, + {{{82,7}},23}, {{{0,8}},109}, {{{0,8}},45}, {{{0,9}},186}, + {{{0,8}},13}, {{{0,8}},141}, {{{0,8}},77}, {{{0,9}},250}, + {{{80,7}},3}, {{{0,8}},83}, {{{0,8}},19}, {{{85,8}},195}, + {{{83,7}},35}, {{{0,8}},115}, {{{0,8}},51}, {{{0,9}},198}, + {{{81,7}},11}, {{{0,8}},99}, {{{0,8}},35}, {{{0,9}},166}, + {{{0,8}},3}, {{{0,8}},131}, {{{0,8}},67}, {{{0,9}},230}, + {{{80,7}},7}, {{{0,8}},91}, {{{0,8}},27}, {{{0,9}},150}, + {{{84,7}},67}, {{{0,8}},123}, {{{0,8}},59}, {{{0,9}},214}, + {{{82,7}},19}, {{{0,8}},107}, {{{0,8}},43}, {{{0,9}},182}, + {{{0,8}},11}, {{{0,8}},139}, {{{0,8}},75}, {{{0,9}},246}, + {{{80,7}},5}, {{{0,8}},87}, {{{0,8}},23}, {{{192,8}},0}, + {{{83,7}},51}, {{{0,8}},119}, {{{0,8}},55}, {{{0,9}},206}, + {{{81,7}},15}, {{{0,8}},103}, {{{0,8}},39}, {{{0,9}},174}, + {{{0,8}},7}, {{{0,8}},135}, {{{0,8}},71}, {{{0,9}},238}, + {{{80,7}},9}, {{{0,8}},95}, {{{0,8}},31}, {{{0,9}},158}, + {{{84,7}},99}, {{{0,8}},127}, {{{0,8}},63}, {{{0,9}},222}, + {{{82,7}},27}, {{{0,8}},111}, {{{0,8}},47}, {{{0,9}},190}, + {{{0,8}},15}, {{{0,8}},143}, {{{0,8}},79}, {{{0,9}},254}, + {{{96,7}},256}, {{{0,8}},80}, {{{0,8}},16}, {{{84,8}},115}, + {{{82,7}},31}, {{{0,8}},112}, {{{0,8}},48}, {{{0,9}},193}, + {{{80,7}},10}, {{{0,8}},96}, {{{0,8}},32}, {{{0,9}},161}, + {{{0,8}},0}, {{{0,8}},128}, {{{0,8}},64}, {{{0,9}},225}, + {{{80,7}},6}, {{{0,8}},88}, {{{0,8}},24}, {{{0,9}},145}, + {{{83,7}},59}, {{{0,8}},120}, {{{0,8}},56}, {{{0,9}},209}, + {{{81,7}},17}, {{{0,8}},104}, {{{0,8}},40}, {{{0,9}},177}, + {{{0,8}},8}, {{{0,8}},136}, {{{0,8}},72}, {{{0,9}},241}, + {{{80,7}},4}, {{{0,8}},84}, {{{0,8}},20}, {{{85,8}},227}, + {{{83,7}},43}, {{{0,8}},116}, {{{0,8}},52}, {{{0,9}},201}, + {{{81,7}},13}, {{{0,8}},100}, {{{0,8}},36}, {{{0,9}},169}, + {{{0,8}},4}, {{{0,8}},132}, {{{0,8}},68}, {{{0,9}},233}, + {{{80,7}},8}, {{{0,8}},92}, {{{0,8}},28}, {{{0,9}},153}, + {{{84,7}},83}, {{{0,8}},124}, {{{0,8}},60}, {{{0,9}},217}, + {{{82,7}},23}, {{{0,8}},108}, {{{0,8}},44}, {{{0,9}},185}, + {{{0,8}},12}, {{{0,8}},140}, {{{0,8}},76}, {{{0,9}},249}, + {{{80,7}},3}, {{{0,8}},82}, {{{0,8}},18}, {{{85,8}},163}, + {{{83,7}},35}, {{{0,8}},114}, {{{0,8}},50}, {{{0,9}},197}, + {{{81,7}},11}, {{{0,8}},98}, {{{0,8}},34}, {{{0,9}},165}, + {{{0,8}},2}, {{{0,8}},130}, {{{0,8}},66}, {{{0,9}},229}, + {{{80,7}},7}, {{{0,8}},90}, {{{0,8}},26}, {{{0,9}},149}, + {{{84,7}},67}, {{{0,8}},122}, {{{0,8}},58}, {{{0,9}},213}, + {{{82,7}},19}, {{{0,8}},106}, {{{0,8}},42}, {{{0,9}},181}, + {{{0,8}},10}, {{{0,8}},138}, {{{0,8}},74}, {{{0,9}},245}, + {{{80,7}},5}, {{{0,8}},86}, {{{0,8}},22}, {{{192,8}},0}, + {{{83,7}},51}, {{{0,8}},118}, {{{0,8}},54}, {{{0,9}},205}, + {{{81,7}},15}, {{{0,8}},102}, {{{0,8}},38}, {{{0,9}},173}, + {{{0,8}},6}, {{{0,8}},134}, {{{0,8}},70}, {{{0,9}},237}, + {{{80,7}},9}, {{{0,8}},94}, {{{0,8}},30}, {{{0,9}},157}, + {{{84,7}},99}, {{{0,8}},126}, {{{0,8}},62}, {{{0,9}},221}, + {{{82,7}},27}, {{{0,8}},110}, {{{0,8}},46}, {{{0,9}},189}, + {{{0,8}},14}, {{{0,8}},142}, {{{0,8}},78}, {{{0,9}},253}, + {{{96,7}},256}, {{{0,8}},81}, {{{0,8}},17}, {{{85,8}},131}, + {{{82,7}},31}, {{{0,8}},113}, {{{0,8}},49}, {{{0,9}},195}, + {{{80,7}},10}, {{{0,8}},97}, {{{0,8}},33}, {{{0,9}},163}, + {{{0,8}},1}, {{{0,8}},129}, {{{0,8}},65}, {{{0,9}},227}, + {{{80,7}},6}, {{{0,8}},89}, {{{0,8}},25}, {{{0,9}},147}, + {{{83,7}},59}, {{{0,8}},121}, {{{0,8}},57}, {{{0,9}},211}, + {{{81,7}},17}, {{{0,8}},105}, {{{0,8}},41}, {{{0,9}},179}, + {{{0,8}},9}, {{{0,8}},137}, {{{0,8}},73}, {{{0,9}},243}, + {{{80,7}},4}, {{{0,8}},85}, {{{0,8}},21}, {{{80,8}},258}, + {{{83,7}},43}, {{{0,8}},117}, {{{0,8}},53}, {{{0,9}},203}, + {{{81,7}},13}, {{{0,8}},101}, {{{0,8}},37}, {{{0,9}},171}, + {{{0,8}},5}, {{{0,8}},133}, {{{0,8}},69}, {{{0,9}},235}, + {{{80,7}},8}, {{{0,8}},93}, {{{0,8}},29}, {{{0,9}},155}, + {{{84,7}},83}, {{{0,8}},125}, {{{0,8}},61}, {{{0,9}},219}, + {{{82,7}},23}, {{{0,8}},109}, {{{0,8}},45}, {{{0,9}},187}, + {{{0,8}},13}, {{{0,8}},141}, {{{0,8}},77}, {{{0,9}},251}, + {{{80,7}},3}, {{{0,8}},83}, {{{0,8}},19}, {{{85,8}},195}, + {{{83,7}},35}, {{{0,8}},115}, {{{0,8}},51}, {{{0,9}},199}, + {{{81,7}},11}, {{{0,8}},99}, {{{0,8}},35}, {{{0,9}},167}, + {{{0,8}},3}, {{{0,8}},131}, {{{0,8}},67}, {{{0,9}},231}, + {{{80,7}},7}, {{{0,8}},91}, {{{0,8}},27}, {{{0,9}},151}, + {{{84,7}},67}, {{{0,8}},123}, {{{0,8}},59}, {{{0,9}},215}, + {{{82,7}},19}, {{{0,8}},107}, {{{0,8}},43}, {{{0,9}},183}, + {{{0,8}},11}, {{{0,8}},139}, {{{0,8}},75}, {{{0,9}},247}, + {{{80,7}},5}, {{{0,8}},87}, {{{0,8}},23}, {{{192,8}},0}, + {{{83,7}},51}, {{{0,8}},119}, {{{0,8}},55}, {{{0,9}},207}, + {{{81,7}},15}, {{{0,8}},103}, {{{0,8}},39}, {{{0,9}},175}, + {{{0,8}},7}, {{{0,8}},135}, {{{0,8}},71}, {{{0,9}},239}, + {{{80,7}},9}, {{{0,8}},95}, {{{0,8}},31}, {{{0,9}},159}, + {{{84,7}},99}, {{{0,8}},127}, {{{0,8}},63}, {{{0,9}},223}, + {{{82,7}},27}, {{{0,8}},111}, {{{0,8}},47}, {{{0,9}},191}, + {{{0,8}},15}, {{{0,8}},143}, {{{0,8}},79}, {{{0,9}},255} + }; +local inflate_huft fixed_td[] = { + {{{80,5}},1}, {{{87,5}},257}, {{{83,5}},17}, {{{91,5}},4097}, + {{{81,5}},5}, {{{89,5}},1025}, {{{85,5}},65}, {{{93,5}},16385}, + {{{80,5}},3}, {{{88,5}},513}, {{{84,5}},33}, {{{92,5}},8193}, + {{{82,5}},9}, {{{90,5}},2049}, {{{86,5}},129}, {{{192,5}},24577}, + {{{80,5}},2}, {{{87,5}},385}, {{{83,5}},25}, {{{91,5}},6145}, + {{{81,5}},7}, {{{89,5}},1537}, {{{85,5}},97}, {{{93,5}},24577}, + {{{80,5}},4}, {{{88,5}},769}, {{{84,5}},49}, {{{92,5}},12289}, + {{{82,5}},13}, {{{90,5}},3073}, {{{86,5}},193}, {{{192,5}},24577} + }; diff --git a/zlib/inflate.c b/zlib/inflate.c new file mode 100644 index 0000000..32e9b8d --- /dev/null +++ b/zlib/inflate.c @@ -0,0 +1,366 @@ +/* inflate.c -- zlib interface to inflate modules + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "infblock.h" + +struct inflate_blocks_state {int dummy;}; /* for buggy compilers */ + +typedef enum { + METHOD, /* waiting for method byte */ + FLAG, /* waiting for flag byte */ + DICT4, /* four dictionary check bytes to go */ + DICT3, /* three dictionary check bytes to go */ + DICT2, /* two dictionary check bytes to go */ + DICT1, /* one dictionary check byte to go */ + DICT0, /* waiting for inflateSetDictionary */ + BLOCKS, /* decompressing blocks */ + CHECK4, /* four check bytes to go */ + CHECK3, /* three check bytes to go */ + CHECK2, /* two check bytes to go */ + CHECK1, /* one check byte to go */ + DONE, /* finished check, done */ + BAD} /* got an error--stay here */ +inflate_mode; + +/* inflate private state */ +struct internal_state { + + /* mode */ + inflate_mode mode; /* current inflate mode */ + + /* mode dependent information */ + union { + uInt method; /* if FLAGS, method byte */ + struct { + uLong was; /* computed check value */ + uLong need; /* stream check value */ + } check; /* if CHECK, check values to compare */ + uInt marker; /* if BAD, inflateSync's marker bytes count */ + } sub; /* submode */ + + /* mode independent information */ + int nowrap; /* flag for no wrapper */ + uInt wbits; /* log2(window size) (8..15, defaults to 15) */ + inflate_blocks_statef + *blocks; /* current inflate_blocks state */ + +}; + + +int ZEXPORT inflateReset(z) +z_streamp z; +{ + if (z == Z_NULL || z->state == Z_NULL) + return Z_STREAM_ERROR; + z->total_in = z->total_out = 0; + z->msg = Z_NULL; + z->state->mode = z->state->nowrap ? BLOCKS : METHOD; + inflate_blocks_reset(z->state->blocks, z, Z_NULL); + Tracev((stderr, "inflate: reset\n")); + return Z_OK; +} + + +int ZEXPORT inflateEnd(z) +z_streamp z; +{ + if (z == Z_NULL || z->state == Z_NULL || z->zfree == Z_NULL) + return Z_STREAM_ERROR; + if (z->state->blocks != Z_NULL) + inflate_blocks_free(z->state->blocks, z); + ZFREE(z, z->state); + z->state = Z_NULL; + Tracev((stderr, "inflate: end\n")); + return Z_OK; +} + + +int ZEXPORT inflateInit2_(z, w, version, stream_size) +z_streamp z; +int w; +const char *version; +int stream_size; +{ + if (version == Z_NULL || version[0] != ZLIB_VERSION[0] || + stream_size != sizeof(z_stream)) + return Z_VERSION_ERROR; + + /* initialize state */ + if (z == Z_NULL) + return Z_STREAM_ERROR; + z->msg = Z_NULL; + if (z->zalloc == Z_NULL) + { + z->zalloc = zcalloc; + z->opaque = (voidpf)0; + } + if (z->zfree == Z_NULL) z->zfree = zcfree; + if ((z->state = (struct internal_state FAR *) + ZALLOC(z,1,sizeof(struct internal_state))) == Z_NULL) + return Z_MEM_ERROR; + z->state->blocks = Z_NULL; + + /* handle undocumented nowrap option (no zlib header or check) */ + z->state->nowrap = 0; + if (w < 0) + { + w = - w; + z->state->nowrap = 1; + } + + /* set window size */ + if (w < 8 || w > 15) + { + inflateEnd(z); + return Z_STREAM_ERROR; + } + z->state->wbits = (uInt)w; + + /* create inflate_blocks state */ + if ((z->state->blocks = + inflate_blocks_new(z, z->state->nowrap ? Z_NULL : adler32, (uInt)1 << w)) + == Z_NULL) + { + inflateEnd(z); + return Z_MEM_ERROR; + } + Tracev((stderr, "inflate: allocated\n")); + + /* reset state */ + inflateReset(z); + return Z_OK; +} + + +int ZEXPORT inflateInit_(z, version, stream_size) +z_streamp z; +const char *version; +int stream_size; +{ + return inflateInit2_(z, DEF_WBITS, version, stream_size); +} + + +#define NEEDBYTE {if(z->avail_in==0)return r;r=f;} +#define NEXTBYTE (z->avail_in--,z->total_in++,*z->next_in++) + +int ZEXPORT inflate(z, f) +z_streamp z; +int f; +{ + int r; + uInt b; + + if (z == Z_NULL || z->state == Z_NULL || z->next_in == Z_NULL) + return Z_STREAM_ERROR; + f = f == Z_FINISH ? Z_BUF_ERROR : Z_OK; + r = Z_BUF_ERROR; + while (1) switch (z->state->mode) + { + case METHOD: + NEEDBYTE + if (((z->state->sub.method = NEXTBYTE) & 0xf) != Z_DEFLATED) + { + z->state->mode = BAD; + z->msg = (char*)"unknown compression method"; + z->state->sub.marker = 5; /* can't try inflateSync */ + break; + } + if ((z->state->sub.method >> 4) + 8 > z->state->wbits) + { + z->state->mode = BAD; + z->msg = (char*)"invalid window size"; + z->state->sub.marker = 5; /* can't try inflateSync */ + break; + } + z->state->mode = FLAG; + case FLAG: + NEEDBYTE + b = NEXTBYTE; + if (((z->state->sub.method << 8) + b) % 31) + { + z->state->mode = BAD; + z->msg = (char*)"incorrect header check"; + z->state->sub.marker = 5; /* can't try inflateSync */ + break; + } + Tracev((stderr, "inflate: zlib header ok\n")); + if (!(b & PRESET_DICT)) + { + z->state->mode = BLOCKS; + break; + } + z->state->mode = DICT4; + case DICT4: + NEEDBYTE + z->state->sub.check.need = (uLong)NEXTBYTE << 24; + z->state->mode = DICT3; + case DICT3: + NEEDBYTE + z->state->sub.check.need += (uLong)NEXTBYTE << 16; + z->state->mode = DICT2; + case DICT2: + NEEDBYTE + z->state->sub.check.need += (uLong)NEXTBYTE << 8; + z->state->mode = DICT1; + case DICT1: + NEEDBYTE + z->state->sub.check.need += (uLong)NEXTBYTE; + z->adler = z->state->sub.check.need; + z->state->mode = DICT0; + return Z_NEED_DICT; + case DICT0: + z->state->mode = BAD; + z->msg = (char*)"need dictionary"; + z->state->sub.marker = 0; /* can try inflateSync */ + return Z_STREAM_ERROR; + case BLOCKS: + r = inflate_blocks(z->state->blocks, z, r); + if (r == Z_DATA_ERROR) + { + z->state->mode = BAD; + z->state->sub.marker = 0; /* can try inflateSync */ + break; + } + if (r == Z_OK) + r = f; + if (r != Z_STREAM_END) + return r; + r = f; + inflate_blocks_reset(z->state->blocks, z, &z->state->sub.check.was); + if (z->state->nowrap) + { + z->state->mode = DONE; + break; + } + z->state->mode = CHECK4; + case CHECK4: + NEEDBYTE + z->state->sub.check.need = (uLong)NEXTBYTE << 24; + z->state->mode = CHECK3; + case CHECK3: + NEEDBYTE + z->state->sub.check.need += (uLong)NEXTBYTE << 16; + z->state->mode = CHECK2; + case CHECK2: + NEEDBYTE + z->state->sub.check.need += (uLong)NEXTBYTE << 8; + z->state->mode = CHECK1; + case CHECK1: + NEEDBYTE + z->state->sub.check.need += (uLong)NEXTBYTE; + + if (z->state->sub.check.was != z->state->sub.check.need) + { + z->state->mode = BAD; + z->msg = (char*)"incorrect data check"; + z->state->sub.marker = 5; /* can't try inflateSync */ + break; + } + Tracev((stderr, "inflate: zlib check ok\n")); + z->state->mode = DONE; + case DONE: + return Z_STREAM_END; + case BAD: + return Z_DATA_ERROR; + default: + return Z_STREAM_ERROR; + } +#ifdef NEED_DUMMY_RETURN + return Z_STREAM_ERROR; /* Some dumb compilers complain without this */ +#endif +} + + +int ZEXPORT inflateSetDictionary(z, dictionary, dictLength) +z_streamp z; +const Bytef *dictionary; +uInt dictLength; +{ + uInt length = dictLength; + + if (z == Z_NULL || z->state == Z_NULL || z->state->mode != DICT0) + return Z_STREAM_ERROR; + + if (adler32(1L, dictionary, dictLength) != z->adler) return Z_DATA_ERROR; + z->adler = 1L; + + if (length >= ((uInt)1<state->wbits)) + { + length = (1<state->wbits)-1; + dictionary += dictLength - length; + } + inflate_set_dictionary(z->state->blocks, dictionary, length); + z->state->mode = BLOCKS; + return Z_OK; +} + + +int ZEXPORT inflateSync(z) +z_streamp z; +{ + uInt n; /* number of bytes to look at */ + Bytef *p; /* pointer to bytes */ + uInt m; /* number of marker bytes found in a row */ + uLong r, w; /* temporaries to save total_in and total_out */ + + /* set up */ + if (z == Z_NULL || z->state == Z_NULL) + return Z_STREAM_ERROR; + if (z->state->mode != BAD) + { + z->state->mode = BAD; + z->state->sub.marker = 0; + } + if ((n = z->avail_in) == 0) + return Z_BUF_ERROR; + p = z->next_in; + m = z->state->sub.marker; + + /* search */ + while (n && m < 4) + { + static const Byte mark[4] = {0, 0, 0xff, 0xff}; + if (*p == mark[m]) + m++; + else if (*p) + m = 0; + else + m = 4 - m; + p++, n--; + } + + /* restore */ + z->total_in += p - z->next_in; + z->next_in = p; + z->avail_in = n; + z->state->sub.marker = m; + + /* return no joy or set up to restart on a new block */ + if (m != 4) + return Z_DATA_ERROR; + r = z->total_in; w = z->total_out; + inflateReset(z); + z->total_in = r; z->total_out = w; + z->state->mode = BLOCKS; + return Z_OK; +} + + +/* Returns true if inflate is currently at the end of a block generated + * by Z_SYNC_FLUSH or Z_FULL_FLUSH. This function is used by one PPP + * implementation to provide an additional safety check. PPP uses Z_SYNC_FLUSH + * but removes the length bytes of the resulting empty stored block. When + * decompressing, PPP checks that at the end of input packet, inflate is + * waiting for these length bytes. + */ +int ZEXPORT inflateSyncPoint(z) +z_streamp z; +{ + if (z == Z_NULL || z->state == Z_NULL || z->state->blocks == Z_NULL) + return Z_STREAM_ERROR; + return inflate_blocks_sync_point(z->state->blocks); +} diff --git a/zlib/inftrees.c b/zlib/inftrees.c new file mode 100644 index 0000000..ef1e0b6 --- /dev/null +++ b/zlib/inftrees.c @@ -0,0 +1,455 @@ +/* inftrees.c -- generate Huffman trees for efficient decoding + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" + +#if !defined(BUILDFIXED) && !defined(STDC) +# define BUILDFIXED /* non ANSI compilers may not accept inffixed.h */ +#endif + +const char inflate_copyright[] = + " inflate 1.1.3 Copyright 1995-1998 Mark Adler "; +/* + If you use the zlib library in a product, an acknowledgment is welcome + in the documentation of your product. If for some reason you cannot + include such an acknowledgment, I would appreciate that you keep this + copyright string in the executable of your product. + */ +struct internal_state {int dummy;}; /* for buggy compilers */ + +/* simplify the use of the inflate_huft type with some defines */ +#define exop word.what.Exop +#define bits word.what.Bits + + +local int huft_build OF(( + uIntf *, /* code lengths in bits */ + uInt, /* number of codes */ + uInt, /* number of "simple" codes */ + const uIntf *, /* list of base values for non-simple codes */ + const uIntf *, /* list of extra bits for non-simple codes */ + inflate_huft * FAR*,/* result: starting table */ + uIntf *, /* maximum lookup bits (returns actual) */ + inflate_huft *, /* space for trees */ + uInt *, /* hufts used in space */ + uIntf * )); /* space for values */ + +/* Tables for deflate from PKZIP's appnote.txt. */ +local const uInt cplens[31] = { /* Copy lengths for literal codes 257..285 */ + 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 17, 19, 23, 27, 31, + 35, 43, 51, 59, 67, 83, 99, 115, 131, 163, 195, 227, 258, 0, 0}; + /* see note #13 above about 258 */ +local const uInt cplext[31] = { /* Extra bits for literal codes 257..285 */ + 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, + 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0, 112, 112}; /* 112==invalid */ +local const uInt cpdist[30] = { /* Copy offsets for distance codes 0..29 */ + 1, 2, 3, 4, 5, 7, 9, 13, 17, 25, 33, 49, 65, 97, 129, 193, + 257, 385, 513, 769, 1025, 1537, 2049, 3073, 4097, 6145, + 8193, 12289, 16385, 24577}; +local const uInt cpdext[30] = { /* Extra bits for distance codes */ + 0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, + 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, + 12, 12, 13, 13}; + +/* + Huffman code decoding is performed using a multi-level table lookup. + The fastest way to decode is to simply build a lookup table whose + size is determined by the longest code. However, the time it takes + to build this table can also be a factor if the data being decoded + is not very long. The most common codes are necessarily the + shortest codes, so those codes dominate the decoding time, and hence + the speed. The idea is you can have a shorter table that decodes the + shorter, more probable codes, and then point to subsidiary tables for + the longer codes. The time it costs to decode the longer codes is + then traded against the time it takes to make longer tables. + + This results of this trade are in the variables lbits and dbits + below. lbits is the number of bits the first level table for literal/ + length codes can decode in one step, and dbits is the same thing for + the distance codes. Subsequent tables are also less than or equal to + those sizes. These values may be adjusted either when all of the + codes are shorter than that, in which case the longest code length in + bits is used, or when the shortest code is *longer* than the requested + table size, in which case the length of the shortest code in bits is + used. + + There are two different values for the two tables, since they code a + different number of possibilities each. The literal/length table + codes 286 possible values, or in a flat code, a little over eight + bits. The distance table codes 30 possible values, or a little less + than five bits, flat. The optimum values for speed end up being + about one bit more than those, so lbits is 8+1 and dbits is 5+1. + The optimum values may differ though from machine to machine, and + possibly even between compilers. Your mileage may vary. + */ + + +/* If BMAX needs to be larger than 16, then h and x[] should be uLong. */ +#define BMAX 15 /* maximum bit length of any code */ + +local int huft_build(b, n, s, d, e, t, m, hp, hn, v) +uIntf *b; /* code lengths in bits (all assumed <= BMAX) */ +uInt n; /* number of codes (assumed <= 288) */ +uInt s; /* number of simple-valued codes (0..s-1) */ +const uIntf *d; /* list of base values for non-simple codes */ +const uIntf *e; /* list of extra bits for non-simple codes */ +inflate_huft * FAR *t; /* result: starting table */ +uIntf *m; /* maximum lookup bits, returns actual */ +inflate_huft *hp; /* space for trees */ +uInt *hn; /* hufts used in space */ +uIntf *v; /* working area: values in order of bit length */ +/* Given a list of code lengths and a maximum table size, make a set of + tables to decode that set of codes. Return Z_OK on success, Z_BUF_ERROR + if the given code set is incomplete (the tables are still built in this + case), Z_DATA_ERROR if the input is invalid (an over-subscribed set of + lengths), or Z_MEM_ERROR if not enough memory. */ +{ + + uInt a; /* counter for codes of length k */ + uInt c[BMAX+1]; /* bit length count table */ + uInt f; /* i repeats in table every f entries */ + int g; /* maximum code length */ + int h; /* table level */ + register uInt i; /* counter, current code */ + register uInt j; /* counter */ + register int k; /* number of bits in current code */ + int l; /* bits per table (returned in m) */ + uInt mask; /* (1 << w) - 1, to avoid cc -O bug on HP */ + register uIntf *p; /* pointer into c[], b[], or v[] */ + inflate_huft *q; /* points to current table */ + struct inflate_huft_s r; /* table entry for structure assignment */ + inflate_huft *u[BMAX]; /* table stack */ + register int w; /* bits before this table == (l * h) */ + uInt x[BMAX+1]; /* bit offsets, then code stack */ + uIntf *xp; /* pointer into x */ + int y; /* number of dummy codes added */ + uInt z; /* number of entries in current table */ + + + /* Generate counts for each bit length */ + p = c; +#define C0 *p++ = 0; +#define C2 C0 C0 C0 C0 +#define C4 C2 C2 C2 C2 + C4 /* clear c[]--assume BMAX+1 is 16 */ + p = b; i = n; + do { + c[*p++]++; /* assume all entries <= BMAX */ + } while (--i); + if (c[0] == n) /* null input--all zero length codes */ + { + *t = (inflate_huft *)Z_NULL; + *m = 0; + return Z_OK; + } + + + /* Find minimum and maximum length, bound *m by those */ + l = *m; + for (j = 1; j <= BMAX; j++) + if (c[j]) + break; + k = j; /* minimum code length */ + if ((uInt)l < j) + l = j; + for (i = BMAX; i; i--) + if (c[i]) + break; + g = i; /* maximum code length */ + if ((uInt)l > i) + l = i; + *m = l; + + + /* Adjust last length count to fill out codes, if needed */ + for (y = 1 << j; j < i; j++, y <<= 1) + if ((y -= c[j]) < 0) + return Z_DATA_ERROR; + if ((y -= c[i]) < 0) + return Z_DATA_ERROR; + c[i] += y; + + + /* Generate starting offsets into the value table for each length */ + x[1] = j = 0; + p = c + 1; xp = x + 2; + while (--i) { /* note that i == g from above */ + *xp++ = (j += *p++); + } + + + /* Make a table of values in order of bit lengths */ + p = b; i = 0; + do { + if ((j = *p++) != 0) + v[x[j]++] = i; + } while (++i < n); + n = x[g]; /* set n to length of v */ + + + /* Generate the Huffman codes and for each, make the table entries */ + x[0] = i = 0; /* first Huffman code is zero */ + p = v; /* grab values in bit order */ + h = -1; /* no tables yet--level -1 */ + w = -l; /* bits decoded == (l * h) */ + u[0] = (inflate_huft *)Z_NULL; /* just to keep compilers happy */ + q = (inflate_huft *)Z_NULL; /* ditto */ + z = 0; /* ditto */ + + /* go through the bit lengths (k already is bits in shortest code) */ + for (; k <= g; k++) + { + a = c[k]; + while (a--) + { + /* here i is the Huffman code of length k bits for value *p */ + /* make tables up to required level */ + while (k > w + l) + { + h++; + w += l; /* previous table always l bits */ + + /* compute minimum size table less than or equal to l bits */ + z = g - w; + z = z > (uInt)l ? l : z; /* table size upper limit */ + if ((f = 1 << (j = k - w)) > a + 1) /* try a k-w bit table */ + { /* too few codes for k-w bit table */ + f -= a + 1; /* deduct codes from patterns left */ + xp = c + k; + if (j < z) + while (++j < z) /* try smaller tables up to z bits */ + { + if ((f <<= 1) <= *++xp) + break; /* enough codes to use up j bits */ + f -= *xp; /* else deduct codes from patterns */ + } + } + z = 1 << j; /* table entries for j-bit table */ + + /* allocate new table */ + if (*hn + z > MANY) /* (note: doesn't matter for fixed) */ + return Z_MEM_ERROR; /* not enough memory */ + u[h] = q = hp + *hn; + *hn += z; + + /* connect to last table, if there is one */ + if (h) + { + x[h] = i; /* save pattern for backing up */ + r.bits = (Byte)l; /* bits to dump before this table */ + r.exop = (Byte)j; /* bits in this table */ + j = i >> (w - l); + r.base = (uInt)(q - u[h-1] - j); /* offset to this table */ + u[h-1][j] = r; /* connect to last table */ + } + else + *t = q; /* first table is returned result */ + } + + /* set up table entry in r */ + r.bits = (Byte)(k - w); + if (p >= v + n) + r.exop = 128 + 64; /* out of values--invalid code */ + else if (*p < s) + { + r.exop = (Byte)(*p < 256 ? 0 : 32 + 64); /* 256 is end-of-block */ + r.base = *p++; /* simple code is just the value */ + } + else + { + r.exop = (Byte)(e[*p - s] + 16 + 64);/* non-simple--look up in lists */ + r.base = d[*p++ - s]; + } + + /* fill code-like entries with r */ + f = 1 << (k - w); + for (j = i >> w; j < z; j += f) + q[j] = r; + + /* backwards increment the k-bit code i */ + for (j = 1 << (k - 1); i & j; j >>= 1) + i ^= j; + i ^= j; + + /* backup over finished tables */ + mask = (1 << w) - 1; /* needed on HP, cc -O bug */ + while ((i & mask) != x[h]) + { + h--; /* don't need to update q */ + w -= l; + mask = (1 << w) - 1; + } + } + } + + + /* Return Z_BUF_ERROR if we were given an incomplete table */ + return y != 0 && g != 1 ? Z_BUF_ERROR : Z_OK; +} + + +int inflate_trees_bits(c, bb, tb, hp, z) +uIntf *c; /* 19 code lengths */ +uIntf *bb; /* bits tree desired/actual depth */ +inflate_huft * FAR *tb; /* bits tree result */ +inflate_huft *hp; /* space for trees */ +z_streamp z; /* for messages */ +{ + int r; + uInt hn = 0; /* hufts used in space */ + uIntf *v; /* work area for huft_build */ + + if ((v = (uIntf*)ZALLOC(z, 19, sizeof(uInt))) == Z_NULL) + return Z_MEM_ERROR; + r = huft_build(c, 19, 19, (uIntf*)Z_NULL, (uIntf*)Z_NULL, + tb, bb, hp, &hn, v); + if (r == Z_DATA_ERROR) + z->msg = (char*)"oversubscribed dynamic bit lengths tree"; + else if (r == Z_BUF_ERROR || *bb == 0) + { + z->msg = (char*)"incomplete dynamic bit lengths tree"; + r = Z_DATA_ERROR; + } + ZFREE(z, v); + return r; +} + + +int inflate_trees_dynamic(nl, nd, c, bl, bd, tl, td, hp, z) +uInt nl; /* number of literal/length codes */ +uInt nd; /* number of distance codes */ +uIntf *c; /* that many (total) code lengths */ +uIntf *bl; /* literal desired/actual bit depth */ +uIntf *bd; /* distance desired/actual bit depth */ +inflate_huft * FAR *tl; /* literal/length tree result */ +inflate_huft * FAR *td; /* distance tree result */ +inflate_huft *hp; /* space for trees */ +z_streamp z; /* for messages */ +{ + int r; + uInt hn = 0; /* hufts used in space */ + uIntf *v; /* work area for huft_build */ + + /* allocate work area */ + if ((v = (uIntf*)ZALLOC(z, 288, sizeof(uInt))) == Z_NULL) + return Z_MEM_ERROR; + + /* build literal/length tree */ + r = huft_build(c, nl, 257, cplens, cplext, tl, bl, hp, &hn, v); + if (r != Z_OK || *bl == 0) + { + if (r == Z_DATA_ERROR) + z->msg = (char*)"oversubscribed literal/length tree"; + else if (r != Z_MEM_ERROR) + { + z->msg = (char*)"incomplete literal/length tree"; + r = Z_DATA_ERROR; + } + ZFREE(z, v); + return r; + } + + /* build distance tree */ + r = huft_build(c + nl, nd, 0, cpdist, cpdext, td, bd, hp, &hn, v); + if (r != Z_OK || (*bd == 0 && nl > 257)) + { + if (r == Z_DATA_ERROR) + z->msg = (char*)"oversubscribed distance tree"; + else if (r == Z_BUF_ERROR) { +#ifdef PKZIP_BUG_WORKAROUND + r = Z_OK; + } +#else + z->msg = (char*)"incomplete distance tree"; + r = Z_DATA_ERROR; + } + else if (r != Z_MEM_ERROR) + { + z->msg = (char*)"empty distance tree with lengths"; + r = Z_DATA_ERROR; + } + ZFREE(z, v); + return r; +#endif + } + + /* done */ + ZFREE(z, v); + return Z_OK; +} + + +/* build fixed tables only once--keep them here */ +#ifdef BUILDFIXED +local int fixed_built = 0; +#define FIXEDH 544 /* number of hufts used by fixed tables */ +local inflate_huft fixed_mem[FIXEDH]; +local uInt fixed_bl; +local uInt fixed_bd; +local inflate_huft *fixed_tl; +local inflate_huft *fixed_td; +#else +#include "inffixed.h" +#endif + + +int inflate_trees_fixed(bl, bd, tl, td, z) +uIntf *bl; /* literal desired/actual bit depth */ +uIntf *bd; /* distance desired/actual bit depth */ +inflate_huft * FAR *tl; /* literal/length tree result */ +inflate_huft * FAR *td; /* distance tree result */ +z_streamp z; /* for memory allocation */ +{ +#ifdef BUILDFIXED + /* build fixed tables if not already */ + if (!fixed_built) + { + int k; /* temporary variable */ + uInt f = 0; /* number of hufts used in fixed_mem */ + uIntf *c; /* length list for huft_build */ + uIntf *v; /* work area for huft_build */ + + /* allocate memory */ + if ((c = (uIntf*)ZALLOC(z, 288, sizeof(uInt))) == Z_NULL) + return Z_MEM_ERROR; + if ((v = (uIntf*)ZALLOC(z, 288, sizeof(uInt))) == Z_NULL) + { + ZFREE(z, c); + return Z_MEM_ERROR; + } + + /* literal table */ + for (k = 0; k < 144; k++) + c[k] = 8; + for (; k < 256; k++) + c[k] = 9; + for (; k < 280; k++) + c[k] = 7; + for (; k < 288; k++) + c[k] = 8; + fixed_bl = 9; + huft_build(c, 288, 257, cplens, cplext, &fixed_tl, &fixed_bl, + fixed_mem, &f, v); + + /* distance table */ + for (k = 0; k < 30; k++) + c[k] = 5; + fixed_bd = 5; + huft_build(c, 30, 0, cpdist, cpdext, &fixed_td, &fixed_bd, + fixed_mem, &f, v); + + /* done */ + ZFREE(z, v); + ZFREE(z, c); + fixed_built = 1; + } +#endif + *bl = fixed_bl; + *bd = fixed_bd; + *tl = fixed_tl; + *td = fixed_td; + return Z_OK; +} diff --git a/zlib/inftrees.h b/zlib/inftrees.h new file mode 100644 index 0000000..85853e0 --- /dev/null +++ b/zlib/inftrees.h @@ -0,0 +1,58 @@ +/* inftrees.h -- header to use inftrees.c + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* Huffman code lookup table entry--this entry is four bytes for machines + that have 16-bit pointers (e.g. PC's in the small or medium model). */ + +typedef struct inflate_huft_s FAR inflate_huft; + +struct inflate_huft_s { + union { + struct { + Byte Exop; /* number of extra bits or operation */ + Byte Bits; /* number of bits in this code or subcode */ + } what; + uInt pad; /* pad structure to a power of 2 (4 bytes for */ + } word; /* 16-bit, 8 bytes for 32-bit int's) */ + uInt base; /* literal, length base, distance base, + or table offset */ +}; + +/* Maximum size of dynamic tree. The maximum found in a long but non- + exhaustive search was 1004 huft structures (850 for length/literals + and 154 for distances, the latter actually the result of an + exhaustive search). The actual maximum is not known, but the + value below is more than safe. */ +#define MANY 1440 + +extern int inflate_trees_bits OF(( + uIntf *, /* 19 code lengths */ + uIntf *, /* bits tree desired/actual depth */ + inflate_huft * FAR *, /* bits tree result */ + inflate_huft *, /* space for trees */ + z_streamp)); /* for messages */ + +extern int inflate_trees_dynamic OF(( + uInt, /* number of literal/length codes */ + uInt, /* number of distance codes */ + uIntf *, /* that many (total) code lengths */ + uIntf *, /* literal desired/actual bit depth */ + uIntf *, /* distance desired/actual bit depth */ + inflate_huft * FAR *, /* literal/length tree result */ + inflate_huft * FAR *, /* distance tree result */ + inflate_huft *, /* space for trees */ + z_streamp)); /* for messages */ + +extern int inflate_trees_fixed OF(( + uIntf *, /* literal desired/actual bit depth */ + uIntf *, /* distance desired/actual bit depth */ + inflate_huft * FAR *, /* literal/length tree result */ + inflate_huft * FAR *, /* distance tree result */ + z_streamp)); /* for memory allocation */ diff --git a/zlib/infutil.c b/zlib/infutil.c new file mode 100644 index 0000000..824dab5 --- /dev/null +++ b/zlib/infutil.c @@ -0,0 +1,87 @@ +/* inflate_util.c -- data and routines common to blocks and codes + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "infblock.h" +#include "inftrees.h" +#include "infcodes.h" +#include "infutil.h" + +struct inflate_codes_state {int dummy;}; /* for buggy compilers */ + +/* And'ing with mask[n] masks the lower n bits */ +uInt inflate_mask[17] = { + 0x0000, + 0x0001, 0x0003, 0x0007, 0x000f, 0x001f, 0x003f, 0x007f, 0x00ff, + 0x01ff, 0x03ff, 0x07ff, 0x0fff, 0x1fff, 0x3fff, 0x7fff, 0xffff +}; + + +/* copy as much as possible from the sliding window to the output area */ +int inflate_flush(s, z, r) +inflate_blocks_statef *s; +z_streamp z; +int r; +{ + uInt n; + Bytef *p; + Bytef *q; + + /* local copies of source and destination pointers */ + p = z->next_out; + q = s->read; + + /* compute number of bytes to copy as far as end of window */ + n = (uInt)((q <= s->write ? s->write : s->end) - q); + if (n > z->avail_out) n = z->avail_out; + if (n && r == Z_BUF_ERROR) r = Z_OK; + + /* update counters */ + z->avail_out -= n; + z->total_out += n; + + /* update check information */ + if (s->checkfn != Z_NULL) + z->adler = s->check = (*s->checkfn)(s->check, q, n); + + /* copy as far as end of window */ + zmemcpy(p, q, n); + p += n; + q += n; + + /* see if more to copy at beginning of window */ + if (q == s->end) + { + /* wrap pointers */ + q = s->window; + if (s->write == s->end) + s->write = s->window; + + /* compute bytes to copy */ + n = (uInt)(s->write - q); + if (n > z->avail_out) n = z->avail_out; + if (n && r == Z_BUF_ERROR) r = Z_OK; + + /* update counters */ + z->avail_out -= n; + z->total_out += n; + + /* update check information */ + if (s->checkfn != Z_NULL) + z->adler = s->check = (*s->checkfn)(s->check, q, n); + + /* copy */ + zmemcpy(p, q, n); + p += n; + q += n; + } + + /* update pointers */ + z->next_out = p; + s->read = q; + + /* done */ + return r; +} diff --git a/zlib/infutil.h b/zlib/infutil.h new file mode 100644 index 0000000..99d1135 --- /dev/null +++ b/zlib/infutil.h @@ -0,0 +1,98 @@ +/* infutil.h -- types and macros common to blocks and codes + * Copyright (C) 1995-1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +#ifndef _INFUTIL_H +#define _INFUTIL_H + +typedef enum { + TYPE, /* get type bits (3, including end bit) */ + LENS, /* get lengths for stored */ + STORED, /* processing stored block */ + TABLE, /* get table lengths */ + BTREE, /* get bit lengths tree for a dynamic block */ + DTREE, /* get length, distance trees for a dynamic block */ + CODES, /* processing fixed or dynamic block */ + DRY, /* output remaining window bytes */ + DONE, /* finished last block, done */ + BAD} /* got a data error--stuck here */ +inflate_block_mode; + +/* inflate blocks semi-private state */ +struct inflate_blocks_state { + + /* mode */ + inflate_block_mode mode; /* current inflate_block mode */ + + /* mode dependent information */ + union { + uInt left; /* if STORED, bytes left to copy */ + struct { + uInt table; /* table lengths (14 bits) */ + uInt index; /* index into blens (or border) */ + uIntf *blens; /* bit lengths of codes */ + uInt bb; /* bit length tree depth */ + inflate_huft *tb; /* bit length decoding tree */ + } trees; /* if DTREE, decoding info for trees */ + struct { + inflate_codes_statef + *codes; + } decode; /* if CODES, current state */ + } sub; /* submode */ + uInt last; /* true if this block is the last block */ + + /* mode independent information */ + uInt bitk; /* bits in bit buffer */ + uLong bitb; /* bit buffer */ + inflate_huft *hufts; /* single malloc for tree space */ + Bytef *window; /* sliding window */ + Bytef *end; /* one byte after sliding window */ + Bytef *read; /* window read pointer */ + Bytef *write; /* window write pointer */ + check_func checkfn; /* check function */ + uLong check; /* check on output */ + +}; + + +/* defines for inflate input/output */ +/* update pointers and return */ +#define UPDBITS {s->bitb=b;s->bitk=k;} +#define UPDIN {z->avail_in=n;z->total_in+=p-z->next_in;z->next_in=p;} +#define UPDOUT {s->write=q;} +#define UPDATE {UPDBITS UPDIN UPDOUT} +#define LEAVE {UPDATE return inflate_flush(s,z,r);} +/* get bytes and bits */ +#define LOADIN {p=z->next_in;n=z->avail_in;b=s->bitb;k=s->bitk;} +#define NEEDBYTE {if(n)r=Z_OK;else LEAVE} +#define NEXTBYTE (n--,*p++) +#define NEEDBITS(j) {while(k<(j)){NEEDBYTE;b|=((uLong)NEXTBYTE)<>=(j);k-=(j);} +/* output bytes */ +#define WAVAIL (uInt)(qread?s->read-q-1:s->end-q) +#define LOADOUT {q=s->write;m=(uInt)WAVAIL;} +#define WRAP {if(q==s->end&&s->read!=s->window){q=s->window;m=(uInt)WAVAIL;}} +#define FLUSH {UPDOUT r=inflate_flush(s,z,r); LOADOUT} +#define NEEDOUT {if(m==0){WRAP if(m==0){FLUSH WRAP if(m==0) LEAVE}}r=Z_OK;} +#define OUTBYTE(a) {*q++=(Byte)(a);m--;} +/* load local pointers */ +#define LOAD {LOADIN LOADOUT} + +/* masks for lower bits (size given to avoid silly warnings with Visual C++) */ +extern uInt inflate_mask[17]; + +/* copy as much as possible from the sliding window to the output area */ +extern int inflate_flush OF(( + inflate_blocks_statef *, + z_streamp , + int)); + +struct internal_state {int dummy;}; /* for buggy compilers */ + +#endif diff --git a/zlib/maketree.c b/zlib/maketree.c new file mode 100644 index 0000000..949d786 --- /dev/null +++ b/zlib/maketree.c @@ -0,0 +1,85 @@ +/* maketree.c -- make inffixed.h table for decoding fixed codes + * Copyright (C) 1998 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* This program is included in the distribution for completeness. + You do not need to compile or run this program since inffixed.h + is already included in the distribution. To use this program + you need to compile zlib with BUILDFIXED defined and then compile + and link this program with the zlib library. Then the output of + this program can be piped to inffixed.h. */ + +#include +#include +#include "zutil.h" +#include "inftrees.h" + +/* simplify the use of the inflate_huft type with some defines */ +#define exop word.what.Exop +#define bits word.what.Bits + +/* generate initialization table for an inflate_huft structure array */ +void maketree(uInt b, inflate_huft *t) +{ + int i, e; + + i = 0; + while (1) + { + e = t[i].exop; + if (e && (e & (16+64)) == 0) /* table pointer */ + { + fprintf(stderr, "maketree: cannot initialize sub-tables!\n"); + exit(1); + } + if (i % 4 == 0) + printf("\n "); + printf(" {{{%u,%u}},%u}", t[i].exop, t[i].bits, t[i].base); + if (++i == (1< +#include "zlib.h" + +#ifdef STDC +# include +# include +#else + extern void exit OF((int)); +#endif + +#ifdef USE_MMAP +# include +# include +# include +#endif + +#if defined(MSDOS) || defined(OS2) || defined(WIN32) +# include +# include +# define SET_BINARY_MODE(file) setmode(fileno(file), O_BINARY) +#else +# define SET_BINARY_MODE(file) +#endif + +#ifdef VMS +# define unlink delete +# define GZ_SUFFIX "-gz" +#endif +#ifdef RISCOS +# define unlink remove +# define GZ_SUFFIX "-gz" +# define fileno(file) file->__file +#endif +#if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os +# include /* for fileno */ +#endif + +#ifndef WIN32 /* unlink already in stdio.h for WIN32 */ + extern int unlink OF((const char *)); +#endif + +#ifndef GZ_SUFFIX +# define GZ_SUFFIX ".gz" +#endif +#define SUFFIX_LEN (sizeof(GZ_SUFFIX)-1) + +#define BUFLEN 16384 +#define MAX_NAME_LEN 1024 + +#ifdef MAXSEG_64K +# define local static + /* Needed for systems with limitation on stack size. */ +#else +# define local +#endif + +char *prog; + +void error OF((const char *msg)); +void gz_compress OF((FILE *in, gzFile out)); +#ifdef USE_MMAP +int gz_compress_mmap OF((FILE *in, gzFile out)); +#endif +void gz_uncompress OF((gzFile in, FILE *out)); +void file_compress OF((char *file, char *mode)); +void file_uncompress OF((char *file)); +int main OF((int argc, char *argv[])); + +/* =========================================================================== + * Display error message and exit + */ +void error(msg) + const char *msg; +{ + fprintf(stderr, "%s: %s\n", prog, msg); + exit(1); +} + +/* =========================================================================== + * Compress input to output then close both files. + */ + +void gz_compress(in, out) + FILE *in; + gzFile out; +{ + local char buf[BUFLEN]; + int len; + int err; + +#ifdef USE_MMAP + /* Try first compressing with mmap. If mmap fails (minigzip used in a + * pipe), use the normal fread loop. + */ + if (gz_compress_mmap(in, out) == Z_OK) return; +#endif + for (;;) { + len = fread(buf, 1, sizeof(buf), in); + if (ferror(in)) { + perror("fread"); + exit(1); + } + if (len == 0) break; + + if (gzwrite(out, buf, (unsigned)len) != len) error(gzerror(out, &err)); + } + fclose(in); + if (gzclose(out) != Z_OK) error("failed gzclose"); +} + +#ifdef USE_MMAP /* MMAP version, Miguel Albrecht */ + +/* Try compressing the input file at once using mmap. Return Z_OK if + * if success, Z_ERRNO otherwise. + */ +int gz_compress_mmap(in, out) + FILE *in; + gzFile out; +{ + int len; + int err; + int ifd = fileno(in); + caddr_t buf; /* mmap'ed buffer for the entire input file */ + off_t buf_len; /* length of the input file */ + struct stat sb; + + /* Determine the size of the file, needed for mmap: */ + if (fstat(ifd, &sb) < 0) return Z_ERRNO; + buf_len = sb.st_size; + if (buf_len <= 0) return Z_ERRNO; + + /* Now do the actual mmap: */ + buf = mmap((caddr_t) 0, buf_len, PROT_READ, MAP_SHARED, ifd, (off_t)0); + if (buf == (caddr_t)(-1)) return Z_ERRNO; + + /* Compress the whole file at once: */ + len = gzwrite(out, (char *)buf, (unsigned)buf_len); + + if (len != (int)buf_len) error(gzerror(out, &err)); + + munmap(buf, buf_len); + fclose(in); + if (gzclose(out) != Z_OK) error("failed gzclose"); + return Z_OK; +} +#endif /* USE_MMAP */ + +/* =========================================================================== + * Uncompress input to output then close both files. + */ +void gz_uncompress(in, out) + gzFile in; + FILE *out; +{ + local char buf[BUFLEN]; + int len; + int err; + + for (;;) { + len = gzread(in, buf, sizeof(buf)); + if (len < 0) error (gzerror(in, &err)); + if (len == 0) break; + + if ((int)fwrite(buf, 1, (unsigned)len, out) != len) { + error("failed fwrite"); + } + } + if (fclose(out)) error("failed fclose"); + + if (gzclose(in) != Z_OK) error("failed gzclose"); +} + + +/* =========================================================================== + * Compress the given file: create a corresponding .gz file and remove the + * original. + */ +void file_compress(file, mode) + char *file; + char *mode; +{ + local char outfile[MAX_NAME_LEN]; + FILE *in; + gzFile out; + + strcpy(outfile, file); + strcat(outfile, GZ_SUFFIX); + + in = fopen(file, "rb"); + if (in == NULL) { + perror(file); + exit(1); + } + out = gzopen(outfile, mode); + if (out == NULL) { + fprintf(stderr, "%s: can't gzopen %s\n", prog, outfile); + exit(1); + } + gz_compress(in, out); + + unlink(file); +} + + +/* =========================================================================== + * Uncompress the given file and remove the original. + */ +void file_uncompress(file) + char *file; +{ + local char buf[MAX_NAME_LEN]; + char *infile, *outfile; + FILE *out; + gzFile in; + int len = strlen(file); + + strcpy(buf, file); + + if (len > SUFFIX_LEN && strcmp(file+len-SUFFIX_LEN, GZ_SUFFIX) == 0) { + infile = file; + outfile = buf; + outfile[len-3] = '\0'; + } else { + outfile = file; + infile = buf; + strcat(infile, GZ_SUFFIX); + } + in = gzopen(infile, "rb"); + if (in == NULL) { + fprintf(stderr, "%s: can't gzopen %s\n", prog, infile); + exit(1); + } + out = fopen(outfile, "wb"); + if (out == NULL) { + perror(file); + exit(1); + } + + gz_uncompress(in, out); + + unlink(infile); +} + + +/* =========================================================================== + * Usage: minigzip [-d] [-f] [-h] [-1 to -9] [files...] + * -d : decompress + * -f : compress with Z_FILTERED + * -h : compress with Z_HUFFMAN_ONLY + * -1 to -9 : compression level + */ + +int main(argc, argv) + int argc; + char *argv[]; +{ + int uncompr = 0; + gzFile file; + char outmode[20]; + + strcpy(outmode, "wb6 "); + + prog = argv[0]; + argc--, argv++; + + while (argc > 0) { + if (strcmp(*argv, "-d") == 0) + uncompr = 1; + else if (strcmp(*argv, "-f") == 0) + outmode[3] = 'f'; + else if (strcmp(*argv, "-h") == 0) + outmode[3] = 'h'; + else if ((*argv)[0] == '-' && (*argv)[1] >= '1' && (*argv)[1] <= '9' && + (*argv)[2] == 0) + outmode[2] = (*argv)[1]; + else + break; + argc--, argv++; + } + if (argc == 0) { + SET_BINARY_MODE(stdin); + SET_BINARY_MODE(stdout); + if (uncompr) { + file = gzdopen(fileno(stdin), "rb"); + if (file == NULL) error("can't gzdopen stdin"); + gz_uncompress(file, stdout); + } else { + file = gzdopen(fileno(stdout), outmode); + if (file == NULL) error("can't gzdopen stdout"); + gz_compress(stdin, file); + } + } else { + do { + if (uncompr) { + file_uncompress(*argv); + } else { + file_compress(*argv, outmode); + } + } while (argv++, --argc); + } + exit(0); + return 0; /* to avoid warning */ +} diff --git a/zlib/msdos/Makefile.b32 b/zlib/msdos/Makefile.b32 new file mode 100644 index 0000000..f476da9 --- /dev/null +++ b/zlib/msdos/Makefile.b32 @@ -0,0 +1,104 @@ +# Makefile for zlib +# Borland C++ + +# This version of the zlib makefile was adapted by Chris Young for use +# with Borland C 4.5x with the Dos Power Pack for a 32-bit protected mode +# flat memory model. It was created for use with POV-Ray ray tracer and +# you may choose to edit the CFLAGS to suit your needs but the +# switches -WX and -DMSDOS are required. +# -- Chris Young 76702.1655@compuserve.com + +# To use, do "make -fmakefile.b32" + +# See zconf.h for details about the memory requirements. + +# ------------- Borland C++ ------------- +MODEL=-WX +CFLAGS= $(MODEL) -P-C -K -N- -k- -d -3 -r- -v- -f -DMSDOS +CC=bcc32 +LD=bcc32 +LIB=tlib +LDFLAGS= $(MODEL) +O=.obj + +# variables +OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \ + trees$(O) +OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\ + trees$(O) +OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \ + infutil$(O) inffast$(O) +OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\ + infutil$(O)+inffast$(O) + +all: test + +adler32.obj: adler32.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +compress.obj: compress.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +crc32.obj: crc32.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +gzio.obj: gzio.c zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h\ + infcodes.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h\ + infcodes.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h + $(CC) -c $(CFLAGS) $*.c + +inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h + $(CC) -c $(CFLAGS) $*.c + +infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +uncompr.obj: uncompr.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +zutil.obj: zutil.c zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +example.obj: example.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +minigzip.obj: minigzip.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +# we must cut the command line to fit in the MS/DOS 128 byte limit: +zlib.lib: $(OBJ1) $(OBJ2) + del zlib.lib + $(LIB) zlib +$(OBJP1) + $(LIB) zlib +$(OBJP2) + +example.exe: example.obj zlib.lib + $(LD) $(LDFLAGS) example.obj zlib.lib + +minigzip.exe: minigzip.obj zlib.lib + $(LD) $(LDFLAGS) minigzip.obj zlib.lib + +test: example.exe minigzip.exe + example + echo hello world | minigzip | minigzip -d + +#clean: +# del *.obj +# del *.exe diff --git a/zlib/msdos/Makefile.bor b/zlib/msdos/Makefile.bor new file mode 100644 index 0000000..f5651b4 --- /dev/null +++ b/zlib/msdos/Makefile.bor @@ -0,0 +1,125 @@ +# Makefile for zlib +# Borland C++ ************ UNTESTED *********** + +# To use, do "make -fmakefile.bor" +# To compile in small model, set below: MODEL=s + +# WARNING: the small model is supported but only for small values of +# MAX_WBITS and MAX_MEM_LEVEL. For example: +# -DMAX_WBITS=11 -DDEF_WBITS=11 -DMAX_MEM_LEVEL=3 +# If you wish to reduce the memory requirements (default 256K for big +# objects plus a few K), you can add to the LOC macro below: +# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14 +# See zconf.h for details about the memory requirements. + +# ------------- Turbo C++, Borland C++ ------------- + +# Optional nonstandard preprocessor flags (e.g. -DMAX_MEM_LEVEL=7) +# should be added to the environment via "set LOCAL_ZLIB=-DFOO" or added +# to the declaration of LOC here: +LOC = $(LOCAL_ZLIB) + +# Type for CPU required: 0: 8086, 1: 80186, 2: 80286, 3: 80386, etc. +CPU_TYP = 0 + +# Memory model: one of s, m, c, l (small, medium, compact, large) +MODEL=l + +CC=bcc +# replace bcc with tcc for Turbo C++ 1.0, with bcc32 for the 32 bit version +LD=$(CC) +AR=tlib + +# compiler flags +CFLAGS=-O2 -Z -m$(MODEL) $(LOC) +# replace "-O2" by "-O -G -a -d" for Turbo C++ 1.0 + +LDFLAGS=-m$(MODEL) + +O=.obj + +# variables +OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \ + trees$(O) +OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\ + trees$(O) +OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \ + infutil$(O) inffast$(O) +OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\ + infutil$(O)+inffast$(O) + +ZLIB_H = zlib.h zconf.h +ZUTIL_H = zutil.h $(ZLIB_H) + +ZLIB_LIB = zlib_$(MODEL).lib + +all: test + +# individual dependencies and action rules: +adler32.obj: adler32.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +compress.obj: compress.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +crc32.obj: crc32.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +gzio.obj: gzio.c $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +infblock.obj: infblock.c $(ZUTIL_H) infblock.h inftrees.h infcodes.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +infcodes.obj: infcodes.c $(ZUTIL_H) inftrees.h infutil.h infcodes.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +inflate.obj: inflate.c $(ZUTIL_H) infblock.h + $(CC) -c $(CFLAGS) $*.c + +inftrees.obj: inftrees.c $(ZUTIL_H) inftrees.h + $(CC) -c $(CFLAGS) $*.c + +infutil.obj: infutil.c $(ZUTIL_H) inftrees.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +inffast.obj: inffast.c $(ZUTIL_H) inftrees.h infutil.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +trees.obj: trees.c deflate.h $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +uncompr.obj: uncompr.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +zutil.obj: zutil.c $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +example.obj: example.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +minigzip.obj: minigzip.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +# we must cut the command line to fit in the MS/DOS 128 byte limit: +$(ZLIB_LIB): $(OBJ1) $(OBJ2) + del $(ZLIB_LIB) + $(AR) $(ZLIB_LIB) +$(OBJP1) + $(AR) $(ZLIB_LIB) +$(OBJP2) + +example.exe: example.obj $(ZLIB_LIB) + $(LD) $(LDFLAGS) example.obj $(ZLIB_LIB) + +minigzip.exe: minigzip.obj $(ZLIB_LIB) + $(LD) $(LDFLAGS) minigzip.obj $(ZLIB_LIB) + +test: example.exe minigzip.exe + example + echo hello world | minigzip | minigzip -d + +#clean: +# del *.obj +# del *.exe diff --git a/zlib/msdos/Makefile.dj2 b/zlib/msdos/Makefile.dj2 new file mode 100644 index 0000000..0ab431c --- /dev/null +++ b/zlib/msdos/Makefile.dj2 @@ -0,0 +1,100 @@ +# Makefile for zlib. Modified for djgpp v2.0 by F. J. Donahoe, 3/15/96. +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile, or to compile and test, type: +# +# make -fmakefile.dj2; make test -fmakefile.dj2 +# +# To install libz.a, zconf.h and zlib.h in the djgpp directories, type: +# +# make install -fmakefile.dj2 +# +# after first defining LIBRARY_PATH and INCLUDE_PATH in djgpp.env as +# in the sample below if the pattern of the DJGPP distribution is to +# be followed. Remember that, while 'es around <=> are ignored in +# makefiles, they are *not* in batch files or in djgpp.env. +# - - - - - +# [make] +# INCLUDE_PATH=%\>;INCLUDE_PATH%%\DJDIR%\include +# LIBRARY_PATH=%\>;LIBRARY_PATH%%\DJDIR%\lib +# BUTT=-m486 +# - - - - - +# Alternately, these variables may be defined below, overriding the values +# in djgpp.env, as +# INCLUDE_PATH=c:\usr\include +# LIBRARY_PATH=c:\usr\lib + +CC=gcc + +#CFLAGS=-MMD -O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-MMD -g -DDEBUG +CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ + -Wstrict-prototypes -Wmissing-prototypes + +# If cp.exe is available, replace "copy /Y" with "cp -fp" . +CP=copy /Y +# If gnu install.exe is available, replace $(CP) with ginstall. +INSTALL=$(CP) +# The default value of RM is "rm -f." If "rm.exe" is found, comment out: +RM=del +LDLIBS=-L. -lz +LD=$(CC) -s -o +LDSHARED=$(CC) + +INCL=zlib.h zconf.h +LIBS=libz.a + +AR=ar rcs + +prefix=/usr/local +exec_prefix = $(prefix) + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: example.exe minigzip.exe + +test: all + ./example + echo hello world | .\minigzip | .\minigzip -d + +%.o : %.c + $(CC) $(CFLAGS) -c $< -o $@ + +libz.a: $(OBJS) + $(AR) $@ $(OBJS) + +%.exe : %.o $(LIBS) + $(LD) $@ $< $(LDLIBS) + +# INCLUDE_PATH and LIBRARY_PATH were set for [make] in djgpp.env . + +.PHONY : uninstall clean + +install: $(INCL) $(LIBS) + -@if not exist $(INCLUDE_PATH)\nul mkdir $(INCLUDE_PATH) + -@if not exist $(LIBRARY_PATH)\nul mkdir $(LIBRARY_PATH) + $(INSTALL) zlib.h $(INCLUDE_PATH) + $(INSTALL) zconf.h $(INCLUDE_PATH) + $(INSTALL) libz.a $(LIBRARY_PATH) + +uninstall: + $(RM) $(INCLUDE_PATH)\zlib.h + $(RM) $(INCLUDE_PATH)\zconf.h + $(RM) $(LIBRARY_PATH)\libz.a + +clean: + $(RM) *.d + $(RM) *.o + $(RM) *.exe + $(RM) libz.a + $(RM) foo.gz + +DEPS := $(wildcard *.d) +ifneq ($(DEPS),) +include $(DEPS) +endif diff --git a/zlib/msdos/Makefile.emx b/zlib/msdos/Makefile.emx new file mode 100644 index 0000000..0e5e5cc --- /dev/null +++ b/zlib/msdos/Makefile.emx @@ -0,0 +1,69 @@ +# Makefile for zlib. Modified for emx 0.9c by Chr. Spieler, 6/17/98. +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile, or to compile and test, type: +# +# make -fmakefile.emx; make test -fmakefile.emx +# + +CC=gcc + +#CFLAGS=-MMD -O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-MMD -g -DDEBUG +CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ + -Wstrict-prototypes -Wmissing-prototypes + +# If cp.exe is available, replace "copy /Y" with "cp -fp" . +CP=copy /Y +# If gnu install.exe is available, replace $(CP) with ginstall. +INSTALL=$(CP) +# The default value of RM is "rm -f." If "rm.exe" is found, comment out: +RM=del +LDLIBS=-L. -lzlib +LD=$(CC) -s -o +LDSHARED=$(CC) + +INCL=zlib.h zconf.h +LIBS=zlib.a + +AR=ar rcs + +prefix=/usr/local +exec_prefix = $(prefix) + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: example.exe minigzip.exe + +test: all + ./example + echo hello world | .\minigzip | .\minigzip -d + +%.o : %.c + $(CC) $(CFLAGS) -c $< -o $@ + +zlib.a: $(OBJS) + $(AR) $@ $(OBJS) + +%.exe : %.o $(LIBS) + $(LD) $@ $< $(LDLIBS) + + +.PHONY : clean + +clean: + $(RM) *.d + $(RM) *.o + $(RM) *.exe + $(RM) zlib.a + $(RM) foo.gz + +DEPS := $(wildcard *.d) +ifneq ($(DEPS),) +include $(DEPS) +endif diff --git a/zlib/msdos/Makefile.msc b/zlib/msdos/Makefile.msc new file mode 100644 index 0000000..562201d --- /dev/null +++ b/zlib/msdos/Makefile.msc @@ -0,0 +1,121 @@ +# Makefile for zlib +# Microsoft C 5.1 or later + +# To use, do "make makefile.msc" +# To compile in small model, set below: MODEL=S + +# If you wish to reduce the memory requirements (default 256K for big +# objects plus a few K), you can add to the LOC macro below: +# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14 +# See zconf.h for details about the memory requirements. + +# ------------- Microsoft C 5.1 and later ------------- + +# Optional nonstandard preprocessor flags (e.g. -DMAX_MEM_LEVEL=7) +# should be added to the environment via "set LOCAL_ZLIB=-DFOO" or added +# to the declaration of LOC here: +LOC = $(LOCAL_ZLIB) + +# Type for CPU required: 0: 8086, 1: 80186, 2: 80286, 3: 80386, etc. +CPU_TYP = 0 + +# Memory model: one of S, M, C, L (small, medium, compact, large) +MODEL=L + +CC=cl +CFLAGS=-nologo -A$(MODEL) -G$(CPU_TYP) -W3 -Oait -Gs $(LOC) +#-Ox generates bad code with MSC 5.1 +LIB_CFLAGS=-Zl $(CFLAGS) + +LD=link +LDFLAGS=/noi/e/st:0x1500/noe/farcall/packcode +# "/farcall/packcode" are only useful for `large code' memory models +# but should be a "no-op" for small code models. + +O=.obj + +# variables +OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \ + trees$(O) +OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\ + trees$(O) +OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \ + infutil$(O) inffast$(O) +OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\ + infutil$(O)+inffast$(O) + +ZLIB_H = zlib.h zconf.h +ZUTIL_H = zutil.h $(ZLIB_H) + +ZLIB_LIB = zlib_$(MODEL).lib + +all: $(ZLIB_LIB) example.exe minigzip.exe + +# individual dependencies and action rules: +adler32.obj: adler32.c $(ZLIB_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +compress.obj: compress.c $(ZLIB_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +crc32.obj: crc32.c $(ZLIB_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h $(ZUTIL_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +gzio.obj: gzio.c $(ZUTIL_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +infblock.obj: infblock.c $(ZUTIL_H) infblock.h inftrees.h infcodes.h infutil.h + $(CC) -c $(LIB_CFLAGS) $*.c + +infcodes.obj: infcodes.c $(ZUTIL_H) inftrees.h infutil.h infcodes.h inffast.h + $(CC) -c $(LIB_CFLAGS) $*.c + +inflate.obj: inflate.c $(ZUTIL_H) infblock.h + $(CC) -c $(LIB_CFLAGS) $*.c + +inftrees.obj: inftrees.c $(ZUTIL_H) inftrees.h + $(CC) -c $(LIB_CFLAGS) $*.c + +infutil.obj: infutil.c $(ZUTIL_H) inftrees.h infutil.h + $(CC) -c $(LIB_CFLAGS) $*.c + +inffast.obj: inffast.c $(ZUTIL_H) inftrees.h infutil.h inffast.h + $(CC) -c $(LIB_CFLAGS) $*.c + +trees.obj: trees.c deflate.h $(ZUTIL_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +uncompr.obj: uncompr.c $(ZLIB_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +zutil.obj: zutil.c $(ZUTIL_H) + $(CC) -c $(LIB_CFLAGS) $*.c + +example.obj: example.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +minigzip.obj: minigzip.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +# we must cut the command line to fit in the MS/DOS 128 byte limit: +$(ZLIB_LIB): $(OBJ1) $(OBJ2) + if exist $(ZLIB_LIB) del $(ZLIB_LIB) + lib $(ZLIB_LIB) $(OBJ1); + lib $(ZLIB_LIB) $(OBJ2); + +example.exe: example.obj $(ZLIB_LIB) + $(LD) $(LDFLAGS) example.obj,,,$(ZLIB_LIB); + +minigzip.exe: minigzip.obj $(ZLIB_LIB) + $(LD) $(LDFLAGS) minigzip.obj,,,$(ZLIB_LIB); + +test: example.exe minigzip.exe + example + echo hello world | minigzip | minigzip -d + +#clean: +# del *.obj +# del *.exe diff --git a/zlib/msdos/Makefile.tc b/zlib/msdos/Makefile.tc new file mode 100644 index 0000000..63e0550 --- /dev/null +++ b/zlib/msdos/Makefile.tc @@ -0,0 +1,108 @@ +# Makefile for zlib +# TurboC 2.0 + +# To use, do "make -fmakefile.tc" +# To compile in small model, set below: MODEL=-ms + +# WARNING: the small model is supported but only for small values of +# MAX_WBITS and MAX_MEM_LEVEL. For example: +# -DMAX_WBITS=11 -DMAX_MEM_LEVEL=3 +# If you wish to reduce the memory requirements (default 256K for big +# objects plus a few K), you can add to CFLAGS below: +# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14 +# See zconf.h for details about the memory requirements. + +# ------------- Turbo C 2.0 ------------- +MODEL=l +# CFLAGS=-O2 -G -Z -m$(MODEL) -DMAX_WBITS=11 -DMAX_MEM_LEVEL=3 +CFLAGS=-O2 -G -Z -m$(MODEL) +CC=tcc -I\tc\include +LD=tcc -L\tc\lib +AR=tlib +LDFLAGS=-m$(MODEL) -f- +O=.obj + +# variables +OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \ + trees$(O) +OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\ + trees$(O) +OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \ + infutil$(O) inffast$(O) +OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\ + infutil$(O)+inffast$(O) + +ZLIB_H = zlib.h zconf.h +ZUTIL_H = zutil.h $(ZLIB_H) + +ZLIB_LIB = zlib_$(MODEL).lib + +all: test + +adler32.obj: adler32.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +compress.obj: compress.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +crc32.obj: crc32.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +gzio.obj: gzio.c $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +infblock.obj: infblock.c $(ZUTIL_H) infblock.h inftrees.h infcodes.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +infcodes.obj: infcodes.c $(ZUTIL_H) inftrees.h infutil.h infcodes.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +inflate.obj: inflate.c $(ZUTIL_H) infblock.h + $(CC) -c $(CFLAGS) $*.c + +inftrees.obj: inftrees.c $(ZUTIL_H) inftrees.h + $(CC) -c $(CFLAGS) $*.c + +infutil.obj: infutil.c $(ZUTIL_H) inftrees.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +inffast.obj: inffast.c $(ZUTIL_H) inftrees.h infutil.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +trees.obj: trees.c deflate.h $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +uncompr.obj: uncompr.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +zutil.obj: zutil.c $(ZUTIL_H) + $(CC) -c $(CFLAGS) $*.c + +example.obj: example.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +minigzip.obj: minigzip.c $(ZLIB_H) + $(CC) -c $(CFLAGS) $*.c + +# we must cut the command line to fit in the MS/DOS 128 byte limit: +$(ZLIB_LIB): $(OBJ1) $(OBJ2) + del $(ZLIB_LIB) + $(AR) $(ZLIB_LIB) +$(OBJP1) + $(AR) $(ZLIB_LIB) +$(OBJP2) + +example.exe: example.obj $(ZLIB_LIB) + $(LD) $(LDFLAGS) -eexample.exe example.obj $(ZLIB_LIB) + +minigzip.exe: minigzip.obj $(ZLIB_LIB) + $(LD) $(LDFLAGS) -eminigzip.exe minigzip.obj $(ZLIB_LIB) + +test: example.exe minigzip.exe + example + echo hello world | minigzip | minigzip -d + +#clean: +# del *.obj +# del *.exe diff --git a/zlib/msdos/Makefile.w32 b/zlib/msdos/Makefile.w32 new file mode 100644 index 0000000..0a05fa9 --- /dev/null +++ b/zlib/msdos/Makefile.w32 @@ -0,0 +1,97 @@ +# Makefile for zlib +# Microsoft 32-bit Visual C++ 4.0 or later (may work on earlier versions) + +# To use, do "nmake /f makefile.w32" + +# If you wish to reduce the memory requirements (default 256K for big +# objects plus a few K), you can add to CFLAGS below: +# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14 +# See zconf.h for details about the memory requirements. + +# ------------- Microsoft Visual C++ 4.0 and later ------------- +MODEL= +CFLAGS=-Ox -GA3s -nologo -W3 +CC=cl +LD=link +LDFLAGS= +O=.obj + +# variables +OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \ + trees$(O) +OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\ + trees$(O) +OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \ + infutil$(O) inffast$(O) +OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\ + infutil$(O)+inffast$(O) + +all: zlib.lib example.exe minigzip.exe + +adler32.obj: adler32.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +compress.obj: compress.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +crc32.obj: crc32.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +gzio.obj: gzio.c zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h\ + infcodes.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h\ + infcodes.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h + $(CC) -c $(CFLAGS) $*.c + +inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h + $(CC) -c $(CFLAGS) $*.c + +infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h + $(CC) -c $(CFLAGS) $*.c + +inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h + $(CC) -c $(CFLAGS) $*.c + +trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +uncompr.obj: uncompr.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +zutil.obj: zutil.c zutil.h zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +example.obj: example.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +minigzip.obj: minigzip.c zlib.h zconf.h + $(CC) -c $(CFLAGS) $*.c + +zlib.lib: $(OBJ1) $(OBJ2) + if exist zlib.lib del zlib.lib + lib /OUT:zlib.lib $(OBJ1) $(OBJ2) + +example.exe: example.obj zlib.lib + $(LD) $(LDFLAGS) example.obj zlib.lib /OUT:example.exe /SUBSYSTEM:CONSOLE + +minigzip.exe: minigzip.obj zlib.lib + $(LD) $(LDFLAGS) minigzip.obj zlib.lib /OUT:minigzip.exe /SUBSYSTEM:CONSOLE + +test: example.exe minigzip.exe + example + echo hello world | minigzip | minigzip -d + +#clean: +# del *.obj +# del *.exe diff --git a/zlib/msdos/Makefile.wat b/zlib/msdos/Makefile.wat new file mode 100644 index 0000000..44bf860 --- /dev/null +++ b/zlib/msdos/Makefile.wat @@ -0,0 +1,103 @@ +# Makefile for zlib +# Watcom 10a + +# This version of the zlib makefile was adapted by Chris Young for use +# with Watcom 10a 32-bit protected mode flat memory model. It was created +# for use with POV-Ray ray tracer and you may choose to edit the CFLAGS to +# suit your needs but the -DMSDOS is required. +# -- Chris Young 76702.1655@compuserve.com + +# To use, do "wmake -f makefile.wat" + +# See zconf.h for details about the memory requirements. + +# ------------- Watcom 10a ------------- +MODEL=-mf +CFLAGS= $(MODEL) -fpi87 -fp5 -zp4 -5r -w5 -oneatx -DMSDOS +CC=wcc386 +LD=wcl386 +LIB=wlib -b -c +LDFLAGS= +O=.obj + +# variables +OBJ1=adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) +OBJ2=trees$(O) zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) +OBJ3=infutil$(O) inffast$(O) +OBJP1=adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O) +OBJP2=trees$(O)+zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O) +OBJP3=infutil$(O)+inffast$(O) + +all: test + +adler32.obj: adler32.c zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +compress.obj: compress.c zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +crc32.obj: crc32.c zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +gzio.obj: gzio.c zutil.h zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h & + infcodes.h infutil.h + $(CC) $(CFLAGS) $*.c + +infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h & + infcodes.h inffast.h + $(CC) $(CFLAGS) $*.c + +inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h + $(CC) $(CFLAGS) $*.c + +inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h + $(CC) $(CFLAGS) $*.c + +infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h + $(CC) $(CFLAGS) $*.c + +inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h + $(CC) $(CFLAGS) $*.c + +trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +uncompr.obj: uncompr.c zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +zutil.obj: zutil.c zutil.h zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +example.obj: example.c zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +minigzip.obj: minigzip.c zlib.h zconf.h + $(CC) $(CFLAGS) $*.c + +# we must cut the command line to fit in the MS/DOS 128 byte limit: +zlib.lib: $(OBJ1) $(OBJ2) $(OBJ3) + del zlib.lib + $(LIB) zlib.lib +$(OBJP1) + $(LIB) zlib.lib +$(OBJP2) + $(LIB) zlib.lib +$(OBJP3) + +example.exe: example.obj zlib.lib + $(LD) $(LDFLAGS) example.obj zlib.lib + +minigzip.exe: minigzip.obj zlib.lib + $(LD) $(LDFLAGS) minigzip.obj zlib.lib + +test: minigzip.exe example.exe + example + echo hello world | minigzip | minigzip -d >test + type test + +#clean: +# del *.obj +# del *.exe diff --git a/zlib/msdos/zlib.def b/zlib/msdos/zlib.def new file mode 100644 index 0000000..6c04412 --- /dev/null +++ b/zlib/msdos/zlib.def @@ -0,0 +1,60 @@ +LIBRARY "zlib" + +DESCRIPTION '"""zlib data compression library"""' + +EXETYPE NT + +SUBSYSTEM WINDOWS + +STUB 'WINSTUB.EXE' + +VERSION 1.13 + +CODE EXECUTE READ + +DATA READ WRITE + +HEAPSIZE 1048576,4096 + +EXPORTS + adler32 @1 + compress @2 + crc32 @3 + deflate @4 + deflateCopy @5 + deflateEnd @6 + deflateInit2_ @7 + deflateInit_ @8 + deflateParams @9 + deflateReset @10 + deflateSetDictionary @11 + gzclose @12 + gzdopen @13 + gzerror @14 + gzflush @15 + gzopen @16 + gzread @17 + gzwrite @18 + inflate @19 + inflateEnd @20 + inflateInit2_ @21 + inflateInit_ @22 + inflateReset @23 + inflateSetDictionary @24 + inflateSync @25 + uncompress @26 + zlibVersion @27 + gzprintf @28 + gzputc @29 + gzgetc @30 + gzseek @31 + gzrewind @32 + gztell @33 + gzeof @34 + gzsetparams @35 + zError @36 + inflateSyncPoint @37 + get_crc_table @38 + compress2 @39 + gzputs @40 + gzgets @41 diff --git a/zlib/msdos/zlib.rc b/zlib/msdos/zlib.rc new file mode 100644 index 0000000..556d4ff --- /dev/null +++ b/zlib/msdos/zlib.rc @@ -0,0 +1,32 @@ +#include + +#define IDR_VERSION1 1 +IDR_VERSION1 VERSIONINFO MOVEABLE IMPURE LOADONCALL DISCARDABLE + FILEVERSION 1,1,3,0 + PRODUCTVERSION 1,1,3,0 + FILEFLAGSMASK VS_FFI_FILEFLAGSMASK + FILEFLAGS 0 + FILEOS VOS_DOS_WINDOWS32 + FILETYPE VFT_DLL + FILESUBTYPE 0 // not used +BEGIN + BLOCK "StringFileInfo" + BEGIN + BLOCK "040904E4" + //language ID = U.S. English, char set = Windows, Multilingual + + BEGIN + VALUE "FileDescription", "zlib data compression library\0" + VALUE "FileVersion", "1.1.3\0" + VALUE "InternalName", "zlib\0" + VALUE "OriginalFilename", "zlib.dll\0" + VALUE "ProductName", "ZLib.DLL\0" + VALUE "Comments","DLL support by Alessandro Iacopetti & Gilles Vollant\0" + VALUE "LegalCopyright", "(C) 1995-1998 Jean-loup Gailly & Mark Adler\0" + END + END + BLOCK "VarFileInfo" + BEGIN + VALUE "Translation", 0x0409, 1252 + END +END diff --git a/zlib/nt/Makefile.emx b/zlib/nt/Makefile.emx new file mode 100644 index 0000000..2d475b1 --- /dev/null +++ b/zlib/nt/Makefile.emx @@ -0,0 +1,138 @@ +# Makefile for zlib. Modified for emx/rsxnt by Chr. Spieler, 6/16/98. +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile, or to compile and test, type: +# +# make -fmakefile.emx; make test -fmakefile.emx +# + +CC=gcc -Zwin32 + +#CFLAGS=-MMD -O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-MMD -g -DDEBUG +CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ + -Wstrict-prototypes -Wmissing-prototypes + +# If cp.exe is available, replace "copy /Y" with "cp -fp" . +CP=copy /Y +# If gnu install.exe is available, replace $(CP) with ginstall. +INSTALL=$(CP) +# The default value of RM is "rm -f." If "rm.exe" is found, comment out: +RM=del +LDLIBS=-L. -lzlib +LD=$(CC) -s -o +LDSHARED=$(CC) + +INCL=zlib.h zconf.h +LIBS=zlib.a + +AR=ar rcs + +prefix=/usr/local +exec_prefix = $(prefix) + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: example.exe minigzip.exe + +test: all + ./example + echo hello world | .\minigzip | .\minigzip -d + +%.o : %.c + $(CC) $(CFLAGS) -c $< -o $@ + +zlib.a: $(OBJS) + $(AR) $@ $(OBJS) + +%.exe : %.o $(LIBS) + $(LD) $@ $< $(LDLIBS) + + +.PHONY : clean + +clean: + $(RM) *.d + $(RM) *.o + $(RM) *.exe + $(RM) zlib.a + $(RM) foo.gz + +DEPS := $(wildcard *.d) +ifneq ($(DEPS),) +include $(DEPS) +endif +# Makefile for zlib. Modified for emx 0.9c by Chr. Spieler, 6/17/98. +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile, or to compile and test, type: +# +# make -fmakefile.emx; make test -fmakefile.emx +# + +CC=gcc + +#CFLAGS=-MMD -O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-MMD -g -DDEBUG +CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ + -Wstrict-prototypes -Wmissing-prototypes + +# If cp.exe is available, replace "copy /Y" with "cp -fp" . +CP=copy /Y +# If gnu install.exe is available, replace $(CP) with ginstall. +INSTALL=$(CP) +# The default value of RM is "rm -f." If "rm.exe" is found, comment out: +RM=del +LDLIBS=-L. -lzlib +LD=$(CC) -s -o +LDSHARED=$(CC) + +INCL=zlib.h zconf.h +LIBS=zlib.a + +AR=ar rcs + +prefix=/usr/local +exec_prefix = $(prefix) + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: example.exe minigzip.exe + +test: all + ./example + echo hello world | .\minigzip | .\minigzip -d + +%.o : %.c + $(CC) $(CFLAGS) -c $< -o $@ + +zlib.a: $(OBJS) + $(AR) $@ $(OBJS) + +%.exe : %.o $(LIBS) + $(LD) $@ $< $(LDLIBS) + + +.PHONY : clean + +clean: + $(RM) *.d + $(RM) *.o + $(RM) *.exe + $(RM) zlib.a + $(RM) foo.gz + +DEPS := $(wildcard *.d) +ifneq ($(DEPS),) +include $(DEPS) +endif diff --git a/zlib/nt/Makefile.gcc b/zlib/nt/Makefile.gcc new file mode 100644 index 0000000..cdd652f --- /dev/null +++ b/zlib/nt/Makefile.gcc @@ -0,0 +1,87 @@ +# Makefile for zlib. Modified for mingw32 by C. Spieler, 6/16/98. +# (This Makefile is directly derived from Makefile.dj2) +# Copyright (C) 1995-1998 Jean-loup Gailly. +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile, or to compile and test, type: +# +# make -fmakefile.gcc; make test -fmakefile.gcc +# +# To install libz.a, zconf.h and zlib.h in the mingw32 directories, type: +# +# make install -fmakefile.gcc +# + +CC=gcc + +#CFLAGS=-MMD -O +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-MMD -g -DDEBUG +CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ + -Wstrict-prototypes -Wmissing-prototypes + +# If cp.exe is available, replace "copy /Y" with "cp -fp" . +CP=copy /Y +# If gnu install.exe is available, replace $(CP) with ginstall. +INSTALL=$(CP) +# The default value of RM is "rm -f." If "rm.exe" is found, comment out: +RM=del +LDLIBS=-L. -lz +LD=$(CC) -s -o +LDSHARED=$(CC) + +INCL=zlib.h zconf.h +LIBS=libz.a + +AR=ar rcs + +prefix=/usr/local +exec_prefix = $(prefix) + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +all: example.exe minigzip.exe + +test: all + ./example + echo hello world | .\minigzip | .\minigzip -d + +%.o : %.c + $(CC) $(CFLAGS) -c $< -o $@ + +libz.a: $(OBJS) + $(AR) $@ $(OBJS) + +%.exe : %.o $(LIBS) + $(LD) $@ $< $(LDLIBS) + +# INCLUDE_PATH and LIBRARY_PATH were set for [make] in djgpp.env . + +.PHONY : uninstall clean + +install: $(INCL) $(LIBS) + -@if not exist $(INCLUDE_PATH)\nul mkdir $(INCLUDE_PATH) + -@if not exist $(LIBRARY_PATH)\nul mkdir $(LIBRARY_PATH) + $(INSTALL) zlib.h $(INCLUDE_PATH) + $(INSTALL) zconf.h $(INCLUDE_PATH) + $(INSTALL) libz.a $(LIBRARY_PATH) + +uninstall: + $(RM) $(INCLUDE_PATH)\zlib.h + $(RM) $(INCLUDE_PATH)\zconf.h + $(RM) $(LIBRARY_PATH)\libz.a + +clean: + $(RM) *.d + $(RM) *.o + $(RM) *.exe + $(RM) libz.a + $(RM) foo.gz + +DEPS := $(wildcard *.d) +ifneq ($(DEPS),) +include $(DEPS) +endif diff --git a/zlib/nt/Makefile.nt b/zlib/nt/Makefile.nt new file mode 100644 index 0000000..b250f2a --- /dev/null +++ b/zlib/nt/Makefile.nt @@ -0,0 +1,88 @@ +# Makefile for zlib + +!include + +CC=cl +LD=link +CFLAGS=-O -nologo +LDFLAGS= +O=.obj + +# variables +OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \ + trees$(O) +OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \ + infutil$(O) inffast$(O) + +all: zlib.dll example.exe minigzip.exe + +adler32.obj: adler32.c zutil.h zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +compress.obj: compress.c zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +crc32.obj: crc32.c zutil.h zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +gzio.obj: gzio.c zutil.h zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h\ + infcodes.h infutil.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h\ + infcodes.h inffast.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +uncompr.obj: uncompr.c zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +zutil.obj: zutil.c zutil.h zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +example.obj: example.c zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +minigzip.obj: minigzip.c zlib.h zconf.h + $(CC) -c $(cvarsdll) $(CFLAGS) $*.c + +zlib.dll: $(OBJ1) $(OBJ2) zlib.dnt + link $(dlllflags) -out:$@ -def:zlib.dnt $(OBJ1) $(OBJ2) $(guilibsdll) + +zlib.lib: zlib.dll + +example.exe: example.obj zlib.lib + $(LD) $(LDFLAGS) example.obj zlib.lib + +minigzip.exe: minigzip.obj zlib.lib + $(LD) $(LDFLAGS) minigzip.obj zlib.lib + +test: example.exe minigzip.exe + example + echo hello world | minigzip | minigzip -d + +clean: + del *.obj + del *.exe + del *.dll + del *.lib diff --git a/zlib/nt/zlib.dnt b/zlib/nt/zlib.dnt new file mode 100644 index 0000000..7f9475c --- /dev/null +++ b/zlib/nt/zlib.dnt @@ -0,0 +1,47 @@ +LIBRARY zlib.dll +EXETYPE WINDOWS +CODE PRELOAD MOVEABLE DISCARDABLE +DATA PRELOAD MOVEABLE MULTIPLE + +EXPORTS + adler32 @1 + compress @2 + crc32 @3 + deflate @4 + deflateCopy @5 + deflateEnd @6 + deflateInit2_ @7 + deflateInit_ @8 + deflateParams @9 + deflateReset @10 + deflateSetDictionary @11 + gzclose @12 + gzdopen @13 + gzerror @14 + gzflush @15 + gzopen @16 + gzread @17 + gzwrite @18 + inflate @19 + inflateEnd @20 + inflateInit2_ @21 + inflateInit_ @22 + inflateReset @23 + inflateSetDictionary @24 + inflateSync @25 + uncompress @26 + zlibVersion @27 + gzprintf @28 + gzputc @29 + gzgetc @30 + gzseek @31 + gzrewind @32 + gztell @33 + gzeof @34 + gzsetparams @35 + zError @36 + inflateSyncPoint @37 + get_crc_table @38 + compress2 @39 + gzputs @40 + gzgets @41 diff --git a/zlib/os2/Makefile.os2 b/zlib/os2/Makefile.os2 new file mode 100644 index 0000000..4f56947 --- /dev/null +++ b/zlib/os2/Makefile.os2 @@ -0,0 +1,136 @@ +# Makefile for zlib under OS/2 using GCC (PGCC) +# For conditions of distribution and use, see copyright notice in zlib.h + +# To compile and test, type: +# cp Makefile.os2 .. +# cd .. +# make -f Makefile.os2 test + +# This makefile will build a static library z.lib, a shared library +# z.dll and a import library zdll.lib. You can use either z.lib or +# zdll.lib by specifying either -lz or -lzdll on gcc's command line + +CC=gcc -Zomf -s + +CFLAGS=-O6 -Wall +#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7 +#CFLAGS=-g -DDEBUG +#CFLAGS=-O3 -Wall -Wwrite-strings -Wpointer-arith -Wconversion \ +# -Wstrict-prototypes -Wmissing-prototypes + +#################### BUG WARNING: ##################### +## infcodes.c hits a bug in pgcc-1.0, so you have to use either +## -O# where # <= 4 or one of (-fno-ommit-frame-pointer or -fno-force-mem) +## This bug is reportedly fixed in pgcc >1.0, but this was not tested +CFLAGS+=-fno-force-mem + +LDFLAGS=-s -L. -lzdll -Zcrtdll +LDSHARED=$(CC) -s -Zomf -Zdll -Zcrtdll + +VER=1.1.0 +ZLIB=z.lib +SHAREDLIB=z.dll +SHAREDLIBIMP=zdll.lib +LIBS=$(ZLIB) $(SHAREDLIB) $(SHAREDLIBIMP) + +AR=emxomfar cr +IMPLIB=emximp +RANLIB=echo +TAR=tar +SHELL=bash + +prefix=/usr/local +exec_prefix = $(prefix) + +OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \ + zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o + +TEST_OBJS = example.o minigzip.o + +DISTFILES = README INDEX ChangeLog configure Make*[a-z0-9] *.[ch] descrip.mms \ + algorithm.txt zlib.3 msdos/Make*[a-z0-9] msdos/zlib.def msdos/zlib.rc \ + nt/Makefile.nt nt/zlib.dnt contrib/README.contrib contrib/*.txt \ + contrib/asm386/*.asm contrib/asm386/*.c \ + contrib/asm386/*.bat contrib/asm386/zlibvc.d?? contrib/iostream/*.cpp \ + contrib/iostream/*.h contrib/iostream2/*.h contrib/iostream2/*.cpp \ + contrib/untgz/Makefile contrib/untgz/*.c contrib/untgz/*.w32 + +all: example.exe minigzip.exe + +test: all + @LD_LIBRARY_PATH=.:$(LD_LIBRARY_PATH) ; export LD_LIBRARY_PATH; \ + echo hello world | ./minigzip | ./minigzip -d || \ + echo ' *** minigzip test FAILED ***' ; \ + if ./example; then \ + echo ' *** zlib test OK ***'; \ + else \ + echo ' *** zlib test FAILED ***'; \ + fi + +$(ZLIB): $(OBJS) + $(AR) $@ $(OBJS) + -@ ($(RANLIB) $@ || true) >/dev/null 2>&1 + +$(SHAREDLIB): $(OBJS) os2/z.def + $(LDSHARED) -o $@ $^ + +$(SHAREDLIBIMP): os2/z.def + $(IMPLIB) -o $@ $^ + +example.exe: example.o $(LIBS) + $(CC) $(CFLAGS) -o $@ example.o $(LDFLAGS) + +minigzip.exe: minigzip.o $(LIBS) + $(CC) $(CFLAGS) -o $@ minigzip.o $(LDFLAGS) + +clean: + rm -f *.o *~ example minigzip libz.a libz.so* foo.gz + +distclean: clean + +zip: + mv Makefile Makefile~; cp -p Makefile.in Makefile + rm -f test.c ztest*.c + v=`sed -n -e 's/\.//g' -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\ + zip -ul9 zlib$$v $(DISTFILES) + mv Makefile~ Makefile + +dist: + mv Makefile Makefile~; cp -p Makefile.in Makefile + rm -f test.c ztest*.c + d=zlib-`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\ + rm -f $$d.tar.gz; \ + if test ! -d ../$$d; then rm -f ../$$d; ln -s `pwd` ../$$d; fi; \ + files=""; \ + for f in $(DISTFILES); do files="$$files $$d/$$f"; done; \ + cd ..; \ + GZIP=-9 $(TAR) chofz $$d/$$d.tar.gz $$files; \ + if test ! -d $$d; then rm -f $$d; fi + mv Makefile~ Makefile + +tags: + etags *.[ch] + +depend: + makedepend -- $(CFLAGS) -- *.[ch] + +# DO NOT DELETE THIS LINE -- make depend depends on it. + +adler32.o: zlib.h zconf.h +compress.o: zlib.h zconf.h +crc32.o: zlib.h zconf.h +deflate.o: deflate.h zutil.h zlib.h zconf.h +example.o: zlib.h zconf.h +gzio.o: zutil.h zlib.h zconf.h +infblock.o: infblock.h inftrees.h infcodes.h infutil.h zutil.h zlib.h zconf.h +infcodes.o: zutil.h zlib.h zconf.h +infcodes.o: inftrees.h infblock.h infcodes.h infutil.h inffast.h +inffast.o: zutil.h zlib.h zconf.h inftrees.h +inffast.o: infblock.h infcodes.h infutil.h inffast.h +inflate.o: zutil.h zlib.h zconf.h infblock.h +inftrees.o: zutil.h zlib.h zconf.h inftrees.h +infutil.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h +minigzip.o: zlib.h zconf.h +trees.o: deflate.h zutil.h zlib.h zconf.h trees.h +uncompr.o: zlib.h zconf.h +zutil.o: zutil.h zlib.h zconf.h diff --git a/zlib/os2/zlib.def b/zlib/os2/zlib.def new file mode 100644 index 0000000..4c753f1 --- /dev/null +++ b/zlib/os2/zlib.def @@ -0,0 +1,51 @@ +; +; Slightly modified version of ../nt/zlib.dnt :-) +; + +LIBRARY Z +DESCRIPTION "Zlib compression library for OS/2" +CODE PRELOAD MOVEABLE DISCARDABLE +DATA PRELOAD MOVEABLE MULTIPLE + +EXPORTS + adler32 + compress + crc32 + deflate + deflateCopy + deflateEnd + deflateInit2_ + deflateInit_ + deflateParams + deflateReset + deflateSetDictionary + gzclose + gzdopen + gzerror + gzflush + gzopen + gzread + gzwrite + inflate + inflateEnd + inflateInit2_ + inflateInit_ + inflateReset + inflateSetDictionary + inflateSync + uncompress + zlibVersion + gzprintf + gzputc + gzgetc + gzseek + gzrewind + gztell + gzeof + gzsetparams + zError + inflateSyncPoint + get_crc_table + compress2 + gzputs + gzgets diff --git a/zlib/trees.c b/zlib/trees.c new file mode 100644 index 0000000..f01fb30 --- /dev/null +++ b/zlib/trees.c @@ -0,0 +1,1214 @@ +/* trees.c -- output deflated data using Huffman coding + * Copyright (C) 1995-1998 Jean-loup Gailly + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * ALGORITHM + * + * The "deflation" process uses several Huffman trees. The more + * common source values are represented by shorter bit sequences. + * + * Each code tree is stored in a compressed form which is itself + * a Huffman encoding of the lengths of all the code strings (in + * ascending order by source values). The actual code strings are + * reconstructed from the lengths in the inflate process, as described + * in the deflate specification. + * + * REFERENCES + * + * Deutsch, L.P.,"'Deflate' Compressed Data Format Specification". + * Available in ftp.uu.net:/pub/archiving/zip/doc/deflate-1.1.doc + * + * Storer, James A. + * Data Compression: Methods and Theory, pp. 49-50. + * Computer Science Press, 1988. ISBN 0-7167-8156-5. + * + * Sedgewick, R. + * Algorithms, p290. + * Addison-Wesley, 1983. ISBN 0-201-06672-6. + */ + +/* @(#) $Id$ */ + +/* #define GEN_TREES_H */ + +#include "deflate.h" + +#ifdef DEBUG +# include +#endif + +/* =========================================================================== + * Constants + */ + +#define MAX_BL_BITS 7 +/* Bit length codes must not exceed MAX_BL_BITS bits */ + +#define END_BLOCK 256 +/* end of block literal code */ + +#define REP_3_6 16 +/* repeat previous bit length 3-6 times (2 bits of repeat count) */ + +#define REPZ_3_10 17 +/* repeat a zero length 3-10 times (3 bits of repeat count) */ + +#define REPZ_11_138 18 +/* repeat a zero length 11-138 times (7 bits of repeat count) */ + +local const int extra_lbits[LENGTH_CODES] /* extra bits for each length code */ + = {0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0}; + +local const int extra_dbits[D_CODES] /* extra bits for each distance code */ + = {0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13}; + +local const int extra_blbits[BL_CODES]/* extra bits for each bit length code */ + = {0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7}; + +local const uch bl_order[BL_CODES] + = {16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15}; +/* The lengths of the bit length codes are sent in order of decreasing + * probability, to avoid transmitting the lengths for unused bit length codes. + */ + +#define Buf_size (8 * 2*sizeof(char)) +/* Number of bits used within bi_buf. (bi_buf might be implemented on + * more than 16 bits on some systems.) + */ + +/* =========================================================================== + * Local data. These are initialized only once. + */ + +#define DIST_CODE_LEN 512 /* see definition of array dist_code below */ + +#if defined(GEN_TREES_H) || !defined(STDC) +/* non ANSI compilers may not accept trees.h */ + +local ct_data static_ltree[L_CODES+2]; +/* The static literal tree. Since the bit lengths are imposed, there is no + * need for the L_CODES extra codes used during heap construction. However + * The codes 286 and 287 are needed to build a canonical tree (see _tr_init + * below). + */ + +local ct_data static_dtree[D_CODES]; +/* The static distance tree. (Actually a trivial tree since all codes use + * 5 bits.) + */ + +uch _dist_code[DIST_CODE_LEN]; +/* Distance codes. The first 256 values correspond to the distances + * 3 .. 258, the last 256 values correspond to the top 8 bits of + * the 15 bit distances. + */ + +uch _length_code[MAX_MATCH-MIN_MATCH+1]; +/* length code for each normalized match length (0 == MIN_MATCH) */ + +local int base_length[LENGTH_CODES]; +/* First normalized length for each code (0 = MIN_MATCH) */ + +local int base_dist[D_CODES]; +/* First normalized distance for each code (0 = distance of 1) */ + +#else +# include "trees.h" +#endif /* GEN_TREES_H */ + +struct static_tree_desc_s { + const ct_data *static_tree; /* static tree or NULL */ + const intf *extra_bits; /* extra bits for each code or NULL */ + int extra_base; /* base index for extra_bits */ + int elems; /* max number of elements in the tree */ + int max_length; /* max bit length for the codes */ +}; + +local static_tree_desc static_l_desc = +{static_ltree, extra_lbits, LITERALS+1, L_CODES, MAX_BITS}; + +local static_tree_desc static_d_desc = +{static_dtree, extra_dbits, 0, D_CODES, MAX_BITS}; + +local static_tree_desc static_bl_desc = +{(const ct_data *)0, extra_blbits, 0, BL_CODES, MAX_BL_BITS}; + +/* =========================================================================== + * Local (static) routines in this file. + */ + +local void tr_static_init OF((void)); +local void init_block OF((deflate_state *s)); +local void pqdownheap OF((deflate_state *s, ct_data *tree, int k)); +local void gen_bitlen OF((deflate_state *s, tree_desc *desc)); +local void gen_codes OF((ct_data *tree, int max_code, ushf *bl_count)); +local void build_tree OF((deflate_state *s, tree_desc *desc)); +local void scan_tree OF((deflate_state *s, ct_data *tree, int max_code)); +local void send_tree OF((deflate_state *s, ct_data *tree, int max_code)); +local int build_bl_tree OF((deflate_state *s)); +local void send_all_trees OF((deflate_state *s, int lcodes, int dcodes, + int blcodes)); +local void compress_block OF((deflate_state *s, ct_data *ltree, + ct_data *dtree)); +local void set_data_type OF((deflate_state *s)); +local unsigned bi_reverse OF((unsigned value, int length)); +local void bi_windup OF((deflate_state *s)); +local void bi_flush OF((deflate_state *s)); +local void copy_block OF((deflate_state *s, charf *buf, unsigned len, + int header)); + +#ifdef GEN_TREES_H +local void gen_trees_header OF((void)); +#endif + +#ifndef DEBUG +# define send_code(s, c, tree) send_bits(s, tree[c].Code, tree[c].Len) + /* Send a code of the given tree. c and tree must not have side effects */ + +#else /* DEBUG */ +# define send_code(s, c, tree) \ + { if (z_verbose>2) fprintf(stderr,"\ncd %3d ",(c)); \ + send_bits(s, tree[c].Code, tree[c].Len); } +#endif + +/* =========================================================================== + * Output a short LSB first on the stream. + * IN assertion: there is enough room in pendingBuf. + */ +#define put_short(s, w) { \ + put_byte(s, (uch)((w) & 0xff)); \ + put_byte(s, (uch)((ush)(w) >> 8)); \ +} + +/* =========================================================================== + * Send a value on a given number of bits. + * IN assertion: length <= 16 and value fits in length bits. + */ +#ifdef DEBUG +local void send_bits OF((deflate_state *s, int value, int length)); + +local void send_bits(s, value, length) + deflate_state *s; + int value; /* value to send */ + int length; /* number of bits */ +{ + Tracevv((stderr," l %2d v %4x ", length, value)); + Assert(length > 0 && length <= 15, "invalid length"); + s->bits_sent += (ulg)length; + + /* If not enough room in bi_buf, use (valid) bits from bi_buf and + * (16 - bi_valid) bits from value, leaving (width - (16-bi_valid)) + * unused bits in value. + */ + if (s->bi_valid > (int)Buf_size - length) { + s->bi_buf |= (value << s->bi_valid); + put_short(s, s->bi_buf); + s->bi_buf = (ush)value >> (Buf_size - s->bi_valid); + s->bi_valid += length - Buf_size; + } else { + s->bi_buf |= value << s->bi_valid; + s->bi_valid += length; + } +} +#else /* !DEBUG */ + +#define send_bits(s, value, length) \ +{ int len = length;\ + if (s->bi_valid > (int)Buf_size - len) {\ + int val = value;\ + s->bi_buf |= (val << s->bi_valid);\ + put_short(s, s->bi_buf);\ + s->bi_buf = (ush)val >> (Buf_size - s->bi_valid);\ + s->bi_valid += len - Buf_size;\ + } else {\ + s->bi_buf |= (value) << s->bi_valid;\ + s->bi_valid += len;\ + }\ +} +#endif /* DEBUG */ + + +#define MAX(a,b) (a >= b ? a : b) +/* the arguments must not have side effects */ + +/* =========================================================================== + * Initialize the various 'constant' tables. + */ +local void tr_static_init() +{ +#if defined(GEN_TREES_H) || !defined(STDC) + static int static_init_done = 0; + int n; /* iterates over tree elements */ + int bits; /* bit counter */ + int length; /* length value */ + int code; /* code value */ + int dist; /* distance index */ + ush bl_count[MAX_BITS+1]; + /* number of codes at each bit length for an optimal tree */ + + if (static_init_done) return; + + /* For some embedded targets, global variables are not initialized: */ + static_l_desc.static_tree = static_ltree; + static_l_desc.extra_bits = extra_lbits; + static_d_desc.static_tree = static_dtree; + static_d_desc.extra_bits = extra_dbits; + static_bl_desc.extra_bits = extra_blbits; + + /* Initialize the mapping length (0..255) -> length code (0..28) */ + length = 0; + for (code = 0; code < LENGTH_CODES-1; code++) { + base_length[code] = length; + for (n = 0; n < (1< dist code (0..29) */ + dist = 0; + for (code = 0 ; code < 16; code++) { + base_dist[code] = dist; + for (n = 0; n < (1<>= 7; /* from now on, all distances are divided by 128 */ + for ( ; code < D_CODES; code++) { + base_dist[code] = dist << 7; + for (n = 0; n < (1<<(extra_dbits[code]-7)); n++) { + _dist_code[256 + dist++] = (uch)code; + } + } + Assert (dist == 256, "tr_static_init: 256+dist != 512"); + + /* Construct the codes of the static literal tree */ + for (bits = 0; bits <= MAX_BITS; bits++) bl_count[bits] = 0; + n = 0; + while (n <= 143) static_ltree[n++].Len = 8, bl_count[8]++; + while (n <= 255) static_ltree[n++].Len = 9, bl_count[9]++; + while (n <= 279) static_ltree[n++].Len = 7, bl_count[7]++; + while (n <= 287) static_ltree[n++].Len = 8, bl_count[8]++; + /* Codes 286 and 287 do not exist, but we must include them in the + * tree construction to get a canonical Huffman tree (longest code + * all ones) + */ + gen_codes((ct_data *)static_ltree, L_CODES+1, bl_count); + + /* The static distance tree is trivial: */ + for (n = 0; n < D_CODES; n++) { + static_dtree[n].Len = 5; + static_dtree[n].Code = bi_reverse((unsigned)n, 5); + } + static_init_done = 1; + +# ifdef GEN_TREES_H + gen_trees_header(); +# endif +#endif /* defined(GEN_TREES_H) || !defined(STDC) */ +} + +/* =========================================================================== + * Genererate the file trees.h describing the static trees. + */ +#ifdef GEN_TREES_H +# ifndef DEBUG +# include +# endif + +# define SEPARATOR(i, last, width) \ + ((i) == (last)? "\n};\n\n" : \ + ((i) % (width) == (width)-1 ? ",\n" : ", ")) + +void gen_trees_header() +{ + FILE *header = fopen("trees.h", "w"); + int i; + + Assert (header != NULL, "Can't open trees.h"); + fprintf(header, + "/* header created automatically with -DGEN_TREES_H */\n\n"); + + fprintf(header, "local const ct_data static_ltree[L_CODES+2] = {\n"); + for (i = 0; i < L_CODES+2; i++) { + fprintf(header, "{{%3u},{%3u}}%s", static_ltree[i].Code, + static_ltree[i].Len, SEPARATOR(i, L_CODES+1, 5)); + } + + fprintf(header, "local const ct_data static_dtree[D_CODES] = {\n"); + for (i = 0; i < D_CODES; i++) { + fprintf(header, "{{%2u},{%2u}}%s", static_dtree[i].Code, + static_dtree[i].Len, SEPARATOR(i, D_CODES-1, 5)); + } + + fprintf(header, "const uch _dist_code[DIST_CODE_LEN] = {\n"); + for (i = 0; i < DIST_CODE_LEN; i++) { + fprintf(header, "%2u%s", _dist_code[i], + SEPARATOR(i, DIST_CODE_LEN-1, 20)); + } + + fprintf(header, "const uch _length_code[MAX_MATCH-MIN_MATCH+1]= {\n"); + for (i = 0; i < MAX_MATCH-MIN_MATCH+1; i++) { + fprintf(header, "%2u%s", _length_code[i], + SEPARATOR(i, MAX_MATCH-MIN_MATCH, 20)); + } + + fprintf(header, "local const int base_length[LENGTH_CODES] = {\n"); + for (i = 0; i < LENGTH_CODES; i++) { + fprintf(header, "%1u%s", base_length[i], + SEPARATOR(i, LENGTH_CODES-1, 20)); + } + + fprintf(header, "local const int base_dist[D_CODES] = {\n"); + for (i = 0; i < D_CODES; i++) { + fprintf(header, "%5u%s", base_dist[i], + SEPARATOR(i, D_CODES-1, 10)); + } + + fclose(header); +} +#endif /* GEN_TREES_H */ + +/* =========================================================================== + * Initialize the tree data structures for a new zlib stream. + */ +void _tr_init(s) + deflate_state *s; +{ + tr_static_init(); + + s->l_desc.dyn_tree = s->dyn_ltree; + s->l_desc.stat_desc = &static_l_desc; + + s->d_desc.dyn_tree = s->dyn_dtree; + s->d_desc.stat_desc = &static_d_desc; + + s->bl_desc.dyn_tree = s->bl_tree; + s->bl_desc.stat_desc = &static_bl_desc; + + s->bi_buf = 0; + s->bi_valid = 0; + s->last_eob_len = 8; /* enough lookahead for inflate */ +#ifdef DEBUG + s->compressed_len = 0L; + s->bits_sent = 0L; +#endif + + /* Initialize the first block of the first file: */ + init_block(s); +} + +/* =========================================================================== + * Initialize a new block. + */ +local void init_block(s) + deflate_state *s; +{ + int n; /* iterates over tree elements */ + + /* Initialize the trees. */ + for (n = 0; n < L_CODES; n++) s->dyn_ltree[n].Freq = 0; + for (n = 0; n < D_CODES; n++) s->dyn_dtree[n].Freq = 0; + for (n = 0; n < BL_CODES; n++) s->bl_tree[n].Freq = 0; + + s->dyn_ltree[END_BLOCK].Freq = 1; + s->opt_len = s->static_len = 0L; + s->last_lit = s->matches = 0; +} + +#define SMALLEST 1 +/* Index within the heap array of least frequent node in the Huffman tree */ + + +/* =========================================================================== + * Remove the smallest element from the heap and recreate the heap with + * one less element. Updates heap and heap_len. + */ +#define pqremove(s, tree, top) \ +{\ + top = s->heap[SMALLEST]; \ + s->heap[SMALLEST] = s->heap[s->heap_len--]; \ + pqdownheap(s, tree, SMALLEST); \ +} + +/* =========================================================================== + * Compares to subtrees, using the tree depth as tie breaker when + * the subtrees have equal frequency. This minimizes the worst case length. + */ +#define smaller(tree, n, m, depth) \ + (tree[n].Freq < tree[m].Freq || \ + (tree[n].Freq == tree[m].Freq && depth[n] <= depth[m])) + +/* =========================================================================== + * Restore the heap property by moving down the tree starting at node k, + * exchanging a node with the smallest of its two sons if necessary, stopping + * when the heap property is re-established (each father smaller than its + * two sons). + */ +local void pqdownheap(s, tree, k) + deflate_state *s; + ct_data *tree; /* the tree to restore */ + int k; /* node to move down */ +{ + int v = s->heap[k]; + int j = k << 1; /* left son of k */ + while (j <= s->heap_len) { + /* Set j to the smallest of the two sons: */ + if (j < s->heap_len && + smaller(tree, s->heap[j+1], s->heap[j], s->depth)) { + j++; + } + /* Exit if v is smaller than both sons */ + if (smaller(tree, v, s->heap[j], s->depth)) break; + + /* Exchange v with the smallest son */ + s->heap[k] = s->heap[j]; k = j; + + /* And continue down the tree, setting j to the left son of k */ + j <<= 1; + } + s->heap[k] = v; +} + +/* =========================================================================== + * Compute the optimal bit lengths for a tree and update the total bit length + * for the current block. + * IN assertion: the fields freq and dad are set, heap[heap_max] and + * above are the tree nodes sorted by increasing frequency. + * OUT assertions: the field len is set to the optimal bit length, the + * array bl_count contains the frequencies for each bit length. + * The length opt_len is updated; static_len is also updated if stree is + * not null. + */ +local void gen_bitlen(s, desc) + deflate_state *s; + tree_desc *desc; /* the tree descriptor */ +{ + ct_data *tree = desc->dyn_tree; + int max_code = desc->max_code; + const ct_data *stree = desc->stat_desc->static_tree; + const intf *extra = desc->stat_desc->extra_bits; + int base = desc->stat_desc->extra_base; + int max_length = desc->stat_desc->max_length; + int h; /* heap index */ + int n, m; /* iterate over the tree elements */ + int bits; /* bit length */ + int xbits; /* extra bits */ + ush f; /* frequency */ + int overflow = 0; /* number of elements with bit length too large */ + + for (bits = 0; bits <= MAX_BITS; bits++) s->bl_count[bits] = 0; + + /* In a first pass, compute the optimal bit lengths (which may + * overflow in the case of the bit length tree). + */ + tree[s->heap[s->heap_max]].Len = 0; /* root of the heap */ + + for (h = s->heap_max+1; h < HEAP_SIZE; h++) { + n = s->heap[h]; + bits = tree[tree[n].Dad].Len + 1; + if (bits > max_length) bits = max_length, overflow++; + tree[n].Len = (ush)bits; + /* We overwrite tree[n].Dad which is no longer needed */ + + if (n > max_code) continue; /* not a leaf node */ + + s->bl_count[bits]++; + xbits = 0; + if (n >= base) xbits = extra[n-base]; + f = tree[n].Freq; + s->opt_len += (ulg)f * (bits + xbits); + if (stree) s->static_len += (ulg)f * (stree[n].Len + xbits); + } + if (overflow == 0) return; + + Trace((stderr,"\nbit length overflow\n")); + /* This happens for example on obj2 and pic of the Calgary corpus */ + + /* Find the first bit length which could increase: */ + do { + bits = max_length-1; + while (s->bl_count[bits] == 0) bits--; + s->bl_count[bits]--; /* move one leaf down the tree */ + s->bl_count[bits+1] += 2; /* move one overflow item as its brother */ + s->bl_count[max_length]--; + /* The brother of the overflow item also moves one step up, + * but this does not affect bl_count[max_length] + */ + overflow -= 2; + } while (overflow > 0); + + /* Now recompute all bit lengths, scanning in increasing frequency. + * h is still equal to HEAP_SIZE. (It is simpler to reconstruct all + * lengths instead of fixing only the wrong ones. This idea is taken + * from 'ar' written by Haruhiko Okumura.) + */ + for (bits = max_length; bits != 0; bits--) { + n = s->bl_count[bits]; + while (n != 0) { + m = s->heap[--h]; + if (m > max_code) continue; + if (tree[m].Len != (unsigned) bits) { + Trace((stderr,"code %d bits %d->%d\n", m, tree[m].Len, bits)); + s->opt_len += ((long)bits - (long)tree[m].Len) + *(long)tree[m].Freq; + tree[m].Len = (ush)bits; + } + n--; + } + } +} + +/* =========================================================================== + * Generate the codes for a given tree and bit counts (which need not be + * optimal). + * IN assertion: the array bl_count contains the bit length statistics for + * the given tree and the field len is set for all tree elements. + * OUT assertion: the field code is set for all tree elements of non + * zero code length. + */ +local void gen_codes (tree, max_code, bl_count) + ct_data *tree; /* the tree to decorate */ + int max_code; /* largest code with non zero frequency */ + ushf *bl_count; /* number of codes at each bit length */ +{ + ush next_code[MAX_BITS+1]; /* next code value for each bit length */ + ush code = 0; /* running code value */ + int bits; /* bit index */ + int n; /* code index */ + + /* The distribution counts are first used to generate the code values + * without bit reversal. + */ + for (bits = 1; bits <= MAX_BITS; bits++) { + next_code[bits] = code = (code + bl_count[bits-1]) << 1; + } + /* Check that the bit counts in bl_count are consistent. The last code + * must be all ones. + */ + Assert (code + bl_count[MAX_BITS]-1 == (1<dyn_tree; + const ct_data *stree = desc->stat_desc->static_tree; + int elems = desc->stat_desc->elems; + int n, m; /* iterate over heap elements */ + int max_code = -1; /* largest code with non zero frequency */ + int node; /* new node being created */ + + /* Construct the initial heap, with least frequent element in + * heap[SMALLEST]. The sons of heap[n] are heap[2*n] and heap[2*n+1]. + * heap[0] is not used. + */ + s->heap_len = 0, s->heap_max = HEAP_SIZE; + + for (n = 0; n < elems; n++) { + if (tree[n].Freq != 0) { + s->heap[++(s->heap_len)] = max_code = n; + s->depth[n] = 0; + } else { + tree[n].Len = 0; + } + } + + /* The pkzip format requires that at least one distance code exists, + * and that at least one bit should be sent even if there is only one + * possible code. So to avoid special checks later on we force at least + * two codes of non zero frequency. + */ + while (s->heap_len < 2) { + node = s->heap[++(s->heap_len)] = (max_code < 2 ? ++max_code : 0); + tree[node].Freq = 1; + s->depth[node] = 0; + s->opt_len--; if (stree) s->static_len -= stree[node].Len; + /* node is 0 or 1 so it does not have extra bits */ + } + desc->max_code = max_code; + + /* The elements heap[heap_len/2+1 .. heap_len] are leaves of the tree, + * establish sub-heaps of increasing lengths: + */ + for (n = s->heap_len/2; n >= 1; n--) pqdownheap(s, tree, n); + + /* Construct the Huffman tree by repeatedly combining the least two + * frequent nodes. + */ + node = elems; /* next internal node of the tree */ + do { + pqremove(s, tree, n); /* n = node of least frequency */ + m = s->heap[SMALLEST]; /* m = node of next least frequency */ + + s->heap[--(s->heap_max)] = n; /* keep the nodes sorted by frequency */ + s->heap[--(s->heap_max)] = m; + + /* Create a new node father of n and m */ + tree[node].Freq = tree[n].Freq + tree[m].Freq; + s->depth[node] = (uch) (MAX(s->depth[n], s->depth[m]) + 1); + tree[n].Dad = tree[m].Dad = (ush)node; +#ifdef DUMP_BL_TREE + if (tree == s->bl_tree) { + fprintf(stderr,"\nnode %d(%d), sons %d(%d) %d(%d)", + node, tree[node].Freq, n, tree[n].Freq, m, tree[m].Freq); + } +#endif + /* and insert the new node in the heap */ + s->heap[SMALLEST] = node++; + pqdownheap(s, tree, SMALLEST); + + } while (s->heap_len >= 2); + + s->heap[--(s->heap_max)] = s->heap[SMALLEST]; + + /* At this point, the fields freq and dad are set. We can now + * generate the bit lengths. + */ + gen_bitlen(s, (tree_desc *)desc); + + /* The field len is now set, we can generate the bit codes */ + gen_codes ((ct_data *)tree, max_code, s->bl_count); +} + +/* =========================================================================== + * Scan a literal or distance tree to determine the frequencies of the codes + * in the bit length tree. + */ +local void scan_tree (s, tree, max_code) + deflate_state *s; + ct_data *tree; /* the tree to be scanned */ + int max_code; /* and its largest code of non zero frequency */ +{ + int n; /* iterates over all tree elements */ + int prevlen = -1; /* last emitted length */ + int curlen; /* length of current code */ + int nextlen = tree[0].Len; /* length of next code */ + int count = 0; /* repeat count of the current code */ + int max_count = 7; /* max repeat count */ + int min_count = 4; /* min repeat count */ + + if (nextlen == 0) max_count = 138, min_count = 3; + tree[max_code+1].Len = (ush)0xffff; /* guard */ + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; nextlen = tree[n+1].Len; + if (++count < max_count && curlen == nextlen) { + continue; + } else if (count < min_count) { + s->bl_tree[curlen].Freq += count; + } else if (curlen != 0) { + if (curlen != prevlen) s->bl_tree[curlen].Freq++; + s->bl_tree[REP_3_6].Freq++; + } else if (count <= 10) { + s->bl_tree[REPZ_3_10].Freq++; + } else { + s->bl_tree[REPZ_11_138].Freq++; + } + count = 0; prevlen = curlen; + if (nextlen == 0) { + max_count = 138, min_count = 3; + } else if (curlen == nextlen) { + max_count = 6, min_count = 3; + } else { + max_count = 7, min_count = 4; + } + } +} + +/* =========================================================================== + * Send a literal or distance tree in compressed form, using the codes in + * bl_tree. + */ +local void send_tree (s, tree, max_code) + deflate_state *s; + ct_data *tree; /* the tree to be scanned */ + int max_code; /* and its largest code of non zero frequency */ +{ + int n; /* iterates over all tree elements */ + int prevlen = -1; /* last emitted length */ + int curlen; /* length of current code */ + int nextlen = tree[0].Len; /* length of next code */ + int count = 0; /* repeat count of the current code */ + int max_count = 7; /* max repeat count */ + int min_count = 4; /* min repeat count */ + + /* tree[max_code+1].Len = -1; */ /* guard already set */ + if (nextlen == 0) max_count = 138, min_count = 3; + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; nextlen = tree[n+1].Len; + if (++count < max_count && curlen == nextlen) { + continue; + } else if (count < min_count) { + do { send_code(s, curlen, s->bl_tree); } while (--count != 0); + + } else if (curlen != 0) { + if (curlen != prevlen) { + send_code(s, curlen, s->bl_tree); count--; + } + Assert(count >= 3 && count <= 6, " 3_6?"); + send_code(s, REP_3_6, s->bl_tree); send_bits(s, count-3, 2); + + } else if (count <= 10) { + send_code(s, REPZ_3_10, s->bl_tree); send_bits(s, count-3, 3); + + } else { + send_code(s, REPZ_11_138, s->bl_tree); send_bits(s, count-11, 7); + } + count = 0; prevlen = curlen; + if (nextlen == 0) { + max_count = 138, min_count = 3; + } else if (curlen == nextlen) { + max_count = 6, min_count = 3; + } else { + max_count = 7, min_count = 4; + } + } +} + +/* =========================================================================== + * Construct the Huffman tree for the bit lengths and return the index in + * bl_order of the last bit length code to send. + */ +local int build_bl_tree(s) + deflate_state *s; +{ + int max_blindex; /* index of last bit length code of non zero freq */ + + /* Determine the bit length frequencies for literal and distance trees */ + scan_tree(s, (ct_data *)s->dyn_ltree, s->l_desc.max_code); + scan_tree(s, (ct_data *)s->dyn_dtree, s->d_desc.max_code); + + /* Build the bit length tree: */ + build_tree(s, (tree_desc *)(&(s->bl_desc))); + /* opt_len now includes the length of the tree representations, except + * the lengths of the bit lengths codes and the 5+5+4 bits for the counts. + */ + + /* Determine the number of bit length codes to send. The pkzip format + * requires that at least 4 bit length codes be sent. (appnote.txt says + * 3 but the actual value used is 4.) + */ + for (max_blindex = BL_CODES-1; max_blindex >= 3; max_blindex--) { + if (s->bl_tree[bl_order[max_blindex]].Len != 0) break; + } + /* Update opt_len to include the bit length tree and counts */ + s->opt_len += 3*(max_blindex+1) + 5+5+4; + Tracev((stderr, "\ndyn trees: dyn %ld, stat %ld", + s->opt_len, s->static_len)); + + return max_blindex; +} + +/* =========================================================================== + * Send the header for a block using dynamic Huffman trees: the counts, the + * lengths of the bit length codes, the literal tree and the distance tree. + * IN assertion: lcodes >= 257, dcodes >= 1, blcodes >= 4. + */ +local void send_all_trees(s, lcodes, dcodes, blcodes) + deflate_state *s; + int lcodes, dcodes, blcodes; /* number of codes for each tree */ +{ + int rank; /* index in bl_order */ + + Assert (lcodes >= 257 && dcodes >= 1 && blcodes >= 4, "not enough codes"); + Assert (lcodes <= L_CODES && dcodes <= D_CODES && blcodes <= BL_CODES, + "too many codes"); + Tracev((stderr, "\nbl counts: ")); + send_bits(s, lcodes-257, 5); /* not +255 as stated in appnote.txt */ + send_bits(s, dcodes-1, 5); + send_bits(s, blcodes-4, 4); /* not -3 as stated in appnote.txt */ + for (rank = 0; rank < blcodes; rank++) { + Tracev((stderr, "\nbl code %2d ", bl_order[rank])); + send_bits(s, s->bl_tree[bl_order[rank]].Len, 3); + } + Tracev((stderr, "\nbl tree: sent %ld", s->bits_sent)); + + send_tree(s, (ct_data *)s->dyn_ltree, lcodes-1); /* literal tree */ + Tracev((stderr, "\nlit tree: sent %ld", s->bits_sent)); + + send_tree(s, (ct_data *)s->dyn_dtree, dcodes-1); /* distance tree */ + Tracev((stderr, "\ndist tree: sent %ld", s->bits_sent)); +} + +/* =========================================================================== + * Send a stored block + */ +void _tr_stored_block(s, buf, stored_len, eof) + deflate_state *s; + charf *buf; /* input block */ + ulg stored_len; /* length of input block */ + int eof; /* true if this is the last block for a file */ +{ + send_bits(s, (STORED_BLOCK<<1)+eof, 3); /* send block type */ +#ifdef DEBUG + s->compressed_len = (s->compressed_len + 3 + 7) & (ulg)~7L; + s->compressed_len += (stored_len + 4) << 3; +#endif + copy_block(s, buf, (unsigned)stored_len, 1); /* with header */ +} + +/* =========================================================================== + * Send one empty static block to give enough lookahead for inflate. + * This takes 10 bits, of which 7 may remain in the bit buffer. + * The current inflate code requires 9 bits of lookahead. If the + * last two codes for the previous block (real code plus EOB) were coded + * on 5 bits or less, inflate may have only 5+3 bits of lookahead to decode + * the last real code. In this case we send two empty static blocks instead + * of one. (There are no problems if the previous block is stored or fixed.) + * To simplify the code, we assume the worst case of last real code encoded + * on one bit only. + */ +void _tr_align(s) + deflate_state *s; +{ + send_bits(s, STATIC_TREES<<1, 3); + send_code(s, END_BLOCK, static_ltree); +#ifdef DEBUG + s->compressed_len += 10L; /* 3 for block type, 7 for EOB */ +#endif + bi_flush(s); + /* Of the 10 bits for the empty block, we have already sent + * (10 - bi_valid) bits. The lookahead for the last real code (before + * the EOB of the previous block) was thus at least one plus the length + * of the EOB plus what we have just sent of the empty static block. + */ + if (1 + s->last_eob_len + 10 - s->bi_valid < 9) { + send_bits(s, STATIC_TREES<<1, 3); + send_code(s, END_BLOCK, static_ltree); +#ifdef DEBUG + s->compressed_len += 10L; +#endif + bi_flush(s); + } + s->last_eob_len = 7; +} + +/* =========================================================================== + * Determine the best encoding for the current block: dynamic trees, static + * trees or store, and output the encoded block to the zip file. + */ +void _tr_flush_block(s, buf, stored_len, eof) + deflate_state *s; + charf *buf; /* input block, or NULL if too old */ + ulg stored_len; /* length of input block */ + int eof; /* true if this is the last block for a file */ +{ + ulg opt_lenb, static_lenb; /* opt_len and static_len in bytes */ + int max_blindex = 0; /* index of last bit length code of non zero freq */ + + /* Build the Huffman trees unless a stored block is forced */ + if (s->level > 0) { + + /* Check if the file is ascii or binary */ + if (s->data_type == Z_UNKNOWN) set_data_type(s); + + /* Construct the literal and distance trees */ + build_tree(s, (tree_desc *)(&(s->l_desc))); + Tracev((stderr, "\nlit data: dyn %ld, stat %ld", s->opt_len, + s->static_len)); + + build_tree(s, (tree_desc *)(&(s->d_desc))); + Tracev((stderr, "\ndist data: dyn %ld, stat %ld", s->opt_len, + s->static_len)); + /* At this point, opt_len and static_len are the total bit lengths of + * the compressed block data, excluding the tree representations. + */ + + /* Build the bit length tree for the above two trees, and get the index + * in bl_order of the last bit length code to send. + */ + max_blindex = build_bl_tree(s); + + /* Determine the best encoding. Compute first the block length in bytes*/ + opt_lenb = (s->opt_len+3+7)>>3; + static_lenb = (s->static_len+3+7)>>3; + + Tracev((stderr, "\nopt %lu(%lu) stat %lu(%lu) stored %lu lit %u ", + opt_lenb, s->opt_len, static_lenb, s->static_len, stored_len, + s->last_lit)); + + if (static_lenb <= opt_lenb) opt_lenb = static_lenb; + + } else { + Assert(buf != (char*)0, "lost buf"); + opt_lenb = static_lenb = stored_len + 5; /* force a stored block */ + } + +#ifdef FORCE_STORED + if (buf != (char*)0) { /* force stored block */ +#else + if (stored_len+4 <= opt_lenb && buf != (char*)0) { + /* 4: two words for the lengths */ +#endif + /* The test buf != NULL is only necessary if LIT_BUFSIZE > WSIZE. + * Otherwise we can't have processed more than WSIZE input bytes since + * the last block flush, because compression would have been + * successful. If LIT_BUFSIZE <= WSIZE, it is never too late to + * transform a block into a stored block. + */ + _tr_stored_block(s, buf, stored_len, eof); + +#ifdef FORCE_STATIC + } else if (static_lenb >= 0) { /* force static trees */ +#else + } else if (static_lenb == opt_lenb) { +#endif + send_bits(s, (STATIC_TREES<<1)+eof, 3); + compress_block(s, (ct_data *)static_ltree, (ct_data *)static_dtree); +#ifdef DEBUG + s->compressed_len += 3 + s->static_len; +#endif + } else { + send_bits(s, (DYN_TREES<<1)+eof, 3); + send_all_trees(s, s->l_desc.max_code+1, s->d_desc.max_code+1, + max_blindex+1); + compress_block(s, (ct_data *)s->dyn_ltree, (ct_data *)s->dyn_dtree); +#ifdef DEBUG + s->compressed_len += 3 + s->opt_len; +#endif + } + Assert (s->compressed_len == s->bits_sent, "bad compressed size"); + /* The above check is made mod 2^32, for files larger than 512 MB + * and uLong implemented on 32 bits. + */ + init_block(s); + + if (eof) { + bi_windup(s); +#ifdef DEBUG + s->compressed_len += 7; /* align on byte boundary */ +#endif + } + Tracev((stderr,"\ncomprlen %lu(%lu) ", s->compressed_len>>3, + s->compressed_len-7*eof)); +} + +/* =========================================================================== + * Save the match info and tally the frequency counts. Return true if + * the current block must be flushed. + */ +int _tr_tally (s, dist, lc) + deflate_state *s; + unsigned dist; /* distance of matched string */ + unsigned lc; /* match length-MIN_MATCH or unmatched char (if dist==0) */ +{ + s->d_buf[s->last_lit] = (ush)dist; + s->l_buf[s->last_lit++] = (uch)lc; + if (dist == 0) { + /* lc is the unmatched char */ + s->dyn_ltree[lc].Freq++; + } else { + s->matches++; + /* Here, lc is the match length - MIN_MATCH */ + dist--; /* dist = match distance - 1 */ + Assert((ush)dist < (ush)MAX_DIST(s) && + (ush)lc <= (ush)(MAX_MATCH-MIN_MATCH) && + (ush)d_code(dist) < (ush)D_CODES, "_tr_tally: bad match"); + + s->dyn_ltree[_length_code[lc]+LITERALS+1].Freq++; + s->dyn_dtree[d_code(dist)].Freq++; + } + +#ifdef TRUNCATE_BLOCK + /* Try to guess if it is profitable to stop the current block here */ + if ((s->last_lit & 0x1fff) == 0 && s->level > 2) { + /* Compute an upper bound for the compressed length */ + ulg out_length = (ulg)s->last_lit*8L; + ulg in_length = (ulg)((long)s->strstart - s->block_start); + int dcode; + for (dcode = 0; dcode < D_CODES; dcode++) { + out_length += (ulg)s->dyn_dtree[dcode].Freq * + (5L+extra_dbits[dcode]); + } + out_length >>= 3; + Tracev((stderr,"\nlast_lit %u, in %ld, out ~%ld(%ld%%) ", + s->last_lit, in_length, out_length, + 100L - out_length*100L/in_length)); + if (s->matches < s->last_lit/2 && out_length < in_length/2) return 1; + } +#endif + return (s->last_lit == s->lit_bufsize-1); + /* We avoid equality with lit_bufsize because of wraparound at 64K + * on 16 bit machines and because stored blocks are restricted to + * 64K-1 bytes. + */ +} + +/* =========================================================================== + * Send the block data compressed using the given Huffman trees + */ +local void compress_block(s, ltree, dtree) + deflate_state *s; + ct_data *ltree; /* literal tree */ + ct_data *dtree; /* distance tree */ +{ + unsigned dist; /* distance of matched string */ + int lc; /* match length or unmatched char (if dist == 0) */ + unsigned lx = 0; /* running index in l_buf */ + unsigned code; /* the code to send */ + int extra; /* number of extra bits to send */ + + if (s->last_lit != 0) do { + dist = s->d_buf[lx]; + lc = s->l_buf[lx++]; + if (dist == 0) { + send_code(s, lc, ltree); /* send a literal byte */ + Tracecv(isgraph(lc), (stderr," '%c' ", lc)); + } else { + /* Here, lc is the match length - MIN_MATCH */ + code = _length_code[lc]; + send_code(s, code+LITERALS+1, ltree); /* send the length code */ + extra = extra_lbits[code]; + if (extra != 0) { + lc -= base_length[code]; + send_bits(s, lc, extra); /* send the extra length bits */ + } + dist--; /* dist is now the match distance - 1 */ + code = d_code(dist); + Assert (code < D_CODES, "bad d_code"); + + send_code(s, code, dtree); /* send the distance code */ + extra = extra_dbits[code]; + if (extra != 0) { + dist -= base_dist[code]; + send_bits(s, dist, extra); /* send the extra distance bits */ + } + } /* literal or match pair ? */ + + /* Check that the overlay between pending_buf and d_buf+l_buf is ok: */ + Assert(s->pending < s->lit_bufsize + 2*lx, "pendingBuf overflow"); + + } while (lx < s->last_lit); + + send_code(s, END_BLOCK, ltree); + s->last_eob_len = ltree[END_BLOCK].Len; +} + +/* =========================================================================== + * Set the data type to ASCII or BINARY, using a crude approximation: + * binary if more than 20% of the bytes are <= 6 or >= 128, ascii otherwise. + * IN assertion: the fields freq of dyn_ltree are set and the total of all + * frequencies does not exceed 64K (to fit in an int on 16 bit machines). + */ +local void set_data_type(s) + deflate_state *s; +{ + int n = 0; + unsigned ascii_freq = 0; + unsigned bin_freq = 0; + while (n < 7) bin_freq += s->dyn_ltree[n++].Freq; + while (n < 128) ascii_freq += s->dyn_ltree[n++].Freq; + while (n < LITERALS) bin_freq += s->dyn_ltree[n++].Freq; + s->data_type = (Byte)(bin_freq > (ascii_freq >> 2) ? Z_BINARY : Z_ASCII); +} + +/* =========================================================================== + * Reverse the first len bits of a code, using straightforward code (a faster + * method would use a table) + * IN assertion: 1 <= len <= 15 + */ +local unsigned bi_reverse(code, len) + unsigned code; /* the value to invert */ + int len; /* its bit length */ +{ + register unsigned res = 0; + do { + res |= code & 1; + code >>= 1, res <<= 1; + } while (--len > 0); + return res >> 1; +} + +/* =========================================================================== + * Flush the bit buffer, keeping at most 7 bits in it. + */ +local void bi_flush(s) + deflate_state *s; +{ + if (s->bi_valid == 16) { + put_short(s, s->bi_buf); + s->bi_buf = 0; + s->bi_valid = 0; + } else if (s->bi_valid >= 8) { + put_byte(s, (Byte)s->bi_buf); + s->bi_buf >>= 8; + s->bi_valid -= 8; + } +} + +/* =========================================================================== + * Flush the bit buffer and align the output on a byte boundary + */ +local void bi_windup(s) + deflate_state *s; +{ + if (s->bi_valid > 8) { + put_short(s, s->bi_buf); + } else if (s->bi_valid > 0) { + put_byte(s, (Byte)s->bi_buf); + } + s->bi_buf = 0; + s->bi_valid = 0; +#ifdef DEBUG + s->bits_sent = (s->bits_sent+7) & ~7; +#endif +} + +/* =========================================================================== + * Copy a stored block, storing first the length and its + * one's complement if requested. + */ +local void copy_block(s, buf, len, header) + deflate_state *s; + charf *buf; /* the input data */ + unsigned len; /* its length */ + int header; /* true if block header must be written */ +{ + bi_windup(s); /* align on byte boundary */ + s->last_eob_len = 8; /* enough lookahead for inflate */ + + if (header) { + put_short(s, (ush)len); + put_short(s, (ush)~len); +#ifdef DEBUG + s->bits_sent += 2*16; +#endif + } +#ifdef DEBUG + s->bits_sent += (ulg)len<<3; +#endif + while (len--) { + put_byte(s, *buf++); + } +} diff --git a/zlib/trees.h b/zlib/trees.h new file mode 100644 index 0000000..72facf9 --- /dev/null +++ b/zlib/trees.h @@ -0,0 +1,128 @@ +/* header created automatically with -DGEN_TREES_H */ + +local const ct_data static_ltree[L_CODES+2] = { +{{ 12},{ 8}}, {{140},{ 8}}, {{ 76},{ 8}}, {{204},{ 8}}, {{ 44},{ 8}}, +{{172},{ 8}}, {{108},{ 8}}, {{236},{ 8}}, {{ 28},{ 8}}, {{156},{ 8}}, +{{ 92},{ 8}}, {{220},{ 8}}, {{ 60},{ 8}}, {{188},{ 8}}, {{124},{ 8}}, +{{252},{ 8}}, {{ 2},{ 8}}, {{130},{ 8}}, {{ 66},{ 8}}, {{194},{ 8}}, +{{ 34},{ 8}}, {{162},{ 8}}, {{ 98},{ 8}}, {{226},{ 8}}, {{ 18},{ 8}}, +{{146},{ 8}}, {{ 82},{ 8}}, {{210},{ 8}}, {{ 50},{ 8}}, {{178},{ 8}}, +{{114},{ 8}}, {{242},{ 8}}, {{ 10},{ 8}}, {{138},{ 8}}, {{ 74},{ 8}}, +{{202},{ 8}}, {{ 42},{ 8}}, {{170},{ 8}}, {{106},{ 8}}, {{234},{ 8}}, +{{ 26},{ 8}}, {{154},{ 8}}, {{ 90},{ 8}}, {{218},{ 8}}, {{ 58},{ 8}}, +{{186},{ 8}}, {{122},{ 8}}, {{250},{ 8}}, {{ 6},{ 8}}, {{134},{ 8}}, +{{ 70},{ 8}}, {{198},{ 8}}, {{ 38},{ 8}}, {{166},{ 8}}, {{102},{ 8}}, +{{230},{ 8}}, {{ 22},{ 8}}, {{150},{ 8}}, {{ 86},{ 8}}, {{214},{ 8}}, +{{ 54},{ 8}}, {{182},{ 8}}, {{118},{ 8}}, {{246},{ 8}}, {{ 14},{ 8}}, +{{142},{ 8}}, {{ 78},{ 8}}, {{206},{ 8}}, {{ 46},{ 8}}, {{174},{ 8}}, +{{110},{ 8}}, {{238},{ 8}}, {{ 30},{ 8}}, {{158},{ 8}}, {{ 94},{ 8}}, +{{222},{ 8}}, {{ 62},{ 8}}, {{190},{ 8}}, {{126},{ 8}}, {{254},{ 8}}, +{{ 1},{ 8}}, {{129},{ 8}}, {{ 65},{ 8}}, {{193},{ 8}}, {{ 33},{ 8}}, +{{161},{ 8}}, {{ 97},{ 8}}, {{225},{ 8}}, {{ 17},{ 8}}, {{145},{ 8}}, +{{ 81},{ 8}}, {{209},{ 8}}, {{ 49},{ 8}}, {{177},{ 8}}, {{113},{ 8}}, +{{241},{ 8}}, {{ 9},{ 8}}, {{137},{ 8}}, {{ 73},{ 8}}, {{201},{ 8}}, +{{ 41},{ 8}}, {{169},{ 8}}, {{105},{ 8}}, {{233},{ 8}}, {{ 25},{ 8}}, +{{153},{ 8}}, {{ 89},{ 8}}, {{217},{ 8}}, {{ 57},{ 8}}, {{185},{ 8}}, +{{121},{ 8}}, {{249},{ 8}}, {{ 5},{ 8}}, {{133},{ 8}}, {{ 69},{ 8}}, +{{197},{ 8}}, {{ 37},{ 8}}, {{165},{ 8}}, {{101},{ 8}}, {{229},{ 8}}, +{{ 21},{ 8}}, {{149},{ 8}}, {{ 85},{ 8}}, {{213},{ 8}}, {{ 53},{ 8}}, +{{181},{ 8}}, {{117},{ 8}}, {{245},{ 8}}, {{ 13},{ 8}}, {{141},{ 8}}, +{{ 77},{ 8}}, {{205},{ 8}}, {{ 45},{ 8}}, {{173},{ 8}}, {{109},{ 8}}, +{{237},{ 8}}, {{ 29},{ 8}}, {{157},{ 8}}, {{ 93},{ 8}}, {{221},{ 8}}, +{{ 61},{ 8}}, {{189},{ 8}}, {{125},{ 8}}, {{253},{ 8}}, {{ 19},{ 9}}, +{{275},{ 9}}, {{147},{ 9}}, {{403},{ 9}}, {{ 83},{ 9}}, {{339},{ 9}}, +{{211},{ 9}}, {{467},{ 9}}, {{ 51},{ 9}}, {{307},{ 9}}, {{179},{ 9}}, +{{435},{ 9}}, {{115},{ 9}}, {{371},{ 9}}, {{243},{ 9}}, {{499},{ 9}}, +{{ 11},{ 9}}, {{267},{ 9}}, {{139},{ 9}}, {{395},{ 9}}, {{ 75},{ 9}}, +{{331},{ 9}}, {{203},{ 9}}, {{459},{ 9}}, {{ 43},{ 9}}, {{299},{ 9}}, +{{171},{ 9}}, {{427},{ 9}}, {{107},{ 9}}, {{363},{ 9}}, {{235},{ 9}}, +{{491},{ 9}}, {{ 27},{ 9}}, {{283},{ 9}}, {{155},{ 9}}, {{411},{ 9}}, +{{ 91},{ 9}}, {{347},{ 9}}, {{219},{ 9}}, {{475},{ 9}}, {{ 59},{ 9}}, +{{315},{ 9}}, {{187},{ 9}}, {{443},{ 9}}, {{123},{ 9}}, {{379},{ 9}}, +{{251},{ 9}}, {{507},{ 9}}, {{ 7},{ 9}}, {{263},{ 9}}, {{135},{ 9}}, +{{391},{ 9}}, {{ 71},{ 9}}, {{327},{ 9}}, {{199},{ 9}}, {{455},{ 9}}, +{{ 39},{ 9}}, {{295},{ 9}}, {{167},{ 9}}, {{423},{ 9}}, {{103},{ 9}}, +{{359},{ 9}}, {{231},{ 9}}, {{487},{ 9}}, {{ 23},{ 9}}, {{279},{ 9}}, +{{151},{ 9}}, {{407},{ 9}}, {{ 87},{ 9}}, {{343},{ 9}}, {{215},{ 9}}, +{{471},{ 9}}, {{ 55},{ 9}}, {{311},{ 9}}, {{183},{ 9}}, {{439},{ 9}}, +{{119},{ 9}}, {{375},{ 9}}, {{247},{ 9}}, {{503},{ 9}}, {{ 15},{ 9}}, +{{271},{ 9}}, {{143},{ 9}}, {{399},{ 9}}, {{ 79},{ 9}}, {{335},{ 9}}, +{{207},{ 9}}, {{463},{ 9}}, {{ 47},{ 9}}, {{303},{ 9}}, {{175},{ 9}}, +{{431},{ 9}}, {{111},{ 9}}, {{367},{ 9}}, {{239},{ 9}}, {{495},{ 9}}, +{{ 31},{ 9}}, {{287},{ 9}}, {{159},{ 9}}, {{415},{ 9}}, {{ 95},{ 9}}, +{{351},{ 9}}, {{223},{ 9}}, {{479},{ 9}}, {{ 63},{ 9}}, {{319},{ 9}}, +{{191},{ 9}}, {{447},{ 9}}, {{127},{ 9}}, {{383},{ 9}}, {{255},{ 9}}, +{{511},{ 9}}, {{ 0},{ 7}}, {{ 64},{ 7}}, {{ 32},{ 7}}, {{ 96},{ 7}}, +{{ 16},{ 7}}, {{ 80},{ 7}}, {{ 48},{ 7}}, {{112},{ 7}}, {{ 8},{ 7}}, +{{ 72},{ 7}}, {{ 40},{ 7}}, {{104},{ 7}}, {{ 24},{ 7}}, {{ 88},{ 7}}, +{{ 56},{ 7}}, {{120},{ 7}}, {{ 4},{ 7}}, {{ 68},{ 7}}, {{ 36},{ 7}}, +{{100},{ 7}}, {{ 20},{ 7}}, {{ 84},{ 7}}, {{ 52},{ 7}}, {{116},{ 7}}, +{{ 3},{ 8}}, {{131},{ 8}}, {{ 67},{ 8}}, {{195},{ 8}}, {{ 35},{ 8}}, +{{163},{ 8}}, {{ 99},{ 8}}, {{227},{ 8}} +}; + +local const ct_data static_dtree[D_CODES] = { +{{ 0},{ 5}}, {{16},{ 5}}, {{ 8},{ 5}}, {{24},{ 5}}, {{ 4},{ 5}}, +{{20},{ 5}}, {{12},{ 5}}, {{28},{ 5}}, {{ 2},{ 5}}, {{18},{ 5}}, +{{10},{ 5}}, {{26},{ 5}}, {{ 6},{ 5}}, {{22},{ 5}}, {{14},{ 5}}, +{{30},{ 5}}, {{ 1},{ 5}}, {{17},{ 5}}, {{ 9},{ 5}}, {{25},{ 5}}, +{{ 5},{ 5}}, {{21},{ 5}}, {{13},{ 5}}, {{29},{ 5}}, {{ 3},{ 5}}, +{{19},{ 5}}, {{11},{ 5}}, {{27},{ 5}}, {{ 7},{ 5}}, {{23},{ 5}} +}; + +const uch _dist_code[DIST_CODE_LEN] = { + 0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8, + 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 10, 10, 10, +10, 10, 10, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, +11, 11, 11, 11, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, +12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 13, 13, 13, 13, +13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, +13, 13, 13, 13, 13, 13, 13, 13, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 0, 0, 16, 17, +18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22, +23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29 +}; + +const uch _length_code[MAX_MATCH-MIN_MATCH+1]= { + 0, 1, 2, 3, 4, 5, 6, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 12, 12, +13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, 16, 16, 16, 16, 16, 16, +17, 17, 17, 17, 17, 17, 17, 17, 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, 19, 19, +19, 19, 19, 19, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, +21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 22, 22, 22, 22, +22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23, +23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, +25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28 +}; + +local const int base_length[LENGTH_CODES] = { +0, 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 20, 24, 28, 32, 40, 48, 56, +64, 80, 96, 112, 128, 160, 192, 224, 0 +}; + +local const int base_dist[D_CODES] = { + 0, 1, 2, 3, 4, 6, 8, 12, 16, 24, + 32, 48, 64, 96, 128, 192, 256, 384, 512, 768, + 1024, 1536, 2048, 3072, 4096, 6144, 8192, 12288, 16384, 24576 +}; + diff --git a/zlib/uncompr.c b/zlib/uncompr.c new file mode 100644 index 0000000..d103321 --- /dev/null +++ b/zlib/uncompr.c @@ -0,0 +1,58 @@ +/* uncompr.c -- decompress a memory buffer + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include "zlib.h" + +/* =========================================================================== + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total + size of the destination buffer, which must be large enough to hold the + entire uncompressed data. (The size of the uncompressed data must have + been saved previously by the compressor and transmitted to the decompressor + by some mechanism outside the scope of this compression library.) + Upon exit, destLen is the actual size of the compressed buffer. + This function can be used to decompress a whole file at once if the + input file is mmap'ed. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted. +*/ +int ZEXPORT uncompress (dest, destLen, source, sourceLen) + Bytef *dest; + uLongf *destLen; + const Bytef *source; + uLong sourceLen; +{ + z_stream stream; + int err; + + stream.next_in = (Bytef*)source; + stream.avail_in = (uInt)sourceLen; + /* Check for source > 64K on 16-bit machine: */ + if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR; + + stream.next_out = dest; + stream.avail_out = (uInt)*destLen; + if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR; + + stream.zalloc = (alloc_func)0; + stream.zfree = (free_func)0; + + err = inflateInit(&stream); + if (err != Z_OK) return err; + + err = inflate(&stream, Z_FINISH); + if (err != Z_STREAM_END) { + inflateEnd(&stream); + return err == Z_OK ? Z_BUF_ERROR : err; + } + *destLen = stream.total_out; + + err = inflateEnd(&stream); + return err; +} diff --git a/zlib/zconf.h b/zlib/zconf.h new file mode 100644 index 0000000..6d450fc --- /dev/null +++ b/zlib/zconf.h @@ -0,0 +1,279 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef _ZCONF_H +#define _ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + */ +#ifdef Z_PREFIX +# define deflateInit_ z_deflateInit_ +# define deflate z_deflate +# define deflateEnd z_deflateEnd +# define inflateInit_ z_inflateInit_ +# define inflate z_inflate +# define inflateEnd z_inflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateSetDictionary z_deflateSetDictionary +# define deflateCopy z_deflateCopy +# define deflateReset z_deflateReset +# define deflateParams z_deflateParams +# define inflateInit2_ z_inflateInit2_ +# define inflateSetDictionary z_inflateSetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateReset z_inflateReset +# define compress z_compress +# define compress2 z_compress2 +# define uncompress z_uncompress +# define adler32 z_adler32 +# define crc32 z_crc32 +# define get_crc_table z_get_crc_table + +# define Byte z_Byte +# define uInt z_uInt +# define uLong z_uLong +# define Bytef z_Bytef +# define charf z_charf +# define intf z_intf +# define uIntf z_uIntf +# define uLongf z_uLongf +# define voidpf z_voidpf +# define voidp z_voidp +#endif + +#if (defined(_WIN32) || defined(__WIN32__)) && !defined(WIN32) +# define WIN32 +#endif +#if defined(__GNUC__) || defined(WIN32) || defined(__386__) || defined(i386) +# ifndef __32BIT__ +# define __32BIT__ +# endif +#endif +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#if defined(MSDOS) && !defined(__32BIT__) +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#if (defined(MSDOS) || defined(_WINDOWS) || defined(WIN32)) && !defined(STDC) +# define STDC +#endif +#if defined(__STDC__) || defined(__cplusplus) || defined(__OS2__) +# ifndef STDC +# define STDC +# endif +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const +# endif +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__) || defined(applec) ||defined(THINK_C) ||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Old Borland C incorrectly complains about missing returns: */ +#if defined(__BORLANDC__) && (__BORLANDC__ < 0x500) +# define NEED_DUMMY_RETURN +#endif + + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#if (defined(M_I86SM) || defined(M_I86MM)) && !defined(__32BIT__) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +#endif +#if defined(__BORLANDC__) && (defined(__SMALL__) || defined(__MEDIUM__)) +# ifndef __32BIT__ +# define SMALL_MEDIUM +# define FAR _far +# endif +#endif + +/* Compile with -DZLIB_DLL for Windows DLL support */ +#if defined(ZLIB_DLL) +# if defined(_WINDOWS) || defined(WINDOWS) +# ifdef FAR +# undef FAR +# endif +# include +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR _cdecl _export +# endif +# endif +# if defined (__BORLANDC__) +# if (__BORLANDC__ >= 0x0500) && defined (WIN32) +# include +# define ZEXPORT __declspec(dllexport) WINAPI +# define ZEXPORTRVA __declspec(dllexport) WINAPIV +# else +# if defined (_Windows) && defined (__DLL__) +# define ZEXPORT _export +# define ZEXPORTVA _export +# endif +# endif +# endif +#endif + +#if defined (__BEOS__) +# if defined (ZLIB_DLL) +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +#endif + +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif +#ifndef ZEXTERN +# define ZEXTERN extern +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(MACOS) && !defined(TARGET_OS_MAC) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#ifdef HAVE_UNISTD_H +# include /* for off_t */ +# include /* for SEEK_* and off_t */ +# define z_off_t off_t +#endif +#ifndef SEEK_SET +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif +#ifndef z_off_t +# define z_off_t long +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) +# pragma map(deflateInit_,"DEIN") +# pragma map(deflateInit2_,"DEIN2") +# pragma map(deflateEnd,"DEEND") +# pragma map(inflateInit_,"ININ") +# pragma map(inflateInit2_,"ININ2") +# pragma map(inflateEnd,"INEND") +# pragma map(inflateSync,"INSY") +# pragma map(inflateSetDictionary,"INSEDI") +# pragma map(inflate_blocks,"INBL") +# pragma map(inflate_blocks_new,"INBLNE") +# pragma map(inflate_blocks_free,"INBLFR") +# pragma map(inflate_blocks_reset,"INBLRE") +# pragma map(inflate_codes_free,"INCOFR") +# pragma map(inflate_codes,"INCO") +# pragma map(inflate_fast,"INFA") +# pragma map(inflate_flush,"INFLU") +# pragma map(inflate_mask,"INMA") +# pragma map(inflate_set_dictionary,"INSEDI2") +# pragma map(inflate_copyright,"INCOPY") +# pragma map(inflate_trees_bits,"INTRBI") +# pragma map(inflate_trees_dynamic,"INTRDY") +# pragma map(inflate_trees_fixed,"INTRFI") +# pragma map(inflate_trees_free,"INTRFR") +#endif + +#endif /* _ZCONF_H */ diff --git a/zlib/zlib.3 b/zlib/zlib.3 new file mode 100644 index 0000000..25c8495 --- /dev/null +++ b/zlib/zlib.3 @@ -0,0 +1,107 @@ +.TH ZLIB 3 "9 July 1998" +.SH NAME +zlib \- compression/decompression library +.SH SYNOPSIS +[see +.I zlib.h +for full description] +.SH DESCRIPTION +The +.I zlib +library is a general purpose data compression library. +The code is thread safe. +It provides in-memory compression and decompression functions, +including integrity checks of the uncompressed data. +This version of the library supports only one compression method (deflation) +but other algorithms will be added later and will have the same stream interface. +.LP +Compression can be done in a single step if the buffers are large enough +(for example if an input file is mmap'ed), +or can be done by repeated calls of the compression function. +In the latter case, +the application must provide more input and/or consume the output +(providing more output space) before each call. +.LP +The library also supports reading and writing files in +.I gzip +(.gz) format +with an interface similar to that of stdio. +.LP +The library does not install any signal handler. The decoder checks +the consistency of the compressed data, so the library should never +crash even in case of corrupted input. +.LP +All functions of the compression library are documented in the file +.IR zlib.h. +The distribution source includes examples of use of the library +the files +.I example.c +and +.IR minigzip.c . +.LP +A Java implementation of +.IR zlib +is available in the Java Development Kit 1.1 +.IP +http://www.javasoft.com/products/JDK/1.1/docs/api/Package-java.util.zip.html +.LP +A Perl interface to +.IR zlib , +written by Paul Marquess (pmarquess@bfsec.bt.co.uk) +is available at CPAN (Comprehensive Perl Archive Network) sites, +such as: +.IP +ftp://ftp.cis.ufl.edu/pub/perl/CPAN/modules/by-module/Compress/Compress-Zlib* +.LP +A Python interface to +.IR zlib +written by A.M. Kuchling +is available from the Python Software Association sites, such as: +.IP +ftp://ftp.python.org/pub/python/contrib/Encoding/zlib*.tar.gz +.SH "SEE ALSO" +Questions about zlib should be sent to: +.IP +zlib@quest.jpl.nasa.gov +or, if this fails, to the author addresses given below. +The zlib home page is: +.IP +http://www.cdrom.com/pub/infozip/zlib/ +.LP +The data format used by the zlib library is described by RFC +(Request for Comments) 1950 to 1952 in the files: +.IP +ftp://ds.internic.net/rfc/rfc1950.txt (zlib format) +.br +rfc1951.txt (deflate format) +.br +rfc1952.txt (gzip format) +.LP +These documents are also available in other formats from: +.IP +ftp://ftp.uu.net/graphics/png/documents/zlib/zdoc-index.html +.SH AUTHORS +Version 1.1.3 +Copyright (C) 1995-1998 Jean-loup Gailly (jloup@gzip.org) +and Mark Adler (madler@alumni.caltech.edu). +.LP +This software is provided "as-is," +without any express or implied warranty. +In no event will the authors be held liable for any damages +arising from the use of this software. +See the distribution directory with respect to requirements +governing redistribution. +The deflate format used by +.I zlib +was defined by Phil Katz. +The deflate and +.I zlib +specifications were written by L. Peter Deutsch. +Thanks to all the people who reported problems and suggested various +improvements in +.IR zlib ; +who are too numerous to cite here. +.LP +UNIX manual page by R. P. C. Rodgers, +U.S. National Library of Medicine (rodgers@nlm.nih.gov). +.\" end of man page diff --git a/zlib/zlib.h b/zlib/zlib.h new file mode 100644 index 0000000..49f56b4 --- /dev/null +++ b/zlib/zlib.h @@ -0,0 +1,893 @@ +/* zlib.h -- interface of the 'zlib' general purpose compression library + version 1.1.3, July 9th, 1998 + + Copyright (C) 1995-1998 Jean-loup Gailly and Mark Adler + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + Jean-loup Gailly Mark Adler + jloup@gzip.org madler@alumni.caltech.edu + + + The data format used by the zlib library is described by RFCs (Request for + Comments) 1950 to 1952 in the files ftp://ds.internic.net/rfc/rfc1950.txt + (zlib format), rfc1951.txt (deflate format) and rfc1952.txt (gzip format). +*/ + +#ifndef _ZLIB_H +#define _ZLIB_H + +#include "zconf.h" + +#ifdef __cplusplus +extern "C" { +#endif + +#define ZLIB_VERSION "1.1.3" + +/* + The 'zlib' compression library provides in-memory compression and + decompression functions, including integrity checks of the uncompressed + data. This version of the library supports only one compression method + (deflation) but other algorithms will be added later and will have the same + stream interface. + + Compression can be done in a single step if the buffers are large + enough (for example if an input file is mmap'ed), or can be done by + repeated calls of the compression function. In the latter case, the + application must provide more input and/or consume the output + (providing more output space) before each call. + + The library also supports reading and writing files in gzip (.gz) format + with an interface similar to that of stdio. + + The library does not install any signal handler. The decoder checks + the consistency of the compressed data, so the library should never + crash even in case of corrupted input. +*/ + +typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size)); +typedef void (*free_func) OF((voidpf opaque, voidpf address)); + +struct internal_state; + +typedef struct z_stream_s { + Bytef *next_in; /* next input byte */ + uInt avail_in; /* number of bytes available at next_in */ + uLong total_in; /* total nb of input bytes read so far */ + + Bytef *next_out; /* next output byte should be put there */ + uInt avail_out; /* remaining free space at next_out */ + uLong total_out; /* total nb of bytes output so far */ + + char *msg; /* last error message, NULL if no error */ + struct internal_state FAR *state; /* not visible by applications */ + + alloc_func zalloc; /* used to allocate the internal state */ + free_func zfree; /* used to free the internal state */ + voidpf opaque; /* private data object passed to zalloc and zfree */ + + int data_type; /* best guess about the data type: ascii or binary */ + uLong adler; /* adler32 value of the uncompressed data */ + uLong reserved; /* reserved for future use */ +} z_stream; + +typedef z_stream FAR *z_streamp; + +/* + The application must update next_in and avail_in when avail_in has + dropped to zero. It must update next_out and avail_out when avail_out + has dropped to zero. The application must initialize zalloc, zfree and + opaque before calling the init function. All other fields are set by the + compression library and must not be updated by the application. + + The opaque value provided by the application will be passed as the first + parameter for calls of zalloc and zfree. This can be useful for custom + memory management. The compression library attaches no meaning to the + opaque value. + + zalloc must return Z_NULL if there is not enough memory for the object. + If zlib is used in a multi-threaded application, zalloc and zfree must be + thread safe. + + On 16-bit systems, the functions zalloc and zfree must be able to allocate + exactly 65536 bytes, but will not be required to allocate more than this + if the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, + pointers returned by zalloc for objects of exactly 65536 bytes *must* + have their offset normalized to zero. The default allocation function + provided by this library ensures this (see zutil.c). To reduce memory + requirements and avoid any allocation of 64K objects, at the expense of + compression ratio, compile the library with -DMAX_WBITS=14 (see zconf.h). + + The fields total_in and total_out can be used for statistics or + progress reports. After compression, total_in holds the total size of + the uncompressed data and may be saved for use in the decompressor + (particularly if the decompressor wants to decompress everything in + a single step). +*/ + + /* constants */ + +#define Z_NO_FLUSH 0 +#define Z_PARTIAL_FLUSH 1 /* will be removed, use Z_SYNC_FLUSH instead */ +#define Z_SYNC_FLUSH 2 +#define Z_FULL_FLUSH 3 +#define Z_FINISH 4 +/* Allowed flush values; see deflate() below for details */ + +#define Z_OK 0 +#define Z_STREAM_END 1 +#define Z_NEED_DICT 2 +#define Z_ERRNO (-1) +#define Z_STREAM_ERROR (-2) +#define Z_DATA_ERROR (-3) +#define Z_MEM_ERROR (-4) +#define Z_BUF_ERROR (-5) +#define Z_VERSION_ERROR (-6) +/* Return codes for the compression/decompression functions. Negative + * values are errors, positive values are used for special but normal events. + */ + +#define Z_NO_COMPRESSION 0 +#define Z_BEST_SPEED 1 +#define Z_BEST_COMPRESSION 9 +#define Z_DEFAULT_COMPRESSION (-1) +/* compression levels */ + +#define Z_FILTERED 1 +#define Z_HUFFMAN_ONLY 2 +#define Z_DEFAULT_STRATEGY 0 +/* compression strategy; see deflateInit2() below for details */ + +#define Z_BINARY 0 +#define Z_ASCII 1 +#define Z_UNKNOWN 2 +/* Possible values of the data_type field */ + +#define Z_DEFLATED 8 +/* The deflate compression method (the only one supported in this version) */ + +#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */ + +#define zlib_version zlibVersion() +/* for compatibility with versions < 1.0.2 */ + + /* basic functions */ + +ZEXTERN const char * ZEXPORT zlibVersion OF((void)); +/* The application can compare zlibVersion and ZLIB_VERSION for consistency. + If the first character differs, the library code actually used is + not compatible with the zlib.h header file used by the application. + This check is automatically made by deflateInit and inflateInit. + */ + +/* +ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level)); + + Initializes the internal stream state for compression. The fields + zalloc, zfree and opaque must be initialized before by the caller. + If zalloc and zfree are set to Z_NULL, deflateInit updates them to + use default allocation functions. + + The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9: + 1 gives best speed, 9 gives best compression, 0 gives no compression at + all (the input data is simply copied a block at a time). + Z_DEFAULT_COMPRESSION requests a default compromise between speed and + compression (currently equivalent to level 6). + + deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if level is not a valid compression level, + Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible + with the version assumed by the caller (ZLIB_VERSION). + msg is set to null if there is no error message. deflateInit does not + perform any compression: this will be done by deflate(). +*/ + + +ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush)); +/* + deflate compresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce some + output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. deflate performs one or both of the + following actions: + + - Compress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in and avail_in are updated and + processing will resume at this point for the next call of deflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. This action is forced if the parameter flush is non zero. + Forcing flush frequently degrades the compression ratio, so this parameter + should be set only when necessary (in interactive applications). + Some output may be provided even if flush is not set. + + Before the call of deflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming + more output, and updating avail_in or avail_out accordingly; avail_out + should never be zero before the call. The application can consume the + compressed output when it wants, for example when the output buffer is full + (avail_out == 0), or after each call of deflate(). If deflate returns Z_OK + and with zero avail_out, it must be called again after making room in the + output buffer because there might be more output pending. + + If the parameter flush is set to Z_SYNC_FLUSH, all pending output is + flushed to the output buffer and the output is aligned on a byte boundary, so + that the decompressor can get all input data available so far. (In particular + avail_in is zero after the call if enough output space has been provided + before the call.) Flushing may degrade compression for some compression + algorithms and so it should be used only when necessary. + + If flush is set to Z_FULL_FLUSH, all output is flushed as with + Z_SYNC_FLUSH, and the compression state is reset so that decompression can + restart from this point if previous compressed data has been damaged or if + random access is desired. Using Z_FULL_FLUSH too often can seriously degrade + the compression. + + If deflate returns with avail_out == 0, this function must be called again + with the same value of the flush parameter and more output space (updated + avail_out), until the flush is complete (deflate returns with non-zero + avail_out). + + If the parameter flush is set to Z_FINISH, pending input is processed, + pending output is flushed and deflate returns with Z_STREAM_END if there + was enough output space; if deflate returns with Z_OK, this function must be + called again with Z_FINISH and more output space (updated avail_out) but no + more input data, until it returns with Z_STREAM_END or an error. After + deflate has returned Z_STREAM_END, the only possible operations on the + stream are deflateReset or deflateEnd. + + Z_FINISH can be used immediately after deflateInit if all the compression + is to be done in a single step. In this case, avail_out must be at least + 0.1% larger than avail_in plus 12 bytes. If deflate does not return + Z_STREAM_END, then it must be called again as described above. + + deflate() sets strm->adler to the adler32 checksum of all input read + so far (that is, total_in bytes). + + deflate() may update data_type if it can make a good guess about + the input data type (Z_ASCII or Z_BINARY). In doubt, the data is considered + binary. This field is only for information purposes and does not affect + the compression algorithm in any manner. + + deflate() returns Z_OK if some progress has been made (more input + processed or more output produced), Z_STREAM_END if all input has been + consumed and all output has been produced (only when flush is set to + Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example + if next_in or next_out was NULL), Z_BUF_ERROR if no progress is possible + (for example avail_in or avail_out was zero). +*/ + + +ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any + pending output. + + deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the + stream state was inconsistent, Z_DATA_ERROR if the stream was freed + prematurely (some input or output was discarded). In the error case, + msg may be set but then points to a static string (which must not be + deallocated). +*/ + + +/* +ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm)); + + Initializes the internal stream state for decompression. The fields + next_in, avail_in, zalloc, zfree and opaque must be initialized before by + the caller. If next_in is not Z_NULL and avail_in is large enough (the exact + value depends on the compression method), inflateInit determines the + compression method from the zlib header and allocates all data structures + accordingly; otherwise the allocation will be deferred to the first call of + inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to + use default allocation functions. + + inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller. msg is set to null if there is no error + message. inflateInit does not perform any decompression apart from reading + the zlib header if present: this will be done by inflate(). (So next_in and + avail_in may be modified, but next_out and avail_out are unchanged.) +*/ + + +ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush)); +/* + inflate decompresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may some + introduce some output latency (reading input without producing any output) + except when forced to flush. + + The detailed semantics are as follows. inflate performs one or both of the + following actions: + + - Decompress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in is updated and processing + will resume at this point for the next call of inflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. inflate() provides as much output as possible, until there + is no more input data or no more space in the output buffer (see below + about the flush parameter). + + Before the call of inflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming + more output, and updating the next_* and avail_* values accordingly. + The application can consume the uncompressed output when it wants, for + example when the output buffer is full (avail_out == 0), or after each + call of inflate(). If inflate returns Z_OK and with zero avail_out, it + must be called again after making room in the output buffer because there + might be more output pending. + + If the parameter flush is set to Z_SYNC_FLUSH, inflate flushes as much + output as possible to the output buffer. The flushing behavior of inflate is + not specified for values of the flush parameter other than Z_SYNC_FLUSH + and Z_FINISH, but the current implementation actually flushes as much output + as possible anyway. + + inflate() should normally be called until it returns Z_STREAM_END or an + error. However if all decompression is to be performed in a single step + (a single call of inflate), the parameter flush should be set to + Z_FINISH. In this case all pending input is processed and all pending + output is flushed; avail_out must be large enough to hold all the + uncompressed data. (The size of the uncompressed data may have been saved + by the compressor for this purpose.) The next operation on this stream must + be inflateEnd to deallocate the decompression state. The use of Z_FINISH + is never required, but can be used to inform inflate that a faster routine + may be used for the single inflate() call. + + If a preset dictionary is needed at this point (see inflateSetDictionary + below), inflate sets strm-adler to the adler32 checksum of the + dictionary chosen by the compressor and returns Z_NEED_DICT; otherwise + it sets strm->adler to the adler32 checksum of all output produced + so far (that is, total_out bytes) and returns Z_OK, Z_STREAM_END or + an error code as described below. At the end of the stream, inflate() + checks that its computed adler32 checksum is equal to that saved by the + compressor and returns Z_STREAM_END only if the checksum is correct. + + inflate() returns Z_OK if some progress has been made (more input processed + or more output produced), Z_STREAM_END if the end of the compressed data has + been reached and all uncompressed output has been produced, Z_NEED_DICT if a + preset dictionary is needed at this point, Z_DATA_ERROR if the input data was + corrupted (input stream not conforming to the zlib format or incorrect + adler32 checksum), Z_STREAM_ERROR if the stream structure was inconsistent + (for example if next_in or next_out was NULL), Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if no progress is possible or if there was not + enough room in the output buffer when Z_FINISH is used. In the Z_DATA_ERROR + case, the application may then call inflateSync to look for a good + compression block. +*/ + + +ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any + pending output. + + inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state + was inconsistent. In the error case, msg may be set but then points to a + static string (which must not be deallocated). +*/ + + /* Advanced functions */ + +/* + The following functions are needed only in some special applications. +*/ + +/* +ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm, + int level, + int method, + int windowBits, + int memLevel, + int strategy)); + + This is another version of deflateInit with more compression options. The + fields next_in, zalloc, zfree and opaque must be initialized before by + the caller. + + The method parameter is the compression method. It must be Z_DEFLATED in + this version of the library. + + The windowBits parameter is the base two logarithm of the window size + (the size of the history buffer). It should be in the range 8..15 for this + version of the library. Larger values of this parameter result in better + compression at the expense of memory usage. The default value is 15 if + deflateInit is used instead. + + The memLevel parameter specifies how much memory should be allocated + for the internal compression state. memLevel=1 uses minimum memory but + is slow and reduces compression ratio; memLevel=9 uses maximum memory + for optimal speed. The default value is 8. See zconf.h for total memory + usage as a function of windowBits and memLevel. + + The strategy parameter is used to tune the compression algorithm. Use the + value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a + filter (or predictor), or Z_HUFFMAN_ONLY to force Huffman encoding only (no + string match). Filtered data consists mostly of small values with a + somewhat random distribution. In this case, the compression algorithm is + tuned to compress them better. The effect of Z_FILTERED is to force more + Huffman coding and less string matching; it is somewhat intermediate + between Z_DEFAULT and Z_HUFFMAN_ONLY. The strategy parameter only affects + the compression ratio but not the correctness of the compressed output even + if it is not set appropriately. + + deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if a parameter is invalid (such as an invalid + method). msg is set to null if there is no error message. deflateInit2 does + not perform any compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the compression dictionary from the given byte sequence + without producing any compressed output. This function must be called + immediately after deflateInit, deflateInit2 or deflateReset, before any + call of deflate. The compressor and decompressor must use exactly the same + dictionary (see inflateSetDictionary). + + The dictionary should consist of strings (byte sequences) that are likely + to be encountered later in the data to be compressed, with the most commonly + used strings preferably put towards the end of the dictionary. Using a + dictionary is most useful when the data to be compressed is short and can be + predicted with good accuracy; the data can then be compressed better than + with the default empty dictionary. + + Depending on the size of the compression data structures selected by + deflateInit or deflateInit2, a part of the dictionary may in effect be + discarded, for example if the dictionary is larger than the window size in + deflate or deflate2. Thus the strings most likely to be useful should be + put at the end of the dictionary, not at the front. + + Upon return of this function, strm->adler is set to the Adler32 value + of the dictionary; the decompressor may later use this value to determine + which dictionary has been used by the compressor. (The Adler32 value + applies to the whole dictionary even if only a subset of the dictionary is + actually used by the compressor.) + + deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a + parameter is invalid (such as NULL dictionary) or the stream state is + inconsistent (for example if deflate has already been called for this stream + or if the compression method is bsort). deflateSetDictionary does not + perform any compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when several compression strategies will be + tried, for example when there are several ways of pre-processing the input + data with a filter. The streams that will be discarded should then be freed + by calling deflateEnd. Note that deflateCopy duplicates the internal + compression state which can be quite large, so this strategy is slow and + can consume lots of memory. + + deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm)); +/* + This function is equivalent to deflateEnd followed by deflateInit, + but does not free and reallocate all the internal compression state. + The stream will keep the same compression level and any other attributes + that may have been set by deflateInit2. + + deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being NULL). +*/ + +ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm, + int level, + int strategy)); +/* + Dynamically update the compression level and compression strategy. The + interpretation of level and strategy is as in deflateInit2. This can be + used to switch between compression and straight copy of the input data, or + to switch to a different kind of input data requiring a different + strategy. If the compression level is changed, the input available so far + is compressed with the old level (and may be flushed); the new level will + take effect only at the next call of deflate(). + + Before the call of deflateParams, the stream state must be set as for + a call of deflate(), since the currently available input may have to + be compressed and flushed. In particular, strm->avail_out must be non-zero. + + deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source + stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR + if strm->avail_out was zero. +*/ + +/* +ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm, + int windowBits)); + + This is another version of inflateInit with an extra parameter. The + fields next_in, avail_in, zalloc, zfree and opaque must be initialized + before by the caller. + + The windowBits parameter is the base two logarithm of the maximum window + size (the size of the history buffer). It should be in the range 8..15 for + this version of the library. The default value is 15 if inflateInit is used + instead. If a compressed stream with a larger window size is given as + input, inflate() will return with the error code Z_DATA_ERROR instead of + trying to allocate a larger window. + + inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if a parameter is invalid (such as a negative + memLevel). msg is set to null if there is no error message. inflateInit2 + does not perform any decompression apart from reading the zlib header if + present: this will be done by inflate(). (So next_in and avail_in may be + modified, but next_out and avail_out are unchanged.) +*/ + +ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the decompression dictionary from the given uncompressed byte + sequence. This function must be called immediately after a call of inflate + if this call returned Z_NEED_DICT. The dictionary chosen by the compressor + can be determined from the Adler32 value returned by this call of + inflate. The compressor and decompressor must use exactly the same + dictionary (see deflateSetDictionary). + + inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a + parameter is invalid (such as NULL dictionary) or the stream state is + inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the + expected one (incorrect Adler32 value). inflateSetDictionary does not + perform any decompression: this will be done by subsequent calls of + inflate(). +*/ + +ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm)); +/* + Skips invalid compressed data until a full flush point (see above the + description of deflate with Z_FULL_FLUSH) can be found, or until all + available input is skipped. No output is provided. + + inflateSync returns Z_OK if a full flush point has been found, Z_BUF_ERROR + if no more input was provided, Z_DATA_ERROR if no flush point has been found, + or Z_STREAM_ERROR if the stream structure was inconsistent. In the success + case, the application may save the current current value of total_in which + indicates where valid compressed data was found. In the error case, the + application may repeatedly call inflateSync, providing more input each time, + until success or end of the input data. +*/ + +ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm)); +/* + This function is equivalent to inflateEnd followed by inflateInit, + but does not free and reallocate all the internal decompression state. + The stream will keep attributes that may have been set by inflateInit2. + + inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being NULL). +*/ + + + /* utility functions */ + +/* + The following utility functions are implemented on top of the + basic stream-oriented functions. To simplify the interface, some + default options are assumed (compression level and memory usage, + standard memory allocation functions). The source code of these + utility functions can easily be modified if you need special options. +*/ + +ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Compresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total + size of the destination buffer, which must be at least 0.1% larger than + sourceLen plus 12 bytes. Upon exit, destLen is the actual size of the + compressed buffer. + This function can be used to compress a whole file at once if the + input file is mmap'ed. + compress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer. +*/ + +ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen, + int level)); +/* + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least 0.1% larger than sourceLen plus + 12 bytes. Upon exit, destLen is the actual size of the compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. +*/ + +ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total + size of the destination buffer, which must be large enough to hold the + entire uncompressed data. (The size of the uncompressed data must have + been saved previously by the compressor and transmitted to the decompressor + by some mechanism outside the scope of this compression library.) + Upon exit, destLen is the actual size of the compressed buffer. + This function can be used to decompress a whole file at once if the + input file is mmap'ed. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted. +*/ + + +typedef voidp gzFile; + +ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode)); +/* + Opens a gzip (.gz) file for reading or writing. The mode parameter + is as in fopen ("rb" or "wb") but can also include a compression level + ("wb9") or a strategy: 'f' for filtered data as in "wb6f", 'h' for + Huffman only compression as in "wb1h". (See the description + of deflateInit2 for more information about the strategy parameter.) + + gzopen can be used to read a file which is not in gzip format; in this + case gzread will directly read from the file without decompression. + + gzopen returns NULL if the file could not be opened or if there was + insufficient memory to allocate the (de)compression state; errno + can be checked to distinguish the two cases (if errno is zero, the + zlib error is Z_MEM_ERROR). */ + +ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode)); +/* + gzdopen() associates a gzFile with the file descriptor fd. File + descriptors are obtained from calls like open, dup, creat, pipe or + fileno (in the file has been previously opened with fopen). + The mode parameter is as in gzopen. + The next call of gzclose on the returned gzFile will also close the + file descriptor fd, just like fclose(fdopen(fd), mode) closes the file + descriptor fd. If you want to keep fd open, use gzdopen(dup(fd), mode). + gzdopen returns NULL if there was insufficient memory to allocate + the (de)compression state. +*/ + +ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy)); +/* + Dynamically update the compression level or strategy. See the description + of deflateInit2 for the meaning of these parameters. + gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not + opened for writing. +*/ + +ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len)); +/* + Reads the given number of uncompressed bytes from the compressed file. + If the input file was not in gzip format, gzread copies the given number + of bytes into the buffer. + gzread returns the number of uncompressed bytes actually read (0 for + end of file, -1 for error). */ + +ZEXTERN int ZEXPORT gzwrite OF((gzFile file, + const voidp buf, unsigned len)); +/* + Writes the given number of uncompressed bytes into the compressed file. + gzwrite returns the number of uncompressed bytes actually written + (0 in case of error). +*/ + +ZEXTERN int ZEXPORTVA gzprintf OF((gzFile file, const char *format, ...)); +/* + Converts, formats, and writes the args to the compressed file under + control of the format string, as in fprintf. gzprintf returns the number of + uncompressed bytes actually written (0 in case of error). +*/ + +ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s)); +/* + Writes the given null-terminated string to the compressed file, excluding + the terminating null character. + gzputs returns the number of characters written, or -1 in case of error. +*/ + +ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len)); +/* + Reads bytes from the compressed file until len-1 characters are read, or + a newline character is read and transferred to buf, or an end-of-file + condition is encountered. The string is then terminated with a null + character. + gzgets returns buf, or Z_NULL in case of error. +*/ + +ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c)); +/* + Writes c, converted to an unsigned char, into the compressed file. + gzputc returns the value that was written, or -1 in case of error. +*/ + +ZEXTERN int ZEXPORT gzgetc OF((gzFile file)); +/* + Reads one byte from the compressed file. gzgetc returns this byte + or -1 in case of end of file or error. +*/ + +ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush)); +/* + Flushes all pending output into the compressed file. The parameter + flush is as in the deflate() function. The return value is the zlib + error number (see function gzerror below). gzflush returns Z_OK if + the flush parameter is Z_FINISH and all output could be flushed. + gzflush should be called only when strictly necessary because it can + degrade compression. +*/ + +ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file, + z_off_t offset, int whence)); +/* + Sets the starting position for the next gzread or gzwrite on the + given compressed file. The offset represents a number of bytes in the + uncompressed data stream. The whence parameter is defined as in lseek(2); + the value SEEK_END is not supported. + If the file is opened for reading, this function is emulated but can be + extremely slow. If the file is opened for writing, only forward seeks are + supported; gzseek then compresses a sequence of zeroes up to the new + starting position. + + gzseek returns the resulting offset location as measured in bytes from + the beginning of the uncompressed stream, or -1 in case of error, in + particular if the file is opened for writing and the new starting position + would be before the current position. +*/ + +ZEXTERN int ZEXPORT gzrewind OF((gzFile file)); +/* + Rewinds the given file. This function is supported only for reading. + + gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET) +*/ + +ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file)); +/* + Returns the starting position for the next gzread or gzwrite on the + given compressed file. This position represents a number of bytes in the + uncompressed data stream. + + gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR) +*/ + +ZEXTERN int ZEXPORT gzeof OF((gzFile file)); +/* + Returns 1 when EOF has previously been detected reading the given + input stream, otherwise zero. +*/ + +ZEXTERN int ZEXPORT gzclose OF((gzFile file)); +/* + Flushes all pending output if necessary, closes the compressed file + and deallocates all the (de)compression state. The return value is the zlib + error number (see function gzerror below). +*/ + +ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum)); +/* + Returns the error message for the last error which occurred on the + given compressed file. errnum is set to zlib error number. If an + error occurred in the file system and not in the compression library, + errnum is set to Z_ERRNO and the application may consult errno + to get the exact error code. +*/ + + /* checksum functions */ + +/* + These functions are not related to compression but are exported + anyway because they might be useful in applications using the + compression library. +*/ + +ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len)); + +/* + Update a running Adler-32 checksum with the bytes buf[0..len-1] and + return the updated checksum. If buf is NULL, this function returns + the required initial value for the checksum. + An Adler-32 checksum is almost as reliable as a CRC32 but can be computed + much faster. Usage example: + + uLong adler = adler32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + adler = adler32(adler, buffer, length); + } + if (adler != original_adler) error(); +*/ + +ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len)); +/* + Update a running crc with the bytes buf[0..len-1] and return the updated + crc. If buf is NULL, this function returns the required initial value + for the crc. Pre- and post-conditioning (one's complement) is performed + within this function so it shouldn't be done by the application. + Usage example: + + uLong crc = crc32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + crc = crc32(crc, buffer, length); + } + if (crc != original_crc) error(); +*/ + + + /* various hacks, don't look :) */ + +/* deflateInit and inflateInit are macros to allow checking the zlib version + * and the compiler's view of z_stream: + */ +ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method, + int windowBits, int memLevel, + int strategy, const char *version, + int stream_size)); +ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits, + const char *version, int stream_size)); +#define deflateInit(strm, level) \ + deflateInit_((strm), (level), ZLIB_VERSION, sizeof(z_stream)) +#define inflateInit(strm) \ + inflateInit_((strm), ZLIB_VERSION, sizeof(z_stream)) +#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \ + deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\ + (strategy), ZLIB_VERSION, sizeof(z_stream)) +#define inflateInit2(strm, windowBits) \ + inflateInit2_((strm), (windowBits), ZLIB_VERSION, sizeof(z_stream)) + + +#if !defined(_Z_UTIL_H) && !defined(NO_DUMMY_DECL) + struct internal_state {int dummy;}; /* hack for buggy compilers */ +#endif + +ZEXTERN const char * ZEXPORT zError OF((int err)); +ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp z)); +ZEXTERN const uLongf * ZEXPORT get_crc_table OF((void)); + +#ifdef __cplusplus +} +#endif + +#endif /* _ZLIB_H */ diff --git a/zlib/zutil.c b/zlib/zutil.c new file mode 100644 index 0000000..b3de4e8 --- /dev/null +++ b/zlib/zutil.c @@ -0,0 +1,225 @@ +/* zutil.c -- target dependent utility functions for the compression library + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include "zutil.h" + +struct internal_state {int dummy;}; /* for buggy compilers */ + +#ifndef STDC +extern void exit OF((int)); +#endif + +const char *z_errmsg[10] = { +"need dictionary", /* Z_NEED_DICT 2 */ +"stream end", /* Z_STREAM_END 1 */ +"", /* Z_OK 0 */ +"file error", /* Z_ERRNO (-1) */ +"stream error", /* Z_STREAM_ERROR (-2) */ +"data error", /* Z_DATA_ERROR (-3) */ +"insufficient memory", /* Z_MEM_ERROR (-4) */ +"buffer error", /* Z_BUF_ERROR (-5) */ +"incompatible version",/* Z_VERSION_ERROR (-6) */ +""}; + + +const char * ZEXPORT zlibVersion() +{ + return ZLIB_VERSION; +} + +#ifdef DEBUG + +# ifndef verbose +# define verbose 0 +# endif +int z_verbose = verbose; + +void z_error (m) + char *m; +{ + fprintf(stderr, "%s\n", m); + exit(1); +} +#endif + +/* exported to allow conversion of error code to string for compress() and + * uncompress() + */ +const char * ZEXPORT zError(err) + int err; +{ + return ERR_MSG(err); +} + + +#ifndef HAVE_MEMCPY + +void zmemcpy(dest, source, len) + Bytef* dest; + const Bytef* source; + uInt len; +{ + if (len == 0) return; + do { + *dest++ = *source++; /* ??? to be unrolled */ + } while (--len != 0); +} + +int zmemcmp(s1, s2, len) + const Bytef* s1; + const Bytef* s2; + uInt len; +{ + uInt j; + + for (j = 0; j < len; j++) { + if (s1[j] != s2[j]) return 2*(s1[j] > s2[j])-1; + } + return 0; +} + +void zmemzero(dest, len) + Bytef* dest; + uInt len; +{ + if (len == 0) return; + do { + *dest++ = 0; /* ??? to be unrolled */ + } while (--len != 0); +} +#endif + +#ifdef __TURBOC__ +#if (defined( __BORLANDC__) || !defined(SMALL_MEDIUM)) && !defined(__32BIT__) +/* Small and medium model in Turbo C are for now limited to near allocation + * with reduced MAX_WBITS and MAX_MEM_LEVEL + */ +# define MY_ZCALLOC + +/* Turbo C malloc() does not allow dynamic allocation of 64K bytes + * and farmalloc(64K) returns a pointer with an offset of 8, so we + * must fix the pointer. Warning: the pointer must be put back to its + * original form in order to free it, use zcfree(). + */ + +#define MAX_PTR 10 +/* 10*64K = 640K */ + +local int next_ptr = 0; + +typedef struct ptr_table_s { + voidpf org_ptr; + voidpf new_ptr; +} ptr_table; + +local ptr_table table[MAX_PTR]; +/* This table is used to remember the original form of pointers + * to large buffers (64K). Such pointers are normalized with a zero offset. + * Since MSDOS is not a preemptive multitasking OS, this table is not + * protected from concurrent access. This hack doesn't work anyway on + * a protected system like OS/2. Use Microsoft C instead. + */ + +voidpf zcalloc (voidpf opaque, unsigned items, unsigned size) +{ + voidpf buf = opaque; /* just to make some compilers happy */ + ulg bsize = (ulg)items*size; + + /* If we allocate less than 65520 bytes, we assume that farmalloc + * will return a usable pointer which doesn't have to be normalized. + */ + if (bsize < 65520L) { + buf = farmalloc(bsize); + if (*(ush*)&buf != 0) return buf; + } else { + buf = farmalloc(bsize + 16L); + } + if (buf == NULL || next_ptr >= MAX_PTR) return NULL; + table[next_ptr].org_ptr = buf; + + /* Normalize the pointer to seg:0 */ + *((ush*)&buf+1) += ((ush)((uch*)buf-0) + 15) >> 4; + *(ush*)&buf = 0; + table[next_ptr++].new_ptr = buf; + return buf; +} + +void zcfree (voidpf opaque, voidpf ptr) +{ + int n; + if (*(ush*)&ptr != 0) { /* object < 64K */ + farfree(ptr); + return; + } + /* Find the original pointer */ + for (n = 0; n < next_ptr; n++) { + if (ptr != table[n].new_ptr) continue; + + farfree(table[n].org_ptr); + while (++n < next_ptr) { + table[n-1] = table[n]; + } + next_ptr--; + return; + } + ptr = opaque; /* just to make some compilers happy */ + Assert(0, "zcfree: ptr not found"); +} +#endif +#endif /* __TURBOC__ */ + + +#if defined(M_I86) && !defined(__32BIT__) +/* Microsoft C in 16-bit mode */ + +# define MY_ZCALLOC + +#if (!defined(_MSC_VER) || (_MSC_VER <= 600)) +# define _halloc halloc +# define _hfree hfree +#endif + +voidpf zcalloc (voidpf opaque, unsigned items, unsigned size) +{ + if (opaque) opaque = 0; /* to make compiler happy */ + return _halloc((long)items, size); +} + +void zcfree (voidpf opaque, voidpf ptr) +{ + if (opaque) opaque = 0; /* to make compiler happy */ + _hfree(ptr); +} + +#endif /* MSC */ + + +#ifndef MY_ZCALLOC /* Any system without a special alloc function */ + +#ifndef STDC +extern voidp calloc OF((uInt items, uInt size)); +extern void free OF((voidpf ptr)); +#endif + +voidpf zcalloc (opaque, items, size) + voidpf opaque; + unsigned items; + unsigned size; +{ + if (opaque) items += size - size; /* make compiler happy */ + return (voidpf)calloc(items, size); +} + +void zcfree (opaque, ptr) + voidpf opaque; + voidpf ptr; +{ + free(ptr); + if (opaque) return; /* make compiler happy */ +} + +#endif /* MY_ZCALLOC */ diff --git a/zlib/zutil.h b/zlib/zutil.h new file mode 100644 index 0000000..6f2cb97 --- /dev/null +++ b/zlib/zutil.h @@ -0,0 +1,220 @@ +/* zutil.h -- internal interface and configuration of the compression library + * Copyright (C) 1995-1998 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* @(#) $Id$ */ + +#ifndef _Z_UTIL_H +#define _Z_UTIL_H + +#include "zlib.h" + +#ifdef STDC +# include +# include +# include +#endif +#ifdef NO_ERRNO_H + extern int errno; +#else +# include +#endif + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + +typedef unsigned char uch; +typedef uch FAR uchf; +typedef unsigned short ush; +typedef ush FAR ushf; +typedef unsigned long ulg; + +extern const char *z_errmsg[10]; /* indexed by 2-zlib_error */ +/* (size given to avoid silly warnings with Visual C++) */ + +#define ERR_MSG(err) z_errmsg[Z_NEED_DICT-(err)] + +#define ERR_RETURN(strm,err) \ + return (strm->msg = (char*)ERR_MSG(err), (err)) +/* To be used only when the state is known to be valid */ + + /* common constants */ + +#ifndef DEF_WBITS +# define DEF_WBITS MAX_WBITS +#endif +/* default windowBits for decompression. MAX_WBITS is for compression only */ + +#if MAX_MEM_LEVEL >= 8 +# define DEF_MEM_LEVEL 8 +#else +# define DEF_MEM_LEVEL MAX_MEM_LEVEL +#endif +/* default memLevel */ + +#define STORED_BLOCK 0 +#define STATIC_TREES 1 +#define DYN_TREES 2 +/* The three kinds of block type */ + +#define MIN_MATCH 3 +#define MAX_MATCH 258 +/* The minimum and maximum match lengths */ + +#define PRESET_DICT 0x20 /* preset dictionary flag in zlib header */ + + /* target dependencies */ + +#ifdef MSDOS +# define OS_CODE 0x00 +# if defined(__TURBOC__) || defined(__BORLANDC__) +# if(__STDC__ == 1) && (defined(__LARGE__) || defined(__COMPACT__)) + /* Allow compilation with ANSI keywords only enabled */ + void _Cdecl farfree( void *block ); + void *_Cdecl farmalloc( unsigned long nbytes ); +# else +# include +# endif +# else /* MSC or DJGPP */ +# include +# endif +#endif + +#ifdef OS2 +# define OS_CODE 0x06 +#endif + +#ifdef WIN32 /* Window 95 & Windows NT */ +# define OS_CODE 0x0b +#endif + +#if defined(VAXC) || defined(VMS) +# define OS_CODE 0x02 +# define F_OPEN(name, mode) \ + fopen((name), (mode), "mbc=60", "ctx=stm", "rfm=fix", "mrs=512") +#endif + +#ifdef AMIGA +# define OS_CODE 0x01 +#endif + +#if defined(ATARI) || defined(atarist) +# define OS_CODE 0x05 +#endif + +#if defined(MACOS) || defined(TARGET_OS_MAC) +# define OS_CODE 0x07 +# if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os +# include /* for fdopen */ +# else +# ifndef fdopen +# define fdopen(fd,mode) NULL /* No fdopen() */ +# endif +# endif +#endif + +#ifdef __50SERIES /* Prime/PRIMOS */ +# define OS_CODE 0x0F +#endif + +#ifdef TOPS20 +# define OS_CODE 0x0a +#endif + +#if defined(_BEOS_) || defined(RISCOS) +# define fdopen(fd,mode) NULL /* No fdopen() */ +#endif + +#if (defined(_MSC_VER) && (_MSC_VER > 600)) +# define fdopen(fd,type) _fdopen(fd,type) +#endif + + + /* Common defaults */ + +#ifndef OS_CODE +# define OS_CODE 0x03 /* assume Unix */ +#endif + +#ifndef F_OPEN +# define F_OPEN(name, mode) fopen((name), (mode)) +#endif + + /* functions */ + +#ifdef HAVE_STRERROR + extern char *strerror OF((int)); +# define zstrerror(errnum) strerror(errnum) +#else +# define zstrerror(errnum) "" +#endif + +#if defined(pyr) +# define NO_MEMCPY +#endif +#if defined(SMALL_MEDIUM) && !defined(_MSC_VER) && !defined(__SC__) + /* Use our own functions for small and medium model with MSC <= 5.0. + * You may have to use the same strategy for Borland C (untested). + * The __SC__ check is for Symantec. + */ +# define NO_MEMCPY +#endif +#if defined(STDC) && !defined(HAVE_MEMCPY) && !defined(NO_MEMCPY) +# define HAVE_MEMCPY +#endif +#ifdef HAVE_MEMCPY +# ifdef SMALL_MEDIUM /* MSDOS small or medium model */ +# define zmemcpy _fmemcpy +# define zmemcmp _fmemcmp +# define zmemzero(dest, len) _fmemset(dest, 0, len) +# else +# define zmemcpy memcpy +# define zmemcmp memcmp +# define zmemzero(dest, len) memset(dest, 0, len) +# endif +#else + extern void zmemcpy OF((Bytef* dest, const Bytef* source, uInt len)); + extern int zmemcmp OF((const Bytef* s1, const Bytef* s2, uInt len)); + extern void zmemzero OF((Bytef* dest, uInt len)); +#endif + +/* Diagnostic functions */ +#ifdef DEBUG +# include + extern int z_verbose; + extern void z_error OF((char *m)); +# define Assert(cond,msg) {if(!(cond)) z_error(msg);} +# define Trace(x) {if (z_verbose>=0) fprintf x ;} +# define Tracev(x) {if (z_verbose>0) fprintf x ;} +# define Tracevv(x) {if (z_verbose>1) fprintf x ;} +# define Tracec(c,x) {if (z_verbose>0 && (c)) fprintf x ;} +# define Tracecv(c,x) {if (z_verbose>1 && (c)) fprintf x ;} +#else +# define Assert(cond,msg) +# define Trace(x) +# define Tracev(x) +# define Tracevv(x) +# define Tracec(c,x) +# define Tracecv(c,x) +#endif + + +typedef uLong (ZEXPORT *check_func) OF((uLong check, const Bytef *buf, + uInt len)); +voidpf zcalloc OF((voidpf opaque, unsigned items, unsigned size)); +void zcfree OF((voidpf opaque, voidpf ptr)); + +#define ZALLOC(strm, items, size) \ + (*((strm)->zalloc))((strm)->opaque, (items), (size)) +#define ZFREE(strm, addr) (*((strm)->zfree))((strm)->opaque, (voidpf)(addr)) +#define TRY_FREE(s, p) {if (p) ZFREE(s, p);} + +#endif /* _Z_UTIL_H */ -- 2.7.4