--- /dev/null
+
+
+0.9.0
+~~~~~
+First version.
+
+
+0.9.0a
+~~~~~~
+Removed 'ranlib' from Makefile, since most modern Unix-es
+don't need it, or even know about it.
+
+
+0.9.0b
+~~~~~~
+Fixed a problem with error reporting in bzip2.c. This does not effect
+the library in any way. Problem is: versions 0.9.0 and 0.9.0a (of the
+program proper) compress and decompress correctly, but give misleading
+error messages (internal panics) when an I/O error occurs, instead of
+reporting the problem correctly. This shouldn't give any data loss
+(as far as I can see), but is confusing.
+
+Made the inline declarations disappear for non-GCC compilers.
+
+
+0.9.0c
+~~~~~~
+Fixed some problems in the library pertaining to some boundary cases.
+This makes the library behave more correctly in those situations. The
+fixes apply only to features (calls and parameters) not used by
+bzip2.c, so the non-fixedness of them in previous versions has no
+effect on reliability of bzip2.c.
+
+In bzlib.c:
+ * made zero-length BZ_FLUSH work correctly in bzCompress().
+ * fixed bzWrite/bzRead to ignore zero-length requests.
+ * fixed bzread to correctly handle read requests after EOF.
+ * wrong parameter order in call to bzDecompressInit in
+ bzBuffToBuffDecompress. Fixed.
+
+In compress.c:
+ * changed setting of nGroups in sendMTFValues() so as to
+ do a bit better on small files. This _does_ effect
+ bzip2.c.
+
+
+0.9.5a
+~~~~~~
+Major change: add a fallback sorting algorithm (blocksort.c)
+to give reasonable behaviour even for very repetitive inputs.
+Nuked --repetitive-best and --repetitive-fast since they are
+no longer useful.
+
+Minor changes: mostly a whole bunch of small changes/
+bugfixes in the driver (bzip2.c). Changes pertaining to the
+user interface are:
+
+ allow decompression of symlink'd files to stdout
+ decompress/test files even without .bz2 extension
+ give more accurate error messages for I/O errors
+ when compressing/decompressing to stdout, don't catch control-C
+ read flags from BZIP2 and BZIP environment variables
+ decline to break hard links to a file unless forced with -f
+ allow -c flag even with no filenames
+ preserve file ownerships as far as possible
+ make -s -1 give the expected block size (100k)
+ add a flag -q --quiet to suppress nonessential warnings
+ stop decoding flags after --, so files beginning in - can be handled
+ resolved inconsistent naming: bzcat or bz2cat ?
+ bzip2 --help now returns 0
+
+Programming-level changes are:
+
+ fixed syntax error in GET_LL4 for Borland C++ 5.02
+ let bzBuffToBuffDecompress return BZ_DATA_ERROR{_MAGIC}
+ fix overshoot of mode-string end in bzopen_or_bzdopen
+ wrapped bzlib.h in #ifdef __cplusplus ... extern "C" { ... }
+ close file handles under all error conditions
+ added minor mods so it compiles with DJGPP out of the box
+ fixed Makefile so it doesn't give problems with BSD make
+ fix uninitialised memory reads in dlltest.c
+
+0.9.5b
+~~~~~~
+Open stdin/stdout in binary mode for DJGPP.
+
+0.9.5c
+~~~~~~
+Changed BZ_N_OVERSHOOT to be ... + 2 instead of ... + 1. The + 1
+version could cause the sorted order to be wrong in some extremely
+obscure cases. Also changed setting of quadrant in blocksort.c.
+
+0.9.5d
+~~~~~~
+The only functional change is to make bzlibVersion() in the library
+return the correct string. This has no effect whatsoever on the
+functioning of the bzip2 program or library. Added a couple of casts
+so the library compiles without warnings at level 3 in MS Visual
+Studio 6.0. Included a Y2K statement in the file Y2K_INFO. All other
+changes are minor documentation changes.
+
+1.0
+~~~
+Several minor bugfixes and enhancements:
+
+* Large file support. The library uses 64-bit counters to
+ count the volume of data passing through it. bzip2.c
+ is now compiled with -D_FILE_OFFSET_BITS=64 to get large
+ file support from the C library. -v correctly prints out
+ file sizes greater than 4 gigabytes. All these changes have
+ been made without assuming a 64-bit platform or a C compiler
+ which supports 64-bit ints, so, except for the C library
+ aspect, they are fully portable.
+
+* Decompression robustness. The library/program should be
+ robust to any corruption of compressed data, detecting and
+ handling _all_ corruption, instead of merely relying on
+ the CRCs. What this means is that the program should
+ never crash, given corrupted data, and the library should
+ always return BZ_DATA_ERROR.
+
+* Fixed an obscure race-condition bug only ever observed on
+ Solaris, in which, if you were very unlucky and issued
+ control-C at exactly the wrong time, both input and output
+ files would be deleted.
+
+* Don't run out of file handles on test/decompression when
+ large numbers of files have invalid magic numbers.
+
+* Avoid library namespace pollution. Prefix all exported
+ symbols with BZ2_.
+
+* Minor sorting enhancements from my DCC2000 paper.
+
+* Advance the version number to 1.0, so as to counteract the
+ (false-in-this-case) impression some people have that programs
+ with version numbers less than 1.0 are in someway, experimental,
+ pre-release versions.
+
+* Create an initial Makefile-libbz2_so to build a shared library.
+ Yes, I know I should really use libtool et al ...
+
+* Make the program exit with 2 instead of 0 when decompression
+ fails due to a bad magic number (ie, an invalid bzip2 header).
+ Also exit with 1 (as the manual claims :-) whenever a diagnostic
+ message would have been printed AND the corresponding operation
+ is aborted, for example
+ bzip2: Output file xx already exists.
+ When a diagnostic message is printed but the operation is not
+ aborted, for example
+ bzip2: Can't guess original name for wurble -- using wurble.out
+ then the exit value 0 is returned, unless some other problem is
+ also detected.
+
+ I think it corresponds more closely to what the manual claims now.
+
+
+1.0.1
+~~~~~
+* Modified dlltest.c so it uses the new BZ2_ naming scheme.
+* Modified makefile-msc to fix minor build probs on Win2k.
+* Updated README.COMPILATION.PROBLEMS.
+
+There are no functionality changes or bug fixes relative to version
+1.0.0. This is just a documentation update + a fix for minor Win32
+build problems. For almost everyone, upgrading from 1.0.0 to 1.0.1 is
+utterly pointless. Don't bother.
--- /dev/null
+
+This program, "bzip2" and associated library "libbzip2", are
+copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+
+1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+Julian Seward, Cambridge, UK.
+jseward@acm.org
+bzip2/libbzip2 version 1.0 of 21 March 2000
+
--- /dev/null
+
+SHELL=/bin/sh
+CC=gcc
+BIGFILES=-D_FILE_OFFSET_BITS=64
+CFLAGS=-Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES)
+
+OBJS= blocksort.o \
+ huffman.o \
+ crctable.o \
+ randtable.o \
+ compress.o \
+ decompress.o \
+ bzlib.o
+
+all: libbz2.a bzip2 bzip2recover test
+
+bzip2: libbz2.a bzip2.o
+ $(CC) $(CFLAGS) -o bzip2 bzip2.o -L. -lbz2
+
+bzip2recover: bzip2recover.o
+ $(CC) $(CFLAGS) -o bzip2recover bzip2recover.o
+
+libbz2.a: $(OBJS)
+ rm -f libbz2.a
+ ar cq libbz2.a $(OBJS)
+ @if ( test -f /usr/bin/ranlib -o -f /bin/ranlib -o \
+ -f /usr/ccs/bin/ranlib ) ; then \
+ echo ranlib libbz2.a ; \
+ ranlib libbz2.a ; \
+ fi
+
+test: bzip2
+ @cat words1
+ ./bzip2 -1 < sample1.ref > sample1.rb2
+ ./bzip2 -2 < sample2.ref > sample2.rb2
+ ./bzip2 -3 < sample3.ref > sample3.rb2
+ ./bzip2 -d < sample1.bz2 > sample1.tst
+ ./bzip2 -d < sample2.bz2 > sample2.tst
+ ./bzip2 -ds < sample3.bz2 > sample3.tst
+ cmp sample1.bz2 sample1.rb2
+ cmp sample2.bz2 sample2.rb2
+ cmp sample3.bz2 sample3.rb2
+ cmp sample1.tst sample1.ref
+ cmp sample2.tst sample2.ref
+ cmp sample3.tst sample3.ref
+ @cat words3
+
+PREFIX=/usr
+
+install: bzip2 bzip2recover
+ if ( test ! -d $(PREFIX)/bin ) ; then mkdir $(PREFIX)/bin ; fi
+ if ( test ! -d $(PREFIX)/lib ) ; then mkdir $(PREFIX)/lib ; fi
+ if ( test ! -d $(PREFIX)/man ) ; then mkdir $(PREFIX)/man ; fi
+ if ( test ! -d $(PREFIX)/man/man1 ) ; then mkdir $(PREFIX)/man/man1 ; fi
+ if ( test ! -d $(PREFIX)/include ) ; then mkdir $(PREFIX)/include ; fi
+ cp -f bzip2 $(PREFIX)/bin/bzip2
+ cp -f bzip2 $(PREFIX)/bin/bunzip2
+ cp -f bzip2 $(PREFIX)/bin/bzcat
+ cp -f bzip2recover $(PREFIX)/bin/bzip2recover
+ chmod a+x $(PREFIX)/bin/bzip2
+ chmod a+x $(PREFIX)/bin/bunzip2
+ chmod a+x $(PREFIX)/bin/bzcat
+ chmod a+x $(PREFIX)/bin/bzip2recover
+ cp -f bzip2.1 $(PREFIX)/man/man1
+ chmod a+r $(PREFIX)/man/man1/bzip2.1
+ cp -f bzlib.h $(PREFIX)/include
+ chmod a+r $(PREFIX)/include/bzlib.h
+ cp -f libbz2.a $(PREFIX)/lib
+ chmod a+r $(PREFIX)/lib/libbz2.a
+
+clean:
+ rm -f *.o libbz2.a bzip2 bzip2recover \
+ sample1.rb2 sample2.rb2 sample3.rb2 \
+ sample1.tst sample2.tst sample3.tst
+
+blocksort.o: blocksort.c
+ @cat words0
+ $(CC) $(CFLAGS) -c blocksort.c
+huffman.o: huffman.c
+ $(CC) $(CFLAGS) -c huffman.c
+crctable.o: crctable.c
+ $(CC) $(CFLAGS) -c crctable.c
+randtable.o: randtable.c
+ $(CC) $(CFLAGS) -c randtable.c
+compress.o: compress.c
+ $(CC) $(CFLAGS) -c compress.c
+decompress.o: decompress.c
+ $(CC) $(CFLAGS) -c decompress.c
+bzlib.o: bzlib.c
+ $(CC) $(CFLAGS) -c bzlib.c
+bzip2.o: bzip2.c
+ $(CC) $(CFLAGS) -c bzip2.c
+bzip2recover.o: bzip2recover.c
+ $(CC) $(CFLAGS) -c bzip2recover.c
+
+DISTNAME=bzip2-1.0.1
+tarfile:
+ rm -f $(DISTNAME)
+ ln -sf . $(DISTNAME)
+ tar cvf $(DISTNAME).tar \
+ $(DISTNAME)/blocksort.c \
+ $(DISTNAME)/huffman.c \
+ $(DISTNAME)/crctable.c \
+ $(DISTNAME)/randtable.c \
+ $(DISTNAME)/compress.c \
+ $(DISTNAME)/decompress.c \
+ $(DISTNAME)/bzlib.c \
+ $(DISTNAME)/bzip2.c \
+ $(DISTNAME)/bzip2recover.c \
+ $(DISTNAME)/bzlib.h \
+ $(DISTNAME)/bzlib_private.h \
+ $(DISTNAME)/Makefile \
+ $(DISTNAME)/manual.texi \
+ $(DISTNAME)/manual.ps \
+ $(DISTNAME)/LICENSE \
+ $(DISTNAME)/bzip2.1 \
+ $(DISTNAME)/bzip2.1.preformatted \
+ $(DISTNAME)/bzip2.txt \
+ $(DISTNAME)/words0 \
+ $(DISTNAME)/words1 \
+ $(DISTNAME)/words2 \
+ $(DISTNAME)/words3 \
+ $(DISTNAME)/sample1.ref \
+ $(DISTNAME)/sample2.ref \
+ $(DISTNAME)/sample3.ref \
+ $(DISTNAME)/sample1.bz2 \
+ $(DISTNAME)/sample2.bz2 \
+ $(DISTNAME)/sample3.bz2 \
+ $(DISTNAME)/dlltest.c \
+ $(DISTNAME)/*.html \
+ $(DISTNAME)/README \
+ $(DISTNAME)/README.COMPILATION.PROBLEMS \
+ $(DISTNAME)/CHANGES \
+ $(DISTNAME)/libbz2.def \
+ $(DISTNAME)/libbz2.dsp \
+ $(DISTNAME)/dlltest.dsp \
+ $(DISTNAME)/makefile.msc \
+ $(DISTNAME)/Y2K_INFO \
+ $(DISTNAME)/unzcrash.c \
+ $(DISTNAME)/spewG.c \
+ $(DISTNAME)/Makefile-libbz2_so
--- /dev/null
+
+# This Makefile builds a shared version of the library,
+# libbz2.so.1.0.1, with soname libbz2.so.1.0,
+# at least on x86-Linux (RedHat 5.2),
+# with gcc-2.7.2.3. Please see the README file for some
+# important info about building the library like this.
+
+SHELL=/bin/sh
+CC=gcc
+BIGFILES=-D_FILE_OFFSET_BITS=64
+CFLAGS=-fpic -fPIC -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES)
+
+OBJS= blocksort.o \
+ huffman.o \
+ crctable.o \
+ randtable.o \
+ compress.o \
+ decompress.o \
+ bzlib.o
+
+all: $(OBJS)
+ $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS)
+ $(CC) $(CFLAGS) -o bzip2-shared bzip2.c libbz2.so.1.0.1
+ rm -f libbz2.so.1.0
+ ln -s libbz2.so.1.0.1 libbz2.so.1.0
+
+clean:
+ rm -f $(OBJS) bzip2.o libbz2.so.1.0.1 libbz2.so.1.0 bzip2-shared
+
+blocksort.o: blocksort.c
+ $(CC) $(CFLAGS) -c blocksort.c
+huffman.o: huffman.c
+ $(CC) $(CFLAGS) -c huffman.c
+crctable.o: crctable.c
+ $(CC) $(CFLAGS) -c crctable.c
+randtable.o: randtable.c
+ $(CC) $(CFLAGS) -c randtable.c
+compress.o: compress.c
+ $(CC) $(CFLAGS) -c compress.c
+decompress.o: decompress.c
+ $(CC) $(CFLAGS) -c decompress.c
+bzlib.o: bzlib.c
+ $(CC) $(CFLAGS) -c bzlib.c
--- /dev/null
+
+This is the README for bzip2, a block-sorting file compressor, version
+1.0. This version is fully compatible with the previous public
+releases, bzip2-0.1pl2, bzip2-0.9.0 and bzip2-0.9.5.
+
+bzip2-1.0 is distributed under a BSD-style license. For details,
+see the file LICENSE.
+
+Complete documentation is available in Postscript form (manual.ps) or
+html (manual_toc.html). A plain-text version of the manual page is
+available as bzip2.txt. A statement about Y2K issues is now included
+in the file Y2K_INFO.
+
+
+HOW TO BUILD -- UNIX
+
+Type `make'. This builds the library libbz2.a and then the
+programs bzip2 and bzip2recover. Six self-tests are run.
+If the self-tests complete ok, carry on to installation:
+
+To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type
+ make install
+To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type
+ make install PREFIX=/xxx/yyy
+If you are (justifiably) paranoid and want to see what 'make install'
+is going to do, you can first do
+ make -n install or
+ make -n install PREFIX=/xxx/yyy respectively.
+The -n instructs make to show the commands it would execute, but
+not actually execute them.
+
+
+HOW TO BUILD -- UNIX, shared library libbz2.so.
+
+Do 'make -f Makefile-libbz2_so'. This Makefile seems to work for
+Linux-ELF (RedHat 5.2 on an x86 box), with gcc. I make no claims
+that it works for any other platform, though I suspect it probably
+will work for most platforms employing both ELF and gcc.
+
+bzip2-shared, a client of the shared library, is also build, but
+not self-tested. So I suggest you also build using the normal
+Makefile, since that conducts a self-test.
+
+Important note for people upgrading .so's from 0.9.0/0.9.5 to
+version 1.0. All the functions in the library have been renamed,
+from (eg) bzCompress to BZ2_bzCompress, to avoid namespace pollution.
+Unfortunately this means that the libbz2.so created by
+Makefile-libbz2_so will not work with any program which used an
+older version of the library. Sorry. I do encourage library
+clients to make the effort to upgrade to use version 1.0, since
+it is both faster and more robust than previous versions.
+
+
+HOW TO BUILD -- Windows 95, NT, DOS, Mac, etc.
+
+It's difficult for me to support compilation on all these platforms.
+My approach is to collect binaries for these platforms, and put them
+on the master web page (http://sourceware.cygnus.com/bzip2). Look
+there. However (FWIW), bzip2-1.0 is very standard ANSI C and should
+compile unmodified with MS Visual C. For Win32, there is one
+important caveat: in bzip2.c, you must set BZ_UNIX to 0 and
+BZ_LCCWIN32 to 1 before building. If you have difficulties building,
+you might want to read README.COMPILATION.PROBLEMS.
+
+
+VALIDATION
+
+Correct operation, in the sense that a compressed file can always be
+decompressed to reproduce the original, is obviously of paramount
+importance. To validate bzip2, I used a modified version of Mark
+Nelson's churn program. Churn is an automated test driver which
+recursively traverses a directory structure, using bzip2 to compress
+and then decompress each file it encounters, and checking that the
+decompressed data is the same as the original. There are more details
+in Section 4 of the user guide.
+
+
+
+Please read and be aware of the following:
+
+WARNING:
+
+ This program (attempts to) compress data by performing several
+ non-trivial transformations on it. Unless you are 100% familiar
+ with *all* the algorithms contained herein, and with the
+ consequences of modifying them, you should NOT meddle with the
+ compression or decompression machinery. Incorrect changes can and
+ very likely *will* lead to disastrous loss of data.
+
+
+DISCLAIMER:
+
+ I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE
+ USE OF THIS PROGRAM, HOWSOEVER CAUSED.
+
+ Every compression of a file implies an assumption that the
+ compressed file can be decompressed to reproduce the original.
+ Great efforts in design, coding and testing have been made to
+ ensure that this program works correctly. However, the complexity
+ of the algorithms, and, in particular, the presence of various
+ special cases in the code which occur with very low but non-zero
+ probability make it impossible to rule out the possibility of bugs
+ remaining in the program. DO NOT COMPRESS ANY DATA WITH THIS
+ PROGRAM UNLESS YOU ARE PREPARED TO ACCEPT THE POSSIBILITY, HOWEVER
+ SMALL, THAT THE DATA WILL NOT BE RECOVERABLE.
+
+ That is not to say this program is inherently unreliable. Indeed,
+ I very much hope the opposite is true. bzip2 has been carefully
+ constructed and extensively tested.
+
+
+PATENTS:
+
+ To the best of my knowledge, bzip2 does not use any patented
+ algorithms. However, I do not have the resources available to
+ carry out a full patent search. Therefore I cannot give any
+ guarantee of the above statement.
+
+End of legalities.
+
+
+WHAT'S NEW IN 0.9.0 (as compared to 0.1pl2) ?
+
+ * Approx 10% faster compression, 30% faster decompression
+ * -t (test mode) is a lot quicker
+ * Can decompress concatenated compressed files
+ * Programming interface, so programs can directly read/write .bz2 files
+ * Less restrictive (BSD-style) licensing
+ * Flag handling more compatible with GNU gzip
+ * Much more documentation, i.e., a proper user manual
+ * Hopefully, improved portability (at least of the library)
+
+WHAT'S NEW IN 0.9.5 ?
+
+ * Compression speed is much less sensitive to the input
+ data than in previous versions. Specifically, the very
+ slow performance caused by repetitive data is fixed.
+ * Many small improvements in file and flag handling.
+ * A Y2K statement.
+
+WHAT'S NEW IN 1.0
+
+ See the CHANGES file.
+
+I hope you find bzip2 useful. Feel free to contact me at
+ jseward@acm.org
+if you have any suggestions or queries. Many people mailed me with
+comments, suggestions and patches after the releases of bzip-0.15,
+bzip-0.21, bzip2-0.1pl2 and bzip2-0.9.0, and the changes in bzip2 are
+largely a result of this feedback. I thank you for your comments.
+
+At least for the time being, bzip2's "home" is (or can be reached via)
+http://www.muraroa.demon.co.uk.
+
+Julian Seward
+jseward@acm.org
+
+Cambridge, UK
+18 July 1996 (version 0.15)
+25 August 1996 (version 0.21)
+ 7 August 1997 (bzip2, version 0.1)
+29 August 1997 (bzip2, version 0.1pl2)
+23 August 1998 (bzip2, version 0.9.0)
+ 8 June 1999 (bzip2, version 0.9.5)
+ 4 Sept 1999 (bzip2, version 0.9.5d)
+ 5 May 2000 (bzip2, version 1.0pre8)
--- /dev/null
+
+bzip2-1.0 should compile without problems on the vast majority of
+platforms. Using the supplied Makefile, I've built and tested it
+myself for x86-linux, sparc-solaris, alpha-linux, x86-cygwin32 and
+alpha-tru64unix. With makefile.msc, Visual C++ 6.0 and nmake, you can
+build a native Win32 version too. Large file support seems to work
+correctly on at least alpha-tru64unix and x86-cygwin32 (on Windows
+2000).
+
+When I say "large file" I mean a file of size 2,147,483,648 (2^31)
+bytes or above. Many older OSs can't handle files above this size,
+but many newer ones can. Large files are pretty huge -- most files
+you'll encounter are not Large Files.
+
+Earlier versions of bzip2 (0.1, 0.9.0, 0.9.5) compiled on a wide
+variety of platforms without difficulty, and I hope this version will
+continue in that tradition. However, in order to support large files,
+I've had to include the define -D_FILE_OFFSET_BITS=64 in the Makefile.
+This can cause problems.
+
+The technique of adding -D_FILE_OFFSET_BITS=64 to get large file
+support is, as far as I know, the Recommended Way to get correct large
+file support. For more details, see the Large File Support
+Specification, published by the Large File Summit, at
+ http://www.sas.com/standard/large.file/
+
+As a general comment, if you get compilation errors which you think
+are related to large file support, try removing the above define from
+the Makefile, ie, delete the line
+ BIGFILES=-D_FILE_OFFSET_BITS=64
+from the Makefile, and do 'make clean ; make'. This will give you a
+version of bzip2 without large file support, which, for most
+applications, is probably not a problem.
+
+Alternatively, try some of the platform-specific hints listed below.
+
+You can use the spewG.c program to generate huge files to test bzip2's
+large file support, if you are feeling paranoid. Be aware though that
+any compilation problems which affect bzip2 will also affect spewG.c,
+alas.
+
+
+Known problems as of 1.0pre8:
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+* HP/UX 10.20 and 11.00, using gcc (2.7.2.3 and 2.95.2): A large
+ number of warnings appear, including the following:
+
+ /usr/include/sys/resource.h: In function `getrlimit':
+ /usr/include/sys/resource.h:168:
+ warning: implicit declaration of function `__getrlimit64'
+ /usr/include/sys/resource.h: In function `setrlimit':
+ /usr/include/sys/resource.h:170:
+ warning: implicit declaration of function `__setrlimit64'
+
+ This would appear to be a problem with large file support, header
+ files and gcc. gcc may or may not give up at this point. If it
+ fails, you might be able to improve matters by adding
+ -D__STDC_EXT__=1
+ to the BIGFILES variable in the Makefile (ie, change its definition
+ to
+ BIGFILES=-D_FILE_OFFSET_BITS=64 -D__STDC_EXT__=1
+
+ Even if gcc does produce a binary which appears to work (ie passes
+ its self-tests), you might want to test it to see if it works properly
+ on large files.
+
+
+* HP/UX 10.20 and 11.00, using HP's cc compiler.
+
+ No specific problems for this combination, except that you'll need to
+ specify the -Ae flag, and zap the gcc-specific stuff
+ -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce.
+ You should retain -D_FILE_OFFSET_BITS=64 in order to get large
+ file support -- which is reported to work ok for this HP/UX + cc
+ combination.
+
+
+* SunOS 4.1.X.
+
+ Amazingly, there are still people out there using this venerable old
+ banger. I shouldn't be too rude -- I started life on SunOS, and
+ it was a pretty darn good OS, way back then. Anyway:
+
+ SunOS doesn't seem to have strerror(), so you'll have to use
+ perror(), perhaps by doing adding this (warning: UNTESTED CODE):
+
+ char* strerror ( int errnum )
+ {
+ if (errnum < 0 || errnum >= sys_nerr)
+ return "Unknown error";
+ else
+ return sys_errlist[errnum];
+ }
+
+ Or you could comment out the relevant calls to strerror; they're
+ not mission-critical. Or you could upgrade to Solaris. Ha ha ha!
+ (what?? you think I've got Bad Attitude?)
+
+
+* Making a shared library on Solaris. (Not really a compilation
+ problem, but many people ask ...)
+
+ Firstly, if you have Solaris 8, either you have libbz2.so already
+ on your system, or you can install it from the Solaris CD.
+
+ Secondly, be aware that there are potential naming conflicts
+ between the .so file supplied with Solaris 8, and the .so file
+ which Makefile-libbz2_so will make. Makefile-libbz2_so creates
+ a .so which has the names which I intend to be "official" as
+ of version 1.0.0 and onwards. Unfortunately, the .so in
+ Solaris 8 appeared before I decided on the final names, so
+ the two libraries are incompatible. We have since communicated
+ and I hope that the problems will have been solved in the next
+ version of Solaris, whenever that might appear.
+
+ All that said: you might be able to get somewhere
+ by finding the line in Makefile-libbz2_so which says
+
+ $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS)
+
+ and replacing with
+
+ ($CC) -G -shared -o libbz2.so.1.0.1 -h libbz2.so.1.0 $(OBJS)
+
+ If gcc objects to the combination -fpic -fPIC, get rid of
+ the second one, leaving just "-fpic".
+
+
+That's the end of the currently known compilation problems.
--- /dev/null
+
+Y2K status of bzip2 and libbzip2, versions 0.1, 0.9.0 and 0.9.5
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+Informally speaking:
+ bzip2 is a compression program built on top of libbzip2,
+ a library which does the real work of compression and
+ decompression. As far as I am aware, libbzip2 does not have
+ any date-related code at all.
+
+ bzip2 itself copies dates from source to destination files
+ when compressing or decompressing, using the 'stat' and 'utime'
+ UNIX system calls. It doesn't examine, manipulate or store the
+ dates in any way. So as far as I can see, there shouldn't be any
+ problem with bzip2 providing 'stat' and 'utime' work correctly
+ on your system.
+
+ On non-unix platforms (those for which BZ_UNIX in bzip2.c is
+ not set to 1), bzip2 doesn't even do the date copying.
+
+ Overall, informally speaking, I don't think bzip2 or libbzip2
+ have a Y2K problem.
+
+Formally speaking:
+ I am not prepared to offer you any assurance whatsoever
+ regarding Y2K issues in my software. You alone assume the
+ entire risk of using the software. The disclaimer of liability
+ in the LICENSE file in the bzip2 source distribution continues
+ to apply on this issue as with every other issue pertaining
+ to the software.
+
+Julian Seward
+Cambridge, UK
+25 August 1999
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Block sorting machinery ---*/
+/*--- blocksort.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+
+ To get some idea how the block sorting algorithms in this file
+ work, read my paper
+ On the Performance of BWT Sorting Algorithms
+ in Proceedings of the IEEE Data Compression Conference 2000,
+ Snowbird, Utah, USA, 27-30 March 2000. The main sort in this
+ file implements the algorithm called cache in the paper.
+--*/
+
+
+#include "bzlib_private.h"
+
+/*---------------------------------------------*/
+/*--- Fallback O(N log(N)^2) sorting ---*/
+/*--- algorithm, for repetitive blocks ---*/
+/*---------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+__inline__
+void fallbackSimpleSort ( UInt32* fmap,
+ UInt32* eclass,
+ Int32 lo,
+ Int32 hi )
+{
+ Int32 i, j, tmp;
+ UInt32 ec_tmp;
+
+ if (lo == hi) return;
+
+ if (hi - lo > 3) {
+ for ( i = hi-4; i >= lo; i-- ) {
+ tmp = fmap[i];
+ ec_tmp = eclass[tmp];
+ for ( j = i+4; j <= hi && ec_tmp > eclass[fmap[j]]; j += 4 )
+ fmap[j-4] = fmap[j];
+ fmap[j-4] = tmp;
+ }
+ }
+
+ for ( i = hi-1; i >= lo; i-- ) {
+ tmp = fmap[i];
+ ec_tmp = eclass[tmp];
+ for ( j = i+1; j <= hi && ec_tmp > eclass[fmap[j]]; j++ )
+ fmap[j-1] = fmap[j];
+ fmap[j-1] = tmp;
+ }
+}
+
+
+/*---------------------------------------------*/
+#define fswap(zz1, zz2) \
+ { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; }
+
+#define fvswap(zzp1, zzp2, zzn) \
+{ \
+ Int32 yyp1 = (zzp1); \
+ Int32 yyp2 = (zzp2); \
+ Int32 yyn = (zzn); \
+ while (yyn > 0) { \
+ fswap(fmap[yyp1], fmap[yyp2]); \
+ yyp1++; yyp2++; yyn--; \
+ } \
+}
+
+
+#define fmin(a,b) ((a) < (b)) ? (a) : (b)
+
+#define fpush(lz,hz) { stackLo[sp] = lz; \
+ stackHi[sp] = hz; \
+ sp++; }
+
+#define fpop(lz,hz) { sp--; \
+ lz = stackLo[sp]; \
+ hz = stackHi[sp]; }
+
+#define FALLBACK_QSORT_SMALL_THRESH 10
+#define FALLBACK_QSORT_STACK_SIZE 100
+
+
+static
+void fallbackQSort3 ( UInt32* fmap,
+ UInt32* eclass,
+ Int32 loSt,
+ Int32 hiSt )
+{
+ Int32 unLo, unHi, ltLo, gtHi, n, m;
+ Int32 sp, lo, hi;
+ UInt32 med, r, r3;
+ Int32 stackLo[FALLBACK_QSORT_STACK_SIZE];
+ Int32 stackHi[FALLBACK_QSORT_STACK_SIZE];
+
+ r = 0;
+
+ sp = 0;
+ fpush ( loSt, hiSt );
+
+ while (sp > 0) {
+
+ AssertH ( sp < FALLBACK_QSORT_STACK_SIZE, 1004 );
+
+ fpop ( lo, hi );
+ if (hi - lo < FALLBACK_QSORT_SMALL_THRESH) {
+ fallbackSimpleSort ( fmap, eclass, lo, hi );
+ continue;
+ }
+
+ /* Random partitioning. Median of 3 sometimes fails to
+ avoid bad cases. Median of 9 seems to help but
+ looks rather expensive. This too seems to work but
+ is cheaper. Guidance for the magic constants
+ 7621 and 32768 is taken from Sedgewick's algorithms
+ book, chapter 35.
+ */
+ r = ((r * 7621) + 1) % 32768;
+ r3 = r % 3;
+ if (r3 == 0) med = eclass[fmap[lo]]; else
+ if (r3 == 1) med = eclass[fmap[(lo+hi)>>1]]; else
+ med = eclass[fmap[hi]];
+
+ unLo = ltLo = lo;
+ unHi = gtHi = hi;
+
+ while (1) {
+ while (1) {
+ if (unLo > unHi) break;
+ n = (Int32)eclass[fmap[unLo]] - (Int32)med;
+ if (n == 0) {
+ fswap(fmap[unLo], fmap[ltLo]);
+ ltLo++; unLo++;
+ continue;
+ };
+ if (n > 0) break;
+ unLo++;
+ }
+ while (1) {
+ if (unLo > unHi) break;
+ n = (Int32)eclass[fmap[unHi]] - (Int32)med;
+ if (n == 0) {
+ fswap(fmap[unHi], fmap[gtHi]);
+ gtHi--; unHi--;
+ continue;
+ };
+ if (n < 0) break;
+ unHi--;
+ }
+ if (unLo > unHi) break;
+ fswap(fmap[unLo], fmap[unHi]); unLo++; unHi--;
+ }
+
+ AssertD ( unHi == unLo-1, "fallbackQSort3(2)" );
+
+ if (gtHi < ltLo) continue;
+
+ n = fmin(ltLo-lo, unLo-ltLo); fvswap(lo, unLo-n, n);
+ m = fmin(hi-gtHi, gtHi-unHi); fvswap(unLo, hi-m+1, m);
+
+ n = lo + unLo - ltLo - 1;
+ m = hi - (gtHi - unHi) + 1;
+
+ if (n - lo > hi - m) {
+ fpush ( lo, n );
+ fpush ( m, hi );
+ } else {
+ fpush ( m, hi );
+ fpush ( lo, n );
+ }
+ }
+}
+
+#undef fmin
+#undef fpush
+#undef fpop
+#undef fswap
+#undef fvswap
+#undef FALLBACK_QSORT_SMALL_THRESH
+#undef FALLBACK_QSORT_STACK_SIZE
+
+
+/*---------------------------------------------*/
+/* Pre:
+ nblock > 0
+ eclass exists for [0 .. nblock-1]
+ ((UChar*)eclass) [0 .. nblock-1] holds block
+ ptr exists for [0 .. nblock-1]
+
+ Post:
+ ((UChar*)eclass) [0 .. nblock-1] holds block
+ All other areas of eclass destroyed
+ fmap [0 .. nblock-1] holds sorted order
+ bhtab [ 0 .. 2+(nblock/32) ] destroyed
+*/
+
+#define SET_BH(zz) bhtab[(zz) >> 5] |= (1 << ((zz) & 31))
+#define CLEAR_BH(zz) bhtab[(zz) >> 5] &= ~(1 << ((zz) & 31))
+#define ISSET_BH(zz) (bhtab[(zz) >> 5] & (1 << ((zz) & 31)))
+#define WORD_BH(zz) bhtab[(zz) >> 5]
+#define UNALIGNED_BH(zz) ((zz) & 0x01f)
+
+static
+void fallbackSort ( UInt32* fmap,
+ UInt32* eclass,
+ UInt32* bhtab,
+ Int32 nblock,
+ Int32 verb )
+{
+ Int32 ftab[257];
+ Int32 ftabCopy[256];
+ Int32 H, i, j, k, l, r, cc, cc1;
+ Int32 nNotDone;
+ Int32 nBhtab;
+ UChar* eclass8 = (UChar*)eclass;
+
+ /*--
+ Initial 1-char radix sort to generate
+ initial fmap and initial BH bits.
+ --*/
+ if (verb >= 4)
+ VPrintf0 ( " bucket sorting ...\n" );
+ for (i = 0; i < 257; i++) ftab[i] = 0;
+ for (i = 0; i < nblock; i++) ftab[eclass8[i]]++;
+ for (i = 0; i < 256; i++) ftabCopy[i] = ftab[i];
+ for (i = 1; i < 257; i++) ftab[i] += ftab[i-1];
+
+ for (i = 0; i < nblock; i++) {
+ j = eclass8[i];
+ k = ftab[j] - 1;
+ ftab[j] = k;
+ fmap[k] = i;
+ }
+
+ nBhtab = 2 + (nblock / 32);
+ for (i = 0; i < nBhtab; i++) bhtab[i] = 0;
+ for (i = 0; i < 256; i++) SET_BH(ftab[i]);
+
+ /*--
+ Inductively refine the buckets. Kind-of an
+ "exponential radix sort" (!), inspired by the
+ Manber-Myers suffix array construction algorithm.
+ --*/
+
+ /*-- set sentinel bits for block-end detection --*/
+ for (i = 0; i < 32; i++) {
+ SET_BH(nblock + 2*i);
+ CLEAR_BH(nblock + 2*i + 1);
+ }
+
+ /*-- the log(N) loop --*/
+ H = 1;
+ while (1) {
+
+ if (verb >= 4)
+ VPrintf1 ( " depth %6d has ", H );
+
+ j = 0;
+ for (i = 0; i < nblock; i++) {
+ if (ISSET_BH(i)) j = i;
+ k = fmap[i] - H; if (k < 0) k += nblock;
+ eclass[k] = j;
+ }
+
+ nNotDone = 0;
+ r = -1;
+ while (1) {
+
+ /*-- find the next non-singleton bucket --*/
+ k = r + 1;
+ while (ISSET_BH(k) && UNALIGNED_BH(k)) k++;
+ if (ISSET_BH(k)) {
+ while (WORD_BH(k) == 0xffffffff) k += 32;
+ while (ISSET_BH(k)) k++;
+ }
+ l = k - 1;
+ if (l >= nblock) break;
+ while (!ISSET_BH(k) && UNALIGNED_BH(k)) k++;
+ if (!ISSET_BH(k)) {
+ while (WORD_BH(k) == 0x00000000) k += 32;
+ while (!ISSET_BH(k)) k++;
+ }
+ r = k - 1;
+ if (r >= nblock) break;
+
+ /*-- now [l, r] bracket current bucket --*/
+ if (r > l) {
+ nNotDone += (r - l + 1);
+ fallbackQSort3 ( fmap, eclass, l, r );
+
+ /*-- scan bucket and generate header bits-- */
+ cc = -1;
+ for (i = l; i <= r; i++) {
+ cc1 = eclass[fmap[i]];
+ if (cc != cc1) { SET_BH(i); cc = cc1; };
+ }
+ }
+ }
+
+ if (verb >= 4)
+ VPrintf1 ( "%6d unresolved strings\n", nNotDone );
+
+ H *= 2;
+ if (H > nblock || nNotDone == 0) break;
+ }
+
+ /*--
+ Reconstruct the original block in
+ eclass8 [0 .. nblock-1], since the
+ previous phase destroyed it.
+ --*/
+ if (verb >= 4)
+ VPrintf0 ( " reconstructing block ...\n" );
+ j = 0;
+ for (i = 0; i < nblock; i++) {
+ while (ftabCopy[j] == 0) j++;
+ ftabCopy[j]--;
+ eclass8[fmap[i]] = (UChar)j;
+ }
+ AssertH ( j < 256, 1005 );
+}
+
+#undef SET_BH
+#undef CLEAR_BH
+#undef ISSET_BH
+#undef WORD_BH
+#undef UNALIGNED_BH
+
+
+/*---------------------------------------------*/
+/*--- The main, O(N^2 log(N)) sorting ---*/
+/*--- algorithm. Faster for "normal" ---*/
+/*--- non-repetitive blocks. ---*/
+/*---------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+__inline__
+Bool mainGtU ( UInt32 i1,
+ UInt32 i2,
+ UChar* block,
+ UInt16* quadrant,
+ UInt32 nblock,
+ Int32* budget )
+{
+ Int32 k;
+ UChar c1, c2;
+ UInt16 s1, s2;
+
+ AssertD ( i1 != i2, "mainGtU" );
+ /* 1 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 2 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 3 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 4 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 5 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 6 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 7 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 8 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 9 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 10 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 11 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+ /* 12 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ i1++; i2++;
+
+ k = nblock + 8;
+
+ do {
+ /* 1 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 2 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 3 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 4 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 5 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 6 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 7 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+ /* 8 */
+ c1 = block[i1]; c2 = block[i2];
+ if (c1 != c2) return (c1 > c2);
+ s1 = quadrant[i1]; s2 = quadrant[i2];
+ if (s1 != s2) return (s1 > s2);
+ i1++; i2++;
+
+ if (i1 >= nblock) i1 -= nblock;
+ if (i2 >= nblock) i2 -= nblock;
+
+ k -= 8;
+ (*budget)--;
+ }
+ while (k >= 0);
+
+ return False;
+}
+
+
+/*---------------------------------------------*/
+/*--
+ Knuth's increments seem to work better
+ than Incerpi-Sedgewick here. Possibly
+ because the number of elems to sort is
+ usually small, typically <= 20.
+--*/
+static
+Int32 incs[14] = { 1, 4, 13, 40, 121, 364, 1093, 3280,
+ 9841, 29524, 88573, 265720,
+ 797161, 2391484 };
+
+static
+void mainSimpleSort ( UInt32* ptr,
+ UChar* block,
+ UInt16* quadrant,
+ Int32 nblock,
+ Int32 lo,
+ Int32 hi,
+ Int32 d,
+ Int32* budget )
+{
+ Int32 i, j, h, bigN, hp;
+ UInt32 v;
+
+ bigN = hi - lo + 1;
+ if (bigN < 2) return;
+
+ hp = 0;
+ while (incs[hp] < bigN) hp++;
+ hp--;
+
+ for (; hp >= 0; hp--) {
+ h = incs[hp];
+
+ i = lo + h;
+ while (True) {
+
+ /*-- copy 1 --*/
+ if (i > hi) break;
+ v = ptr[i];
+ j = i;
+ while ( mainGtU (
+ ptr[j-h]+d, v+d, block, quadrant, nblock, budget
+ ) ) {
+ ptr[j] = ptr[j-h];
+ j = j - h;
+ if (j <= (lo + h - 1)) break;
+ }
+ ptr[j] = v;
+ i++;
+
+ /*-- copy 2 --*/
+ if (i > hi) break;
+ v = ptr[i];
+ j = i;
+ while ( mainGtU (
+ ptr[j-h]+d, v+d, block, quadrant, nblock, budget
+ ) ) {
+ ptr[j] = ptr[j-h];
+ j = j - h;
+ if (j <= (lo + h - 1)) break;
+ }
+ ptr[j] = v;
+ i++;
+
+ /*-- copy 3 --*/
+ if (i > hi) break;
+ v = ptr[i];
+ j = i;
+ while ( mainGtU (
+ ptr[j-h]+d, v+d, block, quadrant, nblock, budget
+ ) ) {
+ ptr[j] = ptr[j-h];
+ j = j - h;
+ if (j <= (lo + h - 1)) break;
+ }
+ ptr[j] = v;
+ i++;
+
+ if (*budget < 0) return;
+ }
+ }
+}
+
+
+/*---------------------------------------------*/
+/*--
+ The following is an implementation of
+ an elegant 3-way quicksort for strings,
+ described in a paper "Fast Algorithms for
+ Sorting and Searching Strings", by Robert
+ Sedgewick and Jon L. Bentley.
+--*/
+
+#define mswap(zz1, zz2) \
+ { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; }
+
+#define mvswap(zzp1, zzp2, zzn) \
+{ \
+ Int32 yyp1 = (zzp1); \
+ Int32 yyp2 = (zzp2); \
+ Int32 yyn = (zzn); \
+ while (yyn > 0) { \
+ mswap(ptr[yyp1], ptr[yyp2]); \
+ yyp1++; yyp2++; yyn--; \
+ } \
+}
+
+static
+__inline__
+UChar mmed3 ( UChar a, UChar b, UChar c )
+{
+ UChar t;
+ if (a > b) { t = a; a = b; b = t; };
+ if (b > c) {
+ b = c;
+ if (a > b) b = a;
+ }
+ return b;
+}
+
+#define mmin(a,b) ((a) < (b)) ? (a) : (b)
+
+#define mpush(lz,hz,dz) { stackLo[sp] = lz; \
+ stackHi[sp] = hz; \
+ stackD [sp] = dz; \
+ sp++; }
+
+#define mpop(lz,hz,dz) { sp--; \
+ lz = stackLo[sp]; \
+ hz = stackHi[sp]; \
+ dz = stackD [sp]; }
+
+
+#define mnextsize(az) (nextHi[az]-nextLo[az])
+
+#define mnextswap(az,bz) \
+ { Int32 tz; \
+ tz = nextLo[az]; nextLo[az] = nextLo[bz]; nextLo[bz] = tz; \
+ tz = nextHi[az]; nextHi[az] = nextHi[bz]; nextHi[bz] = tz; \
+ tz = nextD [az]; nextD [az] = nextD [bz]; nextD [bz] = tz; }
+
+
+#define MAIN_QSORT_SMALL_THRESH 20
+#define MAIN_QSORT_DEPTH_THRESH (BZ_N_RADIX + BZ_N_QSORT)
+#define MAIN_QSORT_STACK_SIZE 100
+
+static
+void mainQSort3 ( UInt32* ptr,
+ UChar* block,
+ UInt16* quadrant,
+ Int32 nblock,
+ Int32 loSt,
+ Int32 hiSt,
+ Int32 dSt,
+ Int32* budget )
+{
+ Int32 unLo, unHi, ltLo, gtHi, n, m, med;
+ Int32 sp, lo, hi, d;
+
+ Int32 stackLo[MAIN_QSORT_STACK_SIZE];
+ Int32 stackHi[MAIN_QSORT_STACK_SIZE];
+ Int32 stackD [MAIN_QSORT_STACK_SIZE];
+
+ Int32 nextLo[3];
+ Int32 nextHi[3];
+ Int32 nextD [3];
+
+ sp = 0;
+ mpush ( loSt, hiSt, dSt );
+
+ while (sp > 0) {
+
+ AssertH ( sp < MAIN_QSORT_STACK_SIZE, 1001 );
+
+ mpop ( lo, hi, d );
+ if (hi - lo < MAIN_QSORT_SMALL_THRESH ||
+ d > MAIN_QSORT_DEPTH_THRESH) {
+ mainSimpleSort ( ptr, block, quadrant, nblock, lo, hi, d, budget );
+ if (*budget < 0) return;
+ continue;
+ }
+
+ med = (Int32)
+ mmed3 ( block[ptr[ lo ]+d],
+ block[ptr[ hi ]+d],
+ block[ptr[ (lo+hi)>>1 ]+d] );
+
+ unLo = ltLo = lo;
+ unHi = gtHi = hi;
+
+ while (True) {
+ while (True) {
+ if (unLo > unHi) break;
+ n = ((Int32)block[ptr[unLo]+d]) - med;
+ if (n == 0) {
+ mswap(ptr[unLo], ptr[ltLo]);
+ ltLo++; unLo++; continue;
+ };
+ if (n > 0) break;
+ unLo++;
+ }
+ while (True) {
+ if (unLo > unHi) break;
+ n = ((Int32)block[ptr[unHi]+d]) - med;
+ if (n == 0) {
+ mswap(ptr[unHi], ptr[gtHi]);
+ gtHi--; unHi--; continue;
+ };
+ if (n < 0) break;
+ unHi--;
+ }
+ if (unLo > unHi) break;
+ mswap(ptr[unLo], ptr[unHi]); unLo++; unHi--;
+ }
+
+ AssertD ( unHi == unLo-1, "mainQSort3(2)" );
+
+ if (gtHi < ltLo) {
+ mpush(lo, hi, d+1 );
+ continue;
+ }
+
+ n = mmin(ltLo-lo, unLo-ltLo); mvswap(lo, unLo-n, n);
+ m = mmin(hi-gtHi, gtHi-unHi); mvswap(unLo, hi-m+1, m);
+
+ n = lo + unLo - ltLo - 1;
+ m = hi - (gtHi - unHi) + 1;
+
+ nextLo[0] = lo; nextHi[0] = n; nextD[0] = d;
+ nextLo[1] = m; nextHi[1] = hi; nextD[1] = d;
+ nextLo[2] = n+1; nextHi[2] = m-1; nextD[2] = d+1;
+
+ if (mnextsize(0) < mnextsize(1)) mnextswap(0,1);
+ if (mnextsize(1) < mnextsize(2)) mnextswap(1,2);
+ if (mnextsize(0) < mnextsize(1)) mnextswap(0,1);
+
+ AssertD (mnextsize(0) >= mnextsize(1), "mainQSort3(8)" );
+ AssertD (mnextsize(1) >= mnextsize(2), "mainQSort3(9)" );
+
+ mpush (nextLo[0], nextHi[0], nextD[0]);
+ mpush (nextLo[1], nextHi[1], nextD[1]);
+ mpush (nextLo[2], nextHi[2], nextD[2]);
+ }
+}
+
+#undef mswap
+#undef mvswap
+#undef mpush
+#undef mpop
+#undef mmin
+#undef mnextsize
+#undef mnextswap
+#undef MAIN_QSORT_SMALL_THRESH
+#undef MAIN_QSORT_DEPTH_THRESH
+#undef MAIN_QSORT_STACK_SIZE
+
+
+/*---------------------------------------------*/
+/* Pre:
+ nblock > N_OVERSHOOT
+ block32 exists for [0 .. nblock-1 +N_OVERSHOOT]
+ ((UChar*)block32) [0 .. nblock-1] holds block
+ ptr exists for [0 .. nblock-1]
+
+ Post:
+ ((UChar*)block32) [0 .. nblock-1] holds block
+ All other areas of block32 destroyed
+ ftab [0 .. 65536 ] destroyed
+ ptr [0 .. nblock-1] holds sorted order
+ if (*budget < 0), sorting was abandoned
+*/
+
+#define BIGFREQ(b) (ftab[((b)+1) << 8] - ftab[(b) << 8])
+#define SETMASK (1 << 21)
+#define CLEARMASK (~(SETMASK))
+
+static
+void mainSort ( UInt32* ptr,
+ UChar* block,
+ UInt16* quadrant,
+ UInt32* ftab,
+ Int32 nblock,
+ Int32 verb,
+ Int32* budget )
+{
+ Int32 i, j, k, ss, sb;
+ Int32 runningOrder[256];
+ Bool bigDone[256];
+ Int32 copyStart[256];
+ Int32 copyEnd [256];
+ UChar c1;
+ Int32 numQSorted;
+ UInt16 s;
+ if (verb >= 4) VPrintf0 ( " main sort initialise ...\n" );
+
+ /*-- set up the 2-byte frequency table --*/
+ for (i = 65536; i >= 0; i--) ftab[i] = 0;
+
+ j = block[0] << 8;
+ i = nblock-1;
+ for (; i >= 3; i -= 4) {
+ quadrant[i] = 0;
+ j = (j >> 8) | ( ((UInt16)block[i]) << 8);
+ ftab[j]++;
+ quadrant[i-1] = 0;
+ j = (j >> 8) | ( ((UInt16)block[i-1]) << 8);
+ ftab[j]++;
+ quadrant[i-2] = 0;
+ j = (j >> 8) | ( ((UInt16)block[i-2]) << 8);
+ ftab[j]++;
+ quadrant[i-3] = 0;
+ j = (j >> 8) | ( ((UInt16)block[i-3]) << 8);
+ ftab[j]++;
+ }
+ for (; i >= 0; i--) {
+ quadrant[i] = 0;
+ j = (j >> 8) | ( ((UInt16)block[i]) << 8);
+ ftab[j]++;
+ }
+
+ /*-- (emphasises close relationship of block & quadrant) --*/
+ for (i = 0; i < BZ_N_OVERSHOOT; i++) {
+ block [nblock+i] = block[i];
+ quadrant[nblock+i] = 0;
+ }
+
+ if (verb >= 4) VPrintf0 ( " bucket sorting ...\n" );
+
+ /*-- Complete the initial radix sort --*/
+ for (i = 1; i <= 65536; i++) ftab[i] += ftab[i-1];
+
+ s = block[0] << 8;
+ i = nblock-1;
+ for (; i >= 3; i -= 4) {
+ s = (s >> 8) | (block[i] << 8);
+ j = ftab[s] -1;
+ ftab[s] = j;
+ ptr[j] = i;
+ s = (s >> 8) | (block[i-1] << 8);
+ j = ftab[s] -1;
+ ftab[s] = j;
+ ptr[j] = i-1;
+ s = (s >> 8) | (block[i-2] << 8);
+ j = ftab[s] -1;
+ ftab[s] = j;
+ ptr[j] = i-2;
+ s = (s >> 8) | (block[i-3] << 8);
+ j = ftab[s] -1;
+ ftab[s] = j;
+ ptr[j] = i-3;
+ }
+ for (; i >= 0; i--) {
+ s = (s >> 8) | (block[i] << 8);
+ j = ftab[s] -1;
+ ftab[s] = j;
+ ptr[j] = i;
+ }
+
+ /*--
+ Now ftab contains the first loc of every small bucket.
+ Calculate the running order, from smallest to largest
+ big bucket.
+ --*/
+ for (i = 0; i <= 255; i++) {
+ bigDone [i] = False;
+ runningOrder[i] = i;
+ }
+
+ {
+ Int32 vv;
+ Int32 h = 1;
+ do h = 3 * h + 1; while (h <= 256);
+ do {
+ h = h / 3;
+ for (i = h; i <= 255; i++) {
+ vv = runningOrder[i];
+ j = i;
+ while ( BIGFREQ(runningOrder[j-h]) > BIGFREQ(vv) ) {
+ runningOrder[j] = runningOrder[j-h];
+ j = j - h;
+ if (j <= (h - 1)) goto zero;
+ }
+ zero:
+ runningOrder[j] = vv;
+ }
+ } while (h != 1);
+ }
+
+ /*--
+ The main sorting loop.
+ --*/
+
+ numQSorted = 0;
+
+ for (i = 0; i <= 255; i++) {
+
+ /*--
+ Process big buckets, starting with the least full.
+ Basically this is a 3-step process in which we call
+ mainQSort3 to sort the small buckets [ss, j], but
+ also make a big effort to avoid the calls if we can.
+ --*/
+ ss = runningOrder[i];
+
+ /*--
+ Step 1:
+ Complete the big bucket [ss] by quicksorting
+ any unsorted small buckets [ss, j], for j != ss.
+ Hopefully previous pointer-scanning phases have already
+ completed many of the small buckets [ss, j], so
+ we don't have to sort them at all.
+ --*/
+ for (j = 0; j <= 255; j++) {
+ if (j != ss) {
+ sb = (ss << 8) + j;
+ if ( ! (ftab[sb] & SETMASK) ) {
+ Int32 lo = ftab[sb] & CLEARMASK;
+ Int32 hi = (ftab[sb+1] & CLEARMASK) - 1;
+ if (hi > lo) {
+ if (verb >= 4)
+ VPrintf4 ( " qsort [0x%x, 0x%x] "
+ "done %d this %d\n",
+ ss, j, numQSorted, hi - lo + 1 );
+ mainQSort3 (
+ ptr, block, quadrant, nblock,
+ lo, hi, BZ_N_RADIX, budget
+ );
+ numQSorted += (hi - lo + 1);
+ if (*budget < 0) return;
+ }
+ }
+ ftab[sb] |= SETMASK;
+ }
+ }
+
+ AssertH ( !bigDone[ss], 1006 );
+
+ /*--
+ Step 2:
+ Now scan this big bucket [ss] so as to synthesise the
+ sorted order for small buckets [t, ss] for all t,
+ including, magically, the bucket [ss,ss] too.
+ This will avoid doing Real Work in subsequent Step 1's.
+ --*/
+ {
+ for (j = 0; j <= 255; j++) {
+ copyStart[j] = ftab[(j << 8) + ss] & CLEARMASK;
+ copyEnd [j] = (ftab[(j << 8) + ss + 1] & CLEARMASK) - 1;
+ }
+ for (j = ftab[ss << 8] & CLEARMASK; j < copyStart[ss]; j++) {
+ k = ptr[j]-1; if (k < 0) k += nblock;
+ c1 = block[k];
+ if (!bigDone[c1])
+ ptr[ copyStart[c1]++ ] = k;
+ }
+ for (j = (ftab[(ss+1) << 8] & CLEARMASK) - 1; j > copyEnd[ss]; j--) {
+ k = ptr[j]-1; if (k < 0) k += nblock;
+ c1 = block[k];
+ if (!bigDone[c1])
+ ptr[ copyEnd[c1]-- ] = k;
+ }
+ }
+
+ AssertH ( copyStart[ss]-1 == copyEnd[ss], 1007 );
+
+ for (j = 0; j <= 255; j++) ftab[(j << 8) + ss] |= SETMASK;
+
+ /*--
+ Step 3:
+ The [ss] big bucket is now done. Record this fact,
+ and update the quadrant descriptors. Remember to
+ update quadrants in the overshoot area too, if
+ necessary. The "if (i < 255)" test merely skips
+ this updating for the last bucket processed, since
+ updating for the last bucket is pointless.
+
+ The quadrant array provides a way to incrementally
+ cache sort orderings, as they appear, so as to
+ make subsequent comparisons in fullGtU() complete
+ faster. For repetitive blocks this makes a big
+ difference (but not big enough to be able to avoid
+ the fallback sorting mechanism, exponential radix sort).
+
+ The precise meaning is: at all times:
+
+ for 0 <= i < nblock and 0 <= j <= nblock
+
+ if block[i] != block[j],
+
+ then the relative values of quadrant[i] and
+ quadrant[j] are meaningless.
+
+ else {
+ if quadrant[i] < quadrant[j]
+ then the string starting at i lexicographically
+ precedes the string starting at j
+
+ else if quadrant[i] > quadrant[j]
+ then the string starting at j lexicographically
+ precedes the string starting at i
+
+ else
+ the relative ordering of the strings starting
+ at i and j has not yet been determined.
+ }
+ --*/
+ bigDone[ss] = True;
+
+ if (i < 255) {
+ Int32 bbStart = ftab[ss << 8] & CLEARMASK;
+ Int32 bbSize = (ftab[(ss+1) << 8] & CLEARMASK) - bbStart;
+ Int32 shifts = 0;
+
+ while ((bbSize >> shifts) > 65534) shifts++;
+
+ for (j = bbSize-1; j >= 0; j--) {
+ Int32 a2update = ptr[bbStart + j];
+ UInt16 qVal = (UInt16)(j >> shifts);
+ quadrant[a2update] = qVal;
+ if (a2update < BZ_N_OVERSHOOT)
+ quadrant[a2update + nblock] = qVal;
+ }
+ AssertH ( ((bbSize-1) >> shifts) <= 65535, 1002 );
+ }
+
+ }
+
+ if (verb >= 4)
+ VPrintf3 ( " %d pointers, %d sorted, %d scanned\n",
+ nblock, numQSorted, nblock - numQSorted );
+}
+
+#undef BIGFREQ
+#undef SETMASK
+#undef CLEARMASK
+
+
+/*---------------------------------------------*/
+/* Pre:
+ nblock > 0
+ arr2 exists for [0 .. nblock-1 +N_OVERSHOOT]
+ ((UChar*)arr2) [0 .. nblock-1] holds block
+ arr1 exists for [0 .. nblock-1]
+
+ Post:
+ ((UChar*)arr2) [0 .. nblock-1] holds block
+ All other areas of block destroyed
+ ftab [ 0 .. 65536 ] destroyed
+ arr1 [0 .. nblock-1] holds sorted order
+*/
+void BZ2_blockSort ( EState* s )
+{
+ UInt32* ptr = s->ptr;
+ UChar* block = s->block;
+ UInt32* ftab = s->ftab;
+ Int32 nblock = s->nblock;
+ Int32 verb = s->verbosity;
+ Int32 wfact = s->workFactor;
+ UInt16* quadrant;
+ Int32 budget;
+ Int32 budgetInit;
+ Int32 i;
+
+ if (nblock < 10000) {
+ fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb );
+ } else {
+ /* Calculate the location for quadrant, remembering to get
+ the alignment right. Assumes that &(block[0]) is at least
+ 2-byte aligned -- this should be ok since block is really
+ the first section of arr2.
+ */
+ i = nblock+BZ_N_OVERSHOOT;
+ if (i & 1) i++;
+ quadrant = (UInt16*)(&(block[i]));
+
+ /* (wfact-1) / 3 puts the default-factor-30
+ transition point at very roughly the same place as
+ with v0.1 and v0.9.0.
+ Not that it particularly matters any more, since the
+ resulting compressed stream is now the same regardless
+ of whether or not we use the main sort or fallback sort.
+ */
+ if (wfact < 1 ) wfact = 1;
+ if (wfact > 100) wfact = 100;
+ budgetInit = nblock * ((wfact-1) / 3);
+ budget = budgetInit;
+
+ mainSort ( ptr, block, quadrant, ftab, nblock, verb, &budget );
+ if (verb >= 3)
+ VPrintf3 ( " %d work, %d block, ratio %5.2f\n",
+ budgetInit - budget,
+ nblock,
+ (float)(budgetInit - budget) /
+ (float)(nblock==0 ? 1 : nblock) );
+ if (budget < 0) {
+ if (verb >= 2)
+ VPrintf0 ( " too repetitive; using fallback"
+ " sorting algorithm\n" );
+ fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb );
+ }
+ }
+
+ s->origPtr = -1;
+ for (i = 0; i < s->nblock; i++)
+ if (ptr[i] == 0)
+ { s->origPtr = i; break; };
+
+ AssertH( s->origPtr != -1, 1003 );
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end blocksort.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+.PU
+.TH bzip2 1
+.SH NAME
+bzip2, bunzip2 \- a block-sorting file compressor, v1.0
+.br
+bzcat \- decompresses files to stdout
+.br
+bzip2recover \- recovers data from damaged bzip2 files
+
+.SH SYNOPSIS
+.ll +8
+.B bzip2
+.RB [ " \-cdfkqstvzVL123456789 " ]
+[
+.I "filenames \&..."
+]
+.ll -8
+.br
+.B bunzip2
+.RB [ " \-fkvsVL " ]
+[
+.I "filenames \&..."
+]
+.br
+.B bzcat
+.RB [ " \-s " ]
+[
+.I "filenames \&..."
+]
+.br
+.B bzip2recover
+.I "filename"
+
+.SH DESCRIPTION
+.I bzip2
+compresses files using the Burrows-Wheeler block sorting
+text compression algorithm, and Huffman coding. Compression is
+generally considerably better than that achieved by more conventional
+LZ77/LZ78-based compressors, and approaches the performance of the PPM
+family of statistical compressors.
+
+The command-line options are deliberately very similar to
+those of
+.I GNU gzip,
+but they are not identical.
+
+.I bzip2
+expects a list of file names to accompany the
+command-line flags. Each file is replaced by a compressed version of
+itself, with the name "original_name.bz2".
+Each compressed file
+has the same modification date, permissions, and, when possible,
+ownership as the corresponding original, so that these properties can
+be correctly restored at decompression time. File name handling is
+naive in the sense that there is no mechanism for preserving original
+file names, permissions, ownerships or dates in filesystems which lack
+these concepts, or have serious file name length restrictions, such as
+MS-DOS.
+
+.I bzip2
+and
+.I bunzip2
+will by default not overwrite existing
+files. If you want this to happen, specify the \-f flag.
+
+If no file names are specified,
+.I bzip2
+compresses from standard
+input to standard output. In this case,
+.I bzip2
+will decline to
+write compressed output to a terminal, as this would be entirely
+incomprehensible and therefore pointless.
+
+.I bunzip2
+(or
+.I bzip2 \-d)
+decompresses all
+specified files. Files which were not created by
+.I bzip2
+will be detected and ignored, and a warning issued.
+.I bzip2
+attempts to guess the filename for the decompressed file
+from that of the compressed file as follows:
+
+ filename.bz2 becomes filename
+ filename.bz becomes filename
+ filename.tbz2 becomes filename.tar
+ filename.tbz becomes filename.tar
+ anyothername becomes anyothername.out
+
+If the file does not end in one of the recognised endings,
+.I .bz2,
+.I .bz,
+.I .tbz2
+or
+.I .tbz,
+.I bzip2
+complains that it cannot
+guess the name of the original file, and uses the original name
+with
+.I .out
+appended.
+
+As with compression, supplying no
+filenames causes decompression from
+standard input to standard output.
+
+.I bunzip2
+will correctly decompress a file which is the
+concatenation of two or more compressed files. The result is the
+concatenation of the corresponding uncompressed files. Integrity
+testing (\-t)
+of concatenated
+compressed files is also supported.
+
+You can also compress or decompress files to the standard output by
+giving the \-c flag. Multiple files may be compressed and
+decompressed like this. The resulting outputs are fed sequentially to
+stdout. Compression of multiple files
+in this manner generates a stream
+containing multiple compressed file representations. Such a stream
+can be decompressed correctly only by
+.I bzip2
+version 0.9.0 or
+later. Earlier versions of
+.I bzip2
+will stop after decompressing
+the first file in the stream.
+
+.I bzcat
+(or
+.I bzip2 -dc)
+decompresses all specified files to
+the standard output.
+
+.I bzip2
+will read arguments from the environment variables
+.I BZIP2
+and
+.I BZIP,
+in that order, and will process them
+before any arguments read from the command line. This gives a
+convenient way to supply default arguments.
+
+Compression is always performed, even if the compressed
+file is slightly
+larger than the original. Files of less than about one hundred bytes
+tend to get larger, since the compression mechanism has a constant
+overhead in the region of 50 bytes. Random data (including the output
+of most file compressors) is coded at about 8.05 bits per byte, giving
+an expansion of around 0.5%.
+
+As a self-check for your protection,
+.I
+bzip2
+uses 32-bit CRCs to
+make sure that the decompressed version of a file is identical to the
+original. This guards against corruption of the compressed data, and
+against undetected bugs in
+.I bzip2
+(hopefully very unlikely). The
+chances of data corruption going undetected is microscopic, about one
+chance in four billion for each file processed. Be aware, though, that
+the check occurs upon decompression, so it can only tell you that
+something is wrong. It can't help you
+recover the original uncompressed
+data. You can use
+.I bzip2recover
+to try to recover data from
+damaged files.
+
+Return values: 0 for a normal exit, 1 for environmental problems (file
+not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt
+compressed file, 3 for an internal consistency error (eg, bug) which
+caused
+.I bzip2
+to panic.
+
+.SH OPTIONS
+.TP
+.B \-c --stdout
+Compress or decompress to standard output.
+.TP
+.B \-d --decompress
+Force decompression.
+.I bzip2,
+.I bunzip2
+and
+.I bzcat
+are
+really the same program, and the decision about what actions to take is
+done on the basis of which name is used. This flag overrides that
+mechanism, and forces
+.I bzip2
+to decompress.
+.TP
+.B \-z --compress
+The complement to \-d: forces compression, regardless of the
+invokation name.
+.TP
+.B \-t --test
+Check integrity of the specified file(s), but don't decompress them.
+This really performs a trial decompression and throws away the result.
+.TP
+.B \-f --force
+Force overwrite of output files. Normally,
+.I bzip2
+will not overwrite
+existing output files. Also forces
+.I bzip2
+to break hard links
+to files, which it otherwise wouldn't do.
+.TP
+.B \-k --keep
+Keep (don't delete) input files during compression
+or decompression.
+.TP
+.B \-s --small
+Reduce memory usage, for compression, decompression and testing. Files
+are decompressed and tested using a modified algorithm which only
+requires 2.5 bytes per block byte. This means any file can be
+decompressed in 2300k of memory, albeit at about half the normal speed.
+
+During compression, \-s selects a block size of 200k, which limits
+memory use to around the same figure, at the expense of your compression
+ratio. In short, if your machine is low on memory (8 megabytes or
+less), use \-s for everything. See MEMORY MANAGEMENT below.
+.TP
+.B \-q --quiet
+Suppress non-essential warning messages. Messages pertaining to
+I/O errors and other critical events will not be suppressed.
+.TP
+.B \-v --verbose
+Verbose mode -- show the compression ratio for each file processed.
+Further \-v's increase the verbosity level, spewing out lots of
+information which is primarily of interest for diagnostic purposes.
+.TP
+.B \-L --license -V --version
+Display the software version, license terms and conditions.
+.TP
+.B \-1 to \-9
+Set the block size to 100 k, 200 k .. 900 k when compressing. Has no
+effect when decompressing. See MEMORY MANAGEMENT below.
+.TP
+.B \--
+Treats all subsequent arguments as file names, even if they start
+with a dash. This is so you can handle files with names beginning
+with a dash, for example: bzip2 \-- \-myfilename.
+.TP
+.B \--repetitive-fast --repetitive-best
+These flags are redundant in versions 0.9.5 and above. They provided
+some coarse control over the behaviour of the sorting algorithm in
+earlier versions, which was sometimes useful. 0.9.5 and above have an
+improved algorithm which renders these flags irrelevant.
+
+.SH MEMORY MANAGEMENT
+.I bzip2
+compresses large files in blocks. The block size affects
+both the compression ratio achieved, and the amount of memory needed for
+compression and decompression. The flags \-1 through \-9
+specify the block size to be 100,000 bytes through 900,000 bytes (the
+default) respectively. At decompression time, the block size used for
+compression is read from the header of the compressed file, and
+.I bunzip2
+then allocates itself just enough memory to decompress
+the file. Since block sizes are stored in compressed files, it follows
+that the flags \-1 to \-9 are irrelevant to and so ignored
+during decompression.
+
+Compression and decompression requirements,
+in bytes, can be estimated as:
+
+ Compression: 400k + ( 8 x block size )
+
+ Decompression: 100k + ( 4 x block size ), or
+ 100k + ( 2.5 x block size )
+
+Larger block sizes give rapidly diminishing marginal returns. Most of
+the compression comes from the first two or three hundred k of block
+size, a fact worth bearing in mind when using
+.I bzip2
+on small machines.
+It is also important to appreciate that the decompression memory
+requirement is set at compression time by the choice of block size.
+
+For files compressed with the default 900k block size,
+.I bunzip2
+will require about 3700 kbytes to decompress. To support decompression
+of any file on a 4 megabyte machine,
+.I bunzip2
+has an option to
+decompress using approximately half this amount of memory, about 2300
+kbytes. Decompression speed is also halved, so you should use this
+option only where necessary. The relevant flag is -s.
+
+In general, try and use the largest block size memory constraints allow,
+since that maximises the compression achieved. Compression and
+decompression speed are virtually unaffected by block size.
+
+Another significant point applies to files which fit in a single block
+-- that means most files you'd encounter using a large block size. The
+amount of real memory touched is proportional to the size of the file,
+since the file is smaller than a block. For example, compressing a file
+20,000 bytes long with the flag -9 will cause the compressor to
+allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560
+kbytes of it. Similarly, the decompressor will allocate 3700k but only
+touch 100k + 20000 * 4 = 180 kbytes.
+
+Here is a table which summarises the maximum memory usage for different
+block sizes. Also recorded is the total compressed size for 14 files of
+the Calgary Text Compression Corpus totalling 3,141,622 bytes. This
+column gives some feel for how compression varies with block size.
+These figures tend to understate the advantage of larger block sizes for
+larger files, since the Corpus is dominated by smaller files.
+
+ Compress Decompress Decompress Corpus
+ Flag usage usage -s usage Size
+
+ -1 1200k 500k 350k 914704
+ -2 2000k 900k 600k 877703
+ -3 2800k 1300k 850k 860338
+ -4 3600k 1700k 1100k 846899
+ -5 4400k 2100k 1350k 845160
+ -6 5200k 2500k 1600k 838626
+ -7 6100k 2900k 1850k 834096
+ -8 6800k 3300k 2100k 828642
+ -9 7600k 3700k 2350k 828642
+
+.SH RECOVERING DATA FROM DAMAGED FILES
+.I bzip2
+compresses files in blocks, usually 900kbytes long. Each
+block is handled independently. If a media or transmission error causes
+a multi-block .bz2
+file to become damaged, it may be possible to
+recover data from the undamaged blocks in the file.
+
+The compressed representation of each block is delimited by a 48-bit
+pattern, which makes it possible to find the block boundaries with
+reasonable certainty. Each block also carries its own 32-bit CRC, so
+damaged blocks can be distinguished from undamaged ones.
+
+.I bzip2recover
+is a simple program whose purpose is to search for
+blocks in .bz2 files, and write each block out into its own .bz2
+file. You can then use
+.I bzip2
+\-t
+to test the
+integrity of the resulting files, and decompress those which are
+undamaged.
+
+.I bzip2recover
+takes a single argument, the name of the damaged file,
+and writes a number of files "rec0001file.bz2",
+"rec0002file.bz2", etc, containing the extracted blocks.
+The output filenames are designed so that the use of
+wildcards in subsequent processing -- for example,
+"bzip2 -dc rec*file.bz2 > recovered_data" -- lists the files in
+the correct order.
+
+.I bzip2recover
+should be of most use dealing with large .bz2
+files, as these will contain many blocks. It is clearly
+futile to use it on damaged single-block files, since a
+damaged block cannot be recovered. If you wish to minimise
+any potential data loss through media or transmission errors,
+you might consider compressing with a smaller
+block size.
+
+.SH PERFORMANCE NOTES
+The sorting phase of compression gathers together similar strings in the
+file. Because of this, files containing very long runs of repeated
+symbols, like "aabaabaabaab ..." (repeated several hundred times) may
+compress more slowly than normal. Versions 0.9.5 and above fare much
+better than previous versions in this respect. The ratio between
+worst-case and average-case compression time is in the region of 10:1.
+For previous versions, this figure was more like 100:1. You can use the
+\-vvvv option to monitor progress in great detail, if you want.
+
+Decompression speed is unaffected by these phenomena.
+
+.I bzip2
+usually allocates several megabytes of memory to operate
+in, and then charges all over it in a fairly random fashion. This means
+that performance, both for compressing and decompressing, is largely
+determined by the speed at which your machine can service cache misses.
+Because of this, small changes to the code to reduce the miss rate have
+been observed to give disproportionately large performance improvements.
+I imagine
+.I bzip2
+will perform best on machines with very large caches.
+
+.SH CAVEATS
+I/O error messages are not as helpful as they could be.
+.I bzip2
+tries hard to detect I/O errors and exit cleanly, but the details of
+what the problem is sometimes seem rather misleading.
+
+This manual page pertains to version 1.0 of
+.I bzip2.
+Compressed
+data created by this version is entirely forwards and backwards
+compatible with the previous public releases, versions 0.1pl2, 0.9.0
+and 0.9.5,
+but with the following exception: 0.9.0 and above can correctly
+decompress multiple concatenated compressed files. 0.1pl2 cannot do
+this; it will stop after decompressing just the first file in the
+stream.
+
+.I bzip2recover
+uses 32-bit integers to represent bit positions in
+compressed files, so it cannot handle compressed files more than 512
+megabytes long. This could easily be fixed.
+
+.SH AUTHOR
+Julian Seward, jseward@acm.org.
+
+http://sourceware.cygnus.com/bzip2
+http://www.muraroa.demon.co.uk
+
+The ideas embodied in
+.I bzip2
+are due to (at least) the following
+people: Michael Burrows and David Wheeler (for the block sorting
+transformation), David Wheeler (again, for the Huffman coder), Peter
+Fenwick (for the structured coding model in the original
+.I bzip,
+and many refinements), and Alistair Moffat, Radford Neal and Ian Witten
+(for the arithmetic coder in the original
+.I bzip).
+I am much
+indebted for their help, support and advice. See the manual in the
+source distribution for pointers to sources of documentation. Christian
+von Roques encouraged me to look for faster sorting algorithms, so as to
+speed up compression. Bela Lubkin encouraged me to improve the
+worst-case compression performance. Many people sent patches, helped
+with portability problems, lent machines, gave advice and were generally
+helpful.
--- /dev/null
+
+
+
+bzip2(1) bzip2(1)
+
+
+N\bNA\bAM\bME\bE
+ bzip2, bunzip2 - a block-sorting file compressor, v1.0
+ bzcat - decompresses files to stdout
+ bzip2recover - recovers data from damaged bzip2 files
+
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ b\bbz\bzi\bip\bp2\b2 [ -\b-c\bcd\bdf\bfk\bkq\bqs\bst\btv\bvz\bzV\bVL\bL1\b12\b23\b34\b45\b56\b67\b78\b89\b9 ] [ _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be_\bs _\b._\b._\b. ]
+ b\bbu\bun\bnz\bzi\bip\bp2\b2 [ -\b-f\bfk\bkv\bvs\bsV\bVL\bL ] [ _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be_\bs _\b._\b._\b. ]
+ b\bbz\bzc\bca\bat\bt [ -\b-s\bs ] [ _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be_\bs _\b._\b._\b. ]
+ b\bbz\bzi\bip\bp2\b2r\bre\bec\bco\bov\bve\ber\br _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ _\bb_\bz_\bi_\bp_\b2 compresses files using the Burrows-Wheeler block
+ sorting text compression algorithm, and Huffman coding.
+ Compression is generally considerably better than that
+ achieved by more conventional LZ77/LZ78-based compressors,
+ and approaches the performance of the PPM family of sta-
+ tistical compressors.
+
+ The command-line options are deliberately very similar to
+ those of _\bG_\bN_\bU _\bg_\bz_\bi_\bp_\b, but they are not identical.
+
+ _\bb_\bz_\bi_\bp_\b2 expects a list of file names to accompany the com-
+ mand-line flags. Each file is replaced by a compressed
+ version of itself, with the name "original_name.bz2".
+ Each compressed file has the same modification date, per-
+ missions, and, when possible, ownership as the correspond-
+ ing original, so that these properties can be correctly
+ restored at decompression time. File name handling is
+ naive in the sense that there is no mechanism for preserv-
+ ing original file names, permissions, ownerships or dates
+ in filesystems which lack these concepts, or have serious
+ file name length restrictions, such as MS-DOS.
+
+ _\bb_\bz_\bi_\bp_\b2 and _\bb_\bu_\bn_\bz_\bi_\bp_\b2 will by default not overwrite existing
+ files. If you want this to happen, specify the -f flag.
+
+ If no file names are specified, _\bb_\bz_\bi_\bp_\b2 compresses from
+ standard input to standard output. In this case, _\bb_\bz_\bi_\bp_\b2
+ will decline to write compressed output to a terminal, as
+ this would be entirely incomprehensible and therefore
+ pointless.
+
+ _\bb_\bu_\bn_\bz_\bi_\bp_\b2 (or _\bb_\bz_\bi_\bp_\b2 _\b-_\bd_\b) decompresses all specified files.
+ Files which were not created by _\bb_\bz_\bi_\bp_\b2 will be detected and
+ ignored, and a warning issued. _\bb_\bz_\bi_\bp_\b2 attempts to guess
+ the filename for the decompressed file from that of the
+ compressed file as follows:
+
+ filename.bz2 becomes filename
+ filename.bz becomes filename
+ filename.tbz2 becomes filename.tar
+
+
+
+ 1
+
+
+
+
+
+bzip2(1) bzip2(1)
+
+
+ filename.tbz becomes filename.tar
+ anyothername becomes anyothername.out
+
+ If the file does not end in one of the recognised endings,
+ _\b._\bb_\bz_\b2_\b, _\b._\bb_\bz_\b, _\b._\bt_\bb_\bz_\b2 or _\b._\bt_\bb_\bz_\b, _\bb_\bz_\bi_\bp_\b2 complains that it cannot
+ guess the name of the original file, and uses the original
+ name with _\b._\bo_\bu_\bt appended.
+
+ As with compression, supplying no filenames causes decom-
+ pression from standard input to standard output.
+
+ _\bb_\bu_\bn_\bz_\bi_\bp_\b2 will correctly decompress a file which is the con-
+ catenation of two or more compressed files. The result is
+ the concatenation of the corresponding uncompressed files.
+ Integrity testing (-t) of concatenated compressed files is
+ also supported.
+
+ You can also compress or decompress files to the standard
+ output by giving the -c flag. Multiple files may be com-
+ pressed and decompressed like this. The resulting outputs
+ are fed sequentially to stdout. Compression of multiple
+ files in this manner generates a stream containing multi-
+ ple compressed file representations. Such a stream can be
+ decompressed correctly only by _\bb_\bz_\bi_\bp_\b2 version 0.9.0 or
+ later. Earlier versions of _\bb_\bz_\bi_\bp_\b2 will stop after decom-
+ pressing the first file in the stream.
+
+ _\bb_\bz_\bc_\ba_\bt (or _\bb_\bz_\bi_\bp_\b2 _\b-_\bd_\bc_\b) decompresses all specified files to
+ the standard output.
+
+ _\bb_\bz_\bi_\bp_\b2 will read arguments from the environment variables
+ _\bB_\bZ_\bI_\bP_\b2 and _\bB_\bZ_\bI_\bP_\b, in that order, and will process them
+ before any arguments read from the command line. This
+ gives a convenient way to supply default arguments.
+
+ Compression is always performed, even if the compressed
+ file is slightly larger than the original. Files of less
+ than about one hundred bytes tend to get larger, since the
+ compression mechanism has a constant overhead in the
+ region of 50 bytes. Random data (including the output of
+ most file compressors) is coded at about 8.05 bits per
+ byte, giving an expansion of around 0.5%.
+
+ As a self-check for your protection, _\bb_\bz_\bi_\bp_\b2 uses 32-bit
+ CRCs to make sure that the decompressed version of a file
+ is identical to the original. This guards against corrup-
+ tion of the compressed data, and against undetected bugs
+ in _\bb_\bz_\bi_\bp_\b2 (hopefully very unlikely). The chances of data
+ corruption going undetected is microscopic, about one
+ chance in four billion for each file processed. Be aware,
+ though, that the check occurs upon decompression, so it
+ can only tell you that something is wrong. It can't help
+ you recover the original uncompressed data. You can use
+ _\bb_\bz_\bi_\bp_\b2_\br_\be_\bc_\bo_\bv_\be_\br to try to recover data from damaged files.
+
+
+
+ 2
+
+
+
+
+
+bzip2(1) bzip2(1)
+
+
+ Return values: 0 for a normal exit, 1 for environmental
+ problems (file not found, invalid flags, I/O errors, &c),
+ 2 to indicate a corrupt compressed file, 3 for an internal
+ consistency error (eg, bug) which caused _\bb_\bz_\bi_\bp_\b2 to panic.
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ -\b-c\bc -\b--\b-s\bst\btd\bdo\bou\but\bt
+ Compress or decompress to standard output.
+
+ -\b-d\bd -\b--\b-d\bde\bec\bco\bom\bmp\bpr\bre\bes\bss\bs
+ Force decompression. _\bb_\bz_\bi_\bp_\b2_\b, _\bb_\bu_\bn_\bz_\bi_\bp_\b2 and _\bb_\bz_\bc_\ba_\bt are
+ really the same program, and the decision about
+ what actions to take is done on the basis of which
+ name is used. This flag overrides that mechanism,
+ and forces _\bb_\bz_\bi_\bp_\b2 to decompress.
+
+ -\b-z\bz -\b--\b-c\bco\bom\bmp\bpr\bre\bes\bss\bs
+ The complement to -d: forces compression, regard-
+ less of the invokation name.
+
+ -\b-t\bt -\b--\b-t\bte\bes\bst\bt
+ Check integrity of the specified file(s), but don't
+ decompress them. This really performs a trial
+ decompression and throws away the result.
+
+ -\b-f\bf -\b--\b-f\bfo\bor\brc\bce\be
+ Force overwrite of output files. Normally, _\bb_\bz_\bi_\bp_\b2
+ will not overwrite existing output files. Also
+ forces _\bb_\bz_\bi_\bp_\b2 to break hard links to files, which it
+ otherwise wouldn't do.
+
+ -\b-k\bk -\b--\b-k\bke\bee\bep\bp
+ Keep (don't delete) input files during compression
+ or decompression.
+
+ -\b-s\bs -\b--\b-s\bsm\bma\bal\bll\bl
+ Reduce memory usage, for compression, decompression
+ and testing. Files are decompressed and tested
+ using a modified algorithm which only requires 2.5
+ bytes per block byte. This means any file can be
+ decompressed in 2300k of memory, albeit at about
+ half the normal speed.
+
+ During compression, -s selects a block size of
+ 200k, which limits memory use to around the same
+ figure, at the expense of your compression ratio.
+ In short, if your machine is low on memory (8
+ megabytes or less), use -s for everything. See
+ MEMORY MANAGEMENT below.
+
+ -\b-q\bq -\b--\b-q\bqu\bui\bie\bet\bt
+ Suppress non-essential warning messages. Messages
+ pertaining to I/O errors and other critical events
+
+
+
+ 3
+
+
+
+
+
+bzip2(1) bzip2(1)
+
+
+ will not be suppressed.
+
+ -\b-v\bv -\b--\b-v\bve\ber\brb\bbo\bos\bse\be
+ Verbose mode -- show the compression ratio for each
+ file processed. Further -v's increase the ver-
+ bosity level, spewing out lots of information which
+ is primarily of interest for diagnostic purposes.
+
+ -\b-L\bL -\b--\b-l\bli\bic\bce\ben\bns\bse\be -\b-V\bV -\b--\b-v\bve\ber\brs\bsi\bio\bon\bn
+ Display the software version, license terms and
+ conditions.
+
+ -\b-1\b1 t\bto\bo -\b-9\b9
+ Set the block size to 100 k, 200 k .. 900 k when
+ compressing. Has no effect when decompressing.
+ See MEMORY MANAGEMENT below.
+
+ -\b--\b- Treats all subsequent arguments as file names, even
+ if they start with a dash. This is so you can han-
+ dle files with names beginning with a dash, for
+ example: bzip2 -- -myfilename.
+
+ -\b--\b-r\bre\bep\bpe\bet\bti\bit\bti\biv\bve\be-\b-f\bfa\bas\bst\bt -\b--\b-r\bre\bep\bpe\bet\bti\bit\bti\biv\bve\be-\b-b\bbe\bes\bst\bt
+ These flags are redundant in versions 0.9.5 and
+ above. They provided some coarse control over the
+ behaviour of the sorting algorithm in earlier ver-
+ sions, which was sometimes useful. 0.9.5 and above
+ have an improved algorithm which renders these
+ flags irrelevant.
+
+
+M\bME\bEM\bMO\bOR\bRY\bY M\bMA\bAN\bNA\bAG\bGE\bEM\bME\bEN\bNT\bT
+ _\bb_\bz_\bi_\bp_\b2 compresses large files in blocks. The block size
+ affects both the compression ratio achieved, and the
+ amount of memory needed for compression and decompression.
+ The flags -1 through -9 specify the block size to be
+ 100,000 bytes through 900,000 bytes (the default) respec-
+ tively. At decompression time, the block size used for
+ compression is read from the header of the compressed
+ file, and _\bb_\bu_\bn_\bz_\bi_\bp_\b2 then allocates itself just enough memory
+ to decompress the file. Since block sizes are stored in
+ compressed files, it follows that the flags -1 to -9 are
+ irrelevant to and so ignored during decompression.
+
+ Compression and decompression requirements, in bytes, can
+ be estimated as:
+
+ Compression: 400k + ( 8 x block size )
+
+ Decompression: 100k + ( 4 x block size ), or
+ 100k + ( 2.5 x block size )
+
+ Larger block sizes give rapidly diminishing marginal
+ returns. Most of the compression comes from the first two
+
+
+
+ 4
+
+
+
+
+
+bzip2(1) bzip2(1)
+
+
+ or three hundred k of block size, a fact worth bearing in
+ mind when using _\bb_\bz_\bi_\bp_\b2 on small machines. It is also
+ important to appreciate that the decompression memory
+ requirement is set at compression time by the choice of
+ block size.
+
+ For files compressed with the default 900k block size,
+ _\bb_\bu_\bn_\bz_\bi_\bp_\b2 will require about 3700 kbytes to decompress. To
+ support decompression of any file on a 4 megabyte machine,
+ _\bb_\bu_\bn_\bz_\bi_\bp_\b2 has an option to decompress using approximately
+ half this amount of memory, about 2300 kbytes. Decompres-
+ sion speed is also halved, so you should use this option
+ only where necessary. The relevant flag is -s.
+
+ In general, try and use the largest block size memory con-
+ straints allow, since that maximises the compression
+ achieved. Compression and decompression speed are virtu-
+ ally unaffected by block size.
+
+ Another significant point applies to files which fit in a
+ single block -- that means most files you'd encounter
+ using a large block size. The amount of real memory
+ touched is proportional to the size of the file, since the
+ file is smaller than a block. For example, compressing a
+ file 20,000 bytes long with the flag -9 will cause the
+ compressor to allocate around 7600k of memory, but only
+ touch 400k + 20000 * 8 = 560 kbytes of it. Similarly, the
+ decompressor will allocate 3700k but only touch 100k +
+ 20000 * 4 = 180 kbytes.
+
+ Here is a table which summarises the maximum memory usage
+ for different block sizes. Also recorded is the total
+ compressed size for 14 files of the Calgary Text Compres-
+ sion Corpus totalling 3,141,622 bytes. This column gives
+ some feel for how compression varies with block size.
+ These figures tend to understate the advantage of larger
+ block sizes for larger files, since the Corpus is domi-
+ nated by smaller files.
+
+ Compress Decompress Decompress Corpus
+ Flag usage usage -s usage Size
+
+ -1 1200k 500k 350k 914704
+ -2 2000k 900k 600k 877703
+ -3 2800k 1300k 850k 860338
+ -4 3600k 1700k 1100k 846899
+ -5 4400k 2100k 1350k 845160
+ -6 5200k 2500k 1600k 838626
+ -7 6100k 2900k 1850k 834096
+ -8 6800k 3300k 2100k 828642
+ -9 7600k 3700k 2350k 828642
+
+
+
+
+
+
+ 5
+
+
+
+
+
+bzip2(1) bzip2(1)
+
+
+R\bRE\bEC\bCO\bOV\bVE\bER\bRI\bIN\bNG\bG D\bDA\bAT\bTA\bA F\bFR\bRO\bOM\bM D\bDA\bAM\bMA\bAG\bGE\bED\bD F\bFI\bIL\bLE\bES\bS
+ _\bb_\bz_\bi_\bp_\b2 compresses files in blocks, usually 900kbytes long.
+ Each block is handled independently. If a media or trans-
+ mission error causes a multi-block .bz2 file to become
+ damaged, it may be possible to recover data from the
+ undamaged blocks in the file.
+
+ The compressed representation of each block is delimited
+ by a 48-bit pattern, which makes it possible to find the
+ block boundaries with reasonable certainty. Each block
+ also carries its own 32-bit CRC, so damaged blocks can be
+ distinguished from undamaged ones.
+
+ _\bb_\bz_\bi_\bp_\b2_\br_\be_\bc_\bo_\bv_\be_\br is a simple program whose purpose is to
+ search for blocks in .bz2 files, and write each block out
+ into its own .bz2 file. You can then use _\bb_\bz_\bi_\bp_\b2 -t to test
+ the integrity of the resulting files, and decompress those
+ which are undamaged.
+
+ _\bb_\bz_\bi_\bp_\b2_\br_\be_\bc_\bo_\bv_\be_\br takes a single argument, the name of the dam-
+ aged file, and writes a number of files "rec0001file.bz2",
+ "rec0002file.bz2", etc, containing the extracted blocks.
+ The output filenames are designed so that the use of
+ wildcards in subsequent processing -- for example, "bzip2
+ -dc rec*file.bz2 > recovered_data" -- lists the files in
+ the correct order.
+
+ _\bb_\bz_\bi_\bp_\b2_\br_\be_\bc_\bo_\bv_\be_\br should be of most use dealing with large .bz2
+ files, as these will contain many blocks. It is clearly
+ futile to use it on damaged single-block files, since a
+ damaged block cannot be recovered. If you wish to min-
+ imise any potential data loss through media or transmis-
+ sion errors, you might consider compressing with a smaller
+ block size.
+
+
+P\bPE\bER\bRF\bFO\bOR\bRM\bMA\bAN\bNC\bCE\bE N\bNO\bOT\bTE\bES\bS
+ The sorting phase of compression gathers together similar
+ strings in the file. Because of this, files containing
+ very long runs of repeated symbols, like "aabaabaabaab
+ ..." (repeated several hundred times) may compress more
+ slowly than normal. Versions 0.9.5 and above fare much
+ better than previous versions in this respect. The ratio
+ between worst-case and average-case compression time is in
+ the region of 10:1. For previous versions, this figure
+ was more like 100:1. You can use the -vvvv option to mon-
+ itor progress in great detail, if you want.
+
+ Decompression speed is unaffected by these phenomena.
+
+ _\bb_\bz_\bi_\bp_\b2 usually allocates several megabytes of memory to
+ operate in, and then charges all over it in a fairly ran-
+ dom fashion. This means that performance, both for com-
+ pressing and decompressing, is largely determined by the
+
+
+
+ 6
+
+
+
+
+
+bzip2(1) bzip2(1)
+
+
+ speed at which your machine can service cache misses.
+ Because of this, small changes to the code to reduce the
+ miss rate have been observed to give disproportionately
+ large performance improvements. I imagine _\bb_\bz_\bi_\bp_\b2 will per-
+ form best on machines with very large caches.
+
+
+C\bCA\bAV\bVE\bEA\bAT\bTS\bS
+ I/O error messages are not as helpful as they could be.
+ _\bb_\bz_\bi_\bp_\b2 tries hard to detect I/O errors and exit cleanly,
+ but the details of what the problem is sometimes seem
+ rather misleading.
+
+ This manual page pertains to version 1.0 of _\bb_\bz_\bi_\bp_\b2_\b. Com-
+ pressed data created by this version is entirely forwards
+ and backwards compatible with the previous public
+ releases, versions 0.1pl2, 0.9.0 and 0.9.5, but with the
+ following exception: 0.9.0 and above can correctly decom-
+ press multiple concatenated compressed files. 0.1pl2 can-
+ not do this; it will stop after decompressing just the
+ first file in the stream.
+
+ _\bb_\bz_\bi_\bp_\b2_\br_\be_\bc_\bo_\bv_\be_\br uses 32-bit integers to represent bit posi-
+ tions in compressed files, so it cannot handle compressed
+ files more than 512 megabytes long. This could easily be
+ fixed.
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Julian Seward, jseward@acm.org.
+
+ http://sourceware.cygnus.com/bzip2
+ http://www.muraroa.demon.co.uk
+
+ The ideas embodied in _\bb_\bz_\bi_\bp_\b2 are due to (at least) the fol-
+ lowing people: Michael Burrows and David Wheeler (for the
+ block sorting transformation), David Wheeler (again, for
+ the Huffman coder), Peter Fenwick (for the structured cod-
+ ing model in the original _\bb_\bz_\bi_\bp_\b, and many refinements), and
+ Alistair Moffat, Radford Neal and Ian Witten (for the
+ arithmetic coder in the original _\bb_\bz_\bi_\bp_\b)_\b. I am much
+ indebted for their help, support and advice. See the man-
+ ual in the source distribution for pointers to sources of
+ documentation. Christian von Roques encouraged me to look
+ for faster sorting algorithms, so as to speed up compres-
+ sion. Bela Lubkin encouraged me to improve the worst-case
+ compression performance. Many people sent patches, helped
+ with portability problems, lent machines, gave advice and
+ were generally helpful.
+
+
+
+
+
+
+
+
+ 7
+
+
--- /dev/null
+
+/*-----------------------------------------------------------*/
+/*--- A block-sorting, lossless compressor bzip2.c ---*/
+/*-----------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+/*----------------------------------------------------*/
+/*--- IMPORTANT ---*/
+/*----------------------------------------------------*/
+
+/*--
+ WARNING:
+ This program and library (attempts to) compress data by
+ performing several non-trivial transformations on it.
+ Unless you are 100% familiar with *all* the algorithms
+ contained herein, and with the consequences of modifying them,
+ you should NOT meddle with the compression or decompression
+ machinery. Incorrect changes can and very likely *will*
+ lead to disasterous loss of data.
+
+ DISCLAIMER:
+ I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE
+ USE OF THIS PROGRAM, HOWSOEVER CAUSED.
+
+ Every compression of a file implies an assumption that the
+ compressed file can be decompressed to reproduce the original.
+ Great efforts in design, coding and testing have been made to
+ ensure that this program works correctly. However, the
+ complexity of the algorithms, and, in particular, the presence
+ of various special cases in the code which occur with very low
+ but non-zero probability make it impossible to rule out the
+ possibility of bugs remaining in the program. DO NOT COMPRESS
+ ANY DATA WITH THIS PROGRAM AND/OR LIBRARY UNLESS YOU ARE PREPARED
+ TO ACCEPT THE POSSIBILITY, HOWEVER SMALL, THAT THE DATA WILL
+ NOT BE RECOVERABLE.
+
+ That is not to say this program is inherently unreliable.
+ Indeed, I very much hope the opposite is true. bzip2/libbzip2
+ has been carefully constructed and extensively tested.
+
+ PATENTS:
+ To the best of my knowledge, bzip2/libbzip2 does not use any
+ patented algorithms. However, I do not have the resources
+ available to carry out a full patent search. Therefore I cannot
+ give any guarantee of the above statement.
+--*/
+
+
+
+/*----------------------------------------------------*/
+/*--- and now for something much more pleasant :-) ---*/
+/*----------------------------------------------------*/
+
+/*---------------------------------------------*/
+/*--
+ Place a 1 beside your platform, and 0 elsewhere.
+--*/
+
+/*--
+ Generic 32-bit Unix.
+ Also works on 64-bit Unix boxes.
+--*/
+#define BZ_UNIX 1
+
+/*--
+ Win32, as seen by Jacob Navia's excellent
+ port of (Chris Fraser & David Hanson)'s excellent
+ lcc compiler.
+--*/
+#define BZ_LCCWIN32 0
+
+#if defined(_WIN32) && !defined(__CYGWIN__)
+#undef BZ_LCCWIN32
+#define BZ_LCCWIN32 1
+#undef BZ_UNIX
+#define BZ_UNIX 0
+#endif
+
+
+/*---------------------------------------------*/
+/*--
+ Some stuff for all platforms.
+--*/
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <signal.h>
+#include <math.h>
+#include <errno.h>
+#include <ctype.h>
+#include "bzlib.h"
+
+#define ERROR_IF_EOF(i) { if ((i) == EOF) ioError(); }
+#define ERROR_IF_NOT_ZERO(i) { if ((i) != 0) ioError(); }
+#define ERROR_IF_MINUS_ONE(i) { if ((i) == (-1)) ioError(); }
+
+
+/*---------------------------------------------*/
+/*--
+ Platform-specific stuff.
+--*/
+
+#if BZ_UNIX
+# include <sys/types.h>
+# include <utime.h>
+# include <unistd.h>
+# include <sys/stat.h>
+# include <sys/times.h>
+
+# define PATH_SEP '/'
+# define MY_LSTAT lstat
+# define MY_S_IFREG S_ISREG
+# define MY_STAT stat
+
+# define APPEND_FILESPEC(root, name) \
+ root=snocString((root), (name))
+
+# define APPEND_FLAG(root, name) \
+ root=snocString((root), (name))
+
+# define SET_BINARY_MODE(fd) /**/
+
+# ifdef __GNUC__
+# define NORETURN __attribute__ ((noreturn))
+# else
+# define NORETURN /**/
+# endif
+# ifdef __DJGPP__
+# include <io.h>
+# include <fcntl.h>
+# undef MY_LSTAT
+# define MY_LSTAT stat
+# undef SET_BINARY_MODE
+# define SET_BINARY_MODE(fd) \
+ do { \
+ int retVal = setmode ( fileno ( fd ), \
+ O_BINARY ); \
+ ERROR_IF_MINUS_ONE ( retVal ); \
+ } while ( 0 )
+# endif
+# ifdef __CYGWIN__
+# include <io.h>
+# include <fcntl.h>
+# undef SET_BINARY_MODE
+# define SET_BINARY_MODE(fd) \
+ do { \
+ int retVal = setmode ( fileno ( fd ), \
+ O_BINARY ); \
+ ERROR_IF_MINUS_ONE ( retVal ); \
+ } while ( 0 )
+# endif
+#endif
+
+
+
+#if BZ_LCCWIN32
+# include <io.h>
+# include <fcntl.h>
+# include <sys\stat.h>
+
+# define NORETURN /**/
+# define PATH_SEP '\\'
+# define MY_LSTAT _stat
+# define MY_STAT _stat
+# define MY_S_IFREG(x) ((x) & _S_IFREG)
+
+# define APPEND_FLAG(root, name) \
+ root=snocString((root), (name))
+
+# if 0
+ /*-- lcc-win32 seems to expand wildcards itself --*/
+# define APPEND_FILESPEC(root, spec) \
+ do { \
+ if ((spec)[0] == '-') { \
+ root = snocString((root), (spec)); \
+ } else { \
+ struct _finddata_t c_file; \
+ long hFile; \
+ hFile = _findfirst((spec), &c_file); \
+ if ( hFile == -1L ) { \
+ root = snocString ((root), (spec)); \
+ } else { \
+ int anInt = 0; \
+ while ( anInt == 0 ) { \
+ root = snocString((root), \
+ &c_file.name[0]); \
+ anInt = _findnext(hFile, &c_file); \
+ } \
+ } \
+ } \
+ } while ( 0 )
+# else
+# define APPEND_FILESPEC(root, name) \
+ root = snocString ((root), (name))
+# endif
+
+# define SET_BINARY_MODE(fd) \
+ do { \
+ int retVal = setmode ( fileno ( fd ), \
+ O_BINARY ); \
+ ERROR_IF_MINUS_ONE ( retVal ); \
+ } while ( 0 )
+
+#endif
+
+
+/*---------------------------------------------*/
+/*--
+ Some more stuff for all platforms :-)
+--*/
+
+typedef char Char;
+typedef unsigned char Bool;
+typedef unsigned char UChar;
+typedef int Int32;
+typedef unsigned int UInt32;
+typedef short Int16;
+typedef unsigned short UInt16;
+
+#define True ((Bool)1)
+#define False ((Bool)0)
+
+/*--
+ IntNative is your platform's `native' int size.
+ Only here to avoid probs with 64-bit platforms.
+--*/
+typedef int IntNative;
+
+
+/*---------------------------------------------------*/
+/*--- Misc (file handling) data decls ---*/
+/*---------------------------------------------------*/
+
+Int32 verbosity;
+Bool keepInputFiles, smallMode, deleteOutputOnInterrupt;
+Bool forceOverwrite, testFailsExist, unzFailsExist, noisy;
+Int32 numFileNames, numFilesProcessed, blockSize100k;
+Int32 exitValue;
+
+/*-- source modes; F==file, I==stdin, O==stdout --*/
+#define SM_I2O 1
+#define SM_F2O 2
+#define SM_F2F 3
+
+/*-- operation modes --*/
+#define OM_Z 1
+#define OM_UNZ 2
+#define OM_TEST 3
+
+Int32 opMode;
+Int32 srcMode;
+
+#define FILE_NAME_LEN 1034
+
+Int32 longestFileName;
+Char inName [FILE_NAME_LEN];
+Char outName[FILE_NAME_LEN];
+Char tmpName[FILE_NAME_LEN];
+Char *progName;
+Char progNameReally[FILE_NAME_LEN];
+FILE *outputHandleJustInCase;
+Int32 workFactor;
+
+static void panic ( Char* ) NORETURN;
+static void ioError ( void ) NORETURN;
+static void outOfMemory ( void ) NORETURN;
+static void configError ( void ) NORETURN;
+static void crcError ( void ) NORETURN;
+static void cleanUpAndFail ( Int32 ) NORETURN;
+static void compressedStreamEOF ( void ) NORETURN;
+
+static void copyFileName ( Char*, Char* );
+static void* myMalloc ( Int32 );
+
+
+
+/*---------------------------------------------------*/
+/*--- An implementation of 64-bit ints. Sigh. ---*/
+/*--- Roll on widespread deployment of ANSI C9X ! ---*/
+/*---------------------------------------------------*/
+
+typedef
+ struct { UChar b[8]; }
+ UInt64;
+
+static
+void uInt64_from_UInt32s ( UInt64* n, UInt32 lo32, UInt32 hi32 )
+{
+ n->b[7] = (UChar)((hi32 >> 24) & 0xFF);
+ n->b[6] = (UChar)((hi32 >> 16) & 0xFF);
+ n->b[5] = (UChar)((hi32 >> 8) & 0xFF);
+ n->b[4] = (UChar) (hi32 & 0xFF);
+ n->b[3] = (UChar)((lo32 >> 24) & 0xFF);
+ n->b[2] = (UChar)((lo32 >> 16) & 0xFF);
+ n->b[1] = (UChar)((lo32 >> 8) & 0xFF);
+ n->b[0] = (UChar) (lo32 & 0xFF);
+}
+
+static
+double uInt64_to_double ( UInt64* n )
+{
+ Int32 i;
+ double base = 1.0;
+ double sum = 0.0;
+ for (i = 0; i < 8; i++) {
+ sum += base * (double)(n->b[i]);
+ base *= 256.0;
+ }
+ return sum;
+}
+
+static
+void uInt64_add ( UInt64* src, UInt64* dst )
+{
+ Int32 i;
+ Int32 carry = 0;
+ for (i = 0; i < 8; i++) {
+ carry += ( ((Int32)src->b[i]) + ((Int32)dst->b[i]) );
+ dst->b[i] = (UChar)(carry & 0xFF);
+ carry >>= 8;
+ }
+}
+
+static
+void uInt64_sub ( UInt64* src, UInt64* dst )
+{
+ Int32 t, i;
+ Int32 borrow = 0;
+ for (i = 0; i < 8; i++) {
+ t = ((Int32)dst->b[i]) - ((Int32)src->b[i]) - borrow;
+ if (t < 0) {
+ dst->b[i] = (UChar)(t + 256);
+ borrow = 1;
+ } else {
+ dst->b[i] = (UChar)t;
+ borrow = 0;
+ }
+ }
+}
+
+static
+void uInt64_mul ( UInt64* a, UInt64* b, UInt64* r_hi, UInt64* r_lo )
+{
+ UChar sum[16];
+ Int32 ia, ib, carry;
+ for (ia = 0; ia < 16; ia++) sum[ia] = 0;
+ for (ia = 0; ia < 8; ia++) {
+ carry = 0;
+ for (ib = 0; ib < 8; ib++) {
+ carry += ( ((Int32)sum[ia+ib])
+ + ((Int32)a->b[ia]) * ((Int32)b->b[ib]) );
+ sum[ia+ib] = (UChar)(carry & 0xFF);
+ carry >>= 8;
+ }
+ sum[ia+8] = (UChar)(carry & 0xFF);
+ if ((carry >>= 8) != 0) panic ( "uInt64_mul" );
+ }
+
+ for (ia = 0; ia < 8; ia++) r_hi->b[ia] = sum[ia+8];
+ for (ia = 0; ia < 8; ia++) r_lo->b[ia] = sum[ia];
+}
+
+
+static
+void uInt64_shr1 ( UInt64* n )
+{
+ Int32 i;
+ for (i = 0; i < 8; i++) {
+ n->b[i] >>= 1;
+ if (i < 7 && (n->b[i+1] & 1)) n->b[i] |= 0x80;
+ }
+}
+
+static
+void uInt64_shl1 ( UInt64* n )
+{
+ Int32 i;
+ for (i = 7; i >= 0; i--) {
+ n->b[i] <<= 1;
+ if (i > 0 && (n->b[i-1] & 0x80)) n->b[i]++;
+ }
+}
+
+static
+Bool uInt64_isZero ( UInt64* n )
+{
+ Int32 i;
+ for (i = 0; i < 8; i++)
+ if (n->b[i] != 0) return 0;
+ return 1;
+}
+
+static
+Int32 uInt64_qrm10 ( UInt64* n )
+{
+ /* Divide *n by 10, and return the remainder. Long division
+ is difficult, so we cheat and instead multiply by
+ 0xCCCC CCCC CCCC CCCD, which is 0.8 (viz, 0.1 << 3).
+ */
+ Int32 i;
+ UInt64 tmp1, tmp2, n_orig, zero_point_eight;
+
+ zero_point_eight.b[1] = zero_point_eight.b[2] =
+ zero_point_eight.b[3] = zero_point_eight.b[4] =
+ zero_point_eight.b[5] = zero_point_eight.b[6] =
+ zero_point_eight.b[7] = 0xCC;
+ zero_point_eight.b[0] = 0xCD;
+
+ n_orig = *n;
+
+ /* divide n by 10,
+ by multiplying by 0.8 and then shifting right 3 times */
+ uInt64_mul ( n, &zero_point_eight, &tmp1, &tmp2 );
+ uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); uInt64_shr1(&tmp1);
+ *n = tmp1;
+
+ /* tmp1 = 8*n, tmp2 = 2*n */
+ uInt64_shl1(&tmp1); uInt64_shl1(&tmp1); uInt64_shl1(&tmp1);
+ tmp2 = *n; uInt64_shl1(&tmp2);
+
+ /* tmp1 = 10*n */
+ uInt64_add ( &tmp2, &tmp1 );
+
+ /* n_orig = n_orig - 10*n */
+ uInt64_sub ( &tmp1, &n_orig );
+
+ /* n_orig should now hold quotient, in range 0 .. 9 */
+ for (i = 7; i >= 1; i--)
+ if (n_orig.b[i] != 0) panic ( "uInt64_qrm10(1)" );
+ if (n_orig.b[0] > 9)
+ panic ( "uInt64_qrm10(2)" );
+
+ return (int)n_orig.b[0];
+}
+
+/* ... and the Whole Entire Point of all this UInt64 stuff is
+ so that we can supply the following function.
+*/
+static
+void uInt64_toAscii ( char* outbuf, UInt64* n )
+{
+ Int32 i, q;
+ UChar buf[32];
+ Int32 nBuf = 0;
+ UInt64 n_copy = *n;
+ do {
+ q = uInt64_qrm10 ( &n_copy );
+ buf[nBuf] = q + '0';
+ nBuf++;
+ } while (!uInt64_isZero(&n_copy));
+ outbuf[nBuf] = 0;
+ for (i = 0; i < nBuf; i++) outbuf[i] = buf[nBuf-i-1];
+}
+
+
+/*---------------------------------------------------*/
+/*--- Processing of complete files and streams ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+Bool myfeof ( FILE* f )
+{
+ Int32 c = fgetc ( f );
+ if (c == EOF) return True;
+ ungetc ( c, f );
+ return False;
+}
+
+
+/*---------------------------------------------*/
+static
+void compressStream ( FILE *stream, FILE *zStream )
+{
+ BZFILE* bzf = NULL;
+ UChar ibuf[5000];
+ Int32 nIbuf;
+ UInt32 nbytes_in_lo32, nbytes_in_hi32;
+ UInt32 nbytes_out_lo32, nbytes_out_hi32;
+ Int32 bzerr, bzerr_dummy, ret;
+
+ SET_BINARY_MODE(stream);
+ SET_BINARY_MODE(zStream);
+
+ if (ferror(stream)) goto errhandler_io;
+ if (ferror(zStream)) goto errhandler_io;
+
+ bzf = BZ2_bzWriteOpen ( &bzerr, zStream,
+ blockSize100k, verbosity, workFactor );
+ if (bzerr != BZ_OK) goto errhandler;
+
+ if (verbosity >= 2) fprintf ( stderr, "\n" );
+
+ while (True) {
+
+ if (myfeof(stream)) break;
+ nIbuf = fread ( ibuf, sizeof(UChar), 5000, stream );
+ if (ferror(stream)) goto errhandler_io;
+ if (nIbuf > 0) BZ2_bzWrite ( &bzerr, bzf, (void*)ibuf, nIbuf );
+ if (bzerr != BZ_OK) goto errhandler;
+
+ }
+
+ BZ2_bzWriteClose64 ( &bzerr, bzf, 0,
+ &nbytes_in_lo32, &nbytes_in_hi32,
+ &nbytes_out_lo32, &nbytes_out_hi32 );
+ if (bzerr != BZ_OK) goto errhandler;
+
+ if (ferror(zStream)) goto errhandler_io;
+ ret = fflush ( zStream );
+ if (ret == EOF) goto errhandler_io;
+ if (zStream != stdout) {
+ ret = fclose ( zStream );
+ if (ret == EOF) goto errhandler_io;
+ }
+ if (ferror(stream)) goto errhandler_io;
+ ret = fclose ( stream );
+ if (ret == EOF) goto errhandler_io;
+
+ if (nbytes_in_lo32 == 0 && nbytes_in_hi32 == 0)
+ nbytes_in_lo32 = 1;
+
+ if (verbosity >= 1) {
+ Char buf_nin[32], buf_nout[32];
+ UInt64 nbytes_in, nbytes_out;
+ double nbytes_in_d, nbytes_out_d;
+ uInt64_from_UInt32s ( &nbytes_in,
+ nbytes_in_lo32, nbytes_in_hi32 );
+ uInt64_from_UInt32s ( &nbytes_out,
+ nbytes_out_lo32, nbytes_out_hi32 );
+ nbytes_in_d = uInt64_to_double ( &nbytes_in );
+ nbytes_out_d = uInt64_to_double ( &nbytes_out );
+ uInt64_toAscii ( buf_nin, &nbytes_in );
+ uInt64_toAscii ( buf_nout, &nbytes_out );
+ fprintf ( stderr, "%6.3f:1, %6.3f bits/byte, "
+ "%5.2f%% saved, %s in, %s out.\n",
+ nbytes_in_d / nbytes_out_d,
+ (8.0 * nbytes_out_d) / nbytes_in_d,
+ 100.0 * (1.0 - nbytes_out_d / nbytes_in_d),
+ buf_nin,
+ buf_nout
+ );
+ }
+
+ return;
+
+ errhandler:
+ BZ2_bzWriteClose64 ( &bzerr_dummy, bzf, 1,
+ &nbytes_in_lo32, &nbytes_in_hi32,
+ &nbytes_out_lo32, &nbytes_out_hi32 );
+ switch (bzerr) {
+ case BZ_CONFIG_ERROR:
+ configError(); break;
+ case BZ_MEM_ERROR:
+ outOfMemory (); break;
+ case BZ_IO_ERROR:
+ errhandler_io:
+ ioError(); break;
+ default:
+ panic ( "compress:unexpected error" );
+ }
+
+ panic ( "compress:end" );
+ /*notreached*/
+}
+
+
+
+/*---------------------------------------------*/
+static
+Bool uncompressStream ( FILE *zStream, FILE *stream )
+{
+ BZFILE* bzf = NULL;
+ Int32 bzerr, bzerr_dummy, ret, nread, streamNo, i;
+ UChar obuf[5000];
+ UChar unused[BZ_MAX_UNUSED];
+ Int32 nUnused;
+ UChar* unusedTmp;
+
+ nUnused = 0;
+ streamNo = 0;
+
+ SET_BINARY_MODE(stream);
+ SET_BINARY_MODE(zStream);
+
+ if (ferror(stream)) goto errhandler_io;
+ if (ferror(zStream)) goto errhandler_io;
+
+ while (True) {
+
+ bzf = BZ2_bzReadOpen (
+ &bzerr, zStream, verbosity,
+ (int)smallMode, unused, nUnused
+ );
+ if (bzf == NULL || bzerr != BZ_OK) goto errhandler;
+ streamNo++;
+
+ while (bzerr == BZ_OK) {
+ nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 );
+ if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler;
+ if ((bzerr == BZ_OK || bzerr == BZ_STREAM_END) && nread > 0)
+ fwrite ( obuf, sizeof(UChar), nread, stream );
+ if (ferror(stream)) goto errhandler_io;
+ }
+ if (bzerr != BZ_STREAM_END) goto errhandler;
+
+ BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused );
+ if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" );
+
+ for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i];
+
+ BZ2_bzReadClose ( &bzerr, bzf );
+ if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" );
+
+ if (nUnused == 0 && myfeof(zStream)) break;
+
+ }
+
+ if (ferror(zStream)) goto errhandler_io;
+ ret = fclose ( zStream );
+ if (ret == EOF) goto errhandler_io;
+
+ if (ferror(stream)) goto errhandler_io;
+ ret = fflush ( stream );
+ if (ret != 0) goto errhandler_io;
+ if (stream != stdout) {
+ ret = fclose ( stream );
+ if (ret == EOF) goto errhandler_io;
+ }
+ if (verbosity >= 2) fprintf ( stderr, "\n " );
+ return True;
+
+ errhandler:
+ BZ2_bzReadClose ( &bzerr_dummy, bzf );
+ switch (bzerr) {
+ case BZ_CONFIG_ERROR:
+ configError(); break;
+ case BZ_IO_ERROR:
+ errhandler_io:
+ ioError(); break;
+ case BZ_DATA_ERROR:
+ crcError();
+ case BZ_MEM_ERROR:
+ outOfMemory();
+ case BZ_UNEXPECTED_EOF:
+ compressedStreamEOF();
+ case BZ_DATA_ERROR_MAGIC:
+ if (zStream != stdin) fclose(zStream);
+ if (stream != stdout) fclose(stream);
+ if (streamNo == 1) {
+ return False;
+ } else {
+ if (noisy)
+ fprintf ( stderr,
+ "\n%s: %s: trailing garbage after EOF ignored\n",
+ progName, inName );
+ return True;
+ }
+ default:
+ panic ( "decompress:unexpected error" );
+ }
+
+ panic ( "decompress:end" );
+ return True; /*notreached*/
+}
+
+
+/*---------------------------------------------*/
+static
+Bool testStream ( FILE *zStream )
+{
+ BZFILE* bzf = NULL;
+ Int32 bzerr, bzerr_dummy, ret, nread, streamNo, i;
+ UChar obuf[5000];
+ UChar unused[BZ_MAX_UNUSED];
+ Int32 nUnused;
+ UChar* unusedTmp;
+
+ nUnused = 0;
+ streamNo = 0;
+
+ SET_BINARY_MODE(zStream);
+ if (ferror(zStream)) goto errhandler_io;
+
+ while (True) {
+
+ bzf = BZ2_bzReadOpen (
+ &bzerr, zStream, verbosity,
+ (int)smallMode, unused, nUnused
+ );
+ if (bzf == NULL || bzerr != BZ_OK) goto errhandler;
+ streamNo++;
+
+ while (bzerr == BZ_OK) {
+ nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 );
+ if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler;
+ }
+ if (bzerr != BZ_STREAM_END) goto errhandler;
+
+ BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused );
+ if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" );
+
+ for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i];
+
+ BZ2_bzReadClose ( &bzerr, bzf );
+ if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" );
+ if (nUnused == 0 && myfeof(zStream)) break;
+
+ }
+
+ if (ferror(zStream)) goto errhandler_io;
+ ret = fclose ( zStream );
+ if (ret == EOF) goto errhandler_io;
+
+ if (verbosity >= 2) fprintf ( stderr, "\n " );
+ return True;
+
+ errhandler:
+ BZ2_bzReadClose ( &bzerr_dummy, bzf );
+ if (verbosity == 0)
+ fprintf ( stderr, "%s: %s: ", progName, inName );
+ switch (bzerr) {
+ case BZ_CONFIG_ERROR:
+ configError(); break;
+ case BZ_IO_ERROR:
+ errhandler_io:
+ ioError(); break;
+ case BZ_DATA_ERROR:
+ fprintf ( stderr,
+ "data integrity (CRC) error in data\n" );
+ return False;
+ case BZ_MEM_ERROR:
+ outOfMemory();
+ case BZ_UNEXPECTED_EOF:
+ fprintf ( stderr,
+ "file ends unexpectedly\n" );
+ return False;
+ case BZ_DATA_ERROR_MAGIC:
+ if (zStream != stdin) fclose(zStream);
+ if (streamNo == 1) {
+ fprintf ( stderr,
+ "bad magic number (file not created by bzip2)\n" );
+ return False;
+ } else {
+ if (noisy)
+ fprintf ( stderr,
+ "trailing garbage after EOF ignored\n" );
+ return True;
+ }
+ default:
+ panic ( "test:unexpected error" );
+ }
+
+ panic ( "test:end" );
+ return True; /*notreached*/
+}
+
+
+/*---------------------------------------------------*/
+/*--- Error [non-] handling grunge ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+void setExit ( Int32 v )
+{
+ if (v > exitValue) exitValue = v;
+}
+
+
+/*---------------------------------------------*/
+static
+void cadvise ( void )
+{
+ if (noisy)
+ fprintf (
+ stderr,
+ "\nIt is possible that the compressed file(s) have become corrupted.\n"
+ "You can use the -tvv option to test integrity of such files.\n\n"
+ "You can use the `bzip2recover' program to *attempt* to recover\n"
+ "data from undamaged sections of corrupted files.\n\n"
+ );
+}
+
+
+/*---------------------------------------------*/
+static
+void showFileNames ( void )
+{
+ if (noisy)
+ fprintf (
+ stderr,
+ "\tInput file = %s, output file = %s\n",
+ inName, outName
+ );
+}
+
+
+/*---------------------------------------------*/
+static
+void cleanUpAndFail ( Int32 ec )
+{
+ IntNative retVal;
+
+ if ( srcMode == SM_F2F
+ && opMode != OM_TEST
+ && deleteOutputOnInterrupt ) {
+ if (noisy)
+ fprintf ( stderr, "%s: Deleting output file %s, if it exists.\n",
+ progName, outName );
+ if (outputHandleJustInCase != NULL)
+ fclose ( outputHandleJustInCase );
+ retVal = remove ( outName );
+ if (retVal != 0)
+ fprintf ( stderr,
+ "%s: WARNING: deletion of output file (apparently) failed.\n",
+ progName );
+ }
+ if (noisy && numFileNames > 0 && numFilesProcessed < numFileNames) {
+ fprintf ( stderr,
+ "%s: WARNING: some files have not been processed:\n"
+ "\t%d specified on command line, %d not processed yet.\n\n",
+ progName, numFileNames,
+ numFileNames - numFilesProcessed );
+ }
+ setExit(ec);
+ exit(exitValue);
+}
+
+
+/*---------------------------------------------*/
+static
+void panic ( Char* s )
+{
+ fprintf ( stderr,
+ "\n%s: PANIC -- internal consistency error:\n"
+ "\t%s\n"
+ "\tThis is a BUG. Please report it to me at:\n"
+ "\tjseward@acm.org\n",
+ progName, s );
+ showFileNames();
+ cleanUpAndFail( 3 );
+}
+
+
+/*---------------------------------------------*/
+static
+void crcError ( void )
+{
+ fprintf ( stderr,
+ "\n%s: Data integrity error when decompressing.\n",
+ progName );
+ showFileNames();
+ cadvise();
+ cleanUpAndFail( 2 );
+}
+
+
+/*---------------------------------------------*/
+static
+void compressedStreamEOF ( void )
+{
+ fprintf ( stderr,
+ "\n%s: Compressed file ends unexpectedly;\n\t"
+ "perhaps it is corrupted? *Possible* reason follows.\n",
+ progName );
+ perror ( progName );
+ showFileNames();
+ cadvise();
+ cleanUpAndFail( 2 );
+}
+
+
+/*---------------------------------------------*/
+static
+void ioError ( void )
+{
+ fprintf ( stderr,
+ "\n%s: I/O or other error, bailing out. "
+ "Possible reason follows.\n",
+ progName );
+ perror ( progName );
+ showFileNames();
+ cleanUpAndFail( 1 );
+}
+
+
+/*---------------------------------------------*/
+static
+void mySignalCatcher ( IntNative n )
+{
+ fprintf ( stderr,
+ "\n%s: Control-C or similar caught, quitting.\n",
+ progName );
+ cleanUpAndFail(1);
+}
+
+
+/*---------------------------------------------*/
+static
+void mySIGSEGVorSIGBUScatcher ( IntNative n )
+{
+ if (opMode == OM_Z)
+ fprintf (
+ stderr,
+ "\n%s: Caught a SIGSEGV or SIGBUS whilst compressing.\n"
+ "\n"
+ " Possible causes are (most likely first):\n"
+ " (1) This computer has unreliable memory or cache hardware\n"
+ " (a surprisingly common problem; try a different machine.)\n"
+ " (2) A bug in the compiler used to create this executable\n"
+ " (unlikely, if you didn't compile bzip2 yourself.)\n"
+ " (3) A real bug in bzip2 -- I hope this should never be the case.\n"
+ " The user's manual, Section 4.3, has more info on (1) and (2).\n"
+ " \n"
+ " If you suspect this is a bug in bzip2, or are unsure about (1)\n"
+ " or (2), feel free to report it to me at: jseward@acm.org.\n"
+ " Section 4.3 of the user's manual describes the info a useful\n"
+ " bug report should have. If the manual is available on your\n"
+ " system, please try and read it before mailing me. If you don't\n"
+ " have the manual or can't be bothered to read it, mail me anyway.\n"
+ "\n",
+ progName );
+ else
+ fprintf (
+ stderr,
+ "\n%s: Caught a SIGSEGV or SIGBUS whilst decompressing.\n"
+ "\n"
+ " Possible causes are (most likely first):\n"
+ " (1) The compressed data is corrupted, and bzip2's usual checks\n"
+ " failed to detect this. Try bzip2 -tvv my_file.bz2.\n"
+ " (2) This computer has unreliable memory or cache hardware\n"
+ " (a surprisingly common problem; try a different machine.)\n"
+ " (3) A bug in the compiler used to create this executable\n"
+ " (unlikely, if you didn't compile bzip2 yourself.)\n"
+ " (4) A real bug in bzip2 -- I hope this should never be the case.\n"
+ " The user's manual, Section 4.3, has more info on (2) and (3).\n"
+ " \n"
+ " If you suspect this is a bug in bzip2, or are unsure about (2)\n"
+ " or (3), feel free to report it to me at: jseward@acm.org.\n"
+ " Section 4.3 of the user's manual describes the info a useful\n"
+ " bug report should have. If the manual is available on your\n"
+ " system, please try and read it before mailing me. If you don't\n"
+ " have the manual or can't be bothered to read it, mail me anyway.\n"
+ "\n",
+ progName );
+
+ showFileNames();
+ if (opMode == OM_Z)
+ cleanUpAndFail( 3 ); else
+ { cadvise(); cleanUpAndFail( 2 ); }
+}
+
+
+/*---------------------------------------------*/
+static
+void outOfMemory ( void )
+{
+ fprintf ( stderr,
+ "\n%s: couldn't allocate enough memory\n",
+ progName );
+ showFileNames();
+ cleanUpAndFail(1);
+}
+
+
+/*---------------------------------------------*/
+static
+void configError ( void )
+{
+ fprintf ( stderr,
+ "bzip2: I'm not configured correctly for this platform!\n"
+ "\tI require Int32, Int16 and Char to have sizes\n"
+ "\tof 4, 2 and 1 bytes to run properly, and they don't.\n"
+ "\tProbably you can fix this by defining them correctly,\n"
+ "\tand recompiling. Bye!\n" );
+ setExit(3);
+ exit(exitValue);
+}
+
+
+/*---------------------------------------------------*/
+/*--- The main driver machinery ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+void pad ( Char *s )
+{
+ Int32 i;
+ if ( (Int32)strlen(s) >= longestFileName ) return;
+ for (i = 1; i <= longestFileName - (Int32)strlen(s); i++)
+ fprintf ( stderr, " " );
+}
+
+
+/*---------------------------------------------*/
+static
+void copyFileName ( Char* to, Char* from )
+{
+ if ( strlen(from) > FILE_NAME_LEN-10 ) {
+ fprintf (
+ stderr,
+ "bzip2: file name\n`%s'\n"
+ "is suspiciously (more than %d chars) long.\n"
+ "Try using a reasonable file name instead. Sorry! :-)\n",
+ from, FILE_NAME_LEN-10
+ );
+ setExit(1);
+ exit(exitValue);
+ }
+
+ strncpy(to,from,FILE_NAME_LEN-10);
+ to[FILE_NAME_LEN-10]='\0';
+}
+
+
+/*---------------------------------------------*/
+static
+Bool fileExists ( Char* name )
+{
+ FILE *tmp = fopen ( name, "rb" );
+ Bool exists = (tmp != NULL);
+ if (tmp != NULL) fclose ( tmp );
+ return exists;
+}
+
+
+/*---------------------------------------------*/
+/*--
+ if in doubt, return True
+--*/
+static
+Bool notAStandardFile ( Char* name )
+{
+ IntNative i;
+ struct MY_STAT statBuf;
+
+ i = MY_LSTAT ( name, &statBuf );
+ if (i != 0) return True;
+ if (MY_S_IFREG(statBuf.st_mode)) return False;
+ return True;
+}
+
+
+/*---------------------------------------------*/
+/*--
+ rac 11/21/98 see if file has hard links to it
+--*/
+static
+Int32 countHardLinks ( Char* name )
+{
+ IntNative i;
+ struct MY_STAT statBuf;
+
+ i = MY_LSTAT ( name, &statBuf );
+ if (i != 0) return 0;
+ return (statBuf.st_nlink - 1);
+}
+
+
+/*---------------------------------------------*/
+static
+void copyDatePermissionsAndOwner ( Char *srcName, Char *dstName )
+{
+#if BZ_UNIX
+ IntNative retVal;
+ struct MY_STAT statBuf;
+ struct utimbuf uTimBuf;
+
+ retVal = MY_LSTAT ( srcName, &statBuf );
+ ERROR_IF_NOT_ZERO ( retVal );
+ uTimBuf.actime = statBuf.st_atime;
+ uTimBuf.modtime = statBuf.st_mtime;
+
+ retVal = chmod ( dstName, statBuf.st_mode );
+ ERROR_IF_NOT_ZERO ( retVal );
+
+ retVal = utime ( dstName, &uTimBuf );
+ ERROR_IF_NOT_ZERO ( retVal );
+
+ retVal = chown ( dstName, statBuf.st_uid, statBuf.st_gid );
+ /* chown() will in many cases return with EPERM, which can
+ be safely ignored.
+ */
+#endif
+}
+
+
+/*---------------------------------------------*/
+static
+void setInterimPermissions ( Char *dstName )
+{
+#if BZ_UNIX
+ IntNative retVal;
+ retVal = chmod ( dstName, S_IRUSR | S_IWUSR );
+ ERROR_IF_NOT_ZERO ( retVal );
+#endif
+}
+
+
+/*---------------------------------------------*/
+static
+Bool containsDubiousChars ( Char* name )
+{
+ Bool cdc = False;
+ for (; *name != '\0'; name++)
+ if (*name == '?' || *name == '*') cdc = True;
+ return cdc;
+}
+
+
+/*---------------------------------------------*/
+#define BZ_N_SUFFIX_PAIRS 4
+
+Char* zSuffix[BZ_N_SUFFIX_PAIRS]
+ = { ".bz2", ".bz", ".tbz2", ".tbz" };
+Char* unzSuffix[BZ_N_SUFFIX_PAIRS]
+ = { "", "", ".tar", ".tar" };
+
+static
+Bool hasSuffix ( Char* s, Char* suffix )
+{
+ Int32 ns = strlen(s);
+ Int32 nx = strlen(suffix);
+ if (ns < nx) return False;
+ if (strcmp(s + ns - nx, suffix) == 0) return True;
+ return False;
+}
+
+static
+Bool mapSuffix ( Char* name,
+ Char* oldSuffix, Char* newSuffix )
+{
+ if (!hasSuffix(name,oldSuffix)) return False;
+ name[strlen(name)-strlen(oldSuffix)] = 0;
+ strcat ( name, newSuffix );
+ return True;
+}
+
+
+/*---------------------------------------------*/
+static
+void compress ( Char *name )
+{
+ FILE *inStr;
+ FILE *outStr;
+ Int32 n, i;
+
+ deleteOutputOnInterrupt = False;
+
+ if (name == NULL && srcMode != SM_I2O)
+ panic ( "compress: bad modes\n" );
+
+ switch (srcMode) {
+ case SM_I2O:
+ copyFileName ( inName, "(stdin)" );
+ copyFileName ( outName, "(stdout)" );
+ break;
+ case SM_F2F:
+ copyFileName ( inName, name );
+ copyFileName ( outName, name );
+ strcat ( outName, ".bz2" );
+ break;
+ case SM_F2O:
+ copyFileName ( inName, name );
+ copyFileName ( outName, "(stdout)" );
+ break;
+ }
+
+ if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) {
+ if (noisy)
+ fprintf ( stderr, "%s: There are no files matching `%s'.\n",
+ progName, inName );
+ setExit(1);
+ return;
+ }
+ if ( srcMode != SM_I2O && !fileExists ( inName ) ) {
+ fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+ progName, inName, strerror(errno) );
+ setExit(1);
+ return;
+ }
+ for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++) {
+ if (hasSuffix(inName, zSuffix[i])) {
+ if (noisy)
+ fprintf ( stderr,
+ "%s: Input file %s already has %s suffix.\n",
+ progName, inName, zSuffix[i] );
+ setExit(1);
+ return;
+ }
+ }
+ if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) {
+ if (noisy)
+ fprintf ( stderr, "%s: Input file %s is not a normal file.\n",
+ progName, inName );
+ setExit(1);
+ return;
+ }
+ if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) {
+ fprintf ( stderr, "%s: Output file %s already exists.\n",
+ progName, outName );
+ setExit(1);
+ return;
+ }
+ if ( srcMode == SM_F2F && !forceOverwrite &&
+ (n=countHardLinks ( inName )) > 0) {
+ fprintf ( stderr, "%s: Input file %s has %d other link%s.\n",
+ progName, inName, n, n > 1 ? "s" : "" );
+ setExit(1);
+ return;
+ }
+
+ switch ( srcMode ) {
+
+ case SM_I2O:
+ inStr = stdin;
+ outStr = stdout;
+ if ( isatty ( fileno ( stdout ) ) ) {
+ fprintf ( stderr,
+ "%s: I won't write compressed data to a terminal.\n",
+ progName );
+ fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+ progName, progName );
+ setExit(1);
+ return;
+ };
+ break;
+
+ case SM_F2O:
+ inStr = fopen ( inName, "rb" );
+ outStr = stdout;
+ if ( isatty ( fileno ( stdout ) ) ) {
+ fprintf ( stderr,
+ "%s: I won't write compressed data to a terminal.\n",
+ progName );
+ fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+ progName, progName );
+ if ( inStr != NULL ) fclose ( inStr );
+ setExit(1);
+ return;
+ };
+ if ( inStr == NULL ) {
+ fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+ progName, inName, strerror(errno) );
+ setExit(1);
+ return;
+ };
+ break;
+
+ case SM_F2F:
+ inStr = fopen ( inName, "rb" );
+ outStr = fopen ( outName, "wb" );
+ if ( outStr == NULL) {
+ fprintf ( stderr, "%s: Can't create output file %s: %s.\n",
+ progName, outName, strerror(errno) );
+ if ( inStr != NULL ) fclose ( inStr );
+ setExit(1);
+ return;
+ }
+ if ( inStr == NULL ) {
+ fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+ progName, inName, strerror(errno) );
+ if ( outStr != NULL ) fclose ( outStr );
+ setExit(1);
+ return;
+ };
+ setInterimPermissions ( outName );
+ break;
+
+ default:
+ panic ( "compress: bad srcMode" );
+ break;
+ }
+
+ if (verbosity >= 1) {
+ fprintf ( stderr, " %s: ", inName );
+ pad ( inName );
+ fflush ( stderr );
+ }
+
+ /*--- Now the input and output handles are sane. Do the Biz. ---*/
+ outputHandleJustInCase = outStr;
+ deleteOutputOnInterrupt = True;
+ compressStream ( inStr, outStr );
+ outputHandleJustInCase = NULL;
+
+ /*--- If there was an I/O error, we won't get here. ---*/
+ if ( srcMode == SM_F2F ) {
+ copyDatePermissionsAndOwner ( inName, outName );
+ deleteOutputOnInterrupt = False;
+ if ( !keepInputFiles ) {
+ IntNative retVal = remove ( inName );
+ ERROR_IF_NOT_ZERO ( retVal );
+ }
+ }
+
+ deleteOutputOnInterrupt = False;
+}
+
+
+/*---------------------------------------------*/
+static
+void uncompress ( Char *name )
+{
+ FILE *inStr;
+ FILE *outStr;
+ Int32 n, i;
+ Bool magicNumberOK;
+ Bool cantGuess;
+
+ deleteOutputOnInterrupt = False;
+
+ if (name == NULL && srcMode != SM_I2O)
+ panic ( "uncompress: bad modes\n" );
+
+ cantGuess = False;
+ switch (srcMode) {
+ case SM_I2O:
+ copyFileName ( inName, "(stdin)" );
+ copyFileName ( outName, "(stdout)" );
+ break;
+ case SM_F2F:
+ copyFileName ( inName, name );
+ copyFileName ( outName, name );
+ for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++)
+ if (mapSuffix(outName,zSuffix[i],unzSuffix[i]))
+ goto zzz;
+ cantGuess = True;
+ strcat ( outName, ".out" );
+ break;
+ case SM_F2O:
+ copyFileName ( inName, name );
+ copyFileName ( outName, "(stdout)" );
+ break;
+ }
+
+ zzz:
+ if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) {
+ if (noisy)
+ fprintf ( stderr, "%s: There are no files matching `%s'.\n",
+ progName, inName );
+ setExit(1);
+ return;
+ }
+ if ( srcMode != SM_I2O && !fileExists ( inName ) ) {
+ fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+ progName, inName, strerror(errno) );
+ setExit(1);
+ return;
+ }
+ if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) {
+ if (noisy)
+ fprintf ( stderr, "%s: Input file %s is not a normal file.\n",
+ progName, inName );
+ setExit(1);
+ return;
+ }
+ if ( /* srcMode == SM_F2F implied && */ cantGuess ) {
+ if (noisy)
+ fprintf ( stderr,
+ "%s: Can't guess original name for %s -- using %s\n",
+ progName, inName, outName );
+ /* just a warning, no return */
+ }
+ if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) {
+ fprintf ( stderr, "%s: Output file %s already exists.\n",
+ progName, outName );
+ setExit(1);
+ return;
+ }
+ if ( srcMode == SM_F2F && !forceOverwrite &&
+ (n=countHardLinks ( inName ) ) > 0) {
+ fprintf ( stderr, "%s: Input file %s has %d other link%s.\n",
+ progName, inName, n, n > 1 ? "s" : "" );
+ setExit(1);
+ return;
+ }
+
+ switch ( srcMode ) {
+
+ case SM_I2O:
+ inStr = stdin;
+ outStr = stdout;
+ if ( isatty ( fileno ( stdin ) ) ) {
+ fprintf ( stderr,
+ "%s: I won't read compressed data from a terminal.\n",
+ progName );
+ fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+ progName, progName );
+ setExit(1);
+ return;
+ };
+ break;
+
+ case SM_F2O:
+ inStr = fopen ( inName, "rb" );
+ outStr = stdout;
+ if ( inStr == NULL ) {
+ fprintf ( stderr, "%s: Can't open input file %s:%s.\n",
+ progName, inName, strerror(errno) );
+ if ( inStr != NULL ) fclose ( inStr );
+ setExit(1);
+ return;
+ };
+ break;
+
+ case SM_F2F:
+ inStr = fopen ( inName, "rb" );
+ outStr = fopen ( outName, "wb" );
+ if ( outStr == NULL) {
+ fprintf ( stderr, "%s: Can't create output file %s: %s.\n",
+ progName, outName, strerror(errno) );
+ if ( inStr != NULL ) fclose ( inStr );
+ setExit(1);
+ return;
+ }
+ if ( inStr == NULL ) {
+ fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+ progName, inName, strerror(errno) );
+ if ( outStr != NULL ) fclose ( outStr );
+ setExit(1);
+ return;
+ };
+ setInterimPermissions ( outName );
+ break;
+
+ default:
+ panic ( "uncompress: bad srcMode" );
+ break;
+ }
+
+ if (verbosity >= 1) {
+ fprintf ( stderr, " %s: ", inName );
+ pad ( inName );
+ fflush ( stderr );
+ }
+
+ /*--- Now the input and output handles are sane. Do the Biz. ---*/
+ outputHandleJustInCase = outStr;
+ deleteOutputOnInterrupt = True;
+ magicNumberOK = uncompressStream ( inStr, outStr );
+ outputHandleJustInCase = NULL;
+
+ /*--- If there was an I/O error, we won't get here. ---*/
+ if ( magicNumberOK ) {
+ if ( srcMode == SM_F2F ) {
+ copyDatePermissionsAndOwner ( inName, outName );
+ deleteOutputOnInterrupt = False;
+ if ( !keepInputFiles ) {
+ IntNative retVal = remove ( inName );
+ ERROR_IF_NOT_ZERO ( retVal );
+ }
+ }
+ } else {
+ unzFailsExist = True;
+ deleteOutputOnInterrupt = False;
+ if ( srcMode == SM_F2F ) {
+ IntNative retVal = remove ( outName );
+ ERROR_IF_NOT_ZERO ( retVal );
+ }
+ }
+ deleteOutputOnInterrupt = False;
+
+ if ( magicNumberOK ) {
+ if (verbosity >= 1)
+ fprintf ( stderr, "done\n" );
+ } else {
+ setExit(2);
+ if (verbosity >= 1)
+ fprintf ( stderr, "not a bzip2 file.\n" ); else
+ fprintf ( stderr,
+ "%s: %s is not a bzip2 file.\n",
+ progName, inName );
+ }
+
+}
+
+
+/*---------------------------------------------*/
+static
+void testf ( Char *name )
+{
+ FILE *inStr;
+ Bool allOK;
+
+ deleteOutputOnInterrupt = False;
+
+ if (name == NULL && srcMode != SM_I2O)
+ panic ( "testf: bad modes\n" );
+
+ copyFileName ( outName, "(none)" );
+ switch (srcMode) {
+ case SM_I2O: copyFileName ( inName, "(stdin)" ); break;
+ case SM_F2F: copyFileName ( inName, name ); break;
+ case SM_F2O: copyFileName ( inName, name ); break;
+ }
+
+ if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) {
+ if (noisy)
+ fprintf ( stderr, "%s: There are no files matching `%s'.\n",
+ progName, inName );
+ setExit(1);
+ return;
+ }
+ if ( srcMode != SM_I2O && !fileExists ( inName ) ) {
+ fprintf ( stderr, "%s: Can't open input %s: %s.\n",
+ progName, inName, strerror(errno) );
+ setExit(1);
+ return;
+ }
+
+ switch ( srcMode ) {
+
+ case SM_I2O:
+ if ( isatty ( fileno ( stdin ) ) ) {
+ fprintf ( stderr,
+ "%s: I won't read compressed data from a terminal.\n",
+ progName );
+ fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+ progName, progName );
+ setExit(1);
+ return;
+ };
+ inStr = stdin;
+ break;
+
+ case SM_F2O: case SM_F2F:
+ inStr = fopen ( inName, "rb" );
+ if ( inStr == NULL ) {
+ fprintf ( stderr, "%s: Can't open input file %s:%s.\n",
+ progName, inName, strerror(errno) );
+ setExit(1);
+ return;
+ };
+ break;
+
+ default:
+ panic ( "testf: bad srcMode" );
+ break;
+ }
+
+ if (verbosity >= 1) {
+ fprintf ( stderr, " %s: ", inName );
+ pad ( inName );
+ fflush ( stderr );
+ }
+
+ /*--- Now the input handle is sane. Do the Biz. ---*/
+ allOK = testStream ( inStr );
+
+ if (allOK && verbosity >= 1) fprintf ( stderr, "ok\n" );
+ if (!allOK) testFailsExist = True;
+}
+
+
+/*---------------------------------------------*/
+static
+void license ( void )
+{
+ fprintf ( stderr,
+
+ "bzip2, a block-sorting file compressor. "
+ "Version %s.\n"
+ " \n"
+ " Copyright (C) 1996-2000 by Julian Seward.\n"
+ " \n"
+ " This program is free software; you can redistribute it and/or modify\n"
+ " it under the terms set out in the LICENSE file, which is included\n"
+ " in the bzip2-1.0 source distribution.\n"
+ " \n"
+ " This program is distributed in the hope that it will be useful,\n"
+ " but WITHOUT ANY WARRANTY; without even the implied warranty of\n"
+ " MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n"
+ " LICENSE file for more details.\n"
+ " \n",
+ BZ2_bzlibVersion()
+ );
+}
+
+
+/*---------------------------------------------*/
+static
+void usage ( Char *fullProgName )
+{
+ fprintf (
+ stderr,
+ "bzip2, a block-sorting file compressor. "
+ "Version %s.\n"
+ "\n usage: %s [flags and input files in any order]\n"
+ "\n"
+ " -h --help print this message\n"
+ " -d --decompress force decompression\n"
+ " -z --compress force compression\n"
+ " -k --keep keep (don't delete) input files\n"
+ " -f --force overwrite existing output files\n"
+ " -t --test test compressed file integrity\n"
+ " -c --stdout output to standard out\n"
+ " -q --quiet suppress noncritical error messages\n"
+ " -v --verbose be verbose (a 2nd -v gives more)\n"
+ " -L --license display software version & license\n"
+ " -V --version display software version & license\n"
+ " -s --small use less memory (at most 2500k)\n"
+ " -1 .. -9 set block size to 100k .. 900k\n"
+ "\n"
+ " If invoked as `bzip2', default action is to compress.\n"
+ " as `bunzip2', default action is to decompress.\n"
+ " as `bzcat', default action is to decompress to stdout.\n"
+ "\n"
+ " If no file names are given, bzip2 compresses or decompresses\n"
+ " from standard input to standard output. You can combine\n"
+ " short flags, so `-v -4' means the same as -v4 or -4v, &c.\n"
+#if BZ_UNIX
+ "\n"
+#endif
+ ,
+
+ BZ2_bzlibVersion(),
+ fullProgName
+ );
+}
+
+
+/*---------------------------------------------*/
+static
+void redundant ( Char* flag )
+{
+ fprintf (
+ stderr,
+ "%s: %s is redundant in versions 0.9.5 and above\n",
+ progName, flag );
+}
+
+
+/*---------------------------------------------*/
+/*--
+ All the garbage from here to main() is purely to
+ implement a linked list of command-line arguments,
+ into which main() copies argv[1 .. argc-1].
+
+ The purpose of this exercise is to facilitate
+ the expansion of wildcard characters * and ? in
+ filenames for OSs which don't know how to do it
+ themselves, like MSDOS, Windows 95 and NT.
+
+ The actual Dirty Work is done by the platform-
+ specific macro APPEND_FILESPEC.
+--*/
+
+typedef
+ struct zzzz {
+ Char *name;
+ struct zzzz *link;
+ }
+ Cell;
+
+
+/*---------------------------------------------*/
+static
+void *myMalloc ( Int32 n )
+{
+ void* p;
+
+ p = malloc ( (size_t)n );
+ if (p == NULL) outOfMemory ();
+ return p;
+}
+
+
+/*---------------------------------------------*/
+static
+Cell *mkCell ( void )
+{
+ Cell *c;
+
+ c = (Cell*) myMalloc ( sizeof ( Cell ) );
+ c->name = NULL;
+ c->link = NULL;
+ return c;
+}
+
+
+/*---------------------------------------------*/
+static
+Cell *snocString ( Cell *root, Char *name )
+{
+ if (root == NULL) {
+ Cell *tmp = mkCell();
+ tmp->name = (Char*) myMalloc ( 5 + strlen(name) );
+ strcpy ( tmp->name, name );
+ return tmp;
+ } else {
+ Cell *tmp = root;
+ while (tmp->link != NULL) tmp = tmp->link;
+ tmp->link = snocString ( tmp->link, name );
+ return root;
+ }
+}
+
+
+/*---------------------------------------------*/
+static
+void addFlagsFromEnvVar ( Cell** argList, Char* varName )
+{
+ Int32 i, j, k;
+ Char *envbase, *p;
+
+ envbase = getenv(varName);
+ if (envbase != NULL) {
+ p = envbase;
+ i = 0;
+ while (True) {
+ if (p[i] == 0) break;
+ p += i;
+ i = 0;
+ while (isspace((Int32)(p[0]))) p++;
+ while (p[i] != 0 && !isspace((Int32)(p[i]))) i++;
+ if (i > 0) {
+ k = i; if (k > FILE_NAME_LEN-10) k = FILE_NAME_LEN-10;
+ for (j = 0; j < k; j++) tmpName[j] = p[j];
+ tmpName[k] = 0;
+ APPEND_FLAG(*argList, tmpName);
+ }
+ }
+ }
+}
+
+
+/*---------------------------------------------*/
+#define ISFLAG(s) (strcmp(aa->name, (s))==0)
+
+IntNative main ( IntNative argc, Char *argv[] )
+{
+ Int32 i, j;
+ Char *tmp;
+ Cell *argList;
+ Cell *aa;
+ Bool decode;
+
+ /*-- Be really really really paranoid :-) --*/
+ if (sizeof(Int32) != 4 || sizeof(UInt32) != 4 ||
+ sizeof(Int16) != 2 || sizeof(UInt16) != 2 ||
+ sizeof(Char) != 1 || sizeof(UChar) != 1)
+ configError();
+
+ /*-- Initialise --*/
+ outputHandleJustInCase = NULL;
+ smallMode = False;
+ keepInputFiles = False;
+ forceOverwrite = False;
+ noisy = True;
+ verbosity = 0;
+ blockSize100k = 9;
+ testFailsExist = False;
+ unzFailsExist = False;
+ numFileNames = 0;
+ numFilesProcessed = 0;
+ workFactor = 30;
+ deleteOutputOnInterrupt = False;
+ exitValue = 0;
+ i = j = 0; /* avoid bogus warning from egcs-1.1.X */
+
+ /*-- Set up signal handlers for mem access errors --*/
+ signal (SIGSEGV, mySIGSEGVorSIGBUScatcher);
+#if BZ_UNIX
+#ifndef __DJGPP__
+ signal (SIGBUS, mySIGSEGVorSIGBUScatcher);
+#endif
+#endif
+
+ copyFileName ( inName, "(none)" );
+ copyFileName ( outName, "(none)" );
+
+ copyFileName ( progNameReally, argv[0] );
+ progName = &progNameReally[0];
+ for (tmp = &progNameReally[0]; *tmp != '\0'; tmp++)
+ if (*tmp == PATH_SEP) progName = tmp + 1;
+
+
+ /*-- Copy flags from env var BZIP2, and
+ expand filename wildcards in arg list.
+ --*/
+ argList = NULL;
+ addFlagsFromEnvVar ( &argList, "BZIP2" );
+ addFlagsFromEnvVar ( &argList, "BZIP" );
+ for (i = 1; i <= argc-1; i++)
+ APPEND_FILESPEC(argList, argv[i]);
+
+
+ /*-- Find the length of the longest filename --*/
+ longestFileName = 7;
+ numFileNames = 0;
+ decode = True;
+ for (aa = argList; aa != NULL; aa = aa->link) {
+ if (ISFLAG("--")) { decode = False; continue; }
+ if (aa->name[0] == '-' && decode) continue;
+ numFileNames++;
+ if (longestFileName < (Int32)strlen(aa->name) )
+ longestFileName = (Int32)strlen(aa->name);
+ }
+
+
+ /*-- Determine source modes; flag handling may change this too. --*/
+ if (numFileNames == 0)
+ srcMode = SM_I2O; else srcMode = SM_F2F;
+
+
+ /*-- Determine what to do (compress/uncompress/test/cat). --*/
+ /*-- Note that subsequent flag handling may change this. --*/
+ opMode = OM_Z;
+
+ if ( (strstr ( progName, "unzip" ) != 0) ||
+ (strstr ( progName, "UNZIP" ) != 0) )
+ opMode = OM_UNZ;
+
+ if ( (strstr ( progName, "z2cat" ) != 0) ||
+ (strstr ( progName, "Z2CAT" ) != 0) ||
+ (strstr ( progName, "zcat" ) != 0) ||
+ (strstr ( progName, "ZCAT" ) != 0) ) {
+ opMode = OM_UNZ;
+ srcMode = (numFileNames == 0) ? SM_I2O : SM_F2O;
+ }
+
+
+ /*-- Look at the flags. --*/
+ for (aa = argList; aa != NULL; aa = aa->link) {
+ if (ISFLAG("--")) break;
+ if (aa->name[0] == '-' && aa->name[1] != '-') {
+ for (j = 1; aa->name[j] != '\0'; j++) {
+ switch (aa->name[j]) {
+ case 'c': srcMode = SM_F2O; break;
+ case 'd': opMode = OM_UNZ; break;
+ case 'z': opMode = OM_Z; break;
+ case 'f': forceOverwrite = True; break;
+ case 't': opMode = OM_TEST; break;
+ case 'k': keepInputFiles = True; break;
+ case 's': smallMode = True; break;
+ case 'q': noisy = False; break;
+ case '1': blockSize100k = 1; break;
+ case '2': blockSize100k = 2; break;
+ case '3': blockSize100k = 3; break;
+ case '4': blockSize100k = 4; break;
+ case '5': blockSize100k = 5; break;
+ case '6': blockSize100k = 6; break;
+ case '7': blockSize100k = 7; break;
+ case '8': blockSize100k = 8; break;
+ case '9': blockSize100k = 9; break;
+ case 'V':
+ case 'L': license(); break;
+ case 'v': verbosity++; break;
+ case 'h': usage ( progName );
+ exit ( 0 );
+ break;
+ default: fprintf ( stderr, "%s: Bad flag `%s'\n",
+ progName, aa->name );
+ usage ( progName );
+ exit ( 1 );
+ break;
+ }
+ }
+ }
+ }
+
+ /*-- And again ... --*/
+ for (aa = argList; aa != NULL; aa = aa->link) {
+ if (ISFLAG("--")) break;
+ if (ISFLAG("--stdout")) srcMode = SM_F2O; else
+ if (ISFLAG("--decompress")) opMode = OM_UNZ; else
+ if (ISFLAG("--compress")) opMode = OM_Z; else
+ if (ISFLAG("--force")) forceOverwrite = True; else
+ if (ISFLAG("--test")) opMode = OM_TEST; else
+ if (ISFLAG("--keep")) keepInputFiles = True; else
+ if (ISFLAG("--small")) smallMode = True; else
+ if (ISFLAG("--quiet")) noisy = False; else
+ if (ISFLAG("--version")) license(); else
+ if (ISFLAG("--license")) license(); else
+ if (ISFLAG("--exponential")) workFactor = 1; else
+ if (ISFLAG("--repetitive-best")) redundant(aa->name); else
+ if (ISFLAG("--repetitive-fast")) redundant(aa->name); else
+ if (ISFLAG("--verbose")) verbosity++; else
+ if (ISFLAG("--help")) { usage ( progName ); exit ( 0 ); }
+ else
+ if (strncmp ( aa->name, "--", 2) == 0) {
+ fprintf ( stderr, "%s: Bad flag `%s'\n", progName, aa->name );
+ usage ( progName );
+ exit ( 1 );
+ }
+ }
+
+ if (verbosity > 4) verbosity = 4;
+ if (opMode == OM_Z && smallMode && blockSize100k > 2)
+ blockSize100k = 2;
+
+ if (opMode == OM_TEST && srcMode == SM_F2O) {
+ fprintf ( stderr, "%s: -c and -t cannot be used together.\n",
+ progName );
+ exit ( 1 );
+ }
+
+ if (srcMode == SM_F2O && numFileNames == 0)
+ srcMode = SM_I2O;
+
+ if (opMode != OM_Z) blockSize100k = 0;
+
+ if (srcMode == SM_F2F) {
+ signal (SIGINT, mySignalCatcher);
+ signal (SIGTERM, mySignalCatcher);
+# if BZ_UNIX
+ signal (SIGHUP, mySignalCatcher);
+# endif
+ }
+
+ if (opMode == OM_Z) {
+ if (srcMode == SM_I2O) {
+ compress ( NULL );
+ } else {
+ decode = True;
+ for (aa = argList; aa != NULL; aa = aa->link) {
+ if (ISFLAG("--")) { decode = False; continue; }
+ if (aa->name[0] == '-' && decode) continue;
+ numFilesProcessed++;
+ compress ( aa->name );
+ }
+ }
+ }
+ else
+
+ if (opMode == OM_UNZ) {
+ unzFailsExist = False;
+ if (srcMode == SM_I2O) {
+ uncompress ( NULL );
+ } else {
+ decode = True;
+ for (aa = argList; aa != NULL; aa = aa->link) {
+ if (ISFLAG("--")) { decode = False; continue; }
+ if (aa->name[0] == '-' && decode) continue;
+ numFilesProcessed++;
+ uncompress ( aa->name );
+ }
+ }
+ if (unzFailsExist) {
+ setExit(2);
+ exit(exitValue);
+ }
+ }
+
+ else {
+ testFailsExist = False;
+ if (srcMode == SM_I2O) {
+ testf ( NULL );
+ } else {
+ decode = True;
+ for (aa = argList; aa != NULL; aa = aa->link) {
+ if (ISFLAG("--")) { decode = False; continue; }
+ if (aa->name[0] == '-' && decode) continue;
+ numFilesProcessed++;
+ testf ( aa->name );
+ }
+ }
+ if (testFailsExist && noisy) {
+ fprintf ( stderr,
+ "\n"
+ "You can use the `bzip2recover' program to attempt to recover\n"
+ "data from undamaged sections of corrupted files.\n\n"
+ );
+ setExit(2);
+ exit(exitValue);
+ }
+ }
+
+ /* Free the argument list memory to mollify leak detectors
+ (eg) Purify, Checker. Serves no other useful purpose.
+ */
+ aa = argList;
+ while (aa != NULL) {
+ Cell* aa2 = aa->link;
+ if (aa->name != NULL) free(aa->name);
+ free(aa);
+ aa = aa2;
+ }
+
+ return exitValue;
+}
+
+
+/*-----------------------------------------------------------*/
+/*--- end bzip2.c ---*/
+/*-----------------------------------------------------------*/
--- /dev/null
+
+
+NAME
+ bzip2, bunzip2 - a block-sorting file compressor, v1.0
+ bzcat - decompresses files to stdout
+ bzip2recover - recovers data from damaged bzip2 files
+
+
+SYNOPSIS
+ bzip2 [ -cdfkqstvzVL123456789 ] [ filenames ... ]
+ bunzip2 [ -fkvsVL ] [ filenames ... ]
+ bzcat [ -s ] [ filenames ... ]
+ bzip2recover filename
+
+
+DESCRIPTION
+ bzip2 compresses files using the Burrows-Wheeler block
+ sorting text compression algorithm, and Huffman coding.
+ Compression is generally considerably better than that
+ achieved by more conventional LZ77/LZ78-based compressors,
+ and approaches the performance of the PPM family of sta-
+ tistical compressors.
+
+ The command-line options are deliberately very similar to
+ those of GNU gzip, but they are not identical.
+
+ bzip2 expects a list of file names to accompany the com-
+ mand-line flags. Each file is replaced by a compressed
+ version of itself, with the name "original_name.bz2".
+ Each compressed file has the same modification date, per-
+ missions, and, when possible, ownership as the correspond-
+ ing original, so that these properties can be correctly
+ restored at decompression time. File name handling is
+ naive in the sense that there is no mechanism for preserv-
+ ing original file names, permissions, ownerships or dates
+ in filesystems which lack these concepts, or have serious
+ file name length restrictions, such as MS-DOS.
+
+ bzip2 and bunzip2 will by default not overwrite existing
+ files. If you want this to happen, specify the -f flag.
+
+ If no file names are specified, bzip2 compresses from
+ standard input to standard output. In this case, bzip2
+ will decline to write compressed output to a terminal, as
+ this would be entirely incomprehensible and therefore
+ pointless.
+
+ bunzip2 (or bzip2 -d) decompresses all specified files.
+ Files which were not created by bzip2 will be detected and
+ ignored, and a warning issued. bzip2 attempts to guess
+ the filename for the decompressed file from that of the
+ compressed file as follows:
+
+ filename.bz2 becomes filename
+ filename.bz becomes filename
+ filename.tbz2 becomes filename.tar
+ filename.tbz becomes filename.tar
+ anyothername becomes anyothername.out
+
+ If the file does not end in one of the recognised endings,
+ .bz2, .bz, .tbz2 or .tbz, bzip2 complains that it cannot
+ guess the name of the original file, and uses the original
+ name with .out appended.
+
+ As with compression, supplying no filenames causes decom-
+ pression from standard input to standard output.
+
+ bunzip2 will correctly decompress a file which is the con-
+ catenation of two or more compressed files. The result is
+ the concatenation of the corresponding uncompressed files.
+ Integrity testing (-t) of concatenated compressed files is
+ also supported.
+
+ You can also compress or decompress files to the standard
+ output by giving the -c flag. Multiple files may be com-
+ pressed and decompressed like this. The resulting outputs
+ are fed sequentially to stdout. Compression of multiple
+ files in this manner generates a stream containing multi-
+ ple compressed file representations. Such a stream can be
+ decompressed correctly only by bzip2 version 0.9.0 or
+ later. Earlier versions of bzip2 will stop after decom-
+ pressing the first file in the stream.
+
+ bzcat (or bzip2 -dc) decompresses all specified files to
+ the standard output.
+
+ bzip2 will read arguments from the environment variables
+ BZIP2 and BZIP, in that order, and will process them
+ before any arguments read from the command line. This
+ gives a convenient way to supply default arguments.
+
+ Compression is always performed, even if the compressed
+ file is slightly larger than the original. Files of less
+ than about one hundred bytes tend to get larger, since the
+ compression mechanism has a constant overhead in the
+ region of 50 bytes. Random data (including the output of
+ most file compressors) is coded at about 8.05 bits per
+ byte, giving an expansion of around 0.5%.
+
+ As a self-check for your protection, bzip2 uses 32-bit
+ CRCs to make sure that the decompressed version of a file
+ is identical to the original. This guards against corrup-
+ tion of the compressed data, and against undetected bugs
+ in bzip2 (hopefully very unlikely). The chances of data
+ corruption going undetected is microscopic, about one
+ chance in four billion for each file processed. Be aware,
+ though, that the check occurs upon decompression, so it
+ can only tell you that something is wrong. It can't help
+ you recover the original uncompressed data. You can use
+ bzip2recover to try to recover data from damaged files.
+
+ Return values: 0 for a normal exit, 1 for environmental
+ problems (file not found, invalid flags, I/O errors, &c),
+ 2 to indicate a corrupt compressed file, 3 for an internal
+ consistency error (eg, bug) which caused bzip2 to panic.
+
+
+OPTIONS
+ -c --stdout
+ Compress or decompress to standard output.
+
+ -d --decompress
+ Force decompression. bzip2, bunzip2 and bzcat are
+ really the same program, and the decision about
+ what actions to take is done on the basis of which
+ name is used. This flag overrides that mechanism,
+ and forces bzip2 to decompress.
+
+ -z --compress
+ The complement to -d: forces compression, regard-
+ less of the invokation name.
+
+ -t --test
+ Check integrity of the specified file(s), but don't
+ decompress them. This really performs a trial
+ decompression and throws away the result.
+
+ -f --force
+ Force overwrite of output files. Normally, bzip2
+ will not overwrite existing output files. Also
+ forces bzip2 to break hard links to files, which it
+ otherwise wouldn't do.
+
+ -k --keep
+ Keep (don't delete) input files during compression
+ or decompression.
+
+ -s --small
+ Reduce memory usage, for compression, decompression
+ and testing. Files are decompressed and tested
+ using a modified algorithm which only requires 2.5
+ bytes per block byte. This means any file can be
+ decompressed in 2300k of memory, albeit at about
+ half the normal speed.
+
+ During compression, -s selects a block size of
+ 200k, which limits memory use to around the same
+ figure, at the expense of your compression ratio.
+ In short, if your machine is low on memory (8
+ megabytes or less), use -s for everything. See
+ MEMORY MANAGEMENT below.
+
+ -q --quiet
+ Suppress non-essential warning messages. Messages
+ pertaining to I/O errors and other critical events
+ will not be suppressed.
+
+ -v --verbose
+ Verbose mode -- show the compression ratio for each
+ file processed. Further -v's increase the ver-
+ bosity level, spewing out lots of information which
+ is primarily of interest for diagnostic purposes.
+
+ -L --license -V --version
+ Display the software version, license terms and
+ conditions.
+
+ -1 to -9
+ Set the block size to 100 k, 200 k .. 900 k when
+ compressing. Has no effect when decompressing.
+ See MEMORY MANAGEMENT below.
+
+ -- Treats all subsequent arguments as file names, even
+ if they start with a dash. This is so you can han-
+ dle files with names beginning with a dash, for
+ example: bzip2 -- -myfilename.
+
+ --repetitive-fast --repetitive-best
+ These flags are redundant in versions 0.9.5 and
+ above. They provided some coarse control over the
+ behaviour of the sorting algorithm in earlier ver-
+ sions, which was sometimes useful. 0.9.5 and above
+ have an improved algorithm which renders these
+ flags irrelevant.
+
+
+MEMORY MANAGEMENT
+ bzip2 compresses large files in blocks. The block size
+ affects both the compression ratio achieved, and the
+ amount of memory needed for compression and decompression.
+ The flags -1 through -9 specify the block size to be
+ 100,000 bytes through 900,000 bytes (the default) respec-
+ tively. At decompression time, the block size used for
+ compression is read from the header of the compressed
+ file, and bunzip2 then allocates itself just enough memory
+ to decompress the file. Since block sizes are stored in
+ compressed files, it follows that the flags -1 to -9 are
+ irrelevant to and so ignored during decompression.
+
+ Compression and decompression requirements, in bytes, can
+ be estimated as:
+
+ Compression: 400k + ( 8 x block size )
+
+ Decompression: 100k + ( 4 x block size ), or
+ 100k + ( 2.5 x block size )
+
+ Larger block sizes give rapidly diminishing marginal
+ returns. Most of the compression comes from the first two
+ or three hundred k of block size, a fact worth bearing in
+ mind when using bzip2 on small machines. It is also
+ important to appreciate that the decompression memory
+ requirement is set at compression time by the choice of
+ block size.
+
+ For files compressed with the default 900k block size,
+ bunzip2 will require about 3700 kbytes to decompress. To
+ support decompression of any file on a 4 megabyte machine,
+ bunzip2 has an option to decompress using approximately
+ half this amount of memory, about 2300 kbytes. Decompres-
+ sion speed is also halved, so you should use this option
+ only where necessary. The relevant flag is -s.
+
+ In general, try and use the largest block size memory con-
+ straints allow, since that maximises the compression
+ achieved. Compression and decompression speed are virtu-
+ ally unaffected by block size.
+
+ Another significant point applies to files which fit in a
+ single block -- that means most files you'd encounter
+ using a large block size. The amount of real memory
+ touched is proportional to the size of the file, since the
+ file is smaller than a block. For example, compressing a
+ file 20,000 bytes long with the flag -9 will cause the
+ compressor to allocate around 7600k of memory, but only
+ touch 400k + 20000 * 8 = 560 kbytes of it. Similarly, the
+ decompressor will allocate 3700k but only touch 100k +
+ 20000 * 4 = 180 kbytes.
+
+ Here is a table which summarises the maximum memory usage
+ for different block sizes. Also recorded is the total
+ compressed size for 14 files of the Calgary Text Compres-
+ sion Corpus totalling 3,141,622 bytes. This column gives
+ some feel for how compression varies with block size.
+ These figures tend to understate the advantage of larger
+ block sizes for larger files, since the Corpus is domi-
+ nated by smaller files.
+
+ Compress Decompress Decompress Corpus
+ Flag usage usage -s usage Size
+
+ -1 1200k 500k 350k 914704
+ -2 2000k 900k 600k 877703
+ -3 2800k 1300k 850k 860338
+ -4 3600k 1700k 1100k 846899
+ -5 4400k 2100k 1350k 845160
+ -6 5200k 2500k 1600k 838626
+ -7 6100k 2900k 1850k 834096
+ -8 6800k 3300k 2100k 828642
+ -9 7600k 3700k 2350k 828642
+
+
+RECOVERING DATA FROM DAMAGED FILES
+ bzip2 compresses files in blocks, usually 900kbytes long.
+ Each block is handled independently. If a media or trans-
+ mission error causes a multi-block .bz2 file to become
+ damaged, it may be possible to recover data from the
+ undamaged blocks in the file.
+
+ The compressed representation of each block is delimited
+ by a 48-bit pattern, which makes it possible to find the
+ block boundaries with reasonable certainty. Each block
+ also carries its own 32-bit CRC, so damaged blocks can be
+ distinguished from undamaged ones.
+
+ bzip2recover is a simple program whose purpose is to
+ search for blocks in .bz2 files, and write each block out
+ into its own .bz2 file. You can then use bzip2 -t to test
+ the integrity of the resulting files, and decompress those
+ which are undamaged.
+
+ bzip2recover takes a single argument, the name of the dam-
+ aged file, and writes a number of files "rec0001file.bz2",
+ "rec0002file.bz2", etc, containing the extracted blocks.
+ The output filenames are designed so that the use of
+ wildcards in subsequent processing -- for example, "bzip2
+ -dc rec*file.bz2 > recovered_data" -- lists the files in
+ the correct order.
+
+ bzip2recover should be of most use dealing with large .bz2
+ files, as these will contain many blocks. It is clearly
+ futile to use it on damaged single-block files, since a
+ damaged block cannot be recovered. If you wish to min-
+ imise any potential data loss through media or transmis-
+ sion errors, you might consider compressing with a smaller
+ block size.
+
+
+PERFORMANCE NOTES
+ The sorting phase of compression gathers together similar
+ strings in the file. Because of this, files containing
+ very long runs of repeated symbols, like "aabaabaabaab
+ ..." (repeated several hundred times) may compress more
+ slowly than normal. Versions 0.9.5 and above fare much
+ better than previous versions in this respect. The ratio
+ between worst-case and average-case compression time is in
+ the region of 10:1. For previous versions, this figure
+ was more like 100:1. You can use the -vvvv option to mon-
+ itor progress in great detail, if you want.
+
+ Decompression speed is unaffected by these phenomena.
+
+ bzip2 usually allocates several megabytes of memory to
+ operate in, and then charges all over it in a fairly ran-
+ dom fashion. This means that performance, both for com-
+ pressing and decompressing, is largely determined by the
+ speed at which your machine can service cache misses.
+ Because of this, small changes to the code to reduce the
+ miss rate have been observed to give disproportionately
+ large performance improvements. I imagine bzip2 will per-
+ form best on machines with very large caches.
+
+
+CAVEATS
+ I/O error messages are not as helpful as they could be.
+ bzip2 tries hard to detect I/O errors and exit cleanly,
+ but the details of what the problem is sometimes seem
+ rather misleading.
+
+ This manual page pertains to version 1.0 of bzip2. Com-
+ pressed data created by this version is entirely forwards
+ and backwards compatible with the previous public
+ releases, versions 0.1pl2, 0.9.0 and 0.9.5, but with the
+ following exception: 0.9.0 and above can correctly decom-
+ press multiple concatenated compressed files. 0.1pl2 can-
+ not do this; it will stop after decompressing just the
+ first file in the stream.
+
+ bzip2recover uses 32-bit integers to represent bit posi-
+ tions in compressed files, so it cannot handle compressed
+ files more than 512 megabytes long. This could easily be
+ fixed.
+
+
+AUTHOR
+ Julian Seward, jseward@acm.org.
+
+ http://sourceware.cygnus.com/bzip2
+ http://www.muraroa.demon.co.uk
+
+ The ideas embodied in bzip2 are due to (at least) the fol-
+ lowing people: Michael Burrows and David Wheeler (for the
+ block sorting transformation), David Wheeler (again, for
+ the Huffman coder), Peter Fenwick (for the structured cod-
+ ing model in the original bzip, and many refinements), and
+ Alistair Moffat, Radford Neal and Ian Witten (for the
+ arithmetic coder in the original bzip). I am much
+ indebted for their help, support and advice. See the man-
+ ual in the source distribution for pointers to sources of
+ documentation. Christian von Roques encouraged me to look
+ for faster sorting algorithms, so as to speed up compres-
+ sion. Bela Lubkin encouraged me to improve the worst-case
+ compression performance. Many people sent patches, helped
+ with portability problems, lent machines, gave advice and
+ were generally helpful.
+
--- /dev/null
+
+/*-----------------------------------------------------------*/
+/*--- Block recoverer program for bzip2 ---*/
+/*--- bzip2recover.c ---*/
+/*-----------------------------------------------------------*/
+
+/*--
+ This program is bzip2recover, a program to attempt data
+ salvage from damaged files created by the accompanying
+ bzip2-1.0 program.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+--*/
+
+/*--
+ This program is a complete hack and should be rewritten
+ properly. It isn't very complicated.
+--*/
+
+#include <stdio.h>
+#include <errno.h>
+#include <stdlib.h>
+#include <string.h>
+
+typedef unsigned int UInt32;
+typedef int Int32;
+typedef unsigned char UChar;
+typedef char Char;
+typedef unsigned char Bool;
+#define True ((Bool)1)
+#define False ((Bool)0)
+
+
+Char inFileName[2000];
+Char outFileName[2000];
+Char progName[2000];
+
+UInt32 bytesOut = 0;
+UInt32 bytesIn = 0;
+
+
+/*---------------------------------------------------*/
+/*--- I/O errors ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+void readError ( void )
+{
+ fprintf ( stderr,
+ "%s: I/O error reading `%s', possible reason follows.\n",
+ progName, inFileName );
+ perror ( progName );
+ fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n",
+ progName );
+ exit ( 1 );
+}
+
+
+/*---------------------------------------------*/
+void writeError ( void )
+{
+ fprintf ( stderr,
+ "%s: I/O error reading `%s', possible reason follows.\n",
+ progName, inFileName );
+ perror ( progName );
+ fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n",
+ progName );
+ exit ( 1 );
+}
+
+
+/*---------------------------------------------*/
+void mallocFail ( Int32 n )
+{
+ fprintf ( stderr,
+ "%s: malloc failed on request for %d bytes.\n",
+ progName, n );
+ fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n",
+ progName );
+ exit ( 1 );
+}
+
+
+/*---------------------------------------------------*/
+/*--- Bit stream I/O ---*/
+/*---------------------------------------------------*/
+
+typedef
+ struct {
+ FILE* handle;
+ Int32 buffer;
+ Int32 buffLive;
+ Char mode;
+ }
+ BitStream;
+
+
+/*---------------------------------------------*/
+BitStream* bsOpenReadStream ( FILE* stream )
+{
+ BitStream *bs = malloc ( sizeof(BitStream) );
+ if (bs == NULL) mallocFail ( sizeof(BitStream) );
+ bs->handle = stream;
+ bs->buffer = 0;
+ bs->buffLive = 0;
+ bs->mode = 'r';
+ return bs;
+}
+
+
+/*---------------------------------------------*/
+BitStream* bsOpenWriteStream ( FILE* stream )
+{
+ BitStream *bs = malloc ( sizeof(BitStream) );
+ if (bs == NULL) mallocFail ( sizeof(BitStream) );
+ bs->handle = stream;
+ bs->buffer = 0;
+ bs->buffLive = 0;
+ bs->mode = 'w';
+ return bs;
+}
+
+
+/*---------------------------------------------*/
+void bsPutBit ( BitStream* bs, Int32 bit )
+{
+ if (bs->buffLive == 8) {
+ Int32 retVal = putc ( (UChar) bs->buffer, bs->handle );
+ if (retVal == EOF) writeError();
+ bytesOut++;
+ bs->buffLive = 1;
+ bs->buffer = bit & 0x1;
+ } else {
+ bs->buffer = ( (bs->buffer << 1) | (bit & 0x1) );
+ bs->buffLive++;
+ };
+}
+
+
+/*---------------------------------------------*/
+/*--
+ Returns 0 or 1, or 2 to indicate EOF.
+--*/
+Int32 bsGetBit ( BitStream* bs )
+{
+ if (bs->buffLive > 0) {
+ bs->buffLive --;
+ return ( ((bs->buffer) >> (bs->buffLive)) & 0x1 );
+ } else {
+ Int32 retVal = getc ( bs->handle );
+ if ( retVal == EOF ) {
+ if (errno != 0) readError();
+ return 2;
+ }
+ bs->buffLive = 7;
+ bs->buffer = retVal;
+ return ( ((bs->buffer) >> 7) & 0x1 );
+ }
+}
+
+
+/*---------------------------------------------*/
+void bsClose ( BitStream* bs )
+{
+ Int32 retVal;
+
+ if ( bs->mode == 'w' ) {
+ while ( bs->buffLive < 8 ) {
+ bs->buffLive++;
+ bs->buffer <<= 1;
+ };
+ retVal = putc ( (UChar) (bs->buffer), bs->handle );
+ if (retVal == EOF) writeError();
+ bytesOut++;
+ retVal = fflush ( bs->handle );
+ if (retVal == EOF) writeError();
+ }
+ retVal = fclose ( bs->handle );
+ if (retVal == EOF) {
+ if (bs->mode == 'w') writeError(); else readError();
+ }
+ free ( bs );
+}
+
+
+/*---------------------------------------------*/
+void bsPutUChar ( BitStream* bs, UChar c )
+{
+ Int32 i;
+ for (i = 7; i >= 0; i--)
+ bsPutBit ( bs, (((UInt32) c) >> i) & 0x1 );
+}
+
+
+/*---------------------------------------------*/
+void bsPutUInt32 ( BitStream* bs, UInt32 c )
+{
+ Int32 i;
+
+ for (i = 31; i >= 0; i--)
+ bsPutBit ( bs, (c >> i) & 0x1 );
+}
+
+
+/*---------------------------------------------*/
+Bool endsInBz2 ( Char* name )
+{
+ Int32 n = strlen ( name );
+ if (n <= 4) return False;
+ return
+ (name[n-4] == '.' &&
+ name[n-3] == 'b' &&
+ name[n-2] == 'z' &&
+ name[n-1] == '2');
+}
+
+
+/*---------------------------------------------------*/
+/*--- ---*/
+/*---------------------------------------------------*/
+
+#define BLOCK_HEADER_HI 0x00003141UL
+#define BLOCK_HEADER_LO 0x59265359UL
+
+#define BLOCK_ENDMARK_HI 0x00001772UL
+#define BLOCK_ENDMARK_LO 0x45385090UL
+
+
+UInt32 bStart[20000];
+UInt32 bEnd[20000];
+UInt32 rbStart[20000];
+UInt32 rbEnd[20000];
+
+Int32 main ( Int32 argc, Char** argv )
+{
+ FILE* inFile;
+ FILE* outFile;
+ BitStream* bsIn, *bsWr;
+ Int32 currBlock, b, wrBlock;
+ UInt32 bitsRead;
+ Int32 rbCtr;
+
+
+ UInt32 buffHi, buffLo, blockCRC;
+ Char* p;
+
+ strcpy ( progName, argv[0] );
+ inFileName[0] = outFileName[0] = 0;
+
+ fprintf ( stderr, "bzip2recover 1.0: extracts blocks from damaged .bz2 files.\n" );
+
+ if (argc != 2) {
+ fprintf ( stderr, "%s: usage is `%s damaged_file_name'.\n",
+ progName, progName );
+ exit(1);
+ }
+
+ strcpy ( inFileName, argv[1] );
+
+ inFile = fopen ( inFileName, "rb" );
+ if (inFile == NULL) {
+ fprintf ( stderr, "%s: can't read `%s'\n", progName, inFileName );
+ exit(1);
+ }
+
+ bsIn = bsOpenReadStream ( inFile );
+ fprintf ( stderr, "%s: searching for block boundaries ...\n", progName );
+
+ bitsRead = 0;
+ buffHi = buffLo = 0;
+ currBlock = 0;
+ bStart[currBlock] = 0;
+
+ rbCtr = 0;
+
+ while (True) {
+ b = bsGetBit ( bsIn );
+ bitsRead++;
+ if (b == 2) {
+ if (bitsRead >= bStart[currBlock] &&
+ (bitsRead - bStart[currBlock]) >= 40) {
+ bEnd[currBlock] = bitsRead-1;
+ if (currBlock > 0)
+ fprintf ( stderr, " block %d runs from %d to %d (incomplete)\n",
+ currBlock, bStart[currBlock], bEnd[currBlock] );
+ } else
+ currBlock--;
+ break;
+ }
+ buffHi = (buffHi << 1) | (buffLo >> 31);
+ buffLo = (buffLo << 1) | (b & 1);
+ if ( ( (buffHi & 0x0000ffff) == BLOCK_HEADER_HI
+ && buffLo == BLOCK_HEADER_LO)
+ ||
+ ( (buffHi & 0x0000ffff) == BLOCK_ENDMARK_HI
+ && buffLo == BLOCK_ENDMARK_LO)
+ ) {
+ if (bitsRead > 49)
+ bEnd[currBlock] = bitsRead-49; else
+ bEnd[currBlock] = 0;
+ if (currBlock > 0 &&
+ (bEnd[currBlock] - bStart[currBlock]) >= 130) {
+ fprintf ( stderr, " block %d runs from %d to %d\n",
+ rbCtr+1, bStart[currBlock], bEnd[currBlock] );
+ rbStart[rbCtr] = bStart[currBlock];
+ rbEnd[rbCtr] = bEnd[currBlock];
+ rbCtr++;
+ }
+ currBlock++;
+
+ bStart[currBlock] = bitsRead;
+ }
+ }
+
+ bsClose ( bsIn );
+
+ /*-- identified blocks run from 1 to rbCtr inclusive. --*/
+
+ if (rbCtr < 1) {
+ fprintf ( stderr,
+ "%s: sorry, I couldn't find any block boundaries.\n",
+ progName );
+ exit(1);
+ };
+
+ fprintf ( stderr, "%s: splitting into blocks\n", progName );
+
+ inFile = fopen ( inFileName, "rb" );
+ if (inFile == NULL) {
+ fprintf ( stderr, "%s: can't open `%s'\n", progName, inFileName );
+ exit(1);
+ }
+ bsIn = bsOpenReadStream ( inFile );
+
+ /*-- placate gcc's dataflow analyser --*/
+ blockCRC = 0; bsWr = 0;
+
+ bitsRead = 0;
+ outFile = NULL;
+ wrBlock = 0;
+ while (True) {
+ b = bsGetBit(bsIn);
+ if (b == 2) break;
+ buffHi = (buffHi << 1) | (buffLo >> 31);
+ buffLo = (buffLo << 1) | (b & 1);
+ if (bitsRead == 47+rbStart[wrBlock])
+ blockCRC = (buffHi << 16) | (buffLo >> 16);
+
+ if (outFile != NULL && bitsRead >= rbStart[wrBlock]
+ && bitsRead <= rbEnd[wrBlock]) {
+ bsPutBit ( bsWr, b );
+ }
+
+ bitsRead++;
+
+ if (bitsRead == rbEnd[wrBlock]+1) {
+ if (outFile != NULL) {
+ bsPutUChar ( bsWr, 0x17 ); bsPutUChar ( bsWr, 0x72 );
+ bsPutUChar ( bsWr, 0x45 ); bsPutUChar ( bsWr, 0x38 );
+ bsPutUChar ( bsWr, 0x50 ); bsPutUChar ( bsWr, 0x90 );
+ bsPutUInt32 ( bsWr, blockCRC );
+ bsClose ( bsWr );
+ }
+ if (wrBlock >= rbCtr) break;
+ wrBlock++;
+ } else
+ if (bitsRead == rbStart[wrBlock]) {
+ outFileName[0] = 0;
+ sprintf ( outFileName, "rec%4d", wrBlock+1 );
+ for (p = outFileName; *p != 0; p++) if (*p == ' ') *p = '0';
+ strcat ( outFileName, inFileName );
+ if ( !endsInBz2(outFileName)) strcat ( outFileName, ".bz2" );
+
+ fprintf ( stderr, " writing block %d to `%s' ...\n",
+ wrBlock+1, outFileName );
+
+ outFile = fopen ( outFileName, "wb" );
+ if (outFile == NULL) {
+ fprintf ( stderr, "%s: can't write `%s'\n",
+ progName, outFileName );
+ exit(1);
+ }
+ bsWr = bsOpenWriteStream ( outFile );
+ bsPutUChar ( bsWr, 'B' ); bsPutUChar ( bsWr, 'Z' );
+ bsPutUChar ( bsWr, 'h' ); bsPutUChar ( bsWr, '9' );
+ bsPutUChar ( bsWr, 0x31 ); bsPutUChar ( bsWr, 0x41 );
+ bsPutUChar ( bsWr, 0x59 ); bsPutUChar ( bsWr, 0x26 );
+ bsPutUChar ( bsWr, 0x53 ); bsPutUChar ( bsWr, 0x59 );
+ }
+ }
+
+ fprintf ( stderr, "%s: finished\n", progName );
+ return 0;
+}
+
+
+
+/*-----------------------------------------------------------*/
+/*--- end bzip2recover.c ---*/
+/*-----------------------------------------------------------*/
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Library top-level functions. ---*/
+/*--- bzlib.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+/*--
+ CHANGES
+ ~~~~~~~
+ 0.9.0 -- original version.
+
+ 0.9.0a/b -- no changes in this file.
+
+ 0.9.0c
+ * made zero-length BZ_FLUSH work correctly in bzCompress().
+ * fixed bzWrite/bzRead to ignore zero-length requests.
+ * fixed bzread to correctly handle read requests after EOF.
+ * wrong parameter order in call to bzDecompressInit in
+ bzBuffToBuffDecompress. Fixed.
+--*/
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------------*/
+/*--- Compression stuff ---*/
+/*---------------------------------------------------*/
+
+
+/*---------------------------------------------------*/
+#ifndef BZ_NO_STDIO
+void BZ2_bz__AssertH__fail ( int errcode )
+{
+ fprintf(stderr,
+ "\n\nbzip2/libbzip2: internal error number %d.\n"
+ "This is a bug in bzip2/libbzip2, %s.\n"
+ "Please report it to me at: jseward@acm.org. If this happened\n"
+ "when you were using some program which uses libbzip2 as a\n"
+ "component, you should also report this bug to the author(s)\n"
+ "of that program. Please make an effort to report this bug;\n"
+ "timely and accurate bug reports eventually lead to higher\n"
+ "quality software. Thanks. Julian Seward, 21 March 2000.\n\n",
+ errcode,
+ BZ2_bzlibVersion()
+ );
+ exit(3);
+}
+#endif
+
+
+/*---------------------------------------------------*/
+static
+int bz_config_ok ( void )
+{
+ if (sizeof(int) != 4) return 0;
+ if (sizeof(short) != 2) return 0;
+ if (sizeof(char) != 1) return 0;
+ return 1;
+}
+
+
+/*---------------------------------------------------*/
+static
+void* default_bzalloc ( void* opaque, Int32 items, Int32 size )
+{
+ void* v = malloc ( items * size );
+ return v;
+}
+
+static
+void default_bzfree ( void* opaque, void* addr )
+{
+ if (addr != NULL) free ( addr );
+}
+
+
+/*---------------------------------------------------*/
+static
+void prepare_new_block ( EState* s )
+{
+ Int32 i;
+ s->nblock = 0;
+ s->numZ = 0;
+ s->state_out_pos = 0;
+ BZ_INITIALISE_CRC ( s->blockCRC );
+ for (i = 0; i < 256; i++) s->inUse[i] = False;
+ s->blockNo++;
+}
+
+
+/*---------------------------------------------------*/
+static
+void init_RL ( EState* s )
+{
+ s->state_in_ch = 256;
+ s->state_in_len = 0;
+}
+
+
+static
+Bool isempty_RL ( EState* s )
+{
+ if (s->state_in_ch < 256 && s->state_in_len > 0)
+ return False; else
+ return True;
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzCompressInit)
+ ( bz_stream* strm,
+ int blockSize100k,
+ int verbosity,
+ int workFactor )
+{
+ Int32 n;
+ EState* s;
+
+ if (!bz_config_ok()) return BZ_CONFIG_ERROR;
+
+ if (strm == NULL ||
+ blockSize100k < 1 || blockSize100k > 9 ||
+ workFactor < 0 || workFactor > 250)
+ return BZ_PARAM_ERROR;
+
+ if (workFactor == 0) workFactor = 30;
+ if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc;
+ if (strm->bzfree == NULL) strm->bzfree = default_bzfree;
+
+ s = BZALLOC( sizeof(EState) );
+ if (s == NULL) return BZ_MEM_ERROR;
+ s->strm = strm;
+
+ s->arr1 = NULL;
+ s->arr2 = NULL;
+ s->ftab = NULL;
+
+ n = 100000 * blockSize100k;
+ s->arr1 = BZALLOC( n * sizeof(UInt32) );
+ s->arr2 = BZALLOC( (n+BZ_N_OVERSHOOT) * sizeof(UInt32) );
+ s->ftab = BZALLOC( 65537 * sizeof(UInt32) );
+
+ if (s->arr1 == NULL || s->arr2 == NULL || s->ftab == NULL) {
+ if (s->arr1 != NULL) BZFREE(s->arr1);
+ if (s->arr2 != NULL) BZFREE(s->arr2);
+ if (s->ftab != NULL) BZFREE(s->ftab);
+ if (s != NULL) BZFREE(s);
+ return BZ_MEM_ERROR;
+ }
+
+ s->blockNo = 0;
+ s->state = BZ_S_INPUT;
+ s->mode = BZ_M_RUNNING;
+ s->combinedCRC = 0;
+ s->blockSize100k = blockSize100k;
+ s->nblockMAX = 100000 * blockSize100k - 19;
+ s->verbosity = verbosity;
+ s->workFactor = workFactor;
+
+ s->block = (UChar*)s->arr2;
+ s->mtfv = (UInt16*)s->arr1;
+ s->zbits = NULL;
+ s->ptr = (UInt32*)s->arr1;
+
+ strm->state = s;
+ strm->total_in_lo32 = 0;
+ strm->total_in_hi32 = 0;
+ strm->total_out_lo32 = 0;
+ strm->total_out_hi32 = 0;
+ init_RL ( s );
+ prepare_new_block ( s );
+ return BZ_OK;
+}
+
+
+/*---------------------------------------------------*/
+static
+void add_pair_to_block ( EState* s )
+{
+ Int32 i;
+ UChar ch = (UChar)(s->state_in_ch);
+ for (i = 0; i < s->state_in_len; i++) {
+ BZ_UPDATE_CRC( s->blockCRC, ch );
+ }
+ s->inUse[s->state_in_ch] = True;
+ switch (s->state_in_len) {
+ case 1:
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ break;
+ case 2:
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ break;
+ case 3:
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ break;
+ default:
+ s->inUse[s->state_in_len-4] = True;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = (UChar)ch; s->nblock++;
+ s->block[s->nblock] = ((UChar)(s->state_in_len-4));
+ s->nblock++;
+ break;
+ }
+}
+
+
+/*---------------------------------------------------*/
+static
+void flush_RL ( EState* s )
+{
+ if (s->state_in_ch < 256) add_pair_to_block ( s );
+ init_RL ( s );
+}
+
+
+/*---------------------------------------------------*/
+#define ADD_CHAR_TO_BLOCK(zs,zchh0) \
+{ \
+ UInt32 zchh = (UInt32)(zchh0); \
+ /*-- fast track the common case --*/ \
+ if (zchh != zs->state_in_ch && \
+ zs->state_in_len == 1) { \
+ UChar ch = (UChar)(zs->state_in_ch); \
+ BZ_UPDATE_CRC( zs->blockCRC, ch ); \
+ zs->inUse[zs->state_in_ch] = True; \
+ zs->block[zs->nblock] = (UChar)ch; \
+ zs->nblock++; \
+ zs->state_in_ch = zchh; \
+ } \
+ else \
+ /*-- general, uncommon cases --*/ \
+ if (zchh != zs->state_in_ch || \
+ zs->state_in_len == 255) { \
+ if (zs->state_in_ch < 256) \
+ add_pair_to_block ( zs ); \
+ zs->state_in_ch = zchh; \
+ zs->state_in_len = 1; \
+ } else { \
+ zs->state_in_len++; \
+ } \
+}
+
+
+/*---------------------------------------------------*/
+static
+Bool copy_input_until_stop ( EState* s )
+{
+ Bool progress_in = False;
+
+ if (s->mode == BZ_M_RUNNING) {
+
+ /*-- fast track the common case --*/
+ while (True) {
+ /*-- block full? --*/
+ if (s->nblock >= s->nblockMAX) break;
+ /*-- no input? --*/
+ if (s->strm->avail_in == 0) break;
+ progress_in = True;
+ ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) );
+ s->strm->next_in++;
+ s->strm->avail_in--;
+ s->strm->total_in_lo32++;
+ if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++;
+ }
+
+ } else {
+
+ /*-- general, uncommon case --*/
+ while (True) {
+ /*-- block full? --*/
+ if (s->nblock >= s->nblockMAX) break;
+ /*-- no input? --*/
+ if (s->strm->avail_in == 0) break;
+ /*-- flush/finish end? --*/
+ if (s->avail_in_expect == 0) break;
+ progress_in = True;
+ ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) );
+ s->strm->next_in++;
+ s->strm->avail_in--;
+ s->strm->total_in_lo32++;
+ if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++;
+ s->avail_in_expect--;
+ }
+ }
+ return progress_in;
+}
+
+
+/*---------------------------------------------------*/
+static
+Bool copy_output_until_stop ( EState* s )
+{
+ Bool progress_out = False;
+
+ while (True) {
+
+ /*-- no output space? --*/
+ if (s->strm->avail_out == 0) break;
+
+ /*-- block done? --*/
+ if (s->state_out_pos >= s->numZ) break;
+
+ progress_out = True;
+ *(s->strm->next_out) = s->zbits[s->state_out_pos];
+ s->state_out_pos++;
+ s->strm->avail_out--;
+ s->strm->next_out++;
+ s->strm->total_out_lo32++;
+ if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+ }
+
+ return progress_out;
+}
+
+
+/*---------------------------------------------------*/
+static
+Bool handle_compress ( bz_stream* strm )
+{
+ Bool progress_in = False;
+ Bool progress_out = False;
+ EState* s = strm->state;
+
+ while (True) {
+
+ if (s->state == BZ_S_OUTPUT) {
+ progress_out |= copy_output_until_stop ( s );
+ if (s->state_out_pos < s->numZ) break;
+ if (s->mode == BZ_M_FINISHING &&
+ s->avail_in_expect == 0 &&
+ isempty_RL(s)) break;
+ prepare_new_block ( s );
+ s->state = BZ_S_INPUT;
+ if (s->mode == BZ_M_FLUSHING &&
+ s->avail_in_expect == 0 &&
+ isempty_RL(s)) break;
+ }
+
+ if (s->state == BZ_S_INPUT) {
+ progress_in |= copy_input_until_stop ( s );
+ if (s->mode != BZ_M_RUNNING && s->avail_in_expect == 0) {
+ flush_RL ( s );
+ BZ2_compressBlock ( s, (Bool)(s->mode == BZ_M_FINISHING) );
+ s->state = BZ_S_OUTPUT;
+ }
+ else
+ if (s->nblock >= s->nblockMAX) {
+ BZ2_compressBlock ( s, False );
+ s->state = BZ_S_OUTPUT;
+ }
+ else
+ if (s->strm->avail_in == 0) {
+ break;
+ }
+ }
+
+ }
+
+ return progress_in || progress_out;
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzCompress) ( bz_stream *strm, int action )
+{
+ Bool progress;
+ EState* s;
+ if (strm == NULL) return BZ_PARAM_ERROR;
+ s = strm->state;
+ if (s == NULL) return BZ_PARAM_ERROR;
+ if (s->strm != strm) return BZ_PARAM_ERROR;
+
+ preswitch:
+ switch (s->mode) {
+
+ case BZ_M_IDLE:
+ return BZ_SEQUENCE_ERROR;
+
+ case BZ_M_RUNNING:
+ if (action == BZ_RUN) {
+ progress = handle_compress ( strm );
+ return progress ? BZ_RUN_OK : BZ_PARAM_ERROR;
+ }
+ else
+ if (action == BZ_FLUSH) {
+ s->avail_in_expect = strm->avail_in;
+ s->mode = BZ_M_FLUSHING;
+ goto preswitch;
+ }
+ else
+ if (action == BZ_FINISH) {
+ s->avail_in_expect = strm->avail_in;
+ s->mode = BZ_M_FINISHING;
+ goto preswitch;
+ }
+ else
+ return BZ_PARAM_ERROR;
+
+ case BZ_M_FLUSHING:
+ if (action != BZ_FLUSH) return BZ_SEQUENCE_ERROR;
+ if (s->avail_in_expect != s->strm->avail_in)
+ return BZ_SEQUENCE_ERROR;
+ progress = handle_compress ( strm );
+ if (s->avail_in_expect > 0 || !isempty_RL(s) ||
+ s->state_out_pos < s->numZ) return BZ_FLUSH_OK;
+ s->mode = BZ_M_RUNNING;
+ return BZ_RUN_OK;
+
+ case BZ_M_FINISHING:
+ if (action != BZ_FINISH) return BZ_SEQUENCE_ERROR;
+ if (s->avail_in_expect != s->strm->avail_in)
+ return BZ_SEQUENCE_ERROR;
+ progress = handle_compress ( strm );
+ if (!progress) return BZ_SEQUENCE_ERROR;
+ if (s->avail_in_expect > 0 || !isempty_RL(s) ||
+ s->state_out_pos < s->numZ) return BZ_FINISH_OK;
+ s->mode = BZ_M_IDLE;
+ return BZ_STREAM_END;
+ }
+ return BZ_OK; /*--not reached--*/
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzCompressEnd) ( bz_stream *strm )
+{
+ EState* s;
+ if (strm == NULL) return BZ_PARAM_ERROR;
+ s = strm->state;
+ if (s == NULL) return BZ_PARAM_ERROR;
+ if (s->strm != strm) return BZ_PARAM_ERROR;
+
+ if (s->arr1 != NULL) BZFREE(s->arr1);
+ if (s->arr2 != NULL) BZFREE(s->arr2);
+ if (s->ftab != NULL) BZFREE(s->ftab);
+ BZFREE(strm->state);
+
+ strm->state = NULL;
+
+ return BZ_OK;
+}
+
+
+/*---------------------------------------------------*/
+/*--- Decompression stuff ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzDecompressInit)
+ ( bz_stream* strm,
+ int verbosity,
+ int small )
+{
+ DState* s;
+
+ if (!bz_config_ok()) return BZ_CONFIG_ERROR;
+
+ if (strm == NULL) return BZ_PARAM_ERROR;
+ if (small != 0 && small != 1) return BZ_PARAM_ERROR;
+ if (verbosity < 0 || verbosity > 4) return BZ_PARAM_ERROR;
+
+ if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc;
+ if (strm->bzfree == NULL) strm->bzfree = default_bzfree;
+
+ s = BZALLOC( sizeof(DState) );
+ if (s == NULL) return BZ_MEM_ERROR;
+ s->strm = strm;
+ strm->state = s;
+ s->state = BZ_X_MAGIC_1;
+ s->bsLive = 0;
+ s->bsBuff = 0;
+ s->calculatedCombinedCRC = 0;
+ strm->total_in_lo32 = 0;
+ strm->total_in_hi32 = 0;
+ strm->total_out_lo32 = 0;
+ strm->total_out_hi32 = 0;
+ s->smallDecompress = (Bool)small;
+ s->ll4 = NULL;
+ s->ll16 = NULL;
+ s->tt = NULL;
+ s->currBlockNo = 0;
+ s->verbosity = verbosity;
+
+ return BZ_OK;
+}
+
+
+/*---------------------------------------------------*/
+static
+void unRLE_obuf_to_output_FAST ( DState* s )
+{
+ UChar k1;
+
+ if (s->blockRandomised) {
+
+ while (True) {
+ /* try to finish existing run */
+ while (True) {
+ if (s->strm->avail_out == 0) return;
+ if (s->state_out_len == 0) break;
+ *( (UChar*)(s->strm->next_out) ) = s->state_out_ch;
+ BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch );
+ s->state_out_len--;
+ s->strm->next_out++;
+ s->strm->avail_out--;
+ s->strm->total_out_lo32++;
+ if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+ }
+
+ /* can a new run be started? */
+ if (s->nblock_used == s->save_nblock+1) return;
+
+
+ s->state_out_len = 1;
+ s->state_out_ch = s->k0;
+ BZ_GET_FAST(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ s->state_out_len = 2;
+ BZ_GET_FAST(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ s->state_out_len = 3;
+ BZ_GET_FAST(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ BZ_GET_FAST(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ s->state_out_len = ((Int32)k1) + 4;
+ BZ_GET_FAST(s->k0); BZ_RAND_UPD_MASK;
+ s->k0 ^= BZ_RAND_MASK; s->nblock_used++;
+ }
+
+ } else {
+
+ /* restore */
+ UInt32 c_calculatedBlockCRC = s->calculatedBlockCRC;
+ UChar c_state_out_ch = s->state_out_ch;
+ Int32 c_state_out_len = s->state_out_len;
+ Int32 c_nblock_used = s->nblock_used;
+ Int32 c_k0 = s->k0;
+ UInt32* c_tt = s->tt;
+ UInt32 c_tPos = s->tPos;
+ char* cs_next_out = s->strm->next_out;
+ unsigned int cs_avail_out = s->strm->avail_out;
+ /* end restore */
+
+ UInt32 avail_out_INIT = cs_avail_out;
+ Int32 s_save_nblockPP = s->save_nblock+1;
+ unsigned int total_out_lo32_old;
+
+ while (True) {
+
+ /* try to finish existing run */
+ if (c_state_out_len > 0) {
+ while (True) {
+ if (cs_avail_out == 0) goto return_notr;
+ if (c_state_out_len == 1) break;
+ *( (UChar*)(cs_next_out) ) = c_state_out_ch;
+ BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch );
+ c_state_out_len--;
+ cs_next_out++;
+ cs_avail_out--;
+ }
+ s_state_out_len_eq_one:
+ {
+ if (cs_avail_out == 0) {
+ c_state_out_len = 1; goto return_notr;
+ };
+ *( (UChar*)(cs_next_out) ) = c_state_out_ch;
+ BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch );
+ cs_next_out++;
+ cs_avail_out--;
+ }
+ }
+ /* can a new run be started? */
+ if (c_nblock_used == s_save_nblockPP) {
+ c_state_out_len = 0; goto return_notr;
+ };
+ c_state_out_ch = c_k0;
+ BZ_GET_FAST_C(k1); c_nblock_used++;
+ if (k1 != c_k0) {
+ c_k0 = k1; goto s_state_out_len_eq_one;
+ };
+ if (c_nblock_used == s_save_nblockPP)
+ goto s_state_out_len_eq_one;
+
+ c_state_out_len = 2;
+ BZ_GET_FAST_C(k1); c_nblock_used++;
+ if (c_nblock_used == s_save_nblockPP) continue;
+ if (k1 != c_k0) { c_k0 = k1; continue; };
+
+ c_state_out_len = 3;
+ BZ_GET_FAST_C(k1); c_nblock_used++;
+ if (c_nblock_used == s_save_nblockPP) continue;
+ if (k1 != c_k0) { c_k0 = k1; continue; };
+
+ BZ_GET_FAST_C(k1); c_nblock_used++;
+ c_state_out_len = ((Int32)k1) + 4;
+ BZ_GET_FAST_C(c_k0); c_nblock_used++;
+ }
+
+ return_notr:
+ total_out_lo32_old = s->strm->total_out_lo32;
+ s->strm->total_out_lo32 += (avail_out_INIT - cs_avail_out);
+ if (s->strm->total_out_lo32 < total_out_lo32_old)
+ s->strm->total_out_hi32++;
+
+ /* save */
+ s->calculatedBlockCRC = c_calculatedBlockCRC;
+ s->state_out_ch = c_state_out_ch;
+ s->state_out_len = c_state_out_len;
+ s->nblock_used = c_nblock_used;
+ s->k0 = c_k0;
+ s->tt = c_tt;
+ s->tPos = c_tPos;
+ s->strm->next_out = cs_next_out;
+ s->strm->avail_out = cs_avail_out;
+ /* end save */
+ }
+}
+
+
+
+/*---------------------------------------------------*/
+__inline__ Int32 BZ2_indexIntoF ( Int32 indx, Int32 *cftab )
+{
+ Int32 nb, na, mid;
+ nb = 0;
+ na = 256;
+ do {
+ mid = (nb + na) >> 1;
+ if (indx >= cftab[mid]) nb = mid; else na = mid;
+ }
+ while (na - nb != 1);
+ return nb;
+}
+
+
+/*---------------------------------------------------*/
+static
+void unRLE_obuf_to_output_SMALL ( DState* s )
+{
+ UChar k1;
+
+ if (s->blockRandomised) {
+
+ while (True) {
+ /* try to finish existing run */
+ while (True) {
+ if (s->strm->avail_out == 0) return;
+ if (s->state_out_len == 0) break;
+ *( (UChar*)(s->strm->next_out) ) = s->state_out_ch;
+ BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch );
+ s->state_out_len--;
+ s->strm->next_out++;
+ s->strm->avail_out--;
+ s->strm->total_out_lo32++;
+ if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+ }
+
+ /* can a new run be started? */
+ if (s->nblock_used == s->save_nblock+1) return;
+
+
+ s->state_out_len = 1;
+ s->state_out_ch = s->k0;
+ BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ s->state_out_len = 2;
+ BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ s->state_out_len = 3;
+ BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK;
+ k1 ^= BZ_RAND_MASK; s->nblock_used++;
+ s->state_out_len = ((Int32)k1) + 4;
+ BZ_GET_SMALL(s->k0); BZ_RAND_UPD_MASK;
+ s->k0 ^= BZ_RAND_MASK; s->nblock_used++;
+ }
+
+ } else {
+
+ while (True) {
+ /* try to finish existing run */
+ while (True) {
+ if (s->strm->avail_out == 0) return;
+ if (s->state_out_len == 0) break;
+ *( (UChar*)(s->strm->next_out) ) = s->state_out_ch;
+ BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch );
+ s->state_out_len--;
+ s->strm->next_out++;
+ s->strm->avail_out--;
+ s->strm->total_out_lo32++;
+ if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+ }
+
+ /* can a new run be started? */
+ if (s->nblock_used == s->save_nblock+1) return;
+
+ s->state_out_len = 1;
+ s->state_out_ch = s->k0;
+ BZ_GET_SMALL(k1); s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ s->state_out_len = 2;
+ BZ_GET_SMALL(k1); s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ s->state_out_len = 3;
+ BZ_GET_SMALL(k1); s->nblock_used++;
+ if (s->nblock_used == s->save_nblock+1) continue;
+ if (k1 != s->k0) { s->k0 = k1; continue; };
+
+ BZ_GET_SMALL(k1); s->nblock_used++;
+ s->state_out_len = ((Int32)k1) + 4;
+ BZ_GET_SMALL(s->k0); s->nblock_used++;
+ }
+
+ }
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzDecompress) ( bz_stream *strm )
+{
+ DState* s;
+ if (strm == NULL) return BZ_PARAM_ERROR;
+ s = strm->state;
+ if (s == NULL) return BZ_PARAM_ERROR;
+ if (s->strm != strm) return BZ_PARAM_ERROR;
+
+ while (True) {
+ if (s->state == BZ_X_IDLE) return BZ_SEQUENCE_ERROR;
+ if (s->state == BZ_X_OUTPUT) {
+ if (s->smallDecompress)
+ unRLE_obuf_to_output_SMALL ( s ); else
+ unRLE_obuf_to_output_FAST ( s );
+ if (s->nblock_used == s->save_nblock+1 && s->state_out_len == 0) {
+ BZ_FINALISE_CRC ( s->calculatedBlockCRC );
+ if (s->verbosity >= 3)
+ VPrintf2 ( " {0x%x, 0x%x}", s->storedBlockCRC,
+ s->calculatedBlockCRC );
+ if (s->verbosity >= 2) VPrintf0 ( "]" );
+ if (s->calculatedBlockCRC != s->storedBlockCRC)
+ return BZ_DATA_ERROR;
+ s->calculatedCombinedCRC
+ = (s->calculatedCombinedCRC << 1) |
+ (s->calculatedCombinedCRC >> 31);
+ s->calculatedCombinedCRC ^= s->calculatedBlockCRC;
+ s->state = BZ_X_BLKHDR_1;
+ } else {
+ return BZ_OK;
+ }
+ }
+ if (s->state >= BZ_X_MAGIC_1) {
+ Int32 r = BZ2_decompress ( s );
+ if (r == BZ_STREAM_END) {
+ if (s->verbosity >= 3)
+ VPrintf2 ( "\n combined CRCs: stored = 0x%x, computed = 0x%x",
+ s->storedCombinedCRC, s->calculatedCombinedCRC );
+ if (s->calculatedCombinedCRC != s->storedCombinedCRC)
+ return BZ_DATA_ERROR;
+ return r;
+ }
+ if (s->state != BZ_X_OUTPUT) return r;
+ }
+ }
+
+ AssertH ( 0, 6001 );
+
+ return 0; /*NOTREACHED*/
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzDecompressEnd) ( bz_stream *strm )
+{
+ DState* s;
+ if (strm == NULL) return BZ_PARAM_ERROR;
+ s = strm->state;
+ if (s == NULL) return BZ_PARAM_ERROR;
+ if (s->strm != strm) return BZ_PARAM_ERROR;
+
+ if (s->tt != NULL) BZFREE(s->tt);
+ if (s->ll16 != NULL) BZFREE(s->ll16);
+ if (s->ll4 != NULL) BZFREE(s->ll4);
+
+ BZFREE(strm->state);
+ strm->state = NULL;
+
+ return BZ_OK;
+}
+
+
+#ifndef BZ_NO_STDIO
+/*---------------------------------------------------*/
+/*--- File I/O stuff ---*/
+/*---------------------------------------------------*/
+
+#define BZ_SETERR(eee) \
+{ \
+ if (bzerror != NULL) *bzerror = eee; \
+ if (bzf != NULL) bzf->lastErr = eee; \
+}
+
+typedef
+ struct {
+ FILE* handle;
+ Char buf[BZ_MAX_UNUSED];
+ Int32 bufN;
+ Bool writing;
+ bz_stream strm;
+ Int32 lastErr;
+ Bool initialisedOk;
+ }
+ bzFile;
+
+
+/*---------------------------------------------*/
+static Bool myfeof ( FILE* f )
+{
+ Int32 c = fgetc ( f );
+ if (c == EOF) return True;
+ ungetc ( c, f );
+ return False;
+}
+
+
+/*---------------------------------------------------*/
+BZFILE* BZ_API(BZ2_bzWriteOpen)
+ ( int* bzerror,
+ FILE* f,
+ int blockSize100k,
+ int verbosity,
+ int workFactor )
+{
+ Int32 ret;
+ bzFile* bzf = NULL;
+
+ BZ_SETERR(BZ_OK);
+
+ if (f == NULL ||
+ (blockSize100k < 1 || blockSize100k > 9) ||
+ (workFactor < 0 || workFactor > 250) ||
+ (verbosity < 0 || verbosity > 4))
+ { BZ_SETERR(BZ_PARAM_ERROR); return NULL; };
+
+ if (ferror(f))
+ { BZ_SETERR(BZ_IO_ERROR); return NULL; };
+
+ bzf = malloc ( sizeof(bzFile) );
+ if (bzf == NULL)
+ { BZ_SETERR(BZ_MEM_ERROR); return NULL; };
+
+ BZ_SETERR(BZ_OK);
+ bzf->initialisedOk = False;
+ bzf->bufN = 0;
+ bzf->handle = f;
+ bzf->writing = True;
+ bzf->strm.bzalloc = NULL;
+ bzf->strm.bzfree = NULL;
+ bzf->strm.opaque = NULL;
+
+ if (workFactor == 0) workFactor = 30;
+ ret = BZ2_bzCompressInit ( &(bzf->strm), blockSize100k,
+ verbosity, workFactor );
+ if (ret != BZ_OK)
+ { BZ_SETERR(ret); free(bzf); return NULL; };
+
+ bzf->strm.avail_in = 0;
+ bzf->initialisedOk = True;
+ return bzf;
+}
+
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzWrite)
+ ( int* bzerror,
+ BZFILE* b,
+ void* buf,
+ int len )
+{
+ Int32 n, n2, ret;
+ bzFile* bzf = (bzFile*)b;
+
+ BZ_SETERR(BZ_OK);
+ if (bzf == NULL || buf == NULL || len < 0)
+ { BZ_SETERR(BZ_PARAM_ERROR); return; };
+ if (!(bzf->writing))
+ { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+ if (ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return; };
+
+ if (len == 0)
+ { BZ_SETERR(BZ_OK); return; };
+
+ bzf->strm.avail_in = len;
+ bzf->strm.next_in = buf;
+
+ while (True) {
+ bzf->strm.avail_out = BZ_MAX_UNUSED;
+ bzf->strm.next_out = bzf->buf;
+ ret = BZ2_bzCompress ( &(bzf->strm), BZ_RUN );
+ if (ret != BZ_RUN_OK)
+ { BZ_SETERR(ret); return; };
+
+ if (bzf->strm.avail_out < BZ_MAX_UNUSED) {
+ n = BZ_MAX_UNUSED - bzf->strm.avail_out;
+ n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar),
+ n, bzf->handle );
+ if (n != n2 || ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return; };
+ }
+
+ if (bzf->strm.avail_in == 0)
+ { BZ_SETERR(BZ_OK); return; };
+ }
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzWriteClose)
+ ( int* bzerror,
+ BZFILE* b,
+ int abandon,
+ unsigned int* nbytes_in,
+ unsigned int* nbytes_out )
+{
+ BZ2_bzWriteClose64 ( bzerror, b, abandon,
+ nbytes_in, NULL, nbytes_out, NULL );
+}
+
+
+void BZ_API(BZ2_bzWriteClose64)
+ ( int* bzerror,
+ BZFILE* b,
+ int abandon,
+ unsigned int* nbytes_in_lo32,
+ unsigned int* nbytes_in_hi32,
+ unsigned int* nbytes_out_lo32,
+ unsigned int* nbytes_out_hi32 )
+{
+ Int32 n, n2, ret;
+ bzFile* bzf = (bzFile*)b;
+
+ if (bzf == NULL)
+ { BZ_SETERR(BZ_OK); return; };
+ if (!(bzf->writing))
+ { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+ if (ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return; };
+
+ if (nbytes_in_lo32 != NULL) *nbytes_in_lo32 = 0;
+ if (nbytes_in_hi32 != NULL) *nbytes_in_hi32 = 0;
+ if (nbytes_out_lo32 != NULL) *nbytes_out_lo32 = 0;
+ if (nbytes_out_hi32 != NULL) *nbytes_out_hi32 = 0;
+
+ if ((!abandon) && bzf->lastErr == BZ_OK) {
+ while (True) {
+ bzf->strm.avail_out = BZ_MAX_UNUSED;
+ bzf->strm.next_out = bzf->buf;
+ ret = BZ2_bzCompress ( &(bzf->strm), BZ_FINISH );
+ if (ret != BZ_FINISH_OK && ret != BZ_STREAM_END)
+ { BZ_SETERR(ret); return; };
+
+ if (bzf->strm.avail_out < BZ_MAX_UNUSED) {
+ n = BZ_MAX_UNUSED - bzf->strm.avail_out;
+ n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar),
+ n, bzf->handle );
+ if (n != n2 || ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return; };
+ }
+
+ if (ret == BZ_STREAM_END) break;
+ }
+ }
+
+ if ( !abandon && !ferror ( bzf->handle ) ) {
+ fflush ( bzf->handle );
+ if (ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return; };
+ }
+
+ if (nbytes_in_lo32 != NULL)
+ *nbytes_in_lo32 = bzf->strm.total_in_lo32;
+ if (nbytes_in_hi32 != NULL)
+ *nbytes_in_hi32 = bzf->strm.total_in_hi32;
+ if (nbytes_out_lo32 != NULL)
+ *nbytes_out_lo32 = bzf->strm.total_out_lo32;
+ if (nbytes_out_hi32 != NULL)
+ *nbytes_out_hi32 = bzf->strm.total_out_hi32;
+
+ BZ_SETERR(BZ_OK);
+ BZ2_bzCompressEnd ( &(bzf->strm) );
+ free ( bzf );
+}
+
+
+/*---------------------------------------------------*/
+BZFILE* BZ_API(BZ2_bzReadOpen)
+ ( int* bzerror,
+ FILE* f,
+ int verbosity,
+ int small,
+ void* unused,
+ int nUnused )
+{
+ bzFile* bzf = NULL;
+ int ret;
+
+ BZ_SETERR(BZ_OK);
+
+ if (f == NULL ||
+ (small != 0 && small != 1) ||
+ (verbosity < 0 || verbosity > 4) ||
+ (unused == NULL && nUnused != 0) ||
+ (unused != NULL && (nUnused < 0 || nUnused > BZ_MAX_UNUSED)))
+ { BZ_SETERR(BZ_PARAM_ERROR); return NULL; };
+
+ if (ferror(f))
+ { BZ_SETERR(BZ_IO_ERROR); return NULL; };
+
+ bzf = malloc ( sizeof(bzFile) );
+ if (bzf == NULL)
+ { BZ_SETERR(BZ_MEM_ERROR); return NULL; };
+
+ BZ_SETERR(BZ_OK);
+
+ bzf->initialisedOk = False;
+ bzf->handle = f;
+ bzf->bufN = 0;
+ bzf->writing = False;
+ bzf->strm.bzalloc = NULL;
+ bzf->strm.bzfree = NULL;
+ bzf->strm.opaque = NULL;
+
+ while (nUnused > 0) {
+ bzf->buf[bzf->bufN] = *((UChar*)(unused)); bzf->bufN++;
+ unused = ((void*)( 1 + ((UChar*)(unused)) ));
+ nUnused--;
+ }
+
+ ret = BZ2_bzDecompressInit ( &(bzf->strm), verbosity, small );
+ if (ret != BZ_OK)
+ { BZ_SETERR(ret); free(bzf); return NULL; };
+
+ bzf->strm.avail_in = bzf->bufN;
+ bzf->strm.next_in = bzf->buf;
+
+ bzf->initialisedOk = True;
+ return bzf;
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzReadClose) ( int *bzerror, BZFILE *b )
+{
+ bzFile* bzf = (bzFile*)b;
+
+ BZ_SETERR(BZ_OK);
+ if (bzf == NULL)
+ { BZ_SETERR(BZ_OK); return; };
+
+ if (bzf->writing)
+ { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+
+ if (bzf->initialisedOk)
+ (void)BZ2_bzDecompressEnd ( &(bzf->strm) );
+ free ( bzf );
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzRead)
+ ( int* bzerror,
+ BZFILE* b,
+ void* buf,
+ int len )
+{
+ Int32 n, ret;
+ bzFile* bzf = (bzFile*)b;
+
+ BZ_SETERR(BZ_OK);
+
+ if (bzf == NULL || buf == NULL || len < 0)
+ { BZ_SETERR(BZ_PARAM_ERROR); return 0; };
+
+ if (bzf->writing)
+ { BZ_SETERR(BZ_SEQUENCE_ERROR); return 0; };
+
+ if (len == 0)
+ { BZ_SETERR(BZ_OK); return 0; };
+
+ bzf->strm.avail_out = len;
+ bzf->strm.next_out = buf;
+
+ while (True) {
+
+ if (ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return 0; };
+
+ if (bzf->strm.avail_in == 0 && !myfeof(bzf->handle)) {
+ n = fread ( bzf->buf, sizeof(UChar),
+ BZ_MAX_UNUSED, bzf->handle );
+ if (ferror(bzf->handle))
+ { BZ_SETERR(BZ_IO_ERROR); return 0; };
+ bzf->bufN = n;
+ bzf->strm.avail_in = bzf->bufN;
+ bzf->strm.next_in = bzf->buf;
+ }
+
+ ret = BZ2_bzDecompress ( &(bzf->strm) );
+
+ if (ret != BZ_OK && ret != BZ_STREAM_END)
+ { BZ_SETERR(ret); return 0; };
+
+ if (ret == BZ_OK && myfeof(bzf->handle) &&
+ bzf->strm.avail_in == 0 && bzf->strm.avail_out > 0)
+ { BZ_SETERR(BZ_UNEXPECTED_EOF); return 0; };
+
+ if (ret == BZ_STREAM_END)
+ { BZ_SETERR(BZ_STREAM_END);
+ return len - bzf->strm.avail_out; };
+ if (bzf->strm.avail_out == 0)
+ { BZ_SETERR(BZ_OK); return len; };
+
+ }
+
+ return 0; /*not reached*/
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzReadGetUnused)
+ ( int* bzerror,
+ BZFILE* b,
+ void** unused,
+ int* nUnused )
+{
+ bzFile* bzf = (bzFile*)b;
+ if (bzf == NULL)
+ { BZ_SETERR(BZ_PARAM_ERROR); return; };
+ if (bzf->lastErr != BZ_STREAM_END)
+ { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+ if (unused == NULL || nUnused == NULL)
+ { BZ_SETERR(BZ_PARAM_ERROR); return; };
+
+ BZ_SETERR(BZ_OK);
+ *nUnused = bzf->strm.avail_in;
+ *unused = bzf->strm.next_in;
+}
+#endif
+
+
+/*---------------------------------------------------*/
+/*--- Misc convenience stuff ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzBuffToBuffCompress)
+ ( char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int blockSize100k,
+ int verbosity,
+ int workFactor )
+{
+ bz_stream strm;
+ int ret;
+
+ if (dest == NULL || destLen == NULL ||
+ source == NULL ||
+ blockSize100k < 1 || blockSize100k > 9 ||
+ verbosity < 0 || verbosity > 4 ||
+ workFactor < 0 || workFactor > 250)
+ return BZ_PARAM_ERROR;
+
+ if (workFactor == 0) workFactor = 30;
+ strm.bzalloc = NULL;
+ strm.bzfree = NULL;
+ strm.opaque = NULL;
+ ret = BZ2_bzCompressInit ( &strm, blockSize100k,
+ verbosity, workFactor );
+ if (ret != BZ_OK) return ret;
+
+ strm.next_in = source;
+ strm.next_out = dest;
+ strm.avail_in = sourceLen;
+ strm.avail_out = *destLen;
+
+ ret = BZ2_bzCompress ( &strm, BZ_FINISH );
+ if (ret == BZ_FINISH_OK) goto output_overflow;
+ if (ret != BZ_STREAM_END) goto errhandler;
+
+ /* normal termination */
+ *destLen -= strm.avail_out;
+ BZ2_bzCompressEnd ( &strm );
+ return BZ_OK;
+
+ output_overflow:
+ BZ2_bzCompressEnd ( &strm );
+ return BZ_OUTBUFF_FULL;
+
+ errhandler:
+ BZ2_bzCompressEnd ( &strm );
+ return ret;
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzBuffToBuffDecompress)
+ ( char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int small,
+ int verbosity )
+{
+ bz_stream strm;
+ int ret;
+
+ if (dest == NULL || destLen == NULL ||
+ source == NULL ||
+ (small != 0 && small != 1) ||
+ verbosity < 0 || verbosity > 4)
+ return BZ_PARAM_ERROR;
+
+ strm.bzalloc = NULL;
+ strm.bzfree = NULL;
+ strm.opaque = NULL;
+ ret = BZ2_bzDecompressInit ( &strm, verbosity, small );
+ if (ret != BZ_OK) return ret;
+
+ strm.next_in = source;
+ strm.next_out = dest;
+ strm.avail_in = sourceLen;
+ strm.avail_out = *destLen;
+
+ ret = BZ2_bzDecompress ( &strm );
+ if (ret == BZ_OK) goto output_overflow_or_eof;
+ if (ret != BZ_STREAM_END) goto errhandler;
+
+ /* normal termination */
+ *destLen -= strm.avail_out;
+ BZ2_bzDecompressEnd ( &strm );
+ return BZ_OK;
+
+ output_overflow_or_eof:
+ if (strm.avail_out > 0) {
+ BZ2_bzDecompressEnd ( &strm );
+ return BZ_UNEXPECTED_EOF;
+ } else {
+ BZ2_bzDecompressEnd ( &strm );
+ return BZ_OUTBUFF_FULL;
+ };
+
+ errhandler:
+ BZ2_bzDecompressEnd ( &strm );
+ return ret;
+}
+
+
+/*---------------------------------------------------*/
+/*--
+ Code contributed by Yoshioka Tsuneo
+ (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp),
+ to support better zlib compatibility.
+ This code is not _officially_ part of libbzip2 (yet);
+ I haven't tested it, documented it, or considered the
+ threading-safeness of it.
+ If this code breaks, please contact both Yoshioka and me.
+--*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+/*--
+ return version like "0.9.0c".
+--*/
+const char * BZ_API(BZ2_bzlibVersion)(void)
+{
+ return BZ_VERSION;
+}
+
+
+#ifndef BZ_NO_STDIO
+/*---------------------------------------------------*/
+
+#if defined(_WIN32) || defined(OS2) || defined(MSDOS)
+# include <fcntl.h>
+# include <io.h>
+# define SET_BINARY_MODE(file) setmode(fileno(file),O_BINARY)
+#else
+# define SET_BINARY_MODE(file)
+#endif
+static
+BZFILE * bzopen_or_bzdopen
+ ( const char *path, /* no use when bzdopen */
+ int fd, /* no use when bzdopen */
+ const char *mode,
+ int open_mode) /* bzopen: 0, bzdopen:1 */
+{
+ int bzerr;
+ char unused[BZ_MAX_UNUSED];
+ int blockSize100k = 9;
+ int writing = 0;
+ char mode2[10] = "";
+ FILE *fp = NULL;
+ BZFILE *bzfp = NULL;
+ int verbosity = 0;
+ int workFactor = 30;
+ int smallMode = 0;
+ int nUnused = 0;
+
+ if (mode == NULL) return NULL;
+ while (*mode) {
+ switch (*mode) {
+ case 'r':
+ writing = 0; break;
+ case 'w':
+ writing = 1; break;
+ case 's':
+ smallMode = 1; break;
+ default:
+ if (isdigit((int)(*mode))) {
+ blockSize100k = *mode-'0';
+ }
+ }
+ mode++;
+ }
+ strcat(mode2, writing ? "w" : "r" );
+ strcat(mode2,"b"); /* binary mode */
+
+ if (open_mode==0) {
+ if (path==NULL || strcmp(path,"")==0) {
+ fp = (writing ? stdout : stdin);
+ SET_BINARY_MODE(fp);
+ } else {
+ fp = fopen(path,mode2);
+ }
+ } else {
+#ifdef BZ_STRICT_ANSI
+ fp = NULL;
+#else
+ fp = fdopen(fd,mode2);
+#endif
+ }
+ if (fp == NULL) return NULL;
+
+ if (writing) {
+ /* Guard against total chaos and anarchy -- JRS */
+ if (blockSize100k < 1) blockSize100k = 1;
+ if (blockSize100k > 9) blockSize100k = 9;
+ bzfp = BZ2_bzWriteOpen(&bzerr,fp,blockSize100k,
+ verbosity,workFactor);
+ } else {
+ bzfp = BZ2_bzReadOpen(&bzerr,fp,verbosity,smallMode,
+ unused,nUnused);
+ }
+ if (bzfp == NULL) {
+ if (fp != stdin && fp != stdout) fclose(fp);
+ return NULL;
+ }
+ return bzfp;
+}
+
+
+/*---------------------------------------------------*/
+/*--
+ open file for read or write.
+ ex) bzopen("file","w9")
+ case path="" or NULL => use stdin or stdout.
+--*/
+BZFILE * BZ_API(BZ2_bzopen)
+ ( const char *path,
+ const char *mode )
+{
+ return bzopen_or_bzdopen(path,-1,mode,/*bzopen*/0);
+}
+
+
+/*---------------------------------------------------*/
+BZFILE * BZ_API(BZ2_bzdopen)
+ ( int fd,
+ const char *mode )
+{
+ return bzopen_or_bzdopen(NULL,fd,mode,/*bzdopen*/1);
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzread) (BZFILE* b, void* buf, int len )
+{
+ int bzerr, nread;
+ if (((bzFile*)b)->lastErr == BZ_STREAM_END) return 0;
+ nread = BZ2_bzRead(&bzerr,b,buf,len);
+ if (bzerr == BZ_OK || bzerr == BZ_STREAM_END) {
+ return nread;
+ } else {
+ return -1;
+ }
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzwrite) (BZFILE* b, void* buf, int len )
+{
+ int bzerr;
+
+ BZ2_bzWrite(&bzerr,b,buf,len);
+ if(bzerr == BZ_OK){
+ return len;
+ }else{
+ return -1;
+ }
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzflush) (BZFILE *b)
+{
+ /* do nothing now... */
+ return 0;
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzclose) (BZFILE* b)
+{
+ int bzerr;
+ FILE *fp = ((bzFile *)b)->handle;
+
+ if (b==NULL) {return;}
+ if(((bzFile*)b)->writing){
+ BZ2_bzWriteClose(&bzerr,b,0,NULL,NULL);
+ if(bzerr != BZ_OK){
+ BZ2_bzWriteClose(NULL,b,1,NULL,NULL);
+ }
+ }else{
+ BZ2_bzReadClose(&bzerr,b);
+ }
+ if(fp!=stdin && fp!=stdout){
+ fclose(fp);
+ }
+}
+
+
+/*---------------------------------------------------*/
+/*--
+ return last error code
+--*/
+static char *bzerrorstrings[] = {
+ "OK"
+ ,"SEQUENCE_ERROR"
+ ,"PARAM_ERROR"
+ ,"MEM_ERROR"
+ ,"DATA_ERROR"
+ ,"DATA_ERROR_MAGIC"
+ ,"IO_ERROR"
+ ,"UNEXPECTED_EOF"
+ ,"OUTBUFF_FULL"
+ ,"CONFIG_ERROR"
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+};
+
+
+const char * BZ_API(BZ2_bzerror) (BZFILE *b, int *errnum)
+{
+ int err = ((bzFile *)b)->lastErr;
+
+ if(err>0) err = 0;
+ *errnum = err;
+ return bzerrorstrings[err*-1];
+}
+#endif
+
+
+/*-------------------------------------------------------------*/
+/*--- end bzlib.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Public header file for the library. ---*/
+/*--- bzlib.h ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+#ifndef _BZLIB_H
+#define _BZLIB_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define BZ_RUN 0
+#define BZ_FLUSH 1
+#define BZ_FINISH 2
+
+#define BZ_OK 0
+#define BZ_RUN_OK 1
+#define BZ_FLUSH_OK 2
+#define BZ_FINISH_OK 3
+#define BZ_STREAM_END 4
+#define BZ_SEQUENCE_ERROR (-1)
+#define BZ_PARAM_ERROR (-2)
+#define BZ_MEM_ERROR (-3)
+#define BZ_DATA_ERROR (-4)
+#define BZ_DATA_ERROR_MAGIC (-5)
+#define BZ_IO_ERROR (-6)
+#define BZ_UNEXPECTED_EOF (-7)
+#define BZ_OUTBUFF_FULL (-8)
+#define BZ_CONFIG_ERROR (-9)
+
+typedef
+ struct {
+ char *next_in;
+ unsigned int avail_in;
+ unsigned int total_in_lo32;
+ unsigned int total_in_hi32;
+
+ char *next_out;
+ unsigned int avail_out;
+ unsigned int total_out_lo32;
+ unsigned int total_out_hi32;
+
+ void *state;
+
+ void *(*bzalloc)(void *,int,int);
+ void (*bzfree)(void *,void *);
+ void *opaque;
+ }
+ bz_stream;
+
+
+#ifndef BZ_IMPORT
+#define BZ_EXPORT
+#endif
+
+#ifdef _WIN32
+# include <stdio.h>
+# include <windows.h>
+# ifdef small
+ /* windows.h define small to char */
+# undef small
+# endif
+# ifdef BZ_EXPORT
+# define BZ_API(func) WINAPI func
+# define BZ_EXTERN extern
+# else
+ /* import windows dll dynamically */
+# define BZ_API(func) (WINAPI * func)
+# define BZ_EXTERN
+# endif
+#else
+# define BZ_API(func) func
+# define BZ_EXTERN extern
+#endif
+
+
+/*-- Core (low-level) library functions --*/
+
+BZ_EXTERN int BZ_API(BZ2_bzCompressInit) (
+ bz_stream* strm,
+ int blockSize100k,
+ int verbosity,
+ int workFactor
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzCompress) (
+ bz_stream* strm,
+ int action
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzCompressEnd) (
+ bz_stream* strm
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzDecompressInit) (
+ bz_stream *strm,
+ int verbosity,
+ int small
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzDecompress) (
+ bz_stream* strm
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzDecompressEnd) (
+ bz_stream *strm
+ );
+
+
+
+/*-- High(er) level library functions --*/
+
+#ifndef BZ_NO_STDIO
+#define BZ_MAX_UNUSED 5000
+
+typedef void BZFILE;
+
+BZ_EXTERN BZFILE* BZ_API(BZ2_bzReadOpen) (
+ int* bzerror,
+ FILE* f,
+ int verbosity,
+ int small,
+ void* unused,
+ int nUnused
+ );
+
+BZ_EXTERN void BZ_API(BZ2_bzReadClose) (
+ int* bzerror,
+ BZFILE* b
+ );
+
+BZ_EXTERN void BZ_API(BZ2_bzReadGetUnused) (
+ int* bzerror,
+ BZFILE* b,
+ void** unused,
+ int* nUnused
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzRead) (
+ int* bzerror,
+ BZFILE* b,
+ void* buf,
+ int len
+ );
+
+BZ_EXTERN BZFILE* BZ_API(BZ2_bzWriteOpen) (
+ int* bzerror,
+ FILE* f,
+ int blockSize100k,
+ int verbosity,
+ int workFactor
+ );
+
+BZ_EXTERN void BZ_API(BZ2_bzWrite) (
+ int* bzerror,
+ BZFILE* b,
+ void* buf,
+ int len
+ );
+
+BZ_EXTERN void BZ_API(BZ2_bzWriteClose) (
+ int* bzerror,
+ BZFILE* b,
+ int abandon,
+ unsigned int* nbytes_in,
+ unsigned int* nbytes_out
+ );
+
+BZ_EXTERN void BZ_API(BZ2_bzWriteClose64) (
+ int* bzerror,
+ BZFILE* b,
+ int abandon,
+ unsigned int* nbytes_in_lo32,
+ unsigned int* nbytes_in_hi32,
+ unsigned int* nbytes_out_lo32,
+ unsigned int* nbytes_out_hi32
+ );
+#endif
+
+
+/*-- Utility functions --*/
+
+BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffCompress) (
+ char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int blockSize100k,
+ int verbosity,
+ int workFactor
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffDecompress) (
+ char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int small,
+ int verbosity
+ );
+
+
+/*--
+ Code contributed by Yoshioka Tsuneo
+ (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp),
+ to support better zlib compatibility.
+ This code is not _officially_ part of libbzip2 (yet);
+ I haven't tested it, documented it, or considered the
+ threading-safeness of it.
+ If this code breaks, please contact both Yoshioka and me.
+--*/
+
+BZ_EXTERN const char * BZ_API(BZ2_bzlibVersion) (
+ void
+ );
+
+#ifndef BZ_NO_STDIO
+BZ_EXTERN BZFILE * BZ_API(BZ2_bzopen) (
+ const char *path,
+ const char *mode
+ );
+
+BZ_EXTERN BZFILE * BZ_API(BZ2_bzdopen) (
+ int fd,
+ const char *mode
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzread) (
+ BZFILE* b,
+ void* buf,
+ int len
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzwrite) (
+ BZFILE* b,
+ void* buf,
+ int len
+ );
+
+BZ_EXTERN int BZ_API(BZ2_bzflush) (
+ BZFILE* b
+ );
+
+BZ_EXTERN void BZ_API(BZ2_bzclose) (
+ BZFILE* b
+ );
+
+BZ_EXTERN const char * BZ_API(BZ2_bzerror) (
+ BZFILE *b,
+ int *errnum
+ );
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
+
+/*-------------------------------------------------------------*/
+/*--- end bzlib.h ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Private header file for the library. ---*/
+/*--- bzlib_private.h ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+#ifndef _BZLIB_PRIVATE_H
+#define _BZLIB_PRIVATE_H
+
+#include <stdlib.h>
+
+#ifndef BZ_NO_STDIO
+#include <stdio.h>
+#include <ctype.h>
+#include <string.h>
+#endif
+
+#include "bzlib.h"
+
+
+
+/*-- General stuff. --*/
+
+#define BZ_VERSION "1.0.1, 23-June-2000"
+
+typedef char Char;
+typedef unsigned char Bool;
+typedef unsigned char UChar;
+typedef int Int32;
+typedef unsigned int UInt32;
+typedef short Int16;
+typedef unsigned short UInt16;
+
+#define True ((Bool)1)
+#define False ((Bool)0)
+
+#ifndef __GNUC__
+#define __inline__ /* */
+#endif
+
+#ifndef BZ_NO_STDIO
+extern void BZ2_bz__AssertH__fail ( int errcode );
+#define AssertH(cond,errcode) \
+ { if (!(cond)) BZ2_bz__AssertH__fail ( errcode ); }
+#if BZ_DEBUG
+#define AssertD(cond,msg) \
+ { if (!(cond)) { \
+ fprintf ( stderr, \
+ "\n\nlibbzip2(debug build): internal error\n\t%s\n", msg );\
+ exit(1); \
+ }}
+#else
+#define AssertD(cond,msg) /* */
+#endif
+#define VPrintf0(zf) \
+ fprintf(stderr,zf)
+#define VPrintf1(zf,za1) \
+ fprintf(stderr,zf,za1)
+#define VPrintf2(zf,za1,za2) \
+ fprintf(stderr,zf,za1,za2)
+#define VPrintf3(zf,za1,za2,za3) \
+ fprintf(stderr,zf,za1,za2,za3)
+#define VPrintf4(zf,za1,za2,za3,za4) \
+ fprintf(stderr,zf,za1,za2,za3,za4)
+#define VPrintf5(zf,za1,za2,za3,za4,za5) \
+ fprintf(stderr,zf,za1,za2,za3,za4,za5)
+#else
+extern void bz_internal_error ( int errcode );
+#define AssertH(cond,errcode) \
+ { if (!(cond)) bz_internal_error ( errcode ); }
+#define AssertD(cond,msg) /* */
+#define VPrintf0(zf) /* */
+#define VPrintf1(zf,za1) /* */
+#define VPrintf2(zf,za1,za2) /* */
+#define VPrintf3(zf,za1,za2,za3) /* */
+#define VPrintf4(zf,za1,za2,za3,za4) /* */
+#define VPrintf5(zf,za1,za2,za3,za4,za5) /* */
+#endif
+
+
+#define BZALLOC(nnn) (strm->bzalloc)(strm->opaque,(nnn),1)
+#define BZFREE(ppp) (strm->bzfree)(strm->opaque,(ppp))
+
+
+/*-- Constants for the back end. --*/
+
+#define BZ_MAX_ALPHA_SIZE 258
+#define BZ_MAX_CODE_LEN 23
+
+#define BZ_RUNA 0
+#define BZ_RUNB 1
+
+#define BZ_N_GROUPS 6
+#define BZ_G_SIZE 50
+#define BZ_N_ITERS 4
+
+#define BZ_MAX_SELECTORS (2 + (900000 / BZ_G_SIZE))
+
+
+
+/*-- Stuff for randomising repetitive blocks. --*/
+
+extern Int32 BZ2_rNums[512];
+
+#define BZ_RAND_DECLS \
+ Int32 rNToGo; \
+ Int32 rTPos \
+
+#define BZ_RAND_INIT_MASK \
+ s->rNToGo = 0; \
+ s->rTPos = 0 \
+
+#define BZ_RAND_MASK ((s->rNToGo == 1) ? 1 : 0)
+
+#define BZ_RAND_UPD_MASK \
+ if (s->rNToGo == 0) { \
+ s->rNToGo = BZ2_rNums[s->rTPos]; \
+ s->rTPos++; \
+ if (s->rTPos == 512) s->rTPos = 0; \
+ } \
+ s->rNToGo--;
+
+
+
+/*-- Stuff for doing CRCs. --*/
+
+extern UInt32 BZ2_crc32Table[256];
+
+#define BZ_INITIALISE_CRC(crcVar) \
+{ \
+ crcVar = 0xffffffffL; \
+}
+
+#define BZ_FINALISE_CRC(crcVar) \
+{ \
+ crcVar = ~(crcVar); \
+}
+
+#define BZ_UPDATE_CRC(crcVar,cha) \
+{ \
+ crcVar = (crcVar << 8) ^ \
+ BZ2_crc32Table[(crcVar >> 24) ^ \
+ ((UChar)cha)]; \
+}
+
+
+
+/*-- States and modes for compression. --*/
+
+#define BZ_M_IDLE 1
+#define BZ_M_RUNNING 2
+#define BZ_M_FLUSHING 3
+#define BZ_M_FINISHING 4
+
+#define BZ_S_OUTPUT 1
+#define BZ_S_INPUT 2
+
+#define BZ_N_RADIX 2
+#define BZ_N_QSORT 12
+#define BZ_N_SHELL 18
+#define BZ_N_OVERSHOOT (BZ_N_RADIX + BZ_N_QSORT + BZ_N_SHELL + 2)
+
+
+
+
+/*-- Structure holding all the compression-side stuff. --*/
+
+typedef
+ struct {
+ /* pointer back to the struct bz_stream */
+ bz_stream* strm;
+
+ /* mode this stream is in, and whether inputting */
+ /* or outputting data */
+ Int32 mode;
+ Int32 state;
+
+ /* remembers avail_in when flush/finish requested */
+ UInt32 avail_in_expect;
+
+ /* for doing the block sorting */
+ UInt32* arr1;
+ UInt32* arr2;
+ UInt32* ftab;
+ Int32 origPtr;
+
+ /* aliases for arr1 and arr2 */
+ UInt32* ptr;
+ UChar* block;
+ UInt16* mtfv;
+ UChar* zbits;
+
+ /* for deciding when to use the fallback sorting algorithm */
+ Int32 workFactor;
+
+ /* run-length-encoding of the input */
+ UInt32 state_in_ch;
+ Int32 state_in_len;
+ BZ_RAND_DECLS;
+
+ /* input and output limits and current posns */
+ Int32 nblock;
+ Int32 nblockMAX;
+ Int32 numZ;
+ Int32 state_out_pos;
+
+ /* map of bytes used in block */
+ Int32 nInUse;
+ Bool inUse[256];
+ UChar unseqToSeq[256];
+
+ /* the buffer for bit stream creation */
+ UInt32 bsBuff;
+ Int32 bsLive;
+
+ /* block and combined CRCs */
+ UInt32 blockCRC;
+ UInt32 combinedCRC;
+
+ /* misc administratium */
+ Int32 verbosity;
+ Int32 blockNo;
+ Int32 blockSize100k;
+
+ /* stuff for coding the MTF values */
+ Int32 nMTF;
+ Int32 mtfFreq [BZ_MAX_ALPHA_SIZE];
+ UChar selector [BZ_MAX_SELECTORS];
+ UChar selectorMtf[BZ_MAX_SELECTORS];
+
+ UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ Int32 code [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ Int32 rfreq [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ /* second dimension: only 3 needed; 4 makes index calculations faster */
+ UInt32 len_pack[BZ_MAX_ALPHA_SIZE][4];
+
+ }
+ EState;
+
+
+
+/*-- externs for compression. --*/
+
+extern void
+BZ2_blockSort ( EState* );
+
+extern void
+BZ2_compressBlock ( EState*, Bool );
+
+extern void
+BZ2_bsInitWrite ( EState* );
+
+extern void
+BZ2_hbAssignCodes ( Int32*, UChar*, Int32, Int32, Int32 );
+
+extern void
+BZ2_hbMakeCodeLengths ( UChar*, Int32*, Int32, Int32 );
+
+
+
+/*-- states for decompression. --*/
+
+#define BZ_X_IDLE 1
+#define BZ_X_OUTPUT 2
+
+#define BZ_X_MAGIC_1 10
+#define BZ_X_MAGIC_2 11
+#define BZ_X_MAGIC_3 12
+#define BZ_X_MAGIC_4 13
+#define BZ_X_BLKHDR_1 14
+#define BZ_X_BLKHDR_2 15
+#define BZ_X_BLKHDR_3 16
+#define BZ_X_BLKHDR_4 17
+#define BZ_X_BLKHDR_5 18
+#define BZ_X_BLKHDR_6 19
+#define BZ_X_BCRC_1 20
+#define BZ_X_BCRC_2 21
+#define BZ_X_BCRC_3 22
+#define BZ_X_BCRC_4 23
+#define BZ_X_RANDBIT 24
+#define BZ_X_ORIGPTR_1 25
+#define BZ_X_ORIGPTR_2 26
+#define BZ_X_ORIGPTR_3 27
+#define BZ_X_MAPPING_1 28
+#define BZ_X_MAPPING_2 29
+#define BZ_X_SELECTOR_1 30
+#define BZ_X_SELECTOR_2 31
+#define BZ_X_SELECTOR_3 32
+#define BZ_X_CODING_1 33
+#define BZ_X_CODING_2 34
+#define BZ_X_CODING_3 35
+#define BZ_X_MTF_1 36
+#define BZ_X_MTF_2 37
+#define BZ_X_MTF_3 38
+#define BZ_X_MTF_4 39
+#define BZ_X_MTF_5 40
+#define BZ_X_MTF_6 41
+#define BZ_X_ENDHDR_2 42
+#define BZ_X_ENDHDR_3 43
+#define BZ_X_ENDHDR_4 44
+#define BZ_X_ENDHDR_5 45
+#define BZ_X_ENDHDR_6 46
+#define BZ_X_CCRC_1 47
+#define BZ_X_CCRC_2 48
+#define BZ_X_CCRC_3 49
+#define BZ_X_CCRC_4 50
+
+
+
+/*-- Constants for the fast MTF decoder. --*/
+
+#define MTFA_SIZE 4096
+#define MTFL_SIZE 16
+
+
+
+/*-- Structure holding all the decompression-side stuff. --*/
+
+typedef
+ struct {
+ /* pointer back to the struct bz_stream */
+ bz_stream* strm;
+
+ /* state indicator for this stream */
+ Int32 state;
+
+ /* for doing the final run-length decoding */
+ UChar state_out_ch;
+ Int32 state_out_len;
+ Bool blockRandomised;
+ BZ_RAND_DECLS;
+
+ /* the buffer for bit stream reading */
+ UInt32 bsBuff;
+ Int32 bsLive;
+
+ /* misc administratium */
+ Int32 blockSize100k;
+ Bool smallDecompress;
+ Int32 currBlockNo;
+ Int32 verbosity;
+
+ /* for undoing the Burrows-Wheeler transform */
+ Int32 origPtr;
+ UInt32 tPos;
+ Int32 k0;
+ Int32 unzftab[256];
+ Int32 nblock_used;
+ Int32 cftab[257];
+ Int32 cftabCopy[257];
+
+ /* for undoing the Burrows-Wheeler transform (FAST) */
+ UInt32 *tt;
+
+ /* for undoing the Burrows-Wheeler transform (SMALL) */
+ UInt16 *ll16;
+ UChar *ll4;
+
+ /* stored and calculated CRCs */
+ UInt32 storedBlockCRC;
+ UInt32 storedCombinedCRC;
+ UInt32 calculatedBlockCRC;
+ UInt32 calculatedCombinedCRC;
+
+ /* map of bytes used in block */
+ Int32 nInUse;
+ Bool inUse[256];
+ Bool inUse16[16];
+ UChar seqToUnseq[256];
+
+ /* for decoding the MTF values */
+ UChar mtfa [MTFA_SIZE];
+ Int32 mtfbase[256 / MTFL_SIZE];
+ UChar selector [BZ_MAX_SELECTORS];
+ UChar selectorMtf[BZ_MAX_SELECTORS];
+ UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+
+ Int32 limit [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ Int32 base [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ Int32 perm [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ Int32 minLens[BZ_N_GROUPS];
+
+ /* save area for scalars in the main decompress code */
+ Int32 save_i;
+ Int32 save_j;
+ Int32 save_t;
+ Int32 save_alphaSize;
+ Int32 save_nGroups;
+ Int32 save_nSelectors;
+ Int32 save_EOB;
+ Int32 save_groupNo;
+ Int32 save_groupPos;
+ Int32 save_nextSym;
+ Int32 save_nblockMAX;
+ Int32 save_nblock;
+ Int32 save_es;
+ Int32 save_N;
+ Int32 save_curr;
+ Int32 save_zt;
+ Int32 save_zn;
+ Int32 save_zvec;
+ Int32 save_zj;
+ Int32 save_gSel;
+ Int32 save_gMinlen;
+ Int32* save_gLimit;
+ Int32* save_gBase;
+ Int32* save_gPerm;
+
+ }
+ DState;
+
+
+
+/*-- Macros for decompression. --*/
+
+#define BZ_GET_FAST(cccc) \
+ s->tPos = s->tt[s->tPos]; \
+ cccc = (UChar)(s->tPos & 0xff); \
+ s->tPos >>= 8;
+
+#define BZ_GET_FAST_C(cccc) \
+ c_tPos = c_tt[c_tPos]; \
+ cccc = (UChar)(c_tPos & 0xff); \
+ c_tPos >>= 8;
+
+#define SET_LL4(i,n) \
+ { if (((i) & 0x1) == 0) \
+ s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0xf0) | (n); else \
+ s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0x0f) | ((n) << 4); \
+ }
+
+#define GET_LL4(i) \
+ ((((UInt32)(s->ll4[(i) >> 1])) >> (((i) << 2) & 0x4)) & 0xF)
+
+#define SET_LL(i,n) \
+ { s->ll16[i] = (UInt16)(n & 0x0000ffff); \
+ SET_LL4(i, n >> 16); \
+ }
+
+#define GET_LL(i) \
+ (((UInt32)s->ll16[i]) | (GET_LL4(i) << 16))
+
+#define BZ_GET_SMALL(cccc) \
+ cccc = BZ2_indexIntoF ( s->tPos, s->cftab ); \
+ s->tPos = GET_LL(s->tPos);
+
+
+/*-- externs for decompression. --*/
+
+extern Int32
+BZ2_indexIntoF ( Int32, Int32* );
+
+extern Int32
+BZ2_decompress ( DState* );
+
+extern void
+BZ2_hbCreateDecodeTables ( Int32*, Int32*, Int32*, UChar*,
+ Int32, Int32, Int32 );
+
+
+#endif
+
+
+/*-- BZ_NO_STDIO seems to make NULL disappear on some platforms. --*/
+
+#ifdef BZ_NO_STDIO
+#ifndef NULL
+#define NULL 0
+#endif
+#endif
+
+
+/*-------------------------------------------------------------*/
+/*--- end bzlib_private.h ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Compression machinery (not incl block sorting) ---*/
+/*--- compress.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+/*--
+ CHANGES
+ ~~~~~~~
+ 0.9.0 -- original version.
+
+ 0.9.0a/b -- no changes in this file.
+
+ 0.9.0c
+ * changed setting of nGroups in sendMTFValues() so as to
+ do a bit better on small files
+--*/
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------------*/
+/*--- Bit stream I/O ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+void BZ2_bsInitWrite ( EState* s )
+{
+ s->bsLive = 0;
+ s->bsBuff = 0;
+}
+
+
+/*---------------------------------------------------*/
+static
+void bsFinishWrite ( EState* s )
+{
+ while (s->bsLive > 0) {
+ s->zbits[s->numZ] = (UChar)(s->bsBuff >> 24);
+ s->numZ++;
+ s->bsBuff <<= 8;
+ s->bsLive -= 8;
+ }
+}
+
+
+/*---------------------------------------------------*/
+#define bsNEEDW(nz) \
+{ \
+ while (s->bsLive >= 8) { \
+ s->zbits[s->numZ] \
+ = (UChar)(s->bsBuff >> 24); \
+ s->numZ++; \
+ s->bsBuff <<= 8; \
+ s->bsLive -= 8; \
+ } \
+}
+
+
+/*---------------------------------------------------*/
+static
+__inline__
+void bsW ( EState* s, Int32 n, UInt32 v )
+{
+ bsNEEDW ( n );
+ s->bsBuff |= (v << (32 - s->bsLive - n));
+ s->bsLive += n;
+}
+
+
+/*---------------------------------------------------*/
+static
+void bsPutUInt32 ( EState* s, UInt32 u )
+{
+ bsW ( s, 8, (u >> 24) & 0xffL );
+ bsW ( s, 8, (u >> 16) & 0xffL );
+ bsW ( s, 8, (u >> 8) & 0xffL );
+ bsW ( s, 8, u & 0xffL );
+}
+
+
+/*---------------------------------------------------*/
+static
+void bsPutUChar ( EState* s, UChar c )
+{
+ bsW( s, 8, (UInt32)c );
+}
+
+
+/*---------------------------------------------------*/
+/*--- The back end proper ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+static
+void makeMaps_e ( EState* s )
+{
+ Int32 i;
+ s->nInUse = 0;
+ for (i = 0; i < 256; i++)
+ if (s->inUse[i]) {
+ s->unseqToSeq[i] = s->nInUse;
+ s->nInUse++;
+ }
+}
+
+
+/*---------------------------------------------------*/
+static
+void generateMTFValues ( EState* s )
+{
+ UChar yy[256];
+ Int32 i, j;
+ Int32 zPend;
+ Int32 wr;
+ Int32 EOB;
+
+ /*
+ After sorting (eg, here),
+ s->arr1 [ 0 .. s->nblock-1 ] holds sorted order,
+ and
+ ((UChar*)s->arr2) [ 0 .. s->nblock-1 ]
+ holds the original block data.
+
+ The first thing to do is generate the MTF values,
+ and put them in
+ ((UInt16*)s->arr1) [ 0 .. s->nblock-1 ].
+ Because there are strictly fewer or equal MTF values
+ than block values, ptr values in this area are overwritten
+ with MTF values only when they are no longer needed.
+
+ The final compressed bitstream is generated into the
+ area starting at
+ (UChar*) (&((UChar*)s->arr2)[s->nblock])
+
+ These storage aliases are set up in bzCompressInit(),
+ except for the last one, which is arranged in
+ compressBlock().
+ */
+ UInt32* ptr = s->ptr;
+ UChar* block = s->block;
+ UInt16* mtfv = s->mtfv;
+
+ makeMaps_e ( s );
+ EOB = s->nInUse+1;
+
+ for (i = 0; i <= EOB; i++) s->mtfFreq[i] = 0;
+
+ wr = 0;
+ zPend = 0;
+ for (i = 0; i < s->nInUse; i++) yy[i] = (UChar) i;
+
+ for (i = 0; i < s->nblock; i++) {
+ UChar ll_i;
+ AssertD ( wr <= i, "generateMTFValues(1)" );
+ j = ptr[i]-1; if (j < 0) j += s->nblock;
+ ll_i = s->unseqToSeq[block[j]];
+ AssertD ( ll_i < s->nInUse, "generateMTFValues(2a)" );
+
+ if (yy[0] == ll_i) {
+ zPend++;
+ } else {
+
+ if (zPend > 0) {
+ zPend--;
+ while (True) {
+ if (zPend & 1) {
+ mtfv[wr] = BZ_RUNB; wr++;
+ s->mtfFreq[BZ_RUNB]++;
+ } else {
+ mtfv[wr] = BZ_RUNA; wr++;
+ s->mtfFreq[BZ_RUNA]++;
+ }
+ if (zPend < 2) break;
+ zPend = (zPend - 2) / 2;
+ };
+ zPend = 0;
+ }
+ {
+ register UChar rtmp;
+ register UChar* ryy_j;
+ register UChar rll_i;
+ rtmp = yy[1];
+ yy[1] = yy[0];
+ ryy_j = &(yy[1]);
+ rll_i = ll_i;
+ while ( rll_i != rtmp ) {
+ register UChar rtmp2;
+ ryy_j++;
+ rtmp2 = rtmp;
+ rtmp = *ryy_j;
+ *ryy_j = rtmp2;
+ };
+ yy[0] = rtmp;
+ j = ryy_j - &(yy[0]);
+ mtfv[wr] = j+1; wr++; s->mtfFreq[j+1]++;
+ }
+
+ }
+ }
+
+ if (zPend > 0) {
+ zPend--;
+ while (True) {
+ if (zPend & 1) {
+ mtfv[wr] = BZ_RUNB; wr++;
+ s->mtfFreq[BZ_RUNB]++;
+ } else {
+ mtfv[wr] = BZ_RUNA; wr++;
+ s->mtfFreq[BZ_RUNA]++;
+ }
+ if (zPend < 2) break;
+ zPend = (zPend - 2) / 2;
+ };
+ zPend = 0;
+ }
+
+ mtfv[wr] = EOB; wr++; s->mtfFreq[EOB]++;
+
+ s->nMTF = wr;
+}
+
+
+/*---------------------------------------------------*/
+#define BZ_LESSER_ICOST 0
+#define BZ_GREATER_ICOST 15
+
+static
+void sendMTFValues ( EState* s )
+{
+ Int32 v, t, i, j, gs, ge, totc, bt, bc, iter;
+ Int32 nSelectors, alphaSize, minLen, maxLen, selCtr;
+ Int32 nGroups, nBytes;
+
+ /*--
+ UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ is a global since the decoder also needs it.
+
+ Int32 code[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ Int32 rfreq[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+ are also globals only used in this proc.
+ Made global to keep stack frame size small.
+ --*/
+
+
+ UInt16 cost[BZ_N_GROUPS];
+ Int32 fave[BZ_N_GROUPS];
+
+ UInt16* mtfv = s->mtfv;
+
+ if (s->verbosity >= 3)
+ VPrintf3( " %d in block, %d after MTF & 1-2 coding, "
+ "%d+2 syms in use\n",
+ s->nblock, s->nMTF, s->nInUse );
+
+ alphaSize = s->nInUse+2;
+ for (t = 0; t < BZ_N_GROUPS; t++)
+ for (v = 0; v < alphaSize; v++)
+ s->len[t][v] = BZ_GREATER_ICOST;
+
+ /*--- Decide how many coding tables to use ---*/
+ AssertH ( s->nMTF > 0, 3001 );
+ if (s->nMTF < 200) nGroups = 2; else
+ if (s->nMTF < 600) nGroups = 3; else
+ if (s->nMTF < 1200) nGroups = 4; else
+ if (s->nMTF < 2400) nGroups = 5; else
+ nGroups = 6;
+
+ /*--- Generate an initial set of coding tables ---*/
+ {
+ Int32 nPart, remF, tFreq, aFreq;
+
+ nPart = nGroups;
+ remF = s->nMTF;
+ gs = 0;
+ while (nPart > 0) {
+ tFreq = remF / nPart;
+ ge = gs-1;
+ aFreq = 0;
+ while (aFreq < tFreq && ge < alphaSize-1) {
+ ge++;
+ aFreq += s->mtfFreq[ge];
+ }
+
+ if (ge > gs
+ && nPart != nGroups && nPart != 1
+ && ((nGroups-nPart) % 2 == 1)) {
+ aFreq -= s->mtfFreq[ge];
+ ge--;
+ }
+
+ if (s->verbosity >= 3)
+ VPrintf5( " initial group %d, [%d .. %d], "
+ "has %d syms (%4.1f%%)\n",
+ nPart, gs, ge, aFreq,
+ (100.0 * (float)aFreq) / (float)(s->nMTF) );
+
+ for (v = 0; v < alphaSize; v++)
+ if (v >= gs && v <= ge)
+ s->len[nPart-1][v] = BZ_LESSER_ICOST; else
+ s->len[nPart-1][v] = BZ_GREATER_ICOST;
+
+ nPart--;
+ gs = ge+1;
+ remF -= aFreq;
+ }
+ }
+
+ /*---
+ Iterate up to BZ_N_ITERS times to improve the tables.
+ ---*/
+ for (iter = 0; iter < BZ_N_ITERS; iter++) {
+
+ for (t = 0; t < nGroups; t++) fave[t] = 0;
+
+ for (t = 0; t < nGroups; t++)
+ for (v = 0; v < alphaSize; v++)
+ s->rfreq[t][v] = 0;
+
+ /*---
+ Set up an auxiliary length table which is used to fast-track
+ the common case (nGroups == 6).
+ ---*/
+ if (nGroups == 6) {
+ for (v = 0; v < alphaSize; v++) {
+ s->len_pack[v][0] = (s->len[1][v] << 16) | s->len[0][v];
+ s->len_pack[v][1] = (s->len[3][v] << 16) | s->len[2][v];
+ s->len_pack[v][2] = (s->len[5][v] << 16) | s->len[4][v];
+ }
+ }
+
+ nSelectors = 0;
+ totc = 0;
+ gs = 0;
+ while (True) {
+
+ /*--- Set group start & end marks. --*/
+ if (gs >= s->nMTF) break;
+ ge = gs + BZ_G_SIZE - 1;
+ if (ge >= s->nMTF) ge = s->nMTF-1;
+
+ /*--
+ Calculate the cost of this group as coded
+ by each of the coding tables.
+ --*/
+ for (t = 0; t < nGroups; t++) cost[t] = 0;
+
+ if (nGroups == 6 && 50 == ge-gs+1) {
+ /*--- fast track the common case ---*/
+ register UInt32 cost01, cost23, cost45;
+ register UInt16 icv;
+ cost01 = cost23 = cost45 = 0;
+
+# define BZ_ITER(nn) \
+ icv = mtfv[gs+(nn)]; \
+ cost01 += s->len_pack[icv][0]; \
+ cost23 += s->len_pack[icv][1]; \
+ cost45 += s->len_pack[icv][2]; \
+
+ BZ_ITER(0); BZ_ITER(1); BZ_ITER(2); BZ_ITER(3); BZ_ITER(4);
+ BZ_ITER(5); BZ_ITER(6); BZ_ITER(7); BZ_ITER(8); BZ_ITER(9);
+ BZ_ITER(10); BZ_ITER(11); BZ_ITER(12); BZ_ITER(13); BZ_ITER(14);
+ BZ_ITER(15); BZ_ITER(16); BZ_ITER(17); BZ_ITER(18); BZ_ITER(19);
+ BZ_ITER(20); BZ_ITER(21); BZ_ITER(22); BZ_ITER(23); BZ_ITER(24);
+ BZ_ITER(25); BZ_ITER(26); BZ_ITER(27); BZ_ITER(28); BZ_ITER(29);
+ BZ_ITER(30); BZ_ITER(31); BZ_ITER(32); BZ_ITER(33); BZ_ITER(34);
+ BZ_ITER(35); BZ_ITER(36); BZ_ITER(37); BZ_ITER(38); BZ_ITER(39);
+ BZ_ITER(40); BZ_ITER(41); BZ_ITER(42); BZ_ITER(43); BZ_ITER(44);
+ BZ_ITER(45); BZ_ITER(46); BZ_ITER(47); BZ_ITER(48); BZ_ITER(49);
+
+# undef BZ_ITER
+
+ cost[0] = cost01 & 0xffff; cost[1] = cost01 >> 16;
+ cost[2] = cost23 & 0xffff; cost[3] = cost23 >> 16;
+ cost[4] = cost45 & 0xffff; cost[5] = cost45 >> 16;
+
+ } else {
+ /*--- slow version which correctly handles all situations ---*/
+ for (i = gs; i <= ge; i++) {
+ UInt16 icv = mtfv[i];
+ for (t = 0; t < nGroups; t++) cost[t] += s->len[t][icv];
+ }
+ }
+
+ /*--
+ Find the coding table which is best for this group,
+ and record its identity in the selector table.
+ --*/
+ bc = 999999999; bt = -1;
+ for (t = 0; t < nGroups; t++)
+ if (cost[t] < bc) { bc = cost[t]; bt = t; };
+ totc += bc;
+ fave[bt]++;
+ s->selector[nSelectors] = bt;
+ nSelectors++;
+
+ /*--
+ Increment the symbol frequencies for the selected table.
+ --*/
+ if (nGroups == 6 && 50 == ge-gs+1) {
+ /*--- fast track the common case ---*/
+
+# define BZ_ITUR(nn) s->rfreq[bt][ mtfv[gs+(nn)] ]++
+
+ BZ_ITUR(0); BZ_ITUR(1); BZ_ITUR(2); BZ_ITUR(3); BZ_ITUR(4);
+ BZ_ITUR(5); BZ_ITUR(6); BZ_ITUR(7); BZ_ITUR(8); BZ_ITUR(9);
+ BZ_ITUR(10); BZ_ITUR(11); BZ_ITUR(12); BZ_ITUR(13); BZ_ITUR(14);
+ BZ_ITUR(15); BZ_ITUR(16); BZ_ITUR(17); BZ_ITUR(18); BZ_ITUR(19);
+ BZ_ITUR(20); BZ_ITUR(21); BZ_ITUR(22); BZ_ITUR(23); BZ_ITUR(24);
+ BZ_ITUR(25); BZ_ITUR(26); BZ_ITUR(27); BZ_ITUR(28); BZ_ITUR(29);
+ BZ_ITUR(30); BZ_ITUR(31); BZ_ITUR(32); BZ_ITUR(33); BZ_ITUR(34);
+ BZ_ITUR(35); BZ_ITUR(36); BZ_ITUR(37); BZ_ITUR(38); BZ_ITUR(39);
+ BZ_ITUR(40); BZ_ITUR(41); BZ_ITUR(42); BZ_ITUR(43); BZ_ITUR(44);
+ BZ_ITUR(45); BZ_ITUR(46); BZ_ITUR(47); BZ_ITUR(48); BZ_ITUR(49);
+
+# undef BZ_ITUR
+
+ } else {
+ /*--- slow version which correctly handles all situations ---*/
+ for (i = gs; i <= ge; i++)
+ s->rfreq[bt][ mtfv[i] ]++;
+ }
+
+ gs = ge+1;
+ }
+ if (s->verbosity >= 3) {
+ VPrintf2 ( " pass %d: size is %d, grp uses are ",
+ iter+1, totc/8 );
+ for (t = 0; t < nGroups; t++)
+ VPrintf1 ( "%d ", fave[t] );
+ VPrintf0 ( "\n" );
+ }
+
+ /*--
+ Recompute the tables based on the accumulated frequencies.
+ --*/
+ for (t = 0; t < nGroups; t++)
+ BZ2_hbMakeCodeLengths ( &(s->len[t][0]), &(s->rfreq[t][0]),
+ alphaSize, 20 );
+ }
+
+
+ AssertH( nGroups < 8, 3002 );
+ AssertH( nSelectors < 32768 &&
+ nSelectors <= (2 + (900000 / BZ_G_SIZE)),
+ 3003 );
+
+
+ /*--- Compute MTF values for the selectors. ---*/
+ {
+ UChar pos[BZ_N_GROUPS], ll_i, tmp2, tmp;
+ for (i = 0; i < nGroups; i++) pos[i] = i;
+ for (i = 0; i < nSelectors; i++) {
+ ll_i = s->selector[i];
+ j = 0;
+ tmp = pos[j];
+ while ( ll_i != tmp ) {
+ j++;
+ tmp2 = tmp;
+ tmp = pos[j];
+ pos[j] = tmp2;
+ };
+ pos[0] = tmp;
+ s->selectorMtf[i] = j;
+ }
+ };
+
+ /*--- Assign actual codes for the tables. --*/
+ for (t = 0; t < nGroups; t++) {
+ minLen = 32;
+ maxLen = 0;
+ for (i = 0; i < alphaSize; i++) {
+ if (s->len[t][i] > maxLen) maxLen = s->len[t][i];
+ if (s->len[t][i] < minLen) minLen = s->len[t][i];
+ }
+ AssertH ( !(maxLen > 20), 3004 );
+ AssertH ( !(minLen < 1), 3005 );
+ BZ2_hbAssignCodes ( &(s->code[t][0]), &(s->len[t][0]),
+ minLen, maxLen, alphaSize );
+ }
+
+ /*--- Transmit the mapping table. ---*/
+ {
+ Bool inUse16[16];
+ for (i = 0; i < 16; i++) {
+ inUse16[i] = False;
+ for (j = 0; j < 16; j++)
+ if (s->inUse[i * 16 + j]) inUse16[i] = True;
+ }
+
+ nBytes = s->numZ;
+ for (i = 0; i < 16; i++)
+ if (inUse16[i]) bsW(s,1,1); else bsW(s,1,0);
+
+ for (i = 0; i < 16; i++)
+ if (inUse16[i])
+ for (j = 0; j < 16; j++) {
+ if (s->inUse[i * 16 + j]) bsW(s,1,1); else bsW(s,1,0);
+ }
+
+ if (s->verbosity >= 3)
+ VPrintf1( " bytes: mapping %d, ", s->numZ-nBytes );
+ }
+
+ /*--- Now the selectors. ---*/
+ nBytes = s->numZ;
+ bsW ( s, 3, nGroups );
+ bsW ( s, 15, nSelectors );
+ for (i = 0; i < nSelectors; i++) {
+ for (j = 0; j < s->selectorMtf[i]; j++) bsW(s,1,1);
+ bsW(s,1,0);
+ }
+ if (s->verbosity >= 3)
+ VPrintf1( "selectors %d, ", s->numZ-nBytes );
+
+ /*--- Now the coding tables. ---*/
+ nBytes = s->numZ;
+
+ for (t = 0; t < nGroups; t++) {
+ Int32 curr = s->len[t][0];
+ bsW ( s, 5, curr );
+ for (i = 0; i < alphaSize; i++) {
+ while (curr < s->len[t][i]) { bsW(s,2,2); curr++; /* 10 */ };
+ while (curr > s->len[t][i]) { bsW(s,2,3); curr--; /* 11 */ };
+ bsW ( s, 1, 0 );
+ }
+ }
+
+ if (s->verbosity >= 3)
+ VPrintf1 ( "code lengths %d, ", s->numZ-nBytes );
+
+ /*--- And finally, the block data proper ---*/
+ nBytes = s->numZ;
+ selCtr = 0;
+ gs = 0;
+ while (True) {
+ if (gs >= s->nMTF) break;
+ ge = gs + BZ_G_SIZE - 1;
+ if (ge >= s->nMTF) ge = s->nMTF-1;
+ AssertH ( s->selector[selCtr] < nGroups, 3006 );
+
+ if (nGroups == 6 && 50 == ge-gs+1) {
+ /*--- fast track the common case ---*/
+ UInt16 mtfv_i;
+ UChar* s_len_sel_selCtr
+ = &(s->len[s->selector[selCtr]][0]);
+ Int32* s_code_sel_selCtr
+ = &(s->code[s->selector[selCtr]][0]);
+
+# define BZ_ITAH(nn) \
+ mtfv_i = mtfv[gs+(nn)]; \
+ bsW ( s, \
+ s_len_sel_selCtr[mtfv_i], \
+ s_code_sel_selCtr[mtfv_i] )
+
+ BZ_ITAH(0); BZ_ITAH(1); BZ_ITAH(2); BZ_ITAH(3); BZ_ITAH(4);
+ BZ_ITAH(5); BZ_ITAH(6); BZ_ITAH(7); BZ_ITAH(8); BZ_ITAH(9);
+ BZ_ITAH(10); BZ_ITAH(11); BZ_ITAH(12); BZ_ITAH(13); BZ_ITAH(14);
+ BZ_ITAH(15); BZ_ITAH(16); BZ_ITAH(17); BZ_ITAH(18); BZ_ITAH(19);
+ BZ_ITAH(20); BZ_ITAH(21); BZ_ITAH(22); BZ_ITAH(23); BZ_ITAH(24);
+ BZ_ITAH(25); BZ_ITAH(26); BZ_ITAH(27); BZ_ITAH(28); BZ_ITAH(29);
+ BZ_ITAH(30); BZ_ITAH(31); BZ_ITAH(32); BZ_ITAH(33); BZ_ITAH(34);
+ BZ_ITAH(35); BZ_ITAH(36); BZ_ITAH(37); BZ_ITAH(38); BZ_ITAH(39);
+ BZ_ITAH(40); BZ_ITAH(41); BZ_ITAH(42); BZ_ITAH(43); BZ_ITAH(44);
+ BZ_ITAH(45); BZ_ITAH(46); BZ_ITAH(47); BZ_ITAH(48); BZ_ITAH(49);
+
+# undef BZ_ITAH
+
+ } else {
+ /*--- slow version which correctly handles all situations ---*/
+ for (i = gs; i <= ge; i++) {
+ bsW ( s,
+ s->len [s->selector[selCtr]] [mtfv[i]],
+ s->code [s->selector[selCtr]] [mtfv[i]] );
+ }
+ }
+
+
+ gs = ge+1;
+ selCtr++;
+ }
+ AssertH( selCtr == nSelectors, 3007 );
+
+ if (s->verbosity >= 3)
+ VPrintf1( "codes %d\n", s->numZ-nBytes );
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_compressBlock ( EState* s, Bool is_last_block )
+{
+ if (s->nblock > 0) {
+
+ BZ_FINALISE_CRC ( s->blockCRC );
+ s->combinedCRC = (s->combinedCRC << 1) | (s->combinedCRC >> 31);
+ s->combinedCRC ^= s->blockCRC;
+ if (s->blockNo > 1) s->numZ = 0;
+
+ if (s->verbosity >= 2)
+ VPrintf4( " block %d: crc = 0x%8x, "
+ "combined CRC = 0x%8x, size = %d\n",
+ s->blockNo, s->blockCRC, s->combinedCRC, s->nblock );
+
+ BZ2_blockSort ( s );
+ }
+
+ s->zbits = (UChar*) (&((UChar*)s->arr2)[s->nblock]);
+
+ /*-- If this is the first block, create the stream header. --*/
+ if (s->blockNo == 1) {
+ BZ2_bsInitWrite ( s );
+ bsPutUChar ( s, 'B' );
+ bsPutUChar ( s, 'Z' );
+ bsPutUChar ( s, 'h' );
+ bsPutUChar ( s, (UChar)('0' + s->blockSize100k) );
+ }
+
+ if (s->nblock > 0) {
+
+ bsPutUChar ( s, 0x31 ); bsPutUChar ( s, 0x41 );
+ bsPutUChar ( s, 0x59 ); bsPutUChar ( s, 0x26 );
+ bsPutUChar ( s, 0x53 ); bsPutUChar ( s, 0x59 );
+
+ /*-- Now the block's CRC, so it is in a known place. --*/
+ bsPutUInt32 ( s, s->blockCRC );
+
+ /*--
+ Now a single bit indicating (non-)randomisation.
+ As of version 0.9.5, we use a better sorting algorithm
+ which makes randomisation unnecessary. So always set
+ the randomised bit to 'no'. Of course, the decoder
+ still needs to be able to handle randomised blocks
+ so as to maintain backwards compatibility with
+ older versions of bzip2.
+ --*/
+ bsW(s,1,0);
+
+ bsW ( s, 24, s->origPtr );
+ generateMTFValues ( s );
+ sendMTFValues ( s );
+ }
+
+
+ /*-- If this is the last block, add the stream trailer. --*/
+ if (is_last_block) {
+
+ bsPutUChar ( s, 0x17 ); bsPutUChar ( s, 0x72 );
+ bsPutUChar ( s, 0x45 ); bsPutUChar ( s, 0x38 );
+ bsPutUChar ( s, 0x50 ); bsPutUChar ( s, 0x90 );
+ bsPutUInt32 ( s, s->combinedCRC );
+ if (s->verbosity >= 2)
+ VPrintf1( " final combined CRC = 0x%x\n ", s->combinedCRC );
+ bsFinishWrite ( s );
+ }
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end compress.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Table for doing CRCs ---*/
+/*--- crctable.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+/*--
+ I think this is an implementation of the AUTODIN-II,
+ Ethernet & FDDI 32-bit CRC standard. Vaguely derived
+ from code by Rob Warnock, in Section 51 of the
+ comp.compression FAQ.
+--*/
+
+UInt32 BZ2_crc32Table[256] = {
+
+ /*-- Ugly, innit? --*/
+
+ 0x00000000L, 0x04c11db7L, 0x09823b6eL, 0x0d4326d9L,
+ 0x130476dcL, 0x17c56b6bL, 0x1a864db2L, 0x1e475005L,
+ 0x2608edb8L, 0x22c9f00fL, 0x2f8ad6d6L, 0x2b4bcb61L,
+ 0x350c9b64L, 0x31cd86d3L, 0x3c8ea00aL, 0x384fbdbdL,
+ 0x4c11db70L, 0x48d0c6c7L, 0x4593e01eL, 0x4152fda9L,
+ 0x5f15adacL, 0x5bd4b01bL, 0x569796c2L, 0x52568b75L,
+ 0x6a1936c8L, 0x6ed82b7fL, 0x639b0da6L, 0x675a1011L,
+ 0x791d4014L, 0x7ddc5da3L, 0x709f7b7aL, 0x745e66cdL,
+ 0x9823b6e0L, 0x9ce2ab57L, 0x91a18d8eL, 0x95609039L,
+ 0x8b27c03cL, 0x8fe6dd8bL, 0x82a5fb52L, 0x8664e6e5L,
+ 0xbe2b5b58L, 0xbaea46efL, 0xb7a96036L, 0xb3687d81L,
+ 0xad2f2d84L, 0xa9ee3033L, 0xa4ad16eaL, 0xa06c0b5dL,
+ 0xd4326d90L, 0xd0f37027L, 0xddb056feL, 0xd9714b49L,
+ 0xc7361b4cL, 0xc3f706fbL, 0xceb42022L, 0xca753d95L,
+ 0xf23a8028L, 0xf6fb9d9fL, 0xfbb8bb46L, 0xff79a6f1L,
+ 0xe13ef6f4L, 0xe5ffeb43L, 0xe8bccd9aL, 0xec7dd02dL,
+ 0x34867077L, 0x30476dc0L, 0x3d044b19L, 0x39c556aeL,
+ 0x278206abL, 0x23431b1cL, 0x2e003dc5L, 0x2ac12072L,
+ 0x128e9dcfL, 0x164f8078L, 0x1b0ca6a1L, 0x1fcdbb16L,
+ 0x018aeb13L, 0x054bf6a4L, 0x0808d07dL, 0x0cc9cdcaL,
+ 0x7897ab07L, 0x7c56b6b0L, 0x71159069L, 0x75d48ddeL,
+ 0x6b93dddbL, 0x6f52c06cL, 0x6211e6b5L, 0x66d0fb02L,
+ 0x5e9f46bfL, 0x5a5e5b08L, 0x571d7dd1L, 0x53dc6066L,
+ 0x4d9b3063L, 0x495a2dd4L, 0x44190b0dL, 0x40d816baL,
+ 0xaca5c697L, 0xa864db20L, 0xa527fdf9L, 0xa1e6e04eL,
+ 0xbfa1b04bL, 0xbb60adfcL, 0xb6238b25L, 0xb2e29692L,
+ 0x8aad2b2fL, 0x8e6c3698L, 0x832f1041L, 0x87ee0df6L,
+ 0x99a95df3L, 0x9d684044L, 0x902b669dL, 0x94ea7b2aL,
+ 0xe0b41de7L, 0xe4750050L, 0xe9362689L, 0xedf73b3eL,
+ 0xf3b06b3bL, 0xf771768cL, 0xfa325055L, 0xfef34de2L,
+ 0xc6bcf05fL, 0xc27dede8L, 0xcf3ecb31L, 0xcbffd686L,
+ 0xd5b88683L, 0xd1799b34L, 0xdc3abdedL, 0xd8fba05aL,
+ 0x690ce0eeL, 0x6dcdfd59L, 0x608edb80L, 0x644fc637L,
+ 0x7a089632L, 0x7ec98b85L, 0x738aad5cL, 0x774bb0ebL,
+ 0x4f040d56L, 0x4bc510e1L, 0x46863638L, 0x42472b8fL,
+ 0x5c007b8aL, 0x58c1663dL, 0x558240e4L, 0x51435d53L,
+ 0x251d3b9eL, 0x21dc2629L, 0x2c9f00f0L, 0x285e1d47L,
+ 0x36194d42L, 0x32d850f5L, 0x3f9b762cL, 0x3b5a6b9bL,
+ 0x0315d626L, 0x07d4cb91L, 0x0a97ed48L, 0x0e56f0ffL,
+ 0x1011a0faL, 0x14d0bd4dL, 0x19939b94L, 0x1d528623L,
+ 0xf12f560eL, 0xf5ee4bb9L, 0xf8ad6d60L, 0xfc6c70d7L,
+ 0xe22b20d2L, 0xe6ea3d65L, 0xeba91bbcL, 0xef68060bL,
+ 0xd727bbb6L, 0xd3e6a601L, 0xdea580d8L, 0xda649d6fL,
+ 0xc423cd6aL, 0xc0e2d0ddL, 0xcda1f604L, 0xc960ebb3L,
+ 0xbd3e8d7eL, 0xb9ff90c9L, 0xb4bcb610L, 0xb07daba7L,
+ 0xae3afba2L, 0xaafbe615L, 0xa7b8c0ccL, 0xa379dd7bL,
+ 0x9b3660c6L, 0x9ff77d71L, 0x92b45ba8L, 0x9675461fL,
+ 0x8832161aL, 0x8cf30badL, 0x81b02d74L, 0x857130c3L,
+ 0x5d8a9099L, 0x594b8d2eL, 0x5408abf7L, 0x50c9b640L,
+ 0x4e8ee645L, 0x4a4ffbf2L, 0x470cdd2bL, 0x43cdc09cL,
+ 0x7b827d21L, 0x7f436096L, 0x7200464fL, 0x76c15bf8L,
+ 0x68860bfdL, 0x6c47164aL, 0x61043093L, 0x65c52d24L,
+ 0x119b4be9L, 0x155a565eL, 0x18197087L, 0x1cd86d30L,
+ 0x029f3d35L, 0x065e2082L, 0x0b1d065bL, 0x0fdc1becL,
+ 0x3793a651L, 0x3352bbe6L, 0x3e119d3fL, 0x3ad08088L,
+ 0x2497d08dL, 0x2056cd3aL, 0x2d15ebe3L, 0x29d4f654L,
+ 0xc5a92679L, 0xc1683bceL, 0xcc2b1d17L, 0xc8ea00a0L,
+ 0xd6ad50a5L, 0xd26c4d12L, 0xdf2f6bcbL, 0xdbee767cL,
+ 0xe3a1cbc1L, 0xe760d676L, 0xea23f0afL, 0xeee2ed18L,
+ 0xf0a5bd1dL, 0xf464a0aaL, 0xf9278673L, 0xfde69bc4L,
+ 0x89b8fd09L, 0x8d79e0beL, 0x803ac667L, 0x84fbdbd0L,
+ 0x9abc8bd5L, 0x9e7d9662L, 0x933eb0bbL, 0x97ffad0cL,
+ 0xafb010b1L, 0xab710d06L, 0xa6322bdfL, 0xa2f33668L,
+ 0xbcb4666dL, 0xb8757bdaL, 0xb5365d03L, 0xb1f740b4L
+};
+
+
+/*-------------------------------------------------------------*/
+/*--- end crctable.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Decompression machinery ---*/
+/*--- decompress.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------------*/
+static
+void makeMaps_d ( DState* s )
+{
+ Int32 i;
+ s->nInUse = 0;
+ for (i = 0; i < 256; i++)
+ if (s->inUse[i]) {
+ s->seqToUnseq[s->nInUse] = i;
+ s->nInUse++;
+ }
+}
+
+
+/*---------------------------------------------------*/
+#define RETURN(rrr) \
+ { retVal = rrr; goto save_state_and_return; };
+
+#define GET_BITS(lll,vvv,nnn) \
+ case lll: s->state = lll; \
+ while (True) { \
+ if (s->bsLive >= nnn) { \
+ UInt32 v; \
+ v = (s->bsBuff >> \
+ (s->bsLive-nnn)) & ((1 << nnn)-1); \
+ s->bsLive -= nnn; \
+ vvv = v; \
+ break; \
+ } \
+ if (s->strm->avail_in == 0) RETURN(BZ_OK); \
+ s->bsBuff \
+ = (s->bsBuff << 8) | \
+ ((UInt32) \
+ (*((UChar*)(s->strm->next_in)))); \
+ s->bsLive += 8; \
+ s->strm->next_in++; \
+ s->strm->avail_in--; \
+ s->strm->total_in_lo32++; \
+ if (s->strm->total_in_lo32 == 0) \
+ s->strm->total_in_hi32++; \
+ }
+
+#define GET_UCHAR(lll,uuu) \
+ GET_BITS(lll,uuu,8)
+
+#define GET_BIT(lll,uuu) \
+ GET_BITS(lll,uuu,1)
+
+/*---------------------------------------------------*/
+#define GET_MTF_VAL(label1,label2,lval) \
+{ \
+ if (groupPos == 0) { \
+ groupNo++; \
+ if (groupNo >= nSelectors) \
+ RETURN(BZ_DATA_ERROR); \
+ groupPos = BZ_G_SIZE; \
+ gSel = s->selector[groupNo]; \
+ gMinlen = s->minLens[gSel]; \
+ gLimit = &(s->limit[gSel][0]); \
+ gPerm = &(s->perm[gSel][0]); \
+ gBase = &(s->base[gSel][0]); \
+ } \
+ groupPos--; \
+ zn = gMinlen; \
+ GET_BITS(label1, zvec, zn); \
+ while (1) { \
+ if (zn > 20 /* the longest code */) \
+ RETURN(BZ_DATA_ERROR); \
+ if (zvec <= gLimit[zn]) break; \
+ zn++; \
+ GET_BIT(label2, zj); \
+ zvec = (zvec << 1) | zj; \
+ }; \
+ if (zvec - gBase[zn] < 0 \
+ || zvec - gBase[zn] >= BZ_MAX_ALPHA_SIZE) \
+ RETURN(BZ_DATA_ERROR); \
+ lval = gPerm[zvec - gBase[zn]]; \
+}
+
+
+/*---------------------------------------------------*/
+Int32 BZ2_decompress ( DState* s )
+{
+ UChar uc;
+ Int32 retVal;
+ Int32 minLen, maxLen;
+ bz_stream* strm = s->strm;
+
+ /* stuff that needs to be saved/restored */
+ Int32 i;
+ Int32 j;
+ Int32 t;
+ Int32 alphaSize;
+ Int32 nGroups;
+ Int32 nSelectors;
+ Int32 EOB;
+ Int32 groupNo;
+ Int32 groupPos;
+ Int32 nextSym;
+ Int32 nblockMAX;
+ Int32 nblock;
+ Int32 es;
+ Int32 N;
+ Int32 curr;
+ Int32 zt;
+ Int32 zn;
+ Int32 zvec;
+ Int32 zj;
+ Int32 gSel;
+ Int32 gMinlen;
+ Int32* gLimit;
+ Int32* gBase;
+ Int32* gPerm;
+
+ if (s->state == BZ_X_MAGIC_1) {
+ /*initialise the save area*/
+ s->save_i = 0;
+ s->save_j = 0;
+ s->save_t = 0;
+ s->save_alphaSize = 0;
+ s->save_nGroups = 0;
+ s->save_nSelectors = 0;
+ s->save_EOB = 0;
+ s->save_groupNo = 0;
+ s->save_groupPos = 0;
+ s->save_nextSym = 0;
+ s->save_nblockMAX = 0;
+ s->save_nblock = 0;
+ s->save_es = 0;
+ s->save_N = 0;
+ s->save_curr = 0;
+ s->save_zt = 0;
+ s->save_zn = 0;
+ s->save_zvec = 0;
+ s->save_zj = 0;
+ s->save_gSel = 0;
+ s->save_gMinlen = 0;
+ s->save_gLimit = NULL;
+ s->save_gBase = NULL;
+ s->save_gPerm = NULL;
+ }
+
+ /*restore from the save area*/
+ i = s->save_i;
+ j = s->save_j;
+ t = s->save_t;
+ alphaSize = s->save_alphaSize;
+ nGroups = s->save_nGroups;
+ nSelectors = s->save_nSelectors;
+ EOB = s->save_EOB;
+ groupNo = s->save_groupNo;
+ groupPos = s->save_groupPos;
+ nextSym = s->save_nextSym;
+ nblockMAX = s->save_nblockMAX;
+ nblock = s->save_nblock;
+ es = s->save_es;
+ N = s->save_N;
+ curr = s->save_curr;
+ zt = s->save_zt;
+ zn = s->save_zn;
+ zvec = s->save_zvec;
+ zj = s->save_zj;
+ gSel = s->save_gSel;
+ gMinlen = s->save_gMinlen;
+ gLimit = s->save_gLimit;
+ gBase = s->save_gBase;
+ gPerm = s->save_gPerm;
+
+ retVal = BZ_OK;
+
+ switch (s->state) {
+
+ GET_UCHAR(BZ_X_MAGIC_1, uc);
+ if (uc != 'B') RETURN(BZ_DATA_ERROR_MAGIC);
+
+ GET_UCHAR(BZ_X_MAGIC_2, uc);
+ if (uc != 'Z') RETURN(BZ_DATA_ERROR_MAGIC);
+
+ GET_UCHAR(BZ_X_MAGIC_3, uc)
+ if (uc != 'h') RETURN(BZ_DATA_ERROR_MAGIC);
+
+ GET_BITS(BZ_X_MAGIC_4, s->blockSize100k, 8)
+ if (s->blockSize100k < '1' ||
+ s->blockSize100k > '9') RETURN(BZ_DATA_ERROR_MAGIC);
+ s->blockSize100k -= '0';
+
+ if (s->smallDecompress) {
+ s->ll16 = BZALLOC( s->blockSize100k * 100000 * sizeof(UInt16) );
+ s->ll4 = BZALLOC(
+ ((1 + s->blockSize100k * 100000) >> 1) * sizeof(UChar)
+ );
+ if (s->ll16 == NULL || s->ll4 == NULL) RETURN(BZ_MEM_ERROR);
+ } else {
+ s->tt = BZALLOC( s->blockSize100k * 100000 * sizeof(Int32) );
+ if (s->tt == NULL) RETURN(BZ_MEM_ERROR);
+ }
+
+ GET_UCHAR(BZ_X_BLKHDR_1, uc);
+
+ if (uc == 0x17) goto endhdr_2;
+ if (uc != 0x31) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_BLKHDR_2, uc);
+ if (uc != 0x41) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_BLKHDR_3, uc);
+ if (uc != 0x59) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_BLKHDR_4, uc);
+ if (uc != 0x26) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_BLKHDR_5, uc);
+ if (uc != 0x53) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_BLKHDR_6, uc);
+ if (uc != 0x59) RETURN(BZ_DATA_ERROR);
+
+ s->currBlockNo++;
+ if (s->verbosity >= 2)
+ VPrintf1 ( "\n [%d: huff+mtf ", s->currBlockNo );
+
+ s->storedBlockCRC = 0;
+ GET_UCHAR(BZ_X_BCRC_1, uc);
+ s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+ GET_UCHAR(BZ_X_BCRC_2, uc);
+ s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+ GET_UCHAR(BZ_X_BCRC_3, uc);
+ s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+ GET_UCHAR(BZ_X_BCRC_4, uc);
+ s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+
+ GET_BITS(BZ_X_RANDBIT, s->blockRandomised, 1);
+
+ s->origPtr = 0;
+ GET_UCHAR(BZ_X_ORIGPTR_1, uc);
+ s->origPtr = (s->origPtr << 8) | ((Int32)uc);
+ GET_UCHAR(BZ_X_ORIGPTR_2, uc);
+ s->origPtr = (s->origPtr << 8) | ((Int32)uc);
+ GET_UCHAR(BZ_X_ORIGPTR_3, uc);
+ s->origPtr = (s->origPtr << 8) | ((Int32)uc);
+
+ if (s->origPtr < 0)
+ RETURN(BZ_DATA_ERROR);
+ if (s->origPtr > 10 + 100000*s->blockSize100k)
+ RETURN(BZ_DATA_ERROR);
+
+ /*--- Receive the mapping table ---*/
+ for (i = 0; i < 16; i++) {
+ GET_BIT(BZ_X_MAPPING_1, uc);
+ if (uc == 1)
+ s->inUse16[i] = True; else
+ s->inUse16[i] = False;
+ }
+
+ for (i = 0; i < 256; i++) s->inUse[i] = False;
+
+ for (i = 0; i < 16; i++)
+ if (s->inUse16[i])
+ for (j = 0; j < 16; j++) {
+ GET_BIT(BZ_X_MAPPING_2, uc);
+ if (uc == 1) s->inUse[i * 16 + j] = True;
+ }
+ makeMaps_d ( s );
+ if (s->nInUse == 0) RETURN(BZ_DATA_ERROR);
+ alphaSize = s->nInUse+2;
+
+ /*--- Now the selectors ---*/
+ GET_BITS(BZ_X_SELECTOR_1, nGroups, 3);
+ if (nGroups < 2 || nGroups > 6) RETURN(BZ_DATA_ERROR);
+ GET_BITS(BZ_X_SELECTOR_2, nSelectors, 15);
+ if (nSelectors < 1) RETURN(BZ_DATA_ERROR);
+ for (i = 0; i < nSelectors; i++) {
+ j = 0;
+ while (True) {
+ GET_BIT(BZ_X_SELECTOR_3, uc);
+ if (uc == 0) break;
+ j++;
+ if (j >= nGroups) RETURN(BZ_DATA_ERROR);
+ }
+ s->selectorMtf[i] = j;
+ }
+
+ /*--- Undo the MTF values for the selectors. ---*/
+ {
+ UChar pos[BZ_N_GROUPS], tmp, v;
+ for (v = 0; v < nGroups; v++) pos[v] = v;
+
+ for (i = 0; i < nSelectors; i++) {
+ v = s->selectorMtf[i];
+ tmp = pos[v];
+ while (v > 0) { pos[v] = pos[v-1]; v--; }
+ pos[0] = tmp;
+ s->selector[i] = tmp;
+ }
+ }
+
+ /*--- Now the coding tables ---*/
+ for (t = 0; t < nGroups; t++) {
+ GET_BITS(BZ_X_CODING_1, curr, 5);
+ for (i = 0; i < alphaSize; i++) {
+ while (True) {
+ if (curr < 1 || curr > 20) RETURN(BZ_DATA_ERROR);
+ GET_BIT(BZ_X_CODING_2, uc);
+ if (uc == 0) break;
+ GET_BIT(BZ_X_CODING_3, uc);
+ if (uc == 0) curr++; else curr--;
+ }
+ s->len[t][i] = curr;
+ }
+ }
+
+ /*--- Create the Huffman decoding tables ---*/
+ for (t = 0; t < nGroups; t++) {
+ minLen = 32;
+ maxLen = 0;
+ for (i = 0; i < alphaSize; i++) {
+ if (s->len[t][i] > maxLen) maxLen = s->len[t][i];
+ if (s->len[t][i] < minLen) minLen = s->len[t][i];
+ }
+ BZ2_hbCreateDecodeTables (
+ &(s->limit[t][0]),
+ &(s->base[t][0]),
+ &(s->perm[t][0]),
+ &(s->len[t][0]),
+ minLen, maxLen, alphaSize
+ );
+ s->minLens[t] = minLen;
+ }
+
+ /*--- Now the MTF values ---*/
+
+ EOB = s->nInUse+1;
+ nblockMAX = 100000 * s->blockSize100k;
+ groupNo = -1;
+ groupPos = 0;
+
+ for (i = 0; i <= 255; i++) s->unzftab[i] = 0;
+
+ /*-- MTF init --*/
+ {
+ Int32 ii, jj, kk;
+ kk = MTFA_SIZE-1;
+ for (ii = 256 / MTFL_SIZE - 1; ii >= 0; ii--) {
+ for (jj = MTFL_SIZE-1; jj >= 0; jj--) {
+ s->mtfa[kk] = (UChar)(ii * MTFL_SIZE + jj);
+ kk--;
+ }
+ s->mtfbase[ii] = kk + 1;
+ }
+ }
+ /*-- end MTF init --*/
+
+ nblock = 0;
+ GET_MTF_VAL(BZ_X_MTF_1, BZ_X_MTF_2, nextSym);
+
+ while (True) {
+
+ if (nextSym == EOB) break;
+
+ if (nextSym == BZ_RUNA || nextSym == BZ_RUNB) {
+
+ es = -1;
+ N = 1;
+ do {
+ if (nextSym == BZ_RUNA) es = es + (0+1) * N; else
+ if (nextSym == BZ_RUNB) es = es + (1+1) * N;
+ N = N * 2;
+ GET_MTF_VAL(BZ_X_MTF_3, BZ_X_MTF_4, nextSym);
+ }
+ while (nextSym == BZ_RUNA || nextSym == BZ_RUNB);
+
+ es++;
+ uc = s->seqToUnseq[ s->mtfa[s->mtfbase[0]] ];
+ s->unzftab[uc] += es;
+
+ if (s->smallDecompress)
+ while (es > 0) {
+ if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR);
+ s->ll16[nblock] = (UInt16)uc;
+ nblock++;
+ es--;
+ }
+ else
+ while (es > 0) {
+ if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR);
+ s->tt[nblock] = (UInt32)uc;
+ nblock++;
+ es--;
+ };
+
+ continue;
+
+ } else {
+
+ if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR);
+
+ /*-- uc = MTF ( nextSym-1 ) --*/
+ {
+ Int32 ii, jj, kk, pp, lno, off;
+ UInt32 nn;
+ nn = (UInt32)(nextSym - 1);
+
+ if (nn < MTFL_SIZE) {
+ /* avoid general-case expense */
+ pp = s->mtfbase[0];
+ uc = s->mtfa[pp+nn];
+ while (nn > 3) {
+ Int32 z = pp+nn;
+ s->mtfa[(z) ] = s->mtfa[(z)-1];
+ s->mtfa[(z)-1] = s->mtfa[(z)-2];
+ s->mtfa[(z)-2] = s->mtfa[(z)-3];
+ s->mtfa[(z)-3] = s->mtfa[(z)-4];
+ nn -= 4;
+ }
+ while (nn > 0) {
+ s->mtfa[(pp+nn)] = s->mtfa[(pp+nn)-1]; nn--;
+ };
+ s->mtfa[pp] = uc;
+ } else {
+ /* general case */
+ lno = nn / MTFL_SIZE;
+ off = nn % MTFL_SIZE;
+ pp = s->mtfbase[lno] + off;
+ uc = s->mtfa[pp];
+ while (pp > s->mtfbase[lno]) {
+ s->mtfa[pp] = s->mtfa[pp-1]; pp--;
+ };
+ s->mtfbase[lno]++;
+ while (lno > 0) {
+ s->mtfbase[lno]--;
+ s->mtfa[s->mtfbase[lno]]
+ = s->mtfa[s->mtfbase[lno-1] + MTFL_SIZE - 1];
+ lno--;
+ }
+ s->mtfbase[0]--;
+ s->mtfa[s->mtfbase[0]] = uc;
+ if (s->mtfbase[0] == 0) {
+ kk = MTFA_SIZE-1;
+ for (ii = 256 / MTFL_SIZE-1; ii >= 0; ii--) {
+ for (jj = MTFL_SIZE-1; jj >= 0; jj--) {
+ s->mtfa[kk] = s->mtfa[s->mtfbase[ii] + jj];
+ kk--;
+ }
+ s->mtfbase[ii] = kk + 1;
+ }
+ }
+ }
+ }
+ /*-- end uc = MTF ( nextSym-1 ) --*/
+
+ s->unzftab[s->seqToUnseq[uc]]++;
+ if (s->smallDecompress)
+ s->ll16[nblock] = (UInt16)(s->seqToUnseq[uc]); else
+ s->tt[nblock] = (UInt32)(s->seqToUnseq[uc]);
+ nblock++;
+
+ GET_MTF_VAL(BZ_X_MTF_5, BZ_X_MTF_6, nextSym);
+ continue;
+ }
+ }
+
+ /* Now we know what nblock is, we can do a better sanity
+ check on s->origPtr.
+ */
+ if (s->origPtr < 0 || s->origPtr >= nblock)
+ RETURN(BZ_DATA_ERROR);
+
+ s->state_out_len = 0;
+ s->state_out_ch = 0;
+ BZ_INITIALISE_CRC ( s->calculatedBlockCRC );
+ s->state = BZ_X_OUTPUT;
+ if (s->verbosity >= 2) VPrintf0 ( "rt+rld" );
+
+ /*-- Set up cftab to facilitate generation of T^(-1) --*/
+ s->cftab[0] = 0;
+ for (i = 1; i <= 256; i++) s->cftab[i] = s->unzftab[i-1];
+ for (i = 1; i <= 256; i++) s->cftab[i] += s->cftab[i-1];
+
+ if (s->smallDecompress) {
+
+ /*-- Make a copy of cftab, used in generation of T --*/
+ for (i = 0; i <= 256; i++) s->cftabCopy[i] = s->cftab[i];
+
+ /*-- compute the T vector --*/
+ for (i = 0; i < nblock; i++) {
+ uc = (UChar)(s->ll16[i]);
+ SET_LL(i, s->cftabCopy[uc]);
+ s->cftabCopy[uc]++;
+ }
+
+ /*-- Compute T^(-1) by pointer reversal on T --*/
+ i = s->origPtr;
+ j = GET_LL(i);
+ do {
+ Int32 tmp = GET_LL(j);
+ SET_LL(j, i);
+ i = j;
+ j = tmp;
+ }
+ while (i != s->origPtr);
+
+ s->tPos = s->origPtr;
+ s->nblock_used = 0;
+ if (s->blockRandomised) {
+ BZ_RAND_INIT_MASK;
+ BZ_GET_SMALL(s->k0); s->nblock_used++;
+ BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK;
+ } else {
+ BZ_GET_SMALL(s->k0); s->nblock_used++;
+ }
+
+ } else {
+
+ /*-- compute the T^(-1) vector --*/
+ for (i = 0; i < nblock; i++) {
+ uc = (UChar)(s->tt[i] & 0xff);
+ s->tt[s->cftab[uc]] |= (i << 8);
+ s->cftab[uc]++;
+ }
+
+ s->tPos = s->tt[s->origPtr] >> 8;
+ s->nblock_used = 0;
+ if (s->blockRandomised) {
+ BZ_RAND_INIT_MASK;
+ BZ_GET_FAST(s->k0); s->nblock_used++;
+ BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK;
+ } else {
+ BZ_GET_FAST(s->k0); s->nblock_used++;
+ }
+
+ }
+
+ RETURN(BZ_OK);
+
+
+
+ endhdr_2:
+
+ GET_UCHAR(BZ_X_ENDHDR_2, uc);
+ if (uc != 0x72) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_ENDHDR_3, uc);
+ if (uc != 0x45) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_ENDHDR_4, uc);
+ if (uc != 0x38) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_ENDHDR_5, uc);
+ if (uc != 0x50) RETURN(BZ_DATA_ERROR);
+ GET_UCHAR(BZ_X_ENDHDR_6, uc);
+ if (uc != 0x90) RETURN(BZ_DATA_ERROR);
+
+ s->storedCombinedCRC = 0;
+ GET_UCHAR(BZ_X_CCRC_1, uc);
+ s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+ GET_UCHAR(BZ_X_CCRC_2, uc);
+ s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+ GET_UCHAR(BZ_X_CCRC_3, uc);
+ s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+ GET_UCHAR(BZ_X_CCRC_4, uc);
+ s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+
+ s->state = BZ_X_IDLE;
+ RETURN(BZ_STREAM_END);
+
+ default: AssertH ( False, 4001 );
+ }
+
+ AssertH ( False, 4002 );
+
+ save_state_and_return:
+
+ s->save_i = i;
+ s->save_j = j;
+ s->save_t = t;
+ s->save_alphaSize = alphaSize;
+ s->save_nGroups = nGroups;
+ s->save_nSelectors = nSelectors;
+ s->save_EOB = EOB;
+ s->save_groupNo = groupNo;
+ s->save_groupPos = groupPos;
+ s->save_nextSym = nextSym;
+ s->save_nblockMAX = nblockMAX;
+ s->save_nblock = nblock;
+ s->save_es = es;
+ s->save_N = N;
+ s->save_curr = curr;
+ s->save_zt = zt;
+ s->save_zn = zn;
+ s->save_zvec = zvec;
+ s->save_zj = zj;
+ s->save_gSel = gSel;
+ s->save_gMinlen = gMinlen;
+ s->save_gLimit = gLimit;
+ s->save_gBase = gBase;
+ s->save_gPerm = gPerm;
+
+ return retVal;
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end decompress.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+/*\r
+ minibz2\r
+ libbz2.dll test program.\r
+ by Yoshioka Tsuneo(QWF00133@nifty.ne.jp/tsuneo-y@is.aist-nara.ac.jp)\r
+ This file is Public Domain.\r
+ welcome any email to me.\r
+\r
+ usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]\r
+*/\r
+\r
+#define BZ_IMPORT\r
+#include <stdio.h>\r
+#include <stdlib.h>\r
+#include "bzlib.h"\r
+#ifdef _WIN32\r
+#include <io.h>\r
+#endif\r
+\r
+\r
+#ifdef _WIN32\r
+\r
+#define BZ2_LIBNAME "libbz2-1.0.0.DLL" \r
+\r
+#include <windows.h>\r
+static int BZ2DLLLoaded = 0;\r
+static HINSTANCE BZ2DLLhLib;\r
+int BZ2DLLLoadLibrary(void)\r
+{\r
+ HINSTANCE hLib;\r
+\r
+ if(BZ2DLLLoaded==1){return 0;}\r
+ hLib=LoadLibrary(BZ2_LIBNAME);\r
+ if(hLib == NULL){\r
+ fprintf(stderr,"Can't load %s\n",BZ2_LIBNAME);\r
+ return -1;\r
+ }\r
+ BZ2_bzlibVersion=GetProcAddress(hLib,"BZ2_bzlibVersion");\r
+ BZ2_bzopen=GetProcAddress(hLib,"BZ2_bzopen");\r
+ BZ2_bzdopen=GetProcAddress(hLib,"BZ2_bzdopen");\r
+ BZ2_bzread=GetProcAddress(hLib,"BZ2_bzread");\r
+ BZ2_bzwrite=GetProcAddress(hLib,"BZ2_bzwrite");\r
+ BZ2_bzflush=GetProcAddress(hLib,"BZ2_bzflush");\r
+ BZ2_bzclose=GetProcAddress(hLib,"BZ2_bzclose");\r
+ BZ2_bzerror=GetProcAddress(hLib,"BZ2_bzerror");\r
+\r
+ if (!BZ2_bzlibVersion || !BZ2_bzopen || !BZ2_bzdopen\r
+ || !BZ2_bzread || !BZ2_bzwrite || !BZ2_bzflush\r
+ || !BZ2_bzclose || !BZ2_bzerror) {\r
+ fprintf(stderr,"GetProcAddress failed.\n");\r
+ return -1;\r
+ }\r
+ BZ2DLLLoaded=1;\r
+ BZ2DLLhLib=hLib;\r
+ return 0;\r
+\r
+}\r
+int BZ2DLLFreeLibrary(void)\r
+{\r
+ if(BZ2DLLLoaded==0){return 0;}\r
+ FreeLibrary(BZ2DLLhLib);\r
+ BZ2DLLLoaded=0;\r
+}\r
+#endif /* WIN32 */\r
+\r
+void usage(void)\r
+{\r
+ puts("usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]");\r
+}\r
+\r
+int main(int argc,char *argv[])\r
+{\r
+ int decompress = 0;\r
+ int level = 9;\r
+ char *fn_r = NULL;\r
+ char *fn_w = NULL;\r
+\r
+#ifdef _WIN32\r
+ if(BZ2DLLLoadLibrary()<0){\r
+ fprintf(stderr,"Loading of %s failed. Giving up.\n", BZ2_LIBNAME);\r
+ exit(1);\r
+ }\r
+ printf("Loading of %s succeeded. Library version is %s.\n",\r
+ BZ2_LIBNAME, BZ2_bzlibVersion() );\r
+#endif\r
+ while(++argv,--argc){\r
+ if(**argv =='-' || **argv=='/'){\r
+ char *p;\r
+\r
+ for(p=*argv+1;*p;p++){\r
+ if(*p=='d'){\r
+ decompress = 1;\r
+ }else if('1'<=*p && *p<='9'){\r
+ level = *p - '0';\r
+ }else{\r
+ usage();\r
+ exit(1);\r
+ }\r
+ }\r
+ }else{\r
+ break;\r
+ }\r
+ }\r
+ if(argc>=1){\r
+ fn_r = *argv;\r
+ argc--;argv++;\r
+ }else{\r
+ fn_r = NULL;\r
+ }\r
+ if(argc>=1){\r
+ fn_w = *argv;\r
+ argc--;argv++;\r
+ }else{\r
+ fn_w = NULL;\r
+ }\r
+ {\r
+ int len;\r
+ char buff[0x1000];\r
+ char mode[10];\r
+\r
+ if(decompress){\r
+ BZFILE *BZ2fp_r = NULL;\r
+ FILE *fp_w = NULL;\r
+\r
+ if(fn_w){\r
+ if((fp_w = fopen(fn_w,"wb"))==NULL){\r
+ printf("can't open [%s]\n",fn_w);\r
+ perror("reason:");\r
+ exit(1);\r
+ }\r
+ }else{\r
+ fp_w = stdout;\r
+ }\r
+ if((BZ2fp_r == NULL && (BZ2fp_r = BZ2_bzdopen(fileno(stdin),"rb"))==NULL)\r
+ || (BZ2fp_r != NULL && (BZ2fp_r = BZ2_bzopen(fn_r,"rb"))==NULL)){\r
+ printf("can't bz2openstream\n");\r
+ exit(1);\r
+ }\r
+ while((len=BZ2_bzread(BZ2fp_r,buff,0x1000))>0){\r
+ fwrite(buff,1,len,fp_w);\r
+ }\r
+ BZ2_bzclose(BZ2fp_r);\r
+ if(fp_w != stdout) fclose(fp_w);\r
+ }else{\r
+ BZFILE *BZ2fp_w = NULL;\r
+ FILE *fp_r = NULL;\r
+\r
+ if(fn_r){\r
+ if((fp_r = fopen(fn_r,"rb"))==NULL){\r
+ printf("can't open [%s]\n",fn_r);\r
+ perror("reason:");\r
+ exit(1);\r
+ }\r
+ }else{\r
+ fp_r = stdin;\r
+ }\r
+ mode[0]='w';\r
+ mode[1] = '0' + level;\r
+ mode[2] = '\0';\r
+\r
+ if((fn_w == NULL && (BZ2fp_w = BZ2_bzdopen(fileno(stdout),mode))==NULL)\r
+ || (fn_w !=NULL && (BZ2fp_w = BZ2_bzopen(fn_w,mode))==NULL)){\r
+ printf("can't bz2openstream\n");\r
+ exit(1);\r
+ }\r
+ while((len=fread(buff,1,0x1000,fp_r))>0){\r
+ BZ2_bzwrite(BZ2fp_w,buff,len);\r
+ }\r
+ BZ2_bzclose(BZ2fp_w);\r
+ if(fp_r!=stdin)fclose(fp_r);\r
+ }\r
+ }\r
+#ifdef _WIN32\r
+ BZ2DLLFreeLibrary();\r
+#endif\r
+ return 0;\r
+}\r
--- /dev/null
+# Microsoft Developer Studio Project File - Name="dlltest" - Package Owner=<4>\r
+# Microsoft Developer Studio Generated Build File, Format Version 5.00\r
+# ** \95Ò\8fW\82µ\82È\82¢\82Å\82\82¾\82³\82¢ **\r
+\r
+# TARGTYPE "Win32 (x86) Console Application" 0x0103\r
+\r
+CFG=dlltest - Win32 Debug\r
+!MESSAGE \82±\82ê\82Í\97L\8cø\82ÈÒ²¸Ì§²Ù\82Å\82Í\82 \82è\82Ü\82¹\82ñ\81B \82±\82ÌÌßÛ¼Þª¸Ä\82ðËÞÙÄÞ\82·\82é\82½\82ß\82É\82Í NMAKE \82ð\8eg\97p\82µ\82Ä\82\82¾\82³\82¢\81B\r
+!MESSAGE [Ò²¸Ì§²Ù\82Ì´¸½Îß°Ä] ºÏÝÄÞ\82ð\8eg\97p\82µ\82Ä\8eÀ\8ds\82µ\82Ä\82\82¾\82³\82¢\r
+!MESSAGE \r
+!MESSAGE NMAKE /f "dlltest.mak".\r
+!MESSAGE \r
+!MESSAGE NMAKE \82Ì\8eÀ\8ds\8e\9e\82É\8d\\90¬\82ð\8ew\92è\82Å\82«\82Ü\82·\r
+!MESSAGE ºÏÝÄÞ ×²Ý\8fã\82ÅϸÛ\82Ì\90Ý\92è\82ð\92è\8b`\82µ\82Ü\82·\81B\97á:\r
+!MESSAGE \r
+!MESSAGE NMAKE /f "dlltest.mak" CFG="dlltest - Win32 Debug"\r
+!MESSAGE \r
+!MESSAGE \91I\91ð\89Â\94\\82ÈËÞÙÄÞ Ó°ÄÞ:\r
+!MESSAGE \r
+!MESSAGE "dlltest - Win32 Release" ("Win32 (x86) Console Application" \97p)\r
+!MESSAGE "dlltest - Win32 Debug" ("Win32 (x86) Console Application" \97p)\r
+!MESSAGE \r
+\r
+# Begin Project\r
+# PROP Scc_ProjName ""\r
+# PROP Scc_LocalPath ""\r
+CPP=cl.exe\r
+RSC=rc.exe\r
+\r
+!IF "$(CFG)" == "dlltest - Win32 Release"\r
+\r
+# PROP BASE Use_MFC 0\r
+# PROP BASE Use_Debug_Libraries 0\r
+# PROP BASE Output_Dir "Release"\r
+# PROP BASE Intermediate_Dir "Release"\r
+# PROP BASE Target_Dir ""\r
+# PROP Use_MFC 0\r
+# PROP Use_Debug_Libraries 0\r
+# PROP Output_Dir "Release"\r
+# PROP Intermediate_Dir "Release"\r
+# PROP Ignore_Export_Lib 0\r
+# PROP Target_Dir ""\r
+# ADD BASE CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c\r
+# ADD CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c\r
+# ADD BASE RSC /l 0x411 /d "NDEBUG"\r
+# ADD RSC /l 0x411 /d "NDEBUG"\r
+BSC32=bscmake.exe\r
+# ADD BASE BSC32 /nologo\r
+# ADD BSC32 /nologo\r
+LINK32=link.exe\r
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386\r
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386 /out:"minibz2.exe"\r
+\r
+!ELSEIF "$(CFG)" == "dlltest - Win32 Debug"\r
+\r
+# PROP BASE Use_MFC 0\r
+# PROP BASE Use_Debug_Libraries 1\r
+# PROP BASE Output_Dir "dlltest_"\r
+# PROP BASE Intermediate_Dir "dlltest_"\r
+# PROP BASE Target_Dir ""\r
+# PROP Use_MFC 0\r
+# PROP Use_Debug_Libraries 1\r
+# PROP Output_Dir "dlltest_"\r
+# PROP Intermediate_Dir "dlltest_"\r
+# PROP Ignore_Export_Lib 0\r
+# PROP Target_Dir ""\r
+# ADD BASE CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c\r
+# ADD CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c\r
+# ADD BASE RSC /l 0x411 /d "_DEBUG"\r
+# ADD RSC /l 0x411 /d "_DEBUG"\r
+BSC32=bscmake.exe\r
+# ADD BASE BSC32 /nologo\r
+# ADD BSC32 /nologo\r
+LINK32=link.exe\r
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /pdbtype:sept\r
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /out:"minibz2.exe" /pdbtype:sept\r
+\r
+!ENDIF \r
+\r
+# Begin Target\r
+\r
+# Name "dlltest - Win32 Release"\r
+# Name "dlltest - Win32 Debug"\r
+# Begin Source File\r
+\r
+SOURCE=.\bzlib.h\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\dlltest.c\r
+# End Source File\r
+# End Target\r
+# End Project\r
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Huffman coding low-level stuff ---*/
+/*--- huffman.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+/*---------------------------------------------------*/
+#define WEIGHTOF(zz0) ((zz0) & 0xffffff00)
+#define DEPTHOF(zz1) ((zz1) & 0x000000ff)
+#define MYMAX(zz2,zz3) ((zz2) > (zz3) ? (zz2) : (zz3))
+
+#define ADDWEIGHTS(zw1,zw2) \
+ (WEIGHTOF(zw1)+WEIGHTOF(zw2)) | \
+ (1 + MYMAX(DEPTHOF(zw1),DEPTHOF(zw2)))
+
+#define UPHEAP(z) \
+{ \
+ Int32 zz, tmp; \
+ zz = z; tmp = heap[zz]; \
+ while (weight[tmp] < weight[heap[zz >> 1]]) { \
+ heap[zz] = heap[zz >> 1]; \
+ zz >>= 1; \
+ } \
+ heap[zz] = tmp; \
+}
+
+#define DOWNHEAP(z) \
+{ \
+ Int32 zz, yy, tmp; \
+ zz = z; tmp = heap[zz]; \
+ while (True) { \
+ yy = zz << 1; \
+ if (yy > nHeap) break; \
+ if (yy < nHeap && \
+ weight[heap[yy+1]] < weight[heap[yy]]) \
+ yy++; \
+ if (weight[tmp] < weight[heap[yy]]) break; \
+ heap[zz] = heap[yy]; \
+ zz = yy; \
+ } \
+ heap[zz] = tmp; \
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_hbMakeCodeLengths ( UChar *len,
+ Int32 *freq,
+ Int32 alphaSize,
+ Int32 maxLen )
+{
+ /*--
+ Nodes and heap entries run from 1. Entry 0
+ for both the heap and nodes is a sentinel.
+ --*/
+ Int32 nNodes, nHeap, n1, n2, i, j, k;
+ Bool tooLong;
+
+ Int32 heap [ BZ_MAX_ALPHA_SIZE + 2 ];
+ Int32 weight [ BZ_MAX_ALPHA_SIZE * 2 ];
+ Int32 parent [ BZ_MAX_ALPHA_SIZE * 2 ];
+
+ for (i = 0; i < alphaSize; i++)
+ weight[i+1] = (freq[i] == 0 ? 1 : freq[i]) << 8;
+
+ while (True) {
+
+ nNodes = alphaSize;
+ nHeap = 0;
+
+ heap[0] = 0;
+ weight[0] = 0;
+ parent[0] = -2;
+
+ for (i = 1; i <= alphaSize; i++) {
+ parent[i] = -1;
+ nHeap++;
+ heap[nHeap] = i;
+ UPHEAP(nHeap);
+ }
+
+ AssertH( nHeap < (BZ_MAX_ALPHA_SIZE+2), 2001 );
+
+ while (nHeap > 1) {
+ n1 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1);
+ n2 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1);
+ nNodes++;
+ parent[n1] = parent[n2] = nNodes;
+ weight[nNodes] = ADDWEIGHTS(weight[n1], weight[n2]);
+ parent[nNodes] = -1;
+ nHeap++;
+ heap[nHeap] = nNodes;
+ UPHEAP(nHeap);
+ }
+
+ AssertH( nNodes < (BZ_MAX_ALPHA_SIZE * 2), 2002 );
+
+ tooLong = False;
+ for (i = 1; i <= alphaSize; i++) {
+ j = 0;
+ k = i;
+ while (parent[k] >= 0) { k = parent[k]; j++; }
+ len[i-1] = j;
+ if (j > maxLen) tooLong = True;
+ }
+
+ if (! tooLong) break;
+
+ for (i = 1; i < alphaSize; i++) {
+ j = weight[i] >> 8;
+ j = 1 + (j / 2);
+ weight[i] = j << 8;
+ }
+ }
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_hbAssignCodes ( Int32 *code,
+ UChar *length,
+ Int32 minLen,
+ Int32 maxLen,
+ Int32 alphaSize )
+{
+ Int32 n, vec, i;
+
+ vec = 0;
+ for (n = minLen; n <= maxLen; n++) {
+ for (i = 0; i < alphaSize; i++)
+ if (length[i] == n) { code[i] = vec; vec++; };
+ vec <<= 1;
+ }
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_hbCreateDecodeTables ( Int32 *limit,
+ Int32 *base,
+ Int32 *perm,
+ UChar *length,
+ Int32 minLen,
+ Int32 maxLen,
+ Int32 alphaSize )
+{
+ Int32 pp, i, j, vec;
+
+ pp = 0;
+ for (i = minLen; i <= maxLen; i++)
+ for (j = 0; j < alphaSize; j++)
+ if (length[j] == i) { perm[pp] = j; pp++; };
+
+ for (i = 0; i < BZ_MAX_CODE_LEN; i++) base[i] = 0;
+ for (i = 0; i < alphaSize; i++) base[length[i]+1]++;
+
+ for (i = 1; i < BZ_MAX_CODE_LEN; i++) base[i] += base[i-1];
+
+ for (i = 0; i < BZ_MAX_CODE_LEN; i++) limit[i] = 0;
+ vec = 0;
+
+ for (i = minLen; i <= maxLen; i++) {
+ vec += (base[i+1] - base[i]);
+ limit[i] = vec-1;
+ vec <<= 1;
+ }
+ for (i = minLen + 1; i <= maxLen; i++)
+ base[i] = ((limit[i-1] + 1) << 1) - base[i];
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end huffman.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+LIBRARY LIBBZ2\r
+DESCRIPTION "libbzip2: library for data compression"\r
+EXPORTS\r
+ BZ2_bzCompressInit\r
+ BZ2_bzCompress\r
+ BZ2_bzCompressEnd\r
+ BZ2_bzDecompressInit\r
+ BZ2_bzDecompress\r
+ BZ2_bzDecompressEnd\r
+ BZ2_bzReadOpen\r
+ BZ2_bzReadClose\r
+ BZ2_bzReadGetUnused\r
+ BZ2_bzRead\r
+ BZ2_bzWriteOpen\r
+ BZ2_bzWrite\r
+ BZ2_bzWriteClose\r
+ BZ2_bzWriteClose64\r
+ BZ2_bzBuffToBuffCompress\r
+ BZ2_bzBuffToBuffDecompress\r
+ BZ2_bzlibVersion\r
+ BZ2_bzopen\r
+ BZ2_bzdopen\r
+ BZ2_bzread\r
+ BZ2_bzwrite\r
+ BZ2_bzflush\r
+ BZ2_bzclose\r
+ BZ2_bzerror\r
--- /dev/null
+# Microsoft Developer Studio Project File - Name="libbz2" - Package Owner=<4>\r
+# Microsoft Developer Studio Generated Build File, Format Version 5.00\r
+# ** \95Ò\8fW\82µ\82È\82¢\82Å\82\82¾\82³\82¢ **\r
+\r
+# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102\r
+\r
+CFG=libbz2 - Win32 Debug\r
+!MESSAGE \82±\82ê\82Í\97L\8cø\82ÈÒ²¸Ì§²Ù\82Å\82Í\82 \82è\82Ü\82¹\82ñ\81B \82±\82ÌÌßÛ¼Þª¸Ä\82ðËÞÙÄÞ\82·\82é\82½\82ß\82É\82Í NMAKE \82ð\8eg\97p\82µ\82Ä\82\82¾\82³\82¢\81B\r
+!MESSAGE [Ò²¸Ì§²Ù\82Ì´¸½Îß°Ä] ºÏÝÄÞ\82ð\8eg\97p\82µ\82Ä\8eÀ\8ds\82µ\82Ä\82\82¾\82³\82¢\r
+!MESSAGE \r
+!MESSAGE NMAKE /f "libbz2.mak".\r
+!MESSAGE \r
+!MESSAGE NMAKE \82Ì\8eÀ\8ds\8e\9e\82É\8d\\90¬\82ð\8ew\92è\82Å\82«\82Ü\82·\r
+!MESSAGE ºÏÝÄÞ ×²Ý\8fã\82ÅϸÛ\82Ì\90Ý\92è\82ð\92è\8b`\82µ\82Ü\82·\81B\97á:\r
+!MESSAGE \r
+!MESSAGE NMAKE /f "libbz2.mak" CFG="libbz2 - Win32 Debug"\r
+!MESSAGE \r
+!MESSAGE \91I\91ð\89Â\94\\82ÈËÞÙÄÞ Ó°ÄÞ:\r
+!MESSAGE \r
+!MESSAGE "libbz2 - Win32 Release" ("Win32 (x86) Dynamic-Link Library" \97p)\r
+!MESSAGE "libbz2 - Win32 Debug" ("Win32 (x86) Dynamic-Link Library" \97p)\r
+!MESSAGE \r
+\r
+# Begin Project\r
+# PROP Scc_ProjName ""\r
+# PROP Scc_LocalPath ""\r
+CPP=cl.exe\r
+MTL=midl.exe\r
+RSC=rc.exe\r
+\r
+!IF "$(CFG)" == "libbz2 - Win32 Release"\r
+\r
+# PROP BASE Use_MFC 0\r
+# PROP BASE Use_Debug_Libraries 0\r
+# PROP BASE Output_Dir "Release"\r
+# PROP BASE Intermediate_Dir "Release"\r
+# PROP BASE Target_Dir ""\r
+# PROP Use_MFC 0\r
+# PROP Use_Debug_Libraries 0\r
+# PROP Output_Dir "Release"\r
+# PROP Intermediate_Dir "Release"\r
+# PROP Ignore_Export_Lib 0\r
+# PROP Target_Dir ""\r
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c\r
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c\r
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32\r
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32\r
+# ADD BASE RSC /l 0x411 /d "NDEBUG"\r
+# ADD RSC /l 0x411 /d "NDEBUG"\r
+BSC32=bscmake.exe\r
+# ADD BASE BSC32 /nologo\r
+# ADD BSC32 /nologo\r
+LINK32=link.exe\r
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386\r
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 /out:"libbz2.dll"\r
+\r
+!ELSEIF "$(CFG)" == "libbz2 - Win32 Debug"\r
+\r
+# PROP BASE Use_MFC 0\r
+# PROP BASE Use_Debug_Libraries 1\r
+# PROP BASE Output_Dir "Debug"\r
+# PROP BASE Intermediate_Dir "Debug"\r
+# PROP BASE Target_Dir ""\r
+# PROP Use_MFC 0\r
+# PROP Use_Debug_Libraries 1\r
+# PROP Output_Dir "Debug"\r
+# PROP Intermediate_Dir "Debug"\r
+# PROP Ignore_Export_Lib 0\r
+# PROP Target_Dir ""\r
+# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c\r
+# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c\r
+# ADD BASE MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32\r
+# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32\r
+# ADD BASE RSC /l 0x411 /d "_DEBUG"\r
+# ADD RSC /l 0x411 /d "_DEBUG"\r
+BSC32=bscmake.exe\r
+# ADD BASE BSC32 /nologo\r
+# ADD BSC32 /nologo\r
+LINK32=link.exe\r
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /pdbtype:sept\r
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:"libbz2.dll" /pdbtype:sept\r
+\r
+!ENDIF \r
+\r
+# Begin Target\r
+\r
+# Name "libbz2 - Win32 Release"\r
+# Name "libbz2 - Win32 Debug"\r
+# Begin Source File\r
+\r
+SOURCE=.\blocksort.c\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\bzlib.c\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\bzlib.h\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\bzlib_private.h\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\compress.c\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\crctable.c\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\decompress.c\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\huffman.c\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\libbz2.def\r
+# End Source File\r
+# Begin Source File\r
+\r
+SOURCE=.\randtable.c\r
+# End Source File\r
+# End Target\r
+# End Project\r
--- /dev/null
+# Makefile for Microsoft Visual C++ 6.0\r
+# usage: nmake -f makefile.msc\r
+# K.M. Syring (syring@gsf.de)\r
+# Fixed up by JRS for bzip2-0.9.5d release.\r
+\r
+CC=cl\r
+CFLAGS= -DWIN32 -MD -Ox -D_FILE_OFFSET_BITS=64\r
+\r
+OBJS= blocksort.obj \\r
+ huffman.obj \\r
+ crctable.obj \\r
+ randtable.obj \\r
+ compress.obj \\r
+ decompress.obj \\r
+ bzlib.obj\r
+\r
+all: lib bzip2 test\r
+\r
+bzip2: lib\r
+ $(CC) $(CFLAGS) -o bzip2 bzip2.c libbz2.lib setargv.obj\r
+ $(CC) $(CFLAGS) -o bzip2recover bzip2recover.c\r
+\r
+lib: $(OBJS)\r
+ lib /out:libbz2.lib $(OBJS)\r
+\r
+test: bzip2\r
+ type words1\r
+ .\\bzip2 -1 < sample1.ref > sample1.rb2\r
+ .\\bzip2 -2 < sample2.ref > sample2.rb2\r
+ .\\bzip2 -3 < sample3.ref > sample3.rb2\r
+ .\\bzip2 -d < sample1.bz2 > sample1.tst\r
+ .\\bzip2 -d < sample2.bz2 > sample2.tst\r
+ .\\bzip2 -ds < sample3.bz2 > sample3.tst\r
+ @echo All six of the fc's should find no differences.\r
+ @echo If fc finds an error on sample3.bz2, this could be\r
+ @echo because WinZip's 'TAR file smart CR/LF conversion'\r
+ @echo is too clever for its own good. Disable this option.\r
+ @echo The correct size for sample3.ref is 120,244. If it\r
+ @echo is 150,251, WinZip has messed it up.\r
+ fc sample1.bz2 sample1.rb2 \r
+ fc sample2.bz2 sample2.rb2\r
+ fc sample3.bz2 sample3.rb2\r
+ fc sample1.tst sample1.ref\r
+ fc sample2.tst sample2.ref\r
+ fc sample3.tst sample3.ref\r
+\r
+\r
+\r
+clean: \r
+ del *.obj\r
+ del libbz2.lib \r
+ del bzip2.exe\r
+ del bzip2recover.exe\r
+ del sample1.rb2 \r
+ del sample2.rb2 \r
+ del sample3.rb2\r
+ del sample1.tst \r
+ del sample2.tst\r
+ del sample3.tst\r
+\r
+.c.obj: \r
+ $(CC) $(CFLAGS) -c $*.c -o $*.obj\r
+\r
--- /dev/null
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.78 Copyright 1998 Radical Eye Software (www.radicaleye.com)
+%%Title: manual.dvi
+%%Pages: 39
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 596 842
+%%EndComments
+%DVIPSCommandLine: dvips -o manual.ps manual.dvi
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource: TeX output 2000.03.23:2343
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N
+/X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72
+mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1}
+ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale
+isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div
+hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul
+TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if}
+forall round exch round exch]setmatrix}N /@landscape{/isls true N}B
+/@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B
+/FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{
+/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N
+string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N
+end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{
+/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0]
+N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup
+length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{
+128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub
+get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data
+dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N
+/rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup
+/base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx
+0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff
+setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff
+.1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N
+/cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id
+gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp
+add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add
+/gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{
+dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1
+adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2
+idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string
+putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval
+adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg}
+{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{
+adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2
+chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{]
+}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup
+length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{
+cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin
+0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul
+add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict
+/eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook
+known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X
+/IE 256 array N 2 string 0 1 255{IE S dup 360 add 36 4 index cvrs cvn
+put}for pop 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N
+/RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley
+X /rulex X V}B /V{}B /RV statusdict begin /product where{pop false[
+(Display)(NeXT)(LaserWriter 16/600)]{dup length product length le{dup
+length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}
+forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false
+RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1
+false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform
+round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg
+rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail
+{dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}
+B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{
+4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{
+p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p
+a}B /bos{/SS save N}B /eos{SS restore}B end
+
+%%EndProcSet
+TeXDict begin 39158280 55380996 1000 600 600 (manual.dvi)
+@start
+%DVIPSBitmapFont: Fa cmti10 10.95 1
+/Fa 1 47 df<120FEA3FC0127FA212FFA31380EA7F00123C0A0A77891C>46
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fb cmbxti10 14.4 1
+/Fb 1 47 df<13FCEA03FF000F13804813C05AA25AA2B5FCA31480A214006C5A6C5A6C5A
+EA0FE0121271912B>46 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fc cmsl10 10.95 25
+/Fc 25 122 df<D901F8160CD907FE161ED91F07163E90263E0380157E017C6D15FC496C
+6CEC03F8D801F06DEC07F00003D900FCEC1FE04901EFEC7FC00007913AE3E007EF804901
+E0B5129F000F913A701FF83F0093C7127E48485E604D5A03F01303003F4A495A90C74A5A
+4D5A4DC7FC0201143E4B5B17FC4C5A003E4948485A4C5A003F01075C6C4A485A020E131F
+021E49C8FC6C6C48137E02385B3A07C0F001F82603E1E05B3A00FF8003E090263E000714
+7E90C73A0FC001FF80923A1F8007C1C0923A3F000F80E0033E90381F00F04B013E137003
+FC4913784A4801FC13384A485B913807E001DA0FC05BDB8003141CEC1F004A495A147E5C
+4948163C4948010F14384A5C495A130F4948167849C71570137E017C17F0494B13E01201
+4848EDC0014848020714C04848EE03804848160790C83903E00F00003E170E007E923801
+F03C486F6C5A48EE3FE00070EE0F803F4975C34C>37 D<EA0780EA0FE0EA1FF0123FA512
+1FEA0F301200A213701360A213E013C0120113801203EA07001206120E5A5A5A5A5A0C1C
+7A8919>44 D<EC07F8EC3FFF9138FC0FC0903903F003E0903907C001F0D90F8013F849C7
+FC013E14FC017E147C017C147E13FC485AA20003157F5B1207A2120F5BA2121F16FF5BA2
+123FA44848EB01FEA648C7EA03FCA5ED07F8A25A16F0A2150F16E0A3ED1FC0A21680007E
+143F1600157E123E003F5C4A5AD81F805B000FEB07E06C6C485A2603F03FC7FC3800FFFC
+EB1FE0283F79BC2D>48 D<157015F014011407143F903803FFE0137FEBFFCFEBF80F1300
+141F15C0A5143F1580A5147F1500A55C5CA513015CA513035CA513075CA5130F5CA3131F
+497EB612F8A31D3D78BC2D>I<133C137F5B481380A31400A26C5A137890C7FCB3EA0780
+EA0FE0121F123FA5121FEA0F601200A213E05BA212015B120390C7FC5A1206120E5A5A12
+3012705A5A11397AA619>59 D<EC7FC0903803FFF890380FC07E90383E003F496D7E01FF
+6D7E82A248140782A26C5A137890C7120FA25EA2EC03FF147F903807FF1FEB1FE0D97F80
+5B3801FE00EA03F8485A4848133F485A003F5D49EC81C048C7FCA2157F48ED03804814FF
+A2007F5B913903BF0700903880073F3A3FC00E1F8E260FE03C13FC3A03FFF00FF83A007F
+C003E02A2A7CA82D>97 D<EB3F80EA1FFFA3C6FC137FA291C9FCA55B5BA512015BA4EC07
+F80003EB3FFF9039F8F80FC09039FBE003E09039FF8001F891C77E5B4848147E49147F5B
+821780A2120F5B17C0A3167F001F16805BA4EEFF00123F5B4B5AA24B5A5E007F4A5AA24B
+5A6D495A4BC7FCD87CE0137E39F87001F839F03C07E039E00FFF80260003FCC8FC2A4077
+BE33>I<EC1FF0ECFFFE903903F01F8090390FC003C0D93F0013E0017E130F49131F0001
+15F04848EB3FE0485AA24848EB1FC0001FEC0F004990C7FC123FA2485AA412FF90C9FCA9
+6CEC0380150716006C6C5B151E001F5C6C6C5B6C6C5B6C6C485A3901F80F8026007FFEC7
+FCEB0FF0242A7AA828>I<EE03F8ED01FFA3ED000F1607A217F0A4160FA217E0A4161FA2
+17C0A491380FF03FECFFFC902603F81F138090390FC007BF90391F8003FF90387E000149
+7F0001157F48481500485A120F5B001F5D485A5E5B127FA2150112FF90C75BA41503A25E
+A37E1507A26C4A5A7F001F141F6C6C133F6C6CEBFFF83B03F001EFFFC03900F80F8F9038
+3FFE0FD90FF0EBE0002D407ABE33>I<EC3FE0903801FFF8903807E07E90380F801F9039
+3F000F80017E14C049EB07E0485A12034848EB03F0485AA2121F5B123FA248481307A290
+B6FCA2D8FF80C8FC90C9FCA87EED01C015036C15806D1307001FEC0F006D131E000F5C6C
+6C5B6C6C485A3900FC07C0D93FFFC7FCEB07F8242A7BA828>I<ED07F0ED3FFCEDFC1E91
+3803F03F4A48B4FC4A481380141FEC3F81DA7F0113008102FE137C93C7FCA213015CA513
+035CA50007B512F8A3260007F0C8FCA3130F5CA5131F5CA5133F5CA5137F91C9FCA55B5B
+A4EA03FF007F13FEB5FCA229407DBF1C>I<147FEB3FFFA313017FA25CA513015CA51303
+5CA4ED07F80107EB1FFF9139F0781FC09138F1E00F9139F38007E0ECF70002FE14F0495A
+5CA25CA24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B491500
+A300015D486C491380B5D8F87F13FCA32E3F7DBE33>104 D<1478EB01FE130314FFA25B
+14FE130314FCEB00F01400ACEB03F8EA01FF14F0A2EA001F130FA314E0A5131F14C0A513
+3F1480A5137F1400A55B5BA4EA03FF007F13F0A2B5FC183E7DBD1A>I<143FEB1FFF5BA2
+13017FA214FEA5130114FCA5130314F8A5130714F0A5130F14E0A5131F14C0A5133F1480
+A5137F1400A55B5BA4EA03FF007F13F8A2B5FC183F7DBE1A>108
+D<902707F007F8EB03FCD803FFD91FFF90380FFF80913CE0781FC03C0FE09126E1E00FEB
+F0073E001FE38007E1C003F090260FE700EBE38002EEDAF70013F802FC14FE02D85C14F8
+4A5CA24A5C011F020F14074A4A14F0A5013F021F140F4A4A14E0A5017F023F141F91C749
+14C0A549027F143F4992C71380A300014B147F486C496DEBFFC0B5D8F87FD9FC3F13FEA3
+47287DA74C>I<903907F007F8D803FFEB1FFF9139E0781FC09138E1E00F3B001FE38007
+E090380FE70002EE14F014FC14D814F85CA24A130F131F4A14E0A4161F133F4A14C0A416
+3F137F91C71380A4167F5B491500A300015D486C491380B5D8F87F13FCA32E287DA733>
+I<EC0FF0ECFFFE903903F01F8090390FC007C049C66C7E013E6D7E01FC6D7E4848804914
+7C0003157E485A000F157F5B121FA2485AA2007F1680A2170048C85AA54B5AA25E5A6C4A
+5A7E4B5A5E6C140F6C6C5C4B5A6C6C013EC7FC6C6C5B6C6C485A3900FC0FE090383FFF80
+D90FF8C8FC292A7BA82D>I<91387F01FE903A7FFF0FFFC09139FE3E03F09238F801F890
+3A01FFE000FE4B137F6D497F4990C713804A15C04A141FA218E0A20103150F5C18F0A317
+1F010716E05CA3173F18C0130F4A147F1880A2EFFF004C5A011F5D16034C5A6E495AEE1F
+C06E495AD93FDC017EC7FC91388F01F8913883FFE0028090C8FC92C9FC137FA291CAFCA4
+5BA25BA31201487EB512F8A3343A81A733>I<903907F01F80D803FFEB7FE09138E1E1F0
+9138E387F839001FE707EB0FE614EE02FC13F002D813E09138F801804AC7FCA25C131FA2
+5CA4133F5CA5137F91C8FCA55B5BA31201487EB512FEA325287EA724>114
+D<9138FF81C0010713E390381F807F90397C003F8049131F4848130F5B00031407A24848
+1400A27FA27F6D90C7FCEBFF8014FC6C13FF6C14C015F06C6C7F011F7F13079038007FFE
+1403140100381300157EA2123C153E157E007C147CA2007E147815F8007F495A4A5A486C
+485A26F9E01FC7FC38E0FFFC38C01FE0222A7DA824>I<EB0380A4130791C7FCA25BA25B
+A2133EA2137E13FE12011207001FB512C0B6FCA2D801FCC7FCA312035BA512075BA5120F
+5BA41407001F130E13C0A4141E141C1380A26D5AA2000F5B14F03807E1E03801FF80D800
+7EC7FC1A3978B723>I<01FE147F00FFEC7FFF4914FEA20007140300031401A34914FCA4
+150312074914F8A41507120F4914F0A4150F121F4914E0A2151FA3153F4914C0157F15FF
+EC01DF3A0FC003BFE09138073FFF3803F01E3801FFF826003FE01380282977A733>I<B5
+39E007FFF05D17E02707FE000313006C48EB01FC6F5A5E00014A5A5EA24B5A6D13070000
+92C7FC5D150E6D5B7F5DA25D1480013F5B14815D14C3011F5B02C7C8FCA214CE14EEEB0F
+FCA25CA26D5A5CA25CA26D5A2C2878A630>I<B500C3B53803FFFCA204FE14F8290FFE00
+3FE00013C0D807F86D48EB7F000003173E183C150F18386D5E0001141F705B153F4D5A15
+776D4B5A0000ECE7F04DC7FCEC01C3170E9038FF0383017F5D91380703F85FEC0E01021E
+5CD93F9C14F002BC6D5A02B813FDDAF8005B4A13FF5F6D5A94C8FC5C4A137E167C6DC7FC
+1678010E14383E2878A642>I<90B539E007FFF05E18E0902707FE000313006D48EB01FC
+705A5F01014A5A5F16036E5C0100140794C7FC160E805E805E1678ED8070023F13F05EED
+81C015C191381FC38015C793C8FC15EF15EEEC0FFCA25DA26E5AA25DA26E5A5DA24AC9FC
+5C140E141E141C5C121C003F5B5A485B495A130300FE5B4848CAFCEA701EEA783CEA3FF0
+EA0FC0343A80A630>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fd cmtt12 14.4 10
+/Fd 10 123 df<EC3FF80103B57E010F14E0013F14F84914FE48B7FC4816C048D9C01F7F
+270FFE00017F49EB007FD81FF0EC1FF848486E7E160748486E7E4914018300FF81A26D16
+80177FA36C5AA26CC9FCCAFCA217FF1800A25E5F16035F16075F160F4C5A163F4C5A5F4C
+5A4B90C7FCED07FE4B5A4B5A4B5A4B5A4B5A4A5B4A90C8FCEC0FFE4A5AEC3FF04A5A4A5A
+495B4990C9FCEB0FFC495A495A495A4948143F485B4890C8EA7F80EA0FFC485A48B8FC5A
+B9FCA36C17007E314A7AC93E>50 D<383FFF805AB57EA37E7EEA003FAEED07FC92383FFF
+8092B512E002C314F802CF8002DF8091B7FCDBF80F1380DBC00113C092C713E04A143F4A
+EC1FF04A15F84A140F4AEC07FCA217034A15FE1701A318FF83A95F18FEA280170318FC6E
+140718F86E140FEF1FF06E143F6EEC7FE06EECFFC0DBC0031380EDF01F92B6120002DF14
+FC02CF5C02C35CD91F8114C090260F807F90C7FC90C7EA0FF8384A7FC83E>98
+D<923803FFF85D4B7FA38181ED0003AEEC1FF0ECFFFE0103EBFF83010F14E34914F3017F
+14FB90B7FC48EBF80F48EBC00191C7FC4848143F4848141F5B4848140F491407123F4914
+03127F5BA312FF90C8FCA97F127FA216077F123F6D140FA26C6C141F6D143F000F157F6C
+6C14FF01FF5B6C6D5A6CD9F01FEBFFFC6C90B500FB13FE6D02F313FF6D14E3010F14C36D
+020113FE010101FC14FC9026003FE0C8FC384A7CC83E>100 D<143E147F4A7E497FA56D
+5B6EC8FC143E91C9FCAC003FB57E5A81A47EC7123FB3B3007FB71280B812C0A56C16802A
+4A76C93E>105 D<007FB512C0B6FC81A47EC7121FB3B3B3A5007FB712F8B812FCA56C16
+F82E4978C83E>108 D<EC1FF0ECFFFE01036D7E010F14E04980017F14FC90B67E489038
+F01FFFECC00748D90001138048486D13C04848EC7FE049143F4848EC1FF049140F003F16
+F8491407A24848EC03FCA448C8EA01FEAA6D1403007F16FCA26D1407A2003F16F86D140F
+6C6CEC1FF0A26C6CEC3FE06D147F6C6CECFFC06D5B6CD9C00713806CD9F01F13006C90B5
+5A6D5C6D5C010F14E001031480010049C7FCEC1FF02F3679B43E>111
+D<ED07FC3B3FFF803FFF804891B512E0B500C314F802CF8002DF806C90B7FC6CDAF80F13
+80D8003FD9C00113C092C713E04A143F4AEC1FF04A15F84A140F4AEC07FCA217034A15FE
+1701A318FF83A95F18FEA280170318FC6E140718F86E140FEF1FF06E143F6EEC7FE06EEC
+FFC0DBC0031380EDF01F92B6120002DF14FC02CF5C02C35C02C114C0DAC07F90C7FCED0F
+F892C9FCB3003FB512C04880B67EA36C5C6C5C384F7FB33E>I<903901FFF00F011F9038
+FE1F8090B612BF000315FF5A5A5A393FFE003F01F01307D87FC0130190C8FC5A48157FA4
+7EEE3F00D87FC091C7FC13F0EA3FFE381FFFF06CEBFFC06C14FE6C6E7EC615E0013F14F8
+010780D9003F7F02007F03071380030013C0003EED3FE0007F151F48150F17F06D1407A3
+7FA26D140F6D15E0161F01FCEC3FC06D14FF9026FFC00F138091B612005E485D013F5C6D
+14E0D8FC0714802778007FF8C7FC2C3677B43E>115 D<147C14FC497EAD003FB712FC5A
+B87EA36C5EA2260001FEC9FCB3A6173FA2EF7F80A76E14FF6D16006F5A9238C007FE9138
+7FF01F92B55A6E5C6E5C6E5C6E1480020149C7FC9138003FF031437DC13E>I<000FB812
+804817C04817E0A418C001C0C712014C13804C1300EE1FFE4C5AEE7FF06C484A5A4B5BC8
+485B4B90C7FC4B5A4B5A4B5A4B5A4B5A4A5B4A5B4A90C8FC4A5A4A5A4A5A4A5A4A5A495B
+495B4990C9FC495A495A4948EC0FC0495A4948EC1FE0485B00075B4890C8FCEA1FFC485A
+485A90B8FCB9FCA46C17C07E33337CB23E>122 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fe cmtt12 13.14 31
+/Fe 31 123 df<ECFFE0010713FC011FEBFF80017F14E048B67E48814815FE489038007F
+FF01F8130748480101138048489038007FC049EC3FE04848141F90C8120F17F048150717
+F87F1603A36CC8FC123EC9FCA2160717F0A2160F17E0161F17C0163FEE7F80A2EEFF004B
+5A15034B5A4B5A4B5AED7FE04B5A4A5B4A90C7FC4A5AEC1FF84A5A4A5A4A5A495BD907FE
+C8FC495A495A495A495A2601FF80EB01F04890C7EA03F8485A485A485A48B7FC5AB8FCA3
+7E6C16F02D447BC338>50 D<003FB6FC4815E0B712F882826C816C16802701FC000113C0
+9238007FE0161FEE0FF0A2160717F81603A6160717F0A2160FEE1FE0163FEE7FC0923801
+FF80030F130090B65A5E16F08216FEEEFF8017C001FCC7EA7FE0EE1FF0EE07F8160317FC
+EE01FE1600A217FF177FA717FF17FE16011603EE07FC160FEE3FF8EEFFF0003FB7FC4816
+E0B812C01780EEFE006C15F86C15C030437DC238>66 D<DA07FC133C91393FFF807E91B5
+12E00103ECF8FE4914FC4914FF5B90383FFE0390387FF000D9FFC0133F4849131F91C712
+0F48481407485A49140348481401A2485AA248481400A25BA2007F167C90CAFCA35A5AAD
+7E7EA37F003F167C17FE7FA26C7EA26C6C140117FC6C7E6D14036C6C15F86C6C14076EEB
+0FF06C6D131FD97FF0EB7FE0903A3FFE03FFC06DB612806D15006D5C6D5C010014F0023F
+13C0DA07FCC7FC2F457CC338>I<007FB512F8B7FC16C08216F8826C813A03F8001FFF15
+07030113806F13C0167FEE3FE0161FEE0FF0A2EE07F8A2EE03FCA21601A217FE1600A417
+7FAD17FF17FEA4160117FCA2160317F81607A2EE0FF0161FEE3FE0167FEEFFC04B13805D
+031F1300007FB65AB75A5E5E16C093C7FC6C14F830437DC238>I<007FB712FCB87EA57E
+D801FCC8FCA9177C94C7FCA6ED07C04B7EA590B6FCA79038FC000FA56F5A92C9FCA7EF0F
+80EF1FC0AA007FB8FCB9FCA56C178032437DC238>I<91391FF003C091397FFC07E049B5
+FC010714CF4914EF4914FF5B90387FF81F9038FFE00748EB800191C7FC4848147F485A49
+143F485A161F485AA249140F123F5BA2127F90C8EA07C093C7FCA35A5AAA923807FFFC4B
+13FE4B13FF7E7E6F13FE6F13FC9238000FE07F003F151FA27F121F7F163F6C7EA26C6C14
+7F7F6C6C14FF6C6C5B6E5A6C6D5A90387FF81F6DB6FC6D14EF6D14CF6D148F0101140F90
+3A007FFC07C0DA1FF0C7FC30457CC338>71 D<007FB612F0B712F8A56C15F0260001FCC7
+FCB3B3B1007FB612F0B712F8A56C15F0254377C238>73 D<90380FFFFE90B612E0000315
+F8488148814881A2273FFE000F138001F01301497F49147F4848EC3FC0A290C8121FA448
+16E0A248150FB3AC6C151FA36C16C0A36D143FA36C6CEC7F806D14FF6D5B01FE130F6CB7
+1200A26C5D6C5D6C5DC615E0010F49C7FC2B457AC338>79 D<003FB512F04814FEB77E16
+E0826C816C813A01FC003FFEED07FF03017F81707E163F161F83160FA7161F5F163F167F
+4C5A5D030790C7FCED3FFE90B65A5E5E5EA282829038FC001FED07FC6F7E150115008282
+AA18E0EF01F0EF03F8A31783EE3F87263FFFE0ECC7F0486D14FFB56C7F18E07013C06C49
+6D13806C496D1300CA12FC35447EC238>82 D<003FB8FC481780B9FCA53BFE0007F0003F
+A9007CEE1F00C792C7FCB3B3A70107B512F04980A56D5C31437DC238>84
+D<267FFFF090387FFFF0B56C90B512F8A56C496D13F0D801FCC73801FC00B3B3A66D1403
+00005EA36D14076D5D6E130F6D6C495A6E133F6D6C495A6D6C495AECFF076D90B5C7FC6D
+5C6D5C6D5C023F13E0020F1380DA03FEC8FC35447FC238>I<D83FFE913803FFE0486C4A
+13F0B56C4913F8A36C90C76C13F06C486E13E0D80FC09138001F80A36C6CED3F00A86C6C
+157EA86C6C5DEC01FC4A7EA24A7EA4D800FC9038DF01F8020F1381A3158F021F13C1A201
+7C5DA2017E14C31507023F13E3A490263E3E035BA2027E13F3A2EC7C01013F14F7A3011F
+5DEC7800A202F813FFA34A137F010F5DA24A133F6D486DC7FC35447FC238>87
+D<001FB712F04816F85AA417F090C8121F17E0EE3FC0167F1780EEFF00A24B5A4B5A123E
+C8485A4B5AA24B5A4B5AA24B5A4BC7FCA24A5A14035D4A5A140F5D4A5A143F5D4A5A14FF
+92C8FC495A13035C495AA2495A495AA2495A495A17F849C7EA01FC485AA2485A485AA248
+5A121F5B485A127F90B7FCB8FCA56C16F82E437BC238>90 D<003FB712804816C0B812E0
+A46C16C06C16802B087A7D38>95 D<EB1FFF90B512E0000314F84814FE4880824881D9F0
+017F9138003FF0ED0FF815076C486D7E6C481301C87FA21500A4EC03FF147F0107B5FC13
+1F90B6FC5A000714C048EBE0004890C7FCEA3FF813E0EA7F8090C8FC5A5AA415017E6C6C
+13036D13076C6CEB3FFFD9FC01B6FC6CB812807E6C816C4A7E6CECF80F6C6CD9C0031300
+D90FFCC9FC31327AB038>97 D<EA3FFE487EB5FCA37E7EC67EACED3FC0913801FFF80207
+13FE021F7F4A804A8091B67E03C07F9139FE001FF802F86D7E4A13034A6D7E5C707E4A80
+188091C8123FA318C0171FA9173F6E1580A2177FA26EECFF00A26E495A6E13034C5A6E49
+5A02FE133F6E6CB45A92B55A6E5C6E5C6E91C7FC6D6C13FCD91E0313F090C7EA7F803244
+7FC238>I<EC3FFF49B512E0010714F8011F8049805B90B7FC48EBE001481300485AEA0F
+F8496D5A4848147C93C7FC485A5B127F90CAFCA35A5AA97E7EA27F123F6D141F6DEC3F80
+121F6C7E01FC147F6C6CECFF006C6C6C5A6C9038F00FFE91B55A6C6C5C6D5C6D5C010714
+80010149C7FC9038003FF0293278B038>I<ED1FFF4B7F5DA38181ED003FACEC7F809038
+03FFF0010F13FC013F13FF4914BF90B7FC5A48EBC07F48EB000FD80FFC7F497F48487F49
+7F485A167F485A163F90C8FCA25A5AA97E6C157FA36D14FF123F6D5B6C7E5D6C6C5B01FC
+5B6C6C133F2603FFC0B6FC6C90B712806C03BF13C06D143F6D13FC6D01F814800107D9E0
+1F1300010090C9FC32447CC238>I<EC3FE0903801FFFC010713FF011F14C04980498090
+B67E489038E03FFC4890380007FE48481301D80FF86D7E49804848158049143F003F16C0
+49141F127F90C8FC17E0160F5A90B7FCA617C048CAFC7E7EA27FA26C7EEE07C06C6CEC0F
+E07F6C7ED807FE141F6DEC3FC06C01C013FF6CD9FC0713806C90B612006D5C6D5C010F5C
+010314E001001480DA1FFCC7FC2B327AB038>I<ED1FF8ED7FFE4AB5FC020714804A14C0
+5C5C91387FF07F15809139FF003F804AEB1F00010191C7FC5CA9003FB612FE4881B8FCA4
+6C5D260001FCC8FCB3AF003FB612E04881A56C5D2A447CC338>I<14F0497E497E497EA4
+6D5A6D5A6D5A91C8FCAB383FFFFC487FB5FCA37E7EC7FCB3AF007FB612F0B712F816FCA3
+16F86C15F0264476C338>105 D<387FFFFEB6FCA57EC77EB3B3B1007FB7FCB81280A56C
+1600294379C238>108 D<023FEB07E03B3FE0FFC01FF8D87FF39038E07FFCD8FFF76D48
+7E90B500F97F15FB6C91B612806C01C1EBF83F00030100EBE01F4902C013C0A24990387F
+800FA2491400A349137EB3A73C3FFF03FFE07FFC4801879038F0FFFEB500C76D13FFA36C
+01874913FE6C01039038E07FFC383080AF38>I<ED7FC03A3FFE01FFF8267FFF0713FEB5
+001F7F4A805C6C90B67E6CECC07F3B007FFE001FE002F8130F4A805C16075C5CA391C7FC
+B3A6273FFFFE03B512E0486D4814F0B6008F14F8A36C020714F06C496C14E035307FAF38
+>I<EC7FC0903803FFF8010F13FE497F017F14C090B67E4881489038C07FF8489038001F
+FC01FC130748486D7E49130148486D7E4980003F168049143F007F16C090C8121FA300FE
+ED0FE0A96C151FA26C16C0A26D143FA26C6CEC7F80A26C6CECFF006D5B6C6C495A6D1307
+6CB4EB1FFC6C9038C07FF86C90B55A6C5D6D5C6D5C010F49C7FC010313F89038007FC02B
+327AB038>I<ED3FC03A3FFE01FFF8267FFF0713FEB5001F7F4A804A806C90B67E6C02C0
+7F3B007FFE001FF802F86D7E4A13034A6D7E5C707E4A80188091C8123FA318C0171FA917
+3F6E1580A2177FA26EECFF00A26E495A6E13034C5A6E495A02FE133F6E6CB45A92B55A6E
+5C6E5C6E91C7FC6E13FC020313F09138007F8092C9FCB0383FFFFE487FB67EA36C91C9FC
+6C5B32487FAF38>I<EEFFC0277FFFC00713F8B5D8E01F13FC037F13FE92B5FC02E114FF
+14E36C01E713813A000FEFFC019139FFF000FE4B137C0380130092C8FCA25C5CA25CA25C
+A45CB2007FB67EB77E82A35E6C5D30307CAF38>114 D<903907FF80F0017FEBF1F848B5
+12FD000714FF5A5A5AEBFC00D87FE0131F0180130F48C71207481403A5007FEC01F001C0
+90C7FCEA3FF013FE381FFFF86CEBFFC0000314F8C614FF013F1480010714E0D9003F13F0
+020013F8ED0FFC1503003CEC01FE007E140000FE15FF167F7EA37F6D14FF16FE01F01303
+6DEB07FC01FF137F91B512F816F016E04815C0D8FC3F1400010F13FCD8780113E0283278
+B038>I<EB01E0497E1307AB003FB712804816C0B8FCA46C1680260007F0C8FCB3A4EE03
+E0EE07F0A66E130F17E06D6C131F6EEB3FC0903901FF81FF92B512806D15006E5B6E5B6E
+13F002075B020190C7FC2C3D7DBB38>I<D83FFE903803FFE0486C497FB55BA36C806C80
+C66CEB0007B3A9160FA2161F163F6E137F6D6C13FFDAF007EBFFE091B712F06D16F87F6D
+14E76D02C713F00100020313E0DA3FF8C8FC35307FAE38>I<000FB712FC4816FE5AA417
+FC0180C7EA1FF8EE3FF0EE7FE0EEFFC04B13804B13006CC7485AC8485A4B5A4B5A4B5A4B
+5A4A5B4A90C7FCEC07FC4A5A4A5A4A5A4A5A49485A4990C8FC495A495A495A495A494814
+7C494814FE485B4890C8FC485A485A485A485A48B7FCB8FCA56C16FC2F2F7DAE38>122
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ff cmbx12 13.14 53
+/Ff 53 122 df<923807FFE092B512FC020714FF021F81027F9038007FC0902601FFF0EB
+0FE04901C0497E4990C7487ED90FFC147F011F824A14FF495AA2137F5CA2715A715A715A
+EF078094C8FCA7EF07FCB9FCA526007FF0C7123F171FB3B3A2003FB5D8E00FB512F8A53D
+4D7ECC44>12 D<B7FCAA200A7F9D29>45 D<EA07E0EA1FF8EA3FFCEA7FFEA2B5FCA6EA7F
+FEA2EA3FFCEA1FF8EA07E01010778F22>I<177817F8EE01FCA21603A2EE07F8A217F016
+0FA217E0161FA2EE3FC0A21780167FA217005EA24B5AA25E1503A24B5AA25E150FA25E15
+1FA24B5AA25E157FA24BC7FCA25D1401A25D1403A24A5AA25D140FA24A5AA25D143FA25D
+147FA24AC8FCA25C1301A25C1303A2495AA25C130FA2495AA25C133FA25C137FA249C9FC
+A25B1201A2485AA25B1207A25B120FA2485AA25B123FA25B127FA248CAFCA25AA2127CA2
+2E6D79D13D>I<15F014011407141F147FEB03FF137FB6FCA313FC1380C7FCB3B3B2007F
+B712E0A52B4777C63D>49 D<ECFFF80107EBFF80013F14F090B612FC4881480101EBFF80
+2707F8003F13C0D80FE0010F13E0D81F806D13F0003F80D87FF06D13F86D15FC6D7F00FF
+16FE6D147FA217FF82A36C5A6C5A6C5A6C5AC95A17FEA3EEFFFCA24B13F817F05D17E04B
+13C017804B13004B5A4B5A5EED7FE04B5A4A5B4A90C7FCEC07FC4A5A4A5A4B131FEC3F80
+4AC7FC14FE4948143E495AEB07E0495A4948147E49C8FC017E15FE90B7FC4816FC5A5A5A
+5A5A5AB8FC17F8A430477AC63D>I<EC3FFE0103B512E0010F14FC013F14FF90267FE01F
+7F9026FF000713E0D801FC6D7FD803F07F486C6D7FD80FFE817F486D80167FA3805C16FF
+7E91C75B6C5A6C5AD80020495B90C75C5D5F4B5B5F031F90C7FCED3FFC4AB45A49B512E0
+168016E016FC90C7EA3FFF030713C06F7F6F7F6F7F83707E83A2701380A318C0EA07E0EA
+1FF8487E487EA2B5FCA31880A25E491600127F494A5A6C485D01E05B001F4A5BD80FFC49
+5B2707FFC03F13C06C90B65AC64BC7FC013F14F8010714E09026007FFEC8FC32487BC63D
+>I<EE07E0160FA2161F163F167F16FFA25D5D5DA25D5D5DA2157D15FDEC01F915F1EC03
+E11407EC0FC1EC1F811501143F147E14FC14F8EB01F01303EB07E014C0EB0F80131FEB3F
+00133E5B13FC485A485A5B1207485A485A90C7FC123E127E5AB912FCA5C80003EBE000AD
+023FB612FCA536487DC73D>I<D8038015E001E0140301FC143F9039FFE003FF91B612C0
+17801700A25E5E16F05E5E93C7FC15FC15F001E790C8FC01E0C9FCAAEC1FFC01E1B512C0
+01E714F001EF14FC9039FFE01FFFDA0007138001FC6D13C001F06D13E04915F0497F17F8
+C913FC167F17FEA417FFA3EA0FC0EA3FF0487EA2487EA317FEA34914FF6C4815FC5B0180
+15F86CC74813F07F6C6C4913E0D80FF04913C0D807FC011F13806CB46CB512006C90B512
+FC6C5D013F14C0010F91C7FC010113F030487AC63D>I<ED7FF8913807FFFE021F6D7E02
+7F80903A01FFF01FE0010790388003F04948486C7E49486D7ED93FF013074948130F01FF
+4A7E4849133F5C5A4890C7FCA25A705A48486E5A705A003F92C8FCA3485AA21520913807
+FFE0021F13FC00FF497F4A6D7EDAFC017F9026FDF0007F4A6D7ED9FFC06D7E4A6D7E8391
+C7FC8382491680A318C05BA3127FA6123FA27F001F1780A3000F4B1300A26C6C5DA26C6D
+495A6C6D5C6C6D495A6D6C48485A90263FFC075B6DB65A6D4AC7FC01035C010014F0020F
+90C8FC32487BC63D>I<121F7F7F13FE90B812E0A45A18C0188018005F5FA25F485E90C8
+EA07E0007E4B5A5F007C151F4CC7FC167E5E485D15014B5A4B5AC8485A4B5AA24BC8FC15
+7EA25D1401A24A5A1407A24A5AA2141FA24A5AA2147FA314FFA3495BA45BA55BAA6D5BA2
+6D90C9FCEB007C334B79C93D>I<EC1FFF49B512F0010714FC011F14FF90263FF00713C0
+49C77F01FCEC3FF04848EC0FF848481407000782491403000F821601A2121F7FA27F13FE
+6D140302C05C14F002FC495A6C6D130FDAFF805B9238E01FE06C6E485A9238FCFF806C91
+B5C7FC6C15FC6C5D7F6D14FE6D806D15C06D81011F81017F81D9FFDF804813072603FE01
+8048486C804848133F4848010F1480003F8049130148486D6C13C0161F824848140382A2
+82A2177FA218807F127FEFFF007F6C6C4A5AA2D81FFC4A5A6C6CEC0FF86C6C6CEB3FF06C
+9039F003FFE06C90B612806C6C92C7FC011F14FC010714E09026003FFEC8FC32487BC63D
+>I<EC1FFE49B512C0010F14F04914FC90397FFC0FFE903AFFE003FF804849C67F48496D
+7E4890C7FC486F7E484881161F003F825B007F82A28300FF81A31880A518C0A45E127FA3
+003F5D7F121F5E120F6C6C91B5FC6C90388001EF6CEBC0036C9038E00FCF6DB5128F011F
+140F010701FE1480010113F8903800010091C7FCA24C1300A3D803F85D487E487E486C4A
+5AA25F4C5AA24C5A49495B6C485D49010790C7FC01E0495AD807F8EB3FFC6CB448B45A6C
+90B55A6C15C06D91C8FC011F13FC010313C032487BC63D>I<EE01F8A24C7EA34C7EA24C
+7EA34C7FA24C7FA34C7FA293B57EA34B8016F303038016E316E103078016C0030F805E83
+031F814C7E4B81153E83037E81037C7F03FC815D830201824B7F0203825D830207824B7F
+020F825D84021F8392B8FC4A83A34A83027CC8120F02FC835C840101844A810103845C84
+0107844A81010F845C85011F85496C82B600C091B712F0A5544D7CCC5D>65
+D<93261FFF80EB01C00307B500F81303033F02FE13074AB7EAC00F0207EEE03F021F903A
+FE007FF87F027F01E0903807FCFF91B5C70001B5FC010301FC6E7E4901F0151F4901C081
+4949814990C97E494882494882485B48197F4A173F5A4A171F5A5C48190FA2485B1A07A2
+5AA297C7FC91CDFCA2B5FCAD7EA280A2F207C07EA36C7FA26C190F6E18807E6E171F6C1A
+006E5F6C193E6C6D177E6D6C5F6D6C4C5A6D6D15036D6D4B5A6D01F04B5A6D01FCED3FC0
+010001FFEDFF806E01E0D903FEC7FC021F01FEEB3FFC020790B612F002015EDA003F92C8
+FC030714FCDB001F13804A4D79CB59>67 D<B912F0F0FF8019F019FC19FFD8001F902680
+000114C0DD001F7F060713F806017F726C7E737E737F737F737F8587737F8587A2747EA3
+8786A21C80A51CC0A586A462A51C80A51C00A26263A2631AFF636163614F5B634F5B073F
+90C7FC4F5A4F5A06035B061F5B4DB512C0BBC8FC19FC19F0198006F0C9FC524B7CCA5E>
+I<BB12C0A486D8000F01E0C77E18071801F0007F193F191F190F1907861903A31901A3EF
+0F80A2737EA497C7FC171FA2173F177F17FF160392B6FCA5EDE0031600177F173F171FA2
+050FEC0F80A3F21F00A494C8FC621A3EA21A7EA31AFE6219011903A21907190FF13FF819
+FF1803183FBBFCA262A3494A7CC951>I<BBFCA41A80D8001F01C0C7FC181F1803848419
+7F193F191F1AC0190FA31907A4171FF103E0A496C7FCA25FA25F5F5E160792B6FCA5EDC0
+071601828383A283A794C9FCB1B8FCA5434A7CC94D>I<93261FFF80EB01C00307B500F8
+1303033F02FE13074AB7EAC00F0207EEE03F021F903AFE007FF87F027F01E0903807FCFF
+91B5C70001B5FC010301FC6E7E4901F0151F4901C0814949814990C97E49488249488248
+5B48197F4A173F5A4A171F5A5C48190FA2485B1A07A25AA297C8FC91CEFCA2B5FCAD6C04
+0FB712C0A280A36C93C7001FEBC000A2807EA27E807E807E806C7F7E6D7E6D7E6D7F6D01
+E05D6D6D5D6D13FC010001FF4AB5FC6E01E0EB07F9021F01FFEB3FF0020791B5EAE07F02
+01EEC01FDA003FED0007030702F81301DB001F018090C8FC524D79CB61>I<B7D8FC01B7
+12F8A5D8001F01C0C8001FEBC000B3AA92B9FCA503C0C8121FB3AEB7D8FC01B712F8A555
+4B7BCA60>I<B712FEA5D8000FEBE000B3B3B3ABB712FEA5274B7DCA2E>I<B8FCA5D8001F
+01C0C9FCB3B3A4193EA4197E197CA519FCA31801A2F003F8A21807180F181F183F187FEF
+01FF1707173FBA12F0A53F4B7BCA4A>76 D<B600E04DB612806F5FA26F5FA2D8001F09FC
+C7FC6FEF0F7FA2DABFFE171EA2DA9FFF173CA3028F6D1678A202876D16F0A202836DED01
+E0A302816DED03C0A202806DED0780A26F6CED0F00A36F6C151EA26F6C5DA26F6D5CA26F
+6D5CA36F6D495AA26F6D495AA26F6D495AA3706C49C7FCA2706C131EA2706C5BA3706D5A
+A2706D5AA270EBE1E0A370EBF3C0A270EBFF80A27190C8FCA2715AA3715AA2715A497EB6
+00F06D480103B71280A3715A715A694B7BCA74>I<B600E092B612F88181A281D8001F6D
+9239001FE0006F705A82A28202BF7F029F7FA2028F7F02877F02837F8214810280806F7F
+6F7F83816F7F6F7F6F7F83816F80707F707F8482707F707F707FA2707F7014807113C019
+E0837113F07113F87113FC19FE837113FF71148F7213CF1AEF847213FF8484A284848485
+A2858585A285858585497EB600F8167F1A3F1A1F1A0FA2554B7BCA60>I<EEFFF8031FEB
+FFC04AB612FC020715FF021FD9C01F13C091277FFE000313F0902601FFF09038007FFC49
+496E7E490180EC0FFF4990C86C7F49486F7F49486F7F017F8449486F7F4849707EA24849
+707E4885A24849701380A2481AC04A82A2481AE0A34890CA6C13F0A5B519F8AE6C1AF0A2
+6E5EA36C1AE0A26E5E6C1AC0A26C1A806E5E6C1A006E5E6C616E16FF6C616C6D4B5B6D6C
+4B5B6E5D6D6D4A5B6D6D4A5B01076D4A90C7FC6D01F8ECFFFE6D01FE01035B9028007FFF
+C01F13F0021F90B612C0020793C8FC020115FCDA001F14C0030101FCC9FC4D4D79CB5C>
+I<B912C018FCF0FF8019F085D8001F902680000713FE05007F063F1380060F13C07213E0
+1AF0841AF8A27213FCA31AFEA81AFCA34E13F8A21AF0601AE04E13C0063F138095B51200
+050713FC92B75A19E096C7FC18F803C0CAFCB3ABB712FCA5474B7BCA54>I<B9FC18F8F0
+FF8019E019F8D8000F9026C0000713FE9439007FFF80061F7F727F727F727F84868684A2
+86A862A24E5BA2624E5B4E5B4E5B4E5B95B5C8FC050713FC92B712F0198006FCC9FC18FF
+9226C0003F13C0050713F0717F717F717F187F85727FA28486A786A71C3E86A28474137E
+72157C726D13FCB700FC6D9038FE01F872EBFF8373EBFFF0071F14E007031480CD383FFE
+00574C7CCA5C>82 D<DA7FFCEB01C00103B5EAC003011FECF00749ECFC0F90B7121F48D9
+E00F13BF4890C713FFD807FC141F4848804848140382484880177F485A173F171F12FFA2
+170F7FA217077F7F7F6D92C7FC6D7E6C13F014FF15F86CECFF8016F86C15FF6C16C0836C
+826C826C826C82013F816D1680010716C01300020F15E01400030714F0ED007F160F1603
+7013F882177F127800F8163FA3171FA27E18F0A27EA26CEE3FE07F18C001E0157F6DEDFF
+8001FC160001FF140302E0EB0FFED97FFEEB3FFC486CB612F0D8FC0F5DD8F803158048C6
+6C49C7FC48010313F0354D79CB44>I<003FBB12C0A5DA80019038FC001FD9FC001601D8
+7FF09438007FE001C0183F49181F90C7170FA2007E1907A3007C1903A500FC1AF0481901
+A5C894C7FCB3B3A749B812FCA54C4A7CC955>I<B700F8023FB512F8A5D8001F01C0C938
+0FE000745AB3B3AD6D180F63811A1F6D96C7FC626D7F1A7E6D7F6D606E6C4B5A6E6CED07
+F06E6C4B5A6E01C0EC3FC06E01F049B45A020101FF011F90C8FC6E91B55A033F15F80307
+15E0030092C9FC040713F0554C7CCA5E>I<B700F00203B6FCA5D8001F01E0C93803FC00
+745A6D61811A036D6D5F1A076D6D5F1A0F6D616F161FA26D6D94C7FC626E6D153E1A7E6E
+177C7015FC6E5F8219016E6D5D19036E5F7014076E5F82190F6E6D5D191F6E6D92C8FC61
+6F153E83197E6F6D137C19FC6F6D5B18016F5DEFF003A26F01F85B18076F01FC5B180F6F
+5DEFFE1F6F92C9FC17FF607013BE18FE705BA2705BA3705BA2705BA2705BA3705BA27090
+CAFCA2177EA2584C7ECA5D>I<B700F84AB6FCA5D8001F01F0C93803FC006F705A6D4E5A
+6D6D4C5A816D4E5A6D6D4C5A826D4EC7FC6E6D5D70157E6E5F6E7F704A5A6E4C5A6E7F70
+4A5A6E4C5A6E7F71495A6E4CC8FC6F7F71137E6F5D6F7F71485A6F4A5A6F13FC71485A6F
+4A5A6F13FFF09F806F02BFC9FC7013FF60705B8260705B8260B3A7037FB612FEA5584B7E
+CA5D>89 D<ECFFFC010FEBFFC0017F14F090B612FC489038803FFE3B03FC0007FF80486C
+6D7F6D7F486D6C7F83167F83A2707E6C90C7FC6C5A6C5AC9FCA5ED1FFF021FB5FC49B6FC
+130F013FEBC03F9038FFFE00000313F04813C04890C7FC485A485AA2485AA2485AA4167F
+A26D14FF007F15EF6D01017F6C6C903907CFFF806C6CD90F8F13FE6C9038E07F076C9038
+FFFE0300014A7ED8003F9038F0007F0103018090C7FC37347CB23C>97
+D<EB7FC0B5FCA512037EB3ED07FF037F13E002C1B512FC02C714FF9126CFF80F7F9126DF
+C0017F02FFC77F4AEC3FF002F8814A6E7E717E4A81831980A37113C0A319E0AC19C0A35F
+1980A219005F606E141F6E5D4D5A6E4A5A02BF4A5A91261FC0035B9027FE0FF01F5B496C
+B548C7FCD9F80114F8496C6C13E0C8D80FFEC8FC3B4D7CCB44>I<91380FFF8091B512F8
+010314FF010F15804948C613C0D97FF8EB1FE0D9FFE0EB3FF04849137F4849EBFFF84890
+C7FCA2485A121FA24848EC7FF0EE3FE0EE1FC0007F92C7FC5BA212FFAC127FA27FA2123F
+A26C6C153EA26C6C157E177C6C6D14FC6C6D14F86C6D13036C6DEB07F0D97FFCEB1FE06D
+B4EBFFC0010F90B5120001035C010014F0020F13802F347CB237>I<EF1FF0EE3FFFA516
+00177FB3EC0FFF91B512E0010314F8010F14FC013FEB01FF903A7FF8003FFFD9FFE0130F
+48497F48497F4890C77E48815B121F5B123FA2127F5BA312FFAC127FA36C7EA3121F6D5C
+120F6C6C5C6C6D5B6C5D6C01E0013F7F6D6C49EBFFE090393FFE03FE6DB512F801075C01
+00148091261FFC00EBC0003B4D7CCB44>I<EC0FFF91B512F0010314FC010F14FF90263F
+FE077F90267FF0007F49486D7E4801806D7E486F7E4890C7120F484881707E121F491403
+003F82A2127F5B701380A212FFA390B8FCA401F8CAFCA5127FA27FA2123FA26C6CED0F80
+A26C6C151F6C17006E5C6C6D147E6C6D5C6C6D495AD93FFCEB07F0903A1FFF803FE00107
+90B55A010192C7FC6D6C13FC020713C031347DB238>I<ED7FF0913807FFFC023F7F4A7F
+902601FFE0138049018113C049484813E0EB0FFCEB1FF8A2EB3FF0A2017F6D13C04A6C13
+80EE7F00163E93C7FCACB77EA526007FF0C8FCB3B3A3003FB512F8A52B4D7DCC26>I<DA
+7FFCEB0FE00103B538807FF8010F9138E1FFFC013F02FB13FE903A7FF01FFFF39026FFC0
+07138348D90001130348168348486DEBC1FCEFC0F8000FEEE00049147F001F82A9000F5E
+6D14FF00075EA26C6C495B6C93C7FC6C9038C007FE9138F01FFC4890B55A01EF14E0D803
+C314809026C07FFCC8FC000790CAFCA47FA27F13FC90B612FCEEFFC06C16F817FE6C8218
+806C17C06D16E00003B812F0120FD81FFCC7000F13F8D83FF0140049153F4848ED1FFC00
+FF160F491507A56D150F007F17F86D151F6C6CED3FF06C6CED7FE0D80FFE913801FFC06C
+6C6C010713806C01F8017F1300C690B612FC013F15F001071580D9003F01F0C7FC37497D
+B13D>I<EB7FC0B5FCA512037EB3923801FFC0030F13F8033F7F4B13FFDBFE077F9138C1
+F0039126C3E0017FDAC78080ECCF0014DE02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFF
+E0A53B4C7BCB44>I<13FCEA03FF487F487FA2487FA66C5BA26C5B6C90C7FCEA00FC90C8
+FCABEB7FC0B5FCA512037EB3B3A2B61280A5194D7BCC22>I<EB7FC0B5FCA512037EB3B3
+B3AAB61280A5194C7BCB22>108 D<90287FC001FFC0EC7FF0B5010F01FC0103B5FC033F
+6D010F804B6D4980DBFE079026803F817F9126C1F801903AC07E007FF00003D9C3E0DAE0
+F8806C9026C78000D9F1E06D7E02CFC7EBF3C002DEEDF780DD7FFF6E7E02FC93C7FC4A5D
+A24A5DA34A5DB3AAB6D8C03FB5D8F00FB512FCA55E327BB167>I<903A7FC001FFC0B501
+0F13F8033F7F4B13FFDBFE077F9138C1F00300039026C3E0017F6CD9C78080ECCF0014DE
+02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFFE0A53B327BB144>I<913807FF80027F13
+F80103B6FC010F15C090261FFE017F903A7FF0003FF849486D7E480180EB07FE4890C76C
+7E4817804980000F17C048486E13E0A2003F17F0A249157F007F17F8A400FF17FCAB007F
+17F8A46C6CEDFFF0A2001F17E0A26C6C4A13C0A26C6C4A13806C6D4913006C5E6C01E0EB
+1FFC6D6C495A903A3FFE01FFF0010FB612C0010392C7FCD9007F13F80207138036347DB2
+3D>I<90397FC007FFB5017F13E002C1B512FC02C714FF9126CFF80F7F9126DFC0037F00
+0301FFC77F6C496E7E02F8814A6E7E717E4A81831980A28319C0A37113E0AC19C05FA319
+805F19005F606E143F6E5D4D5A6E4A5A02FF495BDBC0075B9126EFF01F5B02E7B548C7FC
+02E114F8DAE07F13E0DB0FFEC8FC92CAFCAFB612C0A53B477CB144>I<9039FF803FE0B5
+EBFFF8028113FE02837FDA87E11380EC8F830003D99F0713C06C139E14BCA214F8A24A6C
+13806F13006F5A4A90C7FCA45CB3A8B612E0A52A327CB132>114
+D<903907FF8070017FEBF1F048B6FC1207380FFC01391FE0003F4848130F491307127F90
+C71203A2481401A27FA27F01F090C7FC13FCEBFFC06C13FEECFFE06C14FC6C806CECFF80
+6C15C06C15E06C15F06C7E011F14F8010114FCEB000FEC007FED1FFE0078140F00F81407
+15037E1501A27E16FC7E15036D14F86D13076D14F001F8EB1FE001FFEBFFC04890B51280
+486C1400D8F81F13FCD8E00313C027347CB230>I<14F8A51301A41303A21307A2130FA2
+131F133F137F13FF1203000F90B512F0B7FCA426007FF8C7FCB3A7167CAA013F14F880A2
+90391FFE01F0010F1303903907FF87E06DEBFFC06D14806D6C1300EC0FFC26467EC430>
+I<D97FE0EC3FF0B5EC7FFFA5000315016C81B3AC5EA25EA25E7E6EEB0F7F017F021E7F6E
+017CEBFFE090393FFE01F86DB512F0010714E0010114C09027003FFE00EBC0003B337BB1
+44>I<B600C090387FFFF0A5C601F0C73803F8006E5D017F5E801707013F5E6E140F011F
+5E6E141F6D93C7FC6F5B6D153E81177E6D157C6F13FC6D5DEDF0016D5DEDF803027F5CA2
+EDFC07023F5CEDFE0F021F5CEDFF1F6E91C8FC169F16BF6E13BE16FE6E5BA26E5BA26E5B
+A36F5AA26F5AA26F5AA23C327EB041>I<B60081B500FC90387FFFF0A500019026E00003
+90C73801FC006E6F5C6C6F5E6E6F1303017F61A26E6F1307013F4A5E846E49150F011F61
+6E6F131F6D4A93C7FC179F03806E5B6D021F153EEF0FFE6DD9C03F5DEE3E0703E06E13FC
+6D027E5DEE7C0303F015816D4A6C5C03F815C3DA7FF95E4C7E03FD15E7DA3FFF5E4C137F
+19FF6E496D5BA26E94C8FC4C7FA26E5E93C7120FA26E486E5AA202015E4B1403A26E486E
+5A54327EB059>I<007FB500C090387FFFE0A5C601F0C73803F8006E5D017F5E6E140701
+3F5E80170F011F5E6E141F6D93C7FC6F5B6D153E6F137E6D157C6F13FCA26D6D5B16016D
+5DEDF803027F5CEDFC07023F5CEDFE0F021F5C15FF161F6E91C8FC16BF6E13BE16FE6E5B
+A26E5BA36E5BA26F5AA26F5AA26F5AA393C9FC5D153E157E157CD81F8013FC486C5B387F
+E001D8FFF05B14035D14074A5A49485A007F133F4948CAFC383F81FE381FFFF86C5B6C13
+C0C648CBFC3B477EB041>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fg cmtt12 17.28 6
+/Fg 6 123 df<913803FFC0023F13FC49B67E010715F04981013F15FE498190B812C048
+8348D9FC0180489026E0001F7F480180130391C87F48486F7E49153F4848ED0FFF834848
+178083496F13C012FF8319E07FA2187FA36C5A6C5A6C5ACBFCA218FFA219C05FA219805F
+A24D13005F604D5A173F4D5A4D5AA24C5B4C5B4C5B041F90C7FC4C5A4C5A4C5A4B5B4B5B
+4B5B031F5B4B90C8FC4B5AEDFFF84A5B4A5B4A5B021F5B4A90C9FCEC7FFC4A5A495B495B
+010F5B495B4948CAFC4948ED1F804948ED3FC04849ED7FE0485B000F5B4890C9FC4890B8
+FC5ABAFCA56C18C06C18803B5A79D94A>50 D<383FFFF0487F80B5FCA37EA27EEA000FB0
+EE0FFC93B57E030714E0031F14F84B14FE92B7FC02FD8291B87E85DCE01F7FEE000703FC
+01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A21AE0A219
+7FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A6F130303
+FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0902607F80714C0902603
+F00191C8FC90C8EA3FF043597FD74A>98 D<EC01F0EC07FC4A7EA24A7EA56E5AA26E5AEC
+01F091CAFCAE001FB512FC4880815AA37EA27EC71203B3B3A8003FB812C04817E0A2B912
+F0A36C17E0A26C17C0345974D84A>105 D<003FB512FE4880B77EA57E7EC71201B3B3B3
+B0003FB812FC4817FEBAFCA56C17FE6C17FC385877D74A>108 D<EE0FFC263FFFF090B5
+7E48D9F80714E0DAFC1F14F8B54914FE92B7FC02FD826C90B87E856CDBE01F7FD8000FEC
+000703FC01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A2
+1AE0A2197FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A
+6F130303FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0030714C00301
+91C8FC9238003FF093CAFCB3A4003FB6FC4881A2B77EA36C5DA26C92CAFC435F7FBE4A>
+112 D<000FB912E04818F04818F8A619F001F0C8000313E04D13C04D13804D13004D5A4D
+5A4D5A6C484A5B6C484A5BC9000F5B4C5B4C90C7FC4C5A4C5A4B5B4B5B4B5B4B5B4B5B4B
+90C8FC4B5A4B5A4A5B4A5B4A5B4A5B4A5B4A90C9FC4A5A4A5A495B495B495B4949EC07E0
+4949EC0FF04948C8EA1FF8495A495A485B485B485B485B4890C9FC485A48B9FCBAFCA66C
+18F06C18E03D3E7BBD4A>122 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fh cmbx12 17.28 28
+/Fh 28 120 df<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007
+C7FCB3B3B3B3007FB91280A6395E74DD51>49 D<913801FFF8021FEBFFC091B612F80103
+15FF010F16C0013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F8
+6E148048486E14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380
+A219FFA283A36C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D
+13E0A294B512C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B
+13804B90C8FC4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC
+7F8092C9FC02FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A
+5A5A5A5ABAFCA219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F001
+0FD9C01F13FC90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0
+486D826E806E82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A61
+4C91C7FC604C5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F8
+17FF91C7003F13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A3
+1AC0EA03FCEA0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485B
+D81FF85F000F5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90
+B65A011F16F0010716C001014BC8FCD9001F14F0020149C9FC426079DD51>I<F01F804E
+7E187F18FFA25F5F5F5FA25F5F5FA294B5FC5E5E5EA25E5EEE3FBFEE7F3FA216FEED01FC
+ED03F8ED07F0A2ED0FE0ED1FC0ED3F8016005D15FE4A5A4A5AA24A5A4A5A4A5A4A5AA24A
+C7FC14FE495A5C1303495A495A495A5C133F49C8FC13FE485AA2485A485A485A5B121F48
+5A48C9FC12FEBCFCA6CA6CEBC000B1037FB8FCA6485E7CDD51>I<4DB5ED03C0057F02F0
+14070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F033F9127F8007FFE
+13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A91C9001FB5FC023F01FC
+16074A01F08291B54882490280824991CB7E49498449498449498449865D49498490B5FC
+484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C7FCA25CA3B5FCB07E
+A380A27EA2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E1A00A26C6E616D1BFE6D
+7F6F4E5A7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A6E6DEFFF806E01FC4C90
+C7FC020F01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF913803FFE0033F02F8013F
+1380030F91B648C8FC030117F86F6C16E004071680DC007F02F8C9FC050191CAFC626677
+E375>67 D<B96C90B91280A6D8000102C0C9000102C0C7FCB3B3A293BBFCA604C0C91201
+B3B3A6B96C90B91280A671627AE17E>72 D<B912E0A6C702E0C7FCB3B3B3B3AEB912E0A6
+33627CE13C>I<B700C0083FB612F070627097B7FCA37061D800010DF8C7FC70F103EFA2
+02FD6DF107CFA202FC6DF10F8FA36F6DF01F0FA26F6D183EA26F6D187CA26F6D18F8A36F
+6DEF01F0A26F6DEF03E0A26F6DEF07C0A26F6DEF0F80A3706DEE1F00A2706D163EA2706D
+5EA2706D5EA3706D4B5AA2706D4B5AA2706D4B5AA2706D4B5AA3716D4AC7FCA2716D143E
+A2716D5CA2716D5CA3716D495AA2716D495AA2716D495AA2716D495AA3726D48C8FCA272
+EBC03EA2726D5AA2726D5AA372EBF9F0A272EBFFE0A2725CA2725CA37390C9FCA2735AA2
+735A90381FFFC0B700F86E480207B812F0A3735AA2735A8C627AE199>77
+D<BB7E1AFCF2FFC01BF81BFE757ED800010280C7001F80070114F0736C7F081F7F747F74
+7F7414807414C0A27414E0A21DF0A27513F8A41DFCA91DF8A498B512F0A21DE0A25014C0
+1D8062501400505B505B087F5B4FB512E0071F5C93B9C7FC1BFC1BF01B8008F0C8FC04C0
+CCFCB3B3A2B97EA65E627AE16E>80 D<001FBEFCA64849C79126E0000F148002E0180091
+C8171F498601F81A0349864986A2491B7FA2491B3F007F1DC090C9181FA4007E1C0FA600
+FE1DE0481C07A5CA95C7FCB3B3B3A3021FBAFCA663617AE070>84
+D<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE001F7FD97FE001077F
+D9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7FA26C5B6D5AEB1FC090
+C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE004913F048B512C04891
+C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D7F6EEB01F96C6DD903
+F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E6C6C4B7E011F02FC13
+0F010302F001011400D9001F90CBFC49437CC14E>97 D<903807FF80B6FCA6C6FC7F7FB3
+A8EFFFF8040FEBFF80047F14F00381B612FC038715FF038F010014C0DBBFF0011F7FDBFF
+C001077F93C76C7F4B02007F03F8824B6F7E4B6F13804B17C0851BE0A27313F0A21BF8A3
+7313FCA41BFEAE1BFCA44F13F8A31BF0A24F13E0A24F13C06F17804F1300816F4B5A6F4A
+5B4AB402075B4A6C6C495B9126F83FE0013F13C09127F00FFC03B55A4A6CB648C7FCDAC0
+0115F84A6C15E091C7001F91C8FC90C8000313E04F657BE35A>I<92380FFFF04AB67E02
+0F15F0023F15FC91B77E01039039FE001FFF4901F8010113804901E0010713C049018049
+13E0017F90C7FC49484A13F0A2485B485B5A5C5A7113E0485B7113C048701380943800FE
+0095C7FC485BA4B5FCAE7EA280A27EA2806C18FCA26C6D150119F87E6C6D15036EED07F0
+6C18E06C6D150F6D6DEC1FC06D01E0EC7F806D6DECFF00010701FCEB03FE6D9039FFC03F
+FC010091B512F0023F5D020F1580020102FCC7FCDA000F13C03E437BC148>I<F17FF805
+0FB5FCA6EF000F8484B3A892380FFF804AB512F8020F14FE023FECFF8391B712E3010391
+38807FF3499039F8000FFB011F01E00103B5FC494913004990C87E49488148498148834A
+815A485BA2485BA25AA3485BA4B5FCAE7EA46C7FA37EA26C7FA26C5F806C5F6C6D5D6C6D
+5D017F93B5FC6D6C6C0103806D6D49806D01F0D91FF7EBFFFE6D9039FE01FFE7010190B6
+12876D6CECFE07021F14F8020314E09127003FFE00ECC0004F657BE35A>I<92380FFFC0
+4AB512FC020FECFF80023F15E091B712F80103D9FE037F499039F0007FFF011F01C0011F
+7F49496D7F4990C76C7F49486E7F48498048844A804884485B727E5A5C48717EA35A5C72
+1380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27EA27E6E160FF11F806C183F6C7FF1
+7F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E04A5A6D6DEC3FE0010301FC49B45A
+6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0020092C8FC030713F041437CC14A
+>I<EE3FFC0307B51280033F14C04AB612F0020715F84A9038F03FFC4AEB807F913A7FFE
+00FFFE4A5A4B4813FF4913F05B4913E0A24913C0A27013FE4949EB7FFCEF3FF8EF1FF0EF
+07C094C7FCB0B812C0A6D8001F01C0C8FCB3B3B0007FB612FCA638657CE431>I<F107F8
+DB7FFEEC3FFE020FB5D8F001B5FC027FDAFE03148049B7128F49DCDFFD13C0010FD9F00F
+EBFFC149D9800114014990C7EBFC0349486E6C7E4948EC3FFF48496E0181138007801300
+48F0C03E97C7FC48496E7FA34884A96C60A36C6D4A5BA26C60A26C6D4A90C8FC6D6C4A5A
+6D6C4A5A6D6D485BDBF00F5B4990B612C060D97C7F4AC9FCD9FC0F14F09126007FFECAFC
+92CCFC1201A47FA27F8014F091B77E18FE6CEFFFC019F06D17FC19FF6D846D846D846D84
+013F8490BAFC0003854801E0C712014890C9000F7F484816014848EE007F4848717E8512
+FF5B85A56D5F007F616D173F003F616D177F6C6C4D5A6C01C003035B6C6D4B5B6C01F803
+1F5BC601FF92B5C7FC6D01F8011F5B011F90B712F8010717E0010094C8FC020F15F0DA00
+3F01FCC9FC4A607CC151>I<903807FF80B6FCA6C6FC7F7FB3A8EF1FFF94B512F0040714
+FC041F14FF4C8193267FE07F7F922781FE001F7FDB83F86D7FDB87F07FDB8FC0814C7F03
+9FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F007B71280A651647BE35A>I<EB
+0FE0EB3FF8497E48B5FCA24880A24880A76C5CA26C91C7FCA238007FFC6D5AEB0FE090C9
+FCAF903807FF80007FB5FCA6C6FC7F7FB3B3AEB712C0A622657BE42C>I<903807FF80B6
+FCA6C6FC7F7FB3B3B3B3ADB712E0A623647BE32C>108 D<902607FF80D91FFFEEFFF8B6
+91B500F00207EBFF80040702FC023F14E0041F02FF91B612F84C6F488193267FE07F6D48
+01037F922781FE001F9027E00FF0007FC6DA83F86D9026F01FC06D7F6DD987F06D4A487F
+6DD98FC0DBF87EC7804C6D027C80039FC76E488203BEEEFDF003BC6E4A8003FC04FF834B
+5FA24B5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB612FCA67E417BC087>I<902607
+FF80EB1FFFB691B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FC6DA83
+F86D7F6DD987F07F6DD98FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2
+B7D8F007B71280A651417BC05A>I<923807FFE092B6FC020715E0021F15F8027F15FE49
+4848C66C6C7E010701F0010F13E04901C001037F49496D7F4990C87F49486F7E49486F7E
+48496F13804819C04A814819E048496F13F0A24819F8A348496F13FCA34819FEA4B518FF
+AD6C19FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19E06C6D4B13C0A26C6D4B13806C
+6D4B13006D6C4B5A6D6D495B6D6D495B010701F0010F13E06D01FE017F5B010090B7C7FC
+023F15FC020715E0020092C8FC030713E048437CC151>I<D90FFFEB0FFCB690383FFF80
+93B512E04B14F04B14F8923907FC7FFC92390FE0FFFEC6EC1F806DD93F0113FF6D133E15
+7E157C15F8A215F07013FEA24BEB7FFCEF3FF8EF0FE04B90C7FCA55DB3B0B712F8A63841
+7BC042>114 D<913A3FFF8007800107B5EAF81F011FECFE7F017F91B5FC48B8FC48EBE0
+014890C7121FD80FFC1407D81FF0801600485A007F167F49153FA212FF171FA27F7F7F6D
+92C7FC13FF14E014FF6C14F8EDFFC06C15FC16FF6C16C06C16F06C826C826C826C82013F
+1680010F16C01303D9007F15E0020315F0EC001F1500041F13F81607007C150100FC8117
+7F6C163FA2171F7EA26D16F0A27F173F6D16E06D157F6D16C001FEEDFF806D0203130002
+C0EB0FFE02FCEB7FFC01DFB65A010F5DD8FE0315C026F8007F49C7FC48010F13E035437B
+C140>I<EC07E0A6140FA5141FA3143FA2147FA214FF5BA25B5B5B5B137F48B5FC000F91
+B512FEB8FCA5D8001F01E0C8FCB3AFEF0FC0AC171F6D6D1480A2173F6D16006F5B6D6D13
+7E6D6D5B6DEBFF836EEBFFF86E5C020F14C002035C9126003FFCC7FC325C7DDA3F>I<90
+2607FFC0ED3FFEB60207B5FCA6C6EE00076D826D82B3B3A260A360A2607F60183E6D6D14
+7E4E7F6D6D4948806D6DD907F0ECFF806D01FFEB3FE06D91B55A6E1500021F5C020314F8
+DA003F018002F0C7FC51427BC05A>I<B70081B600FC0103B512FCA6C66C0180C701FCC8
+381FFE006F6FED03F86D047F5F856F6E16076D646F70140F6D705F866F6E161F6D646F4A
+6D143F6D99C7FC4E7F6F616D1B7E6F4A6D14FE6D6395B57E7001FC15016E62DCC0016E13
+036EDBF87F5D05038004E0496C14076E62DCF007ED800F6E4B6C5D050F15C004F8496C14
+1F6E62DCFC1FEDE03F6E4B6C92C8FC053F15F004FE496C5C6E197E7048EDF8FE6E027E6D
+5C05FE15FC4D6D13FD6F601BFF6F496E5BA24D806F60A26F496E5BA24D806F60A26F496E
+90C9FCA294C87E6F5FA26F486F5A047C6F5A6E417DBF75>119 D
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fi cmsy10 10.95 1
+/Fi 1 16 df<EB0FFCEB3FFF90B512C0000314F04880488048804880A2481580A3B712C0
+AA6C1580A36C1500A26C5C6C5C6C5C6C5CC614C0013F90C7FCEB0FFC22227BA72D>15
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fj cmtt10 10.95 89
+/Fj 89 127 df<121C127FEAFF80B3EA7F00B2123EC7FCA8121C127FA2EAFF80A3EA7F00
+A2121C09396DB830>33 D<00101304007C131F00FEEB3F80A26C137FA248133FB2007E14
+00007C7F003C131E00101304191C75B830>I<903907C007C0A2496C487EA8011F131FA2
+02C05BA3007FB7FCA2B81280A36C16006C5D3A007F807F80A2020090C7FCA9495BA2003F
+90B512FE4881B81280A36C1600A22701FC01FCC7FCA300031303A201F85BA76C486C5AA2
+29387DB730>I<EB07E0EB1FF8497E137F497E803801FC7F497E810003131F13F0A6143F
+92C8FC91387F0FFF9026F87E1F1380000113FEEBF9FC13FB4A6C1300D9FFF013C06C13E0
+151F02C05BEB7F809038FF003F4892C7FC485C48EB807E5A15FE391FDFC0FC383F8FE014
+E1397F07F1F8EB03F300FEEBFBF0EB01FF5D7FEDC006027F130F91393F801F8015C06C13
+7F6CEBFFE049EBF83F018701FC1300263FFFFBB5FC6C01F15B14E06C9038C03FFC000390
+38001FF8D801FCEB07E0293A7DB830>38 D<EA07C0EA0FF0EA1FF8A213FCA213FE120F12
+07EA007EA513FE13FCA2120113F81203EA07F0120FEA1FE0127FEAFFC013801300127C12
+380F1D70B730>I<141E147F14FF5BEB03FEEB07FCEB0FF0EB1FE0EB3FC0EB7F80EBFF00
+485A5B12035B485A120F5BA2485AA2123F5BA2127F90C7FCA412FEAD127FA47F123FA27F
+121FA26C7EA27F12076C7E7F12017F6C7EEB7F80EB3FC0EB1FE0EB0FF0EB07FCEB03FEEB
+01FF7F147F141E184771BE30>I<127812FE7E7F6C7E6C7EEA0FF06C7E6C7E6C7E6C7EEB
+7F80133F14C0131FEB0FE014F01307A2EB03F8A214FC1301A214FE1300A4147FAD14FEA4
+130114FCA2130314F8A2EB07F0A2130F14E0EB1FC0133F1480137FEBFF00485A485A485A
+485AEA3FE0485A485A90C7FC5A1278184778BE30>I<14E0497E497EA60038EC0380007E
+EC0FC0D8FF83EB3FE001C3137F9038F3F9FF267FFBFB13C06CB61280000FECFE00000314
+F86C5C6C6C13C0011F90C7FC017F13C048B512F04880000F14FE003FECFF80267FFBFB13
+C026FFF3F913E09038C3F87F0183133FD87E03EB0FC00038EC0380000091C7FCA66D5A6D
+5A23277AAE30>I<143EA2147FAF007FB7FCA2B81280A36C1600A2C76CC8FCAF143EA229
+297DAF30>I<EA03E0EA0FF0EA1FF813FCEA3FFEA213FFA27EA27E1203EA007FA2137E13
+FEEA01FC1203EA07F8EA3FF0127FEAFFE0EA7F801300123C1019708B30>I<007FB612F0
+A2B712F8A36C15F0A225077B9E30>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0
+EA0F000C0C6E8B30>I<16F01501ED03F8A21507A2ED0FF0A2ED1FE0A2ED3FC0A2ED7F80
+A2EDFF00A24A5AA25D1403A24A5AA24A5AA24A5AA24A5AA24A5AA24AC7FCA2495AA25C13
+03A2495AA2495AA2495AA2495AA2495AA249C8FCA2485AA25B1203A2485AA2485AA2485A
+A2485AA2485AA248C9FCA25AA2127CA225477BBE30>I<14FE903807FFC0497F013F13F8
+497F90B57E48EB83FF4848C6138049137F4848EB3FC04848EB1FE049130F001F15F04913
+07A24848EB03F8A290C712014815FCA400FEEC00FEAD6C14016C15FCA36D1303003F15F8
+A26D1307001F15F0A26D130F6C6CEB1FE0A26C6CEB3FC06C6CEB7F806D13FF2601FF8313
+006CEBFFFE6D5B6D5B010F13E06D5BD900FEC7FC273A7CB830>I<EB03C0497EA2130FA2
+131FA2133F137F13FF1203123FB5FCA213EF138FEA7E0F1200B3B0003FB512F84814FCB6
+12FEA26C14FC6C14F81F3977B830>I<EB07FC90383FFFC090B512F00003804814FE4880
+261FF80F1380263FE00113C09038C0007F4848EB3FE090C7121FED0FF04814075A6C15F8
+1503A3127E1218C8FCA2150716F0150F16E0151F16C0153FED7F8015FF4A13005DEC07FC
+4A5A4A5A4A5A4A5A4A5A4990C7FC495A495AEB0FF0EB3FE0495A495A4890C8FC4848EB01
+F04848EB03F8485AEA1FE048B6FCB7FCA37E6C15F025397BB830>I<EB03FF013F13E090
+B512F84814FE4880481580260FFE0113C09038F0007F4848EB1FE0150F16F01507A26C5A
+6C5AC8FC150F16E0A2151FED3FC0157FEDFF8002071300903807FFFE495B5D8115FF6D14
+80D9000113C09138003FE0ED1FF0ED07F8150316FC150116FE1500A21218127EB4FCA215
+0116FC4814036C15F86C6C13076DEB1FF0D83FF0133F3A1FFE01FFE06CB612C06C15806C
+ECFE00C65C013F13F001031380273A7CB830>I<EC03FC4A7E140F141FA2143F147F157E
+14FEA2EB01FCEB03F8A2EB07F0A2EB0FE0EB1FC0A2EB3F80A2EB7F0013FEA2485A485AA2
+485AA2485A485AA2485AA248C7FC12FEB8FC1780A46C1600C8007EC7FCAA91387FFFFE91
+B6FCA46E5B29397DB830>I<000FB612804815C05AA316800180C8FCAEEB83FF019F13C0
+90B512F015FC8181D9FE0313809039F0007FC049133F0180EB1FE06CC7120F000E15F0C8
+1207A216F81503A31218127EA2B4FC150716F048140F6C15E06C141F6DEB3FC06D137F3A
+3FE001FF80261FFC0F13006CB55A6C5C6C5C6C14E06C6C1380D90FFCC7FC25397BB730>
+I<EC0FF8EC7FFF49B51280010714E0131F4914F090387FF80F9039FFC007F84813803803
+FE005B485A4848EB03F0ED01E0484890C7FC5B123F5BA2127FEB000C903803FFE0010F13
+F8D8FF3F13FE48B6FCB7128016C09039FE007FE001F8EB1FF001E0130F49EB07F8ED03FC
+5B90C7120116FE1500A37EA46C7E15016D14FC121F6D1303000FEC07F86D130F6C6CEB1F
+F06DEB3FE03A03FF81FFC06C90B512806C15006D5B011F13F8010713E001011380273A7C
+B830>I<127CB712FC16FEA416FC48C7EA0FF816F0ED1FE0007CEC3FC0C8EA7F80EDFF00
+A24A5A4A5A5D14075D140F5D4A5AA24A5AA24AC7FCA25C5C13015CA213035CA213075CA4
+495AA6131F5CA96D5A6DC8FC273A7CB830>I<49B4FC011F13F0017F13FC90B57E0003EC
+FF804815C048010113E03A1FF8003FF049131FD83FC0EB07F8A24848EB03FC90C71201A5
+6D1303003F15F86D13076C6CEB0FF06C6CEB1FE0D807FCEB7FC03A03FF83FF806C90B512
+006C6C13FC011F13F0497F90B512FE48802607FE0013C0D80FF8EB3FE0D81FE0EB0FF048
+48EB07F8491303007F15FC90C712014815FE481400A66C14016C15FC6D1303003F15F86D
+1307D81FF0EB1FF06D133F3A0FFF01FFE06C90B512C06C1580C6ECFE006D5B011F13F001
+0190C7FC273A7CB830>I<49B4FC010F13E0013F13F890B57E4880488048010113803A0F
+FC007FC0D81FF0EB3FE04848131F49EB0FF048481307A290C7EA03F85A4815FC1501A416
+FEA37E7E6D130315076C7E6C6C130F6D133FD80FFC13FF6CB6FC7E6C14FE6C14F9013FEB
+E1FC010F138190380060011400ED03F8A2150716F0150F000F15E0486C131F486CEB3FC0
+157FEDFF804A1300EC07FE391FF01FFC90B55A6C5C6C5C6C1480C649C7FCEB3FF0273A7C
+B830>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F00C7FCAF120FEA3FC0EA
+7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C276EA630>I<EA03C0EA0FF0EA1FF8A2EA3F
+FCA4EA1FF8A2EA0FF0EA03C0C7FCAFEA03C0EA0FF0121F13F8123F13FCA3121FA2120F12
+031200120113F8120313F01207EA1FE0123FEA7FC0EAFF80EA7F00127E12380E3470A630
+>I<16F01503ED07F8151F157FEDFFF014034A13C0021F138091383FFE00ECFFF8495B01
+0713C0495BD93FFEC7FC495A3801FFF0485B000F13804890C8FCEA7FFC5BEAFFE05B7FEA
+7FF87FEA1FFF6C7F000313E06C7F38007FFC6D7E90380FFF806D7F010113F06D7FEC3FFE
+91381FFF80020713C06E13F01400ED7FF8151F1507ED03F01500252F7BB230>I<007FB7
+FCA2B81280A36C16006C5DCBFCA7003FB612FE4881B81280A36C1600A229157DA530>I<
+1278127EB4FC13C07FEA7FF813FEEA1FFF6C13C000037F6C13F86C6C7EEB1FFF6D7F0103
+13E06D7F9038007FFC6E7E91380FFF806E13C0020113F080ED3FF8151F153FEDFFF05C02
+0713C04A138091383FFE004A5A903801FFF0495B010F13804990C7FCEB7FFC48485A4813
+E0000F5B4890C8FCEA7FFE13F8EAFFE05B90C9FC127E1278252F7BB230>I<EC1FE0ECFF
+F8010313FE010F7F4914804914C090397FF03FE09038FF800F4890380007F0D803FC1303
+3A07F801FBF89038F007FF380FE01F4A13FCEA1FC0495A003FEBFF0F903800FE07903901
+FC03FE007FEBF801EA7E03ECF000A2EAFE0700FC49137EAA00FE6D13FED87E0314FCA2EC
+F801D87F0114F8003FEBFC03903900FE07F0903880FF0F001F90387FFFE06D6C13C0EA0F
+E06E13803A07F007FE009038F801F86C6CC7127C6CB414FE6CEB800390387FF01F6DB512
+FC6D14F86D14E0010314C00100EBFE00EC1FF0273A7CB830>64 D<147F4A7EA2497FA449
+7F14F7A401077F14E3A3010F7FA314C1A2011F7FA490383F80FEA590387F007FA4498049
+133F90B6FCA34881A39038FC001F00038149130FA4000781491307A2D87FFFEB7FFFB56C
+B51280A46C496C130029397DB830>I<007FB512F0B612FE6F7E82826C813A03F8001FF8
+15076F7E1501A26F7EA615015EA24B5A1507ED1FF0ED7FE090B65A5E4BC7FC6F7E16E082
+9039F8000FF8ED03FC6F7E1500167FA3EE3F80A6167F1700A25E4B5A1503ED1FFC007FB6
+FCB75A5E16C05E6C02FCC7FC29387EB730>I<91387F803C903903FFF03E49EBFC7E011F
+13FE49EBFFFE5B9038FFE07F48EB801F3903FE000F484813075B48481303A2484813015B
+123F491300A2127F90C8FC167C16005A5AAC7E7EA2167C6D14FE123FA27F121F6D13016C
+6C14FCA26C6CEB03F86D13076C6CEB0FF03901FF801F6C9038E07FE06DB512C06D14806D
+1400010713FC6D13F09038007FC0273A7CB830>I<003FB512E04814FCB67E6F7E6C816C
+813A03F8007FF0ED1FF8150F6F7E6F7E15016F7EA2EE7F80A2163F17C0161FA4EE0FE0AC
+161F17C0A3163F1780A2167F17005E4B5A15034B5A150F4B5AED7FF0003FB65A485DB75A
+93C7FC6C14FC6C14E02B387FB730>I<007FB7FCB81280A47ED803F8C7123FA8EE1F0093
+C7FCA4157C15FEA490B5FCA6EBF800A4157C92C8FCA5EE07C0EE0FE0A9007FB7FCB8FCA4
+6C16C02B387EB730>I<003FB712804816C0B8FCA27E7ED801FCC7121FA8EE0F8093C7FC
+A5153E157FA490B6FCA69038FC007FA4153E92C8FCAE383FFFF8487FB5FCA27E6C5B2A38
+7EB730>I<02FF13F00103EBC0F8010F13F1013F13FD4913FF90B6FC4813C1EC007F4848
+133F4848131F49130F485A491307121F5B123F491303A2127F90C7FC6F5A92C8FC5A5AA8
+92B5FC4A14805CA26C7F6C6D1400ED03F8A27F003F1407A27F121F6D130F120F7F6C6C13
+1FA2D803FE133F6C6C137FECC1FF6C90B5FC7F6D13FB010F13F30103EBC1F0010090C8FC
+293A7DB830>I<3B3FFF800FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E0D8
+03F8C7EAFE00B290B6FCA601F8C7FCB3A23B3FFF800FFFE0486D4813F0B56C4813F8A26C
+496C13F06C496C13E02D387FB730>I<007FB6FCB71280A46C1500260007F0C7FCB3B3A8
+007FB6FCB71280A46C1500213879B730>I<49B512F04914F85BA27F6D14F090C7EAFE00
+B3B3123C127EB4FCA24A5A1403EB8007397FF01FF86CB55A5D6C5C00075C000149C7FC38
+003FF025397AB730>I<D83FFF90380FFF80486D4813C0B56C5AA26C497E6C496C1380D8
+03F0903803F8004B5A4B5A151F4B5A5E4BC7FC15FE14014A5A5D4A5A4A5A141F5D4A5A4A
+C8FC5C13F18101F37F13F790B57E14EFECC7F01483EC03F8140101FE7F496C7E5B157F49
+7F82151F82150F826F7EA26F7E1501821500D83FFF903803FFC0486D4813E0B56C5AA26C
+497E6C496C13C02B387FB730>I<383FFFF8487FB57EA26C5B6C5BD801FCC9FCB3B0EE0F
+80EE1FC0A9003FB7FC5AB8FCA27E6C16802A387EB730>I<D83FF8ECFFE0486C4913F048
+6C4913F8A2007F16F06C6C4913E00007160001EF14BFEC800FA39039E7C01F3FA4ECE03F
+01E3133EA2ECF07EA201E1137CA2ECF8FCA201E013F8A214FDEC7DF0A3147FEC3FE0A3EC
+1FC0A2EC070091C7FCADD83FFC903801FFE0486C4913F0B54913F8A26C486D13F06C486D
+13E02D387FB730>I<D83FFC90381FFF80486C4913C0B54913E0A26C6D6C13C06C6E1380
+0003913801F800EBF7C0A3EBF3E0A314F013F1A214F8A213F014FCA2147C147EA2143E14
+3FA2141FA21581A2140F15C1A2140715E1A2140315F1A21401A215F91400A3157DA3153F
+EA3FFF481380B5EAC01FA26CEB800F6C496C5A2B387EB730>I<90383FFFE048B512FC00
+0714FF4815804815C04815E0EBF80001E0133FD87F80EB0FF0A290C71207A44815F84814
+03B3A96C1407A26C15F0A36D130FA26D131F6C6CEB3FE001F813FF90B6FC6C15C06C1580
+6C1500000114FCD8003F13E0253A7BB830>I<007FB512F0B612FE6F7E16E0826C813903
+F8003FED0FFCED03FE15016F7EA2821780163FA6167F17005EA24B5A1503ED0FFCED3FF8
+90B6FC5E5E16804BC7FC15F001F8C9FCB0387FFFC0B57EA46C5B29387EB730>I<90383F
+FFE048B512FC000714FF4815804815C04815E0EBF80001E0133F4848EB1FF049130F90C7
+1207A44815F8481403B3A8147E14FE6CEBFF076C15F0EC7F87A2EC3FC7018013CF9038C0
+1FFFD83FE014E0EBF80F90B6FC6C15C06C15806C1500000114FCD8003F7FEB00016E7EA2
+1680157F16C0153F16E0151F16F0150FED07E025467BB830>I<003FB57E4814F0B612FC
+15FF6C816C812603F8017F9138003FF0151F6F7E15071503821501A515035E1507150F4B
+5A153F4AB45A90B65A5E93C7FC5D8182D9F8007FED3FE0151F150F821507A817F8EEF1FC
+A53A3FFF8003FB4801C0EBFFF8B56C7E17F06C496C13E06C49EB7FC0C9EA1F002E397FB7
+30>I<90390FF803C0D97FFF13E048B512C74814F74814FF5A381FF80F383FE001497E48
+48137F90C7123F5A48141FA2150FA37EED07C06C91C7FC7F7FEA3FF0EA1FFEEBFFF06C13
+FF6C14E0000114F86C80011F13FF01031480D9003F13C014019138007FE0151FED0FF0A2
+ED07F8A2007C140312FEA56C140716F07F6DEB0FE06D131F01F8EB3FC001FF13FF91B512
+80160000FD5CD8FC7F13F8D8F81F5BD878011380253A7BB830>I<003FB712C04816E0B8
+FCA43AFE003F800FA8007CED07C0C791C7FCB3B1011FB5FC4980A46D91C7FC2B387EB730
+>I<3B7FFFC007FFFCB56C4813FEA46C496C13FCD803F8C7EA3F80B3B16D147F00011600
+A36C6C14FE6D13016D5CEC800390393FE00FF890391FF83FF06DB55A6D5C6D5C6D91C7FC
+9038007FFCEC1FF02F3980B730>I<D87FFE90380FFFC0B54913E06E5AA24A7E6C486D13
+C0D807F0903801FC00A26D130300035DA46C6C495AA46C6C495AA46D131F6D5CA3EC803F
+013F5CA46D6C48C7FCA490380FE0FEA401075B14F1A301035BA314FB01015BA314FFA26D
+5BA46E5A6E5A2B397EB730>I<D83FFC903801FFE0486C4913F000FF16F8A2007F16F06C
+486D13E0D81FC09038001FC0000F1680A76D143F00071600A7000390380F803E9039F01F
+C07EEC3FE0A3EC7FF0A2147D0001157CA29039F8FDF8FCA314F8A300005D01F913FCA2EC
+F07CA201FD137DA2017D5CECE03DA3017F133FA2ECC01FA2013F5CA2EC800F6D486C5A2D
+397FB730>I<3A3FFF01FFF84801837F02C77FA202835B6C01015B3A01FC007F806D91C7
+FC00005C6D5BEB7F01EC81FCEB3F8314C3011F5B14E7010F5B14FF6D5BA26D5BA26D5BA2
+6D90C8FCA4497FA2497FA2815B81EB0FE781EB1FC381EB3F8181EB7F0081497F49800001
+143F49800003141F49800007140FD87FFEEB7FFFB590B5128080A25C6C486D130029387D
+B730>I<D87FFF90381FFFC0B56C4813E0A46C496C13C0D803F8903803F8006D1307A26C
+6C495AA26C6C5C151F6D5CEC803F013F5CECC07F011F91C7FCA290380FE0FEA214F10107
+5BA2903803FBF8A201015B14FF6D5BA26E5AA36E5AB1903803FFF8497F497FA26D5B6D5B
+2B387EB730>I<001FB612FC4815FE5AA490C7EA03FCED07F816F0150FED1FE016C0153F
+ED7F80003E1500C85A4A5A5D14034A5A5D140F4A5A5D143F4A5A92C7FC5C495A5C130349
+5A5C130F495A5C133F495A91C8FC5B4848147C4914FE1203485A5B120F485A5B123F485A
+90B6FCB7FCA46C15FC27387CB730>I<007FB5FCB61280A4150048C8FCB3B3B3A5B6FC15
+80A46C140019476DBE30>I<007FB5FCB61280A47EC7123FB3B3B3A5007FB5FCB6FCA46C
+140019477DBE30>93 D<1307EB1FC0EB7FF0497E000313FE000FEBFF80003F14E0D87FFD
+13F039FFF07FF8EBC01FEB800F38FE0003007CEB01F00010EB00401D0E77B730>I<007F
+B612F0A2B712F8A36C15F0A225077B7D30>I<EB3FFC48B57E4814E04880488048809038
+F00FFE9038E001FF806F7E6C48133F6C4880C8121FA491B5FC130F137F48B6FC12075A48
+EBC01F383FFC00EA7FE0138048C7FC5AA46C143FA26C6C137F9038C001FF263FF80FEBFF
+C06CB712E0A2000714F76C14C3C6020013C0D93FF090C7FC2B2A7CA830>97
+D<EA3FFC487E12FFA2127F123F1200AAEC03FE91381FFF80027F13E091B57E90B612FC82
+ECFE079138F001FF4A6C13804A137F4AEB3FC091C7121F4915E0160FA217F01607A8160F
+A217E07F161F6EEB3FC0A26EEB7F806E13FFDAF00313009138FC0FFE91B55A5E495CD97E
+7F13C0D93C1F90C7FC90380003FC2C3980B730>I<ECFFE0010713FC011F7F017F7F90B6
+12804815C048EB807F3907FC003F485A485A49EB1F804848EB0F004990C7FC127F90C9FC
+A25A5AA87E7EA27F003FEC07C06DEB0FE06C7E6D131F6C6C14C0D807FE133F9039FFC0FF
+806C90B5FCC615006D5B011F13F801075B01011380232A7AA830>I<913801FFE04A7F5C
+A28080EC0007AAEB03FE90381FFF874913E790B6FC5A5A481303380FFC00D81FF0133F49
+131F485A150F4848130790C7FCA25AA25AA87E6C140FA27F003F141F6D133F6C7E6D137F
+390FF801FF2607FE07EBFFC06CB712E06C16F06C14F76D01C713E0011F010313C0D907FC
+C8FC2C397DB730>I<49B4FC010713E0011F13F8017F7F90B57E488048018113803A07FC
+007FC04848133FD81FE0EB1FE0150F484814F0491307127F90C7FCED03F85A5AB7FCA516
+F048C9FC7E7EA27F003FEC01F06DEB03F86C7E6C7E6D1307D807FEEB1FF03A03FFC07FE0
+6C90B5FC6C15C0013F14806DEBFE00010713F8010013C0252A7CA830>I<EDFF80020713
+E0021F13F05C4A13F891B5FC491387903803FE079138FC03F0903907F800C04A1300A800
+3FB612C04815E0B7FCA36C15C0260007F0C7FCB3A9003FB512FE4880B71280A26C15006C
+5C25397DB830>I<D903FC13FF90261FFF8713C04913DF90B712E05A5A2607FE07138F90
+3AF801FE07C048486C6CC7FCA2497F001F8149133FA56D137F000F92C7FC6D5BA26C6C48
+5AEBFE0790B55A5D485C15C001DF5BD9C3FCC8FC01C0C9FCA37F7F6CB512F015FF6C15C0
+4815F0488148813A3FE0001FFE0180130148C8127F007E8100FE168048151FA56C153F00
+7FED7F006D5C6C6C495A01F013076CB4EB7FFC6C90B55A6C5D000115C06C6C91C7FC011F
+13FC010113C02B3E7DA730>I<EA3FFC487E12FFA2127F123F1200AAEC01FE91380FFF80
+023F13E091B57E90B67EA29138FE07FCECF8039138E001FE14C0EC8000A291C7FCA25BB3
+A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F3880B730>I<
+14E0EB03F8A2497EA36D5AA2EB00E091C8FCA9381FFFF8487F5AA27E7EEA0001B3A9003F
+B612C04815E0B7FCA27E6C15C023397AB830>I<EC01C0EC07F0A2EC0FF8A3EC07F0A2EC
+01C091C7FCA990B512F04814F8A47EEB0003B3B3A5EC07F0A2123C007EEB0FE0B4131FEC
+3FC0147F90B512806C14005C6C5B000F13F0000313C01D4E7CB830>I<EA7FF8487EA412
+7F1200AB0203B512804A14C017E0A217C06E14809139001FE0004B5A4B5A4BC7FC4A5A4A
+5AEC0FF84A5A4A5A4A5A4A5A01FD7F90B57E8114F7ECE3F8ECC1FCEC81FEEC00FF497F49
+6D7E6F7E826F7E15076F7E6F7E3B7FFFF81FFFE0B56C4813F017F8A217F06C496C13E02D
+387FB730>I<387FFFF8B57EA47EEA0001B3B3A8007FB612F0B712F8A46C15F025387BB7
+30>I<02FC137E3B7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F138726
+07FE07EB03F801FC13FE9039F803FC01A201F013F8A301E013F0B3A23C7FFE0FFF07FF80
+B548018F13C0A46C486C01071380322881A730>I<EC01FE3A3FFC0FFF80267FFE3F13E0
+00FF90B57E90B67E7E6C9038FE07FCC6EBF8039138E001FE14C0EC8000A291C7FCA25BB3
+A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F2880A730>I<
+49B4FC010F13E0013F13F8497F90B57E0003ECFF8014013A07FC007FC04848EB3FE0D81F
+E0EB0FF0A24848EB07F8491303007F15FC90C71201A300FEEC00FEA86C14016C15FCA26D
+1303003F15F86D13076D130F6C6CEB1FF06C6CEB3FE06D137F3A07FF01FFC06C90B51280
+6C15006C6C13FC6D5B010F13E0010190C7FC272A7CA830>I<EC03FE3A3FFC1FFF80267F
+FE7F13E000FF90B57E90B612FC6C816CEBFE07C69038F001FF4A6C13804A137F4AEB3FC0
+91C7121F4915E0160FA217F01607A8160FA217E07F161F6EEB3FC0A26EEB7F806E13FFDA
+F00313009138FC0FFE91B55A5E495C6E13C0021F90C7FCEC03FC91C9FCAD383FFFF8487F
+B57EA26C5B6C5B2C3C80A730>I<49B413F8010FEBC1FC013F13F14913FD48B6FC5A4813
+81390FFC007F49131F4848130F491307485A491303127F90C7FC15015A5AA77E7E15037F
+A26C6C1307150F6C6C131F6C6C133F01FC137F3907FF01FF6C90B5FC6C14FD6C14F9013F
+13F1010F13C1903803FE0190C7FCAD92B512F84A14FCA46E14F82E3C7DA730>I<ED07F8
+3A3FFF803FFF486DB51280B512C302CF14C06C13DF6C9038FFFC3FD8001F13E09238801F
+809238000F004A90C7FC5C5C5CA25CA45CAF003FB512FC4880B7FCA26C5C6C5C2A287EA7
+30>I<90381FFC1E48B5129F000714FF5A5A5A387FF007EB800100FEC7FC4880A46C143E
+007F91C7FC13E06CB4FC6C13FC6CEBFF806C14E0000114F86C6C7F01037F9038000FFF02
+001380007C147F00FEEC1FC0A2150F7EA27F151F6DEB3F806D137F9039FC03FF0090B6FC
+5D5D00FC14F0D8F83F13C026780FFEC7FC222A79A830>I<EB0780497E131FA9003FB612
+E04815F0B7FCA36C15E026001FC0C7FCB216F8ED01FCA5ECE003010FEB07F814F09138FC
+1FF06DB512E06D14C016806D14009038007FFCEC1FF026337EB130>I<D83FFCEB3FFC48
+6C497E00FF14FFA2007F147F003F143F00001400B3A41501A2150315076D130F903A7FC0
+7FFFF891B612FC6D15FE7F6D4913FC6D9038F87FF8010001C0C7FC2F2880A630>I<3B3F
+FFC07FFF80486DB512C0B515E0A26C16C06C496C13803B01F80003F000A26D130700005D
+A26D130F017E5CA2017F131F6D5CA2EC803F011F91C7FCA26E5A010F137EA2ECE0FE0107
+5BA214F101035BA3903801FBF0A314FF6D5BA36E5A6E5A2B277EA630>I<3B3FFFC01FFF
+E0486D4813F0B515F8A26C16F06C496C13E0D807E0C7EA3F00A26D5C0003157EA56D14FE
+00015DEC0F80EC1FC0EC3FE0A33A00FC7FF1F8A2147DA2ECFDF9017C5C14F8A3017E13FB
+A290393FF07FE0A3ECE03FA2011F5C90390F800F802D277FA630>I<3A3FFF81FFFC4801
+C37FB580A26C5D6C01815BC648C66CC7FC137FEC80FE90383F81FC90381FC3F8EB0FE3EC
+E7F06DB45A6D5B7F6D5B92C8FC147E147F5C497F81903803F7E0EB07E790380FE3F0ECC1
+F890381F81FC90383F80FE90387F007E017E137F01FE6D7E48486D7E267FFF80B5FCB500
+C1148014E3A214C16C0180140029277DA630>I<3B3FFFC07FFF80486DB512C0B515E0A2
+6C16C06C496C13803B01FC0003F000A2000014076D5C137E150F017F5C7F151FD91F805B
+A214C0010F49C7FCA214E00107137EA2EB03F0157C15FCEB01F85DA2EB00F9ECFDF0147D
+147FA26E5AA36E5AA35DA2143F92C8FCA25C147EA2000F13FE486C5AEA3FC1EBC3F81387
+EB8FF0EBFFE06C5B5C6C90C9FC6C5AEA01F02B3C7EA630>I<001FB612FC4815FE5AA316
+FC90C7EA0FF8ED1FF0ED3FE0ED7FC0EDFF80003E491300C7485A4A5A4A5A4A5A4A5A4A5A
+4A5A4990C7FC495A495A495A495A495A495A4948133E4890C7127F485A485A485A485A48
+5A48B7FCB8FCA46C15FE28277DA630>I<ED3FF0913803FFF8140F5C147F16F09138FFF0
+0092C7FC495A5CB3A21303495A133F383FFFF0B55A5C91C8FC14C080003F7F38003FF813
+076D7E1301B3A2806D7E15F091387FFFF016F8141F8014039138003FF025477BBE30>I<
+127CA212FEB3B3B3AD127CA207476CBE30>I<EA7FE0EAFFFE6D7E8014F07EC66C7E1307
+6D7E1301B3A2806D7E15E091387FFFE06E13F8801407141F5C4A13E09138FFE00092C7FC
+495A5CB3A21303495A137F387FFFF0B5FC14C05C49C8FCEA7FE025477BBE30>I<017C13
+3848B4137C48EB80FE4813C14813C348EBEFFC397FEFFFF0D8FF8713E0010713C0486C13
+80D87C0113003838007C1F0C78B730>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fk cmbx12 14.4 49
+/Fk 49 122 df<EEFFFC031FEBFF804AB612E0020781021F9038C00FF8913A7FFE0003FC
+DAFFF0EB00FE4949EB03FF4901805B4990C7487F49485CA2495A4D7F013F6F5B5CA37190
+C7FC715AEF01F894C9FCA90403B512C0BAFCA526003FFCC7120783B3B3A6003FB5D8FC03
+B612C0A542547DD34B>12 D<B712F0AB240B7F9F2D>45 D<EA07F0487E487E487E487EB5
+1280A76C13006C5A6C5A6C5A6C5A1111769025>I<157815FC14031407141F14FF130F00
+07B5FCB6FCA2147F13F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>49
+D<EC3FFE0103B512E0010F14FC013F14FF90B712C048D9C07F7F2703FE000F13F8D807F8
+01037FD80FE06D7F48486D7F48488001F01680486C6E13C07F486C6E13E07FA27013F0A5
+6C5AA26C5AEA0FF0EA03C0C914E05EA218C05E1880A24C13005F4C5A4B5B5F4B5B5F4B5B
+4B90C7FC4B5A5E4B5AED7FE04B5A4A5B4A48C8FC4A5A5D4A48EB01F04A5AEC3F804AC7FC
+02FEEC03E0495A495A495A495AD91F80140749C8FC013E150F017FB7FC90B812C05A5A5A
+5A5A5A5AB9FC1880A4344E79CD43>I<91380FFFC091B512FC0107ECFF80011F15E09026
+3FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D807FC8048B416C080486D15
+E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B
+5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113F89238007FFE707E701380
+7013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FC
+A25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A1380D80FF84A13006CB44A5A
+6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F1380374F7ACD43>I<177C
+17FEA2160116031607160FA2161F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C
+15FCEC01F815F0EC03E01407EC0FC01580EC1F005C147E147C5C1301495A495A5C495A13
+1F49C7FC133E5B13FC485A5B485A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7
+FCAF020FB712C0A53A4F7CCE43>I<D80380150ED807E0157E01FEEC03FED9FFF0137F91
+B65A5F5F5F5F5F94C7FC5E5E16F016C093C8FC15F801E190C9FC01E0CAFCABEC0FFF027F
+13F001E3B512FE01E76E7E9026FFF8077FDAC0017F49C713F8496E7E49143F4981496E7E
+6C481680C9FC18C08218E0A418F0A3EA0FE0487E487E487E487EA418E0A35B6C484A13C0
+5B491680003EC85A003F17006C6C4A5A6D5D6C6C4A5AD807F8495BD803FE01075B2701FF
+C03F5B6C90B65A013F4AC7FC6D14F8010314C09026007FF8C8FC344F79CD43>I<ED0FFF
+92B512E0020780021F14FC91397FFE03FE903A01FFF0007F4901C0EB3F804990C7121F49
+48EC7FC0494814FF49484913E049485B01FF5C485BA2485B5AA2486F13C04A6D1380486F
+1300177E94C7FC5AA291CAFC5AA21508913801FFF8020713FFB54814C04A14F04AC66C7E
+023C6D7E4A6D7E4A6D7E7013804A15C0A24A15E07013F05C18F8A491C714FCA37EA67EA4
+6C17F880A27E18F06C5D18E06C6D15C07E6E4913806C6D15006D6C495A6D6CEB7FFC6DB4
+48485A6D90B55A010315C0010092C7FC023F13FC020713C0364F7ACD43>I<121F7F7FEB
+FF8091B81280A45A1900606060A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F
+4C5A160F4C5A484B5A4C5A94C8FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FF
+A24A90C9FCA25C5D1407A2140FA25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC0
+6E5A395279D043>I<913807FFC0027F13FC0103B67E010F15E090261FFC0113F8903A3F
+E0003FFCD97F80EB0FFE49C76C7E48488048486E1380000717C04980120F18E0177FA212
+1F7FA27F7F6E14FF02E015C014F802FE4913806C7FDBC00313009238F007FE6C02F85B92
+38FE1FF86C9138FFBFF06CEDFFE017806C4BC7FC6D806D81010F15E06D81010115FC0107
+81011F81491680EBFFE748018115C048D9007F14E04848011F14F048487F484813030300
+14F8484880161F4848020713FC1601824848157F173FA2171FA2170FA218F8A27F007F17
+F06D151FA26C6CED3FE0001F17C06D157F6C6CEDFF806C6C6C010313006C01E0EB0FFE6C
+01FCEBFFFC6C6CB612F06D5D010F1580010102FCC7FCD9000F13C0364F7ACD43>I<9138
+0FFF8091B512F8010314FE010F6E7E4901037F90267FF8007F4948EB3FF048496D7E4849
+80486F7E484980824817805A91C714C05A7013E0A218F0B5FCA318F8A618FCA46C5DA37E
+A25E6C7F6C5DA26C5D6C7F6C6D137B6C6D13F390387FF803011FB512E36D14C301030283
+13F89039007FFE03EC00401500A218F05EA3D801F816E0487E486C16C0487E486D491380
+A218005E5F4C5A91C7FC6C484A5A494A5A49495B6C48495BD803FC010F5B9027FF807FFE
+C7FC6C90B55A6C6C14F06D14C0010F49C8FC010013F0364F7ACD43>I<91B5FC010F14F8
+017F14FF90B712C00003D9C00F7F2707FC00017FD80FE06D7F48486E7E48C87FD87FE06E
+7E7F7F486C1680A66C5A18006C485C6C5AC9485A5F4B5B4B5B4B5B4B5B4B90C7FC16FC4B
+5A4B5A16C04B5A93C8FC4A5A5D14035D5D14075DA25D140FA25DAB91CAFCAAEC1FC04A7E
+ECFFF8497FA2497FA76D5BA26D5BEC3FE06E5A315479D340>63 D<BA7E19FCF1FF801AF0
+1AFCD8000701F0C7000F13FF060014C0071F7F070713F807017F737F747E747F747F8674
+7F747F8886888688A2757EA31D8087A21DC0A51DE0A387A963A31DC0A51D80A2631D00A3
+515AA2646264505B6264505B505B5090C7FCF2FFFE4F5B07075B071F5B96B512C0060F91
+C8FCBB5A1AF01AC007FCC9FC19805B527CD167>68 D<BC1280A5D8000701F8C7000114C0
+F0001F19071901851A7F1A3F1A1FA2F20FE0A21A07A31A03A318F81BF01A01A497C7FC17
+01A317031707170F177F92B6FCA59238F8007F170F170717031701A317001B3EA31B7CA3
+95C8FCA21BFCA21BF8A21A01A31A031BF01A071A0FA21A1F1A3FF27FE0F101FF1907191F
+0603B5FCBCFCA21BC0A34F517CD058>I<BB12FEA5D8000701F8C700077FF0007F191F19
+0785858586861B80A21A1FA31A0FA41BC006F81307A497C7FCA31701A317031707170F17
+7F92B6FCA59238F8007F170F170717031701A31700A795C9FCB3B812F8A54A517CD055>
+I<B8D8C003B8FCA5D8000701F8C9001FEBE000B3AE92BAFCA503F8C9121FB3B1B8D8C003
+B8FCA560527CD169>72 D<B812C0A5D8000701F8C7FCB3B3B3B2B812C0A52A527CD132>
+I<027FB71280A591C76C90C7FCB3B3B3EA07F0EA1FFC487E487EA2B57EA44C5AA34A485B
+7E49495BD83FF8495BD81FE05DD80FFC011F5B2707FF807F90C8FC000190B512FC6C6C14
+F0011F14C0010101F8C9FC39537DD145>I<B812F8A5D8000701F8CAFCB3B3A91A7CA41A
+FC1AF8A51901A31903A219071AF0190FA2191F193F197F19FF180360183F4DB5FCBB12E0
+A546527CD151>76 D<B600FC073FB512FE6F61A26F96B6FCA2D80007F5C00070EF01EFA2
+02EF6DEF03CFA202E76DEF078FA202E36DEF0F0FA202E16D171EA302E06D173CA26F6C17
+78A26F6C17F0A26F6DED01E0A26F6DED03C0A36F6DED0780A26F6DED0F00A26F6D151EA2
+6F6D5DA3706C5DA2706C5DA2706D495AA2706D495AA2706D495AA3706D49C7FCA2706D13
+1EA2706D5BA2716C5BA3716C5BA271EB81E0A271EBC3C0A271EBE780A27101FFC8FCA371
+5BA2715BA2725AA2725AA2D93FFC6F5AB74DB712FEA2725AA2725A77527CD180>I<BAFC
+19F819FF1AE086D8000701F0C7001F13FC060113FF726C13807313C0070F13E01BF08573
+13F81BFCA27313FEA41BFFA81BFEA31BFC61A21BF84F13F04F13E0614F13C04F13004E48
+5A061F5B92B812F01AC04FC7FC19E003F8CBFCB3AEB812C0A550527CD15C>80
+D<B912F0F0FF8019F819FF1AC0D8000701F0C714F0060F7F060113FE727F737F737F8573
+7F87A2737FA387A863A2616363A24F5B4F5B4F90C8FC4F5A06035B060F13F095B512C092
+B8C9FC19F819E019F89226F0000313FE9439007FFF80727F727F727F727F727F8684A286
+84A787A71D1C75133EA38575137E73157C7513FC731401B86C6D9038F803F807039038FE
+07F07390B512E0736C14C0080F1400CEEA7FFC5F537CD164>82 D<91260FFF80130791B5
+00F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5
+FC4848C87E48488149150F001F824981123F4981007F82A28412FF84A27FA26D82A27F7F
+6D93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C83
+6C836D826D82010F821303010082021F16801400030F15C0ED007F040714E01600173F05
+0F13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D
+5D01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7
+FC48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC1280A59126C0003F
+9038C0007F49C71607D87FF8060113C001E08449197F49193F90C8171FA2007E1A0FA300
+7C1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD05E>I<B800C00103
+B612FCA5D8000701F8CAEBF000F31F80B3B3B11B3FA26D97C7FC81637F1B7E6D6D17FE50
+5A6E7E505A6E6D15076E4D5A6E6D4B5A6E6D4B5A6E01F84B5A6E6DDA03FFC8FC6E6CB46C
+EB0FFE6F9039F001FFF8030F90B65A030316C0DB007F92C9FC040F14F8DC007F13805E53
+7CD167>I<B700FC017FB600FE91B612F0A5D8003F01C0C8001F01E0C9EBF8006F71EE0F
+C06D7161876F1C1F6D7196C7FC6F8373606D1E3E6F836D7160876F1CFC6D666F4B801F01
+6D66704A806E525A88704A17076E059F5F70021F80080F160F6E6570023F806EDC3E074C
+C8FC8870027E5F6EDC7C03163E7002FC804F6C167E6E1C7C700101814F6C16FC6E745B70
+010317016E4C6D5D060716C00580496D14036F63DDC00F16E04F6D14076F07F05BDDE01F
+170F6F92C76C5D1DF8DDF03E6E141F6F98C9FCDDF87E16FC067C6E5C6FF1FE3EDDFCFC17
+7E6F4A6E147C1DFFDDFFF06E14FC6F62A24E816F62A270496F5BA24E817061A295C97E70
+61A270487090CAFCA37048705AA24D1601040360A27048705A84537DD18B>87
+D<EC7FFF0107B512F0013F14FE90B77E48D9E00F7F2703FE000113F0486C6D7F6EEB3FFC
+48826E131F83707FA36C496D7FA26C90C7FC6C5AC9FCA6037FB5FC020FB6FC91B7FC0107
+1487013FEBF0074913803901FFFC004813F0485B485B485B4890C7FC5A5BA2485AA45EA2
+6D5C007F151D163D6C6C02797F6C6D01F113F86C9026C003E1EBFFE06C9026F81FC014F0
+6C90B5487EC6ED001F011F01FC010713E0010101E090C8FC3C387CB641>97
+D<EB3FF0B5FCA51203C6FCB3A4923801FFE0030F13FE033FEBFFC092B612F002F301017F
+913AF7F8003FFEDAFFE0EB0FFF03806D7F92C76C7F4A6E7F4A824A6E7FA2727EA285A285
+84A31A80AC1A00A44E5AA36118FF616E4A5BA26E4A5B6E4A5B6F495BDACFC04990C7FCDA
+87F0EB7FFC913A03FE03FFF849C6B612E0496D148049011F01FCC8FC90C7000313C04154
+7BD24B>I<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE0001
+FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F1300705A48
+92C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC
+3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49C7FC
+020113E033387CB63C>I<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13FC91
+B6FC010315C7010F9038E03FE74990380007F7D97FFC0101B5FC49487F4849143F484980
+485B83485B5A91C8FC5AA3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C
+6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9
+003F13F8020301C049C7FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C04901
+817F903A3FFC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C0488191
+C7FC4817E0A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01
+F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE
+903A0FFFC03FF8010390B55A010015C0021F49C7FC020113F034387CB63D>I<ED3FFC02
+03B5FC020F14C0023F14E09139FFF81FF0499038C03FF849EB807F49903800FFFC495A49
+5AA2495AA2EE7FF8495AEE3FF0EE0FC093C7FCAEB712E0A526007FF8C8FCB3B3A7007FB5
+12FEA52E547CD329>I<DA3FFF14FF0103B5D8F00713C0010FDAFC1F13E0013FECFF7F90
+267FFC0F9038FF9FF09026FFE001EBF83F48496C13E0484990387FF01F4890C7D83FF813
+E0489338FC0FC0F0078048486E6CC7FCA2003F82A9001F5EA26C6C4A5AA26C5E6C6D495A
+6C6D495A6C6D485BDAFC0F5B4890B6C8FCD803EF14FC01C314F02607C03F90C9FC91CBFC
+A2120FA37FA213F813FE90B7FC6C16F817FF18C06C836C836C836D828448B9FC12074848
+C700031480D81FF8EC003F4848150748486F13C083485A83A56D5D007F18806D5D003F18
+006C6C4B5AD80FFEED1FFC6C6C6CEC7FF86C01E049485A6C01FE011F5B6C6CB71280010F
+03FCC7FC010115E0D9000F01FCC8FC3C4F7CB543>I<EB3FF0B5FCA51203C6FCB3A4EE1F
+FC93B512C0030314F0030F8092391FE07FFC92393F001FFE037C8003F07FDAF1E081ECF3
+C0DAF7807F8502FFC7FC5CA25CA45CB3ACB6D8F807B612C0A542537BD24B>I<137F497E
+000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3
+A6B612E0A51B547BD325>I<EB3FF0B5FCA51203C6FCB3A54CB512F8A59339003FFE00EF
+1FF0EF3FC04D5A4DC7FCEE03FEEE07F84C5A4C5AEE7FC04CC8FC4B5A4B5AED0FF8ED1FE0
+4B7E4B7EECF1FF02F37F02F77F91B6FC83159F030F7F02FE80DAF8077F4A7E6F7F6F7F83
+707E82707F84707F707F82707F84707F177F717E4D13C0B6D8F003B6FCA540537CD247>
+107 D<EB3FF0B5FCA512017EB3B3B3B1B612F0A51C537BD225>I<D93FF0D91FFCEDFFE0
+B591B500C0010713FE030302F0011F6D7E030F6E017F8092271FE07FFCD9FF037F922A3F
+001FFE01F8007F0003027C9126FF03E080C602F06DD90780137FDAF1E0038FC77FDAF3C0
+159EDAF7806D01BC143F07FC8102FFC75C4A5EA24A5EA44A5EB3ACB6D8F807B6D8C03FB5
+12FEA567367BB570>I<D93FF0EB1FFCB591B512C0030314F0030F8092391FE07FFC9239
+3F001FFE0003027C80C602F07FDAF1E081ECF3C0DAF7807F8502FFC7FC5CA25CA45CB3AC
+B6D8F807B612C0A542367BB54B>I<913801FFE0021F13FE91B612C0010315F0010F9038
+807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C8
+6C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA2
+6C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF80
+7FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F
+13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F
+92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F61
+6E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F14
+80031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380F
+FF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF
+150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114
+D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980
+127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C
+816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00
+F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF
+C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414
+FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE
+07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203
+13802A4D7ECB34>I<D93FF8913801FFC0B50207B5FCA50003ED001FC61607B3AE5FA35F
+A2017F5D173B177B6D6C14F3DC01E313F06D6CD907C3EBFFC0903A0FFFC03F836D90B512
+03010114FE6D6C13F8020701E091C7FC42377BB54B>I<B600F00107B5FCA5000101F8C8
+EA7FE06C6DED3F00A2017F163E6E157E013F167C6E15FC6D5E6F13016D5E8117036D5E6F
+13076D5E6F130F6D5E6F131F6D93C7FC815F6E6C133E177E023F147C6F13FC6E5C16816E
+5C16C3A26EEBE3E016E76E5C16FF6E5CA26E91C8FCA26F5AA36F5AA26F5AA26F5AA26F5A
+6F5A40367DB447>I<B6D8E07FB5D8C003B512C0A5000101F0C701F0C7381FF8006E027F
+ED07E06C715DA26E023F150F017F705DA26E181F013F4B6C92C7FC6E606D70143E94B5FC
+6F177E6D4A6E137C03C001F315FC6D715B160303E001E114016D020702E05B03F013C06D
+71485A160F03F8D9807F13076D05F85B93381F003F03FC160F027F4902FC5BDBFE3E011F
+131F023F04FE90C8FC167EDBFF7C010F5B6E01FCECFF3E4C6D137E6E5FA24C7F6E5F4C7F
+6E5FA24C7F6E5F4C147FA26E5F93C8123F6F5EA2033E6FC9FC5A367DB461>I<B600F001
+07B5FCA5C601F8C8EA7FE06EED3F00A26D6C153E187E013F167C6E15FC6D5E6F13016D5E
+6F13036D5E8117076D6D5C170F6D6D5C171F6D93C7FC6F5B027F143E6F137E023F147C6F
+13FCA26E6D5A16816EEBC1F016C36E5C16E76E5C16FF6E5CA26E91C8FCA36F5AA26F5AA2
+6F5AA26F5AA26F5AA35E150F5E151F93C9FC5DD81FC0133E486C137E486C137C486C13FC
+5D14015D14034A5A6C48485A49485A263FC07FCAFCEB81FE6CB45A6C13F000035BC690CB
+FC404D7DB447>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fl cmr10 10.95 86
+/Fl 86 124 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907
+F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7
+FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11
+D<4AB4FC021F13C091387F01F0903901FC0078D907F0131C4948133E494813FF49485A13
+7F1400A213FE6F5A163893C7FCAA167FB8FCA33900FE00018182B3AC486CECFF80007FD9
+FC3F13FEA32F407FBF33>I<4AB47E021F13F791387F00FFEB01F8903807F001EB0FE0EB
+1FC0EB3F80137F14008101FE80AEB8FCA3C648C77EB3AE486CECFF80007FD9FC3F13FEA3
+2F407FBF33>I<4AB4ECFF80021FD9C00F13E0913B7F01F03F80F8903C01F80078FE003C
+D907F0D93FF8130E49484948131F49484948EB7F804948484913FF137F02005CA201FE92
+C7FC6FED7F0070141C96C7FCAAF13F80BBFCA3C648C76CC7FC197F193FB3AC486C4A6CEB
+7FC0007FD9FC3FD9FE1FB5FCA348407FBF4C>I<121EEA7F80EAFFC0A9EA7F80ACEA3F00
+AC121EAB120CC7FCA8121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A4179C019>33
+D<001E130F397F803FC000FF137F01C013E0A201E013F0A3007F133F391E600F30000013
+00A401E01370491360A3000114E04913C00003130101001380481303000EEB070048130E
+0018130C0038131C003013181C1C7DBE2D>I<013F4C7ED9FFC04B7E2601E0E015072607
+C070150F48486C4B5A023E4BC7FC48486C5D48D90FC0EB01FE003ED90EF0EB07FCDA0F3F
+133E007E903A070FFFF8F8007C0200EBC1F0EE000300FC6D6C495A604D5A171F95C8FC17
+3E177E177C5F16015F007C4948485A1607007E5E003E49495A020E131F003F93C9FC6C49
+133E260F803C137E0238137C6C6C485B3901E0E0016CB448485AD93F0049133F90C74848
+EBFFC0030F903801E0E093398007C0704B4848487E4B153C033E90381F001C4B497F03FC
+133E4B150F4A48017E7F0203147C5D4A4801FCEB0380140F5D4AC7FC5C143E5C14FC5C49
+5A13034948027CEB07005C4948147E011F033E5B91C8140E013E153F017E6F5B017C9238
+0F803C4917380001706C5A49923801E0E0496FB45A6C48043FC7FC41497BC34C>37
+D<EC0FC0EC3FF0ECF878903801F01CEB03E049487E130FEC800F011F7FA2EB3F00A5EC80
+0EA25DA25DA25D6D6C5AECC1C0A2ECC38002E7C7387FFFFCEB0FEE14FC4A020713C06D48
+913801FE006E5DEF00F06D7E4D5A496C5D010F1503D91DFF4A5A013893C7FC496C6C5B01
+E0150E48486C6C131E00036E131C2607801F143C000F6E5B001F6D6C1370263F000714F0
+6F485A48D903FE5B913801FF03486D495A0487C8FCED7FCFED3FFE6F4814386D6D5AA200
+7F6E6C14786D6D6C14704B6C14F06C6C496C6C13E0001F91393E3FC0016C6C903AFC1FF0
+03C03D07FC07F007FC1F800001B5D8C001B512006C6C90C7EA7FFCD90FF8EC0FF03E437C
+C047>I<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113801203
+13005A120E5A1218123812300B1C79BE19>I<1430147014E0EB01C0EB03801307EB0F00
+131E133E133C5B13F85B12015B1203A2485AA2120F5BA2121F90C7FCA25AA3123E127EA6
+127C12FCB2127C127EA6123E123FA37EA27F120FA27F1207A26C7EA212017F12007F1378
+7F133E131E7FEB07801303EB01C0EB00E014701430145A77C323>I<12C07E12707E7E12
+1E7E6C7E7F12036C7E7F12007F1378137CA27FA2133F7FA21480130FA214C0A3130714E0
+A6130314F0B214E01307A614C0130FA31480A2131F1400A25B133EA25BA2137813F85B12
+015B485A12075B48C7FC121E121C5A5A5A5A145A7BC323>I<EB03C0A2805CA600F0140F
+00FC143F00FE147F00FF14FF393FC3C3FC390FE187F03903F18FC03900FDBF00EB3FFCEB
+0FF0EB03C0EB0FF0EB3FFCEBFDBF3903F18FC0390FE187F0393FC3C3FC39FF03C0FF00FE
+147F00FC143F00F0140F00001400A6805CA220277AC32D>I<121EEA7F8012FF13C0A213
+E0A3127FEA1E601200A413E013C0A312011380120313005A120E5A1218123812300B1C79
+8919>44 D<B512FEA617067F961E>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A79
+8919>I<ED0180ED03C01507A21680150FA216005DA2151E153EA2153C157CA2157815F8
+A25D1401A25D1403A25D1407A25D140FA24AC7FCA2141E143EA2143C147CA2147814F8A2
+5C1301A25C1303A25C1307A25C130FA291C8FC5BA2131E133EA25BA2137813F8A25B1201
+A25B1203A25B1207A25B120FA290C9FC5AA2121E123EA2123C127CA2127812F8A25A1260
+225B7BC32D>I<EB01FE90380FFFC090383F03F090387C00F849137C48487F48487F4848
+EB0F80A2000F15C04848EB07E0A3003F15F0A290C712034815F8A64815FCB3A26C15F8A5
+6C6CEB07F0A3001F15E0A36C6CEB0FC0A26C6CEB1F80000315006C6C133E6C6C5B017C5B
+90383F03F090380FFFC0D901FEC7FC263F7DBC2D>I<EB01C013031307131F137FEA07FF
+B5FC139FEAF81F1200B3B3ACEB7FF0B612F8A31D3D78BC2D>I<EB07FC90383FFF8090B5
+12E03903F01FF83907C007FC390F0001FE001E6D7E001C1580003CEC7FC05AED3FE01270
+B4FC6DEB1FF07FA56C5A6CC7FC120CC813E0153FA216C0157F168015FF16004A5A5D4A5A
+4A5A5D4A5A4A5A4AC7FC147E147C5C495A495A495A495A49C71270133E133C5B4914E048
+5A485A485A48C7120148B6FCA25A4815C0B7FCA3243D7CBC2D>I<EB07FC90383FFF8090
+38F80FE03901E003F839078001FCD80F007F000E6D7E001E1580D81F80137F486C14C07F
+A27F5BA2121F6C5AC8138015FF1600A24A5AA24A5A5DEC07E04A5A023FC7FCEB1FFCECFF
+809038000FE0EC07F86E7E6E7E6E7E1680ED7FC0A216E0153FA216F0A2120C123F487E48
+7EA316E0A249137F6CC713C01278EDFF807E6C4913006C495A3907C007FC3903F80FF0C6
+B55A013F1380D907F8C7FC243F7CBC2D>I<150E151E153EA2157EA215FE1401A21403EC
+077E1406140E141CA214381470A214E0EB01C0A2EB0380EB0700A2130E5BA25B5BA25B5B
+1201485A90C7FC5A120E120C121C5AA25A5AB8FCA3C8EAFE00AC4A7E49B6FCA3283E7EBD
+2D>I<00061403D80780131F01F813FE90B5FC5D5D5D15C092C7FC14FCEB3FE090C9FCAC
+EB01FE90380FFF8090383E03E090387001F8496C7E49137E497F90C713800006141FC813
+C0A216E0150FA316F0A3120C127F7F12FFA416E090C7121F12FC007015C012780038EC3F
+80123C6CEC7F00001F14FE6C6C485A6C6C485A3903F80FE0C6B55A013F90C7FCEB07F824
+3F7CBC2D>I<EC1FE0ECFFF8903803F03E90380FC00F90391F000780133E017EEB1FC049
+133F4848137F12035B12074848EB3F80ED1F00001F91C7FC5BA2123FA3485AA214FE9038
+87FF8039FF8F07E090389C01F09038B800FC01B0137E13F0497F16804914C0A2ED1FE0A3
+4914F0A5127FA6123F6D14E0A2121FED3FC0A26C6C1480A20007EC7F006C6C137E6C6C5B
+6C6C485A90387E07F06DB45A010F1380D903FCC7FC243F7CBC2D>I<1238123C123F90B6
+12FCA316F85A16F016E00078C712010070EC03C0ED078016005D48141E151C153C5DC812
+7015F04A5A5D14034A5A92C7FC5C141EA25CA2147C147814F8A213015C1303A31307A313
+0F5CA2131FA6133FAA6D5A0107C8FC26407BBD2D>I<EB03FC90381FFF8090387C07E090
+38F001F83901E0007C48487F48487F48C7FCED0F80121E16C0003E1407A4123FA26DEB0F
+807F6C6C131F6D140001FC133E6C6C5B9038FF80786C6D5A6CEBF3E06CEBFF806C91C7FC
+133F6D13C06D7F013F13F801787F48486C7E3903E01FFF48486C1380260F800313C04848
+7E489038007FE0003E143F007E141F007CEC0FF01507481403A31501A46C15E0007C1403
+A2007E15C06C14076CEC0F806DEB1F006C6C133ED807F05B3901FC03F86CB512E0011F13
+80D903FCC7FC243F7CBC2D>I<EB03FCEB1FFF90387E07C09038FC03F048486C7E48486C
+7E4848137C000F147E4848137F81003F15805B007F15C0A2151F12FF16E0A516F0A5127F
+153FA36C7EA2001F147F120F6C6C13FF6D13DF000313013900F8039F90387E0F1FD91FFE
+13E0EB07F090C7FCA2ED3FC0A41680157FD80F801400487E486C13FEA24A5A5D49485AEB
+8007391E000FE0001F495A260FC07FC7FC3803FFFE6C13F838003FC0243F7CBC2D>I<12
+1EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121EEA7F80A2EAFFC0A4EA7F80A2EA1E00
+0A2779A619>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121E127FEAFF80A213
+C0A4127F121E1200A412011380A3120313005A1206120E120C121C5A1230A20A3979A619
+>I<007FB912E0BA12F0A26C18E0CDFCAE007FB912E0BA12F0A26C18E03C167BA147>61
+D<EB1FF890B5FC3903E01FC0390F0007F0001EEB03F848EB01FC4814FE140000FE14FF7E
+7FA46CC7FC123EC7EA01FEA2EC03FCEC07F815F0EC0FC0EC1F80EC3F00143E5C147814F8
+5C13015CA2495AA25CAB91C7FC90C8FCA8EB0780EB1FE0A2497EA46D5AA2EB078020407B
+BF2B>63 D<15074B7EA34B7EA34B7EA34B7EA34B7E15E7A2913801C7FC15C3A291380381
+FEA34AC67EA3020E6D7EA34A6D7EA34A6D7EA34A6D7EA34A6D7EA349486D7E91B6FCA249
+819138800001A249C87EA24982010E157FA2011E82011C153FA2013C820138151FA20178
+82170F13FC00034C7ED80FFF4B7EB500F0010FB512F8A33D417DC044>65
+D<B712FCEEFF8017F00001903980000FF86C6CC7EA03FE707E701380EF7FC0EF3FE0A2EF
+1FF0A218F8A3170F171FA318F0A2EF3FE0177F18C0EFFF804C1300EE03FCEE0FF8EE7FE0
+91B6C7FC17E091C7EA07FCEE01FE933800FF80EF7FC0EF3FE0EF1FF018F8170F18FC1707
+A218FEA718FC170FA2EF1FF818F0173FEF7FE0EFFFC00403138048486C90380FFE00B85A
+17E094C7FC373E7DBD40>I<DB3FF01306912603FFFE130E020F9038FF801E913A3FF007
+E03E9139FF8000F8D903FEC7EA7C7ED907F8EC1EFE4948140FD93FE0140749481403495A
+91C812014848150012034848167E5B000F173EA24848161EA2123F5B180E127FA3491600
+12FFAC127F7F180EA2123FA27F001F171E181C6C7EA20007173C6D16386C6C1678000117
+706C6C16F06EEC01E06D6C15C06D6C1403D90FF0EC07806D6CEC1F00D903FE143E902600
+FF8013F891393FF007F0020FB512C0020391C7FC9138003FF037427BBF42>I<B712FCEE
+FF8017E000019039C0001FF86C6C48EB03FEEE00FF717E717EEF0FE084717E717E170184
+717EA21980187F19C0A3F03FE0A519F0AB19E0A5F07FC0A21980A218FF19004D5AA24D5A
+6017074D5A4D5AEF7FC04DC7FCEE03FE48486CEB1FF8B85A178004FCC8FC3C3E7DBD45>
+I<B912E0A300019038C000016C6C48EB001FEF0FF01703A217011700A31870A41838161C
+A41800A2163CA2167C16FC150391B5FCA3EC80031500167C163CA2161CA21807A3180E93
+C7FCA4181E181CA2183CA2187CA218F8170117031707171F48486CEB01FFB912F0A3383E
+7DBD3E>I<B91280A300019038C000036C6C48EB007FEF1FC0170F1707A21703A31701A4
+EF00E0A21638A31800A31678A216F81501150791B5FCA3EC8007150115001678A21638A6
+93C8FCAF3801FFE0B612F0A3333E7DBD3B>I<DB3FE0130C912603FFFE131C021F9038FF
+803C913A7FF00FC07C9139FF0001F0D903FC90380078FC4948143DD91FE0141F4948140F
+4948140701FF15034890C8FC491501485A000716005B000F177C5B001F173CA2485AA218
+1C127FA25B95C7FC12FFAB041FB512F0127FA26D9139000FFE00EF03FC123FA27F121FA2
+6C7EA212077F12036C7E7F6C7F6D6C14076D7E6D6C140FD907F8141ED903FEEC3C7C9026
+00FF80EBF83C913A7FF007F01C021FB5EAC00C020391C8FC9138003FF03C427BBF47>I<
+B6D8C01FB512F8A3000101E0C7383FFC0026007F80EC0FF0B3A691B7FCA30280C7120FB3
+A92601FFE0EC3FFCB6D8C01FB512F8A33D3E7DBD44>I<B612F0A3C6EBF000EB3FC0B3B3
+B2EBFFF0B612F0A31C3E7EBD21>I<011FB512FCA3D9000713006E5A1401B3B3A6123FEA
+7F80EAFFC0A44A5A1380D87F005B007C130700385C003C495A6C495A6C495A2603E07EC7
+FC3800FFF8EB3FC026407CBD2F>I<B600C090387FFFFCA3000101E0C7000F138026007F
+80913807FE0018F818E0604D5A4DC7FC173E5F5F4C5A4C5A4C5A4C5A4CC8FC163E5E5E4B
+5A4B5AED07804B7E151F4B7E4B7E15FF913881EFF8913883C7FCEC878791388F03FE9138
+9E01FF14BCDAF8007F4A6D7E5C4A6D7E4A6D7EA2707E707EA2707E707EA2707F717E8417
+3F717E717EA2717E848419802601FFE04A13C0B600C090B6FCA3403E7DBD47>I<B612F8
+A3000101E0C9FC38007F80B3B0EF0380A517071800A45FA35FA25F5F5F4C5A160748486C
+133FB8FCA3313E7DBD39>I<B500C093383FFFF0A300016D93387FF800D8007F18E0D977
+F016EFA3D973F8ED01CFA2D971FCED038FA3D970FEED070FA26E150E80A26E6C141CA36E
+6C1438A26E6C1470A36E6C14E0A26E6CEB01C0A36E6CEB0380A36E6CEB0700A2037F130E
+A36F6C5AA26F6C5AA36F6C5AA25FED07F0A2923803F9C0A36FB45AA26F90C7FCA213F848
+6C147ED807FFEF3FF8B500F8013C011FB512F0A34C3E7DBD53>I<B56C91B512F88080D8
+007F030713006EEC01FC6E6E5A1870EB77FCEB73FEA2EB71FF01707FA26E7E6E7EA26E7E
+6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA26F7E6F7EA26F7E6F1380A2EE7F
+C0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013F0A2177F173FA2171F170FA2
+170701F81503487ED807FF1501B500F81400A218703D3E7DBD44>I<ED7FE0913807FFFE
+91391FC03F8091397E0007E04948EB03F8D907F0EB00FE4948147F49486E7E49486E7E49
+C86C7E01FE6F7E00018349150300038348486F7EA248486F7EA2001F188049167F003F18
+C0A3007F18E049163FA300FF18F0AC007F18E06D167FA4003F18C0A26C6CEEFF80A36C6C
+4B1300A26C6C4B5A00035F6D150700015F6C6C4B5A6D5E6D6C4A5A6D6C4A5A6D6C4AC7FC
+6D6C14FED901FCEB03F8D9007FEB0FE091391FC03F80912607FFFEC8FC9138007FE03C42
+7BBF47>I<B712F8EEFF8017E000019039C0003FF86C6C48EB07FCEE01FE707EEF7F80EF
+3FC018E0A2EF1FF0A218F8A818F0A2EF3FE0A218C0EF7F80EFFF004C5AEE07FCEE3FF091
+B612C04CC7FC0280C9FCB3A73801FFE0B612C0A3353E7DBD3E>I<ED7FE0913807FFFE91
+391FC03F8091397F000FE0D901FCEB03F8D907F0EB00FE4948147F49486E7E49486E7E49
+C86C7E498248486F7E49150300038348486F7EA2000F834981001F1880A24848EE7FC0A3
+007F18E0A249163FA200FF18F0AC007F18E0A26D167FA3003F18C0A26C6CEEFF80A3000F
+18006D5D0007DA0F805B6C6C90393FE003FCED70706C6C496C485A6C6C48486C485A017F
+D9800E5BD93F819038061FC0D91FC19038073F80D90FE14AC7FCD907F1EB03FE902601FD
+C013F8903A007EE007E091271FF03FC013180207B5FC9139007FE1E0DB00011438837113
+78A2706C13F0EFFF0318FFA27113E0A37113C0711380711300715AEF01F83D527BBF47>
+I<B712C016FCEEFF800001D9C00013E06C6C48EB1FF0EE07FCEE01FE707E84717EA2717E
+A284A760177F606017FF95C7FCEE01FCEE07F8EE1FE0EEFF8091B500FCC8FC16F0913880
+01FCED003FEE1FC0707E707E83160383160183A383A484A4F0C004190EA28218E0057F13
+1E2601FFE0161CB600C0EB3FF094381FF83805071370CA3801FFE09438003F803F407DBD
+43>I<D907FC130C90391FFF801C017FEBF03C3901FC03F83A03F0007E7CD807C0EB1FFC
+4848130F001F140748C71203003E1401007E1400A2007C157C12FCA2163CA36C151CA27E
+A26C6C14007F7FEA3FF8EBFF806C13F86CEBFF806C14F06C14FC6C14FF6C15C0013F14E0
+010714F0EB007F020713F89138007FFC150FED07FE15031501ED00FFA200E0157FA3163F
+A27EA3163E7E167E6C157C6C15FC6C15F86D13016DEB03F06DEB07E0D8F9FCEB0FC03AF0
+7F803F8090391FFFFE00D8E00713F839C0007FC028427BBF33>I<003FB91280A3903AF0
+007FE001018090393FC0003F48C7ED1FC0007E1707127C00781703A300701701A548EF00
+E0A5C81600B3B14B7E4B7E0107B612FEA33B3D7DBC42>I<B600C090B512F8A3000101E0
+C70007130026007F80EC01FC715A1870B3B3A4013F16F06E5DA21701011F5E80010F1503
+6E4A5A010793C7FC6D6C5C6D6C141E6D6C5C027F14F86E6C485A91390FF00FE00203B512
+80020049C8FCED1FF03D407DBD44>I<B691380FFFFEA3000301E0020113E06C01809138
+007F806CEF3F00017F163E181C6E153C013F1638A26E1578011F1670A26D6C5DA26E1401
+01075EA26E140301035EA26D6C4AC7FCA2806D150EA26F131E027F141CA26F133C023F14
+38A26E6C5BA26F13F0020F5CA2EDF80102075CA26E6C485AA2EDFE07020191C8FCA26F5A
+6E130EA2ED7F9CA216DCED3FF8A36F5AA36F5AA26F5AA36F5A3F407EBD44>I<B500FE01
+7FB5D88007B5FCA3000301C0010101E0C713F86C90C849EC3FE07148EC0F807E7215006E
+143F017F190E84A26D6C60A24D7E6D6C60A2EFE7F86D6C60A2933801C3FC6E18F0010761
+04037F6E0281140101036104077F17006D6C4D5AA2040EEB7F806D6C4DC7FCA24CEB3FC0
+DA7F80160EA24CEB1FE003C0161E023F171C047814F0DBE070010F133C021F173804F014
+F84C1307DA0FF05EA2DBF1C0EB03FCDA07F95EA2DBFB80EB01FEDA03FF6F5AA293C8FCA2
+6E5FA24B157F020094C8FCA24B81037C153EA20378151E0338151C58407EBD5D>I<007F
+B5D8C003B512E0A3C649C7EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E6D6C141C
+6D6C143C5F6D6C14706D6D13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC020F5BED
+F81E913807FC1C163C6E6C5A913801FF7016F06E5B6F5AA26F7E6F7EA28282153FED3BFE
+ED71FF15F103E07F913801C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C6D7E0238
+6D7E14784A6D7E4A6D7F130149486E7E4A6E7E130749C86C7E496F7E497ED9FFC04A7E00
+076DEC7FFFB500FC0103B512FEA33F3E7EBD44>I<B66C0103B51280A3000101F0C8EBF8
+006C6C48ED3FC0725A013F041EC7FC6D7E606D6C15386D6C1578606D6C5D6E14016D5E6D
+6D1303606E6C49C8FC6E6C5B170E6E6C131E171C6E6C5B6E6C137817706E6C13F06F5B6E
+13016EEB83C05FED7FC7DB3FE7C9FC16EFED1FFE5E150F6F5AB3A4ED1FFC020FB512FCA3
+413E7FBD44>I<003FB712F8A391C7EA1FF013F801E0EC3FE00180EC7FC090C8FC003EED
+FF80A2003C4A1300007C4A5A12784B5A4B5AA200704A5AA24B5A4B5AA2C8485A4A90C7FC
+A24A5A4A5AA24A5AA24A5A4A5AA24A5A4A5AA24990C8FCA2495A4948141CA2495A495AA2
+495A495A173C495AA24890C8FC485A1778485A484815F8A24848140116034848140F4848
+143FED01FFB8FCA32E3E7BBD38>I<EAFFFCA4EAF000B3B3B3B3ABEAFFFCA40E5B77C319>
+I<486C13C00003130101001380481303000EEB070048130E0018130C0038131C00301318
+0070133800601330A300E01370481360A400CFEB678039FFC07FE001E013F0A3007F133F
+A2003F131F01C013E0390F0007801C1C73BE2D>I<EAFFFCA4EA003CB3B3B3B3ABEAFFFC
+A40E5B7FC319>I<EB0FF8EBFFFE3903F01F8039078007E0000F6D7E9038E001F8D81FF0
+7F6E7EA3157F6C5AEA0380C8FCA4EC1FFF0103B5FC90381FF87FEB7F803801FC00EA07F8
+EA0FE0485A485AA248C7FCEE038012FEA315FFA3007F5BEC03BF3B3F80071F8700261FC0
+0E13CF3A07F03C0FFE3A01FFF807FC3A003FC001F0292A7DA82D>97
+D<EA01FC12FFA3120712031201B1EC03FC91381FFF8091387C07E09039FDE001F09039FF
+C000FC4A137E91C77E49158049141F17C0EE0FE0A217F0A2160717F8AA17F0A2160FA217
+E0161F17C06D1580EE3F006D5C6E13FE9039F3C001F89039F1E003F09039E0780FC09026
+C03FFFC7FCC7EA07F82D407EBE33>I<49B4FC010F13E090383F00F8017C131E4848131F
+4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290C9FC5AAB6C7EA3
+003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C6C137890383F01
+F090380FFFC0D901FEC7FC222A7DA828>I<ED01FC15FFA3150715031501B114FF010713
+E190381F80F990387E003D49131FD803F81307485A49130348481301121F123F5B127FA2
+90C7FCA25AAA7E7FA2123FA26C7E000F14037F000714076C6C497E6C6C497ED8007C0179
+13F890383F01F190380FFFC1903A01FE01FC002D407DBE33>I<EB01FE90380FFFC09038
+3F03F09038FC01F848486C7E4848137E48487F000F158049131F001F15C04848130FA212
+7F16E090C7FCA25AA290B6FCA290C9FCA67EA27F123F16E06C7E1501000F15C06C6C1303
+6DEB07806C6C1400C66C131E017E5B90381F80F8903807FFE0010090C7FC232A7EA828>
+I<EC1FC0EC7FF8903801F83C903807E07E90380FC0FFEB1FC1EB3F811401137FEC00FE01
+FE137C1500AEB6FCA3C648C7FCB3AE487E007F13FFA320407EBF1C>I<167C903903F801
+FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC0600000F6EC7FC
+49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E03903FE0FC026071F
+FFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15E06C810003813A
+0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E157E6C5D6C6C49
+5A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D7EA82D>I<EA01
+FC12FFA3120712031201B1EC01FE913807FFC091381E07E091387803F09138E001F8D9FD
+C07F148001FF6D7E91C7FCA25BA25BB3A6486C497EB5D8F87F13FCA32E3F7DBE33>I<EA
+01E0EA07F8A2487EA46C5AA2EA01E0C8FCACEA01FC127FA3120712031201B3AC487EB512
+F0A3143E7DBD1A>I<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC147FEB7FFFA313
+017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03F0381E07C0380F
+FF803801FC00185185BD1C>I<EA01FC12FFA3120712031201B292B51280A392383FFC00
+16E0168093C7FC153C5D5D4A5AEC07C04A5A4AC8FC143E147F4A7E13FD9038FFDFC0EC9F
+E0140F496C7E01FC7F496C7E1401816E7E81826F7E151F826F7EA282486C14FEB539F07F
+FFE0A32B3F7EBE30>I<EA01FC12FFA3120712031201B3B3B1487EB512F8A3153F7DBE1A>
+I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B7803F03C01F80007
+903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91C75B13FF4992C7FC
+A2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>I<3901F801FE00FF
+903807FFC091381E07E091387803F000079038E001F82603F9C07F0001138001FB6D7E91
+C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14FF010713E090381F
+81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F15F04848EB01F8A2
+003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F86C6CEB03F0A26C6C
+EB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFFF0010090C7FC282A
+7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F03A03FFC001FC6C49
+6C7E91C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0A4EE1FE0A2EE3FC0
+6D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA3FFFC7FCEC07F891
+C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F80F090397F00387C
+01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485AA448C7FCAA6C7EA3
+6C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E137990383F81F190380FFFC1
+903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E000FFEB1FF8EC787C
+ECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35BB3A5487EB512FEA3
+1F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E1307003C1303127C00
+78130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F6C1480000114C0D8
+003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F07E14016C14E06CEB
+03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<131CA6133CA4137CA2
+13FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912009038FE01C0A2EB
+7F03013F138090381F8700EB07FEEB01F81B397EB723>I<D801FC14FE00FF147FA30007
+14030003140100011400B3A51501A31503120015076DEB06FF017E010E13806D4913FC90
+381FC078903807FFE00100903880FE002E297DA733>I<B539E00FFFE0A32707FE000313
+006C48EB00FC5E00015D7F00005DA26D13016D5CA26D6C485AA2ECC007011F91C7FCA290
+380FE00EA2ECF01E0107131CA26D6C5AA2ECFC7801011370A2ECFEF001005BA2EC7FC0A3
+6E5AA26EC8FCA3140E2B287EA630>I<B53BC3FFFE03FFF8A3290FFE003FE00013C06C48
+6D48EB3F806C4817006D010F141E00016F131C15076D163C00004A6C1338A2017F5E4B7E
+151DD93F805DED3DFC1538D91FC04A5AED78FE9238707E03D90FE0017F5BEDE03F02F014
+0701070387C7FC9138F1C01F02F9148F010315CE9138FB800F02FF14DE6D15FCED00076D
+5DA24A1303027E5CA2027C1301023C5C023813003D287EA642>I<B539F01FFFE0A30003
+D9C00F1300C690388007F8D97F0013E002805BD93FC05B011F49C7FC90380FE00EECF01E
+6D6C5A01035B6D6C5A6E5AEB00FF6E5A6E5A81141F814A7E81147BECF1FC903801E1FEEC
+C0FF01037F49486C7ED90F007F011E6D7E013E130F496D7E01FC80486C80000F4A7EB539
+803FFFF8A32D277FA630>I<B539E00FFFE0A32707FE000313006C48EB01FC6F5A00015D
+7F00005DA2017F495AA2EC8003013F5CA26D6C48C7FCA26E5A010F130EA26D6C5AA2ECF8
+3C01031338A26D6C5AA2ECFEF001005BA2EC7FC0A36E5AA36EC8FCA2140EA2141E141C14
+3C1438A2147800181370127EB45BA2495AA248485AD87E07C9FCEA780EEA3C3CEA1FF8EA
+07E02B3A7EA630>I<001FB61280A2EBE0000180140049485A001E495A121C4A5A003C49
+5A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90393FC00380A2EB7F
+80EBFF005A5B484813071207491400485A48485BA248485B4848137F00FF495A90B6FCA2
+21277EA628>I<B812F0A22C0280982D>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fm cmbx12 20.736 9
+/Fm 9 123 df<92380FFFE04AB67E020F15F0027F15FE49B87E4917E0010F17F8013F83
+49D9C01F14FF9027FFFC0001814801E06D6C80480180021F804890C86C8048486F804848
+6F8001FF6F804801C06E8002F081486D18806E816E18C0B5821BE06E81A37214F0A56C5B
+A36C5B6C5B6C5B000313C0C690C9FC90CA15E060A34E14C0A21B80601B0060626295B55A
+5F624D5C624D5C4D91C7FC614D5B4D13F04D5B6194B55A4C49C8FC4C5B4C5B4C13E04C5B
+604C90C9FCEE7FFC4C5A4B5B4B5B4B0180EC0FF04B90C8FC4B5A4B5A4B48ED1FE0EDFFE0
+4A5B4A5B4A90C9FC4A48163F4A5ADA3FF017C05D4A48167F4A5A4990CA12FFD903FC1607
+49BAFC5B4919805B5B90BBFC5A5A5A5A481A005A5ABCFCA462A44C7176F061>50
+D<92383FFFF80207B612E0027F15FC49B87E010717E0011F83499026F0007F13FC4948C7
+000F7F90B502036D7E486E6D806F6D80727F486E6E7F8486727FA28684A26C5C72806C5C
+6D90C8FC6D5AEB0FF8EB03E090CAFCA70507B6FC041FB7FC0303B8FC157F0203B9FC021F
+ECFE0391B612800103ECF800010F14C04991C7FC017F13FC90B512F04814C0485C4891C8
+FC485B5A485B5C5A5CA2B5FC5CA360A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A48
+14FC6C6ED90FF0ECFFFC6C02E090263FE07F14FE00019139FC03FFC06C91B6487E013F4B
+487E010F4B1307010303F01301D9003F0280D9003F13FC020101F8CBFC57507ACE5E>97
+D<903801FFFCB6FCA8C67E131F7FB3ADF0FFFC050FEBFFE0057F14FE0403B77E040F16E0
+043F16F84CD9007F13FE9226FDFFF001077F92B500C001018094C86C13E004FC6F7F4C6F
+7F04E06F7F4C6F7F5E747F93C915804B7014C0A27414E0A21DF087A21DF8A31DFC87A41D
+FEAF1DFCA4631DF8A31DF098B5FC1DE0A25014C0A26F1980501400705D705F704B5B505B
+704B5B04FC4B5BDBE7FE92B55A9226C3FF8001035C038101E0011F49C7FC9226807FFC90
+B55A4B6CB712F04A010F16C04A010393C8FC4A010015F84A023F14C090C9000301F0C9FC
+5F797AF76C>I<97380FFFE00607B6FCA8F00003190086B3AD93383FFF800307B512F803
+3F14FF4AB712C0020716F0021F16FC027F9039FE007FFE91B500F0EB0FFF010302800101
+90B5FC4949C87E49498149498149498149498190B548814884484A8192CAFC5AA2485BA2
+5A5C5AA35A5CA4B5FCAF7EA4807EA37EA2807EA26C7F616C6E5D6C606C80616D6D5D6D6D
+5D6D6D92B67E6D6D4A15FC010301FF0207EDFFFE6D02C0EB3FFE6D6C9039FC01FFF86E90
+B65A020F16C002031600DA007F14FC030F14E09226007FFEC749C7FC5F797AF76C>100
+D<EB01FCEB07FF011F13C0497F497F90B57EA24880A24880A76C5CA26C5CA26D5B6D5B6D
+5B010790C8FCEB01FC90CAFCB2903801FFFC007FB5FCA8C67E131F7FB3B3B3A5B81280A8
+297979F835>105 D<903801FFFCB6FCA8C67E131F7FB3B3B3B3B3ABB812C0A82A7879F7
+35>108 D<902601FFF891380FFFE0B692B512FE05036E7E050F15E0053F15F84D819327
+01FFF01F7F4CD900077FDC07FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC04
+7E6F7F5EEDF9F85E03FB707F5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A861
+4E79CD6C>110 D<902601FFFCEC7FFEB6020FB512F0057F14FE4CB712C0040716F0041F
+82047F16FE93B5C66C7F92B500F0010F14C0C66C0380010380011F4AC76C806D4A6E8004
+F06F7F4C6F7F4C6F7F4C8193C915804B7014C0861DE0A27414F0A27414F8A47513FCA575
+13FEAF5113FCA598B512F8A31DF0621DE0621DC0621D806F5E701800704B5B505B704B5B
+7092B55A04FC4A5C704A5C706C010F5C05E0013F49C7FC9227FE7FFC01B55A70B712F004
+0F16C0040393C8FC040015F8053F14C0050301F0C9FC94CCFCB3A6B812E0A85F6F7ACD6C
+>112 D<0007BA12FC1AFEA503E0C714FC4AC74814F84801F04A14F05C02804A14E091C8
+4814C04D14805B494B14004D5B4992B55AA24C5C494A5C615E4C5C001F4B5C5B4C91C7FC
+4C5B93B55AA24B5CC8485C4B5CA24B5C4B5C4B91C8FCA24B5B92B55AA24A5C4A5C4A4A14
+FFA24A5C4A5C4A91C8FC614A4915FE91B55A495CA2495C494A14035E5B495C4991C81207
+A24949ED0FFC90B55A484A151FA2484A153F484A157F484A15FF1803484A140F4891C812
+3F48490207B5FC91B9FCBB12F8A57E484D7BCC56>122 D E
+%EndDVIPSBitmapFont
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+%%PaperSize: A4
+
+%%EndSetup
+%%Page: 1 1
+1 0 bop 150 1318 a Fm(bzip2)64 b(and)g(libbzip2)p 150
+1418 3600 34 v 2010 1515 a Fl(a)31 b(program)f(and)g(library)e(for)i
+(data)h(compression)2198 1623 y(cop)m(yrigh)m(t)f(\(C\))h(1996-2000)j
+(Julian)28 b(Sew)m(ard)2605 1731 y(v)m(ersion)i(1.0)h(of)g(21)g(Marc)m
+(h)g(2000)150 5091 y Fk(Julian)46 b(Sew)l(ard)p 150 5141
+3600 17 v eop
+%%Page: 1 2
+1 1 bop 3705 -116 a Fl(1)150 299 y(This)24 b(program,)j
+Fj(bzip2)p Fl(,)e(and)g(asso)s(ciated)i(library)c Fj(libbzip2)p
+Fl(,)i(are)h(Cop)m(yrigh)m(t)g(\(C\))g(1996-2000)j(Julian)150
+408 y(R)h(Sew)m(ard.)40 b(All)29 b(righ)m(ts)h(reserv)m(ed.)150
+565 y(Redistribution)f(and)i(use)h(in)f(source)h(and)g(binary)e(forms,)
+j(with)e(or)h(without)f(mo)s(di\014cation,)g(are)i(p)s(er-)150
+675 y(mitted)d(pro)m(vided)f(that)i(the)f(follo)m(wing)f(conditions)g
+(are)i(met:)225 832 y Fi(\017)60 b Fl(Redistributions)26
+b(of)k(source)g(co)s(de)g(m)m(ust)g(retain)f(the)h(ab)s(o)m(v)m(e)h
+(cop)m(yrigh)m(t)g(notice,)f(this)f(list)f(of)i(con-)330
+941 y(ditions)e(and)i(the)h(follo)m(wing)e(disclaimer.)225
+1076 y Fi(\017)60 b Fl(The)33 b(origin)f(of)h(this)f(soft)m(w)m(are)j
+(m)m(ust)e(not)h(b)s(e)e(misrepresen)m(ted;)i(y)m(ou)g(m)m(ust)f(not)g
+(claim)g(that)h(y)m(ou)330 1185 y(wrote)d(the)h(original)d(soft)m(w)m
+(are.)44 b(If)31 b(y)m(ou)g(use)g(this)f(soft)m(w)m(are)i(in)e(a)h(pro)
+s(duct,)g(an)f(ac)m(kno)m(wledgmen)m(t)330 1295 y(in)f(the)i(pro)s
+(duct)e(do)s(cumen)m(tation)h(w)m(ould)f(b)s(e)h(appreciated)g(but)g
+(is)f(not)i(required.)225 1429 y Fi(\017)60 b Fl(Altered)21
+b(source)g(v)m(ersions)f(m)m(ust)h(b)s(e)f(plainly)e(mark)m(ed)j(as)g
+(suc)m(h,)i(and)d(m)m(ust)h(not)g(b)s(e)f(misrepresen)m(ted)330
+1539 y(as)31 b(b)s(eing)e(the)h(original)f(soft)m(w)m(are.)225
+1674 y Fi(\017)60 b Fl(The)27 b(name)h(of)f(the)h(author)f(ma)m(y)h
+(not)g(b)s(e)f(used)g(to)h(endorse)f(or)h(promote)g(pro)s(ducts)e
+(deriv)m(ed)g(from)330 1783 y(this)j(soft)m(w)m(are)j(without)d(sp)s
+(eci\014c)h(prior)e(written)i(p)s(ermission.)150 1965
+y(THIS)37 b(SOFTW)-10 b(ARE)38 b(IS)f(PR)m(O)m(VIDED)i(BY)g(THE)f(A)m
+(UTHOR)g(\\AS)g(IS")g(AND)h(ANY)f(EXPRESS)150 2074 y(OR)31
+b(IMPLIED)h(W)-10 b(ARRANTIES,)31 b(INCLUDING,)i(BUT)f(NOT)f(LIMITED)g
+(TO,)h(THE)f(IMPLIED)150 2184 y(W)-10 b(ARRANTIES)27
+b(OF)h(MER)m(CHANT)-8 b(ABILITY)28 b(AND)g(FITNESS)f(F)m(OR)g(A)h(P)-8
+b(AR)g(TICULAR)28 b(PUR-)150 2294 y(POSE)37 b(ARE)g(DISCLAIMED.)h(IN)f
+(NO)h(EVENT)f(SHALL)g(THE)g(A)m(UTHOR)h(BE)g(LIABLE)g(F)m(OR)150
+2403 y(ANY)56 b(DIRECT,)f(INDIRECT,)h(INCIDENT)-8 b(AL,)56
+b(SPECIAL,)e(EXEMPLAR)-8 b(Y,)57 b(OR)e(CONSE-)150 2513
+y(QUENTIAL)48 b(D)m(AMA)m(GES)i(\(INCLUDING,)g(BUT)f(NOT)f(LIMITED)g
+(TO,)g(PR)m(OCUREMENT)150 2622 y(OF)35 b(SUBSTITUTE)e(GOODS)i(OR)f(SER)
+-10 b(VICES;)34 b(LOSS)f(OF)i(USE,)g(D)m(A)-8 b(T)g(A,)36
+b(OR)f(PR)m(OFITS;)f(OR)150 2732 y(BUSINESS)28 b(INTERR)m(UPTION\))g
+(HO)m(WEVER)i(CA)m(USED)f(AND)g(ON)g(ANY)g(THEOR)-8 b(Y)29
+b(OF)g(LIA-)150 2842 y(BILITY,)36 b(WHETHER)g(IN)g(CONTRA)m(CT,)g
+(STRICT)e(LIABILITY,)i(OR)g(TOR)-8 b(T)35 b(\(INCLUDING)150
+2951 y(NEGLIGENCE)45 b(OR)g(OTHER)-10 b(WISE\))44 b(ARISING)h(IN)g(ANY)
+h(W)-10 b(A)i(Y)46 b(OUT)e(OF)i(THE)e(USE)h(OF)150 3061
+y(THIS)29 b(SOFTW)-10 b(ARE,)31 b(EVEN)f(IF)g(AD)m(VISED)i(OF)e(THE)g
+(POSSIBILITY)e(OF)j(SUCH)f(D)m(AMA)m(GE.)150 3218 y(Julian)e(Sew)m
+(ard,)i(Cam)m(bridge,)g(UK.)150 3374 y Fj(jseward@acm.org)150
+3531 y(http://sourceware.cygnus)o(.com)o(/bzi)o(p2)150
+3688 y(http://www.cacheprof.org)150 3845 y(http://www.muraroa.demon)o
+(.co.)o(uk)150 4002 y(bzip2)p Fl(/)p Fj(libbzip2)d Fl(v)m(ersion)j(1.0)
+i(of)e(21)h(Marc)m(h)g(2000.)150 4159 y(P)-8 b(A)g(TENTS:)40
+b(T)-8 b(o)40 b(the)g(b)s(est)g(of)g(m)m(y)g(kno)m(wledge,)j
+Fj(bzip2)38 b Fl(do)s(es)i(not)g(use)g(an)m(y)g(paten)m(ted)h
+(algorithms.)150 4268 y(Ho)m(w)m(ev)m(er,)33 b(I)e(do)f(not)h(ha)m(v)m
+(e)h(the)f(resources)g(a)m(v)-5 b(ailable)30 b(to)h(carry)g(out)g(a)g
+(full)d(paten)m(t)k(searc)m(h.)42 b(Therefore)150 4378
+y(I)30 b(cannot)h(giv)m(e)g(an)m(y)g(guaran)m(tee)h(of)e(the)h(ab)s(o)m
+(v)m(e)g(statemen)m(t.)p eop
+%%Page: 2 3
+2 2 bop 150 -116 a Fl(Chapter)30 b(1:)41 b(In)m(tro)s(duction)2591
+b(2)150 299 y Fh(1)80 b(In)l(tro)t(duction)150 555 y
+Fj(bzip2)20 b Fl(compresses)h(\014les)f(using)g(the)h(Burro)m
+(ws-Wheeler)g(blo)s(c)m(k-sorting)f(text)j(compression)d(algorithm,)150
+665 y(and)33 b(Hu\013man)g(co)s(ding.)50 b(Compression)32
+b(is)h(generally)g(considerably)f(b)s(etter)i(than)f(that)h(ac)m(hiev)m
+(ed)h(b)m(y)150 775 y(more)f(con)m(v)m(en)m(tional)g(LZ77/LZ78-based)g
+(compressors,)g(and)f(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the)
+150 884 y(PPM)c(family)f(of)i(statistical)f(compressors.)150
+1041 y Fj(bzip2)k Fl(is)h(built)e(on)i(top)h(of)g Fj(libbzip2)p
+Fl(,)e(a)i(\015exible)e(library)f(for)i(handling)e(compressed)i(data)i
+(in)d(the)150 1151 y Fj(bzip2)c Fl(format.)43 b(This)30
+b(man)m(ual)g(describ)s(es)g(b)s(oth)g(ho)m(w)i(to)g(use)f(the)g
+(program)g(and)g(ho)m(w)g(to)h(w)m(ork)f(with)150 1260
+y(the)d(library)d(in)m(terface.)41 b(Most)28 b(of)g(the)g(man)m(ual)f
+(is)g(dev)m(oted)i(to)f(this)f(library)-8 b(,)26 b(not)i(the)g
+(program,)g(whic)m(h)150 1370 y(is)h(go)s(o)s(d)i(news)e(if)h(y)m(our)g
+(in)m(terest)h(is)e(only)g(in)h(the)g(program.)150 1527
+y(Chapter)24 b(2)g(describ)s(es)f(ho)m(w)h(to)h(use)f
+Fj(bzip2)p Fl(;)h(this)e(is)g(the)i(only)e(part)h(y)m(ou)h(need)f(to)h
+(read)f(if)f(y)m(ou)h(just)g(w)m(an)m(t)150 1636 y(to)35
+b(kno)m(w)f(ho)m(w)g(to)g(op)s(erate)h(the)f(program.)51
+b(Chapter)34 b(3)g(describ)s(es)e(the)i(programming)f(in)m(terfaces)h
+(in)150 1746 y(detail,)23 b(and)d(Chapter)h(4)h(records)f(some)h
+(miscellaneous)e(notes)i(whic)m(h)e(I)h(though)m(t)h(ough)m(t)g(to)g(b)
+s(e)f(recorded)150 1855 y(somewhere.)p eop
+%%Page: 3 4
+3 3 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(3)150 299 y Fh(2)80 b(Ho)l(w)53
+b(to)g(use)g Fg(bzip2)150 566 y Fl(This)29 b(c)m(hapter)i(con)m(tains)f
+(a)h(cop)m(y)g(of)g(the)f Fj(bzip2)f Fl(man)h(page,)h(and)f(nothing)g
+(else.)390 818 y Ff(NAME)570 1004 y Fj(bzip2)p Fl(,)f
+Fj(bunzip2)g Fl(-)h(a)h(blo)s(c)m(k-sorting)f(\014le)f(compressor,)i
+(v1.0)570 1136 y Fj(bzcat)e Fl(-)i(decompresses)f(\014les)f(to)i
+(stdout)570 1267 y Fj(bzip2recover)c Fl(-)k(reco)m(v)m(ers)h(data)f
+(from)f(damaged)g(bzip2)g(\014les)390 1519 y Ff(SYNOPSIS)570
+1706 y Fj(bzip2)f Fl([)h(-cdfkqstvzVL123456789)35 b(])c([)g
+(\014lenames)e(...)41 b(])570 1837 y Fj(bunzip2)28 b
+Fl([)j(-fkvsVL)f(])h([)f(\014lenames)g(...)41 b(])570
+1968 y Fj(bzcat)29 b Fl([)h(-s)h(])g([)f(\014lenames)g(...)41
+b(])570 2100 y Fj(bzip2recover)27 b Fl(\014lename)390
+2352 y Ff(DESCRIPTION)390 2538 y Fj(bzip2)i Fl(compresses)i(\014les)f
+(using)f(the)i(Burro)m(ws-Wheeler)g(blo)s(c)m(k)f(sorting)g(text)i
+(compres-)390 2642 y(sion)40 b(algorithm,)j(and)d(Hu\013man)h(co)s
+(ding.)71 b(Compression)40 b(is)g(generally)g(considerably)390
+2746 y(b)s(etter)25 b(than)g(that)h(ac)m(hiev)m(ed)g(b)m(y)f(more)g
+(con)m(v)m(en)m(tional)h(LZ77/LZ78-based)g(compressors,)390
+2850 y(and)k(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the)f(PPM)g
+(family)f(of)i(statistical)f(compressors.)390 3001 y(The)e
+(command-line)e(options)i(are)h(delib)s(erately)d(v)m(ery)i(similar)e
+(to)j(those)g(of)f(GNU)h Fj(gzip)p Fl(,)390 3104 y(but)h(they)g(are)h
+(not)g(iden)m(tical.)390 3255 y Fj(bzip2)f Fl(exp)s(ects)h(a)g(list)f
+(of)h(\014le)f(names)h(to)h(accompan)m(y)h(the)e(command-line)e
+(\015ags.)43 b(Eac)m(h)390 3359 y(\014le)e(is)h(replaced)g(b)m(y)g(a)h
+(compressed)f(v)m(ersion)g(of)g(itself,)i(with)e(the)g(name)g
+Fj(original_)390 3463 y(name.bz2)p Fl(.)49 b(Eac)m(h)34
+b(compressed)g(\014le)f(has)g(the)h(same)g(mo)s(di\014cation)e(date,)k
+(p)s(ermissions,)390 3567 y(and,)24 b(when)f(p)s(ossible,)f(o)m
+(wnership)f(as)j(the)f(corresp)s(onding)f(original,)h(so)g(that)h
+(these)g(prop-)390 3671 y(erties)34 b(can)g(b)s(e)f(correctly)i
+(restored)f(at)g(decompression)f(time.)51 b(File)34 b(name)g(handling)d
+(is)390 3774 y(naiv)m(e)26 b(in)f(the)i(sense)f(that)h(there)f(is)f(no)
+i(mec)m(hanism)e(for)h(preserving)f(original)f(\014le)i(names,)390
+3878 y(p)s(ermissions,)37 b(o)m(wnerships)f(or)h(dates)i(in)d
+(\014lesystems)h(whic)m(h)g(lac)m(k)h(these)g(concepts,)j(or)390
+3982 y(ha)m(v)m(e)32 b(serious)d(\014le)g(name)i(length)f
+(restrictions,)f(suc)m(h)h(as)h(MS-DOS.)390 4133 y Fj(bzip2)26
+b Fl(and)h Fj(bunzip2)e Fl(will)f(b)m(y)k(default)e(not)i(o)m(v)m
+(erwrite)g(existing)e(\014les.)38 b(If)27 b(y)m(ou)h(w)m(an)m(t)g(this)
+390 4237 y(to)j(happ)s(en,)e(sp)s(ecify)g(the)i Fj(-f)e
+Fl(\015ag.)390 4388 y(If)34 b(no)h(\014le)f(names)g(are)i(sp)s
+(eci\014ed,)e Fj(bzip2)f Fl(compresses)i(from)f(standard)g(input)f(to)j
+(stan-)390 4491 y(dard)c(output.)49 b(In)32 b(this)g(case,)k
+Fj(bzip2)31 b Fl(will)g(decline)h(to)i(write)e(compressed)h(output)g
+(to)h(a)390 4595 y(terminal,)29 b(as)i(this)e(w)m(ould)g(b)s(e)h(en)m
+(tirely)f(incomprehensible)e(and)j(therefore)h(p)s(oin)m(tless.)390
+4746 y Fj(bunzip2)36 b Fl(\(or)j Fj(bzip2)29 b(-d)p Fl(\))37
+b(decompresses)i(all)e(sp)s(eci\014ed)f(\014les.)63 b(Files)37
+b(whic)m(h)g(w)m(ere)i(not)390 4850 y(created)e(b)m(y)f
+Fj(bzip2)f Fl(will)e(b)s(e)i(detected)j(and)d(ignored,)i(and)e(a)i(w)m
+(arning)d(issued.)56 b Fj(bzip2)390 4954 y Fl(attempts)31
+b(to)f(guess)g(the)g(\014lename)f(for)h(the)g(decompressed)f(\014le)g
+(from)h(that)g(of)g(the)g(com-)390 5058 y(pressed)f(\014le)h(as)h
+(follo)m(ws:)570 5209 y Fj(filename.bz2)57 b Fl(b)s(ecomes)31
+b Fj(filename)570 5340 y(filename.bz)58 b Fl(b)s(ecomes)30
+b Fj(filename)p eop
+%%Page: 4 5
+4 4 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(4)570 299 y Fj(filename.tbz2)27
+b Fl(b)s(ecomes)j Fj(filename.tar)570 470 y(filename.tbz)57
+b Fl(b)s(ecomes)31 b Fj(filename.tar)570 641 y(anyothername)57
+b Fl(b)s(ecomes)31 b Fj(anyothername.out)390 859 y Fl(If)j(the)h
+(\014le)e(do)s(es)i(not)f(end)g(in)f(one)i(of)g(the)g(recognised)f
+(endings,)g Fj(.bz2)p Fl(,)h Fj(.bz)p Fl(,)g Fj(.tbz2)e
+Fl(or)390 963 y Fj(.tbz)p Fl(,)h Fj(bzip2)f Fl(complains)f(that)j(it)e
+(cannot)i(guess)f(the)g(name)h(of)f(the)g(original)e(\014le,)j(and)390
+1067 y(uses)30 b(the)g(original)f(name)h(with)g Fj(.out)f
+Fl(app)s(ended.)390 1218 y(As)j(with)f(compression,)h(supplying)c(no)k
+(\014lenames)f(causes)i(decompression)e(from)h(stan-)390
+1321 y(dard)d(input)g(to)i(standard)e(output.)390 1472
+y Fj(bunzip2)k Fl(will)g(correctly)j(decompress)e(a)i(\014le)e(whic)m
+(h)g(is)h(the)g(concatenation)i(of)e(t)m(w)m(o)i(or)390
+1576 y(more)j(compressed)f(\014les.)67 b(The)39 b(result)g(is)g(the)g
+(concatenation)i(of)f(the)g(corresp)s(onding)390 1680
+y(uncompressed)c(\014les.)59 b(In)m(tegrit)m(y)38 b(testing)f(\()p
+Fj(-t)p Fl(\))g(of)g(concatenated)i(compressed)e(\014les)f(is)390
+1784 y(also)30 b(supp)s(orted.)390 1935 y(Y)-8 b(ou)40
+b(can)g(also)f(compress)g(or)g(decompress)g(\014les)g(to)h(the)f
+(standard)g(output)g(b)m(y)g(giving)390 2039 y(the)30
+b Fj(-c)g Fl(\015ag.)40 b(Multiple)28 b(\014les)h(ma)m(y)i(b)s(e)e
+(compressed)h(and)f(decompressed)h(lik)m(e)f(this.)39
+b(The)390 2142 y(resulting)31 b(outputs)i(are)h(fed)f(sequen)m(tially)f
+(to)i(stdout.)49 b(Compression)32 b(of)h(m)m(ultiple)e(\014les)390
+2246 y(in)24 b(this)g(manner)h(generates)h(a)g(stream)f(con)m(taining)g
+(m)m(ultiple)e(compressed)i(\014le)f(represen-)390 2350
+y(tations.)58 b(Suc)m(h)36 b(a)g(stream)g(can)h(b)s(e)e(decompressed)h
+(correctly)h(only)e(b)m(y)h Fj(bzip2)e Fl(v)m(ersion)390
+2454 y(0.9.0)g(or)e(later.)47 b(Earlier)30 b(v)m(ersions)i(of)g
+Fj(bzip2)f Fl(will)f(stop)i(after)h(decompressing)e(the)i(\014rst)390
+2558 y(\014le)c(in)h(the)g(stream.)390 2709 y Fj(bzcat)f
+Fl(\(or)i Fj(bzip2)e(-dc)p Fl(\))g(decompresses)i(all)e(sp)s(eci\014ed)
+g(\014les)g(to)i(the)g(standard)e(output.)390 2860 y
+Fj(bzip2)f Fl(will)g(read)i(argumen)m(ts)g(from)f(the)h(en)m(vironmen)m
+(t)g(v)-5 b(ariables)28 b Fj(BZIP2)h Fl(and)g Fj(BZIP)p
+Fl(,)g(in)390 2963 y(that)24 b(order,)g(and)f(will)e(pro)s(cess)i(them)
+g(b)s(efore)g(an)m(y)h(argumen)m(ts)f(read)h(from)f(the)g(command)390
+3067 y(line.)39 b(This)29 b(giv)m(es)h(a)h(con)m(v)m(enien)m(t)h(w)m(a)
+m(y)f(to)g(supply)d(default)i(argumen)m(ts.)390 3218
+y(Compression)h(is)h(alw)m(a)m(ys)i(p)s(erformed,)e(ev)m(en)h(if)f(the)
+h(compressed)g(\014le)f(is)g(sligh)m(tly)f(larger)390
+3322 y(than)26 b(the)g(original.)38 b(Files)25 b(of)h(less)g(than)g(ab)
+s(out)g(one)g(h)m(undred)e(b)m(ytes)j(tend)f(to)h(get)g(larger,)390
+3426 y(since)34 b(the)g(compression)f(mec)m(hanism)h(has)f(a)i(constan)
+m(t)g(o)m(v)m(erhead)h(in)d(the)h(region)g(of)g(50)390
+3529 y(b)m(ytes.)54 b(Random)34 b(data)h(\(including)d(the)i(output)h
+(of)f(most)h(\014le)f(compressors\))h(is)e(co)s(ded)390
+3633 y(at)e(ab)s(out)f(8.05)i(bits)d(p)s(er)h(b)m(yte,)h(giving)e(an)h
+(expansion)g(of)g(around)g(0.5\045.)390 3784 y(As)h(a)g(self-c)m(hec)m
+(k)h(for)e(y)m(our)h(protection,)g Fj(bzip2)f Fl(uses)g(32-bit)h(CR)m
+(Cs)f(to)i(mak)m(e)f(sure)f(that)390 3888 y(the)45 b(decompressed)f(v)m
+(ersion)g(of)g(a)h(\014le)e(is)h(iden)m(tical)f(to)i(the)g(original.)81
+b(This)43 b(guards)390 3992 y(against)i(corruption)e(of)h(the)h
+(compressed)f(data,)49 b(and)44 b(against)h(undetected)g(bugs)e(in)390
+4096 y Fj(bzip2)35 b Fl(\(hop)s(efully)e(v)m(ery)k(unlik)m(ely\).)56
+b(The)36 b(c)m(hances)h(of)f(data)h(corruption)e(going)h(unde-)390
+4199 y(tected)g(is)e(microscopic,)h(ab)s(out)f(one)h(c)m(hance)g(in)f
+(four)g(billion)d(for)j(eac)m(h)i(\014le)d(pro)s(cessed.)390
+4303 y(Be)38 b(a)m(w)m(are,)k(though,)d(that)f(the)g(c)m(hec)m(k)i(o)s
+(ccurs)d(up)s(on)f(decompression,)j(so)f(it)f(can)h(only)390
+4407 y(tell)28 b(y)m(ou)g(that)i(something)d(is)h(wrong.)40
+b(It)28 b(can't)i(help)d(y)m(ou)i(reco)m(v)m(er)h(the)e(original)f
+(uncom-)390 4511 y(pressed)h(data.)41 b(Y)-8 b(ou)30
+b(can)f(use)g Fj(bzip2recover)d Fl(to)k(try)f(to)h(reco)m(v)m(er)h
+(data)f(from)e(damaged)390 4614 y(\014les.)390 4766 y(Return)22
+b(v)-5 b(alues:)37 b(0)23 b(for)g(a)g(normal)f(exit,)j(1)e(for)g(en)m
+(vironmen)m(tal)f(problems)f(\(\014le)i(not)g(found,)390
+4869 y(in)m(v)-5 b(alid)30 b(\015ags,)k(I/O)f(errors,)g(&c\),)h(2)f(to)
+g(indicate)f(a)h(corrupt)f(compressed)h(\014le,)f(3)i(for)e(an)390
+4973 y(in)m(ternal)d(consistency)h(error)g(\(eg,)i(bug\))e(whic)m(h)f
+(caused)i Fj(bzip2)e Fl(to)i(panic.)390 5304 y Ff(OPTIONS)p
+eop
+%%Page: 5 6
+5 5 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(5)390 299 y Fj(-c)30
+b(--stdout)870 403 y Fl(Compress)f(or)i(decompress)f(to)h(standard)e
+(output.)390 557 y Fj(-d)h(--decompress)870 661 y Fl(F)-8
+b(orce)44 b(decompression.)77 b Fj(bzip2)p Fl(,)44 b
+Fj(bunzip2)d Fl(and)h Fj(bzcat)f Fl(are)i(really)f(the)870
+764 y(same)27 b(program,)h(and)e(the)i(decision)d(ab)s(out)i(what)g
+(actions)g(to)h(tak)m(e)g(is)e(done)870 868 y(on)k(the)h(basis)e(of)i
+(whic)m(h)e(name)h(is)g(used.)40 b(This)28 b(\015ag)j(o)m(v)m(errides)f
+(that)h(mec)m(h-)870 972 y(anism,)e(and)h(forces)h(bzip2)e(to)i
+(decompress.)390 1126 y Fj(-z)f(--compress)870 1230 y
+Fl(The)39 b(complemen)m(t)h(to)g Fj(-d)p Fl(:)59 b(forces)40
+b(compression,)h(regardless)d(of)i(the)g(in-)870 1334
+y(v)m(ok)-5 b(ation)31 b(name.)390 1488 y Fj(-t)f(--test)8
+b Fl(Chec)m(k)33 b(in)m(tegrit)m(y)j(of)f(the)g(sp)s(eci\014ed)e
+(\014le\(s\),)k(but)d(don't)h(decompress)g(them.)870
+1591 y(This)40 b(really)g(p)s(erforms)g(a)i(trial)e(decompression)h
+(and)g(thro)m(ws)g(a)m(w)m(a)m(y)j(the)870 1695 y(result.)390
+1849 y Fj(-f)30 b(--force)870 1953 y Fl(F)-8 b(orce)31
+b(o)m(v)m(erwrite)f(of)g(output)f(\014les.)40 b(Normally)-8
+b(,)29 b Fj(bzip2)f Fl(will)f(not)j(o)m(v)m(erwrite)870
+2057 y(existing)e(output)g(\014les.)39 b(Also)28 b(forces)h
+Fj(bzip2)e Fl(to)i(break)g(hard)e(links)f(to)k(\014les,)870
+2161 y(whic)m(h)f(it)h(otherwise)g(w)m(ouldn't)f(do.)390
+2315 y Fj(-k)h(--keep)8 b Fl(Keep)24 b(\(don't)i(delete\))h(input)d
+(\014les)g(during)g(compression)h(or)h(decompression.)390
+2469 y Fj(-s)k(--small)870 2573 y Fl(Reduce)23 b(memory)f(usage,)j(for)
+d(compression,)h(decompression)f(and)g(testing.)870 2676
+y(Files)f(are)i(decompressed)e(and)h(tested)h(using)e(a)h(mo)s
+(di\014ed)e(algorithm)h(whic)m(h)870 2780 y(only)30 b(requires)g(2.5)j
+(b)m(ytes)f(p)s(er)e(blo)s(c)m(k)h(b)m(yte.)44 b(This)30
+b(means)h(an)m(y)h(\014le)e(can)i(b)s(e)870 2884 y(decompressed)d(in)f
+(2300k)j(of)e(memory)-8 b(,)30 b(alb)s(eit)e(at)i(ab)s(out)f(half)g
+(the)g(normal)870 2988 y(sp)s(eed.)870 3117 y(During)42
+b(compression,)k Fj(-s)d Fl(selects)h(a)g(blo)s(c)m(k)g(size)f(of)h
+(200k,)k(whic)m(h)42 b(lim-)870 3220 y(its)33 b(memory)g(use)g(to)h
+(around)e(the)i(same)f(\014gure,)h(at)g(the)g(exp)s(ense)f(of)g(y)m
+(our)870 3324 y(compression)g(ratio.)50 b(In)33 b(short,)i(if)d(y)m
+(our)i(mac)m(hine)f(is)g(lo)m(w)g(on)h(memory)f(\(8)870
+3428 y(megab)m(ytes)42 b(or)e(less\),)j(use)d(-s)g(for)g(ev)m
+(erything.)71 b(See)40 b(MEMOR)-8 b(Y)41 b(MAN-)870 3532
+y(A)m(GEMENT)31 b(b)s(elo)m(w.)390 3686 y Fj(-q)f(--quiet)870
+3790 y Fl(Suppress)j(non-essen)m(tial)j(w)m(arning)e(messages.)58
+b(Messages)38 b(p)s(ertaining)33 b(to)870 3893 y(I/O)d(errors)g(and)g
+(other)h(critical)e(ev)m(en)m(ts)j(will)27 b(not)k(b)s(e)f(suppressed.)
+390 4047 y Fj(-v)g(--verbose)870 4151 y Fl(V)-8 b(erb)s(ose)28
+b(mo)s(de)f({)i(sho)m(w)e(the)h(compression)f(ratio)h(for)f(eac)m(h)i
+(\014le)e(pro)s(cessed.)870 4255 y(F)-8 b(urther)30 b
+Fj(-v)p Fl('s)g(increase)g(the)g(v)m(erb)s(osit)m(y)g(lev)m(el,)h(sp)s
+(ewing)d(out)j(lots)f(of)g(infor-)870 4359 y(mation)g(whic)m(h)f(is)h
+(primarily)d(of)j(in)m(terest)h(for)f(diagnostic)g(purp)s(oses.)390
+4513 y Fj(-L)g(--license)e(-V)h(--version)870 4617 y
+Fl(Displa)m(y)h(the)g(soft)m(w)m(are)i(v)m(ersion,)e(license)f(terms)i
+(and)e(conditions.)390 4771 y Fj(-1)h(to)g(-9)72 b Fl(Set)35
+b(the)g(blo)s(c)m(k)f(size)h(to)g(100)h(k,)g(200)g(k)f(..)53
+b(900)36 b(k)f(when)f(compressing.)53 b(Has)870 4875
+y(no)41 b(e\013ect)h(when)d(decompressing.)71 b(See)41
+b(MEMOR)-8 b(Y)41 b(MANA)m(GEMENT)870 4978 y(b)s(elo)m(w.)390
+5132 y Fj(--)324 b Fl(T)-8 b(reats)25 b(all)e(subsequen)m(t)g(argumen)m
+(ts)i(as)f(\014le)g(names,)h(ev)m(en)g(if)e(they)i(start)f(with)870
+5236 y(a)32 b(dash.)43 b(This)29 b(is)h(so)i(y)m(ou)g(can)f(handle)f
+(\014les)g(with)g(names)i(b)s(eginning)c(with)870 5340
+y(a)j(dash,)f(for)g(example:)40 b Fj(bzip2)29 b(--)h(-myfilename)p
+Fl(.)p eop
+%%Page: 6 7
+6 6 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(6)390 299 y Fj(--repetitive-fast)390
+427 y(--repetitive-best)870 530 y Fl(These)34 b(\015ags)g(are)h
+(redundan)m(t)e(in)g(v)m(ersions)g(0.9.5)j(and)e(ab)s(o)m(v)m(e.)53
+b(They)34 b(pro-)870 634 y(vided)h(some)i(coarse)g(con)m(trol)g(o)m(v)m
+(er)g(the)g(b)s(eha)m(viour)e(of)h(the)g(sorting)g(algo-)870
+738 y(rithm)h(in)h(earlier)g(v)m(ersions,)j(whic)m(h)d(w)m(as)h
+(sometimes)h(useful.)65 b(0.9.5)41 b(and)870 842 y(ab)s(o)m(v)m(e)34
+b(ha)m(v)m(e)g(an)f(impro)m(v)m(ed)g(algorithm)f(whic)m(h)f(renders)h
+(these)h(\015ags)h(irrel-)870 946 y(ev)-5 b(an)m(t.)390
+1190 y Ff(MEMOR)-10 b(Y)40 b(MANA)m(GEMENT)390 1377 y
+Fj(bzip2)25 b Fl(compresses)i(large)g(\014les)e(in)g(blo)s(c)m(ks.)39
+b(The)26 b(blo)s(c)m(k)h(size)f(a\013ects)i(b)s(oth)e(the)h(compres-)
+390 1481 y(sion)39 b(ratio)g(ac)m(hiev)m(ed,)k(and)d(the)f(amoun)m(t)i
+(of)e(memory)h(needed)f(for)h(compression)f(and)390 1585
+y(decompression.)59 b(The)36 b(\015ags)h Fj(-1)f Fl(through)h
+Fj(-9)f Fl(sp)s(ecify)f(the)i(blo)s(c)m(k)g(size)f(to)i(b)s(e)e
+(100,000)390 1688 y(b)m(ytes)29 b(through)e(900,000)k(b)m(ytes)d(\(the)
+h(default\))e(resp)s(ectiv)m(ely)-8 b(.)40 b(A)m(t)29
+b(decompression)e(time,)390 1792 y(the)32 b(blo)s(c)m(k)g(size)g(used)g
+(for)g(compression)f(is)g(read)h(from)g(the)g(header)g(of)h(the)f
+(compressed)390 1896 y(\014le,)j(and)f Fj(bunzip2)e Fl(then)i(allo)s
+(cates)h(itself)e(just)h(enough)g(memory)g(to)i(decompress)e(the)390
+2000 y(\014le.)39 b(Since)29 b(blo)s(c)m(k)g(sizes)g(are)h(stored)f(in)
+f(compressed)h(\014les,)g(it)g(follo)m(ws)f(that)i(the)g(\015ags)g
+Fj(-1)390 2103 y Fl(to)h Fj(-9)f Fl(are)h(irrelev)-5
+b(an)m(t)29 b(to)i(and)f(so)h(ignored)e(during)f(decompression.)390
+2255 y(Compression)h(and)g(decompression)h(requiremen)m(ts,)f(in)g(b)m
+(ytes,)j(can)e(b)s(e)g(estimated)h(as:)869 2406 y Fj(Compression:)140
+b(400k)46 b(+)i(\()f(8)h(x)f(block)f(size)h(\))869 2613
+y(Decompression:)d(100k)i(+)i(\()f(4)h(x)f(block)f(size)h(\),)g(or)1585
+2717 y(100k)f(+)i(\()f(2.5)g(x)g(block)g(size)f(\))390
+2868 y Fl(Larger)29 b(blo)s(c)m(k)f(sizes)h(giv)m(e)g(rapidly)d
+(diminishing)e(marginal)k(returns.)39 b(Most)29 b(of)g(the)g(com-)390
+2972 y(pression)d(comes)j(from)f(the)g(\014rst)g(t)m(w)m(o)h(or)f
+(three)h(h)m(undred)d(k)i(of)g(blo)s(c)m(k)g(size,)g(a)h(fact)g(w)m
+(orth)390 3075 y(b)s(earing)j(in)f(mind)g(when)h(using)f
+Fj(bzip2)h Fl(on)g(small)g(mac)m(hines.)47 b(It)33 b(is)f(also)h(imp)s
+(ortan)m(t)f(to)390 3179 y(appreciate)j(that)h(the)f(decompression)f
+(memory)h(requiremen)m(t)f(is)h(set)g(at)h(compression)390
+3283 y(time)30 b(b)m(y)g(the)h(c)m(hoice)g(of)g(blo)s(c)m(k)f(size.)390
+3434 y(F)-8 b(or)45 b(\014les)f(compressed)g(with)g(the)g(default)g
+(900k)i(blo)s(c)m(k)e(size,)49 b Fj(bunzip2)42 b Fl(will)g(require)390
+3538 y(ab)s(out)29 b(3700)j(kb)m(ytes)e(to)h(decompress.)40
+b(T)-8 b(o)30 b(supp)s(ort)e(decompression)h(of)h(an)m(y)g(\014le)f(on)
+g(a)i(4)390 3642 y(megab)m(yte)h(mac)m(hine,)d Fj(bunzip2)f
+Fl(has)i(an)g(option)f(to)i(decompress)e(using)g(appro)m(ximately)390
+3745 y(half)k(this)g(amoun)m(t)i(of)f(memory)-8 b(,)36
+b(ab)s(out)e(2300)i(kb)m(ytes.)53 b(Decompression)34
+b(sp)s(eed)g(is)f(also)390 3849 y(halv)m(ed,)i(so)f(y)m(ou)h(should)d
+(use)h(this)g(option)h(only)f(where)h(necessary)-8 b(.)53
+b(The)33 b(relev)-5 b(an)m(t)35 b(\015ag)390 3953 y(is)29
+b Fj(-s)p Fl(.)390 4104 y(In)34 b(general,)i(try)f(and)f(use)g(the)h
+(largest)h(blo)s(c)m(k)e(size)h(memory)f(constrain)m(ts)h(allo)m(w,)h
+(since)390 4208 y(that)45 b(maximises)f(the)h(compression)f(ac)m(hiev)m
+(ed.)85 b(Compression)43 b(and)h(decompression)390 4311
+y(sp)s(eed)30 b(are)g(virtually)e(una\013ected)j(b)m(y)f(blo)s(c)m(k)g
+(size.)390 4463 y(Another)25 b(signi\014can)m(t)f(p)s(oin)m(t)g
+(applies)f(to)j(\014les)e(whic)m(h)g(\014t)h(in)e(a)j(single)d(blo)s(c)
+m(k)i({)g(that)h(means)390 4566 y(most)g(\014les)g(y)m(ou'd)g(encoun)m
+(ter)h(using)d(a)j(large)f(blo)s(c)m(k)g(size.)39 b(The)25
+b(amoun)m(t)i(of)f(real)g(memory)390 4670 y(touc)m(hed)38
+b(is)e(prop)s(ortional)f(to)j(the)f(size)g(of)h(the)f(\014le,)h(since)f
+(the)g(\014le)g(is)f(smaller)g(than)h(a)390 4774 y(blo)s(c)m(k.)49
+b(F)-8 b(or)35 b(example,)f(compressing)e(a)i(\014le)e(20,000)k(b)m
+(ytes)e(long)f(with)f(the)i(\015ag)g Fj(-9)f Fl(will)390
+4878 y(cause)28 b(the)f(compressor)g(to)h(allo)s(cate)f(around)f(7600k)
+j(of)e(memory)-8 b(,)28 b(but)f(only)f(touc)m(h)i(400k)390
+4981 y Fj(+)h Fl(20000)j(*)e(8)g(=)f(560)i(kb)m(ytes)f(of)g(it.)40
+b(Similarly)-8 b(,)26 b(the)k(decompressor)f(will)e(allo)s(cate)j
+(3700k)390 5085 y(but)g(only)f(touc)m(h)i(100k)h Fj(+)e
+Fl(20000)i(*)f(4)g(=)f(180)i(kb)m(ytes.)390 5236 y(Here)41
+b(is)f(a)i(table)f(whic)m(h)e(summarises)g(the)j(maxim)m(um)d(memory)i
+(usage)h(for)e(di\013eren)m(t)390 5340 y(blo)s(c)m(k)25
+b(sizes.)38 b(Also)25 b(recorded)g(is)f(the)i(total)g(compressed)e
+(size)h(for)g(14)h(\014les)e(of)i(the)f(Calgary)p eop
+%%Page: 7 8
+7 7 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(7)390 299 y(T)-8 b(ext)38
+b(Compression)d(Corpus)h(totalling)h(3,141,622)k(b)m(ytes.)61
+b(This)36 b(column)g(giv)m(es)i(some)390 403 y(feel)23
+b(for)f(ho)m(w)h(compression)f(v)-5 b(aries)23 b(with)e(blo)s(c)m(k)i
+(size.)38 b(These)23 b(\014gures)f(tend)g(to)i(understate)390
+506 y(the)g(adv)-5 b(an)m(tage)26 b(of)e(larger)f(blo)s(c)m(k)h(sizes)f
+(for)h(larger)f(\014les,)h(since)g(the)g(Corpus)e(is)h(dominated)390
+610 y(b)m(y)30 b(smaller)f(\014les.)1107 761 y Fj(Compress)141
+b(Decompress)g(Decompress)f(Corpus)773 865 y(Flag)238
+b(usage)285 b(usage)332 b(-s)48 b(usage)237 b(Size)821
+1073 y(-1)286 b(1200k)332 b(500k)429 b(350k)285 b(914704)821
+1176 y(-2)h(2000k)332 b(900k)429 b(600k)285 b(877703)821
+1280 y(-3)h(2800k)f(1300k)428 b(850k)285 b(860338)821
+1384 y(-4)h(3600k)f(1700k)380 b(1100k)285 b(846899)821
+1488 y(-5)h(4400k)f(2100k)380 b(1350k)285 b(845160)821
+1591 y(-6)h(5200k)f(2500k)380 b(1600k)285 b(838626)821
+1695 y(-7)h(6100k)f(2900k)380 b(1850k)285 b(834096)821
+1799 y(-8)h(6800k)f(3300k)380 b(2100k)285 b(828642)821
+1903 y(-9)h(7600k)f(3700k)380 b(2350k)285 b(828642)390
+2147 y Ff(RECO)m(VERING)37 b(D)m(A)-10 b(T)g(A)40 b(FR)m(OM)h(D)m(AMA)m
+(GED)e(FILES)390 2333 y Fj(bzip2)25 b Fl(compresses)h(\014les)g(in)f
+(blo)s(c)m(ks,)h(usually)e(900kb)m(ytes)29 b(long.)39
+b(Eac)m(h)27 b(blo)s(c)m(k)e(is)h(handled)390 2437 y(indep)s(enden)m
+(tly)-8 b(.)47 b(If)32 b(a)i(media)e(or)h(transmission)e(error)i
+(causes)h(a)f(m)m(ulti-blo)s(c)m(k)f Fj(.bz2)g Fl(\014le)390
+2541 y(to)k(b)s(ecome)h(damaged,)g(it)e(ma)m(y)i(b)s(e)e(p)s(ossible)e
+(to)k(reco)m(v)m(er)g(data)f(from)g(the)f(undamaged)390
+2645 y(blo)s(c)m(ks)30 b(in)f(the)h(\014le.)390 2796
+y(The)j(compressed)h(represen)m(tation)f(of)h(eac)m(h)h(blo)s(c)m(k)e
+(is)g(delimited)e(b)m(y)j(a)g(48-bit)g(pattern,)390 2900
+y(whic)m(h)27 b(mak)m(es)j(it)e(p)s(ossible)e(to)j(\014nd)e(the)i(blo)s
+(c)m(k)f(b)s(oundaries)e(with)i(reasonable)g(certain)m(t)m(y)-8
+b(.)390 3003 y(Eac)m(h)34 b(blo)s(c)m(k)f(also)g(carries)g(its)g(o)m
+(wn)g(32-bit)g(CR)m(C,)h(so)f(damaged)h(blo)s(c)m(ks)f(can)g(b)s(e)g
+(distin-)390 3107 y(guished)c(from)h(undamaged)g(ones.)390
+3258 y Fj(bzip2recover)37 b Fl(is)j(a)h(simple)e(program)h(whose)g
+(purp)s(ose)f(is)h(to)i(searc)m(h)f(for)f(blo)s(c)m(ks)g(in)390
+3362 y Fj(.bz2)34 b Fl(\014les,)i(and)f(write)f(eac)m(h)j(blo)s(c)m(k)d
+(out)i(in)m(to)f(its)g(o)m(wn)g Fj(.bz2)f Fl(\014le.)55
+b(Y)-8 b(ou)36 b(can)f(then)g(use)390 3466 y Fj(bzip2)29
+b(-t)c Fl(to)i(test)f(the)g(in)m(tegrit)m(y)g(of)g(the)g(resulting)e
+(\014les,)i(and)f(decompress)h(those)g(whic)m(h)390 3569
+y(are)31 b(undamaged.)390 3721 y Fj(bzip2recover)41 b
+Fl(tak)m(es)46 b(a)f(single)e(argumen)m(t,)49 b(the)44
+b(name)h(of)g(the)f(damaged)h(\014le,)j(and)390 3824
+y(writes)33 b(a)i(n)m(um)m(b)s(er)d(of)j(\014les)e Fj(rec0001file.bz2)p
+Fl(,)e Fj(rec0002file.bz2)p Fl(,)g(etc,)36 b(con)m(taining)390
+3928 y(the)42 b(extracted)g(blo)s(c)m(ks.)74 b(The)41
+b(output)g(\014lenames)f(are)i(designed)e(so)i(that)g(the)g(use)f(of)
+390 4032 y(wildcards)30 b(in)h(subsequen)m(t)h(pro)s(cessing)f({)i(for)
+g(example,)g Fj(bzip2)c(-dc)g(rec*file.bz2)e(>)390 4136
+y(recovered_data)f Fl({)31 b(lists)e(the)i(\014les)e(in)g(the)i
+(correct)g(order.)390 4287 y Fj(bzip2recover)38 b Fl(should)i(b)s(e)g
+(of)i(most)g(use)f(dealing)f(with)g(large)i Fj(.bz2)e
+Fl(\014les,)k(as)d(these)390 4390 y(will)29 b(con)m(tain)j(man)m(y)g
+(blo)s(c)m(ks.)45 b(It)32 b(is)f(clearly)g(futile)f(to)i(use)g(it)f(on)
+h(damaged)g(single-blo)s(c)m(k)390 4494 y(\014les,)g(since)f(a)h
+(damaged)h(blo)s(c)m(k)e(cannot)i(b)s(e)e(reco)m(v)m(ered.)47
+b(If)32 b(y)m(ou)g(wish)e(to)j(minimise)c(an)m(y)390
+4598 y(p)s(oten)m(tial)36 b(data)i(loss)e(through)g(media)h(or)f
+(transmission)f(errors,)j(y)m(ou)f(migh)m(t)g(consider)390
+4702 y(compressing)29 b(with)g(a)i(smaller)e(blo)s(c)m(k)h(size.)390
+4946 y Ff(PERF)m(ORMANCE)39 b(NOTES)390 5132 y Fl(The)f(sorting)f
+(phase)h(of)h(compression)e(gathers)i(together)h(similar)35
+b(strings)i(in)g(the)i(\014le.)390 5236 y(Because)54
+b(of)f(this,)58 b(\014les)52 b(con)m(taining)g(v)m(ery)h(long)g(runs)e
+(of)i(rep)s(eated)g(sym)m(b)s(ols,)58 b(lik)m(e)390 5340
+y Fj(")p Fl(aabaabaabaab)e(...)p Fj(")g Fl(\(rep)s(eated)g(sev)m(eral)f
+(h)m(undred)e(times\))i(ma)m(y)h(compress)f(more)p eop
+%%Page: 8 9
+8 8 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(8)390 299 y(slo)m(wly)33
+b(than)g(normal.)50 b(V)-8 b(ersions)33 b(0.9.5)i(and)f(ab)s(o)m(v)m(e)
+h(fare)e(m)m(uc)m(h)h(b)s(etter)g(than)f(previous)390
+403 y(v)m(ersions)i(in)g(this)f(resp)s(ect.)57 b(The)35
+b(ratio)h(b)s(et)m(w)m(een)h(w)m(orst-case)g(and)e(a)m(v)m(erage-case)
+40 b(com-)390 506 y(pression)e(time)h(is)f(in)g(the)h(region)g(of)h
+(10:1.)69 b(F)-8 b(or)40 b(previous)e(v)m(ersions,)j(this)d(\014gure)h
+(w)m(as)390 610 y(more)f(lik)m(e)g(100:1.)66 b(Y)-8 b(ou)38
+b(can)h(use)e(the)i Fj(-vvvv)d Fl(option)i(to)h(monitor)e(progress)h
+(in)f(great)390 714 y(detail,)30 b(if)f(y)m(ou)i(w)m(an)m(t.)390
+865 y(Decompression)f(sp)s(eed)g(is)f(una\013ected)i(b)m(y)f(these)h
+(phenomena.)390 1016 y Fj(bzip2)i Fl(usually)g(allo)s(cates)i(sev)m
+(eral)f(megab)m(ytes)j(of)d(memory)h(to)g(op)s(erate)h(in,)e(and)g
+(then)390 1120 y(c)m(harges)k(all)d(o)m(v)m(er)j(it)f(in)e(a)i(fairly)e
+(random)h(fashion.)59 b(This)34 b(means)j(that)g(p)s(erformance,)390
+1224 y(b)s(oth)27 b(for)h(compressing)f(and)g(decompressing,)h(is)f
+(largely)g(determined)g(b)m(y)h(the)g(sp)s(eed)f(at)390
+1327 y(whic)m(h)35 b(y)m(our)h(mac)m(hine)g(can)g(service)g(cac)m(he)i
+(misses.)57 b(Because)37 b(of)g(this,)f(small)f(c)m(hanges)390
+1431 y(to)f(the)f(co)s(de)h(to)f(reduce)g(the)h(miss)d(rate)j(ha)m(v)m
+(e)h(b)s(een)d(observ)m(ed)h(to)h(giv)m(e)g(disprop)s(ortion-)390
+1535 y(ately)i(large)f(p)s(erformance)f(impro)m(v)m(emen)m(ts.)56
+b(I)35 b(imagine)f Fj(bzip2)g Fl(will)e(p)s(erform)i(b)s(est)h(on)390
+1639 y(mac)m(hines)30 b(with)f(v)m(ery)i(large)f(cac)m(hes.)390
+1885 y Ff(CA)-14 b(VEA)k(TS)390 2072 y Fl(I/O)38 b(error)g(messages)h
+(are)f(not)h(as)f(helpful)e(as)i(they)g(could)f(b)s(e.)64
+b Fj(bzip2)37 b Fl(tries)g(hard)g(to)390 2176 y(detect)29
+b(I/O)e(errors)g(and)f(exit)i(cleanly)-8 b(,)27 b(but)g(the)h(details)e
+(of)h(what)h(the)f(problem)f(is)g(some-)390 2280 y(times)k(seem)h
+(rather)f(misleading.)390 2431 y(This)j(man)m(ual)g(page)i(p)s(ertains)
+e(to)i(v)m(ersion)f(1.0)i(of)e Fj(bzip2)p Fl(.)51 b(Compressed)34
+b(data)h(created)390 2534 y(b)m(y)25 b(this)e(v)m(ersion)i(is)e(en)m
+(tirely)h(forw)m(ards)h(and)f(bac)m(kw)m(ards)h(compatible)f(with)f
+(the)i(previous)390 2638 y(public)18 b(releases,)24 b(v)m(ersions)c
+(0.1pl2,)k(0.9.0)e(and)f(0.9.5,)k(but)20 b(with)g(the)h(follo)m(wing)e
+(exception:)390 2742 y(0.9.0)43 b(and)e(ab)s(o)m(v)m(e)h(can)g
+(correctly)f(decompress)g(m)m(ultiple)e(concatenated)k(compressed)390
+2846 y(\014les.)c(0.1pl2)30 b(cannot)g(do)f(this;)f(it)h(will)e(stop)i
+(after)h(decompressing)e(just)g(the)i(\014rst)e(\014le)g(in)390
+2949 y(the)j(stream.)390 3100 y Fj(bzip2recover)20 b
+Fl(uses)k(32-bit)g(in)m(tegers)f(to)i(represen)m(t)f(bit)e(p)s
+(ositions)g(in)g(compressed)i(\014les,)390 3204 y(so)j(it)f(cannot)i
+(handle)d(compressed)i(\014les)f(more)h(than)f(512)i(megab)m(ytes)h
+(long.)39 b(This)25 b(could)390 3308 y(easily)30 b(b)s(e)f(\014xed.)390
+3555 y Ff(A)m(UTHOR)390 3741 y Fl(Julian)f(Sew)m(ard,)i
+Fj(jseward@acm.org)p Fl(.)390 3892 y(The)24 b(ideas)f(em)m(b)s(o)s
+(died)f(in)h Fj(bzip2)f Fl(are)j(due)e(to)i(\(at)g(least\))g(the)f
+(follo)m(wing)e(p)s(eople:)37 b(Mic)m(hael)390 3996 y(Burro)m(ws)48
+b(and)g(Da)m(vid)h(Wheeler)f(\(for)h(the)g(blo)s(c)m(k)f(sorting)g
+(transformation\),)53 b(Da)m(vid)390 4100 y(Wheeler)45
+b(\(again,)50 b(for)45 b(the)g(Hu\013man)g(co)s(der\),)k(P)m(eter)d(F)
+-8 b(en)m(wic)m(k)46 b(\(for)g(the)f(structured)390 4204
+y(co)s(ding)26 b(mo)s(del)g(in)f(the)i(original)e Fj(bzip)p
+Fl(,)i(and)f(man)m(y)h(re\014nemen)m(ts\),)h(and)e(Alistair)f
+(Mo\013at,)390 4307 y(Radford)34 b(Neal)h(and)f(Ian)h(Witten)g(\(for)f
+(the)h(arithmetic)g(co)s(der)f(in)g(the)h(original)d
+Fj(bzip)p Fl(\).)390 4411 y(I)41 b(am)g(m)m(uc)m(h)h(indebted)e(for)h
+(their)f(help,)j(supp)s(ort)c(and)i(advice.)74 b(See)41
+b(the)h(man)m(ual)e(in)390 4515 y(the)28 b(source)g(distribution)23
+b(for)28 b(p)s(oin)m(ters)e(to)j(sources)e(of)h(do)s(cumen)m(tation.)40
+b(Christian)25 b(v)m(on)390 4619 y(Ro)s(ques)31 b(encouraged)h(me)g(to)
+g(lo)s(ok)f(for)h(faster)g(sorting)f(algorithms,)f(so)i(as)g(to)g(sp)s
+(eed)f(up)390 4723 y(compression.)47 b(Bela)34 b(Lubkin)c(encouraged)k
+(me)f(to)g(impro)m(v)m(e)g(the)g(w)m(orst-case)i(compres-)390
+4826 y(sion)25 b(p)s(erformance.)38 b(Man)m(y)26 b(p)s(eople)f(sen)m(t)
+h(patc)m(hes,)h(help)s(ed)d(with)g(p)s(ortabilit)m(y)f(problems,)390
+4930 y(len)m(t)30 b(mac)m(hines,)g(ga)m(v)m(e)j(advice)d(and)g(w)m(ere)
+h(generally)f(helpful.)p eop
+%%Page: 9 10
+9 9 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1927 b Fl(9)150 299 y Fh(3)80 b(Programming)53
+b(with)h Fg(libbzip2)150 568 y Fl(This)29 b(c)m(hapter)i(describ)s(es)d
+(the)j(programming)e(in)m(terface)i(to)g Fj(libbzip2)p
+Fl(.)150 725 y(F)-8 b(or)36 b(general)e(bac)m(kground)h(information,)f
+(particularly)f(ab)s(out)h(memory)h(use)f(and)g(p)s(erformance)g(as-)
+150 834 y(p)s(ects,)d(y)m(ou'd)f(b)s(e)g(w)m(ell)f(advised)g(to)j(read)
+e(Chapter)g(2)g(as)h(w)m(ell.)150 1124 y Fk(3.1)68 b(T)-11
+b(op-lev)l(el)46 b(structure)150 1316 y Fj(libbzip2)33
+b Fl(is)i(a)h(\015exible)e(library)f(for)j(compressing)f(and)g
+(decompressing)f(data)j(in)d(the)i Fj(bzip2)e Fl(data)150
+1426 y(format.)39 b(Although)24 b(pac)m(k)-5 b(aged)26
+b(as)e(a)h(single)e(en)m(tit)m(y)-8 b(,)27 b(it)d(helps)f(to)i(regard)g
+(the)g(library)d(as)i(three)h(separate)150 1535 y(parts:)40
+b(the)31 b(lo)m(w)f(lev)m(el)g(in)m(terface,)h(and)f(the)h(high)e(lev)m
+(el)h(in)m(terface,)h(and)f(some)h(utilit)m(y)d(functions.)150
+1692 y(The)38 b(structure)g(of)g Fj(libbzip2)p Fl('s)e(in)m(terfaces)j
+(is)e(similar)f(to)j(that)g(of)g(Jean-loup)e(Gailly's)g(and)h(Mark)150
+1802 y(Adler's)29 b(excellen)m(t)i Fj(zlib)e Fl(library)-8
+b(.)150 1959 y(All)29 b(externally)g(visible)f(sym)m(b)s(ols)h(ha)m(v)m
+(e)i(names)f(b)s(eginning)e Fj(BZ2_)p Fl(.)39 b(This)29
+b(is)g(new)h(in)f(v)m(ersion)h(1.0.)41 b(The)150 2068
+y(in)m(ten)m(tion)30 b(is)f(to)i(minimise)d(p)s(ollution)f(of)k(the)f
+(namespaces)h(of)g(library)d(clien)m(ts.)150 2321 y Ff(3.1.1)63
+b(Lo)m(w-lev)m(el)39 b(summary)150 2514 y Fl(This)21
+b(in)m(terface)h(pro)m(vides)g(services)g(for)g(compressing)f(and)h
+(decompressing)f(data)i(in)e(memory)-8 b(.)38 b(There's)150
+2623 y(no)43 b(pro)m(vision)e(for)h(dealing)g(with)f(\014les,)k
+(streams)e(or)g(an)m(y)g(other)g(I/O)g(mec)m(hanisms,)i(just)e(straigh)
+m(t)150 2733 y(memory-to-memory)25 b(w)m(ork.)38 b(In)23
+b(fact,)k(this)22 b(part)i(of)f(the)h(library)d(can)j(b)s(e)f(compiled)
+f(without)h(inclusion)150 2843 y(of)31 b Fj(stdio.h)p
+Fl(,)d(whic)m(h)h(ma)m(y)i(b)s(e)f(helpful)d(for)k(em)m(b)s(edded)e
+(applications.)150 2999 y(The)h(lo)m(w-lev)m(el)g(part)g(of)h(the)f
+(library)e(has)i(no)h(global)e(v)-5 b(ariables)29 b(and)h(is)g
+(therefore)g(thread-safe.)150 3156 y(Six)d(routines)g(mak)m(e)j(up)d
+(the)i(lo)m(w)f(lev)m(el)g(in)m(terface:)41 b Fj(BZ2_bzCompressInit)p
+Fl(,)24 b Fj(BZ2_bzCompress)p Fl(,)h(and)150 3266 y Fj
+(BZ2_bzCompressEnd)h Fl(for)k(compression,)f(and)h(a)h(corresp)s
+(onding)d(trio)i Fj(BZ2_bzDecompressInit)p Fl(,)150 3375
+y Fj(BZ2_bzDecompress)37 b Fl(and)j Fj(BZ2_bzDecompressEnd)c
+Fl(for)42 b(decompression.)72 b(The)41 b Fj(*Init)e Fl(functions)150
+3485 y(allo)s(cate)44 b(memory)g(for)f(compression/decompression)f(and)
+h(do)h(other)g(initialisations,)f(whilst)f(the)150 3595
+y Fj(*End)29 b Fl(functions)g(close)i(do)m(wn)f(op)s(erations)f(and)h
+(release)h(memory)-8 b(.)150 3751 y(The)36 b(real)f(w)m(ork)i(is)e
+(done)h(b)m(y)g Fj(BZ2_bzCompress)c Fl(and)j Fj(BZ2_bzDecompress)p
+Fl(.)54 b(These)36 b(compress)g(and)150 3861 y(decompress)30
+b(data)h(from)f(a)h(user-supplied)c(input)i(bu\013er)g(to)i(a)g
+(user-supplied)c(output)j(bu\013er.)40 b(These)150 3971
+y(bu\013ers)32 b(can)i(b)s(e)e(an)m(y)i(size;)g(arbitrary)e(quan)m
+(tities)h(of)g(data)h(are)g(handled)d(b)m(y)i(making)f(rep)s(eated)i
+(calls)150 4080 y(to)f(these)f(functions.)44 b(This)30
+b(is)h(a)h(\015exible)e(mec)m(hanism)i(allo)m(wing)e(a)i(consumer-pull)
+e(st)m(yle)i(of)g(activit)m(y)-8 b(,)150 4190 y(or)30
+b(pro)s(ducer-push,)e(or)i(a)h(mixture)e(of)i(b)s(oth.)150
+4443 y Ff(3.1.2)63 b(High-lev)m(el)41 b(summary)150 4635
+y Fl(This)d(in)m(terface)j(pro)m(vides)e(some)h(handy)f(wrapp)s(ers)f
+(around)h(the)i(lo)m(w-lev)m(el)f(in)m(terface)g(to)h(facilitate)150
+4745 y(reading)26 b(and)g(writing)f Fj(bzip2)g Fl(format)i(\014les)f
+(\()p Fj(.bz2)g Fl(\014les\).)38 b(The)27 b(routines)e(pro)m(vide)h(ho)
+s(oks)h(to)g(facilitate)150 4854 y(reading)43 b(\014les)f(in)h(whic)m
+(h)f(the)i Fj(bzip2)f Fl(data)h(stream)g(is)f(em)m(b)s(edded)f(within)g
+(some)i(larger-scale)g(\014le)150 4964 y(structure,)30
+b(or)h(where)e(there)i(are)g(m)m(ultiple)d Fj(bzip2)h
+Fl(data)i(streams)f(concatenated)j(end-to-end.)150 5121
+y(F)-8 b(or)31 b(reading)f(\014les,)f Fj(BZ2_bzReadOpen)p
+Fl(,)e Fj(BZ2_bzRead)p Fl(,)h Fj(BZ2_bzReadClose)e Fl(and)150
+5230 y Fj(BZ2_bzReadGetUnused)19 b Fl(are)25 b(supplied.)36
+b(F)-8 b(or)25 b(writing)d(\014les,)j Fj(BZ2_bzWriteOpen)p
+Fl(,)d Fj(BZ2_bzWrite)g Fl(and)150 5340 y Fj(BZ2_bzWriteFinish)k
+Fl(are)k(a)m(v)-5 b(ailable.)p eop
+%%Page: 10 11
+10 10 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(10)150 299 y(As)24 b(with)f(the)h(lo)m
+(w-lev)m(el)h(library)-8 b(,)23 b(no)h(global)g(v)-5
+b(ariables)23 b(are)h(used)g(so)g(the)h(library)c(is)j(p)s(er)f(se)h
+(thread-safe.)150 408 y(Ho)m(w)m(ev)m(er,)32 b(if)c(I/O)h(errors)g(o)s
+(ccur)g(whilst)e(reading)i(or)g(writing)e(the)j(underlying)c
+(compressed)j(\014les,)g(y)m(ou)150 518 y(ma)m(y)j(ha)m(v)m(e)g(to)g
+(consult)e Fj(errno)g Fl(to)h(determine)g(the)g(cause)g(of)h(the)f
+(error.)42 b(In)30 b(that)i(case,)h(y)m(ou'd)e(need)g(a)150
+628 y(C)f(library)e(whic)m(h)h(correctly)i(supp)s(orts)d
+Fj(errno)h Fl(in)g(a)i(m)m(ultithreaded)e(en)m(vironmen)m(t.)150
+784 y(T)-8 b(o)56 b(mak)m(e)g(the)g(library)d(a)j(little)e(simpler)f
+(and)i(more)h(p)s(ortable,)61 b Fj(BZ2_bzReadOpen)51
+b Fl(and)k Fj(BZ2_)150 894 y(bzWriteOpen)34 b Fl(require)j(y)m(ou)g(to)
+i(pass)e(them)g(\014le)g(handles)f(\()p Fj(FILE*)p Fl(s\))g(whic)m(h)h
+(ha)m(v)m(e)h(previously)e(b)s(een)150 1004 y(op)s(ened)41
+b(for)g(reading)f(or)h(writing)f(resp)s(ectiv)m(ely)-8
+b(.)73 b(That)41 b(a)m(v)m(oids)h(p)s(ortabilit)m(y)d(problems)g(asso)s
+(ciated)150 1113 y(with)j(\014le)h(op)s(erations)g(and)g(\014le)g
+(attributes,)j(whilst)c(not)i(b)s(eing)e(m)m(uc)m(h)h(of)h(an)g(imp)s
+(osition)c(on)k(the)150 1223 y(programmer.)150 1474 y
+Ff(3.1.3)63 b(Utilit)m(y)40 b(functions)h(summary)150
+1666 y Fl(F)-8 b(or)45 b(v)m(ery)g(simple)d(needs,)48
+b Fj(BZ2_bzBuffToBuffCompres)o(s)38 b Fl(and)44 b Fj
+(BZ2_bzBuffToBuffDecompres)o(s)150 1776 y Fl(are)29 b(pro)m(vided.)38
+b(These)28 b(compress)g(data)h(in)e(memory)h(from)g(one)h(bu\013er)e
+(to)i(another)f(bu\013er)g(in)f(a)h(single)150 1885 y(function)38
+b(call.)67 b(Y)-8 b(ou)40 b(should)d(assess)j(whether)f(these)h
+(functions)d(ful\014ll)f(y)m(our)k(memory-to-memory)150
+1995 y(compression/decompression)26 b(requiremen)m(ts)h(b)s(efore)g(in)
+m(v)m(esting)g(e\013ort)i(in)d(understanding)f(the)j(more)150
+2105 y(general)i(but)g(more)h(complex)f(lo)m(w-lev)m(el)g(in)m
+(terface.)150 2261 y(Y)-8 b(oshiok)j(a)47 b(Tsuneo)e(\()p
+Fj(QWF00133@niftyserve.or.jp)40 b Fl(/)46 b Fj
+(tsuneo-y@is.aist-nara.ac.)o(jp)p Fl(\))40 b(has)150
+2371 y(con)m(tributed)f(some)h(functions)e(to)j(giv)m(e)f(b)s(etter)g
+Fj(zlib)f Fl(compatibilit)m(y)-8 b(.)67 b(These)40 b(functions)e(are)i
+Fj(BZ2_)150 2481 y(bzopen)p Fl(,)e Fj(BZ2_bzread)p Fl(,)f
+Fj(BZ2_bzwrite)p Fl(,)g Fj(BZ2_bzflush)p Fl(,)g Fj(BZ2_bzclose)p
+Fl(,)f Fj(BZ2_bzerror)f Fl(and)i Fj(BZ2_)150 2590 y(bzlibVersion)p
+Fl(.)49 b(Y)-8 b(ou)35 b(ma)m(y)g(\014nd)e(these)i(functions)d(more)j
+(con)m(v)m(enien)m(t)g(for)f(simple)f(\014le)g(reading)h(and)150
+2700 y(writing,)c(than)h(those)h(in)e(the)i(high-lev)m(el)e(in)m
+(terface.)45 b(These)31 b(functions)f(are)i(not)g(\(y)m(et\))h
+(o\016cially)d(part)150 2809 y(of)k(the)g(library)-8
+b(,)33 b(and)g(are)h(minimally)c(do)s(cumen)m(ted)k(here.)51
+b(If)33 b(they)h(break,)h(y)m(ou)f(get)h(to)g(k)m(eep)f(all)f(the)150
+2919 y(pieces.)40 b(I)31 b(hop)s(e)e(to)i(do)s(cumen)m(t)g(them)f(prop)
+s(erly)e(when)h(time)i(p)s(ermits.)150 3076 y(Y)-8 b(oshiok)j(a)27
+b(also)g(con)m(tributed)f(mo)s(di\014cations)f(to)i(allo)m(w)f(the)h
+(library)e(to)i(b)s(e)f(built)f(as)i(a)g(Windo)m(ws)f(DLL.)150
+3362 y Fk(3.2)68 b(Error)45 b(handling)150 3554 y Fl(The)23
+b(library)f(is)h(designed)g(to)i(reco)m(v)m(er)g(cleanly)f(in)e(all)h
+(situations,)h(including)d(the)j(w)m(orst-case)i(situation)150
+3664 y(of)j(decompressing)e(random)g(data.)41 b(I'm)28
+b(not)h(100\045)g(sure)f(that)h(it)f(can)h(alw)m(a)m(ys)g(do)f(this,)g
+(so)g(y)m(ou)h(migh)m(t)150 3774 y(w)m(an)m(t)i(to)g(add)e(a)i(signal)d
+(handler)g(to)j(catc)m(h)h(segmen)m(tation)f(violations)e(during)f
+(decompression)h(if)g(y)m(ou)150 3883 y(are)g(feeling)f(esp)s(ecially)f
+(paranoid.)39 b(I)28 b(w)m(ould)g(b)s(e)g(in)m(terested)h(in)e(hearing)
+h(more)h(ab)s(out)f(the)h(robustness)150 3993 y(of)i(the)f(library)e
+(to)j(corrupted)f(compressed)g(data.)150 4150 y(V)-8
+b(ersion)39 b(1.0)h(is)f(m)m(uc)m(h)g(more)h(robust)e(in)g(this)g(resp)
+s(ect)i(than)f(0.9.0)i(or)e(0.9.5.)70 b(In)m(v)m(estigations)39
+b(with)150 4259 y(Chec)m(k)m(er)21 b(\(a)g(to)s(ol)g(for)f(detecting)h
+(problems)d(with)h(memory)h(managemen)m(t,)k(similar)18
+b(to)j(Purify\))e(indicate)150 4369 y(that,)40 b(at)e(least)f(for)g
+(the)h(few)e(\014les)h(I)g(tested,)j(all)c(single-bit)f(errors)i(in)e
+(the)j(decompressed)f(data)h(are)150 4478 y(caugh)m(t)c(prop)s(erly)-8
+b(,)31 b(with)g(no)i(segmen)m(tation)h(faults,)e(no)g(reads)h(of)g
+(uninitialised)27 b(data)34 b(and)e(no)g(out)h(of)150
+4588 y(range)f(reads)g(or)f(writes.)44 b(So)32 b(it's)f(certainly)g(m)m
+(uc)m(h)h(impro)m(v)m(ed,)g(although)f(I)g(w)m(ouldn't)g(claim)g(it)g
+(to)i(b)s(e)150 4698 y(totally)d(b)s(om)m(bpro)s(of.)150
+4854 y(The)25 b(\014le)g Fj(bzlib.h)f Fl(con)m(tains)i(all)f
+(de\014nitions)e(needed)i(to)i(use)e(the)h(library)-8
+b(.)37 b(In)26 b(particular,)f(y)m(ou)h(should)150 4964
+y(de\014nitely)i(not)j(include)d Fj(bzlib_private.h)p
+Fl(.)150 5121 y(In)39 b Fj(bzlib.h)p Fl(,)h(the)g(v)-5
+b(arious)39 b(return)f(v)-5 b(alues)39 b(are)h(de\014ned.)68
+b(The)39 b(follo)m(wing)f(list)h(is)f(not)i(in)m(tended)f(as)150
+5230 y(an)c(exhaustiv)m(e)h(description)d(of)i(the)h(circumstances)f
+(in)f(whic)m(h)g(a)i(giv)m(en)f(v)-5 b(alue)35 b(ma)m(y)h(b)s(e)e
+(returned)h({)150 5340 y(those)h(descriptions)d(are)j(giv)m(en)f
+(later.)56 b(Rather,)37 b(it)d(is)h(in)m(tended)f(to)i(con)m(v)m(ey)h
+(the)e(rough)g(meaning)g(of)p eop
+%%Page: 11 12
+11 11 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(11)150 299 y(eac)m(h)38
+b(return)d(v)-5 b(alue.)59 b(The)36 b(\014rst)g(\014v)m(e)g(actions)h
+(are)g(normal)f(and)f(not)i(in)m(tended)f(to)h(denote)g(an)f(error)150
+408 y(situation.)150 592 y Fj(BZ_OK)180 b Fl(The)30 b(requested)g
+(action)h(w)m(as)g(completed)f(successfully)-8 b(.)150
+756 y Fj(BZ_RUN_OK)150 866 y(BZ_FLUSH_OK)150 975 y(BZ_FINISH_OK)630
+1085 y Fl(In)24 b Fj(BZ2_bzCompress)p Fl(,)e(the)i(requested)g
+(\015ush/\014nish/nothing-sp)s(ecial)c(action)k(w)m(as)h(com-)630
+1194 y(pleted)30 b(successfully)-8 b(.)150 1358 y Fj(BZ_STREAM_END)630
+1468 y Fl(Compression)38 b(of)j(data)f(w)m(as)h(completed,)h(or)f(the)f
+(logical)f(stream)i(end)e(w)m(as)i(detected)630 1577
+y(during)28 b(decompression.)150 1761 y(The)i(follo)m(wing)f(return)g
+(v)-5 b(alues)30 b(indicate)f(an)h(error)g(of)h(some)g(kind.)150
+1945 y Fj(BZ_CONFIG_ERROR)630 2055 y Fl(Indicates)48
+b(that)h(the)g(library)e(has)h(b)s(een)g(improp)s(erly)d(compiled)j(on)
+g(y)m(our)h(platform)630 2164 y({)j(a)g(ma)5 b(jor)51
+b(con\014guration)g(error.)104 b(Sp)s(eci\014cally)-8
+b(,)55 b(it)c(means)g(that)h Fj(sizeof\(char\))p Fl(,)630
+2274 y Fj(sizeof\(short\))44 b Fl(and)i Fj(sizeof\(int\))f
+Fl(are)j(not)f(1,)52 b(2)c(and)f(4)h(resp)s(ectiv)m(ely)-8
+b(,)51 b(as)d(they)630 2384 y(should)27 b(b)s(e.)40 b(Note)30
+b(that)g(the)f(library)e(should)g(still)g(w)m(ork)i(prop)s(erly)e(on)i
+(64-bit)g(platforms)630 2493 y(whic)m(h)d(follo)m(w)h(the)g(LP64)h
+(programming)e(mo)s(del)h({)g(that)h(is,)g(where)e Fj(sizeof\(long\))f
+Fl(and)630 2603 y Fj(sizeof\(void*\))e Fl(are)k(8.)40
+b(Under)25 b(LP64,)j Fj(sizeof\(int\))c Fl(is)h(still)f(4,)k(so)f
+Fj(libbzip2)p Fl(,)e(whic)m(h)630 2712 y(do)s(esn't)30
+b(use)g(the)h Fj(long)e Fl(t)m(yp)s(e,)i(is)e(OK.)150
+2876 y Fj(BZ_SEQUENCE_ERROR)630 2986 y Fl(When)43 b(using)f(the)i
+(library)-8 b(,)45 b(it)e(is)f(imp)s(ortan)m(t)h(to)h(call)e(the)i
+(functions)e(in)g(the)i(correct)630 3095 y(sequence)28
+b(and)f(with)f(data)j(structures)e(\(bu\013ers)f(etc\))j(in)e(the)g
+(correct)i(states.)41 b Fj(libbzip2)630 3205 y Fl(c)m(hec)m(ks)26
+b(as)e(m)m(uc)m(h)h(as)f(it)g(can)g(to)h(ensure)f(this)f(is)g(happ)s
+(ening,)h(and)f(returns)g Fj(BZ_SEQUENCE_)630 3314 y(ERROR)36
+b Fl(if)h(not.)62 b(Co)s(de)37 b(whic)m(h)g(complies)f(precisely)g
+(with)h(the)g(function)g(seman)m(tics,)j(as)630 3424
+y(detailed)d(b)s(elo)m(w,)i(should)d(nev)m(er)i(receiv)m(e)h(this)d(v)
+-5 b(alue;)41 b(suc)m(h)d(an)g(ev)m(en)m(t)h(denotes)f(buggy)630
+3534 y(co)s(de)31 b(whic)m(h)e(y)m(ou)h(should)f(in)m(v)m(estigate.)150
+3697 y Fj(BZ_PARAM_ERROR)630 3807 y Fl(Returned)43 b(when)f(a)i
+(parameter)g(to)h(a)f(function)e(call)h(is)f(out)i(of)g(range)g(or)g
+(otherwise)630 3917 y(manifestly)34 b(incorrect.)57 b(As)36
+b(with)e Fj(BZ_SEQUENCE_ERROR)p Fl(,)f(this)i(denotes)h(a)g(bug)f(in)g
+(the)630 4026 y(clien)m(t)23 b(co)s(de.)39 b(The)22 b(distinction)f(b)s
+(et)m(w)m(een)j Fj(BZ_PARAM_ERROR)c Fl(and)j Fj(BZ_SEQUENCE_ERROR)630
+4136 y Fl(is)29 b(a)i(bit)f(hazy)-8 b(,)31 b(but)f(still)e(w)m(orth)i
+(making.)150 4300 y Fj(BZ_MEM_ERROR)630 4409 y Fl(Returned)g(when)f(a)i
+(request)f(to)i(allo)s(cate)f(memory)f(failed.)40 b(Note)31
+b(that)g(the)g(quan)m(tit)m(y)g(of)630 4519 y(memory)21
+b(needed)g(to)i(decompress)e(a)g(stream)h(cannot)g(b)s(e)f(determined)f
+(un)m(til)g(the)h(stream's)630 4628 y(header)29 b(has)g(b)s(een)g
+(read.)40 b(So)29 b Fj(BZ2_bzDecompress)c Fl(and)j Fj(BZ2_bzRead)f
+Fl(ma)m(y)j(return)e Fj(BZ_)630 4738 y(MEM_ERROR)d Fl(ev)m(en)k(though)
+e(some)h(of)g(the)g(compressed)g(data)g(has)g(b)s(een)f(read.)39
+b(The)28 b(same)630 4847 y(is)38 b(not)i(true)f(for)g(compression;)k
+(once)d Fj(BZ2_bzCompressInit)34 b Fl(or)39 b Fj(BZ2_bzWriteOpen)630
+4957 y Fl(ha)m(v)m(e)32 b(successfully)c(completed,)j
+Fj(BZ_MEM_ERROR)c Fl(cannot)k(o)s(ccur.)150 5121 y Fj(BZ_DATA_ERROR)630
+5230 y Fl(Returned)h(when)g(a)h(data)g(in)m(tegrit)m(y)g(error)g(is)e
+(detected)k(during)30 b(decompression.)47 b(Most)630
+5340 y(imp)s(ortan)m(tly)-8 b(,)31 b(this)f(means)i(when)f(stored)g
+(and)g(computed)h(CR)m(Cs)f(for)g(the)h(data)g(do)g(not)p
+eop
+%%Page: 12 13
+12 12 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(12)630 299 y(matc)m(h.)41
+b(This)28 b(v)-5 b(alue)29 b(is)f(also)i(returned)e(up)s(on)g
+(detection)i(of)g(an)m(y)g(other)f(anomaly)h(in)e(the)630
+408 y(compressed)i(data.)150 560 y Fj(BZ_DATA_ERROR_MAGIC)630
+670 y Fl(As)k(a)g(sp)s(ecial)f(case)i(of)f Fj(BZ_DATA_ERROR)p
+Fl(,)d(it)i(is)g(sometimes)h(useful)e(to)j(kno)m(w)f(when)f(the)630
+779 y(compressed)d(stream)h(do)s(es)f(not)g(start)h(with)e(the)i
+(correct)h(magic)e(b)m(ytes)h(\()p Fj('B')f('Z')f('h')p
+Fl(\).)150 931 y Fj(BZ_IO_ERROR)630 1040 y Fl(Returned)k(b)m(y)h
+Fj(BZ2_bzRead)d Fl(and)i Fj(BZ2_bzWrite)e Fl(when)i(there)h(is)f(an)g
+(error)h(reading)f(or)630 1150 y(writing)28 b(in)h(the)h(compressed)g
+(\014le,)f(and)h(b)m(y)g Fj(BZ2_bzReadOpen)c Fl(and)j
+Fj(BZ2_bzWriteOpen)630 1259 y Fl(for)i(attempts)i(to)f(use)f(a)h
+(\014le)e(for)i(whic)m(h)e(the)h(error)g(indicator)g(\(viz,)g
+Fj(ferror\(f\))p Fl(\))f(is)g(set.)630 1369 y(On)h(receipt)g(of)h
+Fj(BZ_IO_ERROR)p Fl(,)e(the)h(caller)h(should)d(consult)i
+Fj(errno)g Fl(and/or)g Fj(perror)f Fl(to)630 1479 y(acquire)g(op)s
+(erating-system)g(sp)s(eci\014c)f(information)g(ab)s(out)h(the)h
+(problem.)150 1630 y Fj(BZ_UNEXPECTED_EOF)630 1740 y
+Fl(Returned)36 b(b)m(y)g Fj(BZ2_bzRead)e Fl(when)i(the)h(compressed)f
+(\014le)g(\014nishes)e(b)s(efore)j(the)f(logical)630
+1849 y(end)30 b(of)g(stream)h(is)e(detected.)150 2001
+y Fj(BZ_OUTBUFF_FULL)630 2110 y Fl(Returned)g(b)m(y)i
+Fj(BZ2_bzBuffToBuffCompres)o(s)24 b Fl(and)30 b Fj
+(BZ2_bzBuffToBuffDecompres)o(s)630 2220 y Fl(to)h(indicate)f(that)h
+(the)f(output)g(data)h(will)d(not)i(\014t)h(in)m(to)f(the)h(output)f
+(bu\013er)f(pro)m(vided.)150 2492 y Fk(3.3)68 b(Lo)l(w-lev)l(el)47
+b(in)l(terface)150 2766 y Ff(3.3.1)63 b Fe(BZ2_bzCompressInit)390
+2953 y Fj(typedef)533 3057 y(struct)46 b({)676 3161 y(char)h(*next_in;)
+676 3264 y(unsigned)f(int)h(avail_in;)676 3368 y(unsigned)f(int)h
+(total_in_lo32;)676 3472 y(unsigned)f(int)h(total_in_hi32;)676
+3680 y(char)g(*next_out;)676 3783 y(unsigned)f(int)h(avail_out;)676
+3887 y(unsigned)f(int)h(total_out_lo32;)676 3991 y(unsigned)f(int)h
+(total_out_hi32;)676 4198 y(void)g(*state;)676 4406 y(void)g
+(*\(*bzalloc\)\(void)c(*,int,int\);)676 4510 y(void)k
+(\(*bzfree\)\(void)d(*,void)i(*\);)676 4614 y(void)h(*opaque;)533
+4717 y(})533 4821 y(bz_stream;)390 5029 y(int)g(BZ2_bzCompressInit)c
+(\()k(bz_stream)e(*strm,)1583 5132 y(int)i(blockSize100k,)1583
+5236 y(int)g(verbosity,)1583 5340 y(int)g(workFactor)e(\);)p
+eop
+%%Page: 13 14
+13 13 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(13)150 456 y(Prepares)32
+b(for)h(compression.)47 b(The)32 b Fj(bz_stream)e Fl(structure)j(holds)
+e(all)h(data)h(p)s(ertaining)e(to)i(the)g(com-)150 565
+y(pression)i(activit)m(y)-8 b(.)62 b(A)37 b Fj(bz_stream)e
+Fl(structure)h(should)f(b)s(e)i(allo)s(cated)g(and)f(initialised)e
+(prior)h(to)j(the)150 675 y(call.)67 b(The)39 b(\014elds)e(of)j
+Fj(bz_stream)d Fl(comprise)h(the)i(en)m(tiret)m(y)g(of)f(the)h
+(user-visible)c(data.)68 b Fj(state)38 b Fl(is)h(a)150
+784 y(p)s(oin)m(ter)29 b(to)i(the)g(priv)-5 b(ate)30
+b(data)h(structures)f(required)e(for)i(compression.)150
+941 y(Custom)37 b(memory)g(allo)s(cators)g(are)h(supp)s(orted,)f(via)g
+(\014elds)f Fj(bzalloc)p Fl(,)h Fj(bzfree)p Fl(,)g(and)g
+Fj(opaque)p Fl(.)59 b(The)150 1051 y(v)-5 b(alue)32 b
+Fj(opaque)e Fl(is)i(passed)f(to)i(as)g(the)f(\014rst)g(argumen)m(t)h
+(to)g(all)e(calls)g(to)i Fj(bzalloc)d Fl(and)i Fj(bzfree)p
+Fl(,)f(but)h(is)150 1160 y(otherwise)d(ignored)g(b)m(y)h(the)g(library)
+-8 b(.)38 b(The)29 b(call)h Fj(bzalloc)e(\()i(opaque,)e(n,)i(m)g(\))g
+Fl(is)e(exp)s(ected)j(to)f(return)150 1270 y(a)g(p)s(oin)m(ter)e
+Fj(p)h Fl(to)h Fj(n)g(*)g(m)f Fl(b)m(ytes)h(of)g(memory)-8
+b(,)30 b(and)e Fj(bzfree)h(\()h(opaque,)f(p)h(\))f Fl(should)e(free)i
+(that)h(memory)-8 b(.)150 1427 y(If)33 b(y)m(ou)g(don't)h(w)m(an)m(t)g
+(to)g(use)f(a)g(custom)h(memory)f(allo)s(cator,)h(set)g
+Fj(bzalloc)p Fl(,)e Fj(bzfree)g Fl(and)h Fj(opaque)e
+Fl(to)150 1537 y Fj(NULL)p Fl(,)e(and)h(the)h(library)d(will)f(then)k
+(use)f(the)g(standard)g Fj(malloc)p Fl(/)p Fj(free)e
+Fl(routines.)150 1693 y(Before)39 b(calling)d Fj(BZ2_bzCompressInit)p
+Fl(,)f(\014elds)h Fj(bzalloc)p Fl(,)h Fj(bzfree)f Fl(and)h
+Fj(opaque)f Fl(should)g(b)s(e)h(\014lled)150 1803 y(appropriately)-8
+b(,)35 b(as)h(just)f(describ)s(ed.)53 b(Up)s(on)34 b(return,)i(the)g
+(in)m(ternal)e(state)i(will)d(ha)m(v)m(e)j(b)s(een)f(allo)s(cated)150
+1913 y(and)43 b(initialised,)g(and)g Fj(total_in_lo32)p
+Fl(,)h Fj(total_in_hi32)p Fl(,)f Fj(total_out_lo32)d
+Fl(and)j Fj(total_out_)150 2022 y(hi32)37 b Fl(will)f(ha)m(v)m(e)j(b)s
+(een)f(set)h(to)g(zero.)65 b(These)38 b(four)g(\014elds)e(are)j(used)f
+(b)m(y)g(the)g(library)e(to)j(inform)e(the)150 2132 y(caller)j(of)g
+(the)h(total)g(amoun)m(t)g(of)g(data)g(passed)f(in)m(to)g(and)g(out)g
+(of)h(the)g(library)-8 b(,)41 b(resp)s(ectiv)m(ely)-8
+b(.)70 b(Y)-8 b(ou)150 2241 y(should)34 b(not)j(try)f(to)h(c)m(hange)g
+(them.)58 b(As)36 b(of)h(v)m(ersion)f(1.0,)j(64-bit)d(coun)m(ts)h(are)f
+(main)m(tained,)h(ev)m(en)g(on)150 2351 y(32-bit)i(platforms,)h(using)d
+(the)i Fj(_hi32)e Fl(\014elds)g(to)j(store)f(the)g(upp)s(er)d(32)k
+(bits)d(of)i(the)g(coun)m(t.)66 b(So,)41 b(for)150 2460
+y(example,)30 b(the)h(total)g(amoun)m(t)g(of)f(data)h(in)f(is)f
+Fj(\(total_in_hi32)d(<<)k(32\))g(+)g(total_in_lo32)p
+Fl(.)150 2617 y(P)m(arameter)g Fj(blockSize100k)25 b
+Fl(sp)s(eci\014es)i(the)h(blo)s(c)m(k)g(size)h(to)g(b)s(e)f(used)f(for)
+h(compression.)40 b(It)28 b(should)f(b)s(e)150 2727 y(a)k(v)-5
+b(alue)30 b(b)s(et)m(w)m(een)i(1)f(and)f(9)h(inclusiv)m(e,)e(and)h(the)
+h(actual)g(blo)s(c)m(k)f(size)g(used)g(is)g(100000)j(x)e(this)e
+(\014gure.)42 b(9)150 2836 y(giv)m(es)31 b(the)f(b)s(est)g(compression)
+g(but)f(tak)m(es)j(most)f(memory)-8 b(.)150 2993 y(P)m(arameter)29
+b Fj(verbosity)c Fl(should)h(b)s(e)h(set)i(to)f(a)h(n)m(um)m(b)s(er)d
+(b)s(et)m(w)m(een)j(0)f(and)f(4)h(inclusiv)m(e.)38 b(0)28
+b(is)f(silen)m(t,)h(and)150 3103 y(greater)j(n)m(um)m(b)s(ers)c(giv)m
+(e)j(increasingly)d(v)m(erb)s(ose)j(monitoring/debugging)d(output.)40
+b(If)29 b(the)g(library)e(has)150 3212 y(b)s(een)j(compiled)e(with)i
+Fj(-DBZ_NO_STDIO)p Fl(,)d(no)j(suc)m(h)g(output)g(will)e(app)s(ear)h
+(for)h(an)m(y)h(v)m(erb)s(osit)m(y)f(setting.)150 3369
+y(P)m(arameter)35 b Fj(workFactor)d Fl(con)m(trols)i(ho)m(w)g(the)g
+(compression)f(phase)h(b)s(eha)m(v)m(es)g(when)f(presen)m(ted)h(with)
+150 3479 y(w)m(orst)40 b(case,)j(highly)37 b(rep)s(etitiv)m(e,)k(input)
+d(data.)68 b(If)39 b(compression)g(runs)e(in)m(to)j(di\016culties)d
+(caused)i(b)m(y)150 3588 y(rep)s(etitiv)m(e)34 b(data,)j(the)e(library)
+d(switc)m(hes)j(from)f(the)h(standard)f(sorting)g(algorithm)g(to)i(a)f
+(fallbac)m(k)f(al-)150 3698 y(gorithm.)47 b(The)32 b(fallbac)m(k)g(is)g
+(slo)m(w)m(er)g(than)h(the)f(standard)g(algorithm)g(b)m(y)g(p)s(erhaps)
+f(a)i(factor)h(of)e(three,)150 3808 y(but)e(alw)m(a)m(ys)h(b)s(eha)m(v)
+m(es)f(reasonably)-8 b(,)31 b(no)f(matter)h(ho)m(w)g(bad)f(the)g
+(input.)150 3965 y(Lo)m(w)m(er)25 b(v)-5 b(alues)24 b(of)h
+Fj(workFactor)d Fl(reduce)i(the)h(amoun)m(t)g(of)g(e\013ort)g(the)g
+(standard)f(algorithm)f(will)f(exp)s(end)150 4074 y(b)s(efore)j
+(resorting)h(to)g(the)g(fallbac)m(k.)39 b(Y)-8 b(ou)27
+b(should)c(set)k(this)e(parameter)h(carefully;)g(to)s(o)h(lo)m(w,)g
+(and)e(man)m(y)150 4184 y(inputs)32 b(will)f(b)s(e)i(handled)f(b)m(y)i
+(the)g(fallbac)m(k)g(algorithm)f(and)g(so)h(compress)g(rather)g(slo)m
+(wly)-8 b(,)34 b(to)s(o)h(high,)150 4293 y(and)24 b(y)m(our)h(a)m(v)m
+(erage-to-w)m(orst)30 b(case)c(compression)e(times)h(can)g(b)s(ecome)g
+(v)m(ery)h(large.)39 b(The)24 b(default)g(v)-5 b(alue)150
+4403 y(of)31 b(30)g(giv)m(es)f(reasonable)h(b)s(eha)m(viour)e(o)m(v)m
+(er)i(a)g(wide)e(range)i(of)f(circumstances.)150 4560
+y(Allo)m(w)m(able)h(v)-5 b(alues)31 b(range)i(from)e(0)i(to)f(250)h
+(inclusiv)m(e.)44 b(0)32 b(is)f(a)h(sp)s(ecial)f(case,)i(equiv)-5
+b(alen)m(t)32 b(to)g(using)f(the)150 4669 y(default)f(v)-5
+b(alue)29 b(of)i(30.)150 4826 y(Note)38 b(that)f(the)g(compressed)f
+(output)g(generated)h(is)f(the)g(same)h(regardless)f(of)h(whether)f(or)
+g(not)h(the)150 4936 y(fallbac)m(k)30 b(algorithm)f(is)h(used.)150
+5093 y(Be)23 b(a)m(w)m(are)h(also)f(that)g(this)f(parameter)h(ma)m(y)g
+(disapp)s(ear)e(en)m(tirely)h(in)f(future)h(v)m(ersions)g(of)h(the)g
+(library)-8 b(.)36 b(In)150 5202 y(principle)20 b(it)j(should)e(b)s(e)h
+(p)s(ossible)f(to)j(devise)f(a)g(go)s(o)s(d)g(w)m(a)m(y)i(to)f
+(automatically)f(c)m(ho)s(ose)h(whic)m(h)e(algorithm)150
+5312 y(to)31 b(use.)41 b(Suc)m(h)29 b(a)i(mec)m(hanism)f(w)m(ould)f
+(render)g(the)i(parameter)g(obsolete.)p eop
+%%Page: 14 15
+14 14 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(14)150 299 y(P)m(ossible)29
+b(return)h(v)-5 b(alues:)572 450 y Fj(BZ_CONFIG_ERROR)663
+554 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+657 y Fj(BZ_PARAM_ERROR)663 761 y Fl(if)g Fj(strm)g Fl(is)h
+Fj(NULL)663 865 y Fl(or)g Fj(blockSize)e(<)i Fl(1)h(or)f
+Fj(blockSize)e(>)i Fl(9)663 969 y(or)g Fj(verbosity)e(<)i
+Fl(0)h(or)f Fj(verbosity)e(>)i Fl(4)663 1073 y(or)g Fj(workFactor)e(<)i
+Fl(0)g(or)h Fj(workFactor)c(>)j Fl(250)572 1176 y Fj(BZ_MEM_ERROR)663
+1280 y Fl(if)f(not)i(enough)f(memory)g(is)f(a)m(v)-5
+b(ailable)572 1384 y Fj(BZ_OK)663 1488 y Fl(otherwise)150
+1645 y(Allo)m(w)m(able)30 b(next)g(actions:)572 1796
+y Fj(BZ2_bzCompress)663 1899 y Fl(if)f Fj(BZ_OK)g Fl(is)g(returned)572
+2003 y(no)h(sp)s(eci\014c)f(action)i(needed)f(in)f(case)i(of)g(error)
+150 2255 y Ff(3.3.2)63 b Fe(BZ2_bzCompress)533 2441 y
+Fj(int)47 b(BZ2_bzCompress)d(\()j(bz_stream)f(*strm,)g(int)h(action)f
+(\);)150 2598 y Fl(Pro)m(vides)28 b(more)g(input)f(and/or)h(output)g
+(bu\013er)g(space)h(for)f(the)h(library)-8 b(.)38 b(The)28
+b(caller)g(main)m(tains)f(input)150 2708 y(and)j(output)g(bu\013ers,)f
+(and)h(calls)g Fj(BZ2_bzCompress)c Fl(to)31 b(transfer)f(data)h(b)s(et)
+m(w)m(een)g(them.)150 2865 y(Before)j(eac)m(h)g(call)e(to)i
+Fj(BZ2_bzCompress)p Fl(,)c Fj(next_in)h Fl(should)g(p)s(oin)m(t)h(at)h
+(the)g(data)h(to)g(b)s(e)e(compressed,)150 2974 y(and)41
+b Fj(avail_in)f Fl(should)g(indicate)h(ho)m(w)h(man)m(y)f(b)m(ytes)i
+(the)f(library)d(ma)m(y)k(read.)75 b Fj(BZ2_bzCompress)150
+3084 y Fl(up)s(dates)29 b Fj(next_in)p Fl(,)g Fj(avail_in)f
+Fl(and)i Fj(total_in)e Fl(to)j(re\015ect)g(the)g(n)m(um)m(b)s(er)e(of)h
+(b)m(ytes)h(it)f(has)g(read.)150 3241 y(Similarly)-8
+b(,)27 b Fj(next_out)h Fl(should)g(p)s(oin)m(t)h(to)i(a)f(bu\013er)f
+(in)g(whic)m(h)g(the)h(compressed)g(data)h(is)e(to)i(b)s(e)e(placed,)
+150 3350 y(with)i Fj(avail_out)f Fl(indicating)h(ho)m(w)h(m)m(uc)m(h)h
+(output)f(space)h(is)f(a)m(v)-5 b(ailable.)46 b Fj(BZ2_bzCompress)29
+b Fl(up)s(dates)150 3460 y Fj(next_out)p Fl(,)f Fj(avail_out)g
+Fl(and)i Fj(total_out)e Fl(to)j(re\015ect)g(the)f(n)m(um)m(b)s(er)g(of)
+g(b)m(ytes)h(output.)150 3617 y(Y)-8 b(ou)40 b(ma)m(y)g(pro)m(vide)e
+(and)h(remo)m(v)m(e)i(as)f(little)e(or)h(as)h(m)m(uc)m(h)f(data)h(as)g
+(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e(of)g Fj(BZ2_)150
+3726 y(bzCompress)p Fl(.)48 b(In)33 b(the)h(limit,)f(it)h(is)f
+(acceptable)h(to)h(supply)c(and)j(remo)m(v)m(e)h(data)g(one)f(b)m(yte)g
+(at)h(a)f(time,)150 3836 y(although)28 b(this)f(w)m(ould)g(b)s(e)h
+(terribly)e(ine\016cien)m(t.)39 b(Y)-8 b(ou)29 b(should)e(alw)m(a)m(ys)
+h(ensure)g(that)h(at)g(least)g(one)f(b)m(yte)150 3946
+y(of)j(output)f(space)g(is)g(a)m(v)-5 b(ailable)30 b(at)h(eac)m(h)g
+(call.)150 4102 y(A)38 b(second)h(purp)s(ose)d(of)j Fj(BZ2_bzCompress)
+34 b Fl(is)j(to)i(request)f(a)h(c)m(hange)g(of)g(mo)s(de)e(of)i(the)f
+(compressed)150 4212 y(stream.)150 4369 y(Conceptually)-8
+b(,)24 b(a)g(compressed)g(stream)g(can)f(b)s(e)g(in)g(one)h(of)f(four)g
+(states:)39 b(IDLE,)24 b(R)m(UNNING,)h(FLUSH-)150 4478
+y(ING)37 b(and)g(FINISHING.)g(Before)i(initialisation)33
+b(\()p Fj(BZ2_bzCompressInit)p Fl(\))g(and)j(after)i(termination)150
+4588 y(\()p Fj(BZ2_bzCompressEnd)p Fl(\),)27 b(a)j(stream)h(is)f
+(regarded)g(as)g(IDLE.)150 4745 y(Up)s(on)35 b(initialisation)e(\()p
+Fj(BZ2_bzCompressInit)p Fl(\),)h(the)i(stream)h(is)e(placed)h(in)e(the)
+j(R)m(UNNING)g(state.)150 4854 y(Subsequen)m(t)j(calls)g(to)i
+Fj(BZ2_bzCompress)37 b Fl(should)j(pass)g Fj(BZ_RUN)g
+Fl(as)h(the)g(requested)h(action;)47 b(other)150 4964
+y(actions)31 b(are)f(illegal)f(and)h(will)d(result)j(in)f
+Fj(BZ_SEQUENCE_ERROR)p Fl(.)150 5121 y(A)m(t)38 b(some)f(p)s(oin)m(t,)h
+(the)f(calling)e(program)i(will)d(ha)m(v)m(e)k(pro)m(vided)e(all)f(the)
+i(input)e(data)j(it)e(w)m(an)m(ts)i(to.)61 b(It)150 5230
+y(will)28 b(then)h(w)m(an)m(t)i(to)g(\014nish)d(up)h({)i(in)d
+(e\013ect,)k(asking)e(the)g(library)e(to)j(pro)s(cess)f(an)m(y)g(data)h
+(it)f(migh)m(t)g(ha)m(v)m(e)150 5340 y(bu\013ered)25
+b(in)m(ternally)-8 b(.)38 b(In)25 b(this)g(state,)k Fj(BZ2_bzCompress)
+22 b Fl(will)i(no)i(longer)g(attempt)h(to)g(read)f(data)h(from)p
+eop
+%%Page: 15 16
+15 15 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(15)150 299 y Fj(next_in)p
+Fl(,)33 b(but)g(it)h(will)d(w)m(an)m(t)k(to)g(write)e(data)h(to)h
+Fj(next_out)p Fl(.)49 b(Because)36 b(the)e(output)f(bu\013er)g
+(supplied)150 408 y(b)m(y)e(the)h(user)e(can)i(b)s(e)f(arbitrarily)d
+(small,)j(the)g(\014nishing-up)d(op)s(eration)i(cannot)i(necessarily)e
+(b)s(e)h(done)150 518 y(with)e(a)i(single)e(call)h(of)g
+Fj(BZ2_bzCompress)p Fl(.)150 675 y(Instead,)47 b(the)d(calling)f
+(program)g(passes)h Fj(BZ_FINISH)d Fl(as)j(an)g(action)g(to)h
+Fj(BZ2_bzCompress)p Fl(.)77 b(This)150 784 y(c)m(hanges)30
+b(the)f(stream's)g(state)h(to)f(FINISHING.)g(An)m(y)g(remaining)e
+(input)g(\(ie,)i Fj(next_in[0)f(..)i(avail_)150 894 y(in-1])p
+Fl(\))36 b(is)f(compressed)i(and)f(transferred)g(to)h(the)g(output)g
+(bu\013er.)58 b(T)-8 b(o)38 b(do)e(this,)i Fj(BZ2_bzCompress)150
+1004 y Fl(m)m(ust)h(b)s(e)f(called)g(rep)s(eatedly)h(un)m(til)e(all)h
+(the)h(output)f(has)h(b)s(een)f(consumed.)66 b(A)m(t)40
+b(that)g(p)s(oin)m(t,)g Fj(BZ2_)150 1113 y(bzCompress)h
+Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(and)f(the)h(stream's)g(state)h
+(is)d(set)j(bac)m(k)f(to)g(IDLE.)g Fj(BZ2_)150 1223 y(bzCompressEnd)27
+b Fl(should)h(then)i(b)s(e)g(called.)150 1380 y(Just)25
+b(to)i(mak)m(e)g(sure)e(the)i(calling)d(program)i(do)s(es)g(not)g(c)m
+(heat,)i(the)f(library)c(mak)m(es)k(a)f(note)h(of)f Fj(avail_in)150
+1489 y Fl(at)g(the)g(time)f(of)g(the)g(\014rst)g(call)g(to)h
+Fj(BZ2_bzCompress)21 b Fl(whic)m(h)j(has)h Fj(BZ_FINISH)e
+Fl(as)i(an)h(action)f(\(ie,)i(at)f(the)150 1599 y(time)d(the)h(program)
+g(has)f(announced)g(its)h(in)m(ten)m(tion)f(to)h(not)g(supply)e(an)m(y)
+i(more)g(input\).)37 b(By)24 b(comparing)150 1708 y(this)k(v)-5
+b(alue)28 b(with)g(that)h(of)h Fj(avail_in)c Fl(o)m(v)m(er)k(subsequen)
+m(t)f(calls)f(to)h Fj(BZ2_bzCompress)p Fl(,)d(the)j(library)e(can)150
+1818 y(detect)33 b(an)m(y)e(attempts)i(to)f(slip)d(in)h(more)h(data)h
+(to)h(compress.)43 b(An)m(y)31 b(calls)g(for)g(whic)m(h)f(this)g(is)h
+(detected)150 1928 y(will)j(return)h Fj(BZ_SEQUENCE_ERROR)p
+Fl(.)55 b(This)34 b(indicates)i(a)h(programming)e(mistak)m(e)i(whic)m
+(h)e(should)g(b)s(e)150 2037 y(corrected.)150 2194 y(Instead)i(of)g
+(asking)f(to)h(\014nish,)f(the)h(calling)f(program)g(ma)m(y)h(ask)g
+Fj(BZ2_bzCompress)c Fl(to)38 b(tak)m(e)g(all)e(the)150
+2304 y(remaining)j(input,)i(compress)f(it)g(and)g(terminate)h(the)g
+(curren)m(t)f(\(Burro)m(ws-Wheeler\))h(compression)150
+2413 y(blo)s(c)m(k.)e(This)26 b(could)h(b)s(e)g(useful)f(for)h(error)h
+(con)m(trol)g(purp)s(oses.)38 b(The)27 b(mec)m(hanism)g(is)g(analogous)
+h(to)g(that)150 2523 y(for)35 b(\014nishing:)46 b(call)35
+b Fj(BZ2_bzCompress)c Fl(with)i(an)i(action)g(of)g Fj(BZ_FLUSH)p
+Fl(,)g(remo)m(v)m(e)h(output)f(data,)i(and)150 2632 y(p)s(ersist)h
+(with)g(the)i Fj(BZ_FLUSH)e Fl(action)i(un)m(til)e(the)i(v)-5
+b(alue)39 b Fj(BZ_RUN)f Fl(is)h(returned.)68 b(As)39
+b(with)g(\014nishing,)150 2742 y Fj(BZ2_bzCompress)23
+b Fl(detects)28 b(an)m(y)f(attempt)h(to)f(pro)m(vide)f(more)h(input)e
+(data)i(once)g(the)g(\015ush)e(has)i(b)s(egun.)150 2899
+y(Once)j(the)h(\015ush)e(is)g(complete,)i(the)g(stream)f(returns)g(to)h
+(the)f(normal)g(R)m(UNNING)h(state.)150 3056 y(This)f(all)h(sounds)g
+(prett)m(y)h(complex,)h(but)e(isn't)g(really)-8 b(.)45
+b(Here's)33 b(a)f(table)g(whic)m(h)f(sho)m(ws)h(whic)m(h)f(actions)150
+3165 y(are)e(allo)m(w)m(able)f(in)f(eac)m(h)j(state,)g(what)f(action)g
+(will)c(b)s(e)j(tak)m(en,)j(what)d(the)h(next)f(state)i(is,)e(and)g
+(what)h(the)150 3275 y(non-error)h(return)f(v)-5 b(alues)29
+b(are.)41 b(Note)32 b(that)e(y)m(ou)h(can't)g(explicitly)d(ask)i(what)g
+(state)i(the)e(stream)h(is)e(in,)150 3384 y(but)h(nor)g(do)g(y)m(ou)h
+(need)f(to)h({)g(it)e(can)i(b)s(e)f(inferred)e(from)i(the)h(v)-5
+b(alues)29 b(returned)h(b)m(y)g Fj(BZ2_bzCompress)p Fl(.)390
+3535 y(IDLE/)p Fj(any)572 3639 y Fl(Illegal.)60 b(IDLE)30
+b(state)i(only)d(exists)h(after)h Fj(BZ2_bzCompressEnd)26
+b Fl(or)572 3743 y(b)s(efore)k Fj(BZ2_bzCompressInit)p
+Fl(.)572 3847 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)390
+4054 y Fl(R)m(UNNING/)p Fj(BZ_RUN)572 4158 y Fl(Compress)f(from)h
+Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s
+(ossible.)572 4262 y(Next)h(state)h(=)e(R)m(UNNING)572
+4366 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_RUN_OK)390
+4573 y Fl(R)m(UNNING/)p Fj(BZ_FLUSH)572 4677 y Fl(Remem)m(b)s(er)g
+(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59
+b(Compress)30 b(from)g Fj(next_in)572 4781 y Fl(to)h
+Fj(next_out)d Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g
+(accept)i(an)m(y)f(more)f(input.)572 4885 y(Next)h(state)h(=)e
+(FLUSHING)572 4988 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FLUSH_OK)390
+5196 y Fl(R)m(UNNING/)p Fj(BZ_FINISH)572 5300 y Fl(Remem)m(b)s(er)g
+(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59
+b(Compress)30 b(from)g Fj(next_in)p eop
+%%Page: 16 17
+16 16 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(16)572 299 y(to)31 b Fj(next_out)d
+Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g(accept)i(an)m
+(y)f(more)f(input.)572 403 y(Next)h(state)h(=)e(FINISHING)572
+506 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FINISH_OK)390
+714 y Fl(FLUSHING/)p Fj(BZ_FLUSH)572 818 y Fl(Compress)f(from)h
+Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s
+(ossible,)572 922 y(but)f(do)i(not)f(accept)i(an)m(y)f(more)f(input.)
+572 1025 y(If)g(all)f(the)i(existing)e(input)f(has)i(b)s(een)g(used)g
+(up)f(and)h(all)f(compressed)572 1129 y(output)h(has)g(b)s(een)g(remo)m
+(v)m(ed)663 1233 y(Next)h(state)h(=)e(R)m(UNNING;)i(Return)d(v)-5
+b(alue)30 b(=)g Fj(BZ_RUN_OK)572 1337 y Fl(else)663 1440
+y(Next)h(state)h(=)e(FLUSHING;)h(Return)e(v)-5 b(alue)30
+b(=)g Fj(BZ_FLUSH_OK)390 1648 y Fl(FLUSHING/other)572
+1752 y(Illegal.)572 1856 y(Return)f(v)-5 b(alue)30 b(=)g
+Fj(BZ_SEQUENCE_ERROR)390 2063 y Fl(FINISHING/)p Fj(BZ_FINISH)572
+2167 y Fl(Compress)f(from)h Fj(next_in)f Fl(to)i Fj(next_out)d
+Fl(as)i(m)m(uc)m(h)h(as)f(p)s(ossible,)572 2271 y(but)f(to)j(not)e
+(accept)i(an)m(y)f(more)f(input.)572 2374 y(If)g(all)f(the)i(existing)e
+(input)f(has)i(b)s(een)g(used)g(up)f(and)h(all)f(compressed)572
+2478 y(output)h(has)g(b)s(een)g(remo)m(v)m(ed)663 2582
+y(Next)h(state)h(=)e(IDLE;)g(Return)g(v)-5 b(alue)30
+b(=)g Fj(BZ_STREAM_END)572 2686 y Fl(else)663 2790 y(Next)h(state)h(=)e
+(FINISHING;)g(Return)g(v)-5 b(alue)30 b(=)g Fj(BZ_FINISHING)390
+2997 y Fl(FINISHING/other)572 3101 y(Illegal.)572 3205
+y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)150
+3361 y Fl(That)24 b(still)f(lo)s(oks)g(complicated?)39
+b(W)-8 b(ell,)25 b(fair)f(enough.)38 b(The)24 b(usual)f(sequence)i(of)f
+(calls)g(for)g(compressing)150 3471 y(a)31 b(load)f(of)g(data)h(is:)225
+3628 y Fi(\017)60 b Fl(Get)31 b(started)g(with)e Fj(BZ2_bzCompressInit)
+p Fl(.)225 3774 y Fi(\017)60 b Fl(Sho)m(v)m(el)38 b(data)h(in)e(and)g
+(shlurp)e(out)k(its)e(compressed)h(form)g(using)e(zero)j(or)f(more)h
+(calls)e(of)h Fj(BZ2_)330 3884 y(bzCompress)28 b Fl(with)h(action)h(=)g
+Fj(BZ_RUN)p Fl(.)225 4030 y Fi(\017)60 b Fl(Finish)23
+b(up.)38 b(Rep)s(eatedly)25 b(call)f Fj(BZ2_bzCompress)e
+Fl(with)i(action)h(=)g Fj(BZ_FINISH)p Fl(,)f(cop)m(ying)h(out)h(the)330
+4139 y(compressed)k(output,)g(un)m(til)f Fj(BZ_STREAM_END)e
+Fl(is)i(returned.)225 4285 y Fi(\017)60 b Fl(Close)30
+b(up)f(and)h(go)h(home.)41 b(Call)29 b Fj(BZ2_bzCompressEnd)p
+Fl(.)150 4478 y(If)23 b(the)h(data)h(y)m(ou)f(w)m(an)m(t)h(to)f
+(compress)g(\014ts)f(in)m(to)h(y)m(our)g(input)e(bu\013er)h(all)f(at)j
+(once,)h(y)m(ou)e(can)g(skip)f(the)h(calls)150 4588 y(of)37
+b Fj(BZ2_bzCompress)26 b(\()k(...,)f(BZ_RUN)g(\))36 b
+Fl(and)g(just)g(do)h(the)g Fj(BZ2_bzCompress)26 b(\()k(...,)f
+(BZ_FINISH)150 4698 y(\))h Fl(calls.)150 4854 y(All)36
+b(required)g(memory)h(is)f(allo)s(cated)i(b)m(y)f Fj
+(BZ2_bzCompressInit)p Fl(.)56 b(The)37 b(compression)g(library)e(can)
+150 4964 y(accept)g(an)m(y)f(data)h(at)g(all)d(\(ob)m(viously\).)51
+b(So)34 b(y)m(ou)g(shouldn't)e(get)j(an)m(y)f(error)f(return)g(v)-5
+b(alues)33 b(from)h(the)150 5074 y Fj(BZ2_bzCompress)29
+b Fl(calls.)46 b(If)32 b(y)m(ou)h(do,)g(they)g(will)d(b)s(e)i
+Fj(BZ_SEQUENCE_ERROR)p Fl(,)d(and)j(indicate)f(a)i(bug)f(in)150
+5183 y(y)m(our)e(programming.)150 5340 y(T)-8 b(rivial)28
+b(other)j(p)s(ossible)d(return)h(v)-5 b(alues:)p eop
+%%Page: 17 18
+17 17 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(17)572 299 y Fj(BZ_PARAM_ERROR)663
+403 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)p Fl(,)f(or)i
+Fj(strm->s)d Fl(is)h Fj(NULL)150 652 y Ff(3.3.3)63 b
+Fe(BZ2_bzCompressEnd)390 839 y Fj(int)47 b(BZ2_bzCompressEnd)c(\()k
+(bz_stream)f(*strm)g(\);)150 996 y Fl(Releases)31 b(all)e(memory)h
+(asso)s(ciated)h(with)e(a)i(compression)e(stream.)150
+1153 y(P)m(ossible)g(return)h(v)-5 b(alues:)481 1304
+y Fj(BZ_PARAM_ERROR)117 b Fl(if)30 b Fj(strm)f Fl(is)g
+Fj(NULL)g Fl(or)i Fj(strm->s)d Fl(is)i Fj(NULL)481 1408
+y(BZ_OK)120 b Fl(otherwise)150 1657 y Ff(3.3.4)63 b Fe
+(BZ2_bzDecompressInit)390 1844 y Fj(int)47 b(BZ2_bzDecompressInit)42
+b(\()48 b(bz_stream)d(*strm,)h(int)h(verbosity,)e(int)i(small)f(\);)150
+2001 y Fl(Prepares)30 b(for)f(decompression.)40 b(As)29
+b(with)g Fj(BZ2_bzCompressInit)p Fl(,)c(a)31 b Fj(bz_stream)c
+Fl(record)j(should)e(b)s(e)150 2110 y(allo)s(cated)c(and)f(initialised)
+e(b)s(efore)i(the)i(call.)38 b(Fields)22 b Fj(bzalloc)p
+Fl(,)i Fj(bzfree)e Fl(and)i Fj(opaque)e Fl(should)g(b)s(e)h(set)i(if)
+150 2220 y(a)h(custom)f(memory)g(allo)s(cator)g(is)g(required,)f(or)h
+(made)h Fj(NULL)e Fl(for)h(the)g(normal)f Fj(malloc)p
+Fl(/)p Fj(free)f Fl(routines.)150 2330 y(Up)s(on)h(return,)h(the)g(in)m
+(ternal)f(state)i(will)c(ha)m(v)m(e)k(b)s(een)f(initialised,)d(and)i
+Fj(total_in)f Fl(and)h Fj(total_out)f Fl(will)150 2439
+y(b)s(e)30 b(zero.)150 2596 y(F)-8 b(or)31 b(the)g(meaning)e(of)i
+(parameter)g Fj(verbosity)p Fl(,)d(see)j Fj(BZ2_bzCompressInit)p
+Fl(.)150 2753 y(If)e Fj(small)e Fl(is)h(nonzero,)i(the)f(library)e
+(will)f(use)j(an)g(alternativ)m(e)h(decompression)e(algorithm)g(whic)m
+(h)f(uses)150 2862 y(less)c(memory)g(but)g(at)h(the)g(cost)h(of)e
+(decompressing)g(more)g(slo)m(wly)g(\(roughly)f(sp)s(eaking,)i(half)f
+(the)h(sp)s(eed,)150 2972 y(but)34 b(the)i(maxim)m(um)d(memory)i
+(requiremen)m(t)g(drops)e(to)j(around)e(2300k\).)57 b(See)35
+b(Chapter)g(2)g(for)g(more)150 3082 y(information)29
+b(on)h(memory)g(managemen)m(t.)150 3238 y(Note)40 b(that)f(the)f(amoun)
+m(t)h(of)g(memory)f(needed)g(to)i(decompress)e(a)h(stream)f(cannot)h(b)
+s(e)f(determined)150 3348 y(un)m(til)j(the)h(stream's)h(header)f(has)g
+(b)s(een)g(read,)j(so)e(ev)m(en)g(if)e Fj(BZ2_bzDecompressInit)c
+Fl(succeeds,)46 b(a)150 3458 y(subsequen)m(t)30 b Fj(BZ2_bzDecompress)c
+Fl(could)j(fail)g(with)g Fj(BZ_MEM_ERROR)p Fl(.)150 3614
+y(P)m(ossible)g(return)h(v)-5 b(alues:)572 3765 y Fj(BZ_CONFIG_ERROR)
+663 3869 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+3973 y Fj(BZ_PARAM_ERROR)663 4077 y Fl(if)g Fj(\(small)46
+b(!=)h(0)h(&&)f(small)f(!=)h(1\))663 4181 y Fl(or)30
+b Fj(\(verbosity)45 b(<)j(0)f(||)g(verbosity)e(>)j(4\))572
+4284 y(BZ_MEM_ERROR)663 4388 y Fl(if)29 b(insu\016cien)m(t)g(memory)h
+(is)f(a)m(v)-5 b(ailable)150 4545 y(Allo)m(w)m(able)30
+b(next)g(actions:)572 4696 y Fj(BZ2_bzDecompress)663
+4800 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4904
+y(no)f(sp)s(eci\014c)f(action)i(required)e(in)g(case)i(of)g(error)150
+5153 y Ff(3.3.5)63 b Fe(BZ2_bzDecompress)390 5340 y Fj(int)47
+b(BZ2_bzDecompress)c(\()48 b(bz_stream)d(*strm)h(\);)p
+eop
+%%Page: 18 19
+18 18 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(18)150 299 y(Pro)m(vides)24
+b(more)g(input)f(and/out)h(output)g(bu\013er)g(space)h(for)f(the)g
+(library)-8 b(.)37 b(The)24 b(caller)g(main)m(tains)f(input)150
+408 y(and)30 b(output)g(bu\013ers,)f(and)h(uses)g Fj(BZ2_bzDecompress)c
+Fl(to)31 b(transfer)f(data)h(b)s(et)m(w)m(een)g(them.)150
+565 y(Before)g(eac)m(h)g(call)f(to)g Fj(BZ2_bzDecompress)p
+Fl(,)c Fj(next_in)i Fl(should)h(p)s(oin)m(t)g(at)h(the)h(compressed)e
+(data,)j(and)150 675 y Fj(avail_in)h Fl(should)h(indicate)h(ho)m(w)h
+(man)m(y)f(b)m(ytes)i(the)e(library)f(ma)m(y)i(read.)56
+b Fj(BZ2_bzDecompress)32 b Fl(up-)150 784 y(dates)f Fj(next_in)p
+Fl(,)e Fj(avail_in)f Fl(and)h Fj(total_in)g Fl(to)i(re\015ect)g(the)f
+(n)m(um)m(b)s(er)f(of)i(b)m(ytes)g(it)f(has)g(read.)150
+941 y(Similarly)-8 b(,)37 b Fj(next_out)f Fl(should)g(p)s(oin)m(t)i(to)
+g(a)h(bu\013er)e(in)g(whic)m(h)g(the)i(uncompressed)e(output)g(is)h(to)
+h(b)s(e)150 1051 y(placed,)d(with)e Fj(avail_out)f Fl(indicating)g(ho)m
+(w)i(m)m(uc)m(h)g(output)g(space)h(is)e(a)m(v)-5 b(ailable.)55
+b Fj(BZ2_bzCompress)150 1160 y Fl(up)s(dates)29 b Fj(next_out)p
+Fl(,)g Fj(avail_out)f Fl(and)h Fj(total_out)f Fl(to)j(re\015ect)g(the)g
+(n)m(um)m(b)s(er)e(of)h(b)m(ytes)h(output.)150 1317 y(Y)-8
+b(ou)40 b(ma)m(y)g(pro)m(vide)e(and)h(remo)m(v)m(e)i(as)f(little)e(or)h
+(as)h(m)m(uc)m(h)f(data)h(as)g(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e
+(of)g Fj(BZ2_)150 1427 y(bzDecompress)p Fl(.)e(In)27
+b(the)i(limit,)d(it)i(is)f(acceptable)j(to)f(supply)d(and)h(remo)m(v)m
+(e)j(data)f(one)f(b)m(yte)h(at)g(a)g(time,)150 1537 y(although)f(this)f
+(w)m(ould)g(b)s(e)h(terribly)e(ine\016cien)m(t.)39 b(Y)-8
+b(ou)29 b(should)e(alw)m(a)m(ys)h(ensure)g(that)h(at)g(least)g(one)f(b)
+m(yte)150 1646 y(of)j(output)f(space)g(is)g(a)m(v)-5
+b(ailable)30 b(at)h(eac)m(h)g(call.)150 1803 y(Use)g(of)f
+Fj(BZ2_bzDecompress)c Fl(is)k(simpler)e(than)i Fj(BZ2_bzCompress)p
+Fl(.)150 1960 y(Y)-8 b(ou)31 b(should)d(pro)m(vide)h(input)f(and)i
+(remo)m(v)m(e)i(output)d(as)i(describ)s(ed)d(ab)s(o)m(v)m(e,)k(and)d
+(rep)s(eatedly)h(call)f Fj(BZ2_)150 2069 y(bzDecompress)35
+b Fl(un)m(til)i Fj(BZ_STREAM_END)e Fl(is)j(returned.)64
+b(App)s(earance)39 b(of)g Fj(BZ_STREAM_END)c Fl(denotes)150
+2179 y(that)47 b Fj(BZ2_bzDecompress)42 b Fl(has)k(detected)h(the)f
+(logical)g(end)g(of)g(the)h(compressed)e(stream.)89 b
+Fj(BZ2_)150 2289 y(bzDecompress)28 b Fl(will)g(not)j(pro)s(duce)f
+Fj(BZ_STREAM_END)d Fl(un)m(til)j(all)f(output)i(data)h(has)e(b)s(een)h
+(placed)f(in)m(to)150 2398 y(the)36 b(output)g(bu\013er,)h(so)g(once)g
+Fj(BZ_STREAM_END)32 b Fl(app)s(ears,)38 b(y)m(ou)e(are)h(guaran)m(teed)
+g(to)g(ha)m(v)m(e)h(a)m(v)-5 b(ailable)150 2508 y(all)29
+b(the)i(decompressed)f(output,)g(and)g Fj(BZ2_bzDecompressEnd)25
+b Fl(can)31 b(safely)f(b)s(e)f(called.)150 2665 y(If)40
+b(case)h(of)f(an)h(error)e(return)h(v)-5 b(alue,)42 b(y)m(ou)f(should)d
+(call)h Fj(BZ2_bzDecompressEnd)c Fl(to)41 b(clean)f(up)g(and)150
+2774 y(release)31 b(memory)-8 b(.)150 2931 y(P)m(ossible)29
+b(return)h(v)-5 b(alues:)572 3082 y Fj(BZ_PARAM_ERROR)663
+3186 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)f Fl(or)h
+Fj(strm->s)f Fl(is)g Fj(NULL)663 3290 y Fl(or)h Fj(strm->avail_out)44
+b(<)j(1)572 3393 y(BZ_DATA_ERROR)663 3497 y Fl(if)29
+b(a)i(data)g(in)m(tegrit)m(y)f(error)g(is)g(detected)h(in)e(the)i
+(compressed)f(stream)572 3601 y Fj(BZ_DATA_ERROR_MAGIC)663
+3705 y Fl(if)f(the)i(compressed)f(stream)g(do)s(esn't)h(b)s(egin)e
+(with)g(the)h(righ)m(t)g(magic)h(b)m(ytes)572 3808 y
+Fj(BZ_MEM_ERROR)663 3912 y Fl(if)e(there)i(w)m(asn't)f(enough)h(memory)
+f(a)m(v)-5 b(ailable)572 4016 y Fj(BZ_STREAM_END)663
+4120 y Fl(if)29 b(the)i(logical)e(end)h(of)h(the)f(data)h(stream)g(w)m
+(as)g(detected)g(and)f(all)663 4224 y(output)g(in)f(has)h(b)s(een)g
+(consumed,)f(eg)j Fj(s->avail_out)44 b(>)k(0)572 4327
+y(BZ_OK)663 4431 y Fl(otherwise)150 4588 y(Allo)m(w)m(able)30
+b(next)g(actions:)572 4739 y Fj(BZ2_bzDecompress)663
+4843 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4946
+y Fj(BZ2_bzDecompressEnd)663 5050 y Fl(otherwise)p eop
+%%Page: 19 20
+19 19 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(19)150 299 y Ff(3.3.6)63
+b Fe(BZ2_bzDecompressEnd)390 486 y Fj(int)47 b(BZ2_bzDecompressEnd)42
+b(\()48 b(bz_stream)d(*strm)i(\);)150 643 y Fl(Releases)31
+b(all)e(memory)h(asso)s(ciated)h(with)e(a)i(decompression)e(stream.)150
+799 y(P)m(ossible)g(return)h(v)-5 b(alues:)572 950 y
+Fj(BZ_PARAM_ERROR)663 1054 y Fl(if)29 b Fj(strm)g Fl(is)h
+Fj(NULL)f Fl(or)h Fj(strm->s)f Fl(is)g Fj(NULL)572 1158
+y(BZ_OK)663 1262 y Fl(otherwise)150 1419 y(Allo)m(w)m(able)h(next)g
+(actions:)572 1570 y(None.)150 1857 y Fk(3.4)68 b(High-lev)l(el)47
+b(in)l(terface)150 2050 y Fl(This)35 b(in)m(terface)j(pro)m(vides)d
+(functions)h(for)g(reading)g(and)h(writing)e Fj(bzip2)g
+Fl(format)i(\014les.)59 b(First,)39 b(some)150 2159 y(general)30
+b(p)s(oin)m(ts.)225 2316 y Fi(\017)60 b Fl(All)35 b(of)h(the)g
+(functions)e(tak)m(e)k(an)e Fj(int*)f Fl(\014rst)g(argumen)m(t,)j
+Fj(bzerror)p Fl(.)56 b(After)36 b(eac)m(h)h(call,)g Fj(bzerror)330
+2426 y Fl(should)23 b(b)s(e)i(consulted)g(\014rst)g(to)h(determine)e
+(the)i(outcome)h(of)e(the)h(call.)38 b(If)25 b Fj(bzerror)f
+Fl(is)g Fj(BZ_OK)p Fl(,)i(the)330 2535 y(call)35 b(completed)g
+(successfully)-8 b(,)36 b(and)f(only)g(then)g(should)f(the)h(return)g
+(v)-5 b(alue)35 b(of)h(the)f(function)g(\(if)330 2645
+y(an)m(y\))30 b(b)s(e)f(consulted.)39 b(If)29 b Fj(bzerror)e
+Fl(is)h Fj(BZ_IO_ERROR)p Fl(,)f(there)i(w)m(as)h(an)f(error)g
+(reading/writing)e(the)330 2754 y(underlying)32 b(compressed)j(\014le,)
+h(and)f(y)m(ou)h(should)d(then)i(consult)g Fj(errno)p
+Fl(/)p Fj(perror)e Fl(to)j(determine)330 2864 y(the)i(cause)g(of)g(the)
+g(di\016cult)m(y)-8 b(.)61 b Fj(bzerror)36 b Fl(ma)m(y)i(also)g(b)s(e)f
+(set)h(to)g(v)-5 b(arious)37 b(other)h(v)-5 b(alues;)41
+b(precise)330 2974 y(details)29 b(are)i(giv)m(en)g(on)f(a)h(p)s
+(er-function)d(basis)h(b)s(elo)m(w.)225 3111 y Fi(\017)60
+b Fl(If)40 b Fj(bzerror)f Fl(indicates)g(an)i(error)f(\(ie,)j(an)m
+(ything)d(except)h Fj(BZ_OK)f Fl(and)g Fj(BZ_STREAM_END)p
+Fl(\),)g(y)m(ou)330 3220 y(should)56 b(immediately)h(call)g
+Fj(BZ2_bzReadClose)e Fl(\(or)j Fj(BZ2_bzWriteClose)p
+Fl(,)j(dep)s(ending)56 b(on)330 3330 y(whether)50 b(y)m(ou)g(are)h
+(attempting)g(to)g(read)f(or)g(to)i(write\))d(to)j(free)e(up)f(all)h
+(resources)g(asso)s(ci-)330 3439 y(ated)33 b(with)e(the)i(stream.)47
+b(Once)32 b(an)h(error)f(has)g(b)s(een)g(indicated,)f(b)s(eha)m(viour)g
+(of)i(all)e(calls)h(except)330 3549 y Fj(BZ2_bzReadClose)46
+b Fl(\()p Fj(BZ2_bzWriteClose)p Fl(\))h(is)j(unde\014ned.)99
+b(The)50 b(implication)e(is)i(that)h(\(1\))330 3659 y
+Fj(bzerror)44 b Fl(should)g(b)s(e)h(c)m(hec)m(k)m(ed)j(after)e(eac)m(h)
+h(call,)i(and)c(\(2\))i(if)e Fj(bzerror)f Fl(indicates)g(an)i(error,)
+330 3768 y Fj(BZ2_bzReadClose)26 b Fl(\()p Fj(BZ2_bzWriteClose)p
+Fl(\))h(should)h(then)i(b)s(e)g(called)g(to)h(clean)f(up.)225
+3905 y Fi(\017)60 b Fl(The)33 b Fj(FILE*)f Fl(argumen)m(ts)h(passed)g
+(to)h Fj(BZ2_bzReadOpen)p Fl(/)p Fj(BZ2_bzWriteOp)o(en)27
+b Fl(should)32 b(b)s(e)g(set)i(to)330 4015 y(binary)23
+b(mo)s(de.)38 b(Most)26 b(Unix)d(systems)i(will)d(do)i(this)g(b)m(y)g
+(default,)i(but)e(other)g(platforms,)h(including)330
+4124 y(Windo)m(ws)20 b(and)g(Mac,)k(will)19 b(not.)38
+b(If)20 b(y)m(ou)h(omit)g(this,)h(y)m(ou)f(ma)m(y)h(encoun)m(ter)f
+(problems)e(when)h(mo)m(ving)330 4234 y(co)s(de)31 b(to)g(new)f
+(platforms.)225 4371 y Fi(\017)60 b Fl(Memory)23 b(allo)s(cation)f
+(requests)h(are)g(handled)e(b)m(y)i Fj(malloc)p Fl(/)p
+Fj(free)p Fl(.)36 b(A)m(t)23 b(presen)m(t)g(there)g(is)f(no)h(facilit)m
+(y)330 4481 y(for)40 b(user-de\014ned)e(memory)i(allo)s(cators)g(in)f
+(the)h(\014le)g(I/O)g(functions)e(\(could)i(easily)f(b)s(e)g(added,)330
+4590 y(though\).)150 4842 y Ff(3.4.1)63 b Fe(BZ2_bzReadOpen)533
+5029 y Fj(typedef)46 b(void)h(BZFILE;)533 5236 y(BZFILE)f
+(*BZ2_bzReadOpen)e(\()j(int)g(*bzerror,)f(FILE)g(*f,)1726
+5340 y(int)h(small,)f(int)h(verbosity,)p eop
+%%Page: 20 21
+20 20 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g
+Fj(libbzip2)1891 b Fl(20)1726 299 y Fj(void)47 b(*unused,)f(int)g
+(nUnused)g(\);)150 456 y Fl(Prepare)29 b(to)g(read)g(compressed)f(data)
+i(from)e(\014le)g(handle)f Fj(f)p Fl(.)40 b Fj(f)29 b
+Fl(should)d(refer)j(to)h(a)f(\014le)f(whic)m(h)f(has)i(b)s(een)150
+565 y(op)s(ened)h(for)h(reading,)f(and)h(for)f(whic)m(h)g(the)h(error)g
+(indicator)e(\()p Fj(ferror\(f\))p Fl(\)is)f(not)k(set.)42
+b(If)31 b Fj(small)e Fl(is)h(1,)150 675 y(the)h(library)d(will)f(try)j
+(to)i(decompress)e(using)f(less)g(memory)-8 b(,)31 b(at)g(the)g(exp)s
+(ense)f(of)g(sp)s(eed.)150 832 y(F)-8 b(or)39 b(reasons)f(explained)f
+(b)s(elo)m(w,)j Fj(BZ2_bzRead)35 b Fl(will)h(decompress)i(the)g
+Fj(nUnused)e Fl(b)m(ytes)j(starting)f(at)150 941 y Fj(unused)p
+Fl(,)k(b)s(efore)e(starting)h(to)g(read)g(from)f(the)h(\014le)f
+Fj(f)p Fl(.)71 b(A)m(t)42 b(most)f Fj(BZ_MAX_UNUSED)c
+Fl(b)m(ytes)k(ma)m(y)h(b)s(e)150 1051 y(supplied)32 b(lik)m(e)k(this.)
+55 b(If)36 b(this)e(facilit)m(y)h(is)g(not)h(required,)g(y)m(ou)g
+(should)e(pass)h Fj(NULL)g Fl(and)g Fj(0)g Fl(for)h Fj(unused)150
+1160 y Fl(and)30 b(n)p Fj(Unused)e Fl(resp)s(ectiv)m(ely)-8
+b(.)150 1317 y(F)g(or)31 b(the)g(meaning)e(of)i(parameters)g
+Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj
+(BZ2_bzDecompressInit)p Fl(.)150 1474 y(The)k(amoun)m(t)g(of)g(memory)g
+(needed)g(to)g(decompress)g(a)h(\014le)e(cannot)h(b)s(e)g(determined)e
+(un)m(til)h(the)h(\014le's)150 1584 y(header)22 b(has)f(b)s(een)g
+(read.)38 b(So)22 b(it)f(is)g(p)s(ossible)e(that)k Fj(BZ2_bzReadOpen)17
+b Fl(returns)k Fj(BZ_OK)f Fl(but)h(a)i(subsequen)m(t)150
+1693 y(call)30 b(of)g Fj(BZ2_bzRead)e Fl(will)f(return)j
+Fj(BZ_MEM_ERROR)p Fl(.)150 1850 y(P)m(ossible)f(assignmen)m(ts)h(to)h
+Fj(bzerror)p Fl(:)572 2001 y Fj(BZ_CONFIG_ERROR)663 2105
+y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+2209 y Fj(BZ_PARAM_ERROR)663 2313 y Fl(if)g Fj(f)h Fl(is)g
+Fj(NULL)663 2416 y Fl(or)g Fj(small)f Fl(is)g(neither)h
+Fj(0)g Fl(nor)g Fj(1)663 2520 y Fl(or)g Fj(\(unused)46
+b(==)h(NULL)g(&&)g(nUnused)f(!=)h(0\))663 2624 y Fl(or)30
+b Fj(\(unused)46 b(!=)h(NULL)g(&&)g(!\(0)g(<=)g(nUnused)f(<=)h
+(BZ_MAX_UNUSED\)\))572 2728 y(BZ_IO_ERROR)663 2831 y
+Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572 2935
+y Fj(BZ_MEM_ERROR)663 3039 y Fl(if)g(insu\016cien)m(t)g(memory)h(is)f
+(a)m(v)-5 b(ailable)572 3143 y Fj(BZ_OK)663 3247 y Fl(otherwise.)150
+3403 y(P)m(ossible)29 b(return)h(v)-5 b(alues:)572 3554
+y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h Fj(BZFILE)663
+3658 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 3762
+y(NULL)663 3866 y Fl(otherwise)150 4023 y(Allo)m(w)m(able)g(next)g
+(actions:)572 4174 y Fj(BZ2_bzRead)663 4277 y Fl(if)f
+Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 4381 y(BZ2_bzClose)663
+4485 y Fl(otherwise)150 4887 y Ff(3.4.2)63 b Fe(BZ2_bzRead)533
+5074 y Fj(int)47 b(BZ2_bzRead)e(\()j(int)e(*bzerror,)g(BZFILE)g(*b,)h
+(void)f(*buf,)h(int)g(len)g(\);)150 5230 y Fl(Reads)35
+b(up)f(to)h Fj(len)f Fl(\(uncompressed\))h(b)m(ytes)g(from)f(the)h
+(compressed)g(\014le)f Fj(b)g Fl(in)m(to)h(the)g(bu\013er)f
+Fj(buf)p Fl(.)53 b(If)150 5340 y(the)30 b(read)f(w)m(as)h(successful,)f
+Fj(bzerror)e Fl(is)i(set)h(to)g Fj(BZ_OK)e Fl(and)h(the)h(n)m(um)m(b)s
+(er)e(of)i(b)m(ytes)g(read)f(is)g(returned.)p eop
+%%Page: 21 22
+21 21 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(21)150 299 y(If)33 b(the)g(logical)g
+(end-of-stream)h(w)m(as)g(detected,)i Fj(bzerror)31 b
+Fl(will)g(b)s(e)h(set)i(to)g Fj(BZ_STREAM_END)p Fl(,)d(and)i(the)150
+408 y(n)m(um)m(b)s(er)c(of)i(b)m(ytes)f(read)h(is)e(returned.)40
+b(All)29 b(other)h Fj(bzerror)f Fl(v)-5 b(alues)29 b(denote)i(an)g
+(error.)150 565 y Fj(BZ2_bzRead)37 b Fl(will)f(supply)h
+Fj(len)i Fl(b)m(ytes,)j(unless)c(the)i(logical)f(stream)h(end)e(is)h
+(detected)i(or)e(an)g(error)150 675 y(o)s(ccurs.)75 b(Because)43
+b(of)f(this,)i(it)d(is)g(p)s(ossible)e(to)k(detect)g(the)f(stream)g
+(end)f(b)m(y)h(observing)f(when)g(the)150 784 y(n)m(um)m(b)s(er)29
+b(of)h(b)m(ytes)g(returned)f(is)g(less)g(than)h(the)g(n)m(um)m(b)s(er)f
+(requested.)40 b(Nev)m(ertheless,)31 b(this)e(is)g(regarded)150
+894 y(as)38 b(inadvisable;)g(y)m(ou)g(should)d(instead)i(c)m(hec)m(k)i
+Fj(bzerror)d Fl(after)i(ev)m(ery)g(call)e(and)h(w)m(atc)m(h)i(out)f
+(for)f Fj(BZ_)150 1004 y(STREAM_END)p Fl(.)150 1160 y(In)m(ternally)-8
+b(,)47 b Fj(BZ2_bzRead)41 b Fl(copies)j(data)g(from)g(the)g(compressed)
+g(\014le)f(in)f(c)m(h)m(unks)i(of)g(size)g Fj(BZ_MAX_)150
+1270 y(UNUSED)31 b Fl(b)m(ytes)i(b)s(efore)f(decompressing)f(it.)47
+b(If)32 b(the)h(\014le)e(con)m(tains)i(more)g(b)m(ytes)g(than)f
+(strictly)f(needed)150 1380 y(to)48 b(reac)m(h)f(the)g(logical)f
+(end-of-stream,)52 b Fj(BZ2_bzRead)44 b Fl(will)g(almost)j(certainly)f
+(read)h(some)g(of)g(the)150 1489 y(trailing)c(data)j(b)s(efore)e
+(signalling)f Fj(BZ_SEQUENCE_END)p Fl(.)80 b(T)-8 b(o)46
+b(collect)f(the)g(read)g(but)g(un)m(used)e(data)150 1599
+y(once)29 b Fj(BZ_SEQUENCE_END)24 b Fl(has)k(app)s(eared,)g(call)f
+Fj(BZ2_bzReadGetUnused)c Fl(immediately)j(b)s(efore)i
+Fj(BZ2_)150 1708 y(bzReadClose)p Fl(.)150 1865 y(P)m(ossible)h
+(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 2016 y Fj(BZ_PARAM_ERROR)
+663 2120 y Fl(if)e Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g
+Fl(is)f Fj(NULL)g Fl(or)i Fj(len)46 b(<)i(0)572 2224
+y(BZ_SEQUENCE_ERROR)663 2328 y Fl(if)29 b Fj(b)h Fl(w)m(as)h(op)s(ened)
+e(with)h Fj(BZ2_bzWriteOpen)572 2431 y(BZ_IO_ERROR)663
+2535 y Fl(if)f(there)i(is)e(an)h(error)g(reading)g(from)g(the)g
+(compressed)g(\014le)572 2639 y Fj(BZ_UNEXPECTED_EOF)663
+2743 y Fl(if)f(the)i(compressed)f(\014le)f(ended)h(b)s(efore)g(the)g
+(logical)g(end-of-stream)h(w)m(as)g(detected)572 2847
+y Fj(BZ_DATA_ERROR)663 2950 y Fl(if)e(a)i(data)g(in)m(tegrit)m(y)f
+(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(stream)572
+3054 y Fj(BZ_DATA_ERROR_MAGIC)663 3158 y Fl(if)f(the)i(stream)f(do)s
+(es)g(not)h(b)s(egin)e(with)g(the)i(requisite)e(header)h(b)m(ytes)h
+(\(ie,)f(is)g(not)663 3262 y(a)g Fj(bzip2)f Fl(data)i(\014le\).)61
+b(This)28 b(is)i(really)f(a)i(sp)s(ecial)e(case)i(of)g
+Fj(BZ_DATA_ERROR)p Fl(.)572 3365 y Fj(BZ_MEM_ERROR)663
+3469 y Fl(if)e(insu\016cien)m(t)g(memory)h(w)m(as)h(a)m(v)-5
+b(ailable)572 3573 y Fj(BZ_STREAM_END)663 3677 y Fl(if)29
+b(the)i(logical)e(end)h(of)h(stream)f(w)m(as)h(detected.)572
+3781 y Fj(BZ_OK)663 3884 y Fl(otherwise.)150 4041 y(P)m(ossible)e
+(return)h(v)-5 b(alues:)572 4192 y(n)m(um)m(b)s(er)29
+b(of)h(b)m(ytes)h(read)663 4296 y(if)e Fj(bzerror)f Fl(is)i
+Fj(BZ_OK)f Fl(or)h Fj(BZ_STREAM_END)572 4400 y Fl(unde\014ned)663
+4503 y(otherwise)150 4660 y(Allo)m(w)m(able)g(next)g(actions:)572
+4811 y(collect)h(data)g(from)f Fj(buf)p Fl(,)f(then)h
+Fj(BZ2_bzRead)e Fl(or)i Fj(BZ2_bzReadClose)663 4915 y
+Fl(if)f Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 5019 y Fl(collect)h(data)g
+(from)f Fj(buf)p Fl(,)f(then)h Fj(BZ2_bzReadClose)d Fl(or)j
+Fj(BZ2_bzReadGetUnused)663 5123 y Fl(if)f Fj(bzerror)f
+Fl(is)i Fj(BZ_SEQUENCE_END)572 5226 y(BZ2_bzReadClose)663
+5330 y Fl(otherwise)p eop
+%%Page: 22 23
+22 22 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(22)150 299 y Ff(3.4.3)63
+b Fe(BZ2_bzReadGetUnused)533 486 y Fj(void)47 b(BZ2_bzReadGetUnused)42
+b(\()48 b(int*)e(bzerror,)g(BZFILE)g(*b,)1822 589 y(void**)g(unused,)g
+(int*)g(nUnused)g(\);)150 746 y Fl(Returns)36 b(data)i(whic)m(h)d(w)m
+(as)j(read)f(from)f(the)h(compressed)g(\014le)f(but)g(w)m(as)h(not)h
+(needed)e(to)i(get)g(to)g(the)150 856 y(logical)k(end-of-stream.)78
+b Fj(*unused)41 b Fl(is)h(set)h(to)g(the)g(address)f(of)g(the)h(data,)k
+(and)42 b Fj(*nUnused)e Fl(to)k(the)150 965 y(n)m(um)m(b)s(er)29
+b(of)i(b)m(ytes.)41 b Fj(*nUnused)28 b Fl(will)g(b)s(e)h(set)i(to)g(a)g
+(v)-5 b(alue)30 b(b)s(et)m(w)m(een)h Fj(0)f Fl(and)g
+Fj(BZ_MAX_UNUSED)d Fl(inclusiv)m(e.)150 1122 y(This)d(function)h(ma)m
+(y)h(only)g(b)s(e)f(called)g(once)i Fj(BZ2_bzRead)c Fl(has)j(signalled)
+e Fj(BZ_STREAM_END)e Fl(but)j(b)s(efore)150 1232 y Fj(BZ2_bzReadClose)p
+Fl(.)150 1389 y(P)m(ossible)k(assignmen)m(ts)h(to)h Fj(bzerror)p
+Fl(:)572 1540 y Fj(BZ_PARAM_ERROR)663 1644 y Fl(if)e
+Fj(b)h Fl(is)g Fj(NULL)663 1747 y Fl(or)g Fj(unused)f
+Fl(is)g Fj(NULL)g Fl(or)i Fj(nUnused)d Fl(is)i Fj(NULL)572
+1851 y(BZ_SEQUENCE_ERROR)663 1955 y Fl(if)f Fj(BZ_STREAM_END)e
+Fl(has)j(not)h(b)s(een)e(signalled)663 2059 y(or)h(if)f
+Fj(b)h Fl(w)m(as)h(op)s(ened)f(with)f Fj(BZ2_bzWriteOpen)542
+2162 y(BZ_OK)663 2266 y Fl(otherwise)150 2423 y(Allo)m(w)m(able)h(next)
+g(actions:)572 2574 y Fj(BZ2_bzReadClose)150 2882 y Ff(3.4.4)63
+b Fe(BZ2_bzReadClose)533 3068 y Fj(void)47 b(BZ2_bzReadClose)c(\()48
+b(int)f(*bzerror,)e(BZFILE)h(*b)h(\);)150 3225 y Fl(Releases)36
+b(all)e(memory)h(p)s(ertaining)e(to)i(the)h(compressed)f(\014le)f
+Fj(b)p Fl(.)54 b Fj(BZ2_bzReadClose)31 b Fl(do)s(es)k(not)h(call)150
+3335 y Fj(fclose)c Fl(on)h(the)h(underlying)d(\014le)h(handle,)h(so)h
+(y)m(ou)g(should)e(do)h(that)h(y)m(ourself)f(if)g(appropriate.)49
+b Fj(BZ2_)150 3445 y(bzReadClose)27 b Fl(should)i(b)s(e)g(called)h(to)h
+(clean)f(up)g(after)h(all)e(error)h(situations.)150 3601
+y(P)m(ossible)f(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572
+3752 y Fj(BZ_SEQUENCE_ERROR)663 3856 y Fl(if)e Fj(b)h
+Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzOpenWrite)572
+3960 y(BZ_OK)663 4064 y Fl(otherwise)150 4221 y(Allo)m(w)m(able)g(next)
+g(actions:)572 4372 y(none)150 4679 y Ff(3.4.5)63 b Fe(BZ2_bzWriteOpen)
+533 4866 y Fj(BZFILE)46 b(*BZ2_bzWriteOpen)e(\()j(int)g(*bzerror,)e
+(FILE)i(*f,)1774 4970 y(int)g(blockSize100k,)d(int)j(verbosity,)1774
+5074 y(int)g(workFactor)e(\);)150 5230 y Fl(Prepare)33
+b(to)g(write)f(compressed)h(data)h(to)f(\014le)f(handle)g
+Fj(f)p Fl(.)47 b Fj(f)33 b Fl(should)e(refer)i(to)g(a)g(\014le)f(whic)m
+(h)g(has)h(b)s(een)150 5340 y(op)s(ened)d(for)g(writing,)e(and)i(for)g
+(whic)m(h)f(the)i(error)f(indicator)f(\()p Fj(ferror\(f\))p
+Fl(\)is)f(not)i(set.)p eop
+%%Page: 23 24
+23 23 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(23)150 299 y(F)-8 b(or)31
+b(the)g(meaning)e(of)i(parameters)g Fj(blockSize100k)p
+Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p Fl(,)e(see)150
+408 y Fj(BZ2_bzCompressInit)p Fl(.)150 565 y(All)d(required)f(memory)i
+(is)f(allo)s(cated)i(at)g(this)e(stage,)j(so)f(if)e(the)h(call)g
+(completes)g(successfully)-8 b(,)26 b Fj(BZ_MEM_)150
+675 y(ERROR)j Fl(cannot)i(b)s(e)f(signalled)e(b)m(y)i(a)h(subsequen)m
+(t)f(call)f(to)i Fj(BZ2_bzWrite)p Fl(.)150 832 y(P)m(ossible)e
+(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 983 y Fj(BZ_CONFIG_ERROR)
+663 1087 y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+1190 y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(f)h Fl(is)g
+Fj(NULL)663 1398 y Fl(or)g Fj(blockSize100k)44 b(<)k(1)30
+b Fl(or)g Fj(blockSize100k)44 b(>)k(9)572 1502 y(BZ_IO_ERROR)663
+1605 y Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572
+1709 y Fj(BZ_MEM_ERROR)663 1813 y Fl(if)g(insu\016cien)m(t)g(memory)h
+(is)f(a)m(v)-5 b(ailable)572 1917 y Fj(BZ_OK)663 2021
+y Fl(otherwise)150 2177 y(P)m(ossible)29 b(return)h(v)-5
+b(alues:)572 2328 y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h
+Fj(BZFILE)663 2432 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572
+2536 y(NULL)663 2640 y Fl(otherwise)150 2797 y(Allo)m(w)m(able)g(next)g
+(actions:)572 2948 y Fj(BZ2_bzWrite)663 3051 y Fl(if)f
+Fj(bzerror)f Fl(is)i Fj(BZ_OK)604 3155 y Fl(\(y)m(ou)25
+b(could)e(go)h(directly)f(to)h Fj(BZ2_bzWriteClose)p
+Fl(,)c(but)j(this)g(w)m(ould)g(b)s(e)g(prett)m(y)h(p)s(oin)m(tless\))
+572 3259 y Fj(BZ2_bzWriteClose)663 3363 y Fl(otherwise)150
+3639 y Ff(3.4.6)63 b Fe(BZ2_bzWrite)533 3826 y Fj(void)47
+b(BZ2_bzWrite)e(\()i(int)g(*bzerror,)e(BZFILE)h(*b,)h(void)g(*buf,)f
+(int)h(len)g(\);)150 3983 y Fl(Absorbs)26 b Fj(len)g
+Fl(b)m(ytes)i(from)e(the)i(bu\013er)e Fj(buf)p Fl(,)h(ev)m(en)m(tually)
+g(to)h(b)s(e)e(compressed)h(and)f(written)g(to)i(the)g(\014le.)150
+4140 y(P)m(ossible)h(assignmen)m(ts)h(to)h Fj(bzerror)p
+Fl(:)572 4291 y Fj(BZ_PARAM_ERROR)663 4395 y Fl(if)e
+Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g Fl(is)f Fj(NULL)g
+Fl(or)i Fj(len)46 b(<)i(0)572 4498 y(BZ_SEQUENCE_ERROR)663
+4602 y Fl(if)29 b(b)h(w)m(as)h(op)s(ened)e(with)g Fj(BZ2_bzReadOpen)572
+4706 y(BZ_IO_ERROR)663 4810 y Fl(if)g(there)i(is)e(an)h(error)g
+(writing)f(the)h(compressed)g(\014le.)572 4914 y Fj(BZ_OK)663
+5017 y Fl(otherwise)150 5294 y Ff(3.4.7)63 b Fe(BZ2_bzWriteClose)p
+eop
+%%Page: 24 25
+24 24 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(24)533 299 y Fj(void)47
+b(BZ2_bzWriteClose)c(\()48 b(int)f(*bzerror,)e(BZFILE*)h(f,)1679
+403 y(int)h(abandon,)1679 506 y(unsigned)e(int*)i(nbytes_in,)1679
+610 y(unsigned)e(int*)i(nbytes_out)e(\);)533 818 y(void)i
+(BZ2_bzWriteClose64)c(\()k(int)g(*bzerror,)e(BZFILE*)h(f,)1774
+922 y(int)h(abandon,)1774 1025 y(unsigned)f(int*)g(nbytes_in_lo32,)1774
+1129 y(unsigned)g(int*)g(nbytes_in_hi32,)1774 1233 y(unsigned)g(int*)g
+(nbytes_out_lo32,)1774 1337 y(unsigned)g(int*)g(nbytes_out_hi32)e(\);)
+150 1493 y Fl(Compresses)39 b(and)g(\015ushes)g(to)h(the)g(compressed)g
+(\014le)f(all)f(data)j(so)f(far)g(supplied)c(b)m(y)k
+Fj(BZ2_bzWrite)p Fl(.)150 1603 y(The)27 b(logical)g(end-of-stream)h
+(mark)m(ers)g(are)g(also)f(written,)h(so)f(subsequen)m(t)g(calls)g(to)h
+Fj(BZ2_bzWrite)d Fl(are)150 1713 y(illegal.)50 b(All)33
+b(memory)h(asso)s(ciated)g(with)f(the)i(compressed)e(\014le)h
+Fj(b)f Fl(is)g(released.)52 b Fj(fflush)33 b Fl(is)g(called)g(on)150
+1822 y(the)e(compressed)f(\014le,)f(but)h(it)g(is)f(not)i
+Fj(fclose)p Fl('d.)150 1979 y(If)i Fj(BZ2_bzWriteClose)c
+Fl(is)k(called)f(to)j(clean)e(up)f(after)i(an)g(error,)g(the)g(only)e
+(action)i(is)f(to)h(release)g(the)150 2089 y(memory)-8
+b(.)42 b(The)30 b(library)e(records)j(the)g(error)f(co)s(des)h(issued)e
+(b)m(y)h(previous)f(calls,)i(so)f(this)g(situation)g(will)150
+2198 y(b)s(e)c(detected)h(automatically)-8 b(.)40 b(There)26
+b(is)g(no)g(attempt)h(to)h(complete)e(the)h(compression)f(op)s
+(eration,)g(nor)150 2308 y(to)32 b Fj(fflush)d Fl(the)i(compressed)g
+(\014le.)42 b(Y)-8 b(ou)32 b(can)f(force)h(this)e(b)s(eha)m(viour)g(to)
+h(happ)s(en)f(ev)m(en)i(in)d(the)j(case)g(of)150 2417
+y(no)e(error,)g(b)m(y)h(passing)e(a)i(nonzero)f(v)-5
+b(alue)30 b(to)h Fj(abandon)p Fl(.)150 2574 y(If)j Fj(nbytes_in)d
+Fl(is)j(non-n)m(ull,)f Fj(*nbytes_in)e Fl(will)h(b)s(e)h(set)i(to)g(b)s
+(e)f(the)g(total)h(v)m(olume)f(of)g(uncompressed)150
+2684 y(data)k(handled.)60 b(Similarly)-8 b(,)35 b Fj(nbytes_out)g
+Fl(will)g(b)s(e)h(set)i(to)g(the)g(total)g(v)m(olume)f(of)g(compressed)
+g(data)150 2793 y(written.)h(F)-8 b(or)27 b(compatibilit)m(y)d(with)h
+(older)g(v)m(ersions)h(of)g(the)g(library)-8 b(,)25 b
+Fj(BZ2_bzWriteClose)d Fl(only)j(yields)150 2903 y(the)40
+b(lo)m(w)m(er)g(32)h(bits)d(of)i(these)h(coun)m(ts.)69
+b(Use)40 b Fj(BZ2_bzWriteClose64)35 b Fl(if)k(y)m(ou)h(w)m(an)m(t)h
+(the)f(full)d(64)k(bit)150 3013 y(coun)m(ts.)g(These)30
+b(t)m(w)m(o)i(functions)d(are)i(otherwise)f(absolutely)f(iden)m(tical.)
+150 3169 y(P)m(ossible)g(assignmen)m(ts)h(to)h Fj(bzerror)p
+Fl(:)572 3320 y Fj(BZ_SEQUENCE_ERROR)663 3424 y Fl(if)e
+Fj(b)h Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzReadOpen)572
+3528 y(BZ_IO_ERROR)663 3632 y Fl(if)f(there)i(is)e(an)h(error)g
+(writing)f(the)h(compressed)g(\014le)572 3736 y Fj(BZ_OK)663
+3839 y Fl(otherwise)150 4161 y Ff(3.4.8)63 b(Handling)41
+b(em)m(b)s(edded)g(compressed)h(data)e(streams)150 4354
+y Fl(The)i(high-lev)m(el)g(library)f(facilitates)h(use)h(of)g
+Fj(bzip2)e Fl(data)j(streams)f(whic)m(h)f(form)g(some)i(part)e(of)i(a)
+150 4463 y(surrounding,)27 b(larger)j(data)h(stream.)225
+4620 y Fi(\017)60 b Fl(F)-8 b(or)22 b(writing,)f(the)g(library)e(tak)m
+(es)k(an)e(op)s(en)f(\014le)g(handle,)i(writes)e(compressed)h(data)h
+(to)g(it,)g Fj(fflush)p Fl(es)330 4730 y(it)34 b(but)f(do)s(es)h(not)h
+Fj(fclose)d Fl(it.)52 b(The)34 b(calling)f(application)g(can)h(write)g
+(its)f(o)m(wn)i(data)g(b)s(efore)f(and)330 4839 y(after)d(the)f
+(compressed)h(data)g(stream,)g(using)d(that)j(same)g(\014le)f(handle.)
+225 5011 y Fi(\017)60 b Fl(Reading)34 b(is)f(more)i(complex,)g(and)f
+(the)h(facilities)d(are)j(not)g(as)g(general)f(as)h(they)f(could)g(b)s
+(e)g(since)330 5121 y(generalit)m(y)e(is)f(hard)f(to)j(reconcile)e
+(with)f(e\016ciency)-8 b(.)46 b Fj(BZ2_bzRead)29 b Fl(reads)i(from)g
+(the)h(compressed)330 5230 y(\014le)39 b(in)g(blo)s(c)m(ks)g(of)h(size)
+g Fj(BZ_MAX_UNUSED)c Fl(b)m(ytes,)44 b(and)39 b(in)g(doing)g(so)h
+(probably)e(will)f(o)m(v)m(ersho)s(ot)330 5340 y(the)i(logical)g(end)f
+(of)h(compressed)f(stream.)67 b(T)-8 b(o)40 b(reco)m(v)m(er)g(this)e
+(data)i(once)f(decompression)f(has)p eop
+%%Page: 25 26
+25 25 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(25)330 299 y(ended,)28
+b(call)g Fj(BZ2_bzReadGetUnused)23 b Fl(after)29 b(the)g(last)f(call)g
+(of)g Fj(BZ2_bzRead)e Fl(\(the)j(one)g(returning)330
+408 y Fj(BZ_STREAM_END)p Fl(\))e(but)j(b)s(efore)g(calling)f
+Fj(BZ2_bzReadClose)p Fl(.)150 596 y(This)51 b(mec)m(hanism)g(mak)m(es)j
+(it)e(easy)h(to)g(decompress)f(m)m(ultiple)e Fj(bzip2)i
+Fl(streams)g(placed)g(end-to-)150 706 y(end.)90 b(As)48
+b(the)f(end)f(of)i(one)f(stream,)52 b(when)46 b Fj(BZ2_bzRead)f
+Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(call)e Fj(BZ2_)150
+816 y(bzReadGetUnused)36 b Fl(to)41 b(collect)g(the)g(un)m(used)e(data)
+i(\(cop)m(y)g(it)f(in)m(to)g(y)m(our)h(o)m(wn)f(bu\013er)f
+(somewhere\).)150 925 y(That)25 b(data)g(forms)f(the)h(start)h(of)e
+(the)h(next)g(compressed)g(stream.)39 b(T)-8 b(o)25 b(start)h
+(uncompressing)c(that)k(next)150 1035 y(stream,)40 b(call)d
+Fj(BZ2_bzReadOpen)d Fl(again,)40 b(feeding)d(in)g(the)h(un)m(used)e
+(data)j(via)e(the)h Fj(unused)p Fl(/)p Fj(nUnused)150
+1144 y Fl(parameters.)54 b(Keep)34 b(doing)g(this)f(un)m(til)g
+Fj(BZ_STREAM_END)e Fl(return)j(coincides)f(with)h(the)g(ph)m(ysical)g
+(end)150 1254 y(of)d(\014le)e(\()p Fj(feof\(f\))p Fl(\).)39
+b(In)30 b(this)f(situation)h Fj(BZ2_bzReadGetUnused)25
+b Fl(will)i(of)k(course)g(return)e(no)h(data.)150 1411
+y(This)c(should)f(giv)m(e)j(some)g(feel)f(for)g(ho)m(w)h(the)g
+(high-lev)m(el)e(in)m(terface)i(can)f(b)s(e)g(used.)39
+b(If)27 b(y)m(ou)h(require)e(extra)150 1520 y(\015exibilit)m(y)-8
+b(,)28 b(y)m(ou'll)i(ha)m(v)m(e)h(to)g(bite)f(the)h(bullet)d(and)i(get)
+i(to)f(grips)e(with)g(the)h(lo)m(w-lev)m(el)h(in)m(terface.)150
+1779 y Ff(3.4.9)63 b(Standard)40 b(\014le-reading/writing)j(co)s(de)150
+1972 y Fl(Here's)31 b(ho)m(w)f(y)m(ou'd)h(write)e(data)j(to)f(a)f
+(compressed)g(\014le:)390 2330 y Fj(FILE*)142 b(f;)390
+2434 y(BZFILE*)46 b(b;)390 2538 y(int)238 b(nBuf;)390
+2642 y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i
+(];)390 2746 y(int)238 b(bzerror;)390 2849 y(int)g(nWritten;)390
+3057 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("w")j(\);)390
+3161 y(if)g(\(!f\))g({)533 3264 y(/*)g(handle)f(error)h(*/)390
+3368 y(})390 3472 y(b)g(=)h(BZ2_bzWriteOpen)c(\()j(&bzerror,)e(f,)i(9)h
+(\);)390 3576 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533
+3680 y(BZ2_bzWriteClose)e(\()j(b)g(\);)533 3783 y(/*)g(handle)f(error)h
+(*/)390 3887 y(})390 4095 y(while)f(\()i(/*)f(condition)e(*/)i(\))h({)
+533 4198 y(/*)f(get)g(data)g(to)g(write)f(into)h(buf,)g(and)g(set)g
+(nBuf)f(appropriately)e(*/)533 4302 y(nWritten)i(=)h(BZ2_bzWrite)e(\()i
+(&bzerror,)f(b,)h(buf,)f(nBuf)h(\);)533 4406 y(if)g(\(bzerror)f(==)h
+(BZ_IO_ERROR\))e({)676 4510 y(BZ2_bzWriteClose)f(\()j(&bzerror,)e(b)j
+(\);)676 4614 y(/*)g(handle)e(error)g(*/)533 4717 y(})390
+4821 y(})390 5029 y(BZ2_bzWriteClose)d(\()48 b(&bzerror,)d(b)j(\);)390
+5132 y(if)f(\(bzerror)f(==)h(BZ_IO_ERROR\))d({)533 5236
+y(/*)j(handle)f(error)h(*/)390 5340 y(})p eop
+%%Page: 26 27
+26 26 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(26)150 299 y(And)29 b(to)j(read)e(from)g
+(a)h(compressed)f(\014le:)390 450 y Fj(FILE*)142 b(f;)390
+554 y(BZFILE*)46 b(b;)390 657 y(int)238 b(nBuf;)390 761
+y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i(];)390
+865 y(int)238 b(bzerror;)390 969 y(int)g(nWritten;)390
+1176 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("r")j(\);)390
+1280 y(if)g(\(!f\))g({)533 1384 y(/*)g(handle)f(error)h(*/)390
+1488 y(})390 1591 y(b)g(=)h(BZ2_bzReadOpen)c(\()j(&bzerror,)f(f,)h(0,)g
+(NULL,)f(0)i(\);)390 1695 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533
+1799 y(BZ2_bzReadClose)e(\()j(&bzerror,)f(b)h(\);)533
+1903 y(/*)g(handle)f(error)h(*/)390 2007 y(})390 2214
+y(bzerror)f(=)h(BZ_OK;)390 2318 y(while)f(\(bzerror)g(==)h(BZ_OK)f(&&)i
+(/*)f(arbitrary)e(other)h(conditions)f(*/\))i({)533 2422
+y(nBuf)g(=)g(BZ2_bzRead)e(\()j(&bzerror,)d(b,)i(buf,)g(/*)g(size)g(of)g
+(buf)g(*/)g(\);)533 2525 y(if)g(\(bzerror)f(==)h(BZ_OK\))f({)676
+2629 y(/*)i(do)f(something)e(with)i(buf[0)f(..)h(nBuf-1])f(*/)533
+2733 y(})390 2837 y(})390 2941 y(if)h(\(bzerror)f(!=)h(BZ_STREAM_END\))
+d({)533 3044 y(BZ2_bzReadClose)g(\()j(&bzerror,)f(b)h(\);)533
+3148 y(/*)g(handle)f(error)h(*/)390 3252 y(})g(else)g({)533
+3356 y(BZ2_bzReadClose)d(\()j(&bzerror)f(\);)390 3459
+y(})150 3753 y Fk(3.5)68 b(Utilit)l(y)47 b(functions)150
+4045 y Ff(3.5.1)63 b Fe(BZ2_bzBuffToBuffCompress)533
+4232 y Fj(int)47 b(BZ2_bzBuffToBuffCompress\()41 b(char*)428
+b(dest,)1965 4335 y(unsigned)46 b(int*)g(destLen,)1965
+4439 y(char*)428 b(source,)1965 4543 y(unsigned)46 b(int)94
+b(sourceLen,)1965 4647 y(int)524 b(blockSize100k,)1965
+4751 y(int)g(verbosity,)1965 4854 y(int)g(workFactor)45
+b(\);)150 5011 y Fl(A)m(ttempts)33 b(to)g(compress)f(the)g(data)h(in)e
+Fj(source[0)d(..)i(sourceLen-1])e Fl(in)m(to)k(the)h(destination)e
+(bu\013er,)150 5121 y Fj(dest[0)e(..)g(*destLen-1])p
+Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j
+Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 5230
+y(of)i(the)f(compressed)h(data,)g(and)f Fj(BZ_OK)f Fl(is)h(returned.)39
+b(If)28 b(the)h(compressed)f(data)h(w)m(on't)g(\014t,)g
+Fj(*destLen)150 5340 y Fl(is)g(unc)m(hanged,)i(and)e
+Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)p eop
+%%Page: 27 28
+27 27 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g
+Fj(libbzip2)1891 b Fl(27)150 299 y(Compression)22 b(in)g(this)h(manner)
+g(is)g(a)h(one-shot)g(ev)m(en)m(t,)j(done)c(with)g(a)h(single)e(call)h
+(to)i(this)d(function.)37 b(The)150 408 y(resulting)25
+b(compressed)i(data)i(is)d(a)i(complete)f Fj(bzip2)f
+Fl(format)i(data)g(stream.)40 b(There)27 b(is)f(no)i(mec)m(hanism)150
+518 y(for)23 b(making)g(additional)e(calls)i(to)h(pro)m(vide)f(extra)h
+(input)e(data.)39 b(If)23 b(y)m(ou)h(w)m(an)m(t)g(that)g(kind)e(of)h
+(mec)m(hanism,)150 628 y(use)30 b(the)h(lo)m(w-lev)m(el)f(in)m
+(terface.)150 784 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g
+Fj(blockSize100k)p Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p
+Fl(,)150 894 y(see)h Fj(BZ2_bzCompressInit)p Fl(.)150
+1051 y(T)-8 b(o)27 b(guaran)m(tee)h(that)e(the)h(compressed)f(data)h
+(will)d(\014t)i(in)f(its)g(bu\013er,)i(allo)s(cate)f(an)g(output)g
+(bu\013er)g(of)g(size)150 1160 y(1\045)31 b(larger)f(than)g(the)g
+(uncompressed)f(data,)j(plus)c(six)h(h)m(undred)g(extra)i(b)m(ytes.)150
+1317 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25 b Fl(will)k(not)j(write)e
+(data)j(at)f(or)f(b)s(ey)m(ond)g Fj(dest[*destLen])p
+Fl(,)d(ev)m(en)k(in)150 1427 y(case)f(of)g(bu\013er)e(o)m(v)m(er\015o)m
+(w.)150 1584 y(P)m(ossible)g(return)h(v)-5 b(alues:)572
+1735 y Fj(BZ_CONFIG_ERROR)663 1839 y Fl(if)29 b(the)i(library)d(has)i
+(b)s(een)f(mis-compiled)572 1942 y Fj(BZ_PARAM_ERROR)663
+2046 y Fl(if)g Fj(dest)g Fl(is)h Fj(NULL)f Fl(or)h Fj(destLen)f
+Fl(is)g Fj(NULL)663 2150 y Fl(or)h Fj(blockSize100k)44
+b(<)k(1)30 b Fl(or)g Fj(blockSize100k)44 b(>)k(9)663
+2254 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g
+Fj(verbosity)45 b(>)j(4)663 2357 y Fl(or)30 b Fj(workFactor)45
+b(<)j(0)30 b Fl(or)g Fj(workFactor)45 b(>)i(250)572 2461
+y(BZ_MEM_ERROR)663 2565 y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f
+(a)m(v)-5 b(ailable)572 2669 y Fj(BZ_OUTBUFF_FULL)663
+2773 y Fl(if)29 b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g
+Fj(*destLen)572 2876 y(BZ_OK)663 2980 y Fl(otherwise)150
+3349 y Ff(3.5.2)63 b Fe(BZ2_bzBuffToBuffDecompress)533
+3536 y Fj(int)47 b(BZ2_bzBuffToBuffDecompres)o(s)42 b(\()47
+b(char*)428 b(dest,)2108 3640 y(unsigned)46 b(int*)g(destLen,)2108
+3744 y(char*)428 b(source,)2108 3848 y(unsigned)46 b(int)94
+b(sourceLen,)2108 3951 y(int)524 b(small,)2108 4055 y(int)g(verbosity)
+46 b(\);)150 4212 y Fl(A)m(ttempts)24 b(to)g(decompress)f(the)g(data)g
+(in)f Fj(source[0)28 b(..)i(sourceLen-1])20 b Fl(in)m(to)j(the)g
+(destination)f(bu\013er,)150 4322 y Fj(dest[0)29 b(..)g(*destLen-1])p
+Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j
+Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 4431
+y(of)21 b(the)g(uncompressed)e(data,)24 b(and)c Fj(BZ_OK)f
+Fl(is)h(returned.)36 b(If)20 b(the)h(compressed)g(data)g(w)m(on't)h
+(\014t,)g Fj(*destLen)150 4541 y Fl(is)29 b(unc)m(hanged,)i(and)e
+Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)150 4698 y Fj(source)g
+Fl(is)g(assumed)h(to)h(hold)e(a)i(complete)f Fj(bzip2)f
+Fl(format)i(data)g(stream.)150 4807 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)
+22 b Fl(tries)28 b(to)i(decompress)e(the)h(en)m(tiret)m(y)g(of)g(the)f
+(stream)h(in)m(to)g(the)f(out-)150 4917 y(put)i(bu\013er.)150
+5074 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g
+Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj
+(BZ2_bzDecompressInit)p Fl(.)150 5230 y(Because)j(the)f(compression)e
+(ratio)i(of)g(the)g(compressed)f(data)h(cannot)g(b)s(e)f(kno)m(wn)g(in)
+g(adv)-5 b(ance,)34 b(there)150 5340 y(is)d(no)h(easy)g(w)m(a)m(y)h(to)
+f(guaran)m(tee)i(that)e(the)g(output)f(bu\013er)g(will)e(b)s(e)i(big)g
+(enough.)45 b(Y)-8 b(ou)32 b(ma)m(y)h(of)f(course)p eop
+%%Page: 28 29
+28 28 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(28)150 299 y(mak)m(e)36
+b(arrangemen)m(ts)f(in)e(y)m(our)i(co)s(de)g(to)g(record)g(the)g(size)f
+(of)h(the)g(uncompressed)f(data,)i(but)e(suc)m(h)h(a)150
+408 y(mec)m(hanism)30 b(is)f(b)s(ey)m(ond)h(the)g(scop)s(e)h(of)f(this)
+g(library)-8 b(.)150 565 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25
+b Fl(will)k(not)j(write)e(data)j(at)f(or)f(b)s(ey)m(ond)g
+Fj(dest[*destLen])p Fl(,)d(ev)m(en)k(in)150 675 y(case)f(of)g(bu\013er)
+e(o)m(v)m(er\015o)m(w.)150 832 y(P)m(ossible)g(return)h(v)-5
+b(alues:)572 983 y Fj(BZ_CONFIG_ERROR)663 1087 y Fl(if)29
+b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 1190
+y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(dest)g Fl(is)h
+Fj(NULL)f Fl(or)h Fj(destLen)f Fl(is)g Fj(NULL)663 1398
+y Fl(or)h Fj(small)46 b(!=)i(0)f(&&)g(small)g(!=)g(1)663
+1502 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g
+Fj(verbosity)45 b(>)j(4)572 1605 y(BZ_MEM_ERROR)663 1709
+y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f(a)m(v)-5
+b(ailable)572 1813 y Fj(BZ_OUTBUFF_FULL)663 1917 y Fl(if)29
+b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g
+Fj(*destLen)572 2021 y(BZ_DATA_ERROR)663 2124 y Fl(if)e(a)i(data)g(in)m
+(tegrit)m(y)f(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(data)
+572 2228 y Fj(BZ_DATA_ERROR_MAGIC)663 2332 y Fl(if)f(the)i(compressed)f
+(data)h(do)s(esn't)f(b)s(egin)f(with)g(the)i(righ)m(t)e(magic)i(b)m
+(ytes)572 2436 y Fj(BZ_UNEXPECTED_EOF)663 2539 y Fl(if)e(the)i
+(compressed)f(data)h(ends)e(unexp)s(ectedly)572 2643
+y Fj(BZ_OK)663 2747 y Fl(otherwise)150 3116 y Fk(3.6)68
+b Fd(zlib)43 b Fk(compatibilit)l(y)k(functions)150 3308
+y Fl(Y)-8 b(oshiok)j(a)33 b(Tsuneo)e(has)h(con)m(tributed)g(some)g
+(functions)f(to)i(giv)m(e)g(b)s(etter)f Fj(zlib)f Fl(compatibilit)m(y)
+-8 b(.)45 b(These)150 3418 y(functions)36 b(are)i Fj(BZ2_bzopen)p
+Fl(,)e Fj(BZ2_bzread)p Fl(,)h Fj(BZ2_bzwrite)p Fl(,)f
+Fj(BZ2_bzflush)p Fl(,)h Fj(BZ2_bzclose)p Fl(,)f Fj(BZ2_)150
+3527 y(bzerror)23 b Fl(and)h Fj(BZ2_bzlibVersion)p Fl(.)34
+b(These)25 b(functions)e(are)j(not)f(\(y)m(et\))h(o\016cially)e(part)h
+(of)g(the)g(library)-8 b(.)150 3637 y(If)30 b(they)g(break,)h(y)m(ou)g
+(get)g(to)g(k)m(eep)g(all)f(the)g(pieces.)41 b(Nev)m(ertheless,)31
+b(I)f(think)f(they)i(w)m(ork)f(ok.)390 3788 y Fj(typedef)46
+b(void)g(BZFILE;)390 3995 y(const)g(char)h(*)g(BZ2_bzlibVersion)d(\()j
+(void)g(\);)150 4152 y Fl(Returns)29 b(a)i(string)f(indicating)e(the)i
+(library)e(v)m(ersion.)390 4303 y Fj(BZFILE)46 b(*)i(BZ2_bzopen)92
+b(\()48 b(const)e(char)h(*path,)f(const)g(char)h(*mode)f(\);)390
+4407 y(BZFILE)g(*)i(BZ2_bzdopen)c(\()k(int)381 b(fd,)190
+b(const)46 b(char)h(*mode)f(\);)150 4564 y Fl(Op)s(ens)19
+b(a)j Fj(.bz2)e Fl(\014le)g(for)g(reading)g(or)h(writing,)g(using)f
+(either)g(its)h(name)g(or)g(a)g(pre-existing)f(\014le)g(descriptor.)150
+4674 y(Analogous)30 b(to)i Fj(fopen)c Fl(and)i Fj(fdopen)p
+Fl(.)390 4825 y Fj(int)47 b(BZ2_bzread)93 b(\()47 b(BZFILE*)f(b,)h
+(void*)f(buf,)h(int)g(len)g(\);)390 4928 y(int)g(BZ2_bzwrite)e(\()i
+(BZFILE*)f(b,)h(void*)f(buf,)h(int)g(len)g(\);)150 5085
+y Fl(Reads/writes)30 b(data)h(from/to)g(a)g(previously)d(op)s(ened)i
+Fj(BZFILE)p Fl(.)39 b(Analogous)30 b(to)h Fj(fread)e
+Fl(and)h Fj(fwrite)p Fl(.)390 5236 y Fj(int)95 b(BZ2_bzflush)44
+b(\()k(BZFILE*)e(b)h(\);)390 5340 y(void)g(BZ2_bzclose)d(\()k(BZFILE*)e
+(b)h(\);)p eop
+%%Page: 29 30
+29 29 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(29)150 299 y(Flushes/closes)27
+b(a)h Fj(BZFILE)p Fl(.)39 b Fj(BZ2_bzflush)24 b Fl(do)s(esn't)k
+(actually)f(do)h(an)m(ything.)39 b(Analogous)28 b(to)h
+Fj(fflush)150 408 y Fl(and)h Fj(fclose)p Fl(.)390 559
+y Fj(const)46 b(char)h(*)g(BZ2_bzerror)e(\()j(BZFILE)e(*b,)h(int)g
+(*errnum)e(\))150 716 y Fl(Returns)31 b(a)i(string)e(describing)f(the)i
+(more)g(recen)m(t)h(error)f(status)h(of)f Fj(b)p Fl(,)g(and)g(also)g
+(sets)h Fj(*errnum)d Fl(to)j(its)150 826 y(n)m(umerical)c(v)-5
+b(alue.)150 1242 y Fk(3.7)68 b(Using)46 b(the)f(library)g(in)g(a)g
+Fd(stdio)p Fk(-free)f(en)l(vironmen)l(t)150 1615 y Ff(3.7.1)63
+b(Getting)40 b(rid)h(of)g Fe(stdio)150 1807 y Fl(In)i(a)g(deeply)g(em)m
+(b)s(edded)f(application,)j(y)m(ou)f(migh)m(t)f(w)m(an)m(t)h(to)g(use)f
+(just)g(the)h(memory-to-memory)150 1917 y(functions.)39
+b(Y)-8 b(ou)30 b(can)f(do)g(this)g(con)m(v)m(enien)m(tly)g(b)m(y)g
+(compiling)e(the)j(library)d(with)h(prepro)s(cessor)g(sym)m(b)s(ol)150
+2026 y Fj(BZ_NO_STDIO)35 b Fl(de\014ned.)63 b(Doing)39
+b(this)e(giv)m(es)h(y)m(ou)h(a)f(library)e(con)m(taining)i(only)f(the)i
+(follo)m(wing)e(eigh)m(t)150 2136 y(functions:)150 2293
+y Fj(BZ2_bzCompressInit)p Fl(,)26 b Fj(BZ2_bzCompress)p
+Fl(,)g Fj(BZ2_bzCompressEnd)150 2402 y(BZ2_bzDecompressInit)p
+Fl(,)f Fj(BZ2_bzDecompress)p Fl(,)h Fj(BZ2_bzDecompressEnd)150
+2512 y(BZ2_bzBuffToBuffCompress)o Fl(,)f Fj(BZ2_bzBuffToBuffDecompre)o
+(ss)150 2669 y Fl(When)30 b(compiled)f(lik)m(e)h(this,)f(all)g
+(functions)g(will)f(ignore)i Fj(verbosity)e Fl(settings.)150
+3006 y Ff(3.7.2)63 b(Critical)40 b(error)h(handling)150
+3199 y Fj(libbzip2)20 b Fl(con)m(tains)j(a)g(n)m(um)m(b)s(er)f(of)g(in)
+m(ternal)g(assertion)g(c)m(hec)m(ks)i(whic)m(h)d(should,)i(needless)f
+(to)h(sa)m(y)-8 b(,)26 b(nev)m(er)150 3308 y(b)s(e)g(activ)-5
+b(ated.)40 b(Nev)m(ertheless,)28 b(if)d(an)i(assertion)f(should)e
+(fail,)i(b)s(eha)m(viour)f(dep)s(ends)f(on)j(whether)e(or)i(not)150
+3418 y(the)k(library)d(w)m(as)i(compiled)f(with)g Fj(BZ_NO_STDIO)e
+Fl(set.)150 3575 y(F)-8 b(or)31 b(a)g(normal)e(compile,)h(an)g
+(assertion)g(failure)f(yields)f(the)j(message)533 3726
+y Fj(bzip2/libbzip2:)44 b(internal)h(error)i(number)f(N.)533
+3829 y(This)h(is)g(a)g(bug)g(in)h(bzip2/libbzip2,)43
+b(1.0)k(of)g(21-Mar-2000.)533 3933 y(Please)f(report)g(it)i(to)f(me)g
+(at:)g(jseward@acm.org.)91 b(If)47 b(this)g(happened)533
+4037 y(when)g(you)g(were)f(using)h(some)f(program)g(which)h(uses)f
+(libbzip2)g(as)h(a)533 4141 y(component,)e(you)i(should)f(also)h
+(report)f(this)h(bug)f(to)i(the)f(author\(s\))533 4244
+y(of)g(that)g(program.)93 b(Please)46 b(make)h(an)g(effort)f(to)h
+(report)g(this)f(bug;)533 4348 y(timely)g(and)h(accurate)f(bug)h
+(reports)e(eventually)g(lead)i(to)g(higher)533 4452 y(quality)f
+(software.)93 b(Thanks.)h(Julian)46 b(Seward,)f(21)j(March)e(2000.)150
+4609 y Fl(where)30 b Fj(N)g Fl(is)f(some)i(error)f(co)s(de)h(n)m(um)m
+(b)s(er.)39 b Fj(exit\(3\))28 b Fl(is)i(then)g(called.)150
+4766 y(F)-8 b(or)31 b(a)g Fj(stdio)p Fl(-free)e(library)-8
+b(,)29 b(assertion)h(failures)e(result)i(in)f(a)i(call)e(to)i(a)g
+(function)e(declared)h(as:)533 4917 y Fj(extern)46 b(void)h
+(bz_internal_error)c(\()k(int)g(errcode)f(\);)150 5074
+y Fl(The)30 b(relev)-5 b(an)m(t)31 b(co)s(de)f(is)g(passed)f(as)i(a)g
+(parameter.)41 b(Y)-8 b(ou)31 b(should)d(supply)g(suc)m(h)i(a)h
+(function.)150 5230 y(In)g(either)g(case,)j(once)e(an)g(assertion)g
+(failure)e(has)h(o)s(ccurred,)h(an)m(y)g Fj(bz_stream)e
+Fl(records)h(in)m(v)m(olv)m(ed)h(can)150 5340 y(b)s(e)e(regarded)g(as)h
+(in)m(v)-5 b(alid.)38 b(Y)-8 b(ou)31 b(should)d(not)j(attempt)g(to)g
+(resume)f(normal)g(op)s(eration)f(with)g(them.)p eop
+%%Page: 30 31
+30 30 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(30)150 299 y(Y)-8 b(ou)22
+b(ma)m(y)-8 b(,)25 b(of)d(course,)h(c)m(hange)g(critical)e(error)g
+(handling)e(to)j(suit)f(y)m(our)g(needs.)38 b(As)21 b(I)h(said)e(ab)s
+(o)m(v)m(e,)25 b(critical)150 408 y(errors)30 b(indicate)g(bugs)g(in)g
+(the)h(library)d(and)i(should)f(not)i(o)s(ccur.)42 b(All)29
+b Fj(")p Fl(normal)p Fj(")h Fl(error)g(situations)g(are)150
+518 y(indicated)f(via)h(error)g(return)f(co)s(des)i(from)f(functions,)f
+(and)g(can)i(b)s(e)f(reco)m(v)m(ered)i(from.)150 798
+y Fk(3.8)68 b(Making)45 b(a)g(Windo)l(ws)h(DLL)150 990
+y Fl(Ev)m(erything)30 b(related)g(to)h(Windo)m(ws)f(has)g(b)s(een)f
+(con)m(tributed)h(b)m(y)g(Y)-8 b(oshiok)j(a)31 b(Tsuneo)150
+1100 y(\()p Fj(QWF00133@niftyserve.or.jp)46 b Fl(/)52
+b Fj(tsuneo-y@is.aist-nara.ac.j)o(p)p Fl(\),)g(so)h(y)m(ou)f(should)f
+(send)150 1210 y(y)m(our)30 b(queries)g(to)h(him)e(\(but)h(p)s(erhaps)e
+(Cc:)41 b(me,)31 b Fj(jseward@acm.org)p Fl(\).)150 1366
+y(My)43 b(v)-5 b(ague)44 b(understanding)d(of)i(what)g(to)h(do)f(is:)65
+b(using)41 b(Visual)h(C)p Fj(++)g Fl(5.0,)48 b(op)s(en)42
+b(the)h(pro)5 b(ject)44 b(\014le)150 1476 y Fj(libbz2.dsp)p
+Fl(,)28 b(and)i(build.)37 b(That's)31 b(all.)150 1633
+y(If)41 b(y)m(ou)g(can't)h(op)s(en)e(the)h(pro)5 b(ject)42
+b(\014le)e(for)h(some)g(reason,)j(mak)m(e)e(a)g(new)e(one,)k(naming)c
+(these)i(\014les:)150 1742 y Fj(blocksort.c)p Fl(,)28
+b Fj(bzlib.c)p Fl(,)g Fj(compress.c)p Fl(,)g Fj(crctable.c)p
+Fl(,)g Fj(decompress.c)p Fl(,)f Fj(huffman.c)p Fl(,)150
+1852 y Fj(randtable.c)32 b Fl(and)j Fj(libbz2.def)p Fl(.)53
+b(Y)-8 b(ou)36 b(will)d(also)i(need)g(to)h(name)g(the)g(header)f
+(\014les)f Fj(bzlib.h)g Fl(and)150 1962 y Fj(bzlib_private.h)p
+Fl(.)150 2118 y(If)c(y)m(ou)h(don't)f(use)g(V)m(C)p Fj(++)p
+Fl(,)g(y)m(ou)h(ma)m(y)g(need)f(to)h(de\014ne)f(the)h(propro)s(cessor)e
+(sym)m(b)s(ol)g Fj(_WIN32)p Fl(.)150 2275 y(Finally)-8
+b(,)28 b Fj(dlltest.c)e Fl(is)h(a)i(sample)f(program)g(using)g(the)g
+(DLL.)h(It)g(has)f(a)h(pro)5 b(ject)29 b(\014le,)g Fj(dlltest.dsp)p
+Fl(.)150 2432 y(If)h(y)m(ou)h(just)e(w)m(an)m(t)j(a)e(mak)m(e\014le)h
+(for)f(Visual)f(C,)h(ha)m(v)m(e)i(a)e(lo)s(ok)g(at)i
+Fj(makefile.msc)p Fl(.)150 2589 y(Be)k(a)m(w)m(are)g(that)g(if)e(y)m
+(ou)h(compile)f Fj(bzip2)g Fl(itself)g(on)h(Win32,)h(y)m(ou)g(m)m(ust)f
+(set)g Fj(BZ_UNIX)e Fl(to)j(0)f(and)g Fj(BZ_)150 2698
+y(LCCWIN32)27 b Fl(to)j(1,)g(in)f(the)g(\014le)g Fj(bzip2.c)p
+Fl(,)e(b)s(efore)i(compiling.)39 b(Otherwise)28 b(the)h(resulting)f
+(binary)f(w)m(on't)150 2808 y(w)m(ork)j(correctly)-8
+b(.)150 2965 y(I)30 b(ha)m(v)m(en't)i(tried)d(an)m(y)i(of)g(this)e
+(stu\013)h(m)m(yself,)g(but)g(it)f(all)h(lo)s(oks)g(plausible.)p
+eop
+%%Page: 31 32
+31 31 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(31)150 299 y Fh(4)80 b(Miscellanea)150 583 y Fl(These)30
+b(are)h(just)f(some)g(random)g(though)m(ts)h(of)f(mine.)40
+b(Y)-8 b(our)30 b(mileage)h(ma)m(y)g(v)-5 b(ary)d(.)150
+884 y Fk(4.1)68 b(Limitations)47 b(of)e(the)g(compressed)g(\014le)h
+(format)150 1077 y Fj(bzip2-1.0)p Fl(,)e Fj(0.9.5)e Fl(and)g
+Fj(0.9.0)g Fl(use)h(exactly)h(the)f(same)h(\014le)e(format)i(as)f(the)h
+(previous)d(v)m(ersion,)150 1186 y Fj(bzip2-0.1)p Fl(.)75
+b(This)41 b(decision)g(w)m(as)i(made)g(in)e(the)i(in)m(terests)g(of)g
+(stabilit)m(y)-8 b(.)77 b(Creating)42 b(y)m(et)i(another)150
+1296 y(incompatible)21 b(compressed)i(\014le)f(format)i(w)m(ould)e
+(create)i(further)e(confusion)g(and)h(disruption)d(for)j(users.)150
+1453 y(Nev)m(ertheless,)31 b(this)e(is)g(not)h(a)g(painless)e
+(decision.)39 b(Dev)m(elopmen)m(t)31 b(w)m(ork)f(since)f(the)h(release)
+h(of)f Fj(bzip2-)150 1562 y(0.1)19 b Fl(in)g(August)i(1997)h(has)e(sho)
+m(wn)f(complexities)h(in)f(the)h(\014le)g(format)g(whic)m(h)f(slo)m(w)h
+(do)m(wn)g(decompression)150 1672 y(and,)30 b(in)f(retrosp)s(ect,)i
+(are)g(unnecessary)-8 b(.)40 b(These)31 b(are:)225 1829
+y Fi(\017)60 b Fl(The)20 b(run-length)g(enco)s(der,)i(whic)m(h)e(is)g
+(the)h(\014rst)f(of)h(the)g(compression)f(transformations,)i(is)e(en)m
+(tirely)330 1938 y(irrelev)-5 b(an)m(t.)63 b(The)38 b(original)e(purp)s
+(ose)g(w)m(as)j(to)g(protect)g(the)f(sorting)g(algorithm)f(from)g(the)i
+(v)m(ery)330 2048 y(w)m(orst)h(case)h(input:)58 b(a)41
+b(string)e(of)h(rep)s(eated)g(sym)m(b)s(ols.)68 b(But)40
+b(algorithm)f(steps)h(Q6a)h(and)e(Q6b)330 2157 y(in)30
+b(the)i(original)e(Burro)m(ws-Wheeler)i(tec)m(hnical)g(rep)s(ort)f
+(\(SR)m(C-124\))i(sho)m(w)f(ho)m(w)g(rep)s(eats)g(can)g(b)s(e)330
+2267 y(handled)c(without)i(di\016cult)m(y)f(in)g(blo)s(c)m(k)h
+(sorting.)225 2409 y Fi(\017)60 b Fl(The)30 b(randomisation)e(mec)m
+(hanism)i(do)s(esn't)g(really)f(need)h(to)g(b)s(e)g(there.)41
+b(Udi)29 b(Man)m(b)s(er)h(and)f(Gene)330 2518 y(My)m(ers)j(published)c
+(a)33 b(su\016x)e(arra)m(y)h(construction)f(algorithm)g(a)h(few)g(y)m
+(ears)h(bac)m(k,)g(whic)m(h)d(can)j(b)s(e)330 2628 y(emplo)m(y)m(ed)27
+b(to)h(sort)g(an)m(y)f(blo)s(c)m(k,)h(no)f(matter)h(ho)m(w)f(rep)s
+(etitiv)m(e,)h(in)d(O\(N)j(log)f(N\))h(time.)39 b(Subsequen)m(t)330
+2737 y(w)m(ork)25 b(b)m(y)f(Kunihik)m(o)f(Sadak)-5 b(ane)24
+b(has)h(pro)s(duced)e(a)i(deriv)-5 b(ativ)m(e)24 b(O\(N)h(\(log)g(N\))p
+Fj(^)p Fl(2\))h(algorithm)d(whic)m(h)330 2847 y(usually)28
+b(outp)s(erforms)h(the)i(Man)m(b)s(er-My)m(ers)g(algorithm.)330
+2988 y(I)g(could)g(ha)m(v)m(e)i(c)m(hanged)f(to)g(Sadak)-5
+b(ane's)32 b(algorithm,)f(but)g(I)g(\014nd)f(it)h(to)h(b)s(e)f(slo)m(w)
+m(er)h(than)f Fj(bzip2)p Fl('s)330 3098 y(existing)38
+b(algorithm)g(for)h(most)h(inputs,)f(and)g(the)g(randomisation)f(mec)m
+(hanism)g(protects)i(ade-)330 3208 y(quately)34 b(against)f(bad)g
+(cases.)52 b(I)33 b(didn't)f(think)g(it)i(w)m(as)g(a)g(go)s(o)s(d)f
+(tradeo\013)i(to)f(mak)m(e.)51 b(P)m(artly)34 b(this)330
+3317 y(is)39 b(due)h(to)h(the)f(fact)h(that)g(I)f(w)m(as)g(not)h(\015o)
+s(o)s(ded)e(with)g(email)g(complain)m(ts)g(ab)s(out)h
+Fj(bzip2-0.1)p Fl('s)330 3427 y(p)s(erformance)30 b(on)g(rep)s(etitiv)m
+(e)g(data,)h(so)g(p)s(erhaps)d(it)i(isn't)g(a)h(problem)d(for)j(real)f
+(inputs.)330 3568 y(Probably)i(the)h(b)s(est)g(long-term)g(solution,)g
+(and)g(the)g(one)h(I)f(ha)m(v)m(e)h(incorp)s(orated)e(in)m(to)i(0.9.5)h
+(and)330 3678 y(ab)s(o)m(v)m(e,)42 b(is)c(to)h(use)f(the)h(existing)f
+(sorting)g(algorithm)f(initially)-8 b(,)38 b(and)g(fall)f(bac)m(k)i(to)
+h(a)f(O\(N)f(\(log)330 3787 y(N\))p Fj(^)p Fl(2\))31
+b(algorithm)f(if)f(the)i(standard)e(algorithm)h(gets)h(in)m(to)f
+(di\016culties.)225 3929 y Fi(\017)60 b Fl(The)31 b(compressed)f
+(\014le)g(format)i(w)m(as)f(nev)m(er)h(designed)d(to)j(b)s(e)f(handled)
+e(b)m(y)i(a)g(library)-8 b(,)29 b(and)i(I)g(ha)m(v)m(e)330
+4039 y(had)d(to)i(jump)e(though)g(some)i(ho)s(ops)e(to)i(pro)s(duce)e
+(an)h(e\016cien)m(t)g(implemen)m(tation)f(of)h(decompres-)330
+4148 y(sion.)38 b(It's)26 b(a)h(bit)e(hairy)-8 b(.)38
+b(T)-8 b(ry)26 b(passing)f Fj(decompress.c)d Fl(through)k(the)g(C)f
+(prepro)s(cessor)g(and)h(y)m(ou'll)330 4258 y(see)32
+b(what)g(I)f(mean.)45 b(Muc)m(h)32 b(of)g(this)e(complexit)m(y)i(could)
+f(ha)m(v)m(e)i(b)s(een)e(a)m(v)m(oided)h(if)e(the)i(compressed)330
+4367 y(size)e(of)h(eac)m(h)g(blo)s(c)m(k)f(of)h(data)g(w)m(as)g
+(recorded)f(in)f(the)h(data)h(stream.)225 4509 y Fi(\017)60
+b Fl(An)30 b(Adler-32)g(c)m(hec)m(ksum,)i(rather)e(than)g(a)h(CR)m(C32)
+g(c)m(hec)m(ksum,)g(w)m(ould)e(b)s(e)h(faster)h(to)g(compute.)150
+4698 y(It)e(w)m(ould)f(b)s(e)g(fair)g(to)h(sa)m(y)h(that)g(the)f
+Fj(bzip2)e Fl(format)i(w)m(as)h(frozen)f(b)s(efore)f(I)h(prop)s(erly)d
+(and)j(fully)d(under-)150 4807 y(sto)s(o)s(d)k(the)h(p)s(erformance)e
+(consequences)i(of)g(doing)e(so.)150 4964 y(Impro)m(v)m(emen)m(ts)d
+(whic)m(h)e(I)i(w)m(as)g(able)f(to)h(incorp)s(orate)f(in)m(to)g(0.9.0,)
+k(despite)24 b(using)g(the)i(same)g(\014le)e(format,)150
+5074 y(are:)225 5230 y Fi(\017)60 b Fl(Single)30 b(arra)m(y)i(implemen)
+m(tation)e(of)h(the)h(in)m(v)m(erse)f(BWT.)h(This)e(signi\014can)m(tly)
+f(sp)s(eeds)i(up)f(decom-)330 5340 y(pression,)f(presumably)f(b)s
+(ecause)i(it)g(reduces)g(the)h(n)m(um)m(b)s(er)e(of)i(cac)m(he)h
+(misses.)p eop
+%%Page: 32 33
+32 32 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(32)225 299 y Fi(\017)60 b Fl(F)-8 b(aster)27 b(in)m(v)m(erse)e(MTF)h
+(transform)f(for)g(large)h(MTF)f(v)-5 b(alues.)39 b(The)25
+b(new)g(implemen)m(tation)f(is)g(based)330 408 y(on)30
+b(the)h(notion)f(of)g(sliding)e(blo)s(c)m(ks)h(of)i(v)-5
+b(alues.)225 544 y Fi(\017)60 b Fj(bzip2-0.9.0)24 b Fl(no)m(w)k(reads)f
+(and)f(writes)h(\014les)f(with)g Fj(fread)g Fl(and)h
+Fj(fwrite)p Fl(;)f(v)m(ersion)h(0.1)i(used)d Fj(putc)330
+653 y Fl(and)k Fj(getc)p Fl(.)39 b(Duh!)h(W)-8 b(ell,)31
+b(y)m(ou)f(liv)m(e)g(and)g(learn.)150 836 y(F)-8 b(urther)30
+b(ahead,)g(it)f(w)m(ould)g(b)s(e)g(nice)h(to)g(b)s(e)g(able)f(to)i(do)e
+(random)g(access)j(in)m(to)d(\014les.)40 b(This)28 b(will)f(require)150
+945 y(some)k(careful)e(design)h(of)g(compressed)g(\014le)g(formats.)150
+1227 y Fk(4.2)68 b(P)l(ortabilit)l(y)47 b(issues)150
+1419 y Fl(After)36 b(some)g(consideration,)g(I)f(ha)m(v)m(e)i(decided)d
+(not)i(to)g(use)g(GNU)g Fj(autoconf)d Fl(to)j(con\014gure)g(0.9.5)h(or)
+150 1529 y(1.0.)150 1686 y Fj(autoconf)p Fl(,)31 b(admirable)g(and)h(w)
+m(onderful)f(though)i(it)f(is,)h(mainly)d(assists)j(with)e(p)s
+(ortabilit)m(y)g(problems)150 1795 y(b)s(et)m(w)m(een)f(Unix-lik)m(e)d
+(platforms.)40 b(But)29 b Fj(bzip2)f Fl(do)s(esn't)h(ha)m(v)m(e)h(m)m
+(uc)m(h)f(in)f(the)h(w)m(a)m(y)h(of)g(p)s(ortabilit)m(y)d(prob-)150
+1905 y(lems)35 b(on)h(Unix;)j(most)d(of)g(the)h(di\016culties)d(app)s
+(ear)h(when)g(p)s(orting)g(to)i(the)f(Mac,)j(or)d(to)h(Microsoft's)150
+2015 y(op)s(erating)26 b(systems.)40 b Fj(autoconf)25
+b Fl(do)s(esn't)h(help)g(in)f(those)j(cases,)h(and)d(brings)f(in)g(a)j
+(whole)e(load)g(of)h(new)150 2124 y(complexit)m(y)-8
+b(.)150 2281 y(Most)28 b(p)s(eople)f(should)f(b)s(e)h(able)g(to)h
+(compile)e(the)i(library)d(and)i(program)h(under)e(Unix)g(straigh)m(t)i
+(out-of-)150 2391 y(the-b)s(o)m(x,)j(so)g(to)g(sp)s(eak,)f(esp)s
+(ecially)f(if)g(y)m(ou)i(ha)m(v)m(e)g(a)g(v)m(ersion)f(of)g(GNU)h(C)f
+(a)m(v)-5 b(ailable.)150 2547 y(There)32 b(are)h(a)g(couple)f(of)h
+Fj(__inline__)d Fl(directiv)m(es)i(in)f(the)i(co)s(de.)48
+b(GNU)33 b(C)f(\()p Fj(gcc)p Fl(\))g(should)f(b)s(e)h(able)g(to)150
+2657 y(handle)24 b(them.)39 b(If)25 b(y)m(ou're)i(not)e(using)g(GNU)h
+(C,)f(y)m(our)h(C)f(compiler)f(shouldn't)g(see)i(them)f(at)i(all.)38
+b(If)25 b(y)m(our)150 2767 y(compiler)k(do)s(es,)i(for)g(some)g
+(reason,)h(see)f(them)g(and)f(do)s(esn't)h(lik)m(e)f(them,)i(just)e
+Fj(#define)f(__inline__)150 2876 y Fl(to)37 b(b)s(e)f
+Fj(/*)30 b(*/)p Fl(.)58 b(One)36 b(easy)h(w)m(a)m(y)g(to)h(do)e(this)f
+(is)h(to)h(compile)e(with)g(the)i(\015ag)g Fj(-D__inline__=)p
+Fl(,)d(whic)m(h)150 2986 y(should)28 b(b)s(e)i(understo)s(o)s(d)f(b)m
+(y)h(most)h(Unix)e(compilers.)150 3143 y(If)35 b(y)m(ou)g(still)e(ha)m
+(v)m(e)j(di\016culties,)e(try)h(compiling)e(with)g(the)j(macro)f
+Fj(BZ_STRICT_ANSI)c Fl(de\014ned.)54 b(This)150 3252
+y(should)28 b(enable)i(y)m(ou)h(to)g(build)d(the)i(library)e(in)h(a)i
+(strictly)f(ANSI)g(complian)m(t)f(en)m(vironmen)m(t.)41
+b(Building)150 3362 y(the)25 b(program)f(itself)f(lik)m(e)g(this)h(is)f
+(dangerous)h(and)g(not)g(supp)s(orted,)g(since)g(y)m(ou)h(remo)m(v)m(e)
+g Fj(bzip2)p Fl('s)e(c)m(hec)m(ks)150 3471 y(against)30
+b(compressing)f(directories,)g(sym)m(b)s(olic)g(links,)f(devices,)i
+(and)f(other)h(not-really-a-\014le)g(en)m(tities.)150
+3581 y(This)f(could)g(cause)i(\014lesystem)f(corruption!)150
+3738 y(One)e(other)i(thing:)39 b(if)27 b(y)m(ou)j(create)g(a)f
+Fj(bzip2)f Fl(binary)f(for)i(public)d(distribution,)g(please)i(try)h
+(and)g(link)d(it)150 3847 y(statically)g(\()p Fj(gcc)k(-s)p
+Fl(\).)39 b(This)25 b(a)m(v)m(oids)i(all)f(sorts)h(of)g(library-v)m
+(ersion)d(issues)h(that)i(others)g(ma)m(y)g(encoun)m(ter)150
+3957 y(later)j(on.)150 4114 y(If)f(y)m(ou)g(build)e Fj(bzip2)h
+Fl(on)h(Win32,)h(y)m(ou)f(m)m(ust)g(set)h Fj(BZ_UNIX)e
+Fl(to)i(0)f(and)g Fj(BZ_LCCWIN32)d Fl(to)k(1,)g(in)e(the)i(\014le)150
+4223 y Fj(bzip2.c)p Fl(,)f(b)s(efore)h(compiling.)38
+b(Otherwise)29 b(the)i(resulting)d(binary)h(w)m(on't)i(w)m(ork)f
+(correctly)-8 b(.)150 4505 y Fk(4.3)68 b(Rep)t(orting)46
+b(bugs)150 4698 y Fl(I)25 b(tried)f(prett)m(y)i(hard)e(to)i(mak)m(e)g
+(sure)f Fj(bzip2)e Fl(is)i(bug)f(free,)j(b)s(oth)d(b)m(y)h(design)f
+(and)h(b)m(y)g(testing.)39 b(Hop)s(efully)150 4807 y(y)m(ou'll)29
+b(nev)m(er)i(need)f(to)h(read)g(this)e(section)h(for)h(real.)150
+4964 y(Nev)m(ertheless,)36 b(if)c Fj(bzip2)h Fl(dies)g(with)f(a)i
+(segmen)m(tation)h(fault,)g(a)f(bus)f(error)g(or)h(an)g(in)m(ternal)e
+(assertion)150 5074 y(failure,)i(it)h(will)d(ask)j(y)m(ou)g(to)g(email)
+f(me)h(a)g(bug)f(rep)s(ort.)54 b(Exp)s(erience)33 b(with)h(v)m(ersion)g
+(0.1)i(sho)m(ws)e(that)150 5183 y(almost)c(all)g(these)h(problems)d
+(can)j(b)s(e)f(traced)h(to)g(either)f(compiler)e(bugs)i(or)g(hardw)m
+(are)g(problems.)225 5340 y Fi(\017)60 b Fl(Recompile)22
+b(the)h(program)g(with)f(no)h(optimisation,)g(and)f(see)i(if)e(it)g(w)m
+(orks.)39 b(And/or)22 b(try)h(a)g(di\013eren)m(t)p eop
+%%Page: 33 34
+33 33 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(33)330 299 y(compiler.)77 b(I)43 b(heard)f(all)g(sorts)h(of)h
+(stories)e(ab)s(out)h(v)-5 b(arious)42 b(\015a)m(v)m(ours)h(of)h(GNU)f
+(C)g(\(and)g(other)330 408 y(compilers\))20 b(generating)i(bad)e(co)s
+(de)i(for)f Fj(bzip2)p Fl(,)h(and)f(I'v)m(e)h(run)e(across)i(t)m(w)m(o)
+g(suc)m(h)f(examples)g(m)m(yself.)330 606 y(2.7.X)35
+b(v)m(ersions)e(of)g(GNU)h(C)f(are)h(kno)m(wn)f(to)h(generate)h(bad)d
+(co)s(de)i(from)f(time)g(to)h(time,)g(at)g(high)330 716
+y(optimisation)20 b(lev)m(els.)37 b(If)21 b(y)m(ou)g(get)i(problems,)e
+(try)g(using)f(the)i(\015ags)f Fj(-O2)f(-fomit-frame-pointer)330
+825 y(-fno-strength-reduce)p Fl(.)35 b(Y)-8 b(ou)31 b(should)d(sp)s
+(eci\014cally)h Fc(not)j Fl(use)e Fj(-funroll-loops)p
+Fl(.)330 1023 y(Y)-8 b(ou)38 b(ma)m(y)g(notice)g(that)g(the)g(Mak)m
+(e\014le)g(runs)e(six)g(tests)i(as)g(part)f(of)h(the)g(build)c(pro)s
+(cess.)62 b(If)37 b(the)330 1132 y(program)43 b(passes)g(all)f(of)h
+(these,)k(it's)c(a)h(prett)m(y)f(go)s(o)s(d)g(\(but)g(not)g(100\045\))i
+(indication)c(that)j(the)330 1242 y(compiler)29 b(has)h(done)g(its)g
+(job)g(correctly)-8 b(.)225 1440 y Fi(\017)60 b Fl(If)33
+b Fj(bzip2)f Fl(crashes)i(randomly)-8 b(,)33 b(and)g(the)h(crashes)g
+(are)g(not)g(rep)s(eatable,)g(y)m(ou)g(ma)m(y)g(ha)m(v)m(e)h(a)f
+(\015aky)330 1549 y(memory)k(subsystem.)64 b Fj(bzip2)37
+b Fl(really)g(hammers)h(y)m(our)g(memory)g(hierarc)m(h)m(y)-8
+b(,)41 b(and)d(if)f(it's)h(a)h(bit)330 1659 y(marginal,)33
+b(y)m(ou)h(ma)m(y)g(get)h(these)f(problems.)49 b(Ditto)34
+b(if)f(y)m(our)h(disk)e(or)h(I/O)h(subsystem)e(is)h(slo)m(wly)330
+1768 y(failing.)39 b(Y)-8 b(up,)30 b(this)f(really)g(do)s(es)h(happ)s
+(en.)330 1966 y(T)-8 b(ry)28 b(using)f(a)i(di\013eren)m(t)f(mac)m(hine)
+g(of)h(the)g(same)f(t)m(yp)s(e,)i(and)e(see)h(if)e(y)m(ou)i(can)g(rep)s
+(eat)g(the)f(problem.)225 2163 y Fi(\017)60 b Fl(This)21
+b(isn't)i(really)f(a)h(bug,)i(but)d(...)39 b(If)23 b
+Fj(bzip2)f Fl(tells)g(y)m(ou)h(y)m(our)h(\014le)e(is)g(corrupted)h(on)g
+(decompression,)330 2273 y(and)29 b(y)m(ou)g(obtained)f(the)i(\014le)e
+(via)h(FTP)-8 b(,)29 b(there)h(is)e(a)h(p)s(ossibilit)m(y)d(that)k(y)m
+(ou)f(forgot)h(to)g(tell)e(FTP)h(to)330 2383 y(do)23
+b(a)g(binary)e(mo)s(de)i(transfer.)38 b(That)23 b(absolutely)f(will)e
+(cause)j(the)h(\014le)e(to)h(b)s(e)g(non-decompressible.)330
+2492 y(Y)-8 b(ou'll)30 b(ha)m(v)m(e)h(to)g(transfer)f(it)g(again.)150
+2737 y(If)i(y)m(ou'v)m(e)h(incorp)s(orated)e Fj(libbzip2)f
+Fl(in)m(to)i(y)m(our)g(o)m(wn)g(program)g(and)g(are)g(getting)h
+(problems,)e(please,)150 2847 y(please,)d(please,)h(c)m(hec)m(k)g(that)
+f(the)g(parameters)g(y)m(ou)g(are)g(passing)f(in)f(calls)h(to)h(the)g
+(library)-8 b(,)26 b(are)j(correct,)150 2956 y(and)e(in)f(accordance)k
+(with)c(what)i(the)g(do)s(cumen)m(tation)f(sa)m(ys)h(is)f(allo)m(w)m
+(able.)39 b(I)28 b(ha)m(v)m(e)h(tried)e(to)h(mak)m(e)h(the)150
+3066 y(library)f(robust)i(against)g(suc)m(h)g(problems,)f(but)h(I'm)g
+(sure)g(I)g(ha)m(v)m(en't)h(succeeded.)150 3223 y(Finally)-8
+b(,)32 b(if)g(the)h(ab)s(o)m(v)m(e)i(commen)m(ts)e(don't)g(help,)g(y)m
+(ou'll)f(ha)m(v)m(e)i(to)g(send)e(me)h(a)g(bug)g(rep)s(ort.)48
+b(No)m(w,)34 b(it's)150 3332 y(just)c(amazing)g(ho)m(w)h(man)m(y)f(p)s
+(eople)g(will)d(send)j(me)g(a)h(bug)f(rep)s(ort)g(sa)m(ying)g
+(something)g(lik)m(e)481 3483 y(bzip2)f(crashed)h(with)f(segmen)m
+(tation)j(fault)e(on)g(m)m(y)g(mac)m(hine)150 3640 y(and)h(absolutely)f
+(nothing)h(else.)44 b(Needless)32 b(to)g(sa)m(y)-8 b(,)33
+b(a)f(suc)m(h)f(a)h(rep)s(ort)f(is)g Fc(totally)-8 b(,)32
+b(utterly)-8 b(,)32 b(completely)150 3750 y(and)40 b(comprehensiv)m
+(ely)g(100\045)h(useless;)46 b(a)41 b(w)m(aste)g(of)g(y)m(our)g(time,)i
+(m)m(y)e(time,)i(and)e(net)g(bandwidth)p Fl(.)150 3859
+y(With)31 b(no)h(details)f(at)i(all,)e(there's)h(no)g(w)m(a)m(y)h(I)f
+(can)g(p)s(ossibly)d(b)s(egin)h(to)j(\014gure)e(out)i(what)e(the)i
+(problem)150 3969 y(is.)150 4126 y(The)d(rules)e(of)i(the)g(game)h
+(are:)41 b(facts,)32 b(facts,)f(facts.)41 b(Don't)31
+b(omit)f(them)g(b)s(ecause)g Fj(")p Fl(oh,)g(they)g(w)m(on't)h(b)s(e)
+150 4235 y(relev)-5 b(an)m(t)p Fj(")p Fl(.)41 b(A)m(t)31
+b(the)g(bare)f(minim)m(um:)481 4386 y(Mac)m(hine)h(t)m(yp)s(e.)61
+b(Op)s(erating)29 b(system)h(v)m(ersion.)481 4490 y(Exact)h(v)m(ersion)
+f(of)h Fj(bzip2)e Fl(\(do)h Fj(bzip2)47 b(-V)p Fl(\).)481
+4594 y(Exact)31 b(v)m(ersion)f(of)h(the)f(compiler)f(used.)481
+4698 y(Flags)i(passed)e(to)j(the)e(compiler.)150 4854
+y(Ho)m(w)m(ev)m(er,)i(the)d(most)h(imp)s(ortan)m(t)f(single)f(thing)g
+(that)i(will)d(help)h(me)h(is)f(the)i(\014le)e(that)i(y)m(ou)g(w)m(ere)
+g(trying)150 4964 y(to)f(compress)f(or)g(decompress)g(at)h(the)f(time)g
+(the)g(problem)f(happ)s(ened.)38 b(Without)28 b(that,)h(m)m(y)g(abilit)
+m(y)d(to)150 5074 y(do)k(an)m(ything)g(more)h(than)f(sp)s(eculate)g(ab)
+s(out)g(the)g(cause,)i(is)d(limited.)150 5230 y(Please)34
+b(remem)m(b)s(er)f(that)h(I)f(connect)i(to)f(the)g(In)m(ternet)g(with)e
+(a)i(mo)s(dem,)g(so)f(y)m(ou)h(should)e(con)m(tact)k(me)150
+5340 y(b)s(efore)30 b(mailing)e(me)j(h)m(uge)f(\014les.)p
+eop
+%%Page: 34 35
+34 34 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(34)150 299 y Fk(4.4)68 b(Did)45 b(y)l(ou)g(get)h(the)f(righ)l(t)h
+(pac)l(k)-7 b(age?)150 491 y Fj(bzip2)34 b Fl(is)h(a)h(resource)g(hog.)
+56 b(It)36 b(soaks)g(up)f(large)g(amoun)m(ts)h(of)g(CPU)f(cycles)h(and)
+f(memory)-8 b(.)57 b(Also,)36 b(it)150 601 y(giv)m(es)26
+b(v)m(ery)h(large)f(latencies.)39 b(In)25 b(the)h(w)m(orst)g(case,)i(y)
+m(ou)f(can)f(feed)g(man)m(y)g(megab)m(ytes)h(of)f(uncompressed)150
+711 y(data)45 b(in)m(to)e(the)i(library)c(b)s(efore)j(getting)g(an)m(y)
+g(compressed)g(output,)j(so)d(this)f(probably)f(rules)h(out)150
+820 y(applications)29 b(requiring)e(in)m(teractiv)m(e)32
+b(b)s(eha)m(viour.)150 977 y(These)38 b(aren't)h(faults)e(of)h(m)m(y)g
+(implemen)m(tation,)h(I)f(hop)s(e,)i(but)d(more)h(an)g(in)m(trinsic)e
+(prop)s(ert)m(y)h(of)i(the)150 1087 y(Burro)m(ws-Wheeler)30
+b(transform)g(\(unfortunately\).)40 b(Ma)m(yb)s(e)31
+b(this)e(isn't)h(what)g(y)m(ou)h(w)m(an)m(t.)150 1244
+y(If)h(y)m(ou)h(w)m(an)m(t)g(a)g(compressor)g(and/or)f(library)e(whic)m
+(h)h(is)h(faster,)i(uses)e(less)g(memory)g(but)g(gets)h(prett)m(y)150
+1353 y(go)s(o)s(d)e(compression,)g(and)g(has)h(minimal)c(latency)-8
+b(,)33 b(consider)e(Jean-loup)f(Gailly's)g(and)h(Mark)h(Adler's)150
+1463 y(w)m(ork,)f Fj(zlib-1.1.2)c Fl(and)j Fj(gzip-1.2.4)p
+Fl(.)38 b(Lo)s(ok)31 b(for)f(them)g(at)150 1620 y Fj
+(http://www.cdrom.com/pub)o(/inf)o(ozip)o(/zl)o(ib)24
+b Fl(and)30 b Fj(http://www.gzip.org)25 b Fl(resp)s(ectiv)m(ely)-8
+b(.)150 1776 y(F)g(or)32 b(something)f(faster)i(and)e(ligh)m(ter)f
+(still,)h(y)m(ou)g(migh)m(t)h(try)f(Markus)h(F)g(X)f(J)h(Ob)s(erh)m
+(umer's)d Fj(LZO)i Fl(real-)150 1886 y(time)f
+(compression/decompression)f(library)-8 b(,)28 b(at)150
+1996 y Fj(http://wildsau.idv.uni-l)o(inz.)o(ac.a)o(t/m)o(fx/l)o(zo.h)o
+(tml)o Fl(.)150 2152 y(If)38 b(y)m(ou)h(w)m(an)m(t)g(to)h(use)e(the)g
+Fj(bzip2)g Fl(algorithms)f(to)i(compress)f(small)g(blo)s(c)m(ks)f(of)i
+(data,)j(64k)d(b)m(ytes)g(or)150 2262 y(smaller,)i(for)e(example)g(on)h
+(an)f(on-the-\015y)h(disk)e(compressor,)k(y)m(ou'd)e(b)s(e)f(w)m(ell)g
+(advised)f(not)i(to)g(use)150 2372 y(this)i(library)-8
+b(.)77 b(Instead,)47 b(I'v)m(e)d(made)f(a)h(sp)s(ecial)e(library)f
+(tuned)h(for)h(that)h(kind)d(of)j(use.)79 b(It's)43 b(part)150
+2481 y(of)d Fj(e2compr-0.40)p Fl(,)f(an)g(on-the-\015y)h(disk)e
+(compressor)h(for)h(the)f(Lin)m(ux)f Fj(ext2)h Fl(\014lesystem.)67
+b(Lo)s(ok)40 b(at)150 2591 y Fj(http://www.netspace.net.)o(au/~)o(reit)
+o(er/)o(e2co)o(mpr)p Fl(.)150 2880 y Fk(4.5)68 b(T)-11
+b(esting)150 3072 y Fl(A)30 b(record)h(of)f(the)h(tests)g(I'v)m(e)g
+(done.)150 3229 y(First,)f(some)h(data)g(sets:)225 3386
+y Fi(\017)60 b Fl(B:)32 b(a)f(directory)f(con)m(taining)h(6001)i
+(\014les,)d(one)h(for)g(ev)m(ery)h(length)e(in)g(the)h(range)g(0)h(to)f
+(6000)i(b)m(ytes.)330 3496 y(The)d(\014les)f(con)m(tain)i(random)e(lo)m
+(w)m(ercase)j(letters.)41 b(18.7)32 b(megab)m(ytes.)225
+3633 y Fi(\017)60 b Fl(H:)36 b(m)m(y)f(home)h(directory)f(tree.)56
+b(Do)s(cumen)m(ts,)38 b(source)d(co)s(de,)i(mail)d(\014les,)i
+(compressed)f(data.)57 b(H)330 3743 y(con)m(tains)39
+b(B,)h(and)f(also)g(a)g(directory)g(of)g(\014les)f(designed)g(as)i(b)s
+(oundary)d(cases)j(for)f(the)g(sorting;)330 3853 y(mostly)30
+b(v)m(ery)h(rep)s(etitiv)m(e,)f(nast)m(y)h(\014les.)39
+b(565)32 b(megab)m(ytes.)225 3990 y Fi(\017)60 b Fl(A:)43
+b(directory)f(tree)i(holding)d(v)-5 b(arious)41 b(applications)g(built)
+g(from)h(source:)66 b Fj(egcs)p Fl(,)45 b Fj(gcc-2.8.1)p
+Fl(,)330 4100 y(KDE,)31 b(GTK,)f(Octa)m(v)m(e,)j(etc.)41
+b(2200)33 b(megab)m(ytes.)150 4285 y(The)i(tests)g(conducted)g(are)h
+(as)f(follo)m(ws.)54 b(Eac)m(h)36 b(test)g(means)f(compressing)f(\(a)h
+(cop)m(y)h(of)7 b(\))36 b(eac)m(h)g(\014le)e(in)150 4394
+y(the)d(data)g(set,)g(decompressing)e(it)h(and)g(comparing)f(it)h
+(against)h(the)g(original.)150 4551 y(First,)26 b(a)g(bunc)m(h)f(of)h
+(tests)h(with)d(blo)s(c)m(k)h(sizes)h(and)f(in)m(ternal)g(bu\013er)f
+(sizes)i(set)g(v)m(ery)g(small,)g(to)g(detect)i(an)m(y)150
+4661 y(problems)g(with)g(the)i(blo)s(c)m(king)f(and)g(bu\013ering)e
+(mec)m(hanisms.)40 b(This)28 b(required)g(mo)s(difying)f(the)j(source)
+150 4770 y(co)s(de)h(so)f(as)h(to)g(try)f(to)h(break)g(it.)199
+4927 y(1.)61 b(Data)32 b(set)f(H,)g(with)e(bu\013er)g(size)h(of)h(1)g
+(b)m(yte,)g(and)f(blo)s(c)m(k)g(size)g(of)g(23)i(b)m(ytes.)199
+5065 y(2.)61 b(Data)32 b(set)f(B,)g(bu\013er)e(sizes)h(1)h(b)m(yte,)g
+(blo)s(c)m(k)f(size)g(1)h(b)m(yte.)199 5202 y(3.)61 b(As)30
+b(\(2\))i(but)d(small-mo)s(de)g(decompression.)199 5340
+y(4.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(2)h(b)m(ytes.)p
+eop
+%%Page: 35 36
+35 35 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(35)199 299 y(5.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(3)h
+(b)m(ytes.)199 431 y(6.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)
+g(4)h(b)m(ytes.)199 564 y(7.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h
+(size)g(5)h(b)m(ytes.)199 697 y(8.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)
+m(k)h(size)g(6)h(b)m(ytes)g(and)e(small-mo)s(de)g(decompression.)199
+829 y(9.)61 b(H)30 b(with)g(bu\013er)f(size)h(of)h(1)f(b)m(yte,)i(but)d
+(normal)h(blo)s(c)m(k)g(size)g(\(up)f(to)j(900000)h(b)m(ytes\).)150
+1009 y(Then)c(some)i(tests)g(with)e(unmo)s(di\014ed)f(source)i(co)s
+(de.)199 1166 y(1.)61 b(H,)31 b(all)e(settings)h(normal.)199
+1299 y(2.)61 b(As)30 b(\(1\),)i(with)d(small-mo)s(de)g(decompress.)199
+1431 y(3.)61 b(H,)31 b(compress)f(with)f(\015ag)i Fj(-1)p
+Fl(.)199 1564 y(4.)61 b(H,)31 b(compress)f(with)f(\015ag)i
+Fj(-s)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)199
+1697 y(5.)61 b(F)-8 b(orw)m(ards)33 b(compatibilit)m(y:)45
+b(H,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j Fj(bzip2-0.9.5)d
+Fl(decompressing,)330 1806 y(all)f(settings)i(normal.)199
+1939 y(6.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35
+b(H,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c
+Fl(decompressing,)330 2048 y(all)29 b(settings)i(normal.)199
+2181 y(7.)61 b(Bigger)31 b(tests:)41 b(A,)31 b(all)e(settings)i
+(normal.)199 2314 y(8.)61 b(As)30 b(\(7\),)i(using)d(the)i(fallbac)m(k)
+e(\(Sadak)-5 b(ane-lik)m(e\))31 b(sorting)f(algorithm.)199
+2446 y(9.)61 b(As)30 b(\(8\),)i(compress)e(with)f(\015ag)i
+Fj(-1)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)154
+2579 y(10.)61 b(H,)31 b(using)e(the)h(fallbac)m(k)g(sorting)g
+(algorithm.)154 2711 y(11.)61 b(F)-8 b(orw)m(ards)33
+b(compatibilit)m(y:)45 b(A,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j
+Fj(bzip2-0.9.5)d Fl(decompressing,)330 2821 y(all)f(settings)i(normal.)
+154 2954 y(12.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35
+b(A,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c
+Fl(decompressing,)330 3063 y(all)29 b(settings)i(normal.)154
+3196 y(13.)61 b(Misc)39 b(test:)58 b(ab)s(out)39 b(400)h(megab)m(ytes)h
+(of)e Fj(.tar)f Fl(\014les)f(with)h Fj(bzip2)f Fl(compiled)h(with)f
+(Chec)m(k)m(er)j(\(a)330 3305 y(memory)30 b(access)i(error)e(detector,)
+i(lik)m(e)e(Purify\).)154 3438 y(14.)61 b(Misc)30 b(tests)h(to)g(mak)m
+(e)h(sure)d(it)h(builds)e(and)h(runs)g(ok)i(on)f(non-Lin)m(ux/x86)g
+(platforms.)150 3618 y(These)35 b(tests)h(w)m(ere)f(conducted)g(on)g(a)
+h(225)g(MHz)g(IDT)f(WinChip)d(mac)m(hine,)k(running)d(Lin)m(ux)g
+(2.0.36.)150 3728 y(They)d(represen)m(t)g(nearly)g(a)h(w)m(eek)g(of)f
+(con)m(tin)m(uous)g(computation.)41 b(All)29 b(tests)i(completed)f
+(successfully)-8 b(.)150 4003 y Fk(4.6)68 b(F)-11 b(urther)44
+b(reading)150 4196 y Fj(bzip2)28 b Fl(is)h(not)h(researc)m(h)g(w)m
+(ork,)g(in)e(the)i(sense)g(that)g(it)f(do)s(esn't)g(presen)m(t)h(an)m
+(y)g(new)f(ideas.)40 b(Rather,)30 b(it's)150 4306 y(an)g(engineering)f
+(exercise)i(based)f(on)g(existing)g(ideas.)150 4463 y(F)-8
+b(our)31 b(do)s(cumen)m(ts)f(describ)s(e)e(essen)m(tially)i(all)f(the)i
+(ideas)e(b)s(ehind)f Fj(bzip2)p Fl(:)390 4614 y Fj(Michael)46
+b(Burrows)g(and)h(D.)g(J.)g(Wheeler:)485 4717 y("A)h(block-sorting)c
+(lossless)h(data)i(compression)e(algorithm")533 4821
+y(10th)i(May)g(1994.)533 4925 y(Digital)f(SRC)h(Research)e(Report)i
+(124.)533 5029 y(ftp://ftp.digital.com/pub)o(/DEC)o(/SR)o(C/re)o(sear)o
+(ch-)o(repo)o(rts/)o(SRC)o(-124)o(.ps.)o(gz)533 5132
+y(If)g(you)g(have)g(trouble)f(finding)g(it,)g(try)h(searching)f(at)h
+(the)533 5236 y(New)g(Zealand)f(Digital)g(Library,)f
+(http://www.nzdl.org.)p eop
+%%Page: 36 37
+36 36 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(36)390 299 y Fj(Daniel)46 b(S.)h(Hirschberg)e(and)i(Debra)g(A.)g
+(LeLewer)485 403 y("Efficient)e(Decoding)h(of)h(Prefix)f(Codes")533
+506 y(Communications)e(of)j(the)g(ACM,)g(April)f(1990,)h(Vol)f(33,)h
+(Number)f(4.)533 610 y(You)h(might)f(be)i(able)e(to)h(get)g(an)h
+(electronic)d(copy)h(of)h(this)676 714 y(from)g(the)g(ACM)g(Digital)f
+(Library.)390 922 y(David)g(J.)i(Wheeler)533 1025 y(Program)e(bred3.c)g
+(and)h(accompanying)d(document)i(bred3.ps.)533 1129 y(This)h(contains)e
+(the)i(idea)g(behind)f(the)h(multi-table)e(Huffman)533
+1233 y(coding)h(scheme.)533 1337 y(ftp://ftp.cl.cam.ac.uk/us)o(ers/)o
+(djw)o(3/)390 1544 y(Jon)h(L.)g(Bentley)f(and)h(Robert)f(Sedgewick)485
+1648 y("Fast)h(Algorithms)e(for)i(Sorting)f(and)g(Searching)g(Strings")
+533 1752 y(Available)f(from)i(Sedgewick's)e(web)i(page,)533
+1856 y(www.cs.princeton.edu/~rs)150 2012 y Fl(The)29
+b(follo)m(wing)f(pap)s(er)g(giv)m(es)h(v)-5 b(aluable)28
+b(additional)g(insigh)m(ts)f(in)m(to)j(the)f(algorithm,)g(but)g(is)f
+(not)i(imme-)150 2122 y(diately)g(the)g(basis)f(of)i(an)m(y)g(co)s(de)f
+(used)g(in)f(bzip2.)390 2273 y Fj(Peter)46 b(Fenwick:)533
+2377 y(Block)h(Sorting)e(Text)i(Compression)533 2481
+y(Proceedings)e(of)i(the)g(19th)g(Australasian)d(Computer)i(Science)f
+(Conference,)629 2584 y(Melbourne,)g(Australia.)92 b(Jan)47
+b(31)g(-)h(Feb)f(2,)g(1996.)533 2688 y(ftp://ftp.cs.auckland.ac.)o
+(nz/p)o(ub/)o(pete)o(r-f/)o(ACS)o(C96p)o(aper)o(.ps)150
+2845 y Fl(Kunihik)m(o)28 b(Sadak)-5 b(ane's)31 b(sorting)e(algorithm,)h
+(men)m(tioned)g(ab)s(o)m(v)m(e,)i(is)d(a)m(v)-5 b(ailable)30
+b(from:)390 2996 y Fj(http://naomi.is.s.u-toky)o(o.ac)o(.jp/)o(~sa)o
+(da/p)o(aper)o(s/S)o(ada9)o(8b.p)o(s.g)o(z)150 3153 y
+Fl(The)41 b(Man)m(b)s(er-My)m(ers)g(su\016x)g(arra)m(y)g(construction)g
+(algorithm)f(is)g(describ)s(ed)f(in)h(a)i(pap)s(er)e(a)m(v)-5
+b(ailable)150 3262 y(from:)390 3413 y Fj(http://www.cs.arizona.ed)o
+(u/pe)o(ople)o(/ge)o(ne/P)o(APER)o(S/s)o(uffi)o(x.ps)150
+3570 y Fl(Finally)d(,)33 b(the)h(follo)m(wing)e(pap)s(er)h(do)s(cumen)m
+(ts)g(some)h(recen)m(t)h(in)m(v)m(estigations)e(I)h(made)f(in)m(to)h
+(the)g(p)s(erfor-)150 3680 y(mance)d(of)f(sorting)g(algorithms:)390
+3831 y Fj(Julian)46 b(Seward:)533 3935 y(On)h(the)g(Performance)e(of)i
+(BWT)g(Sorting)f(Algorithms)533 4038 y(Proceedings)f(of)i(the)g(IEEE)g
+(Data)f(Compression)f(Conference)g(2000)629 4142 y(Snowbird,)g(Utah.)94
+b(28-30)46 b(March)h(2000.)p eop
+%%Page: -1 38
+-1 37 bop 3725 -116 a Fl(i)150 299 y Fh(T)-13 b(able)54
+b(of)g(Con)l(ten)l(ts)150 641 y Fk(1)135 b(In)l(tro)t(duction)15
+b Fb(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f
+(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)60
+b Fk(2)150 911 y(2)135 b(Ho)l(w)45 b(to)h(use)f Fd(bzip2)31
+b Fb(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g
+(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)78 b Fk(3)1047
+1048 y Fl(NAME)20 b Fa(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(3)1047
+1157 y(SYNOPSIS)21 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)h(.)f(.)g(.)50 b Fl(3)1047 1267 y(DESCRIPTION)10
+b Fa(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40
+b Fl(3)1047 1377 y(OPTIONS)16 b Fa(.)d(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(4)1047
+1486 y(MEMOR)-8 b(Y)31 b(MANA)m(GEMENT)14 b Fa(.)j(.)e(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44
+b Fl(6)1047 1596 y(RECO)m(VERING)30 b(D)m(A)-8 b(T)g(A)32
+b(FR)m(OM)f(D)m(AMA)m(GED)i(FILES)1256 1705 y Fa(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)57 b Fl(7)1047 1815 y(PERF)m(ORMANCE)30
+b(NOTES)9 b Fa(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)38 b Fl(7)1047 1924
+y(CA)-10 b(VEA)i(TS)10 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Fl(8)1047 2034
+y(A)m(UTHOR)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Fl(8)150 2276 y Fk(3)135
+b(Programming)46 b(with)f Fd(libbzip2)29 b Fb(.)16 b(.)j(.)h(.)f(.)h(.)
+f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)74 b Fk(9)449
+2413 y Fl(3.1)92 b(T)-8 b(op-lev)m(el)30 b(structure)24
+b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)54 b Fl(9)748 2523 y(3.1.1)93 b(Lo)m(w-lev)m(el)30
+b(summary)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)53
+b Fl(9)748 2633 y(3.1.2)93 b(High-lev)m(el)29 b(summary)12
+b Fa(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)41 b
+Fl(9)748 2742 y(3.1.3)93 b(Utilit)m(y)29 b(functions)g(summary)12
+b Fa(.)h(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)41 b Fl(10)449 2852 y(3.2)92 b(Error)29
+b(handling)18 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(10)449
+2961 y(3.3)92 b(Lo)m(w-lev)m(el)31 b(in)m(terface)d Fa(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)57 b Fl(12)748 3071 y(3.3.1)93 b Fj(BZ2_bzCompressInit)21
+b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(12)748
+3181 y(3.3.2)93 b Fj(BZ2_bzCompress)9 b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g
+(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 b Fl(14)748 3290 y(3.3.3)93
+b Fj(BZ2_bzCompressEnd)23 b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g
+(.)52 b Fl(17)748 3400 y(3.3.4)93 b Fj(BZ2_bzDecompressInit)16
+b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(17)748 3509
+y(3.3.5)93 b Fj(BZ2_bzDecompress)21 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)55 b Fl(17)748 3619 y(3.3.6)93 b Fj(BZ2_bzDecompressEnd)18
+b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(19)449
+3729 y(3.4)92 b(High-lev)m(el)30 b(in)m(terface)16 b
+Fa(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)45 b Fl(19)748 3838 y(3.4.1)93 b Fj(BZ2_bzReadOpen)9
+b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38
+b Fl(19)748 3948 y(3.4.2)93 b Fj(BZ2_bzRead)18 b Fa(.)12
+b(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47
+b Fl(20)748 4057 y(3.4.3)93 b Fj(BZ2_bzReadGetUnused)18
+b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(22)748
+4167 y(3.4.4)93 b Fj(BZ2_bzReadClose)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)57 b Fl(22)748 4276 y(3.4.5)93 b
+Fj(BZ2_bzWriteOpen)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)57 b Fl(22)748 4386 y(3.4.6)93 b Fj(BZ2_bzWrite)16
+b Fa(.)11 b(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+45 b Fl(23)748 4496 y(3.4.7)93 b Fj(BZ2_bzWriteClose)21
+b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Fl(23)748
+4605 y(3.4.8)93 b(Handling)28 b(em)m(b)s(edded)h(compressed)h(data)h
+(streams)17 b Fa(.)f(.)f(.)g(.)46 b Fl(24)748 4715 y(3.4.9)93
+b(Standard)29 b(\014le-reading/writing)e(co)s(de)22 b
+Fa(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52
+b Fl(25)449 4824 y(3.5)92 b(Utilit)m(y)29 b(functions)f
+Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)59 b Fl(26)748 4934 y(3.5.1)93 b
+Fj(BZ2_bzBuffToBuffCompres)o(s)22 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)57 b Fl(26)748
+5044 y(3.5.2)93 b Fj(BZ2_bzBuffToBuffDecompr)o(ess)17
+b Fa(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+53 b Fl(27)449 5153 y(3.6)92 b Fj(zlib)29 b Fl(compatibilit)m(y)g
+(functions)23 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52
+b Fl(28)449 5263 y(3.7)92 b(Using)30 b(the)g(library)e(in)h(a)i
+Fj(stdio)p Fl(-free)e(en)m(vironmen)m(t)23 b Fa(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)52 b Fl(29)p
+eop
+%%Page: -2 39
+-2 38 bop 3699 -116 a Fl(ii)748 83 y(3.7.1)93 b(Getting)31
+b(rid)d(of)j Fj(stdio)20 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49
+b Fl(29)748 193 y(3.7.2)93 b(Critical)28 b(error)i(handling)22
+b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Fl(29)449 302
+y(3.8)92 b(Making)30 b(a)h(Windo)m(ws)e(DLL)15 b Fa(.)h(.)f(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)44 b Fl(30)150 545
+y Fk(4)135 b(Miscellanea)11 b Fb(.)21 b(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)h
+(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)
+h(.)f(.)g(.)h(.)56 b Fk(31)449 682 y Fl(4.1)92 b(Limitations)29
+b(of)h(the)h(compressed)f(\014le)f(format)9 b Fa(.)15
+b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38
+b Fl(31)449 791 y(4.2)92 b(P)m(ortabilit)m(y)30 b(issues)14
+b Fa(.)f(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)h(.)f(.)g(.)43 b Fl(32)449 901 y(4.3)92 b(Rep)s(orting)29
+b(bugs)f Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Fl(32)449 1010 y(4.4)92
+b(Did)29 b(y)m(ou)i(get)h(the)e(righ)m(t)g(pac)m(k)-5
+b(age?)22 b Fa(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51
+b Fl(34)449 1120 y(4.5)92 b(T)-8 b(esting)16 b Fa(.)f(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)45 b Fl(34)449 1230 y(4.6)92
+b(F)-8 b(urther)30 b(reading)22 b Fa(.)14 b(.)h(.)g(.)h(.)f(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)51
+b Fl(35)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
--- /dev/null
+\input texinfo @c -*- Texinfo -*-
+@setfilename bzip2.info
+
+@ignore
+This file documents bzip2 version 1.0, and associated library
+libbzip2, written by Julian Seward (jseward@acm.org).
+
+Copyright (C) 1996-2000 Julian R Seward
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for verbatim copies.
+@end ignore
+
+@ifinfo
+@format
+START-INFO-DIR-ENTRY
+* Bzip2: (bzip2). A program and library for data compression.
+END-INFO-DIR-ENTRY
+@end format
+
+@end ifinfo
+
+@iftex
+@c @finalout
+@settitle bzip2 and libbzip2
+@titlepage
+@title bzip2 and libbzip2
+@subtitle a program and library for data compression
+@subtitle copyright (C) 1996-2000 Julian Seward
+@subtitle version 1.0 of 21 March 2000
+@author Julian Seward
+
+@end titlepage
+
+@parindent 0mm
+@parskip 2mm
+
+@end iftex
+@node Top, Overview, (dir), (dir)
+
+This program, @code{bzip2},
+and associated library @code{libbzip2}, are
+Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+@itemize @bullet
+@item
+ Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+@item
+ The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+@item
+ Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+@item
+ The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+@end itemize
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+Julian Seward, Cambridge, UK.
+
+@code{jseward@@acm.org}
+
+@code{http://sourceware.cygnus.com/bzip2}
+
+@code{http://www.cacheprof.org}
+
+@code{http://www.muraroa.demon.co.uk}
+
+@code{bzip2}/@code{libbzip2} version 1.0 of 21 March 2000.
+
+PATENTS: To the best of my knowledge, @code{bzip2} does not use any patented
+algorithms. However, I do not have the resources available to carry out
+a full patent search. Therefore I cannot give any guarantee of the
+above statement.
+
+
+
+
+
+
+
+@node Overview, Implementation, Top, Top
+@chapter Introduction
+
+@code{bzip2} compresses files using the Burrows-Wheeler
+block-sorting text compression algorithm, and Huffman coding.
+Compression is generally considerably better than that
+achieved by more conventional LZ77/LZ78-based compressors,
+and approaches the performance of the PPM family of statistical compressors.
+
+@code{bzip2} is built on top of @code{libbzip2}, a flexible library
+for handling compressed data in the @code{bzip2} format. This manual
+describes both how to use the program and
+how to work with the library interface. Most of the
+manual is devoted to this library, not the program,
+which is good news if your interest is only in the program.
+
+Chapter 2 describes how to use @code{bzip2}; this is the only part
+you need to read if you just want to know how to operate the program.
+Chapter 3 describes the programming interfaces in detail, and
+Chapter 4 records some miscellaneous notes which I thought
+ought to be recorded somewhere.
+
+
+@chapter How to use @code{bzip2}
+
+This chapter contains a copy of the @code{bzip2} man page,
+and nothing else.
+
+@quotation
+
+@unnumberedsubsubsec NAME
+@itemize
+@item @code{bzip2}, @code{bunzip2}
+- a block-sorting file compressor, v1.0
+@item @code{bzcat}
+- decompresses files to stdout
+@item @code{bzip2recover}
+- recovers data from damaged bzip2 files
+@end itemize
+
+@unnumberedsubsubsec SYNOPSIS
+@itemize
+@item @code{bzip2} [ -cdfkqstvzVL123456789 ] [ filenames ... ]
+@item @code{bunzip2} [ -fkvsVL ] [ filenames ... ]
+@item @code{bzcat} [ -s ] [ filenames ... ]
+@item @code{bzip2recover} filename
+@end itemize
+
+@unnumberedsubsubsec DESCRIPTION
+
+@code{bzip2} compresses files using the Burrows-Wheeler block sorting
+text compression algorithm, and Huffman coding. Compression is
+generally considerably better than that achieved by more conventional
+LZ77/LZ78-based compressors, and approaches the performance of the PPM
+family of statistical compressors.
+
+The command-line options are deliberately very similar to those of GNU
+@code{gzip}, but they are not identical.
+
+@code{bzip2} expects a list of file names to accompany the command-line
+flags. Each file is replaced by a compressed version of itself, with
+the name @code{original_name.bz2}. Each compressed file has the same
+modification date, permissions, and, when possible, ownership as the
+corresponding original, so that these properties can be correctly
+restored at decompression time. File name handling is naive in the
+sense that there is no mechanism for preserving original file names,
+permissions, ownerships or dates in filesystems which lack these
+concepts, or have serious file name length restrictions, such as MS-DOS.
+
+@code{bzip2} and @code{bunzip2} will by default not overwrite existing
+files. If you want this to happen, specify the @code{-f} flag.
+
+If no file names are specified, @code{bzip2} compresses from standard
+input to standard output. In this case, @code{bzip2} will decline to
+write compressed output to a terminal, as this would be entirely
+incomprehensible and therefore pointless.
+
+@code{bunzip2} (or @code{bzip2 -d}) decompresses all
+specified files. Files which were not created by @code{bzip2}
+will be detected and ignored, and a warning issued.
+@code{bzip2} attempts to guess the filename for the decompressed file
+from that of the compressed file as follows:
+@itemize
+@item @code{filename.bz2 } becomes @code{filename}
+@item @code{filename.bz } becomes @code{filename}
+@item @code{filename.tbz2} becomes @code{filename.tar}
+@item @code{filename.tbz } becomes @code{filename.tar}
+@item @code{anyothername } becomes @code{anyothername.out}
+@end itemize
+If the file does not end in one of the recognised endings,
+@code{.bz2}, @code{.bz},
+@code{.tbz2} or @code{.tbz}, @code{bzip2} complains that it cannot
+guess the name of the original file, and uses the original name
+with @code{.out} appended.
+
+As with compression, supplying no
+filenames causes decompression from standard input to standard output.
+
+@code{bunzip2} will correctly decompress a file which is the
+concatenation of two or more compressed files. The result is the
+concatenation of the corresponding uncompressed files. Integrity
+testing (@code{-t}) of concatenated compressed files is also supported.
+
+You can also compress or decompress files to the standard output by
+giving the @code{-c} flag. Multiple files may be compressed and
+decompressed like this. The resulting outputs are fed sequentially to
+stdout. Compression of multiple files in this manner generates a stream
+containing multiple compressed file representations. Such a stream
+can be decompressed correctly only by @code{bzip2} version 0.9.0 or
+later. Earlier versions of @code{bzip2} will stop after decompressing
+the first file in the stream.
+
+@code{bzcat} (or @code{bzip2 -dc}) decompresses all specified files to
+the standard output.
+
+@code{bzip2} will read arguments from the environment variables
+@code{BZIP2} and @code{BZIP}, in that order, and will process them
+before any arguments read from the command line. This gives a
+convenient way to supply default arguments.
+
+Compression is always performed, even if the compressed file is slightly
+larger than the original. Files of less than about one hundred bytes
+tend to get larger, since the compression mechanism has a constant
+overhead in the region of 50 bytes. Random data (including the output
+of most file compressors) is coded at about 8.05 bits per byte, giving
+an expansion of around 0.5%.
+
+As a self-check for your protection, @code{bzip2} uses 32-bit CRCs to
+make sure that the decompressed version of a file is identical to the
+original. This guards against corruption of the compressed data, and
+against undetected bugs in @code{bzip2} (hopefully very unlikely). The
+chances of data corruption going undetected is microscopic, about one
+chance in four billion for each file processed. Be aware, though, that
+the check occurs upon decompression, so it can only tell you that
+something is wrong. It can't help you recover the original uncompressed
+data. You can use @code{bzip2recover} to try to recover data from
+damaged files.
+
+Return values: 0 for a normal exit, 1 for environmental problems (file
+not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt
+compressed file, 3 for an internal consistency error (eg, bug) which
+caused @code{bzip2} to panic.
+
+
+@unnumberedsubsubsec OPTIONS
+@table @code
+@item -c --stdout
+Compress or decompress to standard output.
+@item -d --decompress
+Force decompression. @code{bzip2}, @code{bunzip2} and @code{bzcat} are
+really the same program, and the decision about what actions to take is
+done on the basis of which name is used. This flag overrides that
+mechanism, and forces bzip2 to decompress.
+@item -z --compress
+The complement to @code{-d}: forces compression, regardless of the
+invokation name.
+@item -t --test
+Check integrity of the specified file(s), but don't decompress them.
+This really performs a trial decompression and throws away the result.
+@item -f --force
+Force overwrite of output files. Normally, @code{bzip2} will not overwrite
+existing output files. Also forces @code{bzip2} to break hard links
+to files, which it otherwise wouldn't do.
+@item -k --keep
+Keep (don't delete) input files during compression
+or decompression.
+@item -s --small
+Reduce memory usage, for compression, decompression and testing. Files
+are decompressed and tested using a modified algorithm which only
+requires 2.5 bytes per block byte. This means any file can be
+decompressed in 2300k of memory, albeit at about half the normal speed.
+
+During compression, @code{-s} selects a block size of 200k, which limits
+memory use to around the same figure, at the expense of your compression
+ratio. In short, if your machine is low on memory (8 megabytes or
+less), use -s for everything. See MEMORY MANAGEMENT below.
+@item -q --quiet
+Suppress non-essential warning messages. Messages pertaining to
+I/O errors and other critical events will not be suppressed.
+@item -v --verbose
+Verbose mode -- show the compression ratio for each file processed.
+Further @code{-v}'s increase the verbosity level, spewing out lots of
+information which is primarily of interest for diagnostic purposes.
+@item -L --license -V --version
+Display the software version, license terms and conditions.
+@item -1 to -9
+Set the block size to 100 k, 200 k .. 900 k when compressing. Has no
+effect when decompressing. See MEMORY MANAGEMENT below.
+@item --
+Treats all subsequent arguments as file names, even if they start
+with a dash. This is so you can handle files with names beginning
+with a dash, for example: @code{bzip2 -- -myfilename}.
+@item --repetitive-fast
+@item --repetitive-best
+These flags are redundant in versions 0.9.5 and above. They provided
+some coarse control over the behaviour of the sorting algorithm in
+earlier versions, which was sometimes useful. 0.9.5 and above have an
+improved algorithm which renders these flags irrelevant.
+@end table
+
+
+@unnumberedsubsubsec MEMORY MANAGEMENT
+
+@code{bzip2} compresses large files in blocks. The block size affects
+both the compression ratio achieved, and the amount of memory needed for
+compression and decompression. The flags @code{-1} through @code{-9}
+specify the block size to be 100,000 bytes through 900,000 bytes (the
+default) respectively. At decompression time, the block size used for
+compression is read from the header of the compressed file, and
+@code{bunzip2} then allocates itself just enough memory to decompress
+the file. Since block sizes are stored in compressed files, it follows
+that the flags @code{-1} to @code{-9} are irrelevant to and so ignored
+during decompression.
+
+Compression and decompression requirements, in bytes, can be estimated
+as:
+@example
+ Compression: 400k + ( 8 x block size )
+
+ Decompression: 100k + ( 4 x block size ), or
+ 100k + ( 2.5 x block size )
+@end example
+Larger block sizes give rapidly diminishing marginal returns. Most of
+the compression comes from the first two or three hundred k of block
+size, a fact worth bearing in mind when using @code{bzip2} on small machines.
+It is also important to appreciate that the decompression memory
+requirement is set at compression time by the choice of block size.
+
+For files compressed with the default 900k block size, @code{bunzip2}
+will require about 3700 kbytes to decompress. To support decompression
+of any file on a 4 megabyte machine, @code{bunzip2} has an option to
+decompress using approximately half this amount of memory, about 2300
+kbytes. Decompression speed is also halved, so you should use this
+option only where necessary. The relevant flag is @code{-s}.
+
+In general, try and use the largest block size memory constraints allow,
+since that maximises the compression achieved. Compression and
+decompression speed are virtually unaffected by block size.
+
+Another significant point applies to files which fit in a single block
+-- that means most files you'd encounter using a large block size. The
+amount of real memory touched is proportional to the size of the file,
+since the file is smaller than a block. For example, compressing a file
+20,000 bytes long with the flag @code{-9} will cause the compressor to
+allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560
+kbytes of it. Similarly, the decompressor will allocate 3700k but only
+touch 100k + 20000 * 4 = 180 kbytes.
+
+Here is a table which summarises the maximum memory usage for different
+block sizes. Also recorded is the total compressed size for 14 files of
+the Calgary Text Compression Corpus totalling 3,141,622 bytes. This
+column gives some feel for how compression varies with block size.
+These figures tend to understate the advantage of larger block sizes for
+larger files, since the Corpus is dominated by smaller files.
+@example
+ Compress Decompress Decompress Corpus
+ Flag usage usage -s usage Size
+
+ -1 1200k 500k 350k 914704
+ -2 2000k 900k 600k 877703
+ -3 2800k 1300k 850k 860338
+ -4 3600k 1700k 1100k 846899
+ -5 4400k 2100k 1350k 845160
+ -6 5200k 2500k 1600k 838626
+ -7 6100k 2900k 1850k 834096
+ -8 6800k 3300k 2100k 828642
+ -9 7600k 3700k 2350k 828642
+@end example
+
+@unnumberedsubsubsec RECOVERING DATA FROM DAMAGED FILES
+
+@code{bzip2} compresses files in blocks, usually 900kbytes long. Each
+block is handled independently. If a media or transmission error causes
+a multi-block @code{.bz2} file to become damaged, it may be possible to
+recover data from the undamaged blocks in the file.
+
+The compressed representation of each block is delimited by a 48-bit
+pattern, which makes it possible to find the block boundaries with
+reasonable certainty. Each block also carries its own 32-bit CRC, so
+damaged blocks can be distinguished from undamaged ones.
+
+@code{bzip2recover} is a simple program whose purpose is to search for
+blocks in @code{.bz2} files, and write each block out into its own
+@code{.bz2} file. You can then use @code{bzip2 -t} to test the
+integrity of the resulting files, and decompress those which are
+undamaged.
+
+@code{bzip2recover}
+takes a single argument, the name of the damaged file,
+and writes a number of files @code{rec0001file.bz2},
+ @code{rec0002file.bz2}, etc, containing the extracted blocks.
+ The output filenames are designed so that the use of
+ wildcards in subsequent processing -- for example,
+@code{bzip2 -dc rec*file.bz2 > recovered_data} -- lists the files in
+ the correct order.
+
+@code{bzip2recover} should be of most use dealing with large @code{.bz2}
+ files, as these will contain many blocks. It is clearly
+ futile to use it on damaged single-block files, since a
+ damaged block cannot be recovered. If you wish to minimise
+any potential data loss through media or transmission errors,
+you might consider compressing with a smaller
+ block size.
+
+
+@unnumberedsubsubsec PERFORMANCE NOTES
+
+The sorting phase of compression gathers together similar strings in the
+file. Because of this, files containing very long runs of repeated
+symbols, like "aabaabaabaab ..." (repeated several hundred times) may
+compress more slowly than normal. Versions 0.9.5 and above fare much
+better than previous versions in this respect. The ratio between
+worst-case and average-case compression time is in the region of 10:1.
+For previous versions, this figure was more like 100:1. You can use the
+@code{-vvvv} option to monitor progress in great detail, if you want.
+
+Decompression speed is unaffected by these phenomena.
+
+@code{bzip2} usually allocates several megabytes of memory to operate
+in, and then charges all over it in a fairly random fashion. This means
+that performance, both for compressing and decompressing, is largely
+determined by the speed at which your machine can service cache misses.
+Because of this, small changes to the code to reduce the miss rate have
+been observed to give disproportionately large performance improvements.
+I imagine @code{bzip2} will perform best on machines with very large
+caches.
+
+
+@unnumberedsubsubsec CAVEATS
+
+I/O error messages are not as helpful as they could be. @code{bzip2}
+tries hard to detect I/O errors and exit cleanly, but the details of
+what the problem is sometimes seem rather misleading.
+
+This manual page pertains to version 1.0 of @code{bzip2}. Compressed
+data created by this version is entirely forwards and backwards
+compatible with the previous public releases, versions 0.1pl2, 0.9.0 and
+0.9.5, but with the following exception: 0.9.0 and above can correctly
+decompress multiple concatenated compressed files. 0.1pl2 cannot do
+this; it will stop after decompressing just the first file in the
+stream.
+
+@code{bzip2recover} uses 32-bit integers to represent bit positions in
+compressed files, so it cannot handle compressed files more than 512
+megabytes long. This could easily be fixed.
+
+
+@unnumberedsubsubsec AUTHOR
+Julian Seward, @code{jseward@@acm.org}.
+
+The ideas embodied in @code{bzip2} are due to (at least) the following
+people: Michael Burrows and David Wheeler (for the block sorting
+transformation), David Wheeler (again, for the Huffman coder), Peter
+Fenwick (for the structured coding model in the original @code{bzip},
+and many refinements), and Alistair Moffat, Radford Neal and Ian Witten
+(for the arithmetic coder in the original @code{bzip}). I am much
+indebted for their help, support and advice. See the manual in the
+source distribution for pointers to sources of documentation. Christian
+von Roques encouraged me to look for faster sorting algorithms, so as to
+speed up compression. Bela Lubkin encouraged me to improve the
+worst-case compression performance. Many people sent patches, helped
+with portability problems, lent machines, gave advice and were generally
+helpful.
+
+@end quotation
+
+
+
+
+@chapter Programming with @code{libbzip2}
+
+This chapter describes the programming interface to @code{libbzip2}.
+
+For general background information, particularly about memory
+use and performance aspects, you'd be well advised to read Chapter 2
+as well.
+
+@section Top-level structure
+
+@code{libbzip2} is a flexible library for compressing and decompressing
+data in the @code{bzip2} data format. Although packaged as a single
+entity, it helps to regard the library as three separate parts: the low
+level interface, and the high level interface, and some utility
+functions.
+
+The structure of @code{libbzip2}'s interfaces is similar to
+that of Jean-loup Gailly's and Mark Adler's excellent @code{zlib}
+library.
+
+All externally visible symbols have names beginning @code{BZ2_}.
+This is new in version 1.0. The intention is to minimise pollution
+of the namespaces of library clients.
+
+@subsection Low-level summary
+
+This interface provides services for compressing and decompressing
+data in memory. There's no provision for dealing with files, streams
+or any other I/O mechanisms, just straight memory-to-memory work.
+In fact, this part of the library can be compiled without inclusion
+of @code{stdio.h}, which may be helpful for embedded applications.
+
+The low-level part of the library has no global variables and
+is therefore thread-safe.
+
+Six routines make up the low level interface:
+@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, and @* @code{BZ2_bzCompressEnd}
+for compression,
+and a corresponding trio @code{BZ2_bzDecompressInit}, @* @code{BZ2_bzDecompress}
+and @code{BZ2_bzDecompressEnd} for decompression.
+The @code{*Init} functions allocate
+memory for compression/decompression and do other
+initialisations, whilst the @code{*End} functions close down operations
+and release memory.
+
+The real work is done by @code{BZ2_bzCompress} and @code{BZ2_bzDecompress}.
+These compress and decompress data from a user-supplied input buffer
+to a user-supplied output buffer. These buffers can be any size;
+arbitrary quantities of data are handled by making repeated calls
+to these functions. This is a flexible mechanism allowing a
+consumer-pull style of activity, or producer-push, or a mixture of
+both.
+
+
+
+@subsection High-level summary
+
+This interface provides some handy wrappers around the low-level
+interface to facilitate reading and writing @code{bzip2} format
+files (@code{.bz2} files). The routines provide hooks to facilitate
+reading files in which the @code{bzip2} data stream is embedded
+within some larger-scale file structure, or where there are
+multiple @code{bzip2} data streams concatenated end-to-end.
+
+For reading files, @code{BZ2_bzReadOpen}, @code{BZ2_bzRead},
+@code{BZ2_bzReadClose} and @* @code{BZ2_bzReadGetUnused} are supplied. For
+writing files, @code{BZ2_bzWriteOpen}, @code{BZ2_bzWrite} and
+@code{BZ2_bzWriteFinish} are available.
+
+As with the low-level library, no global variables are used
+so the library is per se thread-safe. However, if I/O errors
+occur whilst reading or writing the underlying compressed files,
+you may have to consult @code{errno} to determine the cause of
+the error. In that case, you'd need a C library which correctly
+supports @code{errno} in a multithreaded environment.
+
+To make the library a little simpler and more portable,
+@code{BZ2_bzReadOpen} and @code{BZ2_bzWriteOpen} require you to pass them file
+handles (@code{FILE*}s) which have previously been opened for reading or
+writing respectively. That avoids portability problems associated with
+file operations and file attributes, whilst not being much of an
+imposition on the programmer.
+
+
+
+@subsection Utility functions summary
+For very simple needs, @code{BZ2_bzBuffToBuffCompress} and
+@code{BZ2_bzBuffToBuffDecompress} are provided. These compress
+data in memory from one buffer to another buffer in a single
+function call. You should assess whether these functions
+fulfill your memory-to-memory compression/decompression
+requirements before investing effort in understanding the more
+general but more complex low-level interface.
+
+Yoshioka Tsuneo (@code{QWF00133@@niftyserve.or.jp} /
+@code{tsuneo-y@@is.aist-nara.ac.jp}) has contributed some functions to
+give better @code{zlib} compatibility. These functions are
+@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush},
+@code{BZ2_bzclose},
+@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}. You may find these functions
+more convenient for simple file reading and writing, than those in the
+high-level interface. These functions are not (yet) officially part of
+the library, and are minimally documented here. If they break, you
+get to keep all the pieces. I hope to document them properly when time
+permits.
+
+Yoshioka also contributed modifications to allow the library to be
+built as a Windows DLL.
+
+
+@section Error handling
+
+The library is designed to recover cleanly in all situations, including
+the worst-case situation of decompressing random data. I'm not
+100% sure that it can always do this, so you might want to add
+a signal handler to catch segmentation violations during decompression
+if you are feeling especially paranoid. I would be interested in
+hearing more about the robustness of the library to corrupted
+compressed data.
+
+Version 1.0 is much more robust in this respect than
+0.9.0 or 0.9.5. Investigations with Checker (a tool for
+detecting problems with memory management, similar to Purify)
+indicate that, at least for the few files I tested, all single-bit
+errors in the decompressed data are caught properly, with no
+segmentation faults, no reads of uninitialised data and no
+out of range reads or writes. So it's certainly much improved,
+although I wouldn't claim it to be totally bombproof.
+
+The file @code{bzlib.h} contains all definitions needed to use
+the library. In particular, you should definitely not include
+@code{bzlib_private.h}.
+
+In @code{bzlib.h}, the various return values are defined. The following
+list is not intended as an exhaustive description of the circumstances
+in which a given value may be returned -- those descriptions are given
+later. Rather, it is intended to convey the rough meaning of each
+return value. The first five actions are normal and not intended to
+denote an error situation.
+@table @code
+@item BZ_OK
+The requested action was completed successfully.
+@item BZ_RUN_OK
+@itemx BZ_FLUSH_OK
+@itemx BZ_FINISH_OK
+In @code{BZ2_bzCompress}, the requested flush/finish/nothing-special action
+was completed successfully.
+@item BZ_STREAM_END
+Compression of data was completed, or the logical stream end was
+detected during decompression.
+@end table
+
+The following return values indicate an error of some kind.
+@table @code
+@item BZ_CONFIG_ERROR
+Indicates that the library has been improperly compiled on your
+platform -- a major configuration error. Specifically, it means
+that @code{sizeof(char)}, @code{sizeof(short)} and @code{sizeof(int)}
+are not 1, 2 and 4 respectively, as they should be. Note that the
+library should still work properly on 64-bit platforms which follow
+the LP64 programming model -- that is, where @code{sizeof(long)}
+and @code{sizeof(void*)} are 8. Under LP64, @code{sizeof(int)} is
+still 4, so @code{libbzip2}, which doesn't use the @code{long} type,
+is OK.
+@item BZ_SEQUENCE_ERROR
+When using the library, it is important to call the functions in the
+correct sequence and with data structures (buffers etc) in the correct
+states. @code{libbzip2} checks as much as it can to ensure this is
+happening, and returns @code{BZ_SEQUENCE_ERROR} if not. Code which
+complies precisely with the function semantics, as detailed below,
+should never receive this value; such an event denotes buggy code
+which you should investigate.
+@item BZ_PARAM_ERROR
+Returned when a parameter to a function call is out of range
+or otherwise manifestly incorrect. As with @code{BZ_SEQUENCE_ERROR},
+this denotes a bug in the client code. The distinction between
+@code{BZ_PARAM_ERROR} and @code{BZ_SEQUENCE_ERROR} is a bit hazy, but still worth
+making.
+@item BZ_MEM_ERROR
+Returned when a request to allocate memory failed. Note that the
+quantity of memory needed to decompress a stream cannot be determined
+until the stream's header has been read. So @code{BZ2_bzDecompress} and
+@code{BZ2_bzRead} may return @code{BZ_MEM_ERROR} even though some of
+the compressed data has been read. The same is not true for
+compression; once @code{BZ2_bzCompressInit} or @code{BZ2_bzWriteOpen} have
+successfully completed, @code{BZ_MEM_ERROR} cannot occur.
+@item BZ_DATA_ERROR
+Returned when a data integrity error is detected during decompression.
+Most importantly, this means when stored and computed CRCs for the
+data do not match. This value is also returned upon detection of any
+other anomaly in the compressed data.
+@item BZ_DATA_ERROR_MAGIC
+As a special case of @code{BZ_DATA_ERROR}, it is sometimes useful to
+know when the compressed stream does not start with the correct
+magic bytes (@code{'B' 'Z' 'h'}).
+@item BZ_IO_ERROR
+Returned by @code{BZ2_bzRead} and @code{BZ2_bzWrite} when there is an error
+reading or writing in the compressed file, and by @code{BZ2_bzReadOpen}
+and @code{BZ2_bzWriteOpen} for attempts to use a file for which the
+error indicator (viz, @code{ferror(f)}) is set.
+On receipt of @code{BZ_IO_ERROR}, the caller should consult
+@code{errno} and/or @code{perror} to acquire operating-system
+specific information about the problem.
+@item BZ_UNEXPECTED_EOF
+Returned by @code{BZ2_bzRead} when the compressed file finishes
+before the logical end of stream is detected.
+@item BZ_OUTBUFF_FULL
+Returned by @code{BZ2_bzBuffToBuffCompress} and
+@code{BZ2_bzBuffToBuffDecompress} to indicate that the output data
+will not fit into the output buffer provided.
+@end table
+
+
+
+@section Low-level interface
+
+@subsection @code{BZ2_bzCompressInit}
+@example
+typedef
+ struct @{
+ char *next_in;
+ unsigned int avail_in;
+ unsigned int total_in_lo32;
+ unsigned int total_in_hi32;
+
+ char *next_out;
+ unsigned int avail_out;
+ unsigned int total_out_lo32;
+ unsigned int total_out_hi32;
+
+ void *state;
+
+ void *(*bzalloc)(void *,int,int);
+ void (*bzfree)(void *,void *);
+ void *opaque;
+ @}
+ bz_stream;
+
+int BZ2_bzCompressInit ( bz_stream *strm,
+ int blockSize100k,
+ int verbosity,
+ int workFactor );
+
+@end example
+
+Prepares for compression. The @code{bz_stream} structure
+holds all data pertaining to the compression activity.
+A @code{bz_stream} structure should be allocated and initialised
+prior to the call.
+The fields of @code{bz_stream}
+comprise the entirety of the user-visible data. @code{state}
+is a pointer to the private data structures required for compression.
+
+Custom memory allocators are supported, via fields @code{bzalloc},
+@code{bzfree},
+and @code{opaque}. The value
+@code{opaque} is passed to as the first argument to
+all calls to @code{bzalloc} and @code{bzfree}, but is
+otherwise ignored by the library.
+The call @code{bzalloc ( opaque, n, m )} is expected to return a
+pointer @code{p} to
+@code{n * m} bytes of memory, and @code{bzfree ( opaque, p )}
+should free
+that memory.
+
+If you don't want to use a custom memory allocator, set @code{bzalloc},
+@code{bzfree} and
+@code{opaque} to @code{NULL},
+and the library will then use the standard @code{malloc}/@code{free}
+routines.
+
+Before calling @code{BZ2_bzCompressInit}, fields @code{bzalloc},
+@code{bzfree} and @code{opaque} should
+be filled appropriately, as just described. Upon return, the internal
+state will have been allocated and initialised, and @code{total_in_lo32},
+@code{total_in_hi32}, @code{total_out_lo32} and
+@code{total_out_hi32} will have been set to zero.
+These four fields are used by the library
+to inform the caller of the total amount of data passed into and out of
+the library, respectively. You should not try to change them.
+As of version 1.0, 64-bit counts are maintained, even on 32-bit
+platforms, using the @code{_hi32} fields to store the upper 32 bits
+of the count. So, for example, the total amount of data in
+is @code{(total_in_hi32 << 32) + total_in_lo32}.
+
+Parameter @code{blockSize100k} specifies the block size to be used for
+compression. It should be a value between 1 and 9 inclusive, and the
+actual block size used is 100000 x this figure. 9 gives the best
+compression but takes most memory.
+
+Parameter @code{verbosity} should be set to a number between 0 and 4
+inclusive. 0 is silent, and greater numbers give increasingly verbose
+monitoring/debugging output. If the library has been compiled with
+@code{-DBZ_NO_STDIO}, no such output will appear for any verbosity
+setting.
+
+Parameter @code{workFactor} controls how the compression phase behaves
+when presented with worst case, highly repetitive, input data. If
+compression runs into difficulties caused by repetitive data, the
+library switches from the standard sorting algorithm to a fallback
+algorithm. The fallback is slower than the standard algorithm by
+perhaps a factor of three, but always behaves reasonably, no matter how
+bad the input.
+
+Lower values of @code{workFactor} reduce the amount of effort the
+standard algorithm will expend before resorting to the fallback. You
+should set this parameter carefully; too low, and many inputs will be
+handled by the fallback algorithm and so compress rather slowly, too
+high, and your average-to-worst case compression times can become very
+large. The default value of 30 gives reasonable behaviour over a wide
+range of circumstances.
+
+Allowable values range from 0 to 250 inclusive. 0 is a special case,
+equivalent to using the default value of 30.
+
+Note that the compressed output generated is the same regardless of
+whether or not the fallback algorithm is used.
+
+Be aware also that this parameter may disappear entirely in future
+versions of the library. In principle it should be possible to devise a
+good way to automatically choose which algorithm to use. Such a
+mechanism would render the parameter obsolete.
+
+Possible return values:
+@display
+ @code{BZ_CONFIG_ERROR}
+ if the library has been mis-compiled
+ @code{BZ_PARAM_ERROR}
+ if @code{strm} is @code{NULL}
+ or @code{blockSize} < 1 or @code{blockSize} > 9
+ or @code{verbosity} < 0 or @code{verbosity} > 4
+ or @code{workFactor} < 0 or @code{workFactor} > 250
+ @code{BZ_MEM_ERROR}
+ if not enough memory is available
+ @code{BZ_OK}
+ otherwise
+@end display
+Allowable next actions:
+@display
+ @code{BZ2_bzCompress}
+ if @code{BZ_OK} is returned
+ no specific action needed in case of error
+@end display
+
+@subsection @code{BZ2_bzCompress}
+@example
+ int BZ2_bzCompress ( bz_stream *strm, int action );
+@end example
+Provides more input and/or output buffer space for the library. The
+caller maintains input and output buffers, and calls @code{BZ2_bzCompress} to
+transfer data between them.
+
+Before each call to @code{BZ2_bzCompress}, @code{next_in} should point at
+the data to be compressed, and @code{avail_in} should indicate how many
+bytes the library may read. @code{BZ2_bzCompress} updates @code{next_in},
+@code{avail_in} and @code{total_in} to reflect the number of bytes it
+has read.
+
+Similarly, @code{next_out} should point to a buffer in which the
+compressed data is to be placed, with @code{avail_out} indicating how
+much output space is available. @code{BZ2_bzCompress} updates
+@code{next_out}, @code{avail_out} and @code{total_out} to reflect the
+number of bytes output.
+
+You may provide and remove as little or as much data as you like on each
+call of @code{BZ2_bzCompress}. In the limit, it is acceptable to supply and
+remove data one byte at a time, although this would be terribly
+inefficient. You should always ensure that at least one byte of output
+space is available at each call.
+
+A second purpose of @code{BZ2_bzCompress} is to request a change of mode of the
+compressed stream.
+
+Conceptually, a compressed stream can be in one of four states: IDLE,
+RUNNING, FLUSHING and FINISHING. Before initialisation
+(@code{BZ2_bzCompressInit}) and after termination (@code{BZ2_bzCompressEnd}), a
+stream is regarded as IDLE.
+
+Upon initialisation (@code{BZ2_bzCompressInit}), the stream is placed in the
+RUNNING state. Subsequent calls to @code{BZ2_bzCompress} should pass
+@code{BZ_RUN} as the requested action; other actions are illegal and
+will result in @code{BZ_SEQUENCE_ERROR}.
+
+At some point, the calling program will have provided all the input data
+it wants to. It will then want to finish up -- in effect, asking the
+library to process any data it might have buffered internally. In this
+state, @code{BZ2_bzCompress} will no longer attempt to read data from
+@code{next_in}, but it will want to write data to @code{next_out}.
+Because the output buffer supplied by the user can be arbitrarily small,
+the finishing-up operation cannot necessarily be done with a single call
+of @code{BZ2_bzCompress}.
+
+Instead, the calling program passes @code{BZ_FINISH} as an action to
+@code{BZ2_bzCompress}. This changes the stream's state to FINISHING. Any
+remaining input (ie, @code{next_in[0 .. avail_in-1]}) is compressed and
+transferred to the output buffer. To do this, @code{BZ2_bzCompress} must be
+called repeatedly until all the output has been consumed. At that
+point, @code{BZ2_bzCompress} returns @code{BZ_STREAM_END}, and the stream's
+state is set back to IDLE. @code{BZ2_bzCompressEnd} should then be
+called.
+
+Just to make sure the calling program does not cheat, the library makes
+a note of @code{avail_in} at the time of the first call to
+@code{BZ2_bzCompress} which has @code{BZ_FINISH} as an action (ie, at the
+time the program has announced its intention to not supply any more
+input). By comparing this value with that of @code{avail_in} over
+subsequent calls to @code{BZ2_bzCompress}, the library can detect any
+attempts to slip in more data to compress. Any calls for which this is
+detected will return @code{BZ_SEQUENCE_ERROR}. This indicates a
+programming mistake which should be corrected.
+
+Instead of asking to finish, the calling program may ask
+@code{BZ2_bzCompress} to take all the remaining input, compress it and
+terminate the current (Burrows-Wheeler) compression block. This could
+be useful for error control purposes. The mechanism is analogous to
+that for finishing: call @code{BZ2_bzCompress} with an action of
+@code{BZ_FLUSH}, remove output data, and persist with the
+@code{BZ_FLUSH} action until the value @code{BZ_RUN} is returned. As
+with finishing, @code{BZ2_bzCompress} detects any attempt to provide more
+input data once the flush has begun.
+
+Once the flush is complete, the stream returns to the normal RUNNING
+state.
+
+This all sounds pretty complex, but isn't really. Here's a table
+which shows which actions are allowable in each state, what action
+will be taken, what the next state is, and what the non-error return
+values are. Note that you can't explicitly ask what state the
+stream is in, but nor do you need to -- it can be inferred from the
+values returned by @code{BZ2_bzCompress}.
+@display
+IDLE/@code{any}
+ Illegal. IDLE state only exists after @code{BZ2_bzCompressEnd} or
+ before @code{BZ2_bzCompressInit}.
+ Return value = @code{BZ_SEQUENCE_ERROR}
+
+RUNNING/@code{BZ_RUN}
+ Compress from @code{next_in} to @code{next_out} as much as possible.
+ Next state = RUNNING
+ Return value = @code{BZ_RUN_OK}
+
+RUNNING/@code{BZ_FLUSH}
+ Remember current value of @code{next_in}. Compress from @code{next_in}
+ to @code{next_out} as much as possible, but do not accept any more input.
+ Next state = FLUSHING
+ Return value = @code{BZ_FLUSH_OK}
+
+RUNNING/@code{BZ_FINISH}
+ Remember current value of @code{next_in}. Compress from @code{next_in}
+ to @code{next_out} as much as possible, but do not accept any more input.
+ Next state = FINISHING
+ Return value = @code{BZ_FINISH_OK}
+
+FLUSHING/@code{BZ_FLUSH}
+ Compress from @code{next_in} to @code{next_out} as much as possible,
+ but do not accept any more input.
+ If all the existing input has been used up and all compressed
+ output has been removed
+ Next state = RUNNING; Return value = @code{BZ_RUN_OK}
+ else
+ Next state = FLUSHING; Return value = @code{BZ_FLUSH_OK}
+
+FLUSHING/other
+ Illegal.
+ Return value = @code{BZ_SEQUENCE_ERROR}
+
+FINISHING/@code{BZ_FINISH}
+ Compress from @code{next_in} to @code{next_out} as much as possible,
+ but to not accept any more input.
+ If all the existing input has been used up and all compressed
+ output has been removed
+ Next state = IDLE; Return value = @code{BZ_STREAM_END}
+ else
+ Next state = FINISHING; Return value = @code{BZ_FINISHING}
+
+FINISHING/other
+ Illegal.
+ Return value = @code{BZ_SEQUENCE_ERROR}
+@end display
+
+That still looks complicated? Well, fair enough. The usual sequence
+of calls for compressing a load of data is:
+@itemize @bullet
+@item Get started with @code{BZ2_bzCompressInit}.
+@item Shovel data in and shlurp out its compressed form using zero or more
+calls of @code{BZ2_bzCompress} with action = @code{BZ_RUN}.
+@item Finish up.
+Repeatedly call @code{BZ2_bzCompress} with action = @code{BZ_FINISH},
+copying out the compressed output, until @code{BZ_STREAM_END} is returned.
+@item Close up and go home. Call @code{BZ2_bzCompressEnd}.
+@end itemize
+If the data you want to compress fits into your input buffer all
+at once, you can skip the calls of @code{BZ2_bzCompress ( ..., BZ_RUN )} and
+just do the @code{BZ2_bzCompress ( ..., BZ_FINISH )} calls.
+
+All required memory is allocated by @code{BZ2_bzCompressInit}. The
+compression library can accept any data at all (obviously). So you
+shouldn't get any error return values from the @code{BZ2_bzCompress} calls.
+If you do, they will be @code{BZ_SEQUENCE_ERROR}, and indicate a bug in
+your programming.
+
+Trivial other possible return values:
+@display
+ @code{BZ_PARAM_ERROR}
+ if @code{strm} is @code{NULL}, or @code{strm->s} is @code{NULL}
+@end display
+
+@subsection @code{BZ2_bzCompressEnd}
+@example
+int BZ2_bzCompressEnd ( bz_stream *strm );
+@end example
+Releases all memory associated with a compression stream.
+
+Possible return values:
+@display
+ @code{BZ_PARAM_ERROR} if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL}
+ @code{BZ_OK} otherwise
+@end display
+
+
+@subsection @code{BZ2_bzDecompressInit}
+@example
+int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small );
+@end example
+Prepares for decompression. As with @code{BZ2_bzCompressInit}, a
+@code{bz_stream} record should be allocated and initialised before the
+call. Fields @code{bzalloc}, @code{bzfree} and @code{opaque} should be
+set if a custom memory allocator is required, or made @code{NULL} for
+the normal @code{malloc}/@code{free} routines. Upon return, the internal
+state will have been initialised, and @code{total_in} and
+@code{total_out} will be zero.
+
+For the meaning of parameter @code{verbosity}, see @code{BZ2_bzCompressInit}.
+
+If @code{small} is nonzero, the library will use an alternative
+decompression algorithm which uses less memory but at the cost of
+decompressing more slowly (roughly speaking, half the speed, but the
+maximum memory requirement drops to around 2300k). See Chapter 2 for
+more information on memory management.
+
+Note that the amount of memory needed to decompress
+a stream cannot be determined until the stream's header has been read,
+so even if @code{BZ2_bzDecompressInit} succeeds, a subsequent
+@code{BZ2_bzDecompress} could fail with @code{BZ_MEM_ERROR}.
+
+Possible return values:
+@display
+ @code{BZ_CONFIG_ERROR}
+ if the library has been mis-compiled
+ @code{BZ_PARAM_ERROR}
+ if @code{(small != 0 && small != 1)}
+ or @code{(verbosity < 0 || verbosity > 4)}
+ @code{BZ_MEM_ERROR}
+ if insufficient memory is available
+@end display
+
+Allowable next actions:
+@display
+ @code{BZ2_bzDecompress}
+ if @code{BZ_OK} was returned
+ no specific action required in case of error
+@end display
+
+
+
+@subsection @code{BZ2_bzDecompress}
+@example
+int BZ2_bzDecompress ( bz_stream *strm );
+@end example
+Provides more input and/out output buffer space for the library. The
+caller maintains input and output buffers, and uses @code{BZ2_bzDecompress}
+to transfer data between them.
+
+Before each call to @code{BZ2_bzDecompress}, @code{next_in}
+should point at the compressed data,
+and @code{avail_in} should indicate how many bytes the library
+may read. @code{BZ2_bzDecompress} updates @code{next_in}, @code{avail_in}
+and @code{total_in}
+to reflect the number of bytes it has read.
+
+Similarly, @code{next_out} should point to a buffer in which the uncompressed
+output is to be placed, with @code{avail_out} indicating how much output space
+is available. @code{BZ2_bzCompress} updates @code{next_out},
+@code{avail_out} and @code{total_out} to reflect
+the number of bytes output.
+
+You may provide and remove as little or as much data as you like on
+each call of @code{BZ2_bzDecompress}.
+In the limit, it is acceptable to
+supply and remove data one byte at a time, although this would be
+terribly inefficient. You should always ensure that at least one
+byte of output space is available at each call.
+
+Use of @code{BZ2_bzDecompress} is simpler than @code{BZ2_bzCompress}.
+
+You should provide input and remove output as described above, and
+repeatedly call @code{BZ2_bzDecompress} until @code{BZ_STREAM_END} is
+returned. Appearance of @code{BZ_STREAM_END} denotes that
+@code{BZ2_bzDecompress} has detected the logical end of the compressed
+stream. @code{BZ2_bzDecompress} will not produce @code{BZ_STREAM_END} until
+all output data has been placed into the output buffer, so once
+@code{BZ_STREAM_END} appears, you are guaranteed to have available all
+the decompressed output, and @code{BZ2_bzDecompressEnd} can safely be
+called.
+
+If case of an error return value, you should call @code{BZ2_bzDecompressEnd}
+to clean up and release memory.
+
+Possible return values:
+@display
+ @code{BZ_PARAM_ERROR}
+ if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL}
+ or @code{strm->avail_out < 1}
+ @code{BZ_DATA_ERROR}
+ if a data integrity error is detected in the compressed stream
+ @code{BZ_DATA_ERROR_MAGIC}
+ if the compressed stream doesn't begin with the right magic bytes
+ @code{BZ_MEM_ERROR}
+ if there wasn't enough memory available
+ @code{BZ_STREAM_END}
+ if the logical end of the data stream was detected and all
+ output in has been consumed, eg @code{s->avail_out > 0}
+ @code{BZ_OK}
+ otherwise
+@end display
+Allowable next actions:
+@display
+ @code{BZ2_bzDecompress}
+ if @code{BZ_OK} was returned
+ @code{BZ2_bzDecompressEnd}
+ otherwise
+@end display
+
+
+@subsection @code{BZ2_bzDecompressEnd}
+@example
+int BZ2_bzDecompressEnd ( bz_stream *strm );
+@end example
+Releases all memory associated with a decompression stream.
+
+Possible return values:
+@display
+ @code{BZ_PARAM_ERROR}
+ if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL}
+ @code{BZ_OK}
+ otherwise
+@end display
+
+Allowable next actions:
+@display
+ None.
+@end display
+
+
+@section High-level interface
+
+This interface provides functions for reading and writing
+@code{bzip2} format files. First, some general points.
+
+@itemize @bullet
+@item All of the functions take an @code{int*} first argument,
+ @code{bzerror}.
+ After each call, @code{bzerror} should be consulted first to determine
+ the outcome of the call. If @code{bzerror} is @code{BZ_OK},
+ the call completed
+ successfully, and only then should the return value of the function
+ (if any) be consulted. If @code{bzerror} is @code{BZ_IO_ERROR},
+ there was an error
+ reading/writing the underlying compressed file, and you should
+ then consult @code{errno}/@code{perror} to determine the
+ cause of the difficulty.
+ @code{bzerror} may also be set to various other values; precise details are
+ given on a per-function basis below.
+@item If @code{bzerror} indicates an error
+ (ie, anything except @code{BZ_OK} and @code{BZ_STREAM_END}),
+ you should immediately call @code{BZ2_bzReadClose} (or @code{BZ2_bzWriteClose},
+ depending on whether you are attempting to read or to write)
+ to free up all resources associated
+ with the stream. Once an error has been indicated, behaviour of all calls
+ except @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) is undefined.
+ The implication is that (1) @code{bzerror} should
+ be checked after each call, and (2) if @code{bzerror} indicates an error,
+ @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) should then be called to clean up.
+@item The @code{FILE*} arguments passed to
+ @code{BZ2_bzReadOpen}/@code{BZ2_bzWriteOpen}
+ should be set to binary mode.
+ Most Unix systems will do this by default, but other platforms,
+ including Windows and Mac, will not. If you omit this, you may
+ encounter problems when moving code to new platforms.
+@item Memory allocation requests are handled by
+ @code{malloc}/@code{free}.
+ At present
+ there is no facility for user-defined memory allocators in the file I/O
+ functions (could easily be added, though).
+@end itemize
+
+
+
+@subsection @code{BZ2_bzReadOpen}
+@example
+ typedef void BZFILE;
+
+ BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f,
+ int small, int verbosity,
+ void *unused, int nUnused );
+@end example
+Prepare to read compressed data from file handle @code{f}. @code{f}
+should refer to a file which has been opened for reading, and for which
+the error indicator (@code{ferror(f)})is not set. If @code{small} is 1,
+the library will try to decompress using less memory, at the expense of
+speed.
+
+For reasons explained below, @code{BZ2_bzRead} will decompress the
+@code{nUnused} bytes starting at @code{unused}, before starting to read
+from the file @code{f}. At most @code{BZ_MAX_UNUSED} bytes may be
+supplied like this. If this facility is not required, you should pass
+@code{NULL} and @code{0} for @code{unused} and n@code{Unused}
+respectively.
+
+For the meaning of parameters @code{small} and @code{verbosity},
+see @code{BZ2_bzDecompressInit}.
+
+The amount of memory needed to decompress a file cannot be determined
+until the file's header has been read. So it is possible that
+@code{BZ2_bzReadOpen} returns @code{BZ_OK} but a subsequent call of
+@code{BZ2_bzRead} will return @code{BZ_MEM_ERROR}.
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_CONFIG_ERROR}
+ if the library has been mis-compiled
+ @code{BZ_PARAM_ERROR}
+ if @code{f} is @code{NULL}
+ or @code{small} is neither @code{0} nor @code{1}
+ or @code{(unused == NULL && nUnused != 0)}
+ or @code{(unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))}
+ @code{BZ_IO_ERROR}
+ if @code{ferror(f)} is nonzero
+ @code{BZ_MEM_ERROR}
+ if insufficient memory is available
+ @code{BZ_OK}
+ otherwise.
+@end display
+
+Possible return values:
+@display
+ Pointer to an abstract @code{BZFILE}
+ if @code{bzerror} is @code{BZ_OK}
+ @code{NULL}
+ otherwise
+@end display
+
+Allowable next actions:
+@display
+ @code{BZ2_bzRead}
+ if @code{bzerror} is @code{BZ_OK}
+ @code{BZ2_bzClose}
+ otherwise
+@end display
+
+
+@subsection @code{BZ2_bzRead}
+@example
+ int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len );
+@end example
+Reads up to @code{len} (uncompressed) bytes from the compressed file
+@code{b} into
+the buffer @code{buf}. If the read was successful,
+@code{bzerror} is set to @code{BZ_OK}
+and the number of bytes read is returned. If the logical end-of-stream
+was detected, @code{bzerror} will be set to @code{BZ_STREAM_END},
+and the number
+of bytes read is returned. All other @code{bzerror} values denote an error.
+
+@code{BZ2_bzRead} will supply @code{len} bytes,
+unless the logical stream end is detected
+or an error occurs. Because of this, it is possible to detect the
+stream end by observing when the number of bytes returned is
+less than the number
+requested. Nevertheless, this is regarded as inadvisable; you should
+instead check @code{bzerror} after every call and watch out for
+@code{BZ_STREAM_END}.
+
+Internally, @code{BZ2_bzRead} copies data from the compressed file in chunks
+of size @code{BZ_MAX_UNUSED} bytes
+before decompressing it. If the file contains more bytes than strictly
+needed to reach the logical end-of-stream, @code{BZ2_bzRead} will almost certainly
+read some of the trailing data before signalling @code{BZ_SEQUENCE_END}.
+To collect the read but unused data once @code{BZ_SEQUENCE_END} has
+appeared, call @code{BZ2_bzReadGetUnused} immediately before @code{BZ2_bzReadClose}.
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_PARAM_ERROR}
+ if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0}
+ @code{BZ_SEQUENCE_ERROR}
+ if @code{b} was opened with @code{BZ2_bzWriteOpen}
+ @code{BZ_IO_ERROR}
+ if there is an error reading from the compressed file
+ @code{BZ_UNEXPECTED_EOF}
+ if the compressed file ended before the logical end-of-stream was detected
+ @code{BZ_DATA_ERROR}
+ if a data integrity error was detected in the compressed stream
+ @code{BZ_DATA_ERROR_MAGIC}
+ if the stream does not begin with the requisite header bytes (ie, is not
+ a @code{bzip2} data file). This is really a special case of @code{BZ_DATA_ERROR}.
+ @code{BZ_MEM_ERROR}
+ if insufficient memory was available
+ @code{BZ_STREAM_END}
+ if the logical end of stream was detected.
+ @code{BZ_OK}
+ otherwise.
+@end display
+
+Possible return values:
+@display
+ number of bytes read
+ if @code{bzerror} is @code{BZ_OK} or @code{BZ_STREAM_END}
+ undefined
+ otherwise
+@end display
+
+Allowable next actions:
+@display
+ collect data from @code{buf}, then @code{BZ2_bzRead} or @code{BZ2_bzReadClose}
+ if @code{bzerror} is @code{BZ_OK}
+ collect data from @code{buf}, then @code{BZ2_bzReadClose} or @code{BZ2_bzReadGetUnused}
+ if @code{bzerror} is @code{BZ_SEQUENCE_END}
+ @code{BZ2_bzReadClose}
+ otherwise
+@end display
+
+
+
+@subsection @code{BZ2_bzReadGetUnused}
+@example
+ void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b,
+ void** unused, int* nUnused );
+@end example
+Returns data which was read from the compressed file but was not needed
+to get to the logical end-of-stream. @code{*unused} is set to the address
+of the data, and @code{*nUnused} to the number of bytes. @code{*nUnused} will
+be set to a value between @code{0} and @code{BZ_MAX_UNUSED} inclusive.
+
+This function may only be called once @code{BZ2_bzRead} has signalled
+@code{BZ_STREAM_END} but before @code{BZ2_bzReadClose}.
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_PARAM_ERROR}
+ if @code{b} is @code{NULL}
+ or @code{unused} is @code{NULL} or @code{nUnused} is @code{NULL}
+ @code{BZ_SEQUENCE_ERROR}
+ if @code{BZ_STREAM_END} has not been signalled
+ or if @code{b} was opened with @code{BZ2_bzWriteOpen}
+ @code{BZ_OK}
+ otherwise
+@end display
+
+Allowable next actions:
+@display
+ @code{BZ2_bzReadClose}
+@end display
+
+
+@subsection @code{BZ2_bzReadClose}
+@example
+ void BZ2_bzReadClose ( int *bzerror, BZFILE *b );
+@end example
+Releases all memory pertaining to the compressed file @code{b}.
+@code{BZ2_bzReadClose} does not call @code{fclose} on the underlying file
+handle, so you should do that yourself if appropriate.
+@code{BZ2_bzReadClose} should be called to clean up after all error
+situations.
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_SEQUENCE_ERROR}
+ if @code{b} was opened with @code{BZ2_bzOpenWrite}
+ @code{BZ_OK}
+ otherwise
+@end display
+
+Allowable next actions:
+@display
+ none
+@end display
+
+
+
+@subsection @code{BZ2_bzWriteOpen}
+@example
+ BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f,
+ int blockSize100k, int verbosity,
+ int workFactor );
+@end example
+Prepare to write compressed data to file handle @code{f}.
+@code{f} should refer to
+a file which has been opened for writing, and for which the error
+indicator (@code{ferror(f)})is not set.
+
+For the meaning of parameters @code{blockSize100k},
+@code{verbosity} and @code{workFactor}, see
+@* @code{BZ2_bzCompressInit}.
+
+All required memory is allocated at this stage, so if the call
+completes successfully, @code{BZ_MEM_ERROR} cannot be signalled by a
+subsequent call to @code{BZ2_bzWrite}.
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_CONFIG_ERROR}
+ if the library has been mis-compiled
+ @code{BZ_PARAM_ERROR}
+ if @code{f} is @code{NULL}
+ or @code{blockSize100k < 1} or @code{blockSize100k > 9}
+ @code{BZ_IO_ERROR}
+ if @code{ferror(f)} is nonzero
+ @code{BZ_MEM_ERROR}
+ if insufficient memory is available
+ @code{BZ_OK}
+ otherwise
+@end display
+
+Possible return values:
+@display
+ Pointer to an abstract @code{BZFILE}
+ if @code{bzerror} is @code{BZ_OK}
+ @code{NULL}
+ otherwise
+@end display
+
+Allowable next actions:
+@display
+ @code{BZ2_bzWrite}
+ if @code{bzerror} is @code{BZ_OK}
+ (you could go directly to @code{BZ2_bzWriteClose}, but this would be pretty pointless)
+ @code{BZ2_bzWriteClose}
+ otherwise
+@end display
+
+
+
+@subsection @code{BZ2_bzWrite}
+@example
+ void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len );
+@end example
+Absorbs @code{len} bytes from the buffer @code{buf}, eventually to be
+compressed and written to the file.
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_PARAM_ERROR}
+ if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0}
+ @code{BZ_SEQUENCE_ERROR}
+ if b was opened with @code{BZ2_bzReadOpen}
+ @code{BZ_IO_ERROR}
+ if there is an error writing the compressed file.
+ @code{BZ_OK}
+ otherwise
+@end display
+
+
+
+
+@subsection @code{BZ2_bzWriteClose}
+@example
+ void BZ2_bzWriteClose ( int *bzerror, BZFILE* f,
+ int abandon,
+ unsigned int* nbytes_in,
+ unsigned int* nbytes_out );
+
+ void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f,
+ int abandon,
+ unsigned int* nbytes_in_lo32,
+ unsigned int* nbytes_in_hi32,
+ unsigned int* nbytes_out_lo32,
+ unsigned int* nbytes_out_hi32 );
+@end example
+
+Compresses and flushes to the compressed file all data so far supplied
+by @code{BZ2_bzWrite}. The logical end-of-stream markers are also written, so
+subsequent calls to @code{BZ2_bzWrite} are illegal. All memory associated
+with the compressed file @code{b} is released.
+@code{fflush} is called on the
+compressed file, but it is not @code{fclose}'d.
+
+If @code{BZ2_bzWriteClose} is called to clean up after an error, the only
+action is to release the memory. The library records the error codes
+issued by previous calls, so this situation will be detected
+automatically. There is no attempt to complete the compression
+operation, nor to @code{fflush} the compressed file. You can force this
+behaviour to happen even in the case of no error, by passing a nonzero
+value to @code{abandon}.
+
+If @code{nbytes_in} is non-null, @code{*nbytes_in} will be set to be the
+total volume of uncompressed data handled. Similarly, @code{nbytes_out}
+will be set to the total volume of compressed data written. For
+compatibility with older versions of the library, @code{BZ2_bzWriteClose}
+only yields the lower 32 bits of these counts. Use
+@code{BZ2_bzWriteClose64} if you want the full 64 bit counts. These
+two functions are otherwise absolutely identical.
+
+
+Possible assignments to @code{bzerror}:
+@display
+ @code{BZ_SEQUENCE_ERROR}
+ if @code{b} was opened with @code{BZ2_bzReadOpen}
+ @code{BZ_IO_ERROR}
+ if there is an error writing the compressed file
+ @code{BZ_OK}
+ otherwise
+@end display
+
+@subsection Handling embedded compressed data streams
+
+The high-level library facilitates use of
+@code{bzip2} data streams which form some part of a surrounding, larger
+data stream.
+@itemize @bullet
+@item For writing, the library takes an open file handle, writes
+compressed data to it, @code{fflush}es it but does not @code{fclose} it.
+The calling application can write its own data before and after the
+compressed data stream, using that same file handle.
+@item Reading is more complex, and the facilities are not as general
+as they could be since generality is hard to reconcile with efficiency.
+@code{BZ2_bzRead} reads from the compressed file in blocks of size
+@code{BZ_MAX_UNUSED} bytes, and in doing so probably will overshoot
+the logical end of compressed stream.
+To recover this data once decompression has
+ended, call @code{BZ2_bzReadGetUnused} after the last call of @code{BZ2_bzRead}
+(the one returning @code{BZ_STREAM_END}) but before calling
+@code{BZ2_bzReadClose}.
+@end itemize
+
+This mechanism makes it easy to decompress multiple @code{bzip2}
+streams placed end-to-end. As the end of one stream, when @code{BZ2_bzRead}
+returns @code{BZ_STREAM_END}, call @code{BZ2_bzReadGetUnused} to collect the
+unused data (copy it into your own buffer somewhere).
+That data forms the start of the next compressed stream.
+To start uncompressing that next stream, call @code{BZ2_bzReadOpen} again,
+feeding in the unused data via the @code{unused}/@code{nUnused}
+parameters.
+Keep doing this until @code{BZ_STREAM_END} return coincides with the
+physical end of file (@code{feof(f)}). In this situation
+@code{BZ2_bzReadGetUnused}
+will of course return no data.
+
+This should give some feel for how the high-level interface can be used.
+If you require extra flexibility, you'll have to bite the bullet and get
+to grips with the low-level interface.
+
+@subsection Standard file-reading/writing code
+Here's how you'd write data to a compressed file:
+@example @code
+FILE* f;
+BZFILE* b;
+int nBuf;
+char buf[ /* whatever size you like */ ];
+int bzerror;
+int nWritten;
+
+f = fopen ( "myfile.bz2", "w" );
+if (!f) @{
+ /* handle error */
+@}
+b = BZ2_bzWriteOpen ( &bzerror, f, 9 );
+if (bzerror != BZ_OK) @{
+ BZ2_bzWriteClose ( b );
+ /* handle error */
+@}
+
+while ( /* condition */ ) @{
+ /* get data to write into buf, and set nBuf appropriately */
+ nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf );
+ if (bzerror == BZ_IO_ERROR) @{
+ BZ2_bzWriteClose ( &bzerror, b );
+ /* handle error */
+ @}
+@}
+
+BZ2_bzWriteClose ( &bzerror, b );
+if (bzerror == BZ_IO_ERROR) @{
+ /* handle error */
+@}
+@end example
+And to read from a compressed file:
+@example
+FILE* f;
+BZFILE* b;
+int nBuf;
+char buf[ /* whatever size you like */ ];
+int bzerror;
+int nWritten;
+
+f = fopen ( "myfile.bz2", "r" );
+if (!f) @{
+ /* handle error */
+@}
+b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 );
+if (bzerror != BZ_OK) @{
+ BZ2_bzReadClose ( &bzerror, b );
+ /* handle error */
+@}
+
+bzerror = BZ_OK;
+while (bzerror == BZ_OK && /* arbitrary other conditions */) @{
+ nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ );
+ if (bzerror == BZ_OK) @{
+ /* do something with buf[0 .. nBuf-1] */
+ @}
+@}
+if (bzerror != BZ_STREAM_END) @{
+ BZ2_bzReadClose ( &bzerror, b );
+ /* handle error */
+@} else @{
+ BZ2_bzReadClose ( &bzerror );
+@}
+@end example
+
+
+
+@section Utility functions
+@subsection @code{BZ2_bzBuffToBuffCompress}
+@example
+ int BZ2_bzBuffToBuffCompress( char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int blockSize100k,
+ int verbosity,
+ int workFactor );
+@end example
+Attempts to compress the data in @code{source[0 .. sourceLen-1]}
+into the destination buffer, @code{dest[0 .. *destLen-1]}.
+If the destination buffer is big enough, @code{*destLen} is
+set to the size of the compressed data, and @code{BZ_OK} is
+returned. If the compressed data won't fit, @code{*destLen}
+is unchanged, and @code{BZ_OUTBUFF_FULL} is returned.
+
+Compression in this manner is a one-shot event, done with a single call
+to this function. The resulting compressed data is a complete
+@code{bzip2} format data stream. There is no mechanism for making
+additional calls to provide extra input data. If you want that kind of
+mechanism, use the low-level interface.
+
+For the meaning of parameters @code{blockSize100k}, @code{verbosity}
+and @code{workFactor}, @* see @code{BZ2_bzCompressInit}.
+
+To guarantee that the compressed data will fit in its buffer, allocate
+an output buffer of size 1% larger than the uncompressed data, plus
+six hundred extra bytes.
+
+@code{BZ2_bzBuffToBuffDecompress} will not write data at or
+beyond @code{dest[*destLen]}, even in case of buffer overflow.
+
+Possible return values:
+@display
+ @code{BZ_CONFIG_ERROR}
+ if the library has been mis-compiled
+ @code{BZ_PARAM_ERROR}
+ if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL}
+ or @code{blockSize100k < 1} or @code{blockSize100k > 9}
+ or @code{verbosity < 0} or @code{verbosity > 4}
+ or @code{workFactor < 0} or @code{workFactor > 250}
+ @code{BZ_MEM_ERROR}
+ if insufficient memory is available
+ @code{BZ_OUTBUFF_FULL}
+ if the size of the compressed data exceeds @code{*destLen}
+ @code{BZ_OK}
+ otherwise
+@end display
+
+
+
+@subsection @code{BZ2_bzBuffToBuffDecompress}
+@example
+ int BZ2_bzBuffToBuffDecompress ( char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int small,
+ int verbosity );
+@end example
+Attempts to decompress the data in @code{source[0 .. sourceLen-1]}
+into the destination buffer, @code{dest[0 .. *destLen-1]}.
+If the destination buffer is big enough, @code{*destLen} is
+set to the size of the uncompressed data, and @code{BZ_OK} is
+returned. If the compressed data won't fit, @code{*destLen}
+is unchanged, and @code{BZ_OUTBUFF_FULL} is returned.
+
+@code{source} is assumed to hold a complete @code{bzip2} format
+data stream. @* @code{BZ2_bzBuffToBuffDecompress} tries to decompress
+the entirety of the stream into the output buffer.
+
+For the meaning of parameters @code{small} and @code{verbosity},
+see @code{BZ2_bzDecompressInit}.
+
+Because the compression ratio of the compressed data cannot be known in
+advance, there is no easy way to guarantee that the output buffer will
+be big enough. You may of course make arrangements in your code to
+record the size of the uncompressed data, but such a mechanism is beyond
+the scope of this library.
+
+@code{BZ2_bzBuffToBuffDecompress} will not write data at or
+beyond @code{dest[*destLen]}, even in case of buffer overflow.
+
+Possible return values:
+@display
+ @code{BZ_CONFIG_ERROR}
+ if the library has been mis-compiled
+ @code{BZ_PARAM_ERROR}
+ if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL}
+ or @code{small != 0 && small != 1}
+ or @code{verbosity < 0} or @code{verbosity > 4}
+ @code{BZ_MEM_ERROR}
+ if insufficient memory is available
+ @code{BZ_OUTBUFF_FULL}
+ if the size of the compressed data exceeds @code{*destLen}
+ @code{BZ_DATA_ERROR}
+ if a data integrity error was detected in the compressed data
+ @code{BZ_DATA_ERROR_MAGIC}
+ if the compressed data doesn't begin with the right magic bytes
+ @code{BZ_UNEXPECTED_EOF}
+ if the compressed data ends unexpectedly
+ @code{BZ_OK}
+ otherwise
+@end display
+
+
+
+@section @code{zlib} compatibility functions
+Yoshioka Tsuneo has contributed some functions to
+give better @code{zlib} compatibility. These functions are
+@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush},
+@code{BZ2_bzclose},
+@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}.
+These functions are not (yet) officially part of
+the library. If they break, you get to keep all the pieces.
+Nevertheless, I think they work ok.
+@example
+typedef void BZFILE;
+
+const char * BZ2_bzlibVersion ( void );
+@end example
+Returns a string indicating the library version.
+@example
+BZFILE * BZ2_bzopen ( const char *path, const char *mode );
+BZFILE * BZ2_bzdopen ( int fd, const char *mode );
+@end example
+Opens a @code{.bz2} file for reading or writing, using either its name
+or a pre-existing file descriptor.
+Analogous to @code{fopen} and @code{fdopen}.
+@example
+int BZ2_bzread ( BZFILE* b, void* buf, int len );
+int BZ2_bzwrite ( BZFILE* b, void* buf, int len );
+@end example
+Reads/writes data from/to a previously opened @code{BZFILE}.
+Analogous to @code{fread} and @code{fwrite}.
+@example
+int BZ2_bzflush ( BZFILE* b );
+void BZ2_bzclose ( BZFILE* b );
+@end example
+Flushes/closes a @code{BZFILE}. @code{BZ2_bzflush} doesn't actually do
+anything. Analogous to @code{fflush} and @code{fclose}.
+
+@example
+const char * BZ2_bzerror ( BZFILE *b, int *errnum )
+@end example
+Returns a string describing the more recent error status of
+@code{b}, and also sets @code{*errnum} to its numerical value.
+
+
+@section Using the library in a @code{stdio}-free environment
+
+@subsection Getting rid of @code{stdio}
+
+In a deeply embedded application, you might want to use just
+the memory-to-memory functions. You can do this conveniently
+by compiling the library with preprocessor symbol @code{BZ_NO_STDIO}
+defined. Doing this gives you a library containing only the following
+eight functions:
+
+@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, @code{BZ2_bzCompressEnd} @*
+@code{BZ2_bzDecompressInit}, @code{BZ2_bzDecompress}, @code{BZ2_bzDecompressEnd} @*
+@code{BZ2_bzBuffToBuffCompress}, @code{BZ2_bzBuffToBuffDecompress}
+
+When compiled like this, all functions will ignore @code{verbosity}
+settings.
+
+@subsection Critical error handling
+@code{libbzip2} contains a number of internal assertion checks which
+should, needless to say, never be activated. Nevertheless, if an
+assertion should fail, behaviour depends on whether or not the library
+was compiled with @code{BZ_NO_STDIO} set.
+
+For a normal compile, an assertion failure yields the message
+@example
+ bzip2/libbzip2: internal error number N.
+ This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000.
+ Please report it to me at: jseward@@acm.org. If this happened
+ when you were using some program which uses libbzip2 as a
+ component, you should also report this bug to the author(s)
+ of that program. Please make an effort to report this bug;
+ timely and accurate bug reports eventually lead to higher
+ quality software. Thanks. Julian Seward, 21 March 2000.
+@end example
+where @code{N} is some error code number. @code{exit(3)}
+is then called.
+
+For a @code{stdio}-free library, assertion failures result
+in a call to a function declared as:
+@example
+ extern void bz_internal_error ( int errcode );
+@end example
+The relevant code is passed as a parameter. You should supply
+such a function.
+
+In either case, once an assertion failure has occurred, any
+@code{bz_stream} records involved can be regarded as invalid.
+You should not attempt to resume normal operation with them.
+
+You may, of course, change critical error handling to suit
+your needs. As I said above, critical errors indicate bugs
+in the library and should not occur. All "normal" error
+situations are indicated via error return codes from functions,
+and can be recovered from.
+
+
+@section Making a Windows DLL
+Everything related to Windows has been contributed by Yoshioka Tsuneo
+@* (@code{QWF00133@@niftyserve.or.jp} /
+@code{tsuneo-y@@is.aist-nara.ac.jp}), so you should send your queries to
+him (but perhaps Cc: me, @code{jseward@@acm.org}).
+
+My vague understanding of what to do is: using Visual C++ 5.0,
+open the project file @code{libbz2.dsp}, and build. That's all.
+
+If you can't
+open the project file for some reason, make a new one, naming these files:
+@code{blocksort.c}, @code{bzlib.c}, @code{compress.c},
+@code{crctable.c}, @code{decompress.c}, @code{huffman.c}, @*
+@code{randtable.c} and @code{libbz2.def}. You will also need
+to name the header files @code{bzlib.h} and @code{bzlib_private.h}.
+
+If you don't use VC++, you may need to define the proprocessor symbol
+@code{_WIN32}.
+
+Finally, @code{dlltest.c} is a sample program using the DLL. It has a
+project file, @code{dlltest.dsp}.
+
+If you just want a makefile for Visual C, have a look at
+@code{makefile.msc}.
+
+Be aware that if you compile @code{bzip2} itself on Win32, you must set
+@code{BZ_UNIX} to 0 and @code{BZ_LCCWIN32} to 1, in the file
+@code{bzip2.c}, before compiling. Otherwise the resulting binary won't
+work correctly.
+
+I haven't tried any of this stuff myself, but it all looks plausible.
+
+
+
+@chapter Miscellanea
+
+These are just some random thoughts of mine. Your mileage may
+vary.
+
+@section Limitations of the compressed file format
+@code{bzip2-1.0}, @code{0.9.5} and @code{0.9.0}
+use exactly the same file format as the previous
+version, @code{bzip2-0.1}. This decision was made in the interests of
+stability. Creating yet another incompatible compressed file format
+would create further confusion and disruption for users.
+
+Nevertheless, this is not a painless decision. Development
+work since the release of @code{bzip2-0.1} in August 1997
+has shown complexities in the file format which slow down
+decompression and, in retrospect, are unnecessary. These are:
+@itemize @bullet
+@item The run-length encoder, which is the first of the
+ compression transformations, is entirely irrelevant.
+ The original purpose was to protect the sorting algorithm
+ from the very worst case input: a string of repeated
+ symbols. But algorithm steps Q6a and Q6b in the original
+ Burrows-Wheeler technical report (SRC-124) show how
+ repeats can be handled without difficulty in block
+ sorting.
+@item The randomisation mechanism doesn't really need to be
+ there. Udi Manber and Gene Myers published a suffix
+ array construction algorithm a few years back, which
+ can be employed to sort any block, no matter how
+ repetitive, in O(N log N) time. Subsequent work by
+ Kunihiko Sadakane has produced a derivative O(N (log N)^2)
+ algorithm which usually outperforms the Manber-Myers
+ algorithm.
+
+ I could have changed to Sadakane's algorithm, but I find
+ it to be slower than @code{bzip2}'s existing algorithm for
+ most inputs, and the randomisation mechanism protects
+ adequately against bad cases. I didn't think it was
+ a good tradeoff to make. Partly this is due to the fact
+ that I was not flooded with email complaints about
+ @code{bzip2-0.1}'s performance on repetitive data, so
+ perhaps it isn't a problem for real inputs.
+
+ Probably the best long-term solution,
+ and the one I have incorporated into 0.9.5 and above,
+ is to use the existing sorting
+ algorithm initially, and fall back to a O(N (log N)^2)
+ algorithm if the standard algorithm gets into difficulties.
+@item The compressed file format was never designed to be
+ handled by a library, and I have had to jump though
+ some hoops to produce an efficient implementation of
+ decompression. It's a bit hairy. Try passing
+ @code{decompress.c} through the C preprocessor
+ and you'll see what I mean. Much of this complexity
+ could have been avoided if the compressed size of
+ each block of data was recorded in the data stream.
+@item An Adler-32 checksum, rather than a CRC32 checksum,
+ would be faster to compute.
+@end itemize
+It would be fair to say that the @code{bzip2} format was frozen
+before I properly and fully understood the performance
+consequences of doing so.
+
+Improvements which I was able to incorporate into
+0.9.0, despite using the same file format, are:
+@itemize @bullet
+@item Single array implementation of the inverse BWT. This
+ significantly speeds up decompression, presumably
+ because it reduces the number of cache misses.
+@item Faster inverse MTF transform for large MTF values. The
+ new implementation is based on the notion of sliding blocks
+ of values.
+@item @code{bzip2-0.9.0} now reads and writes files with @code{fread}
+ and @code{fwrite}; version 0.1 used @code{putc} and @code{getc}.
+ Duh! Well, you live and learn.
+
+@end itemize
+Further ahead, it would be nice
+to be able to do random access into files. This will
+require some careful design of compressed file formats.
+
+
+
+@section Portability issues
+After some consideration, I have decided not to use
+GNU @code{autoconf} to configure 0.9.5 or 1.0.
+
+@code{autoconf}, admirable and wonderful though it is,
+mainly assists with portability problems between Unix-like
+platforms. But @code{bzip2} doesn't have much in the way
+of portability problems on Unix; most of the difficulties appear
+when porting to the Mac, or to Microsoft's operating systems.
+@code{autoconf} doesn't help in those cases, and brings in a
+whole load of new complexity.
+
+Most people should be able to compile the library and program
+under Unix straight out-of-the-box, so to speak, especially
+if you have a version of GNU C available.
+
+There are a couple of @code{__inline__} directives in the code. GNU C
+(@code{gcc}) should be able to handle them. If you're not using
+GNU C, your C compiler shouldn't see them at all.
+If your compiler does, for some reason, see them and doesn't
+like them, just @code{#define} @code{__inline__} to be @code{/* */}. One
+easy way to do this is to compile with the flag @code{-D__inline__=},
+which should be understood by most Unix compilers.
+
+If you still have difficulties, try compiling with the macro
+@code{BZ_STRICT_ANSI} defined. This should enable you to build the
+library in a strictly ANSI compliant environment. Building the program
+itself like this is dangerous and not supported, since you remove
+@code{bzip2}'s checks against compressing directories, symbolic links,
+devices, and other not-really-a-file entities. This could cause
+filesystem corruption!
+
+One other thing: if you create a @code{bzip2} binary for public
+distribution, please try and link it statically (@code{gcc -s}). This
+avoids all sorts of library-version issues that others may encounter
+later on.
+
+If you build @code{bzip2} on Win32, you must set @code{BZ_UNIX} to 0 and
+@code{BZ_LCCWIN32} to 1, in the file @code{bzip2.c}, before compiling.
+Otherwise the resulting binary won't work correctly.
+
+
+
+@section Reporting bugs
+I tried pretty hard to make sure @code{bzip2} is
+bug free, both by design and by testing. Hopefully
+you'll never need to read this section for real.
+
+Nevertheless, if @code{bzip2} dies with a segmentation
+fault, a bus error or an internal assertion failure, it
+will ask you to email me a bug report. Experience with
+version 0.1 shows that almost all these problems can
+be traced to either compiler bugs or hardware problems.
+@itemize @bullet
+@item
+Recompile the program with no optimisation, and see if it
+works. And/or try a different compiler.
+I heard all sorts of stories about various flavours
+of GNU C (and other compilers) generating bad code for
+@code{bzip2}, and I've run across two such examples myself.
+
+2.7.X versions of GNU C are known to generate bad code from
+time to time, at high optimisation levels.
+If you get problems, try using the flags
+@code{-O2} @code{-fomit-frame-pointer} @code{-fno-strength-reduce}.
+You should specifically @emph{not} use @code{-funroll-loops}.
+
+You may notice that the Makefile runs six tests as part of
+the build process. If the program passes all of these, it's
+a pretty good (but not 100%) indication that the compiler has
+done its job correctly.
+@item
+If @code{bzip2} crashes randomly, and the crashes are not
+repeatable, you may have a flaky memory subsystem. @code{bzip2}
+really hammers your memory hierarchy, and if it's a bit marginal,
+you may get these problems. Ditto if your disk or I/O subsystem
+is slowly failing. Yup, this really does happen.
+
+Try using a different machine of the same type, and see if
+you can repeat the problem.
+@item This isn't really a bug, but ... If @code{bzip2} tells
+you your file is corrupted on decompression, and you
+obtained the file via FTP, there is a possibility that you
+forgot to tell FTP to do a binary mode transfer. That absolutely
+will cause the file to be non-decompressible. You'll have to transfer
+it again.
+@end itemize
+
+If you've incorporated @code{libbzip2} into your own program
+and are getting problems, please, please, please, check that the
+parameters you are passing in calls to the library, are
+correct, and in accordance with what the documentation says
+is allowable. I have tried to make the library robust against
+such problems, but I'm sure I haven't succeeded.
+
+Finally, if the above comments don't help, you'll have to send
+me a bug report. Now, it's just amazing how many people will
+send me a bug report saying something like
+@display
+ bzip2 crashed with segmentation fault on my machine
+@end display
+and absolutely nothing else. Needless to say, a such a report
+is @emph{totally, utterly, completely and comprehensively 100% useless;
+a waste of your time, my time, and net bandwidth}.
+With no details at all, there's no way I can possibly begin
+to figure out what the problem is.
+
+The rules of the game are: facts, facts, facts. Don't omit
+them because "oh, they won't be relevant". At the bare
+minimum:
+@display
+ Machine type. Operating system version.
+ Exact version of @code{bzip2} (do @code{bzip2 -V}).
+ Exact version of the compiler used.
+ Flags passed to the compiler.
+@end display
+However, the most important single thing that will help me is
+the file that you were trying to compress or decompress at the
+time the problem happened. Without that, my ability to do anything
+more than speculate about the cause, is limited.
+
+Please remember that I connect to the Internet with a modem, so
+you should contact me before mailing me huge files.
+
+
+@section Did you get the right package?
+
+@code{bzip2} is a resource hog. It soaks up large amounts of CPU cycles
+and memory. Also, it gives very large latencies. In the worst case, you
+can feed many megabytes of uncompressed data into the library before
+getting any compressed output, so this probably rules out applications
+requiring interactive behaviour.
+
+These aren't faults of my implementation, I hope, but more
+an intrinsic property of the Burrows-Wheeler transform (unfortunately).
+Maybe this isn't what you want.
+
+If you want a compressor and/or library which is faster, uses less
+memory but gets pretty good compression, and has minimal latency,
+consider Jean-loup
+Gailly's and Mark Adler's work, @code{zlib-1.1.2} and
+@code{gzip-1.2.4}. Look for them at
+
+@code{http://www.cdrom.com/pub/infozip/zlib} and
+@code{http://www.gzip.org} respectively.
+
+For something faster and lighter still, you might try Markus F X J
+Oberhumer's @code{LZO} real-time compression/decompression library, at
+@* @code{http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html}.
+
+If you want to use the @code{bzip2} algorithms to compress small blocks
+of data, 64k bytes or smaller, for example on an on-the-fly disk
+compressor, you'd be well advised not to use this library. Instead,
+I've made a special library tuned for that kind of use. It's part of
+@code{e2compr-0.40}, an on-the-fly disk compressor for the Linux
+@code{ext2} filesystem. Look at
+@code{http://www.netspace.net.au/~reiter/e2compr}.
+
+
+
+@section Testing
+
+A record of the tests I've done.
+
+First, some data sets:
+@itemize @bullet
+@item B: a directory containing 6001 files, one for every length in the
+ range 0 to 6000 bytes. The files contain random lowercase
+ letters. 18.7 megabytes.
+@item H: my home directory tree. Documents, source code, mail files,
+ compressed data. H contains B, and also a directory of
+ files designed as boundary cases for the sorting; mostly very
+ repetitive, nasty files. 565 megabytes.
+@item A: directory tree holding various applications built from source:
+ @code{egcs}, @code{gcc-2.8.1}, KDE, GTK, Octave, etc.
+ 2200 megabytes.
+@end itemize
+The tests conducted are as follows. Each test means compressing
+(a copy of) each file in the data set, decompressing it and
+comparing it against the original.
+
+First, a bunch of tests with block sizes and internal buffer
+sizes set very small,
+to detect any problems with the
+blocking and buffering mechanisms.
+This required modifying the source code so as to try to
+break it.
+@enumerate
+@item Data set H, with
+ buffer size of 1 byte, and block size of 23 bytes.
+@item Data set B, buffer sizes 1 byte, block size 1 byte.
+@item As (2) but small-mode decompression.
+@item As (2) with block size 2 bytes.
+@item As (2) with block size 3 bytes.
+@item As (2) with block size 4 bytes.
+@item As (2) with block size 5 bytes.
+@item As (2) with block size 6 bytes and small-mode decompression.
+@item H with buffer size of 1 byte, but normal block
+ size (up to 900000 bytes).
+@end enumerate
+Then some tests with unmodified source code.
+@enumerate
+@item H, all settings normal.
+@item As (1), with small-mode decompress.
+@item H, compress with flag @code{-1}.
+@item H, compress with flag @code{-s}, decompress with flag @code{-s}.
+@item Forwards compatibility: H, @code{bzip2-0.1pl2} compressing,
+ @code{bzip2-0.9.5} decompressing, all settings normal.
+@item Backwards compatibility: H, @code{bzip2-0.9.5} compressing,
+ @code{bzip2-0.1pl2} decompressing, all settings normal.
+@item Bigger tests: A, all settings normal.
+@item As (7), using the fallback (Sadakane-like) sorting algorithm.
+@item As (8), compress with flag @code{-1}, decompress with flag
+ @code{-s}.
+@item H, using the fallback sorting algorithm.
+@item Forwards compatibility: A, @code{bzip2-0.1pl2} compressing,
+ @code{bzip2-0.9.5} decompressing, all settings normal.
+@item Backwards compatibility: A, @code{bzip2-0.9.5} compressing,
+ @code{bzip2-0.1pl2} decompressing, all settings normal.
+@item Misc test: about 400 megabytes of @code{.tar} files with
+ @code{bzip2} compiled with Checker (a memory access error
+ detector, like Purify).
+@item Misc tests to make sure it builds and runs ok on non-Linux/x86
+ platforms.
+@end enumerate
+These tests were conducted on a 225 MHz IDT WinChip machine, running
+Linux 2.0.36. They represent nearly a week of continuous computation.
+All tests completed successfully.
+
+
+@section Further reading
+@code{bzip2} is not research work, in the sense that it doesn't present
+any new ideas. Rather, it's an engineering exercise based on existing
+ideas.
+
+Four documents describe essentially all the ideas behind @code{bzip2}:
+@example
+Michael Burrows and D. J. Wheeler:
+ "A block-sorting lossless data compression algorithm"
+ 10th May 1994.
+ Digital SRC Research Report 124.
+ ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz
+ If you have trouble finding it, try searching at the
+ New Zealand Digital Library, http://www.nzdl.org.
+
+Daniel S. Hirschberg and Debra A. LeLewer
+ "Efficient Decoding of Prefix Codes"
+ Communications of the ACM, April 1990, Vol 33, Number 4.
+ You might be able to get an electronic copy of this
+ from the ACM Digital Library.
+
+David J. Wheeler
+ Program bred3.c and accompanying document bred3.ps.
+ This contains the idea behind the multi-table Huffman
+ coding scheme.
+ ftp://ftp.cl.cam.ac.uk/users/djw3/
+
+Jon L. Bentley and Robert Sedgewick
+ "Fast Algorithms for Sorting and Searching Strings"
+ Available from Sedgewick's web page,
+ www.cs.princeton.edu/~rs
+@end example
+The following paper gives valuable additional insights into the
+algorithm, but is not immediately the basis of any code
+used in bzip2.
+@example
+Peter Fenwick:
+ Block Sorting Text Compression
+ Proceedings of the 19th Australasian Computer Science Conference,
+ Melbourne, Australia. Jan 31 - Feb 2, 1996.
+ ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps
+@end example
+Kunihiko Sadakane's sorting algorithm, mentioned above,
+is available from:
+@example
+http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz
+@end example
+The Manber-Myers suffix array construction
+algorithm is described in a paper
+available from:
+@example
+http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps
+@end example
+Finally, the following paper documents some recent investigations
+I made into the performance of sorting algorithms:
+@example
+Julian Seward:
+ On the Performance of BWT Sorting Algorithms
+ Proceedings of the IEEE Data Compression Conference 2000
+ Snowbird, Utah. 28-30 March 2000.
+@end example
+
+
+@contents
+
+@bye
+
--- /dev/null
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+ from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Introduction</TITLE>
+<link href="manual_2.html" rel=Next>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the first, previous, <A HREF="manual_2.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC1" HREF="manual_toc.html#TOC1">Introduction</A></H1>
+
+<P>
+<CODE>bzip2</CODE> compresses files using the Burrows-Wheeler
+block-sorting text compression algorithm, and Huffman coding.
+Compression is generally considerably better than that
+achieved by more conventional LZ77/LZ78-based compressors,
+and approaches the performance of the PPM family of statistical compressors.
+
+</P>
+<P>
+<CODE>bzip2</CODE> is built on top of <CODE>libbzip2</CODE>, a flexible library
+for handling compressed data in the <CODE>bzip2</CODE> format. This manual
+describes both how to use the program and
+how to work with the library interface. Most of the
+manual is devoted to this library, not the program,
+which is good news if your interest is only in the program.
+
+</P>
+<P>
+Chapter 2 describes how to use <CODE>bzip2</CODE>; this is the only part
+you need to read if you just want to know how to operate the program.
+Chapter 3 describes the programming interfaces in detail, and
+Chapter 4 records some miscellaneous notes which I thought
+ought to be recorded somewhere.
+
+</P>
+
+<P><HR><P>
+<p>Go to the first, previous, <A HREF="manual_2.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
--- /dev/null
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+ from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - How to use bzip2</TITLE>
+<link href="manual_3.html" rel=Next>
+<link href="manual_1.html" rel=Previous>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_1.html">previous</A>, <A HREF="manual_3.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC2" HREF="manual_toc.html#TOC2">How to use <CODE>bzip2</CODE></A></H1>
+
+<P>
+This chapter contains a copy of the <CODE>bzip2</CODE> man page,
+and nothing else.
+
+</P>
+
+<BLOCKQUOTE>
+
+
+
+<H4><A NAME="SEC3" HREF="manual_toc.html#TOC3">NAME</A></H4>
+
+<UL>
+<LI><CODE>bzip2</CODE>, <CODE>bunzip2</CODE>
+
+- a block-sorting file compressor, v1.0
+<LI><CODE>bzcat</CODE>
+
+- decompresses files to stdout
+<LI><CODE>bzip2recover</CODE>
+
+- recovers data from damaged bzip2 files
+</UL>
+
+
+
+<H4><A NAME="SEC4" HREF="manual_toc.html#TOC4">SYNOPSIS</A></H4>
+
+<UL>
+<LI><CODE>bzip2</CODE> [ -cdfkqstvzVL123456789 ] [ filenames ... ]
+
+<LI><CODE>bunzip2</CODE> [ -fkvsVL ] [ filenames ... ]
+
+<LI><CODE>bzcat</CODE> [ -s ] [ filenames ... ]
+
+<LI><CODE>bzip2recover</CODE> filename
+
+</UL>
+
+
+
+<H4><A NAME="SEC5" HREF="manual_toc.html#TOC5">DESCRIPTION</A></H4>
+
+<P>
+<CODE>bzip2</CODE> compresses files using the Burrows-Wheeler block sorting
+text compression algorithm, and Huffman coding. Compression is
+generally considerably better than that achieved by more conventional
+LZ77/LZ78-based compressors, and approaches the performance of the PPM
+family of statistical compressors.
+
+</P>
+<P>
+The command-line options are deliberately very similar to those of GNU
+<CODE>gzip</CODE>, but they are not identical.
+
+</P>
+<P>
+<CODE>bzip2</CODE> expects a list of file names to accompany the command-line
+flags. Each file is replaced by a compressed version of itself, with
+the name <CODE>original_name.bz2</CODE>. Each compressed file has the same
+modification date, permissions, and, when possible, ownership as the
+corresponding original, so that these properties can be correctly
+restored at decompression time. File name handling is naive in the
+sense that there is no mechanism for preserving original file names,
+permissions, ownerships or dates in filesystems which lack these
+concepts, or have serious file name length restrictions, such as MS-DOS.
+
+</P>
+<P>
+<CODE>bzip2</CODE> and <CODE>bunzip2</CODE> will by default not overwrite existing
+files. If you want this to happen, specify the <CODE>-f</CODE> flag.
+
+</P>
+<P>
+If no file names are specified, <CODE>bzip2</CODE> compresses from standard
+input to standard output. In this case, <CODE>bzip2</CODE> will decline to
+write compressed output to a terminal, as this would be entirely
+incomprehensible and therefore pointless.
+
+</P>
+<P>
+<CODE>bunzip2</CODE> (or <CODE>bzip2 -d</CODE>) decompresses all
+specified files. Files which were not created by <CODE>bzip2</CODE>
+will be detected and ignored, and a warning issued.
+<CODE>bzip2</CODE> attempts to guess the filename for the decompressed file
+from that of the compressed file as follows:
+
+<UL>
+<LI><CODE>filename.bz2 </CODE> becomes <CODE>filename</CODE>
+
+<LI><CODE>filename.bz </CODE> becomes <CODE>filename</CODE>
+
+<LI><CODE>filename.tbz2</CODE> becomes <CODE>filename.tar</CODE>
+
+<LI><CODE>filename.tbz </CODE> becomes <CODE>filename.tar</CODE>
+
+<LI><CODE>anyothername </CODE> becomes <CODE>anyothername.out</CODE>
+
+</UL>
+
+<P>
+If the file does not end in one of the recognised endings,
+<CODE>.bz2</CODE>, <CODE>.bz</CODE>,
+<CODE>.tbz2</CODE> or <CODE>.tbz</CODE>, <CODE>bzip2</CODE> complains that it cannot
+guess the name of the original file, and uses the original name
+with <CODE>.out</CODE> appended.
+
+</P>
+<P>
+As with compression, supplying no
+filenames causes decompression from standard input to standard output.
+
+</P>
+<P>
+<CODE>bunzip2</CODE> will correctly decompress a file which is the
+concatenation of two or more compressed files. The result is the
+concatenation of the corresponding uncompressed files. Integrity
+testing (<CODE>-t</CODE>) of concatenated compressed files is also supported.
+
+</P>
+<P>
+You can also compress or decompress files to the standard output by
+giving the <CODE>-c</CODE> flag. Multiple files may be compressed and
+decompressed like this. The resulting outputs are fed sequentially to
+stdout. Compression of multiple files in this manner generates a stream
+containing multiple compressed file representations. Such a stream
+can be decompressed correctly only by <CODE>bzip2</CODE> version 0.9.0 or
+later. Earlier versions of <CODE>bzip2</CODE> will stop after decompressing
+the first file in the stream.
+
+</P>
+<P>
+<CODE>bzcat</CODE> (or <CODE>bzip2 -dc</CODE>) decompresses all specified files to
+the standard output.
+
+</P>
+<P>
+<CODE>bzip2</CODE> will read arguments from the environment variables
+<CODE>BZIP2</CODE> and <CODE>BZIP</CODE>, in that order, and will process them
+before any arguments read from the command line. This gives a
+convenient way to supply default arguments.
+
+</P>
+<P>
+Compression is always performed, even if the compressed file is slightly
+larger than the original. Files of less than about one hundred bytes
+tend to get larger, since the compression mechanism has a constant
+overhead in the region of 50 bytes. Random data (including the output
+of most file compressors) is coded at about 8.05 bits per byte, giving
+an expansion of around 0.5%.
+
+</P>
+<P>
+As a self-check for your protection, <CODE>bzip2</CODE> uses 32-bit CRCs to
+make sure that the decompressed version of a file is identical to the
+original. This guards against corruption of the compressed data, and
+against undetected bugs in <CODE>bzip2</CODE> (hopefully very unlikely). The
+chances of data corruption going undetected is microscopic, about one
+chance in four billion for each file processed. Be aware, though, that
+the check occurs upon decompression, so it can only tell you that
+something is wrong. It can't help you recover the original uncompressed
+data. You can use <CODE>bzip2recover</CODE> to try to recover data from
+damaged files.
+
+</P>
+<P>
+Return values: 0 for a normal exit, 1 for environmental problems (file
+not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt
+compressed file, 3 for an internal consistency error (eg, bug) which
+caused <CODE>bzip2</CODE> to panic.
+
+</P>
+
+
+
+<H4><A NAME="SEC6" HREF="manual_toc.html#TOC6">OPTIONS</A></H4>
+<DL COMPACT>
+
+<DT><CODE>-c --stdout</CODE>
+<DD>
+Compress or decompress to standard output.
+<DT><CODE>-d --decompress</CODE>
+<DD>
+Force decompression. <CODE>bzip2</CODE>, <CODE>bunzip2</CODE> and <CODE>bzcat</CODE> are
+really the same program, and the decision about what actions to take is
+done on the basis of which name is used. This flag overrides that
+mechanism, and forces bzip2 to decompress.
+<DT><CODE>-z --compress</CODE>
+<DD>
+The complement to <CODE>-d</CODE>: forces compression, regardless of the
+invokation name.
+<DT><CODE>-t --test</CODE>
+<DD>
+Check integrity of the specified file(s), but don't decompress them.
+This really performs a trial decompression and throws away the result.
+<DT><CODE>-f --force</CODE>
+<DD>
+Force overwrite of output files. Normally, <CODE>bzip2</CODE> will not overwrite
+existing output files. Also forces <CODE>bzip2</CODE> to break hard links
+to files, which it otherwise wouldn't do.
+<DT><CODE>-k --keep</CODE>
+<DD>
+Keep (don't delete) input files during compression
+or decompression.
+<DT><CODE>-s --small</CODE>
+<DD>
+Reduce memory usage, for compression, decompression and testing. Files
+are decompressed and tested using a modified algorithm which only
+requires 2.5 bytes per block byte. This means any file can be
+decompressed in 2300k of memory, albeit at about half the normal speed.
+
+During compression, <CODE>-s</CODE> selects a block size of 200k, which limits
+memory use to around the same figure, at the expense of your compression
+ratio. In short, if your machine is low on memory (8 megabytes or
+less), use -s for everything. See MEMORY MANAGEMENT below.
+<DT><CODE>-q --quiet</CODE>
+<DD>
+Suppress non-essential warning messages. Messages pertaining to
+I/O errors and other critical events will not be suppressed.
+<DT><CODE>-v --verbose</CODE>
+<DD>
+Verbose mode -- show the compression ratio for each file processed.
+Further <CODE>-v</CODE>'s increase the verbosity level, spewing out lots of
+information which is primarily of interest for diagnostic purposes.
+<DT><CODE>-L --license -V --version</CODE>
+<DD>
+Display the software version, license terms and conditions.
+<DT><CODE>-1 to -9</CODE>
+<DD>
+Set the block size to 100 k, 200 k .. 900 k when compressing. Has no
+effect when decompressing. See MEMORY MANAGEMENT below.
+<DT><CODE>--</CODE>
+<DD>
+Treats all subsequent arguments as file names, even if they start
+with a dash. This is so you can handle files with names beginning
+with a dash, for example: <CODE>bzip2 -- -myfilename</CODE>.
+<DT><CODE>--repetitive-fast</CODE>
+<DD>
+<DT><CODE>--repetitive-best</CODE>
+<DD>
+These flags are redundant in versions 0.9.5 and above. They provided
+some coarse control over the behaviour of the sorting algorithm in
+earlier versions, which was sometimes useful. 0.9.5 and above have an
+improved algorithm which renders these flags irrelevant.
+</DL>
+
+
+
+<H4><A NAME="SEC7" HREF="manual_toc.html#TOC7">MEMORY MANAGEMENT</A></H4>
+
+<P>
+<CODE>bzip2</CODE> compresses large files in blocks. The block size affects
+both the compression ratio achieved, and the amount of memory needed for
+compression and decompression. The flags <CODE>-1</CODE> through <CODE>-9</CODE>
+specify the block size to be 100,000 bytes through 900,000 bytes (the
+default) respectively. At decompression time, the block size used for
+compression is read from the header of the compressed file, and
+<CODE>bunzip2</CODE> then allocates itself just enough memory to decompress
+the file. Since block sizes are stored in compressed files, it follows
+that the flags <CODE>-1</CODE> to <CODE>-9</CODE> are irrelevant to and so ignored
+during decompression.
+
+</P>
+<P>
+Compression and decompression requirements, in bytes, can be estimated
+as:
+
+<PRE>
+ Compression: 400k + ( 8 x block size )
+
+ Decompression: 100k + ( 4 x block size ), or
+ 100k + ( 2.5 x block size )
+</PRE>
+
+<P>
+Larger block sizes give rapidly diminishing marginal returns. Most of
+the compression comes from the first two or three hundred k of block
+size, a fact worth bearing in mind when using <CODE>bzip2</CODE> on small machines.
+It is also important to appreciate that the decompression memory
+requirement is set at compression time by the choice of block size.
+
+</P>
+<P>
+For files compressed with the default 900k block size, <CODE>bunzip2</CODE>
+will require about 3700 kbytes to decompress. To support decompression
+of any file on a 4 megabyte machine, <CODE>bunzip2</CODE> has an option to
+decompress using approximately half this amount of memory, about 2300
+kbytes. Decompression speed is also halved, so you should use this
+option only where necessary. The relevant flag is <CODE>-s</CODE>.
+
+</P>
+<P>
+In general, try and use the largest block size memory constraints allow,
+since that maximises the compression achieved. Compression and
+decompression speed are virtually unaffected by block size.
+
+</P>
+<P>
+Another significant point applies to files which fit in a single block
+-- that means most files you'd encounter using a large block size. The
+amount of real memory touched is proportional to the size of the file,
+since the file is smaller than a block. For example, compressing a file
+20,000 bytes long with the flag <CODE>-9</CODE> will cause the compressor to
+allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560
+kbytes of it. Similarly, the decompressor will allocate 3700k but only
+touch 100k + 20000 * 4 = 180 kbytes.
+
+</P>
+<P>
+Here is a table which summarises the maximum memory usage for different
+block sizes. Also recorded is the total compressed size for 14 files of
+the Calgary Text Compression Corpus totalling 3,141,622 bytes. This
+column gives some feel for how compression varies with block size.
+These figures tend to understate the advantage of larger block sizes for
+larger files, since the Corpus is dominated by smaller files.
+
+<PRE>
+ Compress Decompress Decompress Corpus
+ Flag usage usage -s usage Size
+
+ -1 1200k 500k 350k 914704
+ -2 2000k 900k 600k 877703
+ -3 2800k 1300k 850k 860338
+ -4 3600k 1700k 1100k 846899
+ -5 4400k 2100k 1350k 845160
+ -6 5200k 2500k 1600k 838626
+ -7 6100k 2900k 1850k 834096
+ -8 6800k 3300k 2100k 828642
+ -9 7600k 3700k 2350k 828642
+</PRE>
+
+
+
+<H4><A NAME="SEC8" HREF="manual_toc.html#TOC8">RECOVERING DATA FROM DAMAGED FILES</A></H4>
+
+<P>
+<CODE>bzip2</CODE> compresses files in blocks, usually 900kbytes long. Each
+block is handled independently. If a media or transmission error causes
+a multi-block <CODE>.bz2</CODE> file to become damaged, it may be possible to
+recover data from the undamaged blocks in the file.
+
+</P>
+<P>
+The compressed representation of each block is delimited by a 48-bit
+pattern, which makes it possible to find the block boundaries with
+reasonable certainty. Each block also carries its own 32-bit CRC, so
+damaged blocks can be distinguished from undamaged ones.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> is a simple program whose purpose is to search for
+blocks in <CODE>.bz2</CODE> files, and write each block out into its own
+<CODE>.bz2</CODE> file. You can then use <CODE>bzip2 -t</CODE> to test the
+integrity of the resulting files, and decompress those which are
+undamaged.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE>
+takes a single argument, the name of the damaged file,
+and writes a number of files <CODE>rec0001file.bz2</CODE>,
+ <CODE>rec0002file.bz2</CODE>, etc, containing the extracted blocks.
+ The output filenames are designed so that the use of
+ wildcards in subsequent processing -- for example,
+<CODE>bzip2 -dc rec*file.bz2 > recovered_data</CODE> -- lists the files in
+ the correct order.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> should be of most use dealing with large <CODE>.bz2</CODE>
+ files, as these will contain many blocks. It is clearly
+ futile to use it on damaged single-block files, since a
+ damaged block cannot be recovered. If you wish to minimise
+any potential data loss through media or transmission errors,
+you might consider compressing with a smaller
+ block size.
+
+</P>
+
+
+
+<H4><A NAME="SEC9" HREF="manual_toc.html#TOC9">PERFORMANCE NOTES</A></H4>
+
+<P>
+The sorting phase of compression gathers together similar strings in the
+file. Because of this, files containing very long runs of repeated
+symbols, like "aabaabaabaab ..." (repeated several hundred times) may
+compress more slowly than normal. Versions 0.9.5 and above fare much
+better than previous versions in this respect. The ratio between
+worst-case and average-case compression time is in the region of 10:1.
+For previous versions, this figure was more like 100:1. You can use the
+<CODE>-vvvv</CODE> option to monitor progress in great detail, if you want.
+
+</P>
+<P>
+Decompression speed is unaffected by these phenomena.
+
+</P>
+<P>
+<CODE>bzip2</CODE> usually allocates several megabytes of memory to operate
+in, and then charges all over it in a fairly random fashion. This means
+that performance, both for compressing and decompressing, is largely
+determined by the speed at which your machine can service cache misses.
+Because of this, small changes to the code to reduce the miss rate have
+been observed to give disproportionately large performance improvements.
+I imagine <CODE>bzip2</CODE> will perform best on machines with very large
+caches.
+
+</P>
+
+
+
+<H4><A NAME="SEC10" HREF="manual_toc.html#TOC10">CAVEATS</A></H4>
+
+<P>
+I/O error messages are not as helpful as they could be. <CODE>bzip2</CODE>
+tries hard to detect I/O errors and exit cleanly, but the details of
+what the problem is sometimes seem rather misleading.
+
+</P>
+<P>
+This manual page pertains to version 1.0 of <CODE>bzip2</CODE>. Compressed
+data created by this version is entirely forwards and backwards
+compatible with the previous public releases, versions 0.1pl2, 0.9.0 and
+0.9.5, but with the following exception: 0.9.0 and above can correctly
+decompress multiple concatenated compressed files. 0.1pl2 cannot do
+this; it will stop after decompressing just the first file in the
+stream.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> uses 32-bit integers to represent bit positions in
+compressed files, so it cannot handle compressed files more than 512
+megabytes long. This could easily be fixed.
+
+</P>
+
+
+
+<H4><A NAME="SEC11" HREF="manual_toc.html#TOC11">AUTHOR</A></H4>
+<P>
+Julian Seward, <CODE>jseward@acm.org</CODE>.
+
+</P>
+<P>
+The ideas embodied in <CODE>bzip2</CODE> are due to (at least) the following
+people: Michael Burrows and David Wheeler (for the block sorting
+transformation), David Wheeler (again, for the Huffman coder), Peter
+Fenwick (for the structured coding model in the original <CODE>bzip</CODE>,
+and many refinements), and Alistair Moffat, Radford Neal and Ian Witten
+(for the arithmetic coder in the original <CODE>bzip</CODE>). I am much
+indebted for their help, support and advice. See the manual in the
+source distribution for pointers to sources of documentation. Christian
+von Roques encouraged me to look for faster sorting algorithms, so as to
+speed up compression. Bela Lubkin encouraged me to improve the
+worst-case compression performance. Many people sent patches, helped
+with portability problems, lent machines, gave advice and were generally
+helpful.
+
+</P>
+</BLOCKQUOTE>
+
+<P><HR><P>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_1.html">previous</A>, <A HREF="manual_3.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
--- /dev/null
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+ from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Programming with libbzip2</TITLE>
+<link href="manual_4.html" rel=Next>
+<link href="manual_2.html" rel=Previous>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_2.html">previous</A>, <A HREF="manual_4.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC12" HREF="manual_toc.html#TOC12">Programming with <CODE>libbzip2</CODE></A></H1>
+
+<P>
+This chapter describes the programming interface to <CODE>libbzip2</CODE>.
+
+</P>
+<P>
+For general background information, particularly about memory
+use and performance aspects, you'd be well advised to read Chapter 2
+as well.
+
+</P>
+
+
+<H2><A NAME="SEC13" HREF="manual_toc.html#TOC13">Top-level structure</A></H2>
+
+<P>
+<CODE>libbzip2</CODE> is a flexible library for compressing and decompressing
+data in the <CODE>bzip2</CODE> data format. Although packaged as a single
+entity, it helps to regard the library as three separate parts: the low
+level interface, and the high level interface, and some utility
+functions.
+
+</P>
+<P>
+The structure of <CODE>libbzip2</CODE>'s interfaces is similar to
+that of Jean-loup Gailly's and Mark Adler's excellent <CODE>zlib</CODE>
+library.
+
+</P>
+<P>
+All externally visible symbols have names beginning <CODE>BZ2_</CODE>.
+This is new in version 1.0. The intention is to minimise pollution
+of the namespaces of library clients.
+
+</P>
+
+
+<H3><A NAME="SEC14" HREF="manual_toc.html#TOC14">Low-level summary</A></H3>
+
+<P>
+This interface provides services for compressing and decompressing
+data in memory. There's no provision for dealing with files, streams
+or any other I/O mechanisms, just straight memory-to-memory work.
+In fact, this part of the library can be compiled without inclusion
+of <CODE>stdio.h</CODE>, which may be helpful for embedded applications.
+
+</P>
+<P>
+The low-level part of the library has no global variables and
+is therefore thread-safe.
+
+</P>
+<P>
+Six routines make up the low level interface:
+<CODE>BZ2_bzCompressInit</CODE>, <CODE>BZ2_bzCompress</CODE>, and <BR> <CODE>BZ2_bzCompressEnd</CODE>
+for compression,
+and a corresponding trio <CODE>BZ2_bzDecompressInit</CODE>, <BR> <CODE>BZ2_bzDecompress</CODE>
+and <CODE>BZ2_bzDecompressEnd</CODE> for decompression.
+The <CODE>*Init</CODE> functions allocate
+memory for compression/decompression and do other
+initialisations, whilst the <CODE>*End</CODE> functions close down operations
+and release memory.
+
+</P>
+<P>
+The real work is done by <CODE>BZ2_bzCompress</CODE> and <CODE>BZ2_bzDecompress</CODE>.
+These compress and decompress data from a user-supplied input buffer
+to a user-supplied output buffer. These buffers can be any size;
+arbitrary quantities of data are handled by making repeated calls
+to these functions. This is a flexible mechanism allowing a
+consumer-pull style of activity, or producer-push, or a mixture of
+both.
+
+</P>
+
+
+
+<H3><A NAME="SEC15" HREF="manual_toc.html#TOC15">High-level summary</A></H3>
+
+<P>
+This interface provides some handy wrappers around the low-level
+interface to facilitate reading and writing <CODE>bzip2</CODE> format
+files (<CODE>.bz2</CODE> files). The routines provide hooks to facilitate
+reading files in which the <CODE>bzip2</CODE> data stream is embedded
+within some larger-scale file structure, or where there are
+multiple <CODE>bzip2</CODE> data streams concatenated end-to-end.
+
+</P>
+<P>
+For reading files, <CODE>BZ2_bzReadOpen</CODE>, <CODE>BZ2_bzRead</CODE>,
+<CODE>BZ2_bzReadClose</CODE> and <BR> <CODE>BZ2_bzReadGetUnused</CODE> are supplied. For
+writing files, <CODE>BZ2_bzWriteOpen</CODE>, <CODE>BZ2_bzWrite</CODE> and
+<CODE>BZ2_bzWriteFinish</CODE> are available.
+
+</P>
+<P>
+As with the low-level library, no global variables are used
+so the library is per se thread-safe. However, if I/O errors
+occur whilst reading or writing the underlying compressed files,
+you may have to consult <CODE>errno</CODE> to determine the cause of
+the error. In that case, you'd need a C library which correctly
+supports <CODE>errno</CODE> in a multithreaded environment.
+
+</P>
+<P>
+To make the library a little simpler and more portable,
+<CODE>BZ2_bzReadOpen</CODE> and <CODE>BZ2_bzWriteOpen</CODE> require you to pass them file
+handles (<CODE>FILE*</CODE>s) which have previously been opened for reading or
+writing respectively. That avoids portability problems associated with
+file operations and file attributes, whilst not being much of an
+imposition on the programmer.
+
+</P>
+
+
+
+<H3><A NAME="SEC16" HREF="manual_toc.html#TOC16">Utility functions summary</A></H3>
+<P>
+For very simple needs, <CODE>BZ2_bzBuffToBuffCompress</CODE> and
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> are provided. These compress
+data in memory from one buffer to another buffer in a single
+function call. You should assess whether these functions
+fulfill your memory-to-memory compression/decompression
+requirements before investing effort in understanding the more
+general but more complex low-level interface.
+
+</P>
+<P>
+Yoshioka Tsuneo (<CODE>QWF00133@niftyserve.or.jp</CODE> /
+<CODE>tsuneo-y@is.aist-nara.ac.jp</CODE>) has contributed some functions to
+give better <CODE>zlib</CODE> compatibility. These functions are
+<CODE>BZ2_bzopen</CODE>, <CODE>BZ2_bzread</CODE>, <CODE>BZ2_bzwrite</CODE>, <CODE>BZ2_bzflush</CODE>,
+<CODE>BZ2_bzclose</CODE>,
+<CODE>BZ2_bzerror</CODE> and <CODE>BZ2_bzlibVersion</CODE>. You may find these functions
+more convenient for simple file reading and writing, than those in the
+high-level interface. These functions are not (yet) officially part of
+the library, and are minimally documented here. If they break, you
+get to keep all the pieces. I hope to document them properly when time
+permits.
+
+</P>
+<P>
+Yoshioka also contributed modifications to allow the library to be
+built as a Windows DLL.
+
+</P>
+
+
+
+<H2><A NAME="SEC17" HREF="manual_toc.html#TOC17">Error handling</A></H2>
+
+<P>
+The library is designed to recover cleanly in all situations, including
+the worst-case situation of decompressing random data. I'm not
+100% sure that it can always do this, so you might want to add
+a signal handler to catch segmentation violations during decompression
+if you are feeling especially paranoid. I would be interested in
+hearing more about the robustness of the library to corrupted
+compressed data.
+
+</P>
+<P>
+Version 1.0 is much more robust in this respect than
+0.9.0 or 0.9.5. Investigations with Checker (a tool for
+detecting problems with memory management, similar to Purify)
+indicate that, at least for the few files I tested, all single-bit
+errors in the decompressed data are caught properly, with no
+segmentation faults, no reads of uninitialised data and no
+out of range reads or writes. So it's certainly much improved,
+although I wouldn't claim it to be totally bombproof.
+
+</P>
+<P>
+The file <CODE>bzlib.h</CODE> contains all definitions needed to use
+the library. In particular, you should definitely not include
+<CODE>bzlib_private.h</CODE>.
+
+</P>
+<P>
+In <CODE>bzlib.h</CODE>, the various return values are defined. The following
+list is not intended as an exhaustive description of the circumstances
+in which a given value may be returned -- those descriptions are given
+later. Rather, it is intended to convey the rough meaning of each
+return value. The first five actions are normal and not intended to
+denote an error situation.
+<DL COMPACT>
+
+<DT><CODE>BZ_OK</CODE>
+<DD>
+The requested action was completed successfully.
+<DT><CODE>BZ_RUN_OK</CODE>
+<DD>
+<DT><CODE>BZ_FLUSH_OK</CODE>
+<DD>
+<DT><CODE>BZ_FINISH_OK</CODE>
+<DD>
+In <CODE>BZ2_bzCompress</CODE>, the requested flush/finish/nothing-special action
+was completed successfully.
+<DT><CODE>BZ_STREAM_END</CODE>
+<DD>
+Compression of data was completed, or the logical stream end was
+detected during decompression.
+</DL>
+
+<P>
+The following return values indicate an error of some kind.
+<DL COMPACT>
+
+<DT><CODE>BZ_CONFIG_ERROR</CODE>
+<DD>
+Indicates that the library has been improperly compiled on your
+platform -- a major configuration error. Specifically, it means
+that <CODE>sizeof(char)</CODE>, <CODE>sizeof(short)</CODE> and <CODE>sizeof(int)</CODE>
+are not 1, 2 and 4 respectively, as they should be. Note that the
+library should still work properly on 64-bit platforms which follow
+the LP64 programming model -- that is, where <CODE>sizeof(long)</CODE>
+and <CODE>sizeof(void*)</CODE> are 8. Under LP64, <CODE>sizeof(int)</CODE> is
+still 4, so <CODE>libbzip2</CODE>, which doesn't use the <CODE>long</CODE> type,
+is OK.
+<DT><CODE>BZ_SEQUENCE_ERROR</CODE>
+<DD>
+When using the library, it is important to call the functions in the
+correct sequence and with data structures (buffers etc) in the correct
+states. <CODE>libbzip2</CODE> checks as much as it can to ensure this is
+happening, and returns <CODE>BZ_SEQUENCE_ERROR</CODE> if not. Code which
+complies precisely with the function semantics, as detailed below,
+should never receive this value; such an event denotes buggy code
+which you should investigate.
+<DT><CODE>BZ_PARAM_ERROR</CODE>
+<DD>
+Returned when a parameter to a function call is out of range
+or otherwise manifestly incorrect. As with <CODE>BZ_SEQUENCE_ERROR</CODE>,
+this denotes a bug in the client code. The distinction between
+<CODE>BZ_PARAM_ERROR</CODE> and <CODE>BZ_SEQUENCE_ERROR</CODE> is a bit hazy, but still worth
+making.
+<DT><CODE>BZ_MEM_ERROR</CODE>
+<DD>
+Returned when a request to allocate memory failed. Note that the
+quantity of memory needed to decompress a stream cannot be determined
+until the stream's header has been read. So <CODE>BZ2_bzDecompress</CODE> and
+<CODE>BZ2_bzRead</CODE> may return <CODE>BZ_MEM_ERROR</CODE> even though some of
+the compressed data has been read. The same is not true for
+compression; once <CODE>BZ2_bzCompressInit</CODE> or <CODE>BZ2_bzWriteOpen</CODE> have
+successfully completed, <CODE>BZ_MEM_ERROR</CODE> cannot occur.
+<DT><CODE>BZ_DATA_ERROR</CODE>
+<DD>
+Returned when a data integrity error is detected during decompression.
+Most importantly, this means when stored and computed CRCs for the
+data do not match. This value is also returned upon detection of any
+other anomaly in the compressed data.
+<DT><CODE>BZ_DATA_ERROR_MAGIC</CODE>
+<DD>
+As a special case of <CODE>BZ_DATA_ERROR</CODE>, it is sometimes useful to
+know when the compressed stream does not start with the correct
+magic bytes (<CODE>'B' 'Z' 'h'</CODE>).
+<DT><CODE>BZ_IO_ERROR</CODE>
+<DD>
+Returned by <CODE>BZ2_bzRead</CODE> and <CODE>BZ2_bzWrite</CODE> when there is an error
+reading or writing in the compressed file, and by <CODE>BZ2_bzReadOpen</CODE>
+and <CODE>BZ2_bzWriteOpen</CODE> for attempts to use a file for which the
+error indicator (viz, <CODE>ferror(f)</CODE>) is set.
+On receipt of <CODE>BZ_IO_ERROR</CODE>, the caller should consult
+<CODE>errno</CODE> and/or <CODE>perror</CODE> to acquire operating-system
+specific information about the problem.
+<DT><CODE>BZ_UNEXPECTED_EOF</CODE>
+<DD>
+Returned by <CODE>BZ2_bzRead</CODE> when the compressed file finishes
+before the logical end of stream is detected.
+<DT><CODE>BZ_OUTBUFF_FULL</CODE>
+<DD>
+Returned by <CODE>BZ2_bzBuffToBuffCompress</CODE> and
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> to indicate that the output data
+will not fit into the output buffer provided.
+</DL>
+
+
+
+<H2><A NAME="SEC18" HREF="manual_toc.html#TOC18">Low-level interface</A></H2>
+
+
+
+<H3><A NAME="SEC19" HREF="manual_toc.html#TOC19"><CODE>BZ2_bzCompressInit</CODE></A></H3>
+
+<PRE>
+typedef
+ struct {
+ char *next_in;
+ unsigned int avail_in;
+ unsigned int total_in_lo32;
+ unsigned int total_in_hi32;
+
+ char *next_out;
+ unsigned int avail_out;
+ unsigned int total_out_lo32;
+ unsigned int total_out_hi32;
+
+ void *state;
+
+ void *(*bzalloc)(void *,int,int);
+ void (*bzfree)(void *,void *);
+ void *opaque;
+ }
+ bz_stream;
+
+int BZ2_bzCompressInit ( bz_stream *strm,
+ int blockSize100k,
+ int verbosity,
+ int workFactor );
+
+</PRE>
+
+<P>
+Prepares for compression. The <CODE>bz_stream</CODE> structure
+holds all data pertaining to the compression activity.
+A <CODE>bz_stream</CODE> structure should be allocated and initialised
+prior to the call.
+The fields of <CODE>bz_stream</CODE>
+comprise the entirety of the user-visible data. <CODE>state</CODE>
+is a pointer to the private data structures required for compression.
+
+</P>
+<P>
+Custom memory allocators are supported, via fields <CODE>bzalloc</CODE>,
+<CODE>bzfree</CODE>,
+and <CODE>opaque</CODE>. The value
+<CODE>opaque</CODE> is passed to as the first argument to
+all calls to <CODE>bzalloc</CODE> and <CODE>bzfree</CODE>, but is
+otherwise ignored by the library.
+The call <CODE>bzalloc ( opaque, n, m )</CODE> is expected to return a
+pointer <CODE>p</CODE> to
+<CODE>n * m</CODE> bytes of memory, and <CODE>bzfree ( opaque, p )</CODE>
+should free
+that memory.
+
+</P>
+<P>
+If you don't want to use a custom memory allocator, set <CODE>bzalloc</CODE>,
+<CODE>bzfree</CODE> and
+<CODE>opaque</CODE> to <CODE>NULL</CODE>,
+and the library will then use the standard <CODE>malloc</CODE>/<CODE>free</CODE>
+routines.
+
+</P>
+<P>
+Before calling <CODE>BZ2_bzCompressInit</CODE>, fields <CODE>bzalloc</CODE>,
+<CODE>bzfree</CODE> and <CODE>opaque</CODE> should
+be filled appropriately, as just described. Upon return, the internal
+state will have been allocated and initialised, and <CODE>total_in_lo32</CODE>,
+<CODE>total_in_hi32</CODE>, <CODE>total_out_lo32</CODE> and
+<CODE>total_out_hi32</CODE> will have been set to zero.
+These four fields are used by the library
+to inform the caller of the total amount of data passed into and out of
+the library, respectively. You should not try to change them.
+As of version 1.0, 64-bit counts are maintained, even on 32-bit
+platforms, using the <CODE>_hi32</CODE> fields to store the upper 32 bits
+of the count. So, for example, the total amount of data in
+is <CODE>(total_in_hi32 << 32) + total_in_lo32</CODE>.
+
+</P>
+<P>
+Parameter <CODE>blockSize100k</CODE> specifies the block size to be used for
+compression. It should be a value between 1 and 9 inclusive, and the
+actual block size used is 100000 x this figure. 9 gives the best
+compression but takes most memory.
+
+</P>
+<P>
+Parameter <CODE>verbosity</CODE> should be set to a number between 0 and 4
+inclusive. 0 is silent, and greater numbers give increasingly verbose
+monitoring/debugging output. If the library has been compiled with
+<CODE>-DBZ_NO_STDIO</CODE>, no such output will appear for any verbosity
+setting.
+
+</P>
+<P>
+Parameter <CODE>workFactor</CODE> controls how the compression phase behaves
+when presented with worst case, highly repetitive, input data. If
+compression runs into difficulties caused by repetitive data, the
+library switches from the standard sorting algorithm to a fallback
+algorithm. The fallback is slower than the standard algorithm by
+perhaps a factor of three, but always behaves reasonably, no matter how
+bad the input.
+
+</P>
+<P>
+Lower values of <CODE>workFactor</CODE> reduce the amount of effort the
+standard algorithm will expend before resorting to the fallback. You
+should set this parameter carefully; too low, and many inputs will be
+handled by the fallback algorithm and so compress rather slowly, too
+high, and your average-to-worst case compression times can become very
+large. The default value of 30 gives reasonable behaviour over a wide
+range of circumstances.
+
+</P>
+<P>
+Allowable values range from 0 to 250 inclusive. 0 is a special case,
+equivalent to using the default value of 30.
+
+</P>
+<P>
+Note that the compressed output generated is the same regardless of
+whether or not the fallback algorithm is used.
+
+</P>
+<P>
+Be aware also that this parameter may disappear entirely in future
+versions of the library. In principle it should be possible to devise a
+good way to automatically choose which algorithm to use. Such a
+mechanism would render the parameter obsolete.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_CONFIG_ERROR</CODE>
+ if the library has been mis-compiled
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>strm</CODE> is <CODE>NULL</CODE>
+ or <CODE>blockSize</CODE> < 1 or <CODE>blockSize</CODE> > 9
+ or <CODE>verbosity</CODE> < 0 or <CODE>verbosity</CODE> > 4
+ or <CODE>workFactor</CODE> < 0 or <CODE>workFactor</CODE> > 250
+ <CODE>BZ_MEM_ERROR</CODE>
+ if not enough memory is available
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ <CODE>BZ2_bzCompress</CODE>
+ if <CODE>BZ_OK</CODE> is returned
+ no specific action needed in case of error
+</PRE>
+
+
+
+<H3><A NAME="SEC20" HREF="manual_toc.html#TOC20"><CODE>BZ2_bzCompress</CODE></A></H3>
+
+<PRE>
+ int BZ2_bzCompress ( bz_stream *strm, int action );
+</PRE>
+
+<P>
+Provides more input and/or output buffer space for the library. The
+caller maintains input and output buffers, and calls <CODE>BZ2_bzCompress</CODE> to
+transfer data between them.
+
+</P>
+<P>
+Before each call to <CODE>BZ2_bzCompress</CODE>, <CODE>next_in</CODE> should point at
+the data to be compressed, and <CODE>avail_in</CODE> should indicate how many
+bytes the library may read. <CODE>BZ2_bzCompress</CODE> updates <CODE>next_in</CODE>,
+<CODE>avail_in</CODE> and <CODE>total_in</CODE> to reflect the number of bytes it
+has read.
+
+</P>
+<P>
+Similarly, <CODE>next_out</CODE> should point to a buffer in which the
+compressed data is to be placed, with <CODE>avail_out</CODE> indicating how
+much output space is available. <CODE>BZ2_bzCompress</CODE> updates
+<CODE>next_out</CODE>, <CODE>avail_out</CODE> and <CODE>total_out</CODE> to reflect the
+number of bytes output.
+
+</P>
+<P>
+You may provide and remove as little or as much data as you like on each
+call of <CODE>BZ2_bzCompress</CODE>. In the limit, it is acceptable to supply and
+remove data one byte at a time, although this would be terribly
+inefficient. You should always ensure that at least one byte of output
+space is available at each call.
+
+</P>
+<P>
+A second purpose of <CODE>BZ2_bzCompress</CODE> is to request a change of mode of the
+compressed stream.
+
+</P>
+<P>
+Conceptually, a compressed stream can be in one of four states: IDLE,
+RUNNING, FLUSHING and FINISHING. Before initialisation
+(<CODE>BZ2_bzCompressInit</CODE>) and after termination (<CODE>BZ2_bzCompressEnd</CODE>), a
+stream is regarded as IDLE.
+
+</P>
+<P>
+Upon initialisation (<CODE>BZ2_bzCompressInit</CODE>), the stream is placed in the
+RUNNING state. Subsequent calls to <CODE>BZ2_bzCompress</CODE> should pass
+<CODE>BZ_RUN</CODE> as the requested action; other actions are illegal and
+will result in <CODE>BZ_SEQUENCE_ERROR</CODE>.
+
+</P>
+<P>
+At some point, the calling program will have provided all the input data
+it wants to. It will then want to finish up -- in effect, asking the
+library to process any data it might have buffered internally. In this
+state, <CODE>BZ2_bzCompress</CODE> will no longer attempt to read data from
+<CODE>next_in</CODE>, but it will want to write data to <CODE>next_out</CODE>.
+Because the output buffer supplied by the user can be arbitrarily small,
+the finishing-up operation cannot necessarily be done with a single call
+of <CODE>BZ2_bzCompress</CODE>.
+
+</P>
+<P>
+Instead, the calling program passes <CODE>BZ_FINISH</CODE> as an action to
+<CODE>BZ2_bzCompress</CODE>. This changes the stream's state to FINISHING. Any
+remaining input (ie, <CODE>next_in[0 .. avail_in-1]</CODE>) is compressed and
+transferred to the output buffer. To do this, <CODE>BZ2_bzCompress</CODE> must be
+called repeatedly until all the output has been consumed. At that
+point, <CODE>BZ2_bzCompress</CODE> returns <CODE>BZ_STREAM_END</CODE>, and the stream's
+state is set back to IDLE. <CODE>BZ2_bzCompressEnd</CODE> should then be
+called.
+
+</P>
+<P>
+Just to make sure the calling program does not cheat, the library makes
+a note of <CODE>avail_in</CODE> at the time of the first call to
+<CODE>BZ2_bzCompress</CODE> which has <CODE>BZ_FINISH</CODE> as an action (ie, at the
+time the program has announced its intention to not supply any more
+input). By comparing this value with that of <CODE>avail_in</CODE> over
+subsequent calls to <CODE>BZ2_bzCompress</CODE>, the library can detect any
+attempts to slip in more data to compress. Any calls for which this is
+detected will return <CODE>BZ_SEQUENCE_ERROR</CODE>. This indicates a
+programming mistake which should be corrected.
+
+</P>
+<P>
+Instead of asking to finish, the calling program may ask
+<CODE>BZ2_bzCompress</CODE> to take all the remaining input, compress it and
+terminate the current (Burrows-Wheeler) compression block. This could
+be useful for error control purposes. The mechanism is analogous to
+that for finishing: call <CODE>BZ2_bzCompress</CODE> with an action of
+<CODE>BZ_FLUSH</CODE>, remove output data, and persist with the
+<CODE>BZ_FLUSH</CODE> action until the value <CODE>BZ_RUN</CODE> is returned. As
+with finishing, <CODE>BZ2_bzCompress</CODE> detects any attempt to provide more
+input data once the flush has begun.
+
+</P>
+<P>
+Once the flush is complete, the stream returns to the normal RUNNING
+state.
+
+</P>
+<P>
+This all sounds pretty complex, but isn't really. Here's a table
+which shows which actions are allowable in each state, what action
+will be taken, what the next state is, and what the non-error return
+values are. Note that you can't explicitly ask what state the
+stream is in, but nor do you need to -- it can be inferred from the
+values returned by <CODE>BZ2_bzCompress</CODE>.
+
+<PRE>
+IDLE/<CODE>any</CODE>
+ Illegal. IDLE state only exists after <CODE>BZ2_bzCompressEnd</CODE> or
+ before <CODE>BZ2_bzCompressInit</CODE>.
+ Return value = <CODE>BZ_SEQUENCE_ERROR</CODE>
+
+RUNNING/<CODE>BZ_RUN</CODE>
+ Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible.
+ Next state = RUNNING
+ Return value = <CODE>BZ_RUN_OK</CODE>
+
+RUNNING/<CODE>BZ_FLUSH</CODE>
+ Remember current value of <CODE>next_in</CODE>. Compress from <CODE>next_in</CODE>
+ to <CODE>next_out</CODE> as much as possible, but do not accept any more input.
+ Next state = FLUSHING
+ Return value = <CODE>BZ_FLUSH_OK</CODE>
+
+RUNNING/<CODE>BZ_FINISH</CODE>
+ Remember current value of <CODE>next_in</CODE>. Compress from <CODE>next_in</CODE>
+ to <CODE>next_out</CODE> as much as possible, but do not accept any more input.
+ Next state = FINISHING
+ Return value = <CODE>BZ_FINISH_OK</CODE>
+
+FLUSHING/<CODE>BZ_FLUSH</CODE>
+ Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible,
+ but do not accept any more input.
+ If all the existing input has been used up and all compressed
+ output has been removed
+ Next state = RUNNING; Return value = <CODE>BZ_RUN_OK</CODE>
+ else
+ Next state = FLUSHING; Return value = <CODE>BZ_FLUSH_OK</CODE>
+
+FLUSHING/other
+ Illegal.
+ Return value = <CODE>BZ_SEQUENCE_ERROR</CODE>
+
+FINISHING/<CODE>BZ_FINISH</CODE>
+ Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible,
+ but to not accept any more input.
+ If all the existing input has been used up and all compressed
+ output has been removed
+ Next state = IDLE; Return value = <CODE>BZ_STREAM_END</CODE>
+ else
+ Next state = FINISHING; Return value = <CODE>BZ_FINISHING</CODE>
+
+FINISHING/other
+ Illegal.
+ Return value = <CODE>BZ_SEQUENCE_ERROR</CODE>
+</PRE>
+
+<P>
+That still looks complicated? Well, fair enough. The usual sequence
+of calls for compressing a load of data is:
+
+<UL>
+<LI>Get started with <CODE>BZ2_bzCompressInit</CODE>.
+
+<LI>Shovel data in and shlurp out its compressed form using zero or more
+
+calls of <CODE>BZ2_bzCompress</CODE> with action = <CODE>BZ_RUN</CODE>.
+<LI>Finish up.
+
+Repeatedly call <CODE>BZ2_bzCompress</CODE> with action = <CODE>BZ_FINISH</CODE>,
+copying out the compressed output, until <CODE>BZ_STREAM_END</CODE> is returned.
+<LI>Close up and go home. Call <CODE>BZ2_bzCompressEnd</CODE>.
+
+</UL>
+
+<P>
+If the data you want to compress fits into your input buffer all
+at once, you can skip the calls of <CODE>BZ2_bzCompress ( ..., BZ_RUN )</CODE> and
+just do the <CODE>BZ2_bzCompress ( ..., BZ_FINISH )</CODE> calls.
+
+</P>
+<P>
+All required memory is allocated by <CODE>BZ2_bzCompressInit</CODE>. The
+compression library can accept any data at all (obviously). So you
+shouldn't get any error return values from the <CODE>BZ2_bzCompress</CODE> calls.
+If you do, they will be <CODE>BZ_SEQUENCE_ERROR</CODE>, and indicate a bug in
+your programming.
+
+</P>
+<P>
+Trivial other possible return values:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>strm</CODE> is <CODE>NULL</CODE>, or <CODE>strm->s</CODE> is <CODE>NULL</CODE>
+</PRE>
+
+
+
+<H3><A NAME="SEC21" HREF="manual_toc.html#TOC21"><CODE>BZ2_bzCompressEnd</CODE></A></H3>
+
+<PRE>
+int BZ2_bzCompressEnd ( bz_stream *strm );
+</PRE>
+
+<P>
+Releases all memory associated with a compression stream.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE> if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm->s</CODE> is <CODE>NULL</CODE>
+ <CODE>BZ_OK</CODE> otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC22" HREF="manual_toc.html#TOC22"><CODE>BZ2_bzDecompressInit</CODE></A></H3>
+
+<PRE>
+int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small );
+</PRE>
+
+<P>
+Prepares for decompression. As with <CODE>BZ2_bzCompressInit</CODE>, a
+<CODE>bz_stream</CODE> record should be allocated and initialised before the
+call. Fields <CODE>bzalloc</CODE>, <CODE>bzfree</CODE> and <CODE>opaque</CODE> should be
+set if a custom memory allocator is required, or made <CODE>NULL</CODE> for
+the normal <CODE>malloc</CODE>/<CODE>free</CODE> routines. Upon return, the internal
+state will have been initialised, and <CODE>total_in</CODE> and
+<CODE>total_out</CODE> will be zero.
+
+</P>
+<P>
+For the meaning of parameter <CODE>verbosity</CODE>, see <CODE>BZ2_bzCompressInit</CODE>.
+
+</P>
+<P>
+If <CODE>small</CODE> is nonzero, the library will use an alternative
+decompression algorithm which uses less memory but at the cost of
+decompressing more slowly (roughly speaking, half the speed, but the
+maximum memory requirement drops to around 2300k). See Chapter 2 for
+more information on memory management.
+
+</P>
+<P>
+Note that the amount of memory needed to decompress
+a stream cannot be determined until the stream's header has been read,
+so even if <CODE>BZ2_bzDecompressInit</CODE> succeeds, a subsequent
+<CODE>BZ2_bzDecompress</CODE> could fail with <CODE>BZ_MEM_ERROR</CODE>.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_CONFIG_ERROR</CODE>
+ if the library has been mis-compiled
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>(small != 0 && small != 1)</CODE>
+ or <CODE>(verbosity < 0 || verbosity > 4)</CODE>
+ <CODE>BZ_MEM_ERROR</CODE>
+ if insufficient memory is available
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ <CODE>BZ2_bzDecompress</CODE>
+ if <CODE>BZ_OK</CODE> was returned
+ no specific action required in case of error
+</PRE>
+
+<P>
+
+
+</P>
+
+
+<H3><A NAME="SEC23" HREF="manual_toc.html#TOC23"><CODE>BZ2_bzDecompress</CODE></A></H3>
+
+<PRE>
+int BZ2_bzDecompress ( bz_stream *strm );
+</PRE>
+
+<P>
+Provides more input and/out output buffer space for the library. The
+caller maintains input and output buffers, and uses <CODE>BZ2_bzDecompress</CODE>
+to transfer data between them.
+
+</P>
+<P>
+Before each call to <CODE>BZ2_bzDecompress</CODE>, <CODE>next_in</CODE>
+should point at the compressed data,
+and <CODE>avail_in</CODE> should indicate how many bytes the library
+may read. <CODE>BZ2_bzDecompress</CODE> updates <CODE>next_in</CODE>, <CODE>avail_in</CODE>
+and <CODE>total_in</CODE>
+to reflect the number of bytes it has read.
+
+</P>
+<P>
+Similarly, <CODE>next_out</CODE> should point to a buffer in which the uncompressed
+output is to be placed, with <CODE>avail_out</CODE> indicating how much output space
+is available. <CODE>BZ2_bzCompress</CODE> updates <CODE>next_out</CODE>,
+<CODE>avail_out</CODE> and <CODE>total_out</CODE> to reflect
+the number of bytes output.
+
+</P>
+<P>
+You may provide and remove as little or as much data as you like on
+each call of <CODE>BZ2_bzDecompress</CODE>.
+In the limit, it is acceptable to
+supply and remove data one byte at a time, although this would be
+terribly inefficient. You should always ensure that at least one
+byte of output space is available at each call.
+
+</P>
+<P>
+Use of <CODE>BZ2_bzDecompress</CODE> is simpler than <CODE>BZ2_bzCompress</CODE>.
+
+</P>
+<P>
+You should provide input and remove output as described above, and
+repeatedly call <CODE>BZ2_bzDecompress</CODE> until <CODE>BZ_STREAM_END</CODE> is
+returned. Appearance of <CODE>BZ_STREAM_END</CODE> denotes that
+<CODE>BZ2_bzDecompress</CODE> has detected the logical end of the compressed
+stream. <CODE>BZ2_bzDecompress</CODE> will not produce <CODE>BZ_STREAM_END</CODE> until
+all output data has been placed into the output buffer, so once
+<CODE>BZ_STREAM_END</CODE> appears, you are guaranteed to have available all
+the decompressed output, and <CODE>BZ2_bzDecompressEnd</CODE> can safely be
+called.
+
+</P>
+<P>
+If case of an error return value, you should call <CODE>BZ2_bzDecompressEnd</CODE>
+to clean up and release memory.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm->s</CODE> is <CODE>NULL</CODE>
+ or <CODE>strm->avail_out < 1</CODE>
+ <CODE>BZ_DATA_ERROR</CODE>
+ if a data integrity error is detected in the compressed stream
+ <CODE>BZ_DATA_ERROR_MAGIC</CODE>
+ if the compressed stream doesn't begin with the right magic bytes
+ <CODE>BZ_MEM_ERROR</CODE>
+ if there wasn't enough memory available
+ <CODE>BZ_STREAM_END</CODE>
+ if the logical end of the data stream was detected and all
+ output in has been consumed, eg <CODE>s->avail_out > 0</CODE>
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ <CODE>BZ2_bzDecompress</CODE>
+ if <CODE>BZ_OK</CODE> was returned
+ <CODE>BZ2_bzDecompressEnd</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC24" HREF="manual_toc.html#TOC24"><CODE>BZ2_bzDecompressEnd</CODE></A></H3>
+
+<PRE>
+int BZ2_bzDecompressEnd ( bz_stream *strm );
+</PRE>
+
+<P>
+Releases all memory associated with a decompression stream.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm->s</CODE> is <CODE>NULL</CODE>
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ None.
+</PRE>
+
+
+
+<H2><A NAME="SEC25" HREF="manual_toc.html#TOC25">High-level interface</A></H2>
+
+<P>
+This interface provides functions for reading and writing
+<CODE>bzip2</CODE> format files. First, some general points.
+
+</P>
+
+<UL>
+<LI>All of the functions take an <CODE>int*</CODE> first argument,
+
+ <CODE>bzerror</CODE>.
+ After each call, <CODE>bzerror</CODE> should be consulted first to determine
+ the outcome of the call. If <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>,
+ the call completed
+ successfully, and only then should the return value of the function
+ (if any) be consulted. If <CODE>bzerror</CODE> is <CODE>BZ_IO_ERROR</CODE>,
+ there was an error
+ reading/writing the underlying compressed file, and you should
+ then consult <CODE>errno</CODE>/<CODE>perror</CODE> to determine the
+ cause of the difficulty.
+ <CODE>bzerror</CODE> may also be set to various other values; precise details are
+ given on a per-function basis below.
+<LI>If <CODE>bzerror</CODE> indicates an error
+
+ (ie, anything except <CODE>BZ_OK</CODE> and <CODE>BZ_STREAM_END</CODE>),
+ you should immediately call <CODE>BZ2_bzReadClose</CODE> (or <CODE>BZ2_bzWriteClose</CODE>,
+ depending on whether you are attempting to read or to write)
+ to free up all resources associated
+ with the stream. Once an error has been indicated, behaviour of all calls
+ except <CODE>BZ2_bzReadClose</CODE> (<CODE>BZ2_bzWriteClose</CODE>) is undefined.
+ The implication is that (1) <CODE>bzerror</CODE> should
+ be checked after each call, and (2) if <CODE>bzerror</CODE> indicates an error,
+ <CODE>BZ2_bzReadClose</CODE> (<CODE>BZ2_bzWriteClose</CODE>) should then be called to clean up.
+<LI>The <CODE>FILE*</CODE> arguments passed to
+
+ <CODE>BZ2_bzReadOpen</CODE>/<CODE>BZ2_bzWriteOpen</CODE>
+ should be set to binary mode.
+ Most Unix systems will do this by default, but other platforms,
+ including Windows and Mac, will not. If you omit this, you may
+ encounter problems when moving code to new platforms.
+<LI>Memory allocation requests are handled by
+
+ <CODE>malloc</CODE>/<CODE>free</CODE>.
+ At present
+ there is no facility for user-defined memory allocators in the file I/O
+ functions (could easily be added, though).
+</UL>
+
+
+
+<H3><A NAME="SEC26" HREF="manual_toc.html#TOC26"><CODE>BZ2_bzReadOpen</CODE></A></H3>
+
+<PRE>
+ typedef void BZFILE;
+
+ BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f,
+ int small, int verbosity,
+ void *unused, int nUnused );
+</PRE>
+
+<P>
+Prepare to read compressed data from file handle <CODE>f</CODE>. <CODE>f</CODE>
+should refer to a file which has been opened for reading, and for which
+the error indicator (<CODE>ferror(f)</CODE>)is not set. If <CODE>small</CODE> is 1,
+the library will try to decompress using less memory, at the expense of
+speed.
+
+</P>
+<P>
+For reasons explained below, <CODE>BZ2_bzRead</CODE> will decompress the
+<CODE>nUnused</CODE> bytes starting at <CODE>unused</CODE>, before starting to read
+from the file <CODE>f</CODE>. At most <CODE>BZ_MAX_UNUSED</CODE> bytes may be
+supplied like this. If this facility is not required, you should pass
+<CODE>NULL</CODE> and <CODE>0</CODE> for <CODE>unused</CODE> and n<CODE>Unused</CODE>
+respectively.
+
+</P>
+<P>
+For the meaning of parameters <CODE>small</CODE> and <CODE>verbosity</CODE>,
+see <CODE>BZ2_bzDecompressInit</CODE>.
+
+</P>
+<P>
+The amount of memory needed to decompress a file cannot be determined
+until the file's header has been read. So it is possible that
+<CODE>BZ2_bzReadOpen</CODE> returns <CODE>BZ_OK</CODE> but a subsequent call of
+<CODE>BZ2_bzRead</CODE> will return <CODE>BZ_MEM_ERROR</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_CONFIG_ERROR</CODE>
+ if the library has been mis-compiled
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>f</CODE> is <CODE>NULL</CODE>
+ or <CODE>small</CODE> is neither <CODE>0</CODE> nor <CODE>1</CODE>
+ or <CODE>(unused == NULL && nUnused != 0)</CODE>
+ or <CODE>(unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))</CODE>
+ <CODE>BZ_IO_ERROR</CODE>
+ if <CODE>ferror(f)</CODE> is nonzero
+ <CODE>BZ_MEM_ERROR</CODE>
+ if insufficient memory is available
+ <CODE>BZ_OK</CODE>
+ otherwise.
+</PRE>
+
+<P>
+Possible return values:
+
+<PRE>
+ Pointer to an abstract <CODE>BZFILE</CODE>
+ if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>
+ <CODE>NULL</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ <CODE>BZ2_bzRead</CODE>
+ if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>
+ <CODE>BZ2_bzClose</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC27" HREF="manual_toc.html#TOC27"><CODE>BZ2_bzRead</CODE></A></H3>
+
+<PRE>
+ int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len );
+</PRE>
+
+<P>
+Reads up to <CODE>len</CODE> (uncompressed) bytes from the compressed file
+<CODE>b</CODE> into
+the buffer <CODE>buf</CODE>. If the read was successful,
+<CODE>bzerror</CODE> is set to <CODE>BZ_OK</CODE>
+and the number of bytes read is returned. If the logical end-of-stream
+was detected, <CODE>bzerror</CODE> will be set to <CODE>BZ_STREAM_END</CODE>,
+and the number
+of bytes read is returned. All other <CODE>bzerror</CODE> values denote an error.
+
+</P>
+<P>
+<CODE>BZ2_bzRead</CODE> will supply <CODE>len</CODE> bytes,
+unless the logical stream end is detected
+or an error occurs. Because of this, it is possible to detect the
+stream end by observing when the number of bytes returned is
+less than the number
+requested. Nevertheless, this is regarded as inadvisable; you should
+instead check <CODE>bzerror</CODE> after every call and watch out for
+<CODE>BZ_STREAM_END</CODE>.
+
+</P>
+<P>
+Internally, <CODE>BZ2_bzRead</CODE> copies data from the compressed file in chunks
+of size <CODE>BZ_MAX_UNUSED</CODE> bytes
+before decompressing it. If the file contains more bytes than strictly
+needed to reach the logical end-of-stream, <CODE>BZ2_bzRead</CODE> will almost certainly
+read some of the trailing data before signalling <CODE>BZ_SEQUENCE_END</CODE>.
+To collect the read but unused data once <CODE>BZ_SEQUENCE_END</CODE> has
+appeared, call <CODE>BZ2_bzReadGetUnused</CODE> immediately before <CODE>BZ2_bzReadClose</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>b</CODE> is <CODE>NULL</CODE> or <CODE>buf</CODE> is <CODE>NULL</CODE> or <CODE>len < 0</CODE>
+ <CODE>BZ_SEQUENCE_ERROR</CODE>
+ if <CODE>b</CODE> was opened with <CODE>BZ2_bzWriteOpen</CODE>
+ <CODE>BZ_IO_ERROR</CODE>
+ if there is an error reading from the compressed file
+ <CODE>BZ_UNEXPECTED_EOF</CODE>
+ if the compressed file ended before the logical end-of-stream was detected
+ <CODE>BZ_DATA_ERROR</CODE>
+ if a data integrity error was detected in the compressed stream
+ <CODE>BZ_DATA_ERROR_MAGIC</CODE>
+ if the stream does not begin with the requisite header bytes (ie, is not
+ a <CODE>bzip2</CODE> data file). This is really a special case of <CODE>BZ_DATA_ERROR</CODE>.
+ <CODE>BZ_MEM_ERROR</CODE>
+ if insufficient memory was available
+ <CODE>BZ_STREAM_END</CODE>
+ if the logical end of stream was detected.
+ <CODE>BZ_OK</CODE>
+ otherwise.
+</PRE>
+
+<P>
+Possible return values:
+
+<PRE>
+ number of bytes read
+ if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> or <CODE>BZ_STREAM_END</CODE>
+ undefined
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ collect data from <CODE>buf</CODE>, then <CODE>BZ2_bzRead</CODE> or <CODE>BZ2_bzReadClose</CODE>
+ if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>
+ collect data from <CODE>buf</CODE>, then <CODE>BZ2_bzReadClose</CODE> or <CODE>BZ2_bzReadGetUnused</CODE>
+ if <CODE>bzerror</CODE> is <CODE>BZ_SEQUENCE_END</CODE>
+ <CODE>BZ2_bzReadClose</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC28" HREF="manual_toc.html#TOC28"><CODE>BZ2_bzReadGetUnused</CODE></A></H3>
+
+<PRE>
+ void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b,
+ void** unused, int* nUnused );
+</PRE>
+
+<P>
+Returns data which was read from the compressed file but was not needed
+to get to the logical end-of-stream. <CODE>*unused</CODE> is set to the address
+of the data, and <CODE>*nUnused</CODE> to the number of bytes. <CODE>*nUnused</CODE> will
+be set to a value between <CODE>0</CODE> and <CODE>BZ_MAX_UNUSED</CODE> inclusive.
+
+</P>
+<P>
+This function may only be called once <CODE>BZ2_bzRead</CODE> has signalled
+<CODE>BZ_STREAM_END</CODE> but before <CODE>BZ2_bzReadClose</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>b</CODE> is <CODE>NULL</CODE>
+ or <CODE>unused</CODE> is <CODE>NULL</CODE> or <CODE>nUnused</CODE> is <CODE>NULL</CODE>
+ <CODE>BZ_SEQUENCE_ERROR</CODE>
+ if <CODE>BZ_STREAM_END</CODE> has not been signalled
+ or if <CODE>b</CODE> was opened with <CODE>BZ2_bzWriteOpen</CODE>
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ <CODE>BZ2_bzReadClose</CODE>
+</PRE>
+
+
+
+<H3><A NAME="SEC29" HREF="manual_toc.html#TOC29"><CODE>BZ2_bzReadClose</CODE></A></H3>
+
+<PRE>
+ void BZ2_bzReadClose ( int *bzerror, BZFILE *b );
+</PRE>
+
+<P>
+Releases all memory pertaining to the compressed file <CODE>b</CODE>.
+<CODE>BZ2_bzReadClose</CODE> does not call <CODE>fclose</CODE> on the underlying file
+handle, so you should do that yourself if appropriate.
+<CODE>BZ2_bzReadClose</CODE> should be called to clean up after all error
+situations.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_SEQUENCE_ERROR</CODE>
+ if <CODE>b</CODE> was opened with <CODE>BZ2_bzOpenWrite</CODE>
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ none
+</PRE>
+
+
+
+<H3><A NAME="SEC30" HREF="manual_toc.html#TOC30"><CODE>BZ2_bzWriteOpen</CODE></A></H3>
+
+<PRE>
+ BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f,
+ int blockSize100k, int verbosity,
+ int workFactor );
+</PRE>
+
+<P>
+Prepare to write compressed data to file handle <CODE>f</CODE>.
+<CODE>f</CODE> should refer to
+a file which has been opened for writing, and for which the error
+indicator (<CODE>ferror(f)</CODE>)is not set.
+
+</P>
+<P>
+For the meaning of parameters <CODE>blockSize100k</CODE>,
+<CODE>verbosity</CODE> and <CODE>workFactor</CODE>, see
+<BR> <CODE>BZ2_bzCompressInit</CODE>.
+
+</P>
+<P>
+All required memory is allocated at this stage, so if the call
+completes successfully, <CODE>BZ_MEM_ERROR</CODE> cannot be signalled by a
+subsequent call to <CODE>BZ2_bzWrite</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_CONFIG_ERROR</CODE>
+ if the library has been mis-compiled
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>f</CODE> is <CODE>NULL</CODE>
+ or <CODE>blockSize100k < 1</CODE> or <CODE>blockSize100k > 9</CODE>
+ <CODE>BZ_IO_ERROR</CODE>
+ if <CODE>ferror(f)</CODE> is nonzero
+ <CODE>BZ_MEM_ERROR</CODE>
+ if insufficient memory is available
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+<P>
+Possible return values:
+
+<PRE>
+ Pointer to an abstract <CODE>BZFILE</CODE>
+ if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>
+ <CODE>NULL</CODE>
+ otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+ <CODE>BZ2_bzWrite</CODE>
+ if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>
+ (you could go directly to <CODE>BZ2_bzWriteClose</CODE>, but this would be pretty pointless)
+ <CODE>BZ2_bzWriteClose</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC31" HREF="manual_toc.html#TOC31"><CODE>BZ2_bzWrite</CODE></A></H3>
+
+<PRE>
+ void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len );
+</PRE>
+
+<P>
+Absorbs <CODE>len</CODE> bytes from the buffer <CODE>buf</CODE>, eventually to be
+compressed and written to the file.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>b</CODE> is <CODE>NULL</CODE> or <CODE>buf</CODE> is <CODE>NULL</CODE> or <CODE>len < 0</CODE>
+ <CODE>BZ_SEQUENCE_ERROR</CODE>
+ if b was opened with <CODE>BZ2_bzReadOpen</CODE>
+ <CODE>BZ_IO_ERROR</CODE>
+ if there is an error writing the compressed file.
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC32" HREF="manual_toc.html#TOC32"><CODE>BZ2_bzWriteClose</CODE></A></H3>
+
+<PRE>
+ void BZ2_bzWriteClose ( int *bzerror, BZFILE* f,
+ int abandon,
+ unsigned int* nbytes_in,
+ unsigned int* nbytes_out );
+
+ void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f,
+ int abandon,
+ unsigned int* nbytes_in_lo32,
+ unsigned int* nbytes_in_hi32,
+ unsigned int* nbytes_out_lo32,
+ unsigned int* nbytes_out_hi32 );
+</PRE>
+
+<P>
+Compresses and flushes to the compressed file all data so far supplied
+by <CODE>BZ2_bzWrite</CODE>. The logical end-of-stream markers are also written, so
+subsequent calls to <CODE>BZ2_bzWrite</CODE> are illegal. All memory associated
+with the compressed file <CODE>b</CODE> is released.
+<CODE>fflush</CODE> is called on the
+compressed file, but it is not <CODE>fclose</CODE>'d.
+
+</P>
+<P>
+If <CODE>BZ2_bzWriteClose</CODE> is called to clean up after an error, the only
+action is to release the memory. The library records the error codes
+issued by previous calls, so this situation will be detected
+automatically. There is no attempt to complete the compression
+operation, nor to <CODE>fflush</CODE> the compressed file. You can force this
+behaviour to happen even in the case of no error, by passing a nonzero
+value to <CODE>abandon</CODE>.
+
+</P>
+<P>
+If <CODE>nbytes_in</CODE> is non-null, <CODE>*nbytes_in</CODE> will be set to be the
+total volume of uncompressed data handled. Similarly, <CODE>nbytes_out</CODE>
+will be set to the total volume of compressed data written. For
+compatibility with older versions of the library, <CODE>BZ2_bzWriteClose</CODE>
+only yields the lower 32 bits of these counts. Use
+<CODE>BZ2_bzWriteClose64</CODE> if you want the full 64 bit counts. These
+two functions are otherwise absolutely identical.
+
+</P>
+
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+ <CODE>BZ_SEQUENCE_ERROR</CODE>
+ if <CODE>b</CODE> was opened with <CODE>BZ2_bzReadOpen</CODE>
+ <CODE>BZ_IO_ERROR</CODE>
+ if there is an error writing the compressed file
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC33" HREF="manual_toc.html#TOC33">Handling embedded compressed data streams</A></H3>
+
+<P>
+The high-level library facilitates use of
+<CODE>bzip2</CODE> data streams which form some part of a surrounding, larger
+data stream.
+
+<UL>
+<LI>For writing, the library takes an open file handle, writes
+
+compressed data to it, <CODE>fflush</CODE>es it but does not <CODE>fclose</CODE> it.
+The calling application can write its own data before and after the
+compressed data stream, using that same file handle.
+<LI>Reading is more complex, and the facilities are not as general
+
+as they could be since generality is hard to reconcile with efficiency.
+<CODE>BZ2_bzRead</CODE> reads from the compressed file in blocks of size
+<CODE>BZ_MAX_UNUSED</CODE> bytes, and in doing so probably will overshoot
+the logical end of compressed stream.
+To recover this data once decompression has
+ended, call <CODE>BZ2_bzReadGetUnused</CODE> after the last call of <CODE>BZ2_bzRead</CODE>
+(the one returning <CODE>BZ_STREAM_END</CODE>) but before calling
+<CODE>BZ2_bzReadClose</CODE>.
+</UL>
+
+<P>
+This mechanism makes it easy to decompress multiple <CODE>bzip2</CODE>
+streams placed end-to-end. As the end of one stream, when <CODE>BZ2_bzRead</CODE>
+returns <CODE>BZ_STREAM_END</CODE>, call <CODE>BZ2_bzReadGetUnused</CODE> to collect the
+unused data (copy it into your own buffer somewhere).
+That data forms the start of the next compressed stream.
+To start uncompressing that next stream, call <CODE>BZ2_bzReadOpen</CODE> again,
+feeding in the unused data via the <CODE>unused</CODE>/<CODE>nUnused</CODE>
+parameters.
+Keep doing this until <CODE>BZ_STREAM_END</CODE> return coincides with the
+physical end of file (<CODE>feof(f)</CODE>). In this situation
+<CODE>BZ2_bzReadGetUnused</CODE>
+will of course return no data.
+
+</P>
+<P>
+This should give some feel for how the high-level interface can be used.
+If you require extra flexibility, you'll have to bite the bullet and get
+to grips with the low-level interface.
+
+</P>
+
+
+<H3><A NAME="SEC34" HREF="manual_toc.html#TOC34">Standard file-reading/writing code</A></H3>
+<P>
+Here's how you'd write data to a compressed file:
+
+<PRE>
+FILE* f;
+BZFILE* b;
+int nBuf;
+char buf[ /* whatever size you like */ ];
+int bzerror;
+int nWritten;
+
+f = fopen ( "myfile.bz2", "w" );
+if (!f) {
+ /* handle error */
+}
+b = BZ2_bzWriteOpen ( &bzerror, f, 9 );
+if (bzerror != BZ_OK) {
+ BZ2_bzWriteClose ( b );
+ /* handle error */
+}
+
+while ( /* condition */ ) {
+ /* get data to write into buf, and set nBuf appropriately */
+ nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf );
+ if (bzerror == BZ_IO_ERROR) {
+ BZ2_bzWriteClose ( &bzerror, b );
+ /* handle error */
+ }
+}
+
+BZ2_bzWriteClose ( &bzerror, b );
+if (bzerror == BZ_IO_ERROR) {
+ /* handle error */
+}
+</PRE>
+
+<P>
+And to read from a compressed file:
+
+<PRE>
+FILE* f;
+BZFILE* b;
+int nBuf;
+char buf[ /* whatever size you like */ ];
+int bzerror;
+int nWritten;
+
+f = fopen ( "myfile.bz2", "r" );
+if (!f) {
+ /* handle error */
+}
+b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 );
+if (bzerror != BZ_OK) {
+ BZ2_bzReadClose ( &bzerror, b );
+ /* handle error */
+}
+
+bzerror = BZ_OK;
+while (bzerror == BZ_OK && /* arbitrary other conditions */) {
+ nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ );
+ if (bzerror == BZ_OK) {
+ /* do something with buf[0 .. nBuf-1] */
+ }
+}
+if (bzerror != BZ_STREAM_END) {
+ BZ2_bzReadClose ( &bzerror, b );
+ /* handle error */
+} else {
+ BZ2_bzReadClose ( &bzerror );
+}
+</PRE>
+
+
+
+<H2><A NAME="SEC35" HREF="manual_toc.html#TOC35">Utility functions</A></H2>
+
+
+<H3><A NAME="SEC36" HREF="manual_toc.html#TOC36"><CODE>BZ2_bzBuffToBuffCompress</CODE></A></H3>
+
+<PRE>
+ int BZ2_bzBuffToBuffCompress( char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int blockSize100k,
+ int verbosity,
+ int workFactor );
+</PRE>
+
+<P>
+Attempts to compress the data in <CODE>source[0 .. sourceLen-1]</CODE>
+into the destination buffer, <CODE>dest[0 .. *destLen-1]</CODE>.
+If the destination buffer is big enough, <CODE>*destLen</CODE> is
+set to the size of the compressed data, and <CODE>BZ_OK</CODE> is
+returned. If the compressed data won't fit, <CODE>*destLen</CODE>
+is unchanged, and <CODE>BZ_OUTBUFF_FULL</CODE> is returned.
+
+</P>
+<P>
+Compression in this manner is a one-shot event, done with a single call
+to this function. The resulting compressed data is a complete
+<CODE>bzip2</CODE> format data stream. There is no mechanism for making
+additional calls to provide extra input data. If you want that kind of
+mechanism, use the low-level interface.
+
+</P>
+<P>
+For the meaning of parameters <CODE>blockSize100k</CODE>, <CODE>verbosity</CODE>
+and <CODE>workFactor</CODE>, <BR> see <CODE>BZ2_bzCompressInit</CODE>.
+
+</P>
+<P>
+To guarantee that the compressed data will fit in its buffer, allocate
+an output buffer of size 1% larger than the uncompressed data, plus
+six hundred extra bytes.
+
+</P>
+<P>
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> will not write data at or
+beyond <CODE>dest[*destLen]</CODE>, even in case of buffer overflow.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_CONFIG_ERROR</CODE>
+ if the library has been mis-compiled
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>dest</CODE> is <CODE>NULL</CODE> or <CODE>destLen</CODE> is <CODE>NULL</CODE>
+ or <CODE>blockSize100k < 1</CODE> or <CODE>blockSize100k > 9</CODE>
+ or <CODE>verbosity < 0</CODE> or <CODE>verbosity > 4</CODE>
+ or <CODE>workFactor < 0</CODE> or <CODE>workFactor > 250</CODE>
+ <CODE>BZ_MEM_ERROR</CODE>
+ if insufficient memory is available
+ <CODE>BZ_OUTBUFF_FULL</CODE>
+ if the size of the compressed data exceeds <CODE>*destLen</CODE>
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC37" HREF="manual_toc.html#TOC37"><CODE>BZ2_bzBuffToBuffDecompress</CODE></A></H3>
+
+<PRE>
+ int BZ2_bzBuffToBuffDecompress ( char* dest,
+ unsigned int* destLen,
+ char* source,
+ unsigned int sourceLen,
+ int small,
+ int verbosity );
+</PRE>
+
+<P>
+Attempts to decompress the data in <CODE>source[0 .. sourceLen-1]</CODE>
+into the destination buffer, <CODE>dest[0 .. *destLen-1]</CODE>.
+If the destination buffer is big enough, <CODE>*destLen</CODE> is
+set to the size of the uncompressed data, and <CODE>BZ_OK</CODE> is
+returned. If the compressed data won't fit, <CODE>*destLen</CODE>
+is unchanged, and <CODE>BZ_OUTBUFF_FULL</CODE> is returned.
+
+</P>
+<P>
+<CODE>source</CODE> is assumed to hold a complete <CODE>bzip2</CODE> format
+data stream. <BR> <CODE>BZ2_bzBuffToBuffDecompress</CODE> tries to decompress
+the entirety of the stream into the output buffer.
+
+</P>
+<P>
+For the meaning of parameters <CODE>small</CODE> and <CODE>verbosity</CODE>,
+see <CODE>BZ2_bzDecompressInit</CODE>.
+
+</P>
+<P>
+Because the compression ratio of the compressed data cannot be known in
+advance, there is no easy way to guarantee that the output buffer will
+be big enough. You may of course make arrangements in your code to
+record the size of the uncompressed data, but such a mechanism is beyond
+the scope of this library.
+
+</P>
+<P>
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> will not write data at or
+beyond <CODE>dest[*destLen]</CODE>, even in case of buffer overflow.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+ <CODE>BZ_CONFIG_ERROR</CODE>
+ if the library has been mis-compiled
+ <CODE>BZ_PARAM_ERROR</CODE>
+ if <CODE>dest</CODE> is <CODE>NULL</CODE> or <CODE>destLen</CODE> is <CODE>NULL</CODE>
+ or <CODE>small != 0 && small != 1</CODE>
+ or <CODE>verbosity < 0</CODE> or <CODE>verbosity > 4</CODE>
+ <CODE>BZ_MEM_ERROR</CODE>
+ if insufficient memory is available
+ <CODE>BZ_OUTBUFF_FULL</CODE>
+ if the size of the compressed data exceeds <CODE>*destLen</CODE>
+ <CODE>BZ_DATA_ERROR</CODE>
+ if a data integrity error was detected in the compressed data
+ <CODE>BZ_DATA_ERROR_MAGIC</CODE>
+ if the compressed data doesn't begin with the right magic bytes
+ <CODE>BZ_UNEXPECTED_EOF</CODE>
+ if the compressed data ends unexpectedly
+ <CODE>BZ_OK</CODE>
+ otherwise
+</PRE>
+
+
+
+<H2><A NAME="SEC38" HREF="manual_toc.html#TOC38"><CODE>zlib</CODE> compatibility functions</A></H2>
+<P>
+Yoshioka Tsuneo has contributed some functions to
+give better <CODE>zlib</CODE> compatibility. These functions are
+<CODE>BZ2_bzopen</CODE>, <CODE>BZ2_bzread</CODE>, <CODE>BZ2_bzwrite</CODE>, <CODE>BZ2_bzflush</CODE>,
+<CODE>BZ2_bzclose</CODE>,
+<CODE>BZ2_bzerror</CODE> and <CODE>BZ2_bzlibVersion</CODE>.
+These functions are not (yet) officially part of
+the library. If they break, you get to keep all the pieces.
+Nevertheless, I think they work ok.
+
+<PRE>
+typedef void BZFILE;
+
+const char * BZ2_bzlibVersion ( void );
+</PRE>
+
+<P>
+Returns a string indicating the library version.
+
+<PRE>
+BZFILE * BZ2_bzopen ( const char *path, const char *mode );
+BZFILE * BZ2_bzdopen ( int fd, const char *mode );
+</PRE>
+
+<P>
+Opens a <CODE>.bz2</CODE> file for reading or writing, using either its name
+or a pre-existing file descriptor.
+Analogous to <CODE>fopen</CODE> and <CODE>fdopen</CODE>.
+
+<PRE>
+int BZ2_bzread ( BZFILE* b, void* buf, int len );
+int BZ2_bzwrite ( BZFILE* b, void* buf, int len );
+</PRE>
+
+<P>
+Reads/writes data from/to a previously opened <CODE>BZFILE</CODE>.
+Analogous to <CODE>fread</CODE> and <CODE>fwrite</CODE>.
+
+<PRE>
+int BZ2_bzflush ( BZFILE* b );
+void BZ2_bzclose ( BZFILE* b );
+</PRE>
+
+<P>
+Flushes/closes a <CODE>BZFILE</CODE>. <CODE>BZ2_bzflush</CODE> doesn't actually do
+anything. Analogous to <CODE>fflush</CODE> and <CODE>fclose</CODE>.
+
+</P>
+
+<PRE>
+const char * BZ2_bzerror ( BZFILE *b, int *errnum )
+</PRE>
+
+<P>
+Returns a string describing the more recent error status of
+<CODE>b</CODE>, and also sets <CODE>*errnum</CODE> to its numerical value.
+
+</P>
+
+
+
+<H2><A NAME="SEC39" HREF="manual_toc.html#TOC39">Using the library in a <CODE>stdio</CODE>-free environment</A></H2>
+
+
+
+<H3><A NAME="SEC40" HREF="manual_toc.html#TOC40">Getting rid of <CODE>stdio</CODE></A></H3>
+
+<P>
+In a deeply embedded application, you might want to use just
+the memory-to-memory functions. You can do this conveniently
+by compiling the library with preprocessor symbol <CODE>BZ_NO_STDIO</CODE>
+defined. Doing this gives you a library containing only the following
+eight functions:
+
+</P>
+<P>
+<CODE>BZ2_bzCompressInit</CODE>, <CODE>BZ2_bzCompress</CODE>, <CODE>BZ2_bzCompressEnd</CODE> <BR>
+<CODE>BZ2_bzDecompressInit</CODE>, <CODE>BZ2_bzDecompress</CODE>, <CODE>BZ2_bzDecompressEnd</CODE> <BR>
+<CODE>BZ2_bzBuffToBuffCompress</CODE>, <CODE>BZ2_bzBuffToBuffDecompress</CODE>
+
+</P>
+<P>
+When compiled like this, all functions will ignore <CODE>verbosity</CODE>
+settings.
+
+</P>
+
+
+<H3><A NAME="SEC41" HREF="manual_toc.html#TOC41">Critical error handling</A></H3>
+<P>
+<CODE>libbzip2</CODE> contains a number of internal assertion checks which
+should, needless to say, never be activated. Nevertheless, if an
+assertion should fail, behaviour depends on whether or not the library
+was compiled with <CODE>BZ_NO_STDIO</CODE> set.
+
+</P>
+<P>
+For a normal compile, an assertion failure yields the message
+
+<PRE>
+ bzip2/libbzip2: internal error number N.
+ This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000.
+ Please report it to me at: jseward@acm.org. If this happened
+ when you were using some program which uses libbzip2 as a
+ component, you should also report this bug to the author(s)
+ of that program. Please make an effort to report this bug;
+ timely and accurate bug reports eventually lead to higher
+ quality software. Thanks. Julian Seward, 21 March 2000.
+</PRE>
+
+<P>
+where <CODE>N</CODE> is some error code number. <CODE>exit(3)</CODE>
+is then called.
+
+</P>
+<P>
+For a <CODE>stdio</CODE>-free library, assertion failures result
+in a call to a function declared as:
+
+<PRE>
+ extern void bz_internal_error ( int errcode );
+</PRE>
+
+<P>
+The relevant code is passed as a parameter. You should supply
+such a function.
+
+</P>
+<P>
+In either case, once an assertion failure has occurred, any
+<CODE>bz_stream</CODE> records involved can be regarded as invalid.
+You should not attempt to resume normal operation with them.
+
+</P>
+<P>
+You may, of course, change critical error handling to suit
+your needs. As I said above, critical errors indicate bugs
+in the library and should not occur. All "normal" error
+situations are indicated via error return codes from functions,
+and can be recovered from.
+
+</P>
+
+
+
+<H2><A NAME="SEC42" HREF="manual_toc.html#TOC42">Making a Windows DLL</A></H2>
+<P>
+Everything related to Windows has been contributed by Yoshioka Tsuneo
+<BR> (<CODE>QWF00133@niftyserve.or.jp</CODE> /
+<CODE>tsuneo-y@is.aist-nara.ac.jp</CODE>), so you should send your queries to
+him (but perhaps Cc: me, <CODE>jseward@acm.org</CODE>).
+
+</P>
+<P>
+My vague understanding of what to do is: using Visual C++ 5.0,
+open the project file <CODE>libbz2.dsp</CODE>, and build. That's all.
+
+</P>
+<P>
+If you can't
+open the project file for some reason, make a new one, naming these files:
+<CODE>blocksort.c</CODE>, <CODE>bzlib.c</CODE>, <CODE>compress.c</CODE>,
+<CODE>crctable.c</CODE>, <CODE>decompress.c</CODE>, <CODE>huffman.c</CODE>, <BR>
+<CODE>randtable.c</CODE> and <CODE>libbz2.def</CODE>. You will also need
+to name the header files <CODE>bzlib.h</CODE> and <CODE>bzlib_private.h</CODE>.
+
+</P>
+<P>
+If you don't use VC++, you may need to define the proprocessor symbol
+<CODE>_WIN32</CODE>.
+
+</P>
+<P>
+Finally, <CODE>dlltest.c</CODE> is a sample program using the DLL. It has a
+project file, <CODE>dlltest.dsp</CODE>.
+
+</P>
+<P>
+If you just want a makefile for Visual C, have a look at
+<CODE>makefile.msc</CODE>.
+
+</P>
+<P>
+Be aware that if you compile <CODE>bzip2</CODE> itself on Win32, you must set
+<CODE>BZ_UNIX</CODE> to 0 and <CODE>BZ_LCCWIN32</CODE> to 1, in the file
+<CODE>bzip2.c</CODE>, before compiling. Otherwise the resulting binary won't
+work correctly.
+
+</P>
+<P>
+I haven't tried any of this stuff myself, but it all looks plausible.
+
+</P>
+
+<P><HR><P>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_2.html">previous</A>, <A HREF="manual_4.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
--- /dev/null
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+ from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Miscellanea</TITLE>
+<link href="manual_3.html" rel=Previous>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_3.html">previous</A>, next, last section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC43" HREF="manual_toc.html#TOC43">Miscellanea</A></H1>
+
+<P>
+These are just some random thoughts of mine. Your mileage may
+vary.
+
+</P>
+
+
+<H2><A NAME="SEC44" HREF="manual_toc.html#TOC44">Limitations of the compressed file format</A></H2>
+<P>
+<CODE>bzip2-1.0</CODE>, <CODE>0.9.5</CODE> and <CODE>0.9.0</CODE>
+use exactly the same file format as the previous
+version, <CODE>bzip2-0.1</CODE>. This decision was made in the interests of
+stability. Creating yet another incompatible compressed file format
+would create further confusion and disruption for users.
+
+</P>
+<P>
+Nevertheless, this is not a painless decision. Development
+work since the release of <CODE>bzip2-0.1</CODE> in August 1997
+has shown complexities in the file format which slow down
+decompression and, in retrospect, are unnecessary. These are:
+
+<UL>
+<LI>The run-length encoder, which is the first of the
+
+ compression transformations, is entirely irrelevant.
+ The original purpose was to protect the sorting algorithm
+ from the very worst case input: a string of repeated
+ symbols. But algorithm steps Q6a and Q6b in the original
+ Burrows-Wheeler technical report (SRC-124) show how
+ repeats can be handled without difficulty in block
+ sorting.
+<LI>The randomisation mechanism doesn't really need to be
+
+ there. Udi Manber and Gene Myers published a suffix
+ array construction algorithm a few years back, which
+ can be employed to sort any block, no matter how
+ repetitive, in O(N log N) time. Subsequent work by
+ Kunihiko Sadakane has produced a derivative O(N (log N)^2)
+ algorithm which usually outperforms the Manber-Myers
+ algorithm.
+
+ I could have changed to Sadakane's algorithm, but I find
+ it to be slower than <CODE>bzip2</CODE>'s existing algorithm for
+ most inputs, and the randomisation mechanism protects
+ adequately against bad cases. I didn't think it was
+ a good tradeoff to make. Partly this is due to the fact
+ that I was not flooded with email complaints about
+ <CODE>bzip2-0.1</CODE>'s performance on repetitive data, so
+ perhaps it isn't a problem for real inputs.
+
+ Probably the best long-term solution,
+ and the one I have incorporated into 0.9.5 and above,
+ is to use the existing sorting
+ algorithm initially, and fall back to a O(N (log N)^2)
+ algorithm if the standard algorithm gets into difficulties.
+<LI>The compressed file format was never designed to be
+
+ handled by a library, and I have had to jump though
+ some hoops to produce an efficient implementation of
+ decompression. It's a bit hairy. Try passing
+ <CODE>decompress.c</CODE> through the C preprocessor
+ and you'll see what I mean. Much of this complexity
+ could have been avoided if the compressed size of
+ each block of data was recorded in the data stream.
+<LI>An Adler-32 checksum, rather than a CRC32 checksum,
+
+ would be faster to compute.
+</UL>
+
+<P>
+It would be fair to say that the <CODE>bzip2</CODE> format was frozen
+before I properly and fully understood the performance
+consequences of doing so.
+
+</P>
+<P>
+Improvements which I was able to incorporate into
+0.9.0, despite using the same file format, are:
+
+<UL>
+<LI>Single array implementation of the inverse BWT. This
+
+ significantly speeds up decompression, presumably
+ because it reduces the number of cache misses.
+<LI>Faster inverse MTF transform for large MTF values. The
+
+ new implementation is based on the notion of sliding blocks
+ of values.
+<LI><CODE>bzip2-0.9.0</CODE> now reads and writes files with <CODE>fread</CODE>
+
+ and <CODE>fwrite</CODE>; version 0.1 used <CODE>putc</CODE> and <CODE>getc</CODE>.
+ Duh! Well, you live and learn.
+
+</UL>
+
+<P>
+Further ahead, it would be nice
+to be able to do random access into files. This will
+require some careful design of compressed file formats.
+
+</P>
+
+
+
+<H2><A NAME="SEC45" HREF="manual_toc.html#TOC45">Portability issues</A></H2>
+<P>
+After some consideration, I have decided not to use
+GNU <CODE>autoconf</CODE> to configure 0.9.5 or 1.0.
+
+</P>
+<P>
+<CODE>autoconf</CODE>, admirable and wonderful though it is,
+mainly assists with portability problems between Unix-like
+platforms. But <CODE>bzip2</CODE> doesn't have much in the way
+of portability problems on Unix; most of the difficulties appear
+when porting to the Mac, or to Microsoft's operating systems.
+<CODE>autoconf</CODE> doesn't help in those cases, and brings in a
+whole load of new complexity.
+
+</P>
+<P>
+Most people should be able to compile the library and program
+under Unix straight out-of-the-box, so to speak, especially
+if you have a version of GNU C available.
+
+</P>
+<P>
+There are a couple of <CODE>__inline__</CODE> directives in the code. GNU C
+(<CODE>gcc</CODE>) should be able to handle them. If you're not using
+GNU C, your C compiler shouldn't see them at all.
+If your compiler does, for some reason, see them and doesn't
+like them, just <CODE>#define</CODE> <CODE>__inline__</CODE> to be <CODE>/* */</CODE>. One
+easy way to do this is to compile with the flag <CODE>-D__inline__=</CODE>,
+which should be understood by most Unix compilers.
+
+</P>
+<P>
+If you still have difficulties, try compiling with the macro
+<CODE>BZ_STRICT_ANSI</CODE> defined. This should enable you to build the
+library in a strictly ANSI compliant environment. Building the program
+itself like this is dangerous and not supported, since you remove
+<CODE>bzip2</CODE>'s checks against compressing directories, symbolic links,
+devices, and other not-really-a-file entities. This could cause
+filesystem corruption!
+
+</P>
+<P>
+One other thing: if you create a <CODE>bzip2</CODE> binary for public
+distribution, please try and link it statically (<CODE>gcc -s</CODE>). This
+avoids all sorts of library-version issues that others may encounter
+later on.
+
+</P>
+<P>
+If you build <CODE>bzip2</CODE> on Win32, you must set <CODE>BZ_UNIX</CODE> to 0 and
+<CODE>BZ_LCCWIN32</CODE> to 1, in the file <CODE>bzip2.c</CODE>, before compiling.
+Otherwise the resulting binary won't work correctly.
+
+</P>
+
+
+
+<H2><A NAME="SEC46" HREF="manual_toc.html#TOC46">Reporting bugs</A></H2>
+<P>
+I tried pretty hard to make sure <CODE>bzip2</CODE> is
+bug free, both by design and by testing. Hopefully
+you'll never need to read this section for real.
+
+</P>
+<P>
+Nevertheless, if <CODE>bzip2</CODE> dies with a segmentation
+fault, a bus error or an internal assertion failure, it
+will ask you to email me a bug report. Experience with
+version 0.1 shows that almost all these problems can
+be traced to either compiler bugs or hardware problems.
+
+<UL>
+<LI>
+
+Recompile the program with no optimisation, and see if it
+works. And/or try a different compiler.
+I heard all sorts of stories about various flavours
+of GNU C (and other compilers) generating bad code for
+<CODE>bzip2</CODE>, and I've run across two such examples myself.
+
+2.7.X versions of GNU C are known to generate bad code from
+time to time, at high optimisation levels.
+If you get problems, try using the flags
+<CODE>-O2</CODE> <CODE>-fomit-frame-pointer</CODE> <CODE>-fno-strength-reduce</CODE>.
+You should specifically <EM>not</EM> use <CODE>-funroll-loops</CODE>.
+
+You may notice that the Makefile runs six tests as part of
+the build process. If the program passes all of these, it's
+a pretty good (but not 100%) indication that the compiler has
+done its job correctly.
+<LI>
+
+If <CODE>bzip2</CODE> crashes randomly, and the crashes are not
+repeatable, you may have a flaky memory subsystem. <CODE>bzip2</CODE>
+really hammers your memory hierarchy, and if it's a bit marginal,
+you may get these problems. Ditto if your disk or I/O subsystem
+is slowly failing. Yup, this really does happen.
+
+Try using a different machine of the same type, and see if
+you can repeat the problem.
+<LI>This isn't really a bug, but ... If <CODE>bzip2</CODE> tells
+
+you your file is corrupted on decompression, and you
+obtained the file via FTP, there is a possibility that you
+forgot to tell FTP to do a binary mode transfer. That absolutely
+will cause the file to be non-decompressible. You'll have to transfer
+it again.
+</UL>
+
+<P>
+If you've incorporated <CODE>libbzip2</CODE> into your own program
+and are getting problems, please, please, please, check that the
+parameters you are passing in calls to the library, are
+correct, and in accordance with what the documentation says
+is allowable. I have tried to make the library robust against
+such problems, but I'm sure I haven't succeeded.
+
+</P>
+<P>
+Finally, if the above comments don't help, you'll have to send
+me a bug report. Now, it's just amazing how many people will
+send me a bug report saying something like
+
+<PRE>
+ bzip2 crashed with segmentation fault on my machine
+</PRE>
+
+<P>
+and absolutely nothing else. Needless to say, a such a report
+is <EM>totally, utterly, completely and comprehensively 100% useless;
+a waste of your time, my time, and net bandwidth</EM>.
+With no details at all, there's no way I can possibly begin
+to figure out what the problem is.
+
+</P>
+<P>
+The rules of the game are: facts, facts, facts. Don't omit
+them because "oh, they won't be relevant". At the bare
+minimum:
+
+<PRE>
+ Machine type. Operating system version.
+ Exact version of <CODE>bzip2</CODE> (do <CODE>bzip2 -V</CODE>).
+ Exact version of the compiler used.
+ Flags passed to the compiler.
+</PRE>
+
+<P>
+However, the most important single thing that will help me is
+the file that you were trying to compress or decompress at the
+time the problem happened. Without that, my ability to do anything
+more than speculate about the cause, is limited.
+
+</P>
+<P>
+Please remember that I connect to the Internet with a modem, so
+you should contact me before mailing me huge files.
+
+</P>
+
+
+
+<H2><A NAME="SEC47" HREF="manual_toc.html#TOC47">Did you get the right package?</A></H2>
+
+<P>
+<CODE>bzip2</CODE> is a resource hog. It soaks up large amounts of CPU cycles
+and memory. Also, it gives very large latencies. In the worst case, you
+can feed many megabytes of uncompressed data into the library before
+getting any compressed output, so this probably rules out applications
+requiring interactive behaviour.
+
+</P>
+<P>
+These aren't faults of my implementation, I hope, but more
+an intrinsic property of the Burrows-Wheeler transform (unfortunately).
+Maybe this isn't what you want.
+
+</P>
+<P>
+If you want a compressor and/or library which is faster, uses less
+memory but gets pretty good compression, and has minimal latency,
+consider Jean-loup
+Gailly's and Mark Adler's work, <CODE>zlib-1.1.2</CODE> and
+<CODE>gzip-1.2.4</CODE>. Look for them at
+
+</P>
+<P>
+<CODE>http://www.cdrom.com/pub/infozip/zlib</CODE> and
+<CODE>http://www.gzip.org</CODE> respectively.
+
+</P>
+<P>
+For something faster and lighter still, you might try Markus F X J
+Oberhumer's <CODE>LZO</CODE> real-time compression/decompression library, at
+<BR> <CODE>http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html</CODE>.
+
+</P>
+<P>
+If you want to use the <CODE>bzip2</CODE> algorithms to compress small blocks
+of data, 64k bytes or smaller, for example on an on-the-fly disk
+compressor, you'd be well advised not to use this library. Instead,
+I've made a special library tuned for that kind of use. It's part of
+<CODE>e2compr-0.40</CODE>, an on-the-fly disk compressor for the Linux
+<CODE>ext2</CODE> filesystem. Look at
+<CODE>http://www.netspace.net.au/~reiter/e2compr</CODE>.
+
+</P>
+
+
+
+<H2><A NAME="SEC48" HREF="manual_toc.html#TOC48">Testing</A></H2>
+
+<P>
+A record of the tests I've done.
+
+</P>
+<P>
+First, some data sets:
+
+<UL>
+<LI>B: a directory containing 6001 files, one for every length in the
+
+ range 0 to 6000 bytes. The files contain random lowercase
+ letters. 18.7 megabytes.
+<LI>H: my home directory tree. Documents, source code, mail files,
+
+ compressed data. H contains B, and also a directory of
+ files designed as boundary cases for the sorting; mostly very
+ repetitive, nasty files. 565 megabytes.
+<LI>A: directory tree holding various applications built from source:
+
+ <CODE>egcs</CODE>, <CODE>gcc-2.8.1</CODE>, KDE, GTK, Octave, etc.
+ 2200 megabytes.
+</UL>
+
+<P>
+The tests conducted are as follows. Each test means compressing
+(a copy of) each file in the data set, decompressing it and
+comparing it against the original.
+
+</P>
+<P>
+First, a bunch of tests with block sizes and internal buffer
+sizes set very small,
+to detect any problems with the
+blocking and buffering mechanisms.
+This required modifying the source code so as to try to
+break it.
+
+<OL>
+<LI>Data set H, with
+
+ buffer size of 1 byte, and block size of 23 bytes.
+<LI>Data set B, buffer sizes 1 byte, block size 1 byte.
+
+<LI>As (2) but small-mode decompression.
+
+<LI>As (2) with block size 2 bytes.
+
+<LI>As (2) with block size 3 bytes.
+
+<LI>As (2) with block size 4 bytes.
+
+<LI>As (2) with block size 5 bytes.
+
+<LI>As (2) with block size 6 bytes and small-mode decompression.
+
+<LI>H with buffer size of 1 byte, but normal block
+
+ size (up to 900000 bytes).
+</OL>
+
+<P>
+Then some tests with unmodified source code.
+
+<OL>
+<LI>H, all settings normal.
+
+<LI>As (1), with small-mode decompress.
+
+<LI>H, compress with flag <CODE>-1</CODE>.
+
+<LI>H, compress with flag <CODE>-s</CODE>, decompress with flag <CODE>-s</CODE>.
+
+<LI>Forwards compatibility: H, <CODE>bzip2-0.1pl2</CODE> compressing,
+
+ <CODE>bzip2-0.9.5</CODE> decompressing, all settings normal.
+<LI>Backwards compatibility: H, <CODE>bzip2-0.9.5</CODE> compressing,
+
+ <CODE>bzip2-0.1pl2</CODE> decompressing, all settings normal.
+<LI>Bigger tests: A, all settings normal.
+
+<LI>As (7), using the fallback (Sadakane-like) sorting algorithm.
+
+<LI>As (8), compress with flag <CODE>-1</CODE>, decompress with flag
+
+ <CODE>-s</CODE>.
+<LI>H, using the fallback sorting algorithm.
+
+<LI>Forwards compatibility: A, <CODE>bzip2-0.1pl2</CODE> compressing,
+
+ <CODE>bzip2-0.9.5</CODE> decompressing, all settings normal.
+<LI>Backwards compatibility: A, <CODE>bzip2-0.9.5</CODE> compressing,
+
+ <CODE>bzip2-0.1pl2</CODE> decompressing, all settings normal.
+<LI>Misc test: about 400 megabytes of <CODE>.tar</CODE> files with
+
+ <CODE>bzip2</CODE> compiled with Checker (a memory access error
+ detector, like Purify).
+<LI>Misc tests to make sure it builds and runs ok on non-Linux/x86
+
+ platforms.
+</OL>
+
+<P>
+These tests were conducted on a 225 MHz IDT WinChip machine, running
+Linux 2.0.36. They represent nearly a week of continuous computation.
+All tests completed successfully.
+
+</P>
+
+
+
+<H2><A NAME="SEC49" HREF="manual_toc.html#TOC49">Further reading</A></H2>
+<P>
+<CODE>bzip2</CODE> is not research work, in the sense that it doesn't present
+any new ideas. Rather, it's an engineering exercise based on existing
+ideas.
+
+</P>
+<P>
+Four documents describe essentially all the ideas behind <CODE>bzip2</CODE>:
+
+<PRE>
+Michael Burrows and D. J. Wheeler:
+ "A block-sorting lossless data compression algorithm"
+ 10th May 1994.
+ Digital SRC Research Report 124.
+ ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz
+ If you have trouble finding it, try searching at the
+ New Zealand Digital Library, http://www.nzdl.org.
+
+Daniel S. Hirschberg and Debra A. LeLewer
+ "Efficient Decoding of Prefix Codes"
+ Communications of the ACM, April 1990, Vol 33, Number 4.
+ You might be able to get an electronic copy of this
+ from the ACM Digital Library.
+
+David J. Wheeler
+ Program bred3.c and accompanying document bred3.ps.
+ This contains the idea behind the multi-table Huffman
+ coding scheme.
+ ftp://ftp.cl.cam.ac.uk/users/djw3/
+
+Jon L. Bentley and Robert Sedgewick
+ "Fast Algorithms for Sorting and Searching Strings"
+ Available from Sedgewick's web page,
+ www.cs.princeton.edu/~rs
+</PRE>
+
+<P>
+The following paper gives valuable additional insights into the
+algorithm, but is not immediately the basis of any code
+used in bzip2.
+
+<PRE>
+Peter Fenwick:
+ Block Sorting Text Compression
+ Proceedings of the 19th Australasian Computer Science Conference,
+ Melbourne, Australia. Jan 31 - Feb 2, 1996.
+ ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps
+</PRE>
+
+<P>
+Kunihiko Sadakane's sorting algorithm, mentioned above,
+is available from:
+
+<PRE>
+http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz
+</PRE>
+
+<P>
+The Manber-Myers suffix array construction
+algorithm is described in a paper
+available from:
+
+<PRE>
+http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps
+</PRE>
+
+<P>
+Finally, the following paper documents some recent investigations
+I made into the performance of sorting algorithms:
+
+<PRE>
+Julian Seward:
+ On the Performance of BWT Sorting Algorithms
+ Proceedings of the IEEE Data Compression Conference 2000
+ Snowbird, Utah. 28-30 March 2000.
+</PRE>
+
+<P><HR><P>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_3.html">previous</A>, next, last section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
--- /dev/null
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+ from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Table of Contents</TITLE>
+
+</HEAD>
+<BODY>
+<H1>bzip2 and libbzip2</H1>
+<H2>a program and library for data compression</H2>
+<H2>copyright (C) 1996-2000 Julian Seward</H2>
+<H2>version 1.0 of 21 March 2000</H2>
+<ADDRESS>Julian Seward</ADDRESS>
+<P>
+<P><HR><P>
+
+<P>
+This program, <CODE>bzip2</CODE>,
+and associated library <CODE>libbzip2</CODE>, are
+Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+</P>
+<P>
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+
+<UL>
+<LI>
+
+ Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+<LI>
+
+ The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+<LI>
+
+ Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+<LI>
+
+ The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+</UL>
+
+<P>
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS
+OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+</P>
+<P>
+Julian Seward, Cambridge, UK.
+
+</P>
+<P>
+<CODE>jseward@acm.org</CODE>
+
+</P>
+<P>
+<CODE>http://sourceware.cygnus.com/bzip2</CODE>
+
+</P>
+<P>
+<CODE>http://www.cacheprof.org</CODE>
+
+</P>
+<P>
+<CODE>http://www.muraroa.demon.co.uk</CODE>
+
+</P>
+<P>
+<CODE>bzip2</CODE>/<CODE>libbzip2</CODE> version 1.0 of 21 March 2000.
+
+</P>
+<P>
+PATENTS: To the best of my knowledge, <CODE>bzip2</CODE> does not use any patented
+algorithms. However, I do not have the resources available to carry out
+a full patent search. Therefore I cannot give any guarantee of the
+above statement.
+
+</P>
+
+<UL>
+<LI><A NAME="TOC1" HREF="manual_1.html#SEC1">Introduction</A>
+<LI><A NAME="TOC2" HREF="manual_2.html#SEC2">How to use <CODE>bzip2</CODE></A>
+<UL>
+<UL>
+<UL>
+<LI><A NAME="TOC3" HREF="manual_2.html#SEC3">NAME</A>
+<LI><A NAME="TOC4" HREF="manual_2.html#SEC4">SYNOPSIS</A>
+<LI><A NAME="TOC5" HREF="manual_2.html#SEC5">DESCRIPTION</A>
+<LI><A NAME="TOC6" HREF="manual_2.html#SEC6">OPTIONS</A>
+<LI><A NAME="TOC7" HREF="manual_2.html#SEC7">MEMORY MANAGEMENT</A>
+<LI><A NAME="TOC8" HREF="manual_2.html#SEC8">RECOVERING DATA FROM DAMAGED FILES</A>
+<LI><A NAME="TOC9" HREF="manual_2.html#SEC9">PERFORMANCE NOTES</A>
+<LI><A NAME="TOC10" HREF="manual_2.html#SEC10">CAVEATS</A>
+<LI><A NAME="TOC11" HREF="manual_2.html#SEC11">AUTHOR</A>
+</UL>
+</UL>
+</UL>
+<LI><A NAME="TOC12" HREF="manual_3.html#SEC12">Programming with <CODE>libbzip2</CODE></A>
+<UL>
+<LI><A NAME="TOC13" HREF="manual_3.html#SEC13">Top-level structure</A>
+<UL>
+<LI><A NAME="TOC14" HREF="manual_3.html#SEC14">Low-level summary</A>
+<LI><A NAME="TOC15" HREF="manual_3.html#SEC15">High-level summary</A>
+<LI><A NAME="TOC16" HREF="manual_3.html#SEC16">Utility functions summary</A>
+</UL>
+<LI><A NAME="TOC17" HREF="manual_3.html#SEC17">Error handling</A>
+<LI><A NAME="TOC18" HREF="manual_3.html#SEC18">Low-level interface</A>
+<UL>
+<LI><A NAME="TOC19" HREF="manual_3.html#SEC19"><CODE>BZ2_bzCompressInit</CODE></A>
+<LI><A NAME="TOC20" HREF="manual_3.html#SEC20"><CODE>BZ2_bzCompress</CODE></A>
+<LI><A NAME="TOC21" HREF="manual_3.html#SEC21"><CODE>BZ2_bzCompressEnd</CODE></A>
+<LI><A NAME="TOC22" HREF="manual_3.html#SEC22"><CODE>BZ2_bzDecompressInit</CODE></A>
+<LI><A NAME="TOC23" HREF="manual_3.html#SEC23"><CODE>BZ2_bzDecompress</CODE></A>
+<LI><A NAME="TOC24" HREF="manual_3.html#SEC24"><CODE>BZ2_bzDecompressEnd</CODE></A>
+</UL>
+<LI><A NAME="TOC25" HREF="manual_3.html#SEC25">High-level interface</A>
+<UL>
+<LI><A NAME="TOC26" HREF="manual_3.html#SEC26"><CODE>BZ2_bzReadOpen</CODE></A>
+<LI><A NAME="TOC27" HREF="manual_3.html#SEC27"><CODE>BZ2_bzRead</CODE></A>
+<LI><A NAME="TOC28" HREF="manual_3.html#SEC28"><CODE>BZ2_bzReadGetUnused</CODE></A>
+<LI><A NAME="TOC29" HREF="manual_3.html#SEC29"><CODE>BZ2_bzReadClose</CODE></A>
+<LI><A NAME="TOC30" HREF="manual_3.html#SEC30"><CODE>BZ2_bzWriteOpen</CODE></A>
+<LI><A NAME="TOC31" HREF="manual_3.html#SEC31"><CODE>BZ2_bzWrite</CODE></A>
+<LI><A NAME="TOC32" HREF="manual_3.html#SEC32"><CODE>BZ2_bzWriteClose</CODE></A>
+<LI><A NAME="TOC33" HREF="manual_3.html#SEC33">Handling embedded compressed data streams</A>
+<LI><A NAME="TOC34" HREF="manual_3.html#SEC34">Standard file-reading/writing code</A>
+</UL>
+<LI><A NAME="TOC35" HREF="manual_3.html#SEC35">Utility functions</A>
+<UL>
+<LI><A NAME="TOC36" HREF="manual_3.html#SEC36"><CODE>BZ2_bzBuffToBuffCompress</CODE></A>
+<LI><A NAME="TOC37" HREF="manual_3.html#SEC37"><CODE>BZ2_bzBuffToBuffDecompress</CODE></A>
+</UL>
+<LI><A NAME="TOC38" HREF="manual_3.html#SEC38"><CODE>zlib</CODE> compatibility functions</A>
+<LI><A NAME="TOC39" HREF="manual_3.html#SEC39">Using the library in a <CODE>stdio</CODE>-free environment</A>
+<UL>
+<LI><A NAME="TOC40" HREF="manual_3.html#SEC40">Getting rid of <CODE>stdio</CODE></A>
+<LI><A NAME="TOC41" HREF="manual_3.html#SEC41">Critical error handling</A>
+</UL>
+<LI><A NAME="TOC42" HREF="manual_3.html#SEC42">Making a Windows DLL</A>
+</UL>
+<LI><A NAME="TOC43" HREF="manual_4.html#SEC43">Miscellanea</A>
+<UL>
+<LI><A NAME="TOC44" HREF="manual_4.html#SEC44">Limitations of the compressed file format</A>
+<LI><A NAME="TOC45" HREF="manual_4.html#SEC45">Portability issues</A>
+<LI><A NAME="TOC46" HREF="manual_4.html#SEC46">Reporting bugs</A>
+<LI><A NAME="TOC47" HREF="manual_4.html#SEC47">Did you get the right package?</A>
+<LI><A NAME="TOC48" HREF="manual_4.html#SEC48">Testing</A>
+<LI><A NAME="TOC49" HREF="manual_4.html#SEC49">Further reading</A>
+</UL>
+</UL>
+<P><HR><P>
+This document was generated on 23 March 2000 using the
+<A HREF="http://wwwcn.cern.ch/dci/texi2html/">texi2html</A>
+translator version 1.51a.</P>
+</BODY>
+</HTML>
--- /dev/null
+
+/*-------------------------------------------------------------*/
+/*--- Table for randomising repetitive blocks ---*/
+/*--- randtable.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+ This file is a part of bzip2 and/or libbzip2, a program and
+ library for lossless, block-sorting data compression.
+
+ Copyright (C) 1996-2000 Julian R Seward. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+
+ 2. The origin of this software must not be misrepresented; you must
+ not claim that you wrote the original software. If you use this
+ software in a product, an acknowledgment in the product
+ documentation would be appreciated but is not required.
+
+ 3. Altered source versions must be plainly marked as such, and must
+ not be misrepresented as being the original software.
+
+ 4. The name of the author may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+ OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+ INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ Julian Seward, Cambridge, UK.
+ jseward@acm.org
+ bzip2/libbzip2 version 1.0 of 21 March 2000
+
+ This program is based on (at least) the work of:
+ Mike Burrows
+ David Wheeler
+ Peter Fenwick
+ Alistair Moffat
+ Radford Neal
+ Ian H. Witten
+ Robert Sedgewick
+ Jon L. Bentley
+
+ For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------*/
+Int32 BZ2_rNums[512] = {
+ 619, 720, 127, 481, 931, 816, 813, 233, 566, 247,
+ 985, 724, 205, 454, 863, 491, 741, 242, 949, 214,
+ 733, 859, 335, 708, 621, 574, 73, 654, 730, 472,
+ 419, 436, 278, 496, 867, 210, 399, 680, 480, 51,
+ 878, 465, 811, 169, 869, 675, 611, 697, 867, 561,
+ 862, 687, 507, 283, 482, 129, 807, 591, 733, 623,
+ 150, 238, 59, 379, 684, 877, 625, 169, 643, 105,
+ 170, 607, 520, 932, 727, 476, 693, 425, 174, 647,
+ 73, 122, 335, 530, 442, 853, 695, 249, 445, 515,
+ 909, 545, 703, 919, 874, 474, 882, 500, 594, 612,
+ 641, 801, 220, 162, 819, 984, 589, 513, 495, 799,
+ 161, 604, 958, 533, 221, 400, 386, 867, 600, 782,
+ 382, 596, 414, 171, 516, 375, 682, 485, 911, 276,
+ 98, 553, 163, 354, 666, 933, 424, 341, 533, 870,
+ 227, 730, 475, 186, 263, 647, 537, 686, 600, 224,
+ 469, 68, 770, 919, 190, 373, 294, 822, 808, 206,
+ 184, 943, 795, 384, 383, 461, 404, 758, 839, 887,
+ 715, 67, 618, 276, 204, 918, 873, 777, 604, 560,
+ 951, 160, 578, 722, 79, 804, 96, 409, 713, 940,
+ 652, 934, 970, 447, 318, 353, 859, 672, 112, 785,
+ 645, 863, 803, 350, 139, 93, 354, 99, 820, 908,
+ 609, 772, 154, 274, 580, 184, 79, 626, 630, 742,
+ 653, 282, 762, 623, 680, 81, 927, 626, 789, 125,
+ 411, 521, 938, 300, 821, 78, 343, 175, 128, 250,
+ 170, 774, 972, 275, 999, 639, 495, 78, 352, 126,
+ 857, 956, 358, 619, 580, 124, 737, 594, 701, 612,
+ 669, 112, 134, 694, 363, 992, 809, 743, 168, 974,
+ 944, 375, 748, 52, 600, 747, 642, 182, 862, 81,
+ 344, 805, 988, 739, 511, 655, 814, 334, 249, 515,
+ 897, 955, 664, 981, 649, 113, 974, 459, 893, 228,
+ 433, 837, 553, 268, 926, 240, 102, 654, 459, 51,
+ 686, 754, 806, 760, 493, 403, 415, 394, 687, 700,
+ 946, 670, 656, 610, 738, 392, 760, 799, 887, 653,
+ 978, 321, 576, 617, 626, 502, 894, 679, 243, 440,
+ 680, 879, 194, 572, 640, 724, 926, 56, 204, 700,
+ 707, 151, 457, 449, 797, 195, 791, 558, 945, 679,
+ 297, 59, 87, 824, 713, 663, 412, 693, 342, 606,
+ 134, 108, 571, 364, 631, 212, 174, 643, 304, 329,
+ 343, 97, 430, 751, 497, 314, 983, 374, 822, 928,
+ 140, 206, 73, 263, 980, 736, 876, 478, 430, 305,
+ 170, 514, 364, 692, 829, 82, 855, 953, 676, 246,
+ 369, 970, 294, 750, 807, 827, 150, 790, 288, 923,
+ 804, 378, 215, 828, 592, 281, 565, 555, 710, 82,
+ 896, 831, 547, 261, 524, 462, 293, 465, 502, 56,
+ 661, 821, 976, 991, 658, 869, 905, 758, 745, 193,
+ 768, 550, 608, 933, 378, 286, 215, 979, 792, 961,
+ 61, 688, 793, 644, 986, 403, 106, 366, 905, 644,
+ 372, 567, 466, 434, 645, 210, 389, 550, 919, 135,
+ 780, 773, 635, 389, 707, 100, 626, 958, 165, 504,
+ 920, 176, 193, 713, 857, 265, 203, 50, 668, 108,
+ 645, 990, 626, 197, 510, 357, 358, 850, 858, 364,
+ 936, 638
+};
+
+
+/*-------------------------------------------------------------*/
+/*--- end randtable.c ---*/
+/*-------------------------------------------------------------*/
--- /dev/null
+This file is exceedingly boring. If you find yourself
+reading it, please (1) take it from me that you can safely
+guess what the rest of the file says, and (2) seek professional
+help.
+
+ps. there are no further sarcastic remarks in this file.
+
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
--- /dev/null
+
+/* spew out a thoroughly gigantic file designed so that bzip2
+ can compress it reasonably rapidly. This is to help test
+ support for large files (> 2GB) in a reasonable amount of time.
+ I suggest you use the undocumented --exponential option to
+ bzip2 when compressing the resulting file; this saves a bit of
+ time. Note: *don't* bother with --exponential when compressing
+ Real Files; it'll just waste a lot of CPU time :-)
+ (but is otherwise harmless).
+*/
+
+#define _FILE_OFFSET_BITS 64
+
+#include <stdio.h>
+#include <stdlib.h>
+
+/* The number of megabytes of junk to spew out (roughly) */
+#define MEGABYTES 5000
+
+#define N_BUF 1000000
+char buf[N_BUF];
+
+int main ( int argc, char** argv )
+{
+ int ii, kk, p;
+ srandom(1);
+ setbuffer ( stdout, buf, N_BUF );
+ for (kk = 0; kk < MEGABYTES * 515; kk+=3) {
+ p = 25+random()%50;
+ for (ii = 0; ii < p; ii++)
+ printf ( "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" );
+ for (ii = 0; ii < p-1; ii++)
+ printf ( "bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb" );
+ for (ii = 0; ii < p+1; ii++)
+ printf ( "ccccccccccccccccccccccccccccccccccccc" );
+ }
+ fflush(stdout);
+ return 0;
+}
--- /dev/null
+
+/* A test program written to test robustness to decompression of
+ corrupted data. Usage is
+ unzcrash filename
+ and the program will read the specified file, compress it (in memory),
+ and then repeatedly decompress it, each time with a different bit of
+ the compressed data inverted, so as to test all possible one-bit errors.
+ This should not cause any invalid memory accesses. If it does,
+ I want to know about it!
+
+ p.s. As you can see from the above description, the process is
+ incredibly slow. A file of size eg 5KB will cause it to run for
+ many hours.
+*/
+
+#include <stdio.h>
+#include <assert.h>
+#include "bzlib.h"
+
+#define M_BLOCK 1000000
+
+typedef unsigned char uchar;
+
+#define M_BLOCK_OUT (M_BLOCK + 1000000)
+uchar inbuf[M_BLOCK];
+uchar outbuf[M_BLOCK_OUT];
+uchar zbuf[M_BLOCK + 600 + (M_BLOCK / 100)];
+
+int nIn, nOut, nZ;
+
+static char *bzerrorstrings[] = {
+ "OK"
+ ,"SEQUENCE_ERROR"
+ ,"PARAM_ERROR"
+ ,"MEM_ERROR"
+ ,"DATA_ERROR"
+ ,"DATA_ERROR_MAGIC"
+ ,"IO_ERROR"
+ ,"UNEXPECTED_EOF"
+ ,"OUTBUFF_FULL"
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+ ,"???" /* for future */
+};
+
+void flip_bit ( int bit )
+{
+ int byteno = bit / 8;
+ int bitno = bit % 8;
+ uchar mask = 1 << bitno;
+ //fprintf ( stderr, "(byte %d bit %d mask %d)",
+ // byteno, bitno, (int)mask );
+ zbuf[byteno] ^= mask;
+}
+
+int main ( int argc, char** argv )
+{
+ FILE* f;
+ int r;
+ int bit;
+ int i;
+
+ if (argc != 2) {
+ fprintf ( stderr, "usage: unzcrash filename\n" );
+ return 1;
+ }
+
+ f = fopen ( argv[1], "r" );
+ if (!f) {
+ fprintf ( stderr, "unzcrash: can't open %s\n", argv[1] );
+ return 1;
+ }
+
+ nIn = fread ( inbuf, 1, M_BLOCK, f );
+ fprintf ( stderr, "%d bytes read\n", nIn );
+
+ nZ = M_BLOCK;
+ r = BZ2_bzBuffToBuffCompress (
+ zbuf, &nZ, inbuf, nIn, 9, 0, 30 );
+
+ assert (r == BZ_OK);
+ fprintf ( stderr, "%d after compression\n", nZ );
+
+ for (bit = 0; bit < nZ*8; bit++) {
+ fprintf ( stderr, "bit %d ", bit );
+ flip_bit ( bit );
+ nOut = M_BLOCK_OUT;
+ r = BZ2_bzBuffToBuffDecompress (
+ outbuf, &nOut, zbuf, nZ, 0, 0 );
+ fprintf ( stderr, " %d %s ", r, bzerrorstrings[-r] );
+
+ if (r != BZ_OK) {
+ fprintf ( stderr, "\n" );
+ } else {
+ if (nOut != nIn) {
+ fprintf(stderr, "nIn/nOut mismatch %d %d\n", nIn, nOut );
+ return 1;
+ } else {
+ for (i = 0; i < nOut; i++)
+ if (inbuf[i] != outbuf[i]) {
+ fprintf(stderr, "mismatch at %d\n", i );
+ return 1;
+ }
+ if (i == nOut) fprintf(stderr, "really ok!\n" );
+ }
+ }
+
+ flip_bit ( bit );
+ }
+
+#if 0
+ assert (nOut == nIn);
+ for (i = 0; i < nOut; i++) {
+ if (inbuf[i] != outbuf[i]) {
+ fprintf ( stderr, "difference at %d !\n", i );
+ return 1;
+ }
+ }
+#endif
+
+ fprintf ( stderr, "all ok\n" );
+ return 0;
+}
--- /dev/null
+
+If compilation produces errors, or a large number of warnings,
+please read README.COMPILATION.PROBLEMS -- you might be able to
+adjust the flags in this Makefile to improve matters.
+
--- /dev/null
+
+Doing 6 tests (3 compress, 3 uncompress) ...
+If there's a problem, things might stop at this point.
+
--- /dev/null
+
+Checking test results. If any of the four "cmp"s which follow
+report any differences, something is wrong. If you can't easily
+figure out what, please let me know (jseward@acm.org).
+
--- /dev/null
+
+If you got this far and the "cmp"s didn't complain, it looks
+like you're in business.
+
+To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type
+ make install
+To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type
+ make install PREFIX=/xxx/yyy
+If you are (justifiably) paranoid and want to see what 'make install'
+is going to do, you can first do
+ make -n install or
+ make -n install PREFIX=/xxx/yyy respectively.
+The -n instructs make to show the commands it would execute, but
+not actually execute them.
+
+Instructions for use are in the preformatted manual page, in the file
+bzip2.txt. For more detailed documentation, read the full manual.
+It is available in Postscript form (manual.ps) and HTML form
+(manual_toc.html).
+
+You can also do "bzip2 --help" to see some helpful information.
+"bzip2 -L" displays the software license.
+
--- /dev/null
+
+ ChangeLog file for zlib
+
+Changes in 1.1.3 (9 July 1998)
+- fix "an inflate input buffer bug that shows up on rare but persistent
+ occasions" (Mark)
+- fix gzread and gztell for concatenated .gz files (Didier Le Botlan)
+- fix gzseek(..., SEEK_SET) in write mode
+- fix crc check after a gzeek (Frank Faubert)
+- fix miniunzip when the last entry in a zip file is itself a zip file
+ (J Lillge)
+- add contrib/asm586 and contrib/asm686 (Brian Raiter)
+ See http://www.muppetlabs.com/~breadbox/software/assembly.html
+- add support for Delphi 3 in contrib/delphi (Bob Dellaca)
+- add support for C++Builder 3 and Delphi 3 in contrib/delphi2 (Davide Moretti)
+- do not exit prematurely in untgz if 0 at start of block (Magnus Holmgren)
+- use macro EXTERN instead of extern to support DLL for BeOS (Sander Stoks)
+- added a FAQ file
+
+- Support gzdopen on Mac with Metrowerks (Jason Linhart)
+- Do not redefine Byte on Mac (Brad Pettit & Jason Linhart)
+- define SEEK_END too if SEEK_SET is not defined (Albert Chin-A-Young)
+- avoid some warnings with Borland C (Tom Tanner)
+- fix a problem in contrib/minizip/zip.c for 16-bit MSDOS (Gilles Vollant)
+- emulate utime() for WIN32 in contrib/untgz (Gilles Vollant)
+- allow several arguments to configure (Tim Mooney, Frodo Looijaard)
+- use libdir and includedir in Makefile.in (Tim Mooney)
+- support shared libraries on OSF1 V4 (Tim Mooney)
+- remove so_locations in "make clean" (Tim Mooney)
+- fix maketree.c compilation error (Glenn, Mark)
+- Python interface to zlib now in Python 1.5 (Jeremy Hylton)
+- new Makefile.riscos (Rich Walker)
+- initialize static descriptors in trees.c for embedded targets (Nick Smith)
+- use "foo-gz" in example.c for RISCOS and VMS (Nick Smith)
+- add the OS/2 files in Makefile.in too (Andrew Zabolotny)
+- fix fdopen and halloc macros for Microsoft C 6.0 (Tom Lane)
+- fix maketree.c to allow clean compilation of inffixed.h (Mark)
+- fix parameter check in deflateCopy (Gunther Nikl)
+- cleanup trees.c, use compressed_len only in debug mode (Christian Spieler)
+- Many portability patches by Christian Spieler:
+ . zutil.c, zutil.h: added "const" for zmem*
+ . Make_vms.com: fixed some typos
+ . Make_vms.com: msdos/Makefile.*: removed zutil.h from some dependency lists
+ . msdos/Makefile.msc: remove "default rtl link library" info from obj files
+ . msdos/Makefile.*: use model-dependent name for the built zlib library
+ . msdos/Makefile.emx, nt/Makefile.emx, nt/Makefile.gcc:
+ new makefiles, for emx (DOS/OS2), emx&rsxnt and mingw32 (Windows 9x / NT)
+- use define instead of typedef for Bytef also for MSC small/medium (Tom Lane)
+- replace __far with _far for better portability (Christian Spieler, Tom Lane)
+- fix test for errno.h in configure (Tim Newsham)
+
+Changes in 1.1.2 (19 March 98)
+- added contrib/minzip, mini zip and unzip based on zlib (Gilles Vollant)
+ See http://www.winimage.com/zLibDll/unzip.html
+- preinitialize the inflate tables for fixed codes, to make the code
+ completely thread safe (Mark)
+- some simplifications and slight speed-up to the inflate code (Mark)
+- fix gzeof on non-compressed files (Allan Schrum)
+- add -std1 option in configure for OSF1 to fix gzprintf (Martin Mokrejs)
+- use default value of 4K for Z_BUFSIZE for 16-bit MSDOS (Tim Wegner + Glenn)
+- added os2/Makefile.def and os2/zlib.def (Andrew Zabolotny)
+- add shared lib support for UNIX_SV4.2MP (MATSUURA Takanori)
+- do not wrap extern "C" around system includes (Tom Lane)
+- mention zlib binding for TCL in README (Andreas Kupries)
+- added amiga/Makefile.pup for Amiga powerUP SAS/C PPC (Andreas Kleinert)
+- allow "make install prefix=..." even after configure (Glenn Randers-Pehrson)
+- allow "configure --prefix $HOME" (Tim Mooney)
+- remove warnings in example.c and gzio.c (Glenn Randers-Pehrson)
+- move Makefile.sas to amiga/Makefile.sas
+
+Changes in 1.1.1 (27 Feb 98)
+- fix macros _tr_tally_* in deflate.h for debug mode (Glenn Randers-Pehrson)
+- remove block truncation heuristic which had very marginal effect for zlib
+ (smaller lit_bufsize than in gzip 1.2.4) and degraded a little the
+ compression ratio on some files. This also allows inlining _tr_tally for
+ matches in deflate_slow.
+- added msdos/Makefile.w32 for WIN32 Microsoft Visual C++ (Bob Frazier)
+
+Changes in 1.1.0 (24 Feb 98)
+- do not return STREAM_END prematurely in inflate (John Bowler)
+- revert to the zlib 1.0.8 inflate to avoid the gcc 2.8.0 bug (Jeremy Buhler)
+- compile with -DFASTEST to get compression code optimized for speed only
+- in minigzip, try mmap'ing the input file first (Miguel Albrecht)
+- increase size of I/O buffers in minigzip.c and gzio.c (not a big gain
+ on Sun but significant on HP)
+
+- add a pointer to experimental unzip library in README (Gilles Vollant)
+- initialize variable gcc in configure (Chris Herborth)
+
+Changes in 1.0.9 (17 Feb 1998)
+- added gzputs and gzgets functions
+- do not clear eof flag in gzseek (Mark Diekhans)
+- fix gzseek for files in transparent mode (Mark Diekhans)
+- do not assume that vsprintf returns the number of bytes written (Jens Krinke)
+- replace EXPORT with ZEXPORT to avoid conflict with other programs
+- added compress2 in zconf.h, zlib.def, zlib.dnt
+- new asm code from Gilles Vollant in contrib/asm386
+- simplify the inflate code (Mark):
+ . Replace ZALLOC's in huft_build() with single ZALLOC in inflate_blocks_new()
+ . ZALLOC the length list in inflate_trees_fixed() instead of using stack
+ . ZALLOC the value area for huft_build() instead of using stack
+ . Simplify Z_FINISH check in inflate()
+
+- Avoid gcc 2.8.0 comparison bug a little differently than zlib 1.0.8
+- in inftrees.c, avoid cc -O bug on HP (Farshid Elahi)
+- in zconf.h move the ZLIB_DLL stuff earlier to avoid problems with
+ the declaration of FAR (Gilles VOllant)
+- install libz.so* with mode 755 (executable) instead of 644 (Marc Lehmann)
+- read_buf buf parameter of type Bytef* instead of charf*
+- zmemcpy parameters are of type Bytef*, not charf* (Joseph Strout)
+- do not redeclare unlink in minigzip.c for WIN32 (John Bowler)
+- fix check for presence of directories in "make install" (Ian Willis)
+
+Changes in 1.0.8 (27 Jan 1998)
+- fixed offsets in contrib/asm386/gvmat32.asm (Gilles Vollant)
+- fix gzgetc and gzputc for big endian systems (Markus Oberhumer)
+- added compress2() to allow setting the compression level
+- include sys/types.h to get off_t on some systems (Marc Lehmann & QingLong)
+- use constant arrays for the static trees in trees.c instead of computing
+ them at run time (thanks to Ken Raeburn for this suggestion). To create
+ trees.h, compile with GEN_TREES_H and run "make test".
+- check return code of example in "make test" and display result
+- pass minigzip command line options to file_compress
+- simplifying code of inflateSync to avoid gcc 2.8 bug
+
+- support CC="gcc -Wall" in configure -s (QingLong)
+- avoid a flush caused by ftell in gzopen for write mode (Ken Raeburn)
+- fix test for shared library support to avoid compiler warnings
+- zlib.lib -> zlib.dll in msdos/zlib.rc (Gilles Vollant)
+- check for TARGET_OS_MAC in addition to MACOS (Brad Pettit)
+- do not use fdopen for Metrowerks on Mac (Brad Pettit))
+- add checks for gzputc and gzputc in example.c
+- avoid warnings in gzio.c and deflate.c (Andreas Kleinert)
+- use const for the CRC table (Ken Raeburn)
+- fixed "make uninstall" for shared libraries
+- use Tracev instead of Trace in infblock.c
+- in example.c use correct compressed length for test_sync
+- suppress +vnocompatwarnings in configure for HPUX (not always supported)
+
+Changes in 1.0.7 (20 Jan 1998)
+- fix gzseek which was broken in write mode
+- return error for gzseek to negative absolute position
+- fix configure for Linux (Chun-Chung Chen)
+- increase stack space for MSC (Tim Wegner)
+- get_crc_table and inflateSyncPoint are EXPORTed (Gilles Vollant)
+- define EXPORTVA for gzprintf (Gilles Vollant)
+- added man page zlib.3 (Rick Rodgers)
+- for contrib/untgz, fix makedir() and improve Makefile
+
+- check gzseek in write mode in example.c
+- allocate extra buffer for seeks only if gzseek is actually called
+- avoid signed/unsigned comparisons (Tim Wegner, Gilles Vollant)
+- add inflateSyncPoint in zconf.h
+- fix list of exported functions in nt/zlib.dnt and mdsos/zlib.def
+
+Changes in 1.0.6 (19 Jan 1998)
+- add functions gzprintf, gzputc, gzgetc, gztell, gzeof, gzseek, gzrewind and
+ gzsetparams (thanks to Roland Giersig and Kevin Ruland for some of this code)
+- Fix a deflate bug occuring only with compression level 0 (thanks to
+ Andy Buckler for finding this one).
+- In minigzip, pass transparently also the first byte for .Z files.
+- return Z_BUF_ERROR instead of Z_OK if output buffer full in uncompress()
+- check Z_FINISH in inflate (thanks to Marc Schluper)
+- Implement deflateCopy (thanks to Adam Costello)
+- make static libraries by default in configure, add --shared option.
+- move MSDOS or Windows specific files to directory msdos
+- suppress the notion of partial flush to simplify the interface
+ (but the symbol Z_PARTIAL_FLUSH is kept for compatibility with 1.0.4)
+- suppress history buffer provided by application to simplify the interface
+ (this feature was not implemented anyway in 1.0.4)
+- next_in and avail_in must be initialized before calling inflateInit or
+ inflateInit2
+- add EXPORT in all exported functions (for Windows DLL)
+- added Makefile.nt (thanks to Stephen Williams)
+- added the unsupported "contrib" directory:
+ contrib/asm386/ by Gilles Vollant <info@winimage.com>
+ 386 asm code replacing longest_match().
+ contrib/iostream/ by Kevin Ruland <kevin@rodin.wustl.edu>
+ A C++ I/O streams interface to the zlib gz* functions
+ contrib/iostream2/ by Tyge Løvset <Tyge.Lovset@cmr.no>
+ Another C++ I/O streams interface
+ contrib/untgz/ by "Pedro A. Aranda Guti\irrez" <paag@tid.es>
+ A very simple tar.gz file extractor using zlib
+ contrib/visual-basic.txt by Carlos Rios <c_rios@sonda.cl>
+ How to use compress(), uncompress() and the gz* functions from VB.
+- pass params -f (filtered data), -h (huffman only), -1 to -9 (compression
+ level) in minigzip (thanks to Tom Lane)
+
+- use const for rommable constants in deflate
+- added test for gzseek and gztell in example.c
+- add undocumented function inflateSyncPoint() (hack for Paul Mackerras)
+- add undocumented function zError to convert error code to string
+ (for Tim Smithers)
+- Allow compilation of gzio with -DNO_DEFLATE to avoid the compression code.
+- Use default memcpy for Symantec MSDOS compiler.
+- Add EXPORT keyword for check_func (needed for Windows DLL)
+- add current directory to LD_LIBRARY_PATH for "make test"
+- create also a link for libz.so.1
+- added support for FUJITSU UXP/DS (thanks to Toshiaki Nomura)
+- use $(SHAREDLIB) instead of libz.so in Makefile.in (for HPUX)
+- added -soname for Linux in configure (Chun-Chung Chen,
+- assign numbers to the exported functions in zlib.def (for Windows DLL)
+- add advice in zlib.h for best usage of deflateSetDictionary
+- work around compiler bug on Atari (cast Z_NULL in call of s->checkfn)
+- allow compilation with ANSI keywords only enabled for TurboC in large model
+- avoid "versionString"[0] (Borland bug)
+- add NEED_DUMMY_RETURN for Borland
+- use variable z_verbose for tracing in debug mode (L. Peter Deutsch).
+- allow compilation with CC
+- defined STDC for OS/2 (David Charlap)
+- limit external names to 8 chars for MVS (Thomas Lund)
+- in minigzip.c, use static buffers only for 16-bit systems
+- fix suffix check for "minigzip -d foo.gz"
+- do not return an error for the 2nd of two consecutive gzflush() (Felix Lee)
+- use _fdopen instead of fdopen for MSC >= 6.0 (Thomas Fanslau)
+- added makelcc.bat for lcc-win32 (Tom St Denis)
+- in Makefile.dj2, use copy and del instead of install and rm (Frank Donahoe)
+- Avoid expanded $Id$. Use "rcs -kb" or "cvs admin -kb" to avoid Id expansion.
+- check for unistd.h in configure (for off_t)
+- remove useless check parameter in inflate_blocks_free
+- avoid useless assignment of s->check to itself in inflate_blocks_new
+- do not flush twice in gzclose (thanks to Ken Raeburn)
+- rename FOPEN as F_OPEN to avoid clash with /usr/include/sys/file.h
+- use NO_ERRNO_H instead of enumeration of operating systems with errno.h
+- work around buggy fclose on pipes for HP/UX
+- support zlib DLL with BORLAND C++ 5.0 (thanks to Glenn Randers-Pehrson)
+- fix configure if CC is already equal to gcc
+
+Changes in 1.0.5 (3 Jan 98)
+- Fix inflate to terminate gracefully when fed corrupted or invalid data
+- Use const for rommable constants in inflate
+- Eliminate memory leaks on error conditions in inflate
+- Removed some vestigial code in inflate
+- Update web address in README
+
+Changes in 1.0.4 (24 Jul 96)
+- In very rare conditions, deflate(s, Z_FINISH) could fail to produce an EOF
+ bit, so the decompressor could decompress all the correct data but went
+ on to attempt decompressing extra garbage data. This affected minigzip too.
+- zlibVersion and gzerror return const char* (needed for DLL)
+- port to RISCOS (no fdopen, no multiple dots, no unlink, no fileno)
+- use z_error only for DEBUG (avoid problem with DLLs)
+
+Changes in 1.0.3 (2 Jul 96)
+- use z_streamp instead of z_stream *, which is now a far pointer in MSDOS
+ small and medium models; this makes the library incompatible with previous
+ versions for these models. (No effect in large model or on other systems.)
+- return OK instead of BUF_ERROR if previous deflate call returned with
+ avail_out as zero but there is nothing to do
+- added memcmp for non STDC compilers
+- define NO_DUMMY_DECL for more Mac compilers (.h files merged incorrectly)
+- define __32BIT__ if __386__ or i386 is defined (pb. with Watcom and SCO)
+- better check for 16-bit mode MSC (avoids problem with Symantec)
+
+Changes in 1.0.2 (23 May 96)
+- added Windows DLL support
+- added a function zlibVersion (for the DLL support)
+- fixed declarations using Bytef in infutil.c (pb with MSDOS medium model)
+- Bytef is define's instead of typedef'd only for Borland C
+- avoid reading uninitialized memory in example.c
+- mention in README that the zlib format is now RFC1950
+- updated Makefile.dj2
+- added algorithm.doc
+
+Changes in 1.0.1 (20 May 96) [1.0 skipped to avoid confusion]
+- fix array overlay in deflate.c which sometimes caused bad compressed data
+- fix inflate bug with empty stored block
+- fix MSDOS medium model which was broken in 0.99
+- fix deflateParams() which could generated bad compressed data.
+- Bytef is define'd instead of typedef'ed (work around Borland bug)
+- added an INDEX file
+- new makefiles for DJGPP (Makefile.dj2), 32-bit Borland (Makefile.b32),
+ Watcom (Makefile.wat), Amiga SAS/C (Makefile.sas)
+- speed up adler32 for modern machines without auto-increment
+- added -ansi for IRIX in configure
+- static_init_done in trees.c is an int
+- define unlink as delete for VMS
+- fix configure for QNX
+- add configure branch for SCO and HPUX
+- avoid many warnings (unused variables, dead assignments, etc...)
+- no fdopen for BeOS
+- fix the Watcom fix for 32 bit mode (define FAR as empty)
+- removed redefinition of Byte for MKWERKS
+- work around an MWKERKS bug (incorrect merge of all .h files)
+
+Changes in 0.99 (27 Jan 96)
+- allow preset dictionary shared between compressor and decompressor
+- allow compression level 0 (no compression)
+- add deflateParams in zlib.h: allow dynamic change of compression level
+ and compression strategy.
+- test large buffers and deflateParams in example.c
+- add optional "configure" to build zlib as a shared library
+- suppress Makefile.qnx, use configure instead
+- fixed deflate for 64-bit systems (detected on Cray)
+- fixed inflate_blocks for 64-bit systems (detected on Alpha)
+- declare Z_DEFLATED in zlib.h (possible parameter for deflateInit2)
+- always return Z_BUF_ERROR when deflate() has nothing to do
+- deflateInit and inflateInit are now macros to allow version checking
+- prefix all global functions and types with z_ with -DZ_PREFIX
+- make falloc completely reentrant (inftrees.c)
+- fixed very unlikely race condition in ct_static_init
+- free in reverse order of allocation to help memory manager
+- use zlib-1.0/* instead of zlib/* inside the tar.gz
+- make zlib warning-free with "gcc -O3 -Wall -Wwrite-strings -Wpointer-arith
+ -Wconversion -Wstrict-prototypes -Wmissing-prototypes"
+- allow gzread on concatenated .gz files
+- deflateEnd now returns Z_DATA_ERROR if it was premature
+- deflate is finally (?) fully deterministic (no matches beyond end of input)
+- Document Z_SYNC_FLUSH
+- add uninstall in Makefile
+- Check for __cpluplus in zlib.h
+- Better test in ct_align for partial flush
+- avoid harmless warnings for Borland C++
+- initialize hash_head in deflate.c
+- avoid warning on fdopen (gzio.c) for HP cc -Aa
+- include stdlib.h for STDC compilers
+- include errno.h for Cray
+- ignore error if ranlib doesn't exist
+- call ranlib twice for NeXTSTEP
+- use exec_prefix instead of prefix for libz.a
+- renamed ct_* as _tr_* to avoid conflict with applications
+- clear z->msg in inflateInit2 before any error return
+- initialize opaque in example.c, gzio.c, deflate.c and inflate.c
+- fixed typo in zconf.h (_GNUC__ => __GNUC__)
+- check for WIN32 in zconf.h and zutil.c (avoid farmalloc in 32-bit mode)
+- fix typo in Make_vms.com (f$trnlnm -> f$getsyi)
+- in fcalloc, normalize pointer if size > 65520 bytes
+- don't use special fcalloc for 32 bit Borland C++
+- use STDC instead of __GO32__ to avoid redeclaring exit, calloc, etc...
+- use Z_BINARY instead of BINARY
+- document that gzclose after gzdopen will close the file
+- allow "a" as mode in gzopen.
+- fix error checking in gzread
+- allow skipping .gz extra-field on pipes
+- added reference to Perl interface in README
+- put the crc table in FAR data (I dislike more and more the medium model :)
+- added get_crc_table
+- added a dimension to all arrays (Borland C can't count).
+- workaround Borland C bug in declaration of inflate_codes_new & inflate_fast
+- guard against multiple inclusion of *.h (for precompiled header on Mac)
+- Watcom C pretends to be Microsoft C small model even in 32 bit mode.
+- don't use unsized arrays to avoid silly warnings by Visual C++:
+ warning C4746: 'inflate_mask' : unsized array treated as '__far'
+ (what's wrong with far data in far model?).
+- define enum out of inflate_blocks_state to allow compilation with C++
+
+Changes in 0.95 (16 Aug 95)
+- fix MSDOS small and medium model (now easier to adapt to any compiler)
+- inlined send_bits
+- fix the final (:-) bug for deflate with flush (output was correct but
+ not completely flushed in rare occasions).
+- default window size is same for compression and decompression
+ (it's now sufficient to set MAX_WBITS in zconf.h).
+- voidp -> voidpf and voidnp -> voidp (for consistency with other
+ typedefs and because voidnp was not near in large model).
+
+Changes in 0.94 (13 Aug 95)
+- support MSDOS medium model
+- fix deflate with flush (could sometimes generate bad output)
+- fix deflateReset (zlib header was incorrectly suppressed)
+- added support for VMS
+- allow a compression level in gzopen()
+- gzflush now calls fflush
+- For deflate with flush, flush even if no more input is provided.
+- rename libgz.a as libz.a
+- avoid complex expression in infcodes.c triggering Turbo C bug
+- work around a problem with gcc on Alpha (in INSERT_STRING)
+- don't use inline functions (problem with some gcc versions)
+- allow renaming of Byte, uInt, etc... with #define.
+- avoid warning about (unused) pointer before start of array in deflate.c
+- avoid various warnings in gzio.c, example.c, infblock.c, adler32.c, zutil.c
+- avoid reserved word 'new' in trees.c
+
+Changes in 0.93 (25 June 95)
+- temporarily disable inline functions
+- make deflate deterministic
+- give enough lookahead for PARTIAL_FLUSH
+- Set binary mode for stdin/stdout in minigzip.c for OS/2
+- don't even use signed char in inflate (not portable enough)
+- fix inflate memory leak for segmented architectures
+
+Changes in 0.92 (3 May 95)
+- don't assume that char is signed (problem on SGI)
+- Clear bit buffer when starting a stored block
+- no memcpy on Pyramid
+- suppressed inftest.c
+- optimized fill_window, put longest_match inline for gcc
+- optimized inflate on stored blocks.
+- untabify all sources to simplify patches
+
+Changes in 0.91 (2 May 95)
+- Default MEM_LEVEL is 8 (not 9 for Unix) as documented in zlib.h
+- Document the memory requirements in zconf.h
+- added "make install"
+- fix sync search logic in inflateSync
+- deflate(Z_FULL_FLUSH) now works even if output buffer too short
+- after inflateSync, don't scare people with just "lo world"
+- added support for DJGPP
+
+Changes in 0.9 (1 May 95)
+- don't assume that zalloc clears the allocated memory (the TurboC bug
+ was Mark's bug after all :)
+- let again gzread copy uncompressed data unchanged (was working in 0.71)
+- deflate(Z_FULL_FLUSH), inflateReset and inflateSync are now fully implemented
+- added a test of inflateSync in example.c
+- moved MAX_WBITS to zconf.h because users might want to change that.
+- document explicitly that zalloc(64K) on MSDOS must return a normalized
+ pointer (zero offset)
+- added Makefiles for Microsoft C, Turbo C, Borland C++
+- faster crc32()
+
+Changes in 0.8 (29 April 95)
+- added fast inflate (inffast.c)
+- deflate(Z_FINISH) now returns Z_STREAM_END when done. Warning: this
+ is incompatible with previous versions of zlib which returned Z_OK.
+- work around a TurboC compiler bug (bad code for b << 0, see infutil.h)
+ (actually that was not a compiler bug, see 0.81 above)
+- gzread no longer reads one extra byte in certain cases
+- In gzio destroy(), don't reference a freed structure
+- avoid many warnings for MSDOS
+- avoid the ERROR symbol which is used by MS Windows
+
+Changes in 0.71 (14 April 95)
+- Fixed more MSDOS compilation problems :( There is still a bug with
+ TurboC large model.
+
+Changes in 0.7 (14 April 95)
+- Added full inflate support.
+- Simplified the crc32() interface. The pre- and post-conditioning
+ (one's complement) is now done inside crc32(). WARNING: this is
+ incompatible with previous versions; see zlib.h for the new usage.
+
+Changes in 0.61 (12 April 95)
+- workaround for a bug in TurboC. example and minigzip now work on MSDOS.
+
+Changes in 0.6 (11 April 95)
+- added minigzip.c
+- added gzdopen to reopen a file descriptor as gzFile
+- added transparent reading of non-gziped files in gzread.
+- fixed bug in gzread (don't read crc as data)
+- fixed bug in destroy (gzio.c) (don't return Z_STREAM_END for gzclose).
+- don't allocate big arrays in the stack (for MSDOS)
+- fix some MSDOS compilation problems
+
+Changes in 0.5:
+- do real compression in deflate.c. Z_PARTIAL_FLUSH is supported but
+ not yet Z_FULL_FLUSH.
+- support decompression but only in a single step (forced Z_FINISH)
+- added opaque object for zalloc and zfree.
+- added deflateReset and inflateReset
+- added a variable zlib_version for consistency checking.
+- renamed the 'filter' parameter of deflateInit2 as 'strategy'.
+ Added Z_FILTERED and Z_HUFFMAN_ONLY constants.
+
+Changes in 0.4:
+- avoid "zip" everywhere, use zlib instead of ziplib.
+- suppress Z_BLOCK_FLUSH, interpret Z_PARTIAL_FLUSH as block flush
+ if compression method == 8.
+- added adler32 and crc32
+- renamed deflateOptions as deflateInit2, call one or the other but not both
+- added the method parameter for deflateInit2.
+- added inflateInit2
+- simplied considerably deflateInit and inflateInit by not supporting
+ user-provided history buffer. This is supported only in deflateInit2
+ and inflateInit2.
+
+Changes in 0.3:
+- prefix all macro names with Z_
+- use Z_FINISH instead of deflateEnd to finish compression.
+- added Z_HUFFMAN_ONLY
+- added gzerror()
--- /dev/null
+
+ Frequently Asked Questions about zlib
+
+
+If your question is not there, please check the zlib home page
+http://www.cdrom.com/pub/infozip/zlib/ which may have more recent information.
+
+
+1) I need a Windows DLL
+2) I need a Visual Basic interface to zlib
+3) compress() returns Z_BUF_ERROR
+4) deflate or inflate returns Z_BUF_ERROR
+5) Where is the zlib documentation (man pages, etc...)?
+6) Why don't you use GNU autoconf, libtool, etc...?
+7) There is a bug in zlib.
+8) I get "undefined reference to gzputc"
+
+
+
+1) I need a Windows DLL
+
+ The zlib sources can be compiled without change to produce a DLL.
+ If you want a precompiled DLL, see http://www.winimage.com/zLibDll
+
+
+2) I need a Visual Basic interface to zlib
+
+ See http://www.tcfb.com/dowseware/cmp-z-it.zip
+ http://web2.airmail.net/markn/articles/zlibtool/zlibtool.htm
+ and contrib/visual-basic.txt
+
+3) compress() returns Z_BUF_ERROR
+
+ Make sure that before the call of compress, the length of the
+ compressed buffer is equal to the total size of the compressed buffer
+ and not zero. For Visual Basic, check that this parameter is passed
+ by reference ("as any"), not by value ("as long").
+
+
+4) deflate or inflate returns Z_BUF_ERROR
+
+ Make sure that before the call avail_in and avail_out are not zero.
+
+
+5) Where is the zlib documentation (man pages, etc...)?
+
+ It's in zlib.h for the moment. Volunteers to transform this
+ to man pages, please contact jloup@gzip.org. Examples of zlib usage
+ are in the files example.c and minigzip.c.
+
+
+6) Why don't you use GNU autoconf, libtool, etc...?
+
+ Because we would like to keep zlib as a very small and simple package.
+ zlib is rather portable and doesn't need much configuration.
+
+
+7) There is a bug in zlib.
+
+ Most of the time, such problems are due to an incorrect usage
+ of zlib. Please try to reproduce the problem with a small
+ program and send us the corresponding source at zlib@quest.jpl.nasa.gov
+ Do not send multi-megabyte data files without prior agreement.
+
+
+8) I get "undefined reference to gzputc"
+
+ If "make test" produces something like
+ example.o(.text+0x174):
+ check that you don't have old files libz.* in /usr/lib, /usr/local/lib
+ or /usr/X11R6/lib. Remove old versions then do "make install".
+
--- /dev/null
+ChangeLog history of changes
+INDEX this file
+FAQ Frequently Asked Questions about zlib
+Make_vms.com script for Vax/VMS
+Makefile makefile for Unix (generated by configure)
+Makefile.in makefile for Unix (template for configure)
+Makefile.riscos makefile for RISCOS
+README guess what
+algorithm.txt description of the (de)compression algorithm
+configure configure script for Unix
+descrip.mms makefile for Vax/VMS
+zlib.3 mini man page for zlib (volunteers to write full
+ man pages from zlib.h welcome. write to jloup@gzip.org)
+
+amiga/Makefile.sas makefile for Amiga SAS/C
+amiga/Makefile.pup makefile for Amiga powerUP SAS/C PPC
+
+msdos/Makefile.w32 makefile for Microsoft Visual C++ 32-bit
+msdos/Makefile.b32 makefile for Borland C++ 32-bit
+msdos/Makefile.bor makefile for Borland C/C++ 16-bit
+msdos/Makefile.dj2 makefile for DJGPP 2.x
+msdos/Makefile.emx makefile for EMX 0.9c (32-bit DOS/OS2)
+msdos/Makefile.msc makefile for Microsoft C 16-bit
+msdos/Makefile.tc makefile for Turbo C
+msdos/Makefile.wat makefile for Watcom C
+msdos/zlib.def definition file for Windows DLL
+msdos/zlib.rc definition file for Windows DLL
+
+nt/Makefile.nt makefile for Windows NT
+nt/zlib.dnt definition file for Windows NT DLL
+nt/Makefile.emx makefile for EMX 0.9c/RSXNT 1.41 (Win32 Intel)
+nt/Makefile.gcc makefile for Windows NT using GCC (mingw32)
+
+
+ zlib public header files (must be kept):
+zconf.h
+zlib.h
+
+ private source files used to build the zlib library:
+adler32.c
+compress.c
+crc32.c
+deflate.c
+deflate.h
+gzio.c
+infblock.c
+infblock.h
+infcodes.c
+infcodes.h
+inffast.c
+inffast.h
+inflate.c
+inftrees.c
+inftrees.h
+infutil.c
+infutil.h
+maketree.c
+trees.c
+uncompr.c
+zutil.c
+zutil.h
+
+ source files for sample programs:
+example.c
+minigzip.c
+
+ unsupported contribution by third parties
+
+contrib/asm386/ by Gilles Vollant <info@winimage.com>
+ 386 asm code replacing longest_match().
+
+contrib/minizip/ by Gilles Vollant <info@winimage.com>
+ Mini zip and unzip based on zlib
+ See http://www.winimage.com/zLibDll/unzip.html
+
+contrib/iostream/ by Kevin Ruland <kevin@rodin.wustl.edu>
+ A C++ I/O streams interface to the zlib gz* functions
+
+contrib/iostream2/ by Tyge Løvset <Tyge.Lovset@cmr.no>
+ Another C++ I/O streams interface
+
+contrib/untgz/ by "Pedro A. Aranda Guti\irrez" <paag@tid.es>
+ A very simple tar.gz extractor using zlib
+
+contrib/visual-basic.txt by Carlos Rios <c_rios@sonda.cl>
+ How to use compress(), uncompress() and the gz* functions from VB.
--- /dev/null
+$! make libz under VMS
+$! written by Martin P.J. Zinser <m.zinser@gsi.de>
+$!
+$! Look for the compiler used
+$!
+$ ccopt = ""
+$ if f$getsyi("HW_MODEL").ge.1024
+$ then
+$ ccopt = "/prefix=all"+ccopt
+$ comp = "__decc__=1"
+$ if f$trnlnm("SYS").eqs."" then define sys sys$library:
+$ else
+$ if f$search("SYS$SYSTEM:DECC$COMPILER.EXE").eqs.""
+$ then
+$ comp = "__vaxc__=1"
+$ if f$trnlnm("SYS").eqs."" then define sys sys$library:
+$ else
+$ if f$trnlnm("SYS").eqs."" then define sys decc$library_include:
+$ ccopt = "/decc/prefix=all"+ccopt
+$ comp = "__decc__=1"
+$ endif
+$ endif
+$!
+$! Build the thing plain or with mms
+$!
+$ write sys$output "Compiling Zlib sources ..."
+$ if f$search("SYS$SYSTEM:MMS.EXE").eqs.""
+$ then
+$ dele example.obj;*,minigzip.obj;*
+$ CALL MAKE adler32.OBJ "CC ''CCOPT' adler32" -
+ adler32.c zlib.h zconf.h
+$ CALL MAKE compress.OBJ "CC ''CCOPT' compress" -
+ compress.c zlib.h zconf.h
+$ CALL MAKE crc32.OBJ "CC ''CCOPT' crc32" -
+ crc32.c zlib.h zconf.h
+$ CALL MAKE deflate.OBJ "CC ''CCOPT' deflate" -
+ deflate.c deflate.h zutil.h zlib.h zconf.h
+$ CALL MAKE gzio.OBJ "CC ''CCOPT' gzio" -
+ gzio.c zutil.h zlib.h zconf.h
+$ CALL MAKE infblock.OBJ "CC ''CCOPT' infblock" -
+ infblock.c zutil.h zlib.h zconf.h infblock.h
+$ CALL MAKE infcodes.OBJ "CC ''CCOPT' infcodes" -
+ infcodes.c zutil.h zlib.h zconf.h inftrees.h
+$ CALL MAKE inffast.OBJ "CC ''CCOPT' inffast" -
+ inffast.c zutil.h zlib.h zconf.h inffast.h
+$ CALL MAKE inflate.OBJ "CC ''CCOPT' inflate" -
+ inflate.c zutil.h zlib.h zconf.h infblock.h
+$ CALL MAKE inftrees.OBJ "CC ''CCOPT' inftrees" -
+ inftrees.c zutil.h zlib.h zconf.h inftrees.h
+$ CALL MAKE infutil.OBJ "CC ''CCOPT' infutil" -
+ infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h
+$ CALL MAKE trees.OBJ "CC ''CCOPT' trees" -
+ trees.c deflate.h zutil.h zlib.h zconf.h
+$ CALL MAKE uncompr.OBJ "CC ''CCOPT' uncompr" -
+ uncompr.c zlib.h zconf.h
+$ CALL MAKE zutil.OBJ "CC ''CCOPT' zutil" -
+ zutil.c zutil.h zlib.h zconf.h
+$ write sys$output "Building Zlib ..."
+$ CALL MAKE libz.OLB "lib/crea libz.olb *.obj" *.OBJ
+$ write sys$output "Building example..."
+$ CALL MAKE example.OBJ "CC ''CCOPT' example" -
+ example.c zlib.h zconf.h
+$ call make example.exe "LINK example,libz.olb/lib" example.obj libz.olb
+$ write sys$output "Building minigzip..."
+$ CALL MAKE minigzip.OBJ "CC ''CCOPT' minigzip" -
+ minigzip.c zlib.h zconf.h
+$ call make minigzip.exe -
+ "LINK minigzip,libz.olb/lib,x11vms:xvmsutils.olb/lib" -
+ minigzip.obj libz.olb
+$ else
+$ mms/macro=('comp')
+$ endif
+$ write sys$output "Zlib build completed"
+$ exit
+$!
+$!
+$MAKE: SUBROUTINE !SUBROUTINE TO CHECK DEPENDENCIES
+$ V = 'F$Verify(0)
+$! P1 = What we are trying to make
+$! P2 = Command to make it
+$! P3 - P8 What it depends on
+$
+$ If F$Search(P1) .Eqs. "" Then Goto Makeit
+$ Time = F$CvTime(F$File(P1,"RDT"))
+$arg=3
+$Loop:
+$ Argument = P'arg
+$ If Argument .Eqs. "" Then Goto Exit
+$ El=0
+$Loop2:
+$ File = F$Element(El," ",Argument)
+$ If File .Eqs. " " Then Goto Endl
+$ AFile = ""
+$Loop3:
+$ OFile = AFile
+$ AFile = F$Search(File)
+$ If AFile .Eqs. "" .Or. AFile .Eqs. OFile Then Goto NextEl
+$ If F$CvTime(F$File(AFile,"RDT")) .Ges. Time Then Goto Makeit
+$ Goto Loop3
+$NextEL:
+$ El = El + 1
+$ Goto Loop2
+$EndL:
+$ arg=arg+1
+$ If arg .Le. 8 Then Goto Loop
+$ Goto Exit
+$
+$Makeit:
+$ VV=F$VERIFY(0)
+$ write sys$output P2
+$ 'P2
+$ VV='F$Verify(VV)
+$Exit:
+$ If V Then Set Verify
+$ENDSUBROUTINE
--- /dev/null
+# Makefile for zlib
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile and test, type:
+# ./configure; make test
+# The call of configure is optional if you don't have special requirements
+# If you wish to build zlib as a shared library, use: ./configure -s
+
+# To install /usr/local/lib/libz.* and /usr/local/include/zlib.h, type:
+# make install
+# To install in $HOME instead of /usr/local, use:
+# make install prefix=$HOME
+
+CC=cc
+
+CFLAGS=-O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-g -DDEBUG
+#CFLAGS=-O3 -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+# -Wstrict-prototypes -Wmissing-prototypes
+
+LDFLAGS=-L. -lz
+LDSHARED=$(CC)
+CPP=$(CC) -E
+
+VER=1.1.3
+LIBS=libz.a
+SHAREDLIB=libz.so
+
+AR=ar rc
+RANLIB=ranlib
+TAR=tar
+SHELL=/bin/sh
+
+prefix = /usr/local
+exec_prefix = ${prefix}
+libdir = ${exec_prefix}/lib
+includedir = ${prefix}/include
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+OBJA =
+# to use the asm code: make OBJA=match.o
+
+TEST_OBJS = example.o minigzip.o
+
+DISTFILES = README FAQ INDEX ChangeLog configure Make*[a-z0-9] *.[ch] *.mms \
+ algorithm.txt zlib.3 msdos/Make*[a-z0-9] msdos/zlib.def msdos/zlib.rc \
+ nt/Make*[a-z0-9] nt/zlib.dnt amiga/Make*.??? os2/M*.os2 os2/zlib.def \
+ contrib/RE*.contrib contrib/*.txt contrib/asm386/*.asm contrib/asm386/*.c \
+ contrib/asm386/*.bat contrib/asm386/zlibvc.d?? contrib/asm[56]86/*.?86 \
+ contrib/asm[56]86/*.S contrib/iostream/*.cpp \
+ contrib/iostream/*.h contrib/iostream2/*.h contrib/iostream2/*.cpp \
+ contrib/untgz/Makefile contrib/untgz/*.c contrib/untgz/*.w32 \
+ contrib/minizip/[CM]*[pe] contrib/minizip/*.[ch] contrib/minizip/*.[td]?? \
+ contrib/delphi*/*.???
+
+all: example minigzip
+
+test: all
+ @LD_LIBRARY_PATH=.:$(LD_LIBRARY_PATH) ; export LD_LIBRARY_PATH; \
+ echo hello world | ./minigzip | ./minigzip -d || \
+ echo ' *** minigzip test FAILED ***' ; \
+ if ./example; then \
+ echo ' *** zlib test OK ***'; \
+ else \
+ echo ' *** zlib test FAILED ***'; \
+ fi
+
+libz.a: $(OBJS) $(OBJA)
+ $(AR) $@ $(OBJS) $(OBJA)
+ -@ ($(RANLIB) $@ || true) >/dev/null 2>&1
+
+match.o: match.S
+ $(CPP) match.S > _match.s
+ $(CC) -c _match.s
+ mv _match.o match.o
+ rm -f _match.s
+
+$(SHAREDLIB).$(VER): $(OBJS)
+ $(LDSHARED) -o $@ $(OBJS)
+ rm -f $(SHAREDLIB) $(SHAREDLIB).1
+ ln -s $@ $(SHAREDLIB)
+ ln -s $@ $(SHAREDLIB).1
+
+example: example.o $(LIBS)
+ $(CC) $(CFLAGS) -o $@ example.o $(LDFLAGS)
+
+minigzip: minigzip.o $(LIBS)
+ $(CC) $(CFLAGS) -o $@ minigzip.o $(LDFLAGS)
+
+install: $(LIBS)
+ -@if [ ! -d $(includedir) ]; then mkdir $(includedir); fi
+ -@if [ ! -d $(libdir) ]; then mkdir $(libdir); fi
+ cp zlib.h zconf.h $(includedir)
+ chmod 644 $(includedir)/zlib.h $(includedir)/zconf.h
+ cp $(LIBS) $(libdir)
+ cd $(libdir); chmod 755 $(LIBS)
+ -@(cd $(libdir); $(RANLIB) libz.a || true) >/dev/null 2>&1
+ cd $(libdir); if test -f $(SHAREDLIB).$(VER); then \
+ rm -f $(SHAREDLIB) $(SHAREDLIB).1; \
+ ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB); \
+ ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB).1; \
+ (ldconfig || true) >/dev/null 2>&1; \
+ fi
+# The ranlib in install is needed on NeXTSTEP which checks file times
+# ldconfig is for Linux
+
+uninstall:
+ cd $(includedir); \
+ v=$(VER); \
+ if test -f zlib.h; then \
+ v=`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`; \
+ rm -f zlib.h zconf.h; \
+ fi; \
+ cd $(libdir); rm -f libz.a; \
+ if test -f $(SHAREDLIB).$$v; then \
+ rm -f $(SHAREDLIB).$$v $(SHAREDLIB) $(SHAREDLIB).1; \
+ fi
+
+clean:
+ rm -f *.o *~ example minigzip libz.a libz.so* foo.gz so_locations \
+ _match.s maketree
+
+distclean: clean
+
+zip:
+ mv Makefile Makefile~; cp -p Makefile.in Makefile
+ rm -f test.c ztest*.c contrib/minizip/test.zip
+ v=`sed -n -e 's/\.//g' -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\
+ zip -ul9 zlib$$v $(DISTFILES)
+ mv Makefile~ Makefile
+
+dist:
+ mv Makefile Makefile~; cp -p Makefile.in Makefile
+ rm -f test.c ztest*.c contrib/minizip/test.zip
+ d=zlib-`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\
+ rm -f $$d.tar.gz; \
+ if test ! -d ../$$d; then rm -f ../$$d; ln -s `pwd` ../$$d; fi; \
+ files=""; \
+ for f in $(DISTFILES); do files="$$files $$d/$$f"; done; \
+ cd ..; \
+ GZIP=-9 $(TAR) chofz $$d/$$d.tar.gz $$files; \
+ if test ! -d $$d; then rm -f $$d; fi
+ mv Makefile~ Makefile
+
+tags:
+ etags *.[ch]
+
+depend:
+ makedepend -- $(CFLAGS) -- *.[ch]
+
+# DO NOT DELETE THIS LINE -- make depend depends on it.
+
+adler32.o: zlib.h zconf.h
+compress.o: zlib.h zconf.h
+crc32.o: zlib.h zconf.h
+deflate.o: deflate.h zutil.h zlib.h zconf.h
+example.o: zlib.h zconf.h
+gzio.o: zutil.h zlib.h zconf.h
+infblock.o: infblock.h inftrees.h infcodes.h infutil.h zutil.h zlib.h zconf.h
+infcodes.o: zutil.h zlib.h zconf.h
+infcodes.o: inftrees.h infblock.h infcodes.h infutil.h inffast.h
+inffast.o: zutil.h zlib.h zconf.h inftrees.h
+inffast.o: infblock.h infcodes.h infutil.h inffast.h
+inflate.o: zutil.h zlib.h zconf.h infblock.h
+inftrees.o: zutil.h zlib.h zconf.h inftrees.h
+infutil.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h
+minigzip.o: zlib.h zconf.h
+trees.o: deflate.h zutil.h zlib.h zconf.h trees.h
+uncompr.o: zlib.h zconf.h
+zutil.o: zutil.h zlib.h zconf.h
--- /dev/null
+# Makefile for zlib
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile and test, type:
+# ./configure; make test
+# The call of configure is optional if you don't have special requirements
+# If you wish to build zlib as a shared library, use: ./configure -s
+
+# To install /usr/local/lib/libz.* and /usr/local/include/zlib.h, type:
+# make install
+# To install in $HOME instead of /usr/local, use:
+# make install prefix=$HOME
+
+CC=cc
+
+CFLAGS=-O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-g -DDEBUG
+#CFLAGS=-O3 -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+# -Wstrict-prototypes -Wmissing-prototypes
+
+LDFLAGS=-L. -lz
+LDSHARED=$(CC)
+CPP=$(CC) -E
+
+VER=1.1.3
+LIBS=libz.a
+SHAREDLIB=libz.so
+
+AR=ar rc
+RANLIB=ranlib
+TAR=tar
+SHELL=/bin/sh
+
+prefix = /usr/local
+exec_prefix = ${prefix}
+libdir = ${exec_prefix}/lib
+includedir = ${prefix}/include
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+OBJA =
+# to use the asm code: make OBJA=match.o
+
+TEST_OBJS = example.o minigzip.o
+
+DISTFILES = README FAQ INDEX ChangeLog configure Make*[a-z0-9] *.[ch] *.mms \
+ algorithm.txt zlib.3 msdos/Make*[a-z0-9] msdos/zlib.def msdos/zlib.rc \
+ nt/Make*[a-z0-9] nt/zlib.dnt amiga/Make*.??? os2/M*.os2 os2/zlib.def \
+ contrib/RE*.contrib contrib/*.txt contrib/asm386/*.asm contrib/asm386/*.c \
+ contrib/asm386/*.bat contrib/asm386/zlibvc.d?? contrib/asm[56]86/*.?86 \
+ contrib/asm[56]86/*.S contrib/iostream/*.cpp \
+ contrib/iostream/*.h contrib/iostream2/*.h contrib/iostream2/*.cpp \
+ contrib/untgz/Makefile contrib/untgz/*.c contrib/untgz/*.w32 \
+ contrib/minizip/[CM]*[pe] contrib/minizip/*.[ch] contrib/minizip/*.[td]?? \
+ contrib/delphi*/*.???
+
+all: example minigzip
+
+test: all
+ @LD_LIBRARY_PATH=.:$(LD_LIBRARY_PATH) ; export LD_LIBRARY_PATH; \
+ echo hello world | ./minigzip | ./minigzip -d || \
+ echo ' *** minigzip test FAILED ***' ; \
+ if ./example; then \
+ echo ' *** zlib test OK ***'; \
+ else \
+ echo ' *** zlib test FAILED ***'; \
+ fi
+
+libz.a: $(OBJS) $(OBJA)
+ $(AR) $@ $(OBJS) $(OBJA)
+ -@ ($(RANLIB) $@ || true) >/dev/null 2>&1
+
+match.o: match.S
+ $(CPP) match.S > _match.s
+ $(CC) -c _match.s
+ mv _match.o match.o
+ rm -f _match.s
+
+$(SHAREDLIB).$(VER): $(OBJS)
+ $(LDSHARED) -o $@ $(OBJS)
+ rm -f $(SHAREDLIB) $(SHAREDLIB).1
+ ln -s $@ $(SHAREDLIB)
+ ln -s $@ $(SHAREDLIB).1
+
+example: example.o $(LIBS)
+ $(CC) $(CFLAGS) -o $@ example.o $(LDFLAGS)
+
+minigzip: minigzip.o $(LIBS)
+ $(CC) $(CFLAGS) -o $@ minigzip.o $(LDFLAGS)
+
+install: $(LIBS)
+ -@if [ ! -d $(includedir) ]; then mkdir $(includedir); fi
+ -@if [ ! -d $(libdir) ]; then mkdir $(libdir); fi
+ cp zlib.h zconf.h $(includedir)
+ chmod 644 $(includedir)/zlib.h $(includedir)/zconf.h
+ cp $(LIBS) $(libdir)
+ cd $(libdir); chmod 755 $(LIBS)
+ -@(cd $(libdir); $(RANLIB) libz.a || true) >/dev/null 2>&1
+ cd $(libdir); if test -f $(SHAREDLIB).$(VER); then \
+ rm -f $(SHAREDLIB) $(SHAREDLIB).1; \
+ ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB); \
+ ln -s $(SHAREDLIB).$(VER) $(SHAREDLIB).1; \
+ (ldconfig || true) >/dev/null 2>&1; \
+ fi
+# The ranlib in install is needed on NeXTSTEP which checks file times
+# ldconfig is for Linux
+
+uninstall:
+ cd $(includedir); \
+ v=$(VER); \
+ if test -f zlib.h; then \
+ v=`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`; \
+ rm -f zlib.h zconf.h; \
+ fi; \
+ cd $(libdir); rm -f libz.a; \
+ if test -f $(SHAREDLIB).$$v; then \
+ rm -f $(SHAREDLIB).$$v $(SHAREDLIB) $(SHAREDLIB).1; \
+ fi
+
+clean:
+ rm -f *.o *~ example minigzip libz.a libz.so* foo.gz so_locations \
+ _match.s maketree
+
+distclean: clean
+
+zip:
+ mv Makefile Makefile~; cp -p Makefile.in Makefile
+ rm -f test.c ztest*.c contrib/minizip/test.zip
+ v=`sed -n -e 's/\.//g' -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\
+ zip -ul9 zlib$$v $(DISTFILES)
+ mv Makefile~ Makefile
+
+dist:
+ mv Makefile Makefile~; cp -p Makefile.in Makefile
+ rm -f test.c ztest*.c contrib/minizip/test.zip
+ d=zlib-`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\
+ rm -f $$d.tar.gz; \
+ if test ! -d ../$$d; then rm -f ../$$d; ln -s `pwd` ../$$d; fi; \
+ files=""; \
+ for f in $(DISTFILES); do files="$$files $$d/$$f"; done; \
+ cd ..; \
+ GZIP=-9 $(TAR) chofz $$d/$$d.tar.gz $$files; \
+ if test ! -d $$d; then rm -f $$d; fi
+ mv Makefile~ Makefile
+
+tags:
+ etags *.[ch]
+
+depend:
+ makedepend -- $(CFLAGS) -- *.[ch]
+
+# DO NOT DELETE THIS LINE -- make depend depends on it.
+
+adler32.o: zlib.h zconf.h
+compress.o: zlib.h zconf.h
+crc32.o: zlib.h zconf.h
+deflate.o: deflate.h zutil.h zlib.h zconf.h
+example.o: zlib.h zconf.h
+gzio.o: zutil.h zlib.h zconf.h
+infblock.o: infblock.h inftrees.h infcodes.h infutil.h zutil.h zlib.h zconf.h
+infcodes.o: zutil.h zlib.h zconf.h
+infcodes.o: inftrees.h infblock.h infcodes.h infutil.h inffast.h
+inffast.o: zutil.h zlib.h zconf.h inftrees.h
+inffast.o: infblock.h infcodes.h infutil.h inffast.h
+inflate.o: zutil.h zlib.h zconf.h infblock.h
+inftrees.o: zutil.h zlib.h zconf.h inftrees.h
+infutil.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h
+minigzip.o: zlib.h zconf.h
+trees.o: deflate.h zutil.h zlib.h zconf.h trees.h
+uncompr.o: zlib.h zconf.h
+zutil.o: zutil.h zlib.h zconf.h
--- /dev/null
+# Project: zlib_1_03
+# Patched for zlib 1.1.2 rw@shadow.org.uk 19980430
+# test works out-of-the-box, installs `somewhere' on demand
+
+# Toolflags:
+CCflags = -c -depend !Depend -IC: -g -throwback -DRISCOS -fah
+C++flags = -c -depend !Depend -IC: -throwback
+Linkflags = -aif -c++ -o $@
+ObjAsmflags = -throwback -NoCache -depend !Depend
+CMHGflags =
+LibFileflags = -c -l -o $@
+Squeezeflags = -o $@
+
+# change the line below to where _you_ want the library installed.
+libdest = lib:zlib
+
+# Final targets:
+@.lib: @.o.adler32 @.o.compress @.o.crc32 @.o.deflate @.o.gzio \
+ @.o.infblock @.o.infcodes @.o.inffast @.o.inflate @.o.inftrees @.o.infutil @.o.trees \
+ @.o.uncompr @.o.zutil
+ LibFile $(LibFileflags) @.o.adler32 @.o.compress @.o.crc32 @.o.deflate \
+ @.o.gzio @.o.infblock @.o.infcodes @.o.inffast @.o.inflate @.o.inftrees @.o.infutil \
+ @.o.trees @.o.uncompr @.o.zutil
+test: @.minigzip @.example @.lib
+ @copy @.lib @.libc A~C~DF~L~N~P~Q~RS~TV
+ @echo running tests: hang on.
+ @/@.minigzip -f -9 libc
+ @/@.minigzip -d libc-gz
+ @/@.minigzip -f -1 libc
+ @/@.minigzip -d libc-gz
+ @/@.minigzip -h -9 libc
+ @/@.minigzip -d libc-gz
+ @/@.minigzip -h -1 libc
+ @/@.minigzip -d libc-gz
+ @/@.minigzip -9 libc
+ @/@.minigzip -d libc-gz
+ @/@.minigzip -1 libc
+ @/@.minigzip -d libc-gz
+ @diff @.lib @.libc
+ @echo that should have reported '@.lib and @.libc identical' if you have diff.
+ @/@.example @.fred @.fred
+ @echo that will have given lots of hello!'s.
+
+@.minigzip: @.o.minigzip @.lib C:o.Stubs
+ Link $(Linkflags) @.o.minigzip @.lib C:o.Stubs
+@.example: @.o.example @.lib C:o.Stubs
+ Link $(Linkflags) @.o.example @.lib C:o.Stubs
+
+install: @.lib
+ cdir $(libdest)
+ cdir $(libdest).h
+ @copy @.h.zlib $(libdest).h.zlib A~C~DF~L~N~P~Q~RS~TV
+ @copy @.h.zconf $(libdest).h.zconf A~C~DF~L~N~P~Q~RS~TV
+ @copy @.lib $(libdest).lib A~C~DF~L~N~P~Q~RS~TV
+ @echo okay, installed zlib in $(libdest)
+
+clean:; remove @.minigzip
+ remove @.example
+ remove @.libc
+ -wipe @.o.* F~r~cV
+ remove @.fred
+
+# User-editable dependencies:
+.c.o:
+ cc $(ccflags) -o $@ $<
+
+# Static dependencies:
+
+# Dynamic dependencies:
+o.example: c.example
+o.example: h.zlib
+o.example: h.zconf
+o.minigzip: c.minigzip
+o.minigzip: h.zlib
+o.minigzip: h.zconf
+o.adler32: c.adler32
+o.adler32: h.zlib
+o.adler32: h.zconf
+o.compress: c.compress
+o.compress: h.zlib
+o.compress: h.zconf
+o.crc32: c.crc32
+o.crc32: h.zlib
+o.crc32: h.zconf
+o.deflate: c.deflate
+o.deflate: h.deflate
+o.deflate: h.zutil
+o.deflate: h.zlib
+o.deflate: h.zconf
+o.gzio: c.gzio
+o.gzio: h.zutil
+o.gzio: h.zlib
+o.gzio: h.zconf
+o.infblock: c.infblock
+o.infblock: h.zutil
+o.infblock: h.zlib
+o.infblock: h.zconf
+o.infblock: h.infblock
+o.infblock: h.inftrees
+o.infblock: h.infcodes
+o.infblock: h.infutil
+o.infcodes: c.infcodes
+o.infcodes: h.zutil
+o.infcodes: h.zlib
+o.infcodes: h.zconf
+o.infcodes: h.inftrees
+o.infcodes: h.infblock
+o.infcodes: h.infcodes
+o.infcodes: h.infutil
+o.infcodes: h.inffast
+o.inffast: c.inffast
+o.inffast: h.zutil
+o.inffast: h.zlib
+o.inffast: h.zconf
+o.inffast: h.inftrees
+o.inffast: h.infblock
+o.inffast: h.infcodes
+o.inffast: h.infutil
+o.inffast: h.inffast
+o.inflate: c.inflate
+o.inflate: h.zutil
+o.inflate: h.zlib
+o.inflate: h.zconf
+o.inflate: h.infblock
+o.inftrees: c.inftrees
+o.inftrees: h.zutil
+o.inftrees: h.zlib
+o.inftrees: h.zconf
+o.inftrees: h.inftrees
+o.inftrees: h.inffixed
+o.infutil: c.infutil
+o.infutil: h.zutil
+o.infutil: h.zlib
+o.infutil: h.zconf
+o.infutil: h.infblock
+o.infutil: h.inftrees
+o.infutil: h.infcodes
+o.infutil: h.infutil
+o.trees: c.trees
+o.trees: h.deflate
+o.trees: h.zutil
+o.trees: h.zlib
+o.trees: h.zconf
+o.trees: h.trees
+o.uncompr: c.uncompr
+o.uncompr: h.zlib
+o.uncompr: h.zconf
+o.zutil: c.zutil
+o.zutil: h.zutil
+o.zutil: h.zlib
+o.zutil: h.zconf
--- /dev/null
+zlib 1.1.3 is a general purpose data compression library. All the code
+is thread safe. The data format used by the zlib library
+is described by RFCs (Request for Comments) 1950 to 1952 in the files
+ftp://ds.internic.net/rfc/rfc1950.txt (zlib format), rfc1951.txt (deflate
+format) and rfc1952.txt (gzip format). These documents are also available in
+other formats from ftp://ftp.uu.net/graphics/png/documents/zlib/zdoc-index.html
+
+All functions of the compression library are documented in the file zlib.h
+(volunteer to write man pages welcome, contact jloup@gzip.org). A usage
+example of the library is given in the file example.c which also tests that
+the library is working correctly. Another example is given in the file
+minigzip.c. The compression library itself is composed of all source files
+except example.c and minigzip.c.
+
+To compile all files and run the test program, follow the instructions
+given at the top of Makefile. In short "make test; make install"
+should work for most machines. For Unix: "configure; make test; make install"
+For MSDOS, use one of the special makefiles such as Makefile.msc.
+For VMS, use Make_vms.com or descrip.mms.
+
+Questions about zlib should be sent to <zlib@quest.jpl.nasa.gov>, or to
+Gilles Vollant <info@winimage.com> for the Windows DLL version.
+The zlib home page is http://www.cdrom.com/pub/infozip/zlib/
+The official zlib ftp site is ftp://ftp.cdrom.com/pub/infozip/zlib/
+Before reporting a problem, please check those sites to verify that
+you have the latest version of zlib; otherwise get the latest version and
+check whether the problem still exists or not.
+
+Mark Nelson <markn@tiny.com> wrote an article about zlib for the Jan. 1997
+issue of Dr. Dobb's Journal; a copy of the article is available in
+http://web2.airmail.net/markn/articles/zlibtool/zlibtool.htm
+
+The changes made in version 1.1.3 are documented in the file ChangeLog.
+The main changes since 1.1.2 are:
+
+- fix "an inflate input buffer bug that shows up on rare but persistent
+ occasions" (Mark)
+- fix gzread and gztell for concatenated .gz files (Didier Le Botlan)
+- fix gzseek(..., SEEK_SET) in write mode
+- fix crc check after a gzeek (Frank Faubert)
+- fix miniunzip when the last entry in a zip file is itself a zip file
+ (J Lillge)
+- add contrib/asm586 and contrib/asm686 (Brian Raiter)
+ See http://www.muppetlabs.com/~breadbox/software/assembly.html
+- add support for Delphi 3 in contrib/delphi (Bob Dellaca)
+- add support for C++Builder 3 and Delphi 3 in contrib/delphi2 (Davide Moretti)
+- do not exit prematurely in untgz if 0 at start of block (Magnus Holmgren)
+- use macro EXTERN instead of extern to support DLL for BeOS (Sander Stoks)
+- added a FAQ file
+
+plus many changes for portability.
+
+Unsupported third party contributions are provided in directory "contrib".
+
+A Java implementation of zlib is available in the Java Development Kit 1.1
+http://www.javasoft.com/products/JDK/1.1/docs/api/Package-java.util.zip.html
+See the zlib home page http://www.cdrom.com/pub/infozip/zlib/ for details.
+
+A Perl interface to zlib written by Paul Marquess <pmarquess@bfsec.bt.co.uk>
+is in the CPAN (Comprehensive Perl Archive Network) sites, such as:
+ftp://ftp.cis.ufl.edu/pub/perl/CPAN/modules/by-module/Compress/Compress-Zlib*
+
+A Python interface to zlib written by A.M. Kuchling <amk@magnet.com>
+is available in Python 1.5 and later versions, see
+http://www.python.org/doc/lib/module-zlib.html
+
+A zlib binding for TCL written by Andreas Kupries <a.kupries@westend.com>
+is availlable at http://www.westend.com/~kupries/doc/trf/man/man.html
+
+An experimental package to read and write files in .zip format,
+written on top of zlib by Gilles Vollant <info@winimage.com>, is
+available at http://www.winimage.com/zLibDll/unzip.html
+and also in the contrib/minizip directory of zlib.
+
+
+Notes for some targets:
+
+- To build a Windows DLL version, include in a DLL project zlib.def, zlib.rc
+ and all .c files except example.c and minigzip.c; compile with -DZLIB_DLL
+ The zlib DLL support was initially done by Alessandro Iacopetti and is
+ now maintained by Gilles Vollant <info@winimage.com>. Check the zlib DLL
+ home page at http://www.winimage.com/zLibDll
+
+ From Visual Basic, you can call the DLL functions which do not take
+ a structure as argument: compress, uncompress and all gz* functions.
+ See contrib/visual-basic.txt for more information, or get
+ http://www.tcfb.com/dowseware/cmp-z-it.zip
+
+- For 64-bit Irix, deflate.c must be compiled without any optimization.
+ With -O, one libpng test fails. The test works in 32 bit mode (with
+ the -n32 compiler flag). The compiler bug has been reported to SGI.
+
+- zlib doesn't work with gcc 2.6.3 on a DEC 3000/300LX under OSF/1 2.1
+ it works when compiled with cc.
+
+- on Digital Unix 4.0D (formely OSF/1) on AlphaServer, the cc option -std1
+ is necessary to get gzprintf working correctly. This is done by configure.
+
+- zlib doesn't work on HP-UX 9.05 with some versions of /bin/cc. It works
+ with other compilers. Use "make test" to check your compiler.
+
+- gzdopen is not supported on RISCOS, BEOS and by some Mac compilers.
+
+- For Turbo C the small model is supported only with reduced performance to
+ avoid any far allocation; it was tested with -DMAX_WBITS=11 -DMAX_MEM_LEVEL=3
+
+- For PalmOs, see http://www.cs.uit.no/~perm/PASTA/pilot/software.html
+ Per Harald Myrvang <perm@stud.cs.uit.no>
+
+
+Acknowledgments:
+
+ The deflate format used by zlib was defined by Phil Katz. The deflate
+ and zlib specifications were written by L. Peter Deutsch. Thanks to all the
+ people who reported problems and suggested various improvements in zlib;
+ they are too numerous to cite here.
+
+Copyright notice:
+
+ (C) 1995-1998 Jean-loup Gailly and Mark Adler
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ Jean-loup Gailly Mark Adler
+ jloup@gzip.org madler@alumni.caltech.edu
+
+If you use the zlib library in a product, we would appreciate *not*
+receiving lengthy legal documents to sign. The sources are provided
+for free but without warranty of any kind. The library has been
+entirely written by Jean-loup Gailly and Mark Adler; it does not
+include third-party code.
+
+If you redistribute modified sources, we would appreciate that you include
+in the file ChangeLog history information documenting your changes.
--- /dev/null
+/* adler32.c -- compute the Adler-32 checksum of a data stream
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include "zlib.h"
+
+#define BASE 65521L /* largest prime smaller than 65536 */
+#define NMAX 5552
+/* NMAX is the largest n such that 255n(n+1)/2 + (n+1)(BASE-1) <= 2^32-1 */
+
+#define DO1(buf,i) {s1 += buf[i]; s2 += s1;}
+#define DO2(buf,i) DO1(buf,i); DO1(buf,i+1);
+#define DO4(buf,i) DO2(buf,i); DO2(buf,i+2);
+#define DO8(buf,i) DO4(buf,i); DO4(buf,i+4);
+#define DO16(buf) DO8(buf,0); DO8(buf,8);
+
+/* ========================================================================= */
+uLong ZEXPORT adler32(adler, buf, len)
+ uLong adler;
+ const Bytef *buf;
+ uInt len;
+{
+ unsigned long s1 = adler & 0xffff;
+ unsigned long s2 = (adler >> 16) & 0xffff;
+ int k;
+
+ if (buf == Z_NULL) return 1L;
+
+ while (len > 0) {
+ k = len < NMAX ? len : NMAX;
+ len -= k;
+ while (k >= 16) {
+ DO16(buf);
+ buf += 16;
+ k -= 16;
+ }
+ if (k != 0) do {
+ s1 += *buf++;
+ s2 += s1;
+ } while (--k);
+ s1 %= BASE;
+ s2 %= BASE;
+ }
+ return (s2 << 16) | s1;
+}
--- /dev/null
+1. Compression algorithm (deflate)
+
+The deflation algorithm used by gzip (also zip and zlib) is a variation of
+LZ77 (Lempel-Ziv 1977, see reference below). It finds duplicated strings in
+the input data. The second occurrence of a string is replaced by a
+pointer to the previous string, in the form of a pair (distance,
+length). Distances are limited to 32K bytes, and lengths are limited
+to 258 bytes. When a string does not occur anywhere in the previous
+32K bytes, it is emitted as a sequence of literal bytes. (In this
+description, `string' must be taken as an arbitrary sequence of bytes,
+and is not restricted to printable characters.)
+
+Literals or match lengths are compressed with one Huffman tree, and
+match distances are compressed with another tree. The trees are stored
+in a compact form at the start of each block. The blocks can have any
+size (except that the compressed data for one block must fit in
+available memory). A block is terminated when deflate() determines that
+it would be useful to start another block with fresh trees. (This is
+somewhat similar to the behavior of LZW-based _compress_.)
+
+Duplicated strings are found using a hash table. All input strings of
+length 3 are inserted in the hash table. A hash index is computed for
+the next 3 bytes. If the hash chain for this index is not empty, all
+strings in the chain are compared with the current input string, and
+the longest match is selected.
+
+The hash chains are searched starting with the most recent strings, to
+favor small distances and thus take advantage of the Huffman encoding.
+The hash chains are singly linked. There are no deletions from the
+hash chains, the algorithm simply discards matches that are too old.
+
+To avoid a worst-case situation, very long hash chains are arbitrarily
+truncated at a certain length, determined by a runtime option (level
+parameter of deflateInit). So deflate() does not always find the longest
+possible match but generally finds a match which is long enough.
+
+deflate() also defers the selection of matches with a lazy evaluation
+mechanism. After a match of length N has been found, deflate() searches for
+a longer match at the next input byte. If a longer match is found, the
+previous match is truncated to a length of one (thus producing a single
+literal byte) and the process of lazy evaluation begins again. Otherwise,
+the original match is kept, and the next match search is attempted only N
+steps later.
+
+The lazy match evaluation is also subject to a runtime parameter. If
+the current match is long enough, deflate() reduces the search for a longer
+match, thus speeding up the whole process. If compression ratio is more
+important than speed, deflate() attempts a complete second search even if
+the first match is already long enough.
+
+The lazy match evaluation is not performed for the fastest compression
+modes (level parameter 1 to 3). For these fast modes, new strings
+are inserted in the hash table only when no match was found, or
+when the match is not too long. This degrades the compression ratio
+but saves time since there are both fewer insertions and fewer searches.
+
+
+2. Decompression algorithm (inflate)
+
+2.1 Introduction
+
+The real question is, given a Huffman tree, how to decode fast. The most
+important realization is that shorter codes are much more common than
+longer codes, so pay attention to decoding the short codes fast, and let
+the long codes take longer to decode.
+
+inflate() sets up a first level table that covers some number of bits of
+input less than the length of longest code. It gets that many bits from the
+stream, and looks it up in the table. The table will tell if the next
+code is that many bits or less and how many, and if it is, it will tell
+the value, else it will point to the next level table for which inflate()
+grabs more bits and tries to decode a longer code.
+
+How many bits to make the first lookup is a tradeoff between the time it
+takes to decode and the time it takes to build the table. If building the
+table took no time (and if you had infinite memory), then there would only
+be a first level table to cover all the way to the longest code. However,
+building the table ends up taking a lot longer for more bits since short
+codes are replicated many times in such a table. What inflate() does is
+simply to make the number of bits in the first table a variable, and set it
+for the maximum speed.
+
+inflate() sends new trees relatively often, so it is possibly set for a
+smaller first level table than an application that has only one tree for
+all the data. For inflate, which has 286 possible codes for the
+literal/length tree, the size of the first table is nine bits. Also the
+distance trees have 30 possible values, and the size of the first table is
+six bits. Note that for each of those cases, the table ended up one bit
+longer than the ``average'' code length, i.e. the code length of an
+approximately flat code which would be a little more than eight bits for
+286 symbols and a little less than five bits for 30 symbols. It would be
+interesting to see if optimizing the first level table for other
+applications gave values within a bit or two of the flat code size.
+
+
+2.2 More details on the inflate table lookup
+
+Ok, you want to know what this cleverly obfuscated inflate tree actually
+looks like. You are correct that it's not a Huffman tree. It is simply a
+lookup table for the first, let's say, nine bits of a Huffman symbol. The
+symbol could be as short as one bit or as long as 15 bits. If a particular
+symbol is shorter than nine bits, then that symbol's translation is duplicated
+in all those entries that start with that symbol's bits. For example, if the
+symbol is four bits, then it's duplicated 32 times in a nine-bit table. If a
+symbol is nine bits long, it appears in the table once.
+
+If the symbol is longer than nine bits, then that entry in the table points
+to another similar table for the remaining bits. Again, there are duplicated
+entries as needed. The idea is that most of the time the symbol will be short
+and there will only be one table look up. (That's whole idea behind data
+compression in the first place.) For the less frequent long symbols, there
+will be two lookups. If you had a compression method with really long
+symbols, you could have as many levels of lookups as is efficient. For
+inflate, two is enough.
+
+So a table entry either points to another table (in which case nine bits in
+the above example are gobbled), or it contains the translation for the symbol
+and the number of bits to gobble. Then you start again with the next
+ungobbled bit.
+
+You may wonder: why not just have one lookup table for how ever many bits the
+longest symbol is? The reason is that if you do that, you end up spending
+more time filling in duplicate symbol entries than you do actually decoding.
+At least for deflate's output that generates new trees every several 10's of
+kbytes. You can imagine that filling in a 2^15 entry table for a 15-bit code
+would take too long if you're only decoding several thousand symbols. At the
+other extreme, you could make a new table for every bit in the code. In fact,
+that's essentially a Huffman tree. But then you spend two much time
+traversing the tree while decoding, even for short symbols.
+
+So the number of bits for the first lookup table is a trade of the time to
+fill out the table vs. the time spent looking at the second level and above of
+the table.
+
+Here is an example, scaled down:
+
+The code being decoded, with 10 symbols, from 1 to 6 bits long:
+
+A: 0
+B: 10
+C: 1100
+D: 11010
+E: 11011
+F: 11100
+G: 11101
+H: 11110
+I: 111110
+J: 111111
+
+Let's make the first table three bits long (eight entries):
+
+000: A,1
+001: A,1
+010: A,1
+011: A,1
+100: B,2
+101: B,2
+110: -> table X (gobble 3 bits)
+111: -> table Y (gobble 3 bits)
+
+Each entry is what the bits decode to and how many bits that is, i.e. how
+many bits to gobble. Or the entry points to another table, with the number of
+bits to gobble implicit in the size of the table.
+
+Table X is two bits long since the longest code starting with 110 is five bits
+long:
+
+00: C,1
+01: C,1
+10: D,2
+11: E,2
+
+Table Y is three bits long since the longest code starting with 111 is six
+bits long:
+
+000: F,2
+001: F,2
+010: G,2
+011: G,2
+100: H,2
+101: H,2
+110: I,3
+111: J,3
+
+So what we have here are three tables with a total of 20 entries that had to
+be constructed. That's compared to 64 entries for a single table. Or
+compared to 16 entries for a Huffman tree (six two entry tables and one four
+entry table). Assuming that the code ideally represents the probability of
+the symbols, it takes on the average 1.25 lookups per symbol. That's compared
+to one lookup for the single table, or 1.66 lookups per symbol for the
+Huffman tree.
+
+There, I think that gives you a picture of what's going on. For inflate, the
+meaning of a particular symbol is often more than just a letter. It can be a
+byte (a "literal"), or it can be either a length or a distance which
+indicates a base value and a number of bits to fetch after the code that is
+added to the base value. Or it might be the special end-of-block code. The
+data structures created in inftrees.c try to encode all that information
+compactly in the tables.
+
+
+Jean-loup Gailly Mark Adler
+jloup@gzip.org madler@alumni.caltech.edu
+
+
+References:
+
+[LZ77] Ziv J., Lempel A., ``A Universal Algorithm for Sequential Data
+Compression,'' IEEE Transactions on Information Theory, Vol. 23, No. 3,
+pp. 337-343.
+
+``DEFLATE Compressed Data Format Specification'' available in
+ftp://ds.internic.net/rfc/rfc1951.txt
--- /dev/null
+# Amiga powerUP (TM) Makefile
+# makefile for libpng and SAS C V6.58/7.00 PPC compiler
+# Copyright (C) 1998 by Andreas R. Kleinert
+
+CC = scppc
+CFLAGS = NOSTKCHK NOSINT OPTIMIZE OPTGO OPTPEEP OPTINLOCAL OPTINL \
+ OPTLOOP OPTRDEP=8 OPTDEP=8 OPTCOMP=8
+LIBNAME = libzip.a
+AR = ppc-amigaos-ar
+AR_FLAGS = cr
+RANLIB = ppc-amigaos-ranlib
+LDFLAGS = -r -o
+LDLIBS = LIB:scppc.a
+LN = ppc-amigaos-ld
+RM = delete quiet
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: example minigzip
+
+test: all
+ example
+ echo hello world | minigzip | minigzip -d
+
+$(LIBNAME): $(OBJS)
+ $(AR) $(AR_FLAGS) $@ $(OBJS)
+ $(RANLIB) $@
+
+example: example.o $(LIBNAME)
+ $(LN) $(LDFLAGS) example LIB:c_ppc.o example.o $(LIBNAME) $(LDLIBS) LIB:end.o
+
+minigzip: minigzip.o $(LIBNAME)
+ $(LN) $(LDFLAGS) minigzip LIB:c_ppc.o minigzip.o $(LIBNAME) $(LDLIBS) LIB:end.o
+
+clean:
+ $(RM) *.o example minigzip $(LIBNAME) foo.gz
+
+zip:
+ zip -ul9 zlib README ChangeLog Makefile Make????.??? Makefile.?? \
+ descrip.mms *.[ch]
+
+tgz:
+ cd ..; tar cfz zlib/zlib.tgz zlib/README zlib/ChangeLog zlib/Makefile \
+ zlib/Make????.??? zlib/Makefile.?? zlib/descrip.mms zlib/*.[ch]
+
+# DO NOT DELETE THIS LINE -- make depend depends on it.
+
+adler32.o: zutil.h zlib.h zconf.h
+compress.o: zlib.h zconf.h
+crc32.o: zutil.h zlib.h zconf.h
+deflate.o: deflate.h zutil.h zlib.h zconf.h
+example.o: zlib.h zconf.h
+gzio.o: zutil.h zlib.h zconf.h
+infblock.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h
+infcodes.o: zutil.h zlib.h zconf.h inftrees.h infutil.h infcodes.h inffast.h
+inffast.o: zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+inflate.o: zutil.h zlib.h zconf.h infblock.h
+inftrees.o: zutil.h zlib.h zconf.h inftrees.h
+infutil.o: zutil.h zlib.h zconf.h inftrees.h infutil.h
+minigzip.o: zlib.h zconf.h
+trees.o: deflate.h zutil.h zlib.h zconf.h
+uncompr.o: zlib.h zconf.h
+zutil.o: zutil.h zlib.h zconf.h
--- /dev/null
+# SMakefile for zlib
+# Modified from the standard UNIX Makefile Copyright Jean-loup Gailly
+# Osma Ahvenlampi <Osma.Ahvenlampi@hut.fi>
+# Amiga, SAS/C 6.56 & Smake
+
+CC=sc
+CFLAGS=OPT
+#CFLAGS=OPT CPU=68030
+#CFLAGS=DEBUG=LINE
+LDFLAGS=LIB z.lib
+
+SCOPTIONS=OPTSCHED OPTINLINE OPTALIAS OPTTIME OPTINLOCAL STRMERGE \
+ NOICONS PARMS=BOTH NOSTACKCHECK UTILLIB NOVERSION ERRORREXX
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: SCOPTIONS example minigzip
+
+test: all
+ `cd`/example
+ echo hello world | minigzip | minigzip -d
+
+install: z.lib
+ copy zlib.h zconf.h INCLUDE: clone
+ copy z.lib LIB: clone
+
+z.lib: $(OBJS)
+ oml z.lib r $(OBJS)
+
+example: example.o z.lib
+ $(CC) $(CFLAGS) LINK TO $@ example.o $(LDFLAGS)
+
+minigzip: minigzip.o z.lib
+ $(CC) $(CFLAGS) LINK TO $@ minigzip.o $(LDFLAGS)
+
+clean:
+ -delete force quiet *.o example minigzip z.lib foo.gz *.lnk SCOPTIONS
+
+SCOPTIONS: Smakefile
+ copy to $@ <from <
+$(SCOPTIONS)
+<
+
+# DO NOT DELETE THIS LINE -- make depend depends on it.
+
+adler32.o: zutil.h zlib.h zconf.h
+compress.o: zlib.h zconf.h
+crc32.o: zutil.h zlib.h zconf.h
+deflate.o: deflate.h zutil.h zlib.h zconf.h
+example.o: zlib.h zconf.h
+gzio.o: zutil.h zlib.h zconf.h
+infblock.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h
+infcodes.o: zutil.h zlib.h zconf.h inftrees.h infutil.h infcodes.h inffast.h
+inffast.o: zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+inflate.o: zutil.h zlib.h zconf.h infblock.h
+inftrees.o: zutil.h zlib.h zconf.h inftrees.h
+infutil.o: zutil.h zlib.h zconf.h inftrees.h infutil.h
+minigzip.o: zlib.h zconf.h
+trees.o: deflate.h zutil.h zlib.h zconf.h
+uncompr.o: zlib.h zconf.h
+zutil.o: zutil.h zlib.h zconf.h
--- /dev/null
+/* compress.c -- compress a memory buffer
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include "zlib.h"
+
+/* ===========================================================================
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least 0.1% larger than sourceLen plus
+ 12 bytes. Upon exit, destLen is the actual size of the compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+*/
+int ZEXPORT compress2 (dest, destLen, source, sourceLen, level)
+ Bytef *dest;
+ uLongf *destLen;
+ const Bytef *source;
+ uLong sourceLen;
+ int level;
+{
+ z_stream stream;
+ int err;
+
+ stream.next_in = (Bytef*)source;
+ stream.avail_in = (uInt)sourceLen;
+#ifdef MAXSEG_64K
+ /* Check for source > 64K on 16-bit machine: */
+ if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR;
+#endif
+ stream.next_out = dest;
+ stream.avail_out = (uInt)*destLen;
+ if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR;
+
+ stream.zalloc = (alloc_func)0;
+ stream.zfree = (free_func)0;
+ stream.opaque = (voidpf)0;
+
+ err = deflateInit(&stream, level);
+ if (err != Z_OK) return err;
+
+ err = deflate(&stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ deflateEnd(&stream);
+ return err == Z_OK ? Z_BUF_ERROR : err;
+ }
+ *destLen = stream.total_out;
+
+ err = deflateEnd(&stream);
+ return err;
+}
+
+/* ===========================================================================
+ */
+int ZEXPORT compress (dest, destLen, source, sourceLen)
+ Bytef *dest;
+ uLongf *destLen;
+ const Bytef *source;
+ uLong sourceLen;
+{
+ return compress2(dest, destLen, source, sourceLen, Z_DEFAULT_COMPRESSION);
+}
--- /dev/null
+#!/bin/sh
+# configure script for zlib. This script is needed only if
+# you wish to build a shared library and your system supports them,
+# of if you need special compiler, flags or install directory.
+# Otherwise, you can just use directly "make test; make install"
+#
+# To create a shared library, use "configure --shared"; by default a static
+# library is created. If the primitive shared library support provided here
+# does not work, use ftp://prep.ai.mit.edu/pub/gnu/libtool-*.tar.gz
+#
+# To impose specific compiler or flags or install directory, use for example:
+# prefix=$HOME CC=cc CFLAGS="-O4" ./configure
+# or for csh/tcsh users:
+# (setenv prefix $HOME; setenv CC cc; setenv CFLAGS "-O4"; ./configure)
+# LDSHARED is the command to be used to create a shared library
+
+# Incorrect settings of CC or CFLAGS may prevent creating a shared library.
+# If you have problems, try without defining CC and CFLAGS before reporting
+# an error.
+
+LIBS=libz.a
+SHAREDLIB=libz.so
+VER=`sed -n -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`
+AR=${AR-"ar rc"}
+RANLIB=${RANLIB-"ranlib"}
+prefix=${prefix-/usr/local}
+exec_prefix=${exec_prefix-'${prefix}'}
+libdir=${libdir-'${exec_prefix}/lib'}
+includedir=${includedir-'${prefix}/include'}
+shared_ext='.so'
+shared=0
+gcc=0
+old_cc="$CC"
+old_cflags="$CFLAGS"
+
+while test $# -ge 1
+do
+case "$1" in
+ -h* | --h*)
+ echo 'usage:'
+ echo ' configure [--shared] [--prefix=PREFIX] [--exec_prefix=EXPREFIX]'
+ echo ' [--libdir=LIBDIR] [--includedir=INCLUDEDIR]'
+ exit 0;;
+ -p*=* | --p*=*) prefix=`echo $1 | sed 's/[-a-z_]*=//'`; shift;;
+ -e*=* | --e*=*) exec_prefix=`echo $1 | sed 's/[-a-z_]*=//'`; shift;;
+ -l*=* | --libdir=*) libdir=`echo $1 | sed 's/[-a-z_]*=//'`; shift;;
+ -i*=* | --includedir=*) includedir=`echo $1 | sed 's/[-a-z_]*=//'`;shift;;
+ -p* | --p*) prefix="$2"; shift; shift;;
+ -e* | --e*) exec_prefix="$2"; shift; shift;;
+ -l* | --l*) libdir="$2"; shift; shift;;
+ -i* | --i*) includedir="$2"; shift; shift;;
+ -s* | --s*) shared=1; shift;;
+ esac
+done
+
+test=ztest$$
+cat > $test.c <<EOF
+extern int getchar();
+int hello() {return getchar();}
+EOF
+
+test -z "$CC" && echo Checking for gcc...
+cc=${CC-gcc}
+cflags=${CFLAGS-"-O3"}
+# to force the asm version use: CFLAGS="-O3 -DASMV" ./configure
+case "$cc" in
+ *gcc*) gcc=1;;
+esac
+
+if test "$gcc" -eq 1 && ($cc -c $cflags $test.c) 2>/dev/null; then
+ CC="$cc"
+ SFLAGS=${CFLAGS-"-fPIC -O3"}
+ CFLAGS="$cflags"
+ case `(uname -s || echo unknown) 2>/dev/null` in
+ Linux | linux) LDSHARED=${LDSHARED-"gcc -shared -Wl,-soname,libz.so.1"};;
+ *) LDSHARED=${LDSHARED-"gcc -shared"};;
+ esac
+else
+ # find system name and corresponding cc options
+ CC=${CC-cc}
+ case `(uname -sr || echo unknown) 2>/dev/null` in
+ HP-UX*) SFLAGS=${CFLAGS-"-O +z"}
+ CFLAGS=${CFLAGS-"-O"}
+# LDSHARED=${LDSHARED-"ld -b +vnocompatwarnings"}
+ LDSHARED=${LDSHARED-"ld -b"}
+ shared_ext='.sl'
+ SHAREDLIB='libz.sl';;
+ IRIX*) SFLAGS=${CFLAGS-"-ansi -O2 -rpath ."}
+ CFLAGS=${CFLAGS-"-ansi -O2"}
+ LDSHARED=${LDSHARED-"cc -shared"};;
+ OSF1\ V4*) SFLAGS=${CFLAGS-"-O -std1"}
+ CFLAGS=${CFLAGS-"-O -std1"}
+ LDSHARED=${LDSHARED-"cc -shared -Wl,-soname,$SHAREDLIB -Wl,-msym -Wl,-rpath,$(libdir) -Wl,-set_version,${VER}:1.0"};;
+ OSF1*) SFLAGS=${CFLAGS-"-O -std1"}
+ CFLAGS=${CFLAGS-"-O -std1"}
+ LDSHARED=${LDSHARED-"cc -shared"};;
+ QNX*) SFLAGS=${CFLAGS-"-4 -O"}
+ CFLAGS=${CFLAGS-"-4 -O"}
+ LDSHARED=${LDSHARED-"cc"}
+ RANLIB=${RANLIB-"true"}
+ AR="cc -A";;
+ SCO_SV\ 3.2*) SFLAGS=${CFLAGS-"-O3 -dy -KPIC "}
+ CFLAGS=${CFLAGS-"-O3"}
+ LDSHARED=${LDSHARED-"cc -dy -KPIC -G"};;
+ SunOS\ 5*) SFLAGS=${CFLAGS-"-fast -xcg89 -KPIC -R."}
+ CFLAGS=${CFLAGS-"-fast -xcg89"}
+ LDSHARED=${LDSHARED-"cc -G"};;
+ SunOS\ 4*) SFLAGS=${CFLAGS-"-O2 -PIC"}
+ CFLAGS=${CFLAGS-"-O2"}
+ LDSHARED=${LDSHARED-"ld"};;
+ UNIX_System_V\ 4.2.0)
+ SFLAGS=${CFLAGS-"-KPIC -O"}
+ CFLAGS=${CFLAGS-"-O"}
+ LDSHARED=${LDSHARED-"cc -G"};;
+ UNIX_SV\ 4.2MP)
+ SFLAGS=${CFLAGS-"-Kconform_pic -O"}
+ CFLAGS=${CFLAGS-"-O"}
+ LDSHARED=${LDSHARED-"cc -G"};;
+ # send working options for other systems to support@gzip.org
+ *) SFLAGS=${CFLAGS-"-O"}
+ CFLAGS=${CFLAGS-"-O"}
+ LDSHARED=${LDSHARED-"cc -shared"};;
+ esac
+fi
+
+if test $shared -eq 1; then
+ echo Checking for shared library support...
+ # we must test in two steps (cc then ld), required at least on SunOS 4.x
+ if test "`($CC -c $SFLAGS $test.c) 2>&1`" = "" &&
+ test "`($LDSHARED -o $test$shared_ext $test.o) 2>&1`" = ""; then
+ CFLAGS="$SFLAGS"
+ LIBS="$SHAREDLIB.$VER"
+ echo Building shared library $SHAREDLIB.$VER with $CC.
+ elif test -z "$old_cc" -a -z "$old_cflags"; then
+ echo No shared library suppport.
+ shared=0;
+ else
+ echo 'No shared library suppport; try without defining CC and CFLAGS'
+ shared=0;
+ fi
+fi
+if test $shared -eq 0; then
+ LDSHARED="$CC"
+ echo Building static library $LIBS version $VER with $CC.
+fi
+
+cat > $test.c <<EOF
+#include <unistd.h>
+int main() { return 0; }
+EOF
+if test "`($CC -c $CFLAGS $test.c) 2>&1`" = ""; then
+ CFLAGS="$CFLAGS -DHAVE_UNISTD_H"
+ echo "Checking for unistd.h... Yes."
+else
+ echo "Checking for unistd.h... No."
+fi
+
+cat > $test.c <<EOF
+#include <errno.h>
+int main() { return 0; }
+EOF
+if test "`($CC -c $CFLAGS $test.c) 2>&1`" = ""; then
+ echo "Checking for errno.h... Yes."
+else
+ echo "Checking for errno.h... No."
+ CFLAGS="$CFLAGS -DNO_ERRNO_H"
+fi
+
+cat > $test.c <<EOF
+#include <sys/types.h>
+#include <sys/mman.h>
+#include <sys/stat.h>
+caddr_t hello() {
+ return mmap((caddr_t)0, (off_t)0, PROT_READ, MAP_SHARED, 0, (off_t)0);
+}
+EOF
+if test "`($CC -c $CFLAGS $test.c) 2>&1`" = ""; then
+ CFLAGS="$CFLAGS -DUSE_MMAP"
+ echo Checking for mmap support... Yes.
+else
+ echo Checking for mmap support... No.
+fi
+
+CPP=${CPP-"$CC -E"}
+case $CFLAGS in
+ *ASMV*)
+ if test "`nm $test.o | grep _hello`" = ""; then
+ CPP="$CPP -DNO_UNDERLINE"
+ echo Checking for underline in external names... No.
+ else
+ echo Checking for underline in external names... Yes.
+ fi;;
+esac
+
+rm -f $test.[co] $test$shared_ext
+
+# udpate Makefile
+sed < Makefile.in "
+/^CC *=/s%=.*%=$CC%
+/^CFLAGS *=/s%=.*%=$CFLAGS%
+/^CPP *=/s%=.*%=$CPP%
+/^LDSHARED *=/s%=.*%=$LDSHARED%
+/^LIBS *=/s%=.*%=$LIBS%
+/^SHAREDLIB *=/s%=.*%=$SHAREDLIB%
+/^AR *=/s%=.*%=$AR%
+/^RANLIB *=/s%=.*%=$RANLIB%
+/^VER *=/s%=.*%=$VER%
+/^prefix *=/s%=.*%=$prefix%
+/^exec_prefix *=/s%=.*%=$exec_prefix%
+/^libdir *=/s%=.*%=$libdir%
+/^includedir *=/s%=.*%=$includedir%
+" > Makefile
--- /dev/null
+All files under this contrib directory are UNSUPPORTED. There were
+provided by users of zlib and were not tested by the authors of zlib.
+Use at your own risk. Please contact the authors of the contributions
+for help about these, not the zlib authors. Thanks.
+
+
+asm386/ by Gilles Vollant <info@winimage.com>
+ 386 asm code replacing longest_match(), for Visual C++ 4.2 and ML 6.11c
+
+asm586/ and asm686/ by Brian Raiter <breadbox@muppetlabs.com>
+ asm code for Pentium and Pentium Pro
+ See http://www.muppetlabs.com/~breadbox/software/assembly.html
+
+delphi/ by Bob Dellaca <bobdl@xtra.co.nz>
+ Support for Delphi
+
+delphi2/ by Davide Moretti <dave@rimini.com>
+ Another support for C++Builder and Delphi
+
+minizip/ by Gilles Vollant <info@winimage.com>
+ Mini zip and unzip based on zlib
+ See http://www.winimage.com/zLibDll/unzip.html
+
+iostream/ by Kevin Ruland <kevin@rodin.wustl.edu>
+ A C++ I/O streams interface to the zlib gz* functions
+
+iostream2/ by Tyge Løvset <Tyge.Lovset@cmr.no>
+ Another C++ I/O streams interface
+
+untgz/ by "Pedro A. Aranda Guti\irrez" <paag@tid.es>
+ A very simple tar.gz file extractor using zlib
+
+visual-basic.txt by Carlos Rios <c_rios@sonda.cl>
+ How to use compress(), uncompress() and the gz* functions from VB.
--- /dev/null
+;
+; gvmat32.asm -- Asm portion of the optimized longest_match for 32 bits x86
+; Copyright (C) 1995-1996 Jean-loup Gailly and Gilles Vollant.
+; File written by Gilles Vollant, by modifiying the longest_match
+; from Jean-loup Gailly in deflate.c
+; It need wmask == 0x7fff
+; (assembly code is faster with a fixed wmask)
+;
+; For Visual C++ 4.2 and ML 6.11c (version in directory \MASM611C of Win95 DDK)
+; I compile with : "ml /coff /Zi /c gvmat32.asm"
+;
+
+;uInt longest_match_7fff(s, cur_match)
+; deflate_state *s;
+; IPos cur_match; /* current match */
+
+ NbStack equ 76
+ cur_match equ dword ptr[esp+NbStack-0]
+ str_s equ dword ptr[esp+NbStack-4]
+; 5 dword on top (ret,ebp,esi,edi,ebx)
+ adrret equ dword ptr[esp+NbStack-8]
+ pushebp equ dword ptr[esp+NbStack-12]
+ pushedi equ dword ptr[esp+NbStack-16]
+ pushesi equ dword ptr[esp+NbStack-20]
+ pushebx equ dword ptr[esp+NbStack-24]
+
+ chain_length equ dword ptr [esp+NbStack-28]
+ limit equ dword ptr [esp+NbStack-32]
+ best_len equ dword ptr [esp+NbStack-36]
+ window equ dword ptr [esp+NbStack-40]
+ prev equ dword ptr [esp+NbStack-44]
+ scan_start equ word ptr [esp+NbStack-48]
+ wmask equ dword ptr [esp+NbStack-52]
+ match_start_ptr equ dword ptr [esp+NbStack-56]
+ nice_match equ dword ptr [esp+NbStack-60]
+ scan equ dword ptr [esp+NbStack-64]
+
+ windowlen equ dword ptr [esp+NbStack-68]
+ match_start equ dword ptr [esp+NbStack-72]
+ strend equ dword ptr [esp+NbStack-76]
+ NbStackAdd equ (NbStack-24)
+
+ .386p
+
+ name gvmatch
+ .MODEL FLAT
+
+
+
+; all the +4 offsets are due to the addition of pending_buf_size (in zlib
+; in the deflate_state structure since the asm code was first written
+; (if you compile with zlib 1.0.4 or older, remove the +4).
+; Note : these value are good with a 8 bytes boundary pack structure
+ dep_chain_length equ 70h+4
+ dep_window equ 2ch+4
+ dep_strstart equ 60h+4
+ dep_prev_length equ 6ch+4
+ dep_nice_match equ 84h+4
+ dep_w_size equ 20h+4
+ dep_prev equ 34h+4
+ dep_w_mask equ 28h+4
+ dep_good_match equ 80h+4
+ dep_match_start equ 64h+4
+ dep_lookahead equ 68h+4
+
+
+_TEXT segment
+
+IFDEF NOUNDERLINE
+ public longest_match_7fff
+; public match_init
+ELSE
+ public _longest_match_7fff
+; public _match_init
+ENDIF
+
+ MAX_MATCH equ 258
+ MIN_MATCH equ 3
+ MIN_LOOKAHEAD equ (MAX_MATCH+MIN_MATCH+1)
+
+
+
+IFDEF NOUNDERLINE
+;match_init proc near
+; ret
+;match_init endp
+ELSE
+;_match_init proc near
+; ret
+;_match_init endp
+ENDIF
+
+
+IFDEF NOUNDERLINE
+longest_match_7fff proc near
+ELSE
+_longest_match_7fff proc near
+ENDIF
+
+ mov edx,[esp+4]
+
+
+
+ push ebp
+ push edi
+ push esi
+ push ebx
+
+ sub esp,NbStackAdd
+
+; initialize or check the variables used in match.asm.
+ mov ebp,edx
+
+; chain_length = s->max_chain_length
+; if (prev_length>=good_match) chain_length >>= 2
+ mov edx,[ebp+dep_chain_length]
+ mov ebx,[ebp+dep_prev_length]
+ cmp [ebp+dep_good_match],ebx
+ ja noshr
+ shr edx,2
+noshr:
+; we increment chain_length because in the asm, the --chain_lenght is in the beginning of the loop
+ inc edx
+ mov edi,[ebp+dep_nice_match]
+ mov chain_length,edx
+ mov eax,[ebp+dep_lookahead]
+ cmp eax,edi
+; if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead;
+ jae nolookaheadnicematch
+ mov edi,eax
+nolookaheadnicematch:
+; best_len = s->prev_length
+ mov best_len,ebx
+
+; window = s->window
+ mov esi,[ebp+dep_window]
+ mov ecx,[ebp+dep_strstart]
+ mov window,esi
+
+ mov nice_match,edi
+; scan = window + strstart
+ add esi,ecx
+ mov scan,esi
+; dx = *window
+ mov dx,word ptr [esi]
+; bx = *(window+best_len-1)
+ mov bx,word ptr [esi+ebx-1]
+ add esi,MAX_MATCH-1
+; scan_start = *scan
+ mov scan_start,dx
+; strend = scan + MAX_MATCH-1
+ mov strend,esi
+; bx = scan_end = *(window+best_len-1)
+
+; IPos limit = s->strstart > (IPos)MAX_DIST(s) ?
+; s->strstart - (IPos)MAX_DIST(s) : NIL;
+
+ mov esi,[ebp+dep_w_size]
+ sub esi,MIN_LOOKAHEAD
+; here esi = MAX_DIST(s)
+ sub ecx,esi
+ ja nodist
+ xor ecx,ecx
+nodist:
+ mov limit,ecx
+
+; prev = s->prev
+ mov edx,[ebp+dep_prev]
+ mov prev,edx
+
+;
+ mov edx,dword ptr [ebp+dep_match_start]
+ mov bp,scan_start
+ mov eax,cur_match
+ mov match_start,edx
+
+ mov edx,window
+ mov edi,edx
+ add edi,best_len
+ mov esi,prev
+ dec edi
+; windowlen = window + best_len -1
+ mov windowlen,edi
+
+ jmp beginloop2
+ align 4
+
+; here, in the loop
+; eax = ax = cur_match
+; ecx = limit
+; bx = scan_end
+; bp = scan_start
+; edi = windowlen (window + best_len -1)
+; esi = prev
+
+
+;// here; chain_length <=16
+normalbeg0add16:
+ add chain_length,16
+ jz exitloop
+normalbeg0:
+ cmp word ptr[edi+eax],bx
+ je normalbeg2noroll
+rcontlabnoroll:
+; cur_match = prev[cur_match & wmask]
+ and eax,7fffh
+ mov ax,word ptr[esi+eax*2]
+; if cur_match > limit, go to exitloop
+ cmp ecx,eax
+ jnb exitloop
+; if --chain_length != 0, go to exitloop
+ dec chain_length
+ jnz normalbeg0
+ jmp exitloop
+
+normalbeg2noroll:
+; if (scan_start==*(cur_match+window)) goto normalbeg2
+ cmp bp,word ptr[edx+eax]
+ jne rcontlabnoroll
+ jmp normalbeg2
+
+contloop3:
+ mov edi,windowlen
+
+; cur_match = prev[cur_match & wmask]
+ and eax,7fffh
+ mov ax,word ptr[esi+eax*2]
+; if cur_match > limit, go to exitloop
+ cmp ecx,eax
+jnbexitloopshort1:
+ jnb exitloop
+; if --chain_length != 0, go to exitloop
+
+
+; begin the main loop
+beginloop2:
+ sub chain_length,16+1
+; if chain_length <=16, don't use the unrolled loop
+ jna normalbeg0add16
+
+do16:
+ cmp word ptr[edi+eax],bx
+ je normalbeg2dc0
+
+maccn MACRO lab
+ and eax,7fffh
+ mov ax,word ptr[esi+eax*2]
+ cmp ecx,eax
+ jnb exitloop
+ cmp word ptr[edi+eax],bx
+ je lab
+ ENDM
+
+rcontloop0:
+ maccn normalbeg2dc1
+
+rcontloop1:
+ maccn normalbeg2dc2
+
+rcontloop2:
+ maccn normalbeg2dc3
+
+rcontloop3:
+ maccn normalbeg2dc4
+
+rcontloop4:
+ maccn normalbeg2dc5
+
+rcontloop5:
+ maccn normalbeg2dc6
+
+rcontloop6:
+ maccn normalbeg2dc7
+
+rcontloop7:
+ maccn normalbeg2dc8
+
+rcontloop8:
+ maccn normalbeg2dc9
+
+rcontloop9:
+ maccn normalbeg2dc10
+
+rcontloop10:
+ maccn short normalbeg2dc11
+
+rcontloop11:
+ maccn short normalbeg2dc12
+
+rcontloop12:
+ maccn short normalbeg2dc13
+
+rcontloop13:
+ maccn short normalbeg2dc14
+
+rcontloop14:
+ maccn short normalbeg2dc15
+
+rcontloop15:
+ and eax,7fffh
+ mov ax,word ptr[esi+eax*2]
+ cmp ecx,eax
+ jnb exitloop
+
+ sub chain_length,16
+ ja do16
+ jmp normalbeg0add16
+
+;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
+
+normbeg MACRO rcontlab,valsub
+; if we are here, we know that *(match+best_len-1) == scan_end
+ cmp bp,word ptr[edx+eax]
+; if (match != scan_start) goto rcontlab
+ jne rcontlab
+; calculate the good chain_length, and we'll compare scan and match string
+ add chain_length,16-valsub
+ jmp iseq
+ ENDM
+
+
+normalbeg2dc11:
+ normbeg rcontloop11,11
+
+normalbeg2dc12:
+ normbeg short rcontloop12,12
+
+normalbeg2dc13:
+ normbeg short rcontloop13,13
+
+normalbeg2dc14:
+ normbeg short rcontloop14,14
+
+normalbeg2dc15:
+ normbeg short rcontloop15,15
+
+normalbeg2dc10:
+ normbeg rcontloop10,10
+
+normalbeg2dc9:
+ normbeg rcontloop9,9
+
+normalbeg2dc8:
+ normbeg rcontloop8,8
+
+normalbeg2dc7:
+ normbeg rcontloop7,7
+
+normalbeg2dc6:
+ normbeg rcontloop6,6
+
+normalbeg2dc5:
+ normbeg rcontloop5,5
+
+normalbeg2dc4:
+ normbeg rcontloop4,4
+
+normalbeg2dc3:
+ normbeg rcontloop3,3
+
+normalbeg2dc2:
+ normbeg rcontloop2,2
+
+normalbeg2dc1:
+ normbeg rcontloop1,1
+
+normalbeg2dc0:
+ normbeg rcontloop0,0
+
+
+; we go in normalbeg2 because *(ushf*)(match+best_len-1) == scan_end
+
+normalbeg2:
+ mov edi,window
+
+ cmp bp,word ptr[edi+eax]
+ jne contloop3 ; if *(ushf*)match != scan_start, continue
+
+iseq:
+; if we are here, we know that *(match+best_len-1) == scan_end
+; and (match == scan_start)
+
+ mov edi,edx
+ mov esi,scan ; esi = scan
+ add edi,eax ; edi = window + cur_match = match
+
+ mov edx,[esi+3] ; compare manually dword at match+3
+ xor edx,[edi+3] ; and scan +3
+
+ jz begincompare ; if equal, go to long compare
+
+; we will determine the unmatch byte and calculate len (in esi)
+ or dl,dl
+ je eq1rr
+ mov esi,3
+ jmp trfinval
+eq1rr:
+ or dx,dx
+ je eq1
+
+ mov esi,4
+ jmp trfinval
+eq1:
+ and edx,0ffffffh
+ jz eq11
+ mov esi,5
+ jmp trfinval
+eq11:
+ mov esi,6
+ jmp trfinval
+
+begincompare:
+ ; here we now scan and match begin same
+ add edi,6
+ add esi,6
+ mov ecx,(MAX_MATCH-(2+4))/4 ; scan for at most MAX_MATCH bytes
+ repe cmpsd ; loop until mismatch
+
+ je trfin ; go to trfin if not unmatch
+; we determine the unmatch byte
+ sub esi,4
+ mov edx,[edi-4]
+ xor edx,[esi]
+
+ or dl,dl
+ jnz trfin
+ inc esi
+
+ or dx,dx
+ jnz trfin
+ inc esi
+
+ and edx,0ffffffh
+ jnz trfin
+ inc esi
+
+trfin:
+ sub esi,scan ; esi = len
+trfinval:
+; here we have finised compare, and esi contain len of equal string
+ cmp esi,best_len ; if len > best_len, go newbestlen
+ ja short newbestlen
+; now we restore edx, ecx and esi, for the big loop
+ mov esi,prev
+ mov ecx,limit
+ mov edx,window
+ jmp contloop3
+
+newbestlen:
+ mov best_len,esi ; len become best_len
+
+ mov match_start,eax ; save new position as match_start
+ cmp esi,nice_match ; if best_len >= nice_match, exit
+ jae exitloop
+ mov ecx,scan
+ mov edx,window ; restore edx=window
+ add ecx,esi
+ add esi,edx
+
+ dec esi
+ mov windowlen,esi ; windowlen = window + best_len-1
+ mov bx,[ecx-1] ; bx = *(scan+best_len-1) = scan_end
+
+; now we restore ecx and esi, for the big loop :
+ mov esi,prev
+ mov ecx,limit
+ jmp contloop3
+
+exitloop:
+; exit : s->match_start=match_start
+ mov ebx,match_start
+ mov ebp,str_s
+ mov ecx,best_len
+ mov dword ptr [ebp+dep_match_start],ebx
+ mov eax,dword ptr [ebp+dep_lookahead]
+ cmp ecx,eax
+ ja minexlo
+ mov eax,ecx
+minexlo:
+; return min(best_len,s->lookahead)
+
+; restore stack and register ebx,esi,edi,ebp
+ add esp,NbStackAdd
+
+ pop ebx
+ pop esi
+ pop edi
+ pop ebp
+ ret
+InfoAuthor:
+; please don't remove this string !
+; Your are free use gvmat32 in any fre or commercial apps if you don't remove the string in the binary!
+ db 0dh,0ah,"GVMat32 optimised assembly code written 1996-98 by Gilles Vollant",0dh,0ah
+
+
+
+IFDEF NOUNDERLINE
+longest_match_7fff endp
+ELSE
+_longest_match_7fff endp
+ENDIF
+
+
+IFDEF NOUNDERLINE
+cpudetect32 proc near
+ELSE
+_cpudetect32 proc near
+ENDIF
+
+
+ pushfd ; push original EFLAGS
+ pop eax ; get original EFLAGS
+ mov ecx, eax ; save original EFLAGS
+ xor eax, 40000h ; flip AC bit in EFLAGS
+ push eax ; save new EFLAGS value on stack
+ popfd ; replace current EFLAGS value
+ pushfd ; get new EFLAGS
+ pop eax ; store new EFLAGS in EAX
+ xor eax, ecx ; can\92t toggle AC bit, processor=80386
+ jz end_cpu_is_386 ; jump if 80386 processor
+ push ecx
+ popfd ; restore AC bit in EFLAGS first
+
+ pushfd
+ pushfd
+ pop ecx
+
+ mov eax, ecx ; get original EFLAGS
+ xor eax, 200000h ; flip ID bit in EFLAGS
+ push eax ; save new EFLAGS value on stack
+ popfd ; replace current EFLAGS value
+ pushfd ; get new EFLAGS
+ pop eax ; store new EFLAGS in EAX
+ popfd ; restore original EFLAGS
+ xor eax, ecx ; can\92t toggle ID bit,
+ je is_old_486 ; processor=old
+
+ mov eax,1
+ db 0fh,0a2h ;CPUID
+
+exitcpudetect:
+ ret
+
+end_cpu_is_386:
+ mov eax,0300h
+ jmp exitcpudetect
+
+is_old_486:
+ mov eax,0400h
+ jmp exitcpudetect
+
+IFDEF NOUNDERLINE
+cpudetect32 endp
+ELSE
+_cpudetect32 endp
+ENDIF
+
+_TEXT ends
+end
--- /dev/null
+/* gvmat32.c -- C portion of the optimized longest_match for 32 bits x86
+ * Copyright (C) 1995-1996 Jean-loup Gailly and Gilles Vollant.
+ * File written by Gilles Vollant, by modifiying the longest_match
+ * from Jean-loup Gailly in deflate.c
+ * it prepare all parameters and call the assembly longest_match_gvasm
+ * longest_match execute standard C code is wmask != 0x7fff
+ * (assembly code is faster with a fixed wmask)
+ *
+ */
+
+#include "deflate.h"
+
+#undef FAR
+#include <windows.h>
+
+#ifdef ASMV
+#define NIL 0
+
+#define UNALIGNED_OK
+
+
+/* if your C compiler don't add underline before function name,
+ define ADD_UNDERLINE_ASMFUNC */
+#ifdef ADD_UNDERLINE_ASMFUNC
+#define longest_match_7fff _longest_match_7fff
+#endif
+
+
+
+void match_init()
+{
+}
+
+unsigned long cpudetect32();
+
+uInt longest_match_c(
+ deflate_state *s,
+ IPos cur_match); /* current match */
+
+
+uInt longest_match_7fff(
+ deflate_state *s,
+ IPos cur_match); /* current match */
+
+uInt longest_match(
+ deflate_state *s,
+ IPos cur_match) /* current match */
+{
+ static uInt iIsPPro=2;
+
+ if ((s->w_mask == 0x7fff) && (iIsPPro==0))
+ return longest_match_7fff(s,cur_match);
+
+ if (iIsPPro==2)
+ iIsPPro = (((cpudetect32()/0x100)&0xf)>=6) ? 1 : 0;
+
+ return longest_match_c(s,cur_match);
+}
+
+
+
+uInt longest_match_c(s, cur_match)
+ deflate_state *s;
+ IPos cur_match; /* current match */
+{
+ unsigned chain_length = s->max_chain_length;/* max hash chain length */
+ register Bytef *scan = s->window + s->strstart; /* current string */
+ register Bytef *match; /* matched string */
+ register int len; /* length of current match */
+ int best_len = s->prev_length; /* best match length so far */
+ int nice_match = s->nice_match; /* stop if match long enough */
+ IPos limit = s->strstart > (IPos)MAX_DIST(s) ?
+ s->strstart - (IPos)MAX_DIST(s) : NIL;
+ /* Stop when cur_match becomes <= limit. To simplify the code,
+ * we prevent matches with the string of window index 0.
+ */
+ Posf *prev = s->prev;
+ uInt wmask = s->w_mask;
+
+#ifdef UNALIGNED_OK
+ /* Compare two bytes at a time. Note: this is not always beneficial.
+ * Try with and without -DUNALIGNED_OK to check.
+ */
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1;
+ register ush scan_start = *(ushf*)scan;
+ register ush scan_end = *(ushf*)(scan+best_len-1);
+#else
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH;
+ register Byte scan_end1 = scan[best_len-1];
+ register Byte scan_end = scan[best_len];
+#endif
+
+ /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16.
+ * It is easy to get rid of this optimization if necessary.
+ */
+ Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever");
+
+ /* Do not waste too much time if we already have a good match: */
+ if (s->prev_length >= s->good_match) {
+ chain_length >>= 2;
+ }
+ /* Do not look for matches beyond the end of the input. This is necessary
+ * to make deflate deterministic.
+ */
+ if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead;
+
+ Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead");
+
+ do {
+ Assert(cur_match < s->strstart, "no future");
+ match = s->window + cur_match;
+
+ /* Skip to next match if the match length cannot increase
+ * or if the match length is less than 2:
+ */
+#if (defined(UNALIGNED_OK) && MAX_MATCH == 258)
+ /* This code assumes sizeof(unsigned short) == 2. Do not use
+ * UNALIGNED_OK if your compiler uses a different size.
+ */
+ if (*(ushf*)(match+best_len-1) != scan_end ||
+ *(ushf*)match != scan_start) continue;
+
+ /* It is not necessary to compare scan[2] and match[2] since they are
+ * always equal when the other bytes match, given that the hash keys
+ * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at
+ * strstart+3, +5, ... up to strstart+257. We check for insufficient
+ * lookahead only every 4th comparison; the 128th check will be made
+ * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is
+ * necessary to put more guard bytes at the end of the window, or
+ * to check more often for insufficient lookahead.
+ */
+ Assert(scan[2] == match[2], "scan[2]?");
+ scan++, match++;
+ do {
+ } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ scan < strend);
+ /* The funny "do {}" generates better code on most compilers */
+
+ /* Here, scan <= window+strstart+257 */
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+ if (*scan == *match) scan++;
+
+ len = (MAX_MATCH - 1) - (int)(strend-scan);
+ scan = strend - (MAX_MATCH-1);
+
+#else /* UNALIGNED_OK */
+
+ if (match[best_len] != scan_end ||
+ match[best_len-1] != scan_end1 ||
+ *match != *scan ||
+ *++match != scan[1]) continue;
+
+ /* The check at best_len-1 can be removed because it will be made
+ * again later. (This heuristic is not always a win.)
+ * It is not necessary to compare scan[2] and match[2] since they
+ * are always equal when the other bytes match, given that
+ * the hash keys are equal and that HASH_BITS >= 8.
+ */
+ scan += 2, match++;
+ Assert(*scan == *match, "match[2]?");
+
+ /* We check for insufficient lookahead only every 8th comparison;
+ * the 256th check will be made at strstart+258.
+ */
+ do {
+ } while (*++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ scan < strend);
+
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+
+ len = MAX_MATCH - (int)(strend - scan);
+ scan = strend - MAX_MATCH;
+
+#endif /* UNALIGNED_OK */
+
+ if (len > best_len) {
+ s->match_start = cur_match;
+ best_len = len;
+ if (len >= nice_match) break;
+#ifdef UNALIGNED_OK
+ scan_end = *(ushf*)(scan+best_len-1);
+#else
+ scan_end1 = scan[best_len-1];
+ scan_end = scan[best_len];
+#endif
+ }
+ } while ((cur_match = prev[cur_match & wmask]) > limit
+ && --chain_length != 0);
+
+ if ((uInt)best_len <= s->lookahead) return (uInt)best_len;
+ return s->lookahead;
+}
+
+#endif /* ASMV */
--- /dev/null
+c:\masm611\bin\ml /coff /Zi /c /Flgvmat32.lst gvmat32.asm
--- /dev/null
+LIBRARY "zlib"
+
+DESCRIPTION '"""zlib data compression library"""'
+
+
+VERSION 1.11
+
+
+HEAPSIZE 1048576,8192
+
+EXPORTS
+ adler32 @1
+ compress @2
+ crc32 @3
+ deflate @4
+ deflateCopy @5
+ deflateEnd @6
+ deflateInit2_ @7
+ deflateInit_ @8
+ deflateParams @9
+ deflateReset @10
+ deflateSetDictionary @11
+ gzclose @12
+ gzdopen @13
+ gzerror @14
+ gzflush @15
+ gzopen @16
+ gzread @17
+ gzwrite @18
+ inflate @19
+ inflateEnd @20
+ inflateInit2_ @21
+ inflateInit_ @22
+ inflateReset @23
+ inflateSetDictionary @24
+ inflateSync @25
+ uncompress @26
+ zlibVersion @27
+ gzprintf @28
+ gzputc @29
+ gzgetc @30
+ gzseek @31
+ gzrewind @32
+ gztell @33
+ gzeof @34
+ gzsetparams @35
+ zError @36
+ inflateSyncPoint @37
+ get_crc_table @38
+ compress2 @39
+ gzputs @40
+ gzgets @41
+
+ unzOpen @61
+ unzClose @62
+ unzGetGlobalInfo @63
+ unzGetCurrentFileInfo @64
+ unzGoToFirstFile @65
+ unzGoToNextFile @66
+ unzOpenCurrentFile @67
+ unzReadCurrentFile @68
+ unztell @70
+ unzeof @71
+ unzCloseCurrentFile @72
+ unzGetGlobalComment @73
+ unzStringFileNameCompare @74
+ unzLocateFile @75
+ unzGetLocalExtrafield @76
+
+ zipOpen @80
+ zipOpenNewFileInZip @81
+ zipWriteInFileInZip @82
+ zipCloseFileInZip @83
+ zipClose @84
--- /dev/null
+# Microsoft Developer Studio Project File - Name="zlibvc" - Package Owner=<4>
+# Microsoft Developer Studio Generated Build File, Format Version 5.00
+# ** DO NOT EDIT **
+
+# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102
+# TARGTYPE "Win32 (ALPHA) Dynamic-Link Library" 0x0602
+
+CFG=zlibvc - Win32 Release
+!MESSAGE This is not a valid makefile. To build this project using NMAKE,
+!MESSAGE use the Export Makefile command and run
+!MESSAGE
+!MESSAGE NMAKE /f "zlibvc.mak".
+!MESSAGE
+!MESSAGE You can specify a configuration when running NMAKE
+!MESSAGE by defining the macro CFG on the command line. For example:
+!MESSAGE
+!MESSAGE NMAKE /f "zlibvc.mak" CFG="zlibvc - Win32 Release"
+!MESSAGE
+!MESSAGE Possible choices for configuration are:
+!MESSAGE
+!MESSAGE "zlibvc - Win32 Release" (based on "Win32 (x86) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 Debug" (based on "Win32 (x86) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 ReleaseAxp" (based on\
+ "Win32 (ALPHA) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 ReleaseWithoutAsm" (based on\
+ "Win32 (x86) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 ReleaseWithoutCrtdll" (based on\
+ "Win32 (x86) Dynamic-Link Library")
+!MESSAGE
+
+# Begin Project
+# PROP Scc_ProjName ""
+# PROP Scc_LocalPath ""
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir ".\Release"
+# PROP BASE Intermediate_Dir ".\Release"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir ".\Release"
+# PROP Intermediate_Dir ".\Release"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386
+# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 1
+# PROP BASE Output_Dir ".\Debug"
+# PROP BASE Intermediate_Dir ".\Debug"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 1
+# PROP Output_Dir ".\Debug"
+# PROP Intermediate_Dir ".\Debug"
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /c
+# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "_DEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "_DEBUG" /win32
+# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "_DEBUG"
+# ADD RSC /l 0x40c /d "_DEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:".\Debug\zlib.dll"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "zlibvc__"
+# PROP BASE Intermediate_Dir "zlibvc__"
+# PROP BASE Ignore_Export_Lib 0
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "zlibvc__"
+# PROP Intermediate_Dir "zlibvc__"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c
+# ADD CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT BASE LINK32 /pdb:none
+# ADD LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:"zlibvc__\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "zlibvc_0"
+# PROP BASE Intermediate_Dir "zlibvc_0"
+# PROP BASE Ignore_Export_Lib 0
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "zlibvc_0"
+# PROP Intermediate_Dir "zlibvc_0"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT BASE LINK32 /pdb:none
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_0\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "zlibvc_1"
+# PROP BASE Intermediate_Dir "zlibvc_1"
+# PROP BASE Ignore_Export_Lib 0
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "zlibvc_1"
+# PROP Intermediate_Dir "zlibvc_1"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /YX /FD /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT BASE LINK32 /pdb:none
+# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_1\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ENDIF
+
+# Begin Target
+
+# Name "zlibvc - Win32 Release"
+# Name "zlibvc - Win32 Debug"
+# Name "zlibvc - Win32 ReleaseAxp"
+# Name "zlibvc - Win32 ReleaseWithoutAsm"
+# Name "zlibvc - Win32 ReleaseWithoutCrtdll"
+# Begin Group "Source Files"
+
+# PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;hpj;bat;for;f90"
+# Begin Source File
+
+SOURCE=.\adler32.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_ADLER=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\compress.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_COMPR=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\crc32.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_CRC32=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\deflate.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_DEFLA=\
+ ".\deflate.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\gvmat32c.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\gzio.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_GZIO_=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\infblock.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFBL=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\infcodes.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFCO=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inffast.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\inffast.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFFA=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inffast.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\inflate.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFLA=\
+ ".\infblock.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\inftrees.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFTR=\
+ ".\inftrees.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\infutil.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFUT=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\trees.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_TREES=\
+ ".\deflate.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\uncompr.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_UNCOM=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\unzip.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\zip.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\zlib.rc
+# End Source File
+# Begin Source File
+
+SOURCE=.\zlibvc.def
+# End Source File
+# Begin Source File
+
+SOURCE=.\zutil.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_ZUTIL=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# End Group
+# Begin Group "Header Files"
+
+# PROP Default_Filter "h;hpp;hxx;hm;inl;fi;fd"
+# Begin Source File
+
+SOURCE=.\deflate.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\infblock.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\infcodes.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\inffast.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\inftrees.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\infutil.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\zconf.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\zlib.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\zutil.h
+# End Source File
+# End Group
+# Begin Group "Resource Files"
+
+# PROP Default_Filter "ico;cur;bmp;dlg;rc2;rct;bin;cnt;rtf;gif;jpg;jpeg;jpe"
+# End Group
+# End Target
+# End Project
--- /dev/null
+Microsoft Developer Studio Workspace File, Format Version 5.00
+# WARNING: DO NOT EDIT OR DELETE THIS WORKSPACE FILE!
+
+###############################################################################
+
+Project: "zlibstat"=.\zlibstat.dsp - Package Owner=<4>
+
+Package=<5>
+{{{
+}}}
+
+Package=<4>
+{{{
+}}}
+
+###############################################################################
+
+Project: "zlibvc"=.\zlibvc.dsp - Package Owner=<4>
+
+Package=<5>
+{{{
+}}}
+
+Package=<4>
+{{{
+}}}
+
+###############################################################################
+
+Global:
+
+Package=<5>
+{{{
+}}}
+
+Package=<3>
+{{{
+}}}
+
+###############################################################################
+
--- /dev/null
+This is a patched version of zlib modified to use
+Pentium-optimized assembly code in the deflation algorithm. The files
+changed/added by this patch are:
+
+README.586
+match.S
+
+The effectiveness of these modifications is a bit marginal, as the the
+program's bottleneck seems to be mostly L1-cache contention, for which
+there is no real way to work around without rewriting the basic
+algorithm. The speedup on average is around 5-10% (which is generally
+less than the amount of variance between subsequent executions).
+However, when used at level 9 compression, the cache contention can
+drop enough for the assembly version to achieve 10-20% speedup (and
+sometimes more, depending on the amount of overall redundancy in the
+files). Even here, though, cache contention can still be the limiting
+factor, depending on the nature of the program using the zlib library.
+This may also mean that better improvements will be seen on a Pentium
+with MMX, which suffers much less from L1-cache contention, but I have
+not yet verified this.
+
+Note that this code has been tailored for the Pentium in particular,
+and will not perform well on the Pentium Pro (due to the use of a
+partial register in the inner loop).
+
+If you are using an assembler other than GNU as, you will have to
+translate match.S to use your assembler's syntax. (Have fun.)
+
+Brian Raiter
+breadbox@muppetlabs.com
+April, 1998
+
+
+Added for zlib 1.1.3:
+
+The patches come from
+http://www.muppetlabs.com/~breadbox/software/assembly.html
+
+To compile zlib with this asm file, copy match.S to the zlib directory
+then do:
+
+CFLAGS="-O3 -DASMV" ./configure
+make OBJA=match.o
--- /dev/null
+/* match.s -- Pentium-optimized version of longest_match()
+ * Written for zlib 1.1.2
+ * Copyright (C) 1998 Brian Raiter <breadbox@muppetlabs.com>
+ *
+ * This is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License.
+ */
+
+#ifndef NO_UNDERLINE
+#define match_init _match_init
+#define longest_match _longest_match
+#endif
+
+#define MAX_MATCH (258)
+#define MIN_MATCH (3)
+#define MIN_LOOKAHEAD (MAX_MATCH + MIN_MATCH + 1)
+#define MAX_MATCH_8 ((MAX_MATCH + 7) & ~7)
+
+/* stack frame offsets */
+
+#define wmask 0 /* local copy of s->wmask */
+#define window 4 /* local copy of s->window */
+#define windowbestlen 8 /* s->window + bestlen */
+#define chainlenscanend 12 /* high word: current chain len */
+ /* low word: last bytes sought */
+#define scanstart 16 /* first two bytes of string */
+#define scanalign 20 /* dword-misalignment of string */
+#define nicematch 24 /* a good enough match size */
+#define bestlen 28 /* size of best match so far */
+#define scan 32 /* ptr to string wanting match */
+
+#define LocalVarsSize (36)
+/* saved ebx 36 */
+/* saved edi 40 */
+/* saved esi 44 */
+/* saved ebp 48 */
+/* return address 52 */
+#define deflatestate 56 /* the function arguments */
+#define curmatch 60
+
+/* Offsets for fields in the deflate_state structure. These numbers
+ * are calculated from the definition of deflate_state, with the
+ * assumption that the compiler will dword-align the fields. (Thus,
+ * changing the definition of deflate_state could easily cause this
+ * program to crash horribly, without so much as a warning at
+ * compile time. Sigh.)
+ */
+#define dsWSize 36
+#define dsWMask 44
+#define dsWindow 48
+#define dsPrev 56
+#define dsMatchLen 88
+#define dsPrevMatch 92
+#define dsStrStart 100
+#define dsMatchStart 104
+#define dsLookahead 108
+#define dsPrevLen 112
+#define dsMaxChainLen 116
+#define dsGoodMatch 132
+#define dsNiceMatch 136
+
+
+.file "match.S"
+
+.globl match_init, longest_match
+
+.text
+
+/* uInt longest_match(deflate_state *deflatestate, IPos curmatch) */
+
+longest_match:
+
+/* Save registers that the compiler may be using, and adjust %esp to */
+/* make room for our stack frame. */
+
+ pushl %ebp
+ pushl %edi
+ pushl %esi
+ pushl %ebx
+ subl $LocalVarsSize, %esp
+
+/* Retrieve the function arguments. %ecx will hold cur_match */
+/* throughout the entire function. %edx will hold the pointer to the */
+/* deflate_state structure during the function's setup (before */
+/* entering the main loop). */
+
+ movl deflatestate(%esp), %edx
+ movl curmatch(%esp), %ecx
+
+/* if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; */
+
+ movl dsNiceMatch(%edx), %eax
+ movl dsLookahead(%edx), %ebx
+ cmpl %eax, %ebx
+ jl LookaheadLess
+ movl %eax, %ebx
+LookaheadLess: movl %ebx, nicematch(%esp)
+
+/* register Bytef *scan = s->window + s->strstart; */
+
+ movl dsWindow(%edx), %esi
+ movl %esi, window(%esp)
+ movl dsStrStart(%edx), %ebp
+ lea (%esi,%ebp), %edi
+ movl %edi, scan(%esp)
+
+/* Determine how many bytes the scan ptr is off from being */
+/* dword-aligned. */
+
+ movl %edi, %eax
+ negl %eax
+ andl $3, %eax
+ movl %eax, scanalign(%esp)
+
+/* IPos limit = s->strstart > (IPos)MAX_DIST(s) ? */
+/* s->strstart - (IPos)MAX_DIST(s) : NIL; */
+
+ movl dsWSize(%edx), %eax
+ subl $MIN_LOOKAHEAD, %eax
+ subl %eax, %ebp
+ jg LimitPositive
+ xorl %ebp, %ebp
+LimitPositive:
+
+/* unsigned chain_length = s->max_chain_length; */
+/* if (s->prev_length >= s->good_match) { */
+/* chain_length >>= 2; */
+/* } */
+
+ movl dsPrevLen(%edx), %eax
+ movl dsGoodMatch(%edx), %ebx
+ cmpl %ebx, %eax
+ movl dsMaxChainLen(%edx), %ebx
+ jl LastMatchGood
+ shrl $2, %ebx
+LastMatchGood:
+
+/* chainlen is decremented once beforehand so that the function can */
+/* use the sign flag instead of the zero flag for the exit test. */
+/* It is then shifted into the high word, to make room for the scanend */
+/* scanend value, which it will always accompany. */
+
+ decl %ebx
+ shll $16, %ebx
+
+/* int best_len = s->prev_length; */
+
+ movl dsPrevLen(%edx), %eax
+ movl %eax, bestlen(%esp)
+
+/* Store the sum of s->window + best_len in %esi locally, and in %esi. */
+
+ addl %eax, %esi
+ movl %esi, windowbestlen(%esp)
+
+/* register ush scan_start = *(ushf*)scan; */
+/* register ush scan_end = *(ushf*)(scan+best_len-1); */
+
+ movw (%edi), %bx
+ movw %bx, scanstart(%esp)
+ movw -1(%edi,%eax), %bx
+ movl %ebx, chainlenscanend(%esp)
+
+/* Posf *prev = s->prev; */
+/* uInt wmask = s->w_mask; */
+
+ movl dsPrev(%edx), %edi
+ movl dsWMask(%edx), %edx
+ mov %edx, wmask(%esp)
+
+/* Jump into the main loop. */
+
+ jmp LoopEntry
+
+.balign 16
+
+/* do {
+ * match = s->window + cur_match;
+ * if (*(ushf*)(match+best_len-1) != scan_end ||
+ * *(ushf*)match != scan_start) continue;
+ * [...]
+ * } while ((cur_match = prev[cur_match & wmask]) > limit
+ * && --chain_length != 0);
+ *
+ * Here is the inner loop of the function. The function will spend the
+ * majority of its time in this loop, and majority of that time will
+ * be spent in the first ten instructions.
+ *
+ * Within this loop:
+ * %ebx = chainlenscanend - i.e., ((chainlen << 16) | scanend)
+ * %ecx = curmatch
+ * %edx = curmatch & wmask
+ * %esi = windowbestlen - i.e., (window + bestlen)
+ * %edi = prev
+ * %ebp = limit
+ *
+ * Two optimization notes on the choice of instructions:
+ *
+ * The first instruction uses a 16-bit address, which costs an extra,
+ * unpairable cycle. This is cheaper than doing a 32-bit access and
+ * zeroing the high word, due to the 3-cycle misalignment penalty which
+ * would occur half the time. This also turns out to be cheaper than
+ * doing two separate 8-bit accesses, as the memory is so rarely in the
+ * L1 cache.
+ *
+ * The window buffer, however, apparently spends a lot of time in the
+ * cache, and so it is faster to retrieve the word at the end of the
+ * match string with two 8-bit loads. The instructions that test the
+ * word at the beginning of the match string, however, are executed
+ * much less frequently, and there it was cheaper to use 16-bit
+ * instructions, which avoided the necessity of saving off and
+ * subsequently reloading one of the other registers.
+ */
+LookupLoop:
+ /* 1 U & V */
+ movw (%edi,%edx,2), %cx /* 2 U pipe */
+ movl wmask(%esp), %edx /* 2 V pipe */
+ cmpl %ebp, %ecx /* 3 U pipe */
+ jbe LeaveNow /* 3 V pipe */
+ subl $0x00010000, %ebx /* 4 U pipe */
+ js LeaveNow /* 4 V pipe */
+LoopEntry: movb -1(%esi,%ecx), %al /* 5 U pipe */
+ andl %ecx, %edx /* 5 V pipe */
+ cmpb %bl, %al /* 6 U pipe */
+ jnz LookupLoop /* 6 V pipe */
+ movb (%esi,%ecx), %ah
+ cmpb %bh, %ah
+ jnz LookupLoop
+ movl window(%esp), %eax
+ movw (%eax,%ecx), %ax
+ cmpw scanstart(%esp), %ax
+ jnz LookupLoop
+
+/* Store the current value of chainlen. */
+
+ movl %ebx, chainlenscanend(%esp)
+
+/* Point %edi to the string under scrutiny, and %esi to the string we */
+/* are hoping to match it up with. In actuality, %esi and %edi are */
+/* both pointed (MAX_MATCH_8 - scanalign) bytes ahead, and %edx is */
+/* initialized to -(MAX_MATCH_8 - scanalign). */
+
+ movl window(%esp), %esi
+ movl scan(%esp), %edi
+ addl %ecx, %esi
+ movl scanalign(%esp), %eax
+ movl $(-MAX_MATCH_8), %edx
+ lea MAX_MATCH_8(%edi,%eax), %edi
+ lea MAX_MATCH_8(%esi,%eax), %esi
+
+/* Test the strings for equality, 8 bytes at a time. At the end,
+ * adjust %edx so that it is offset to the exact byte that mismatched.
+ *
+ * We already know at this point that the first three bytes of the
+ * strings match each other, and they can be safely passed over before
+ * starting the compare loop. So what this code does is skip over 0-3
+ * bytes, as much as necessary in order to dword-align the %edi
+ * pointer. (%esi will still be misaligned three times out of four.)
+ *
+ * It should be confessed that this loop usually does not represent
+ * much of the total running time. Replacing it with a more
+ * straightforward "rep cmpsb" would not drastically degrade
+ * performance.
+ */
+LoopCmps:
+ movl (%esi,%edx), %eax
+ movl (%edi,%edx), %ebx
+ xorl %ebx, %eax
+ jnz LeaveLoopCmps
+ movl 4(%esi,%edx), %eax
+ movl 4(%edi,%edx), %ebx
+ xorl %ebx, %eax
+ jnz LeaveLoopCmps4
+ addl $8, %edx
+ jnz LoopCmps
+ jmp LenMaximum
+LeaveLoopCmps4: addl $4, %edx
+LeaveLoopCmps: testl $0x0000FFFF, %eax
+ jnz LenLower
+ addl $2, %edx
+ shrl $16, %eax
+LenLower: subb $1, %al
+ adcl $0, %edx
+
+/* Calculate the length of the match. If it is longer than MAX_MATCH, */
+/* then automatically accept it as the best possible match and leave. */
+
+ lea (%edi,%edx), %eax
+ movl scan(%esp), %edi
+ subl %edi, %eax
+ cmpl $MAX_MATCH, %eax
+ jge LenMaximum
+
+/* If the length of the match is not longer than the best match we */
+/* have so far, then forget it and return to the lookup loop. */
+
+ movl deflatestate(%esp), %edx
+ movl bestlen(%esp), %ebx
+ cmpl %ebx, %eax
+ jg LongerMatch
+ movl chainlenscanend(%esp), %ebx
+ movl windowbestlen(%esp), %esi
+ movl dsPrev(%edx), %edi
+ movl wmask(%esp), %edx
+ andl %ecx, %edx
+ jmp LookupLoop
+
+/* s->match_start = cur_match; */
+/* best_len = len; */
+/* if (len >= nice_match) break; */
+/* scan_end = *(ushf*)(scan+best_len-1); */
+
+LongerMatch: movl nicematch(%esp), %ebx
+ movl %eax, bestlen(%esp)
+ movl %ecx, dsMatchStart(%edx)
+ cmpl %ebx, %eax
+ jge LeaveNow
+ movl window(%esp), %esi
+ addl %eax, %esi
+ movl %esi, windowbestlen(%esp)
+ movl chainlenscanend(%esp), %ebx
+ movw -1(%edi,%eax), %bx
+ movl dsPrev(%edx), %edi
+ movl %ebx, chainlenscanend(%esp)
+ movl wmask(%esp), %edx
+ andl %ecx, %edx
+ jmp LookupLoop
+
+/* Accept the current string, with the maximum possible length. */
+
+LenMaximum: movl deflatestate(%esp), %edx
+ movl $MAX_MATCH, bestlen(%esp)
+ movl %ecx, dsMatchStart(%edx)
+
+/* if ((uInt)best_len <= s->lookahead) return (uInt)best_len; */
+/* return s->lookahead; */
+
+LeaveNow:
+ movl deflatestate(%esp), %edx
+ movl bestlen(%esp), %ebx
+ movl dsLookahead(%edx), %eax
+ cmpl %eax, %ebx
+ jg LookaheadRet
+ movl %ebx, %eax
+LookaheadRet:
+
+/* Restore the stack and return from whence we came. */
+
+ addl $LocalVarsSize, %esp
+ popl %ebx
+ popl %esi
+ popl %edi
+ popl %ebp
+match_init: ret
--- /dev/null
+This is a patched version of zlib, modified to use
+Pentium-Pro-optimized assembly code in the deflation algorithm. The
+files changed/added by this patch are:
+
+README.686
+match.S
+
+The speedup that this patch provides varies, depending on whether the
+compiler used to build the original version of zlib falls afoul of the
+PPro's speed traps. My own tests show a speedup of around 10-20% at
+the default compression level, and 20-30% using -9, against a version
+compiled using gcc 2.7.2.3. Your mileage may vary.
+
+Note that this code has been tailored for the PPro/PII in particular,
+and will not perform particuarly well on a Pentium.
+
+If you are using an assembler other than GNU as, you will have to
+translate match.S to use your assembler's syntax. (Have fun.)
+
+Brian Raiter
+breadbox@muppetlabs.com
+April, 1998
+
+
+Added for zlib 1.1.3:
+
+The patches come from
+http://www.muppetlabs.com/~breadbox/software/assembly.html
+
+To compile zlib with this asm file, copy match.S to the zlib directory
+then do:
+
+CFLAGS="-O3 -DASMV" ./configure
+make OBJA=match.o
--- /dev/null
+/* match.s -- Pentium-Pro-optimized version of longest_match()
+ * Written for zlib 1.1.2
+ * Copyright (C) 1998 Brian Raiter <breadbox@muppetlabs.com>
+ *
+ * This is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License.
+ */
+
+#ifndef NO_UNDERLINE
+#define match_init _match_init
+#define longest_match _longest_match
+#endif
+
+#define MAX_MATCH (258)
+#define MIN_MATCH (3)
+#define MIN_LOOKAHEAD (MAX_MATCH + MIN_MATCH + 1)
+#define MAX_MATCH_8 ((MAX_MATCH + 7) & ~7)
+
+/* stack frame offsets */
+
+#define chainlenwmask 0 /* high word: current chain len */
+ /* low word: s->wmask */
+#define window 4 /* local copy of s->window */
+#define windowbestlen 8 /* s->window + bestlen */
+#define scanstart 16 /* first two bytes of string */
+#define scanend 12 /* last two bytes of string */
+#define scanalign 20 /* dword-misalignment of string */
+#define nicematch 24 /* a good enough match size */
+#define bestlen 28 /* size of best match so far */
+#define scan 32 /* ptr to string wanting match */
+
+#define LocalVarsSize (36)
+/* saved ebx 36 */
+/* saved edi 40 */
+/* saved esi 44 */
+/* saved ebp 48 */
+/* return address 52 */
+#define deflatestate 56 /* the function arguments */
+#define curmatch 60
+
+/* Offsets for fields in the deflate_state structure. These numbers
+ * are calculated from the definition of deflate_state, with the
+ * assumption that the compiler will dword-align the fields. (Thus,
+ * changing the definition of deflate_state could easily cause this
+ * program to crash horribly, without so much as a warning at
+ * compile time. Sigh.)
+ */
+#define dsWSize 36
+#define dsWMask 44
+#define dsWindow 48
+#define dsPrev 56
+#define dsMatchLen 88
+#define dsPrevMatch 92
+#define dsStrStart 100
+#define dsMatchStart 104
+#define dsLookahead 108
+#define dsPrevLen 112
+#define dsMaxChainLen 116
+#define dsGoodMatch 132
+#define dsNiceMatch 136
+
+
+.file "match.S"
+
+.globl match_init, longest_match
+
+.text
+
+/* uInt longest_match(deflate_state *deflatestate, IPos curmatch) */
+
+longest_match:
+
+/* Save registers that the compiler may be using, and adjust %esp to */
+/* make room for our stack frame. */
+
+ pushl %ebp
+ pushl %edi
+ pushl %esi
+ pushl %ebx
+ subl $LocalVarsSize, %esp
+
+/* Retrieve the function arguments. %ecx will hold cur_match */
+/* throughout the entire function. %edx will hold the pointer to the */
+/* deflate_state structure during the function's setup (before */
+/* entering the main loop). */
+
+ movl deflatestate(%esp), %edx
+ movl curmatch(%esp), %ecx
+
+/* uInt wmask = s->w_mask; */
+/* unsigned chain_length = s->max_chain_length; */
+/* if (s->prev_length >= s->good_match) { */
+/* chain_length >>= 2; */
+/* } */
+
+ movl dsPrevLen(%edx), %eax
+ movl dsGoodMatch(%edx), %ebx
+ cmpl %ebx, %eax
+ movl dsWMask(%edx), %eax
+ movl dsMaxChainLen(%edx), %ebx
+ jl LastMatchGood
+ shrl $2, %ebx
+LastMatchGood:
+
+/* chainlen is decremented once beforehand so that the function can */
+/* use the sign flag instead of the zero flag for the exit test. */
+/* It is then shifted into the high word, to make room for the wmask */
+/* value, which it will always accompany. */
+
+ decl %ebx
+ shll $16, %ebx
+ orl %eax, %ebx
+ movl %ebx, chainlenwmask(%esp)
+
+/* if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; */
+
+ movl dsNiceMatch(%edx), %eax
+ movl dsLookahead(%edx), %ebx
+ cmpl %eax, %ebx
+ jl LookaheadLess
+ movl %eax, %ebx
+LookaheadLess: movl %ebx, nicematch(%esp)
+
+/* register Bytef *scan = s->window + s->strstart; */
+
+ movl dsWindow(%edx), %esi
+ movl %esi, window(%esp)
+ movl dsStrStart(%edx), %ebp
+ lea (%esi,%ebp), %edi
+ movl %edi, scan(%esp)
+
+/* Determine how many bytes the scan ptr is off from being */
+/* dword-aligned. */
+
+ movl %edi, %eax
+ negl %eax
+ andl $3, %eax
+ movl %eax, scanalign(%esp)
+
+/* IPos limit = s->strstart > (IPos)MAX_DIST(s) ? */
+/* s->strstart - (IPos)MAX_DIST(s) : NIL; */
+
+ movl dsWSize(%edx), %eax
+ subl $MIN_LOOKAHEAD, %eax
+ subl %eax, %ebp
+ jg LimitPositive
+ xorl %ebp, %ebp
+LimitPositive:
+
+/* int best_len = s->prev_length; */
+
+ movl dsPrevLen(%edx), %eax
+ movl %eax, bestlen(%esp)
+
+/* Store the sum of s->window + best_len in %esi locally, and in %esi. */
+
+ addl %eax, %esi
+ movl %esi, windowbestlen(%esp)
+
+/* register ush scan_start = *(ushf*)scan; */
+/* register ush scan_end = *(ushf*)(scan+best_len-1); */
+/* Posf *prev = s->prev; */
+
+ movzwl (%edi), %ebx
+ movl %ebx, scanstart(%esp)
+ movzwl -1(%edi,%eax), %ebx
+ movl %ebx, scanend(%esp)
+ movl dsPrev(%edx), %edi
+
+/* Jump into the main loop. */
+
+ movl chainlenwmask(%esp), %edx
+ jmp LoopEntry
+
+.balign 16
+
+/* do {
+ * match = s->window + cur_match;
+ * if (*(ushf*)(match+best_len-1) != scan_end ||
+ * *(ushf*)match != scan_start) continue;
+ * [...]
+ * } while ((cur_match = prev[cur_match & wmask]) > limit
+ * && --chain_length != 0);
+ *
+ * Here is the inner loop of the function. The function will spend the
+ * majority of its time in this loop, and majority of that time will
+ * be spent in the first ten instructions.
+ *
+ * Within this loop:
+ * %ebx = scanend
+ * %ecx = curmatch
+ * %edx = chainlenwmask - i.e., ((chainlen << 16) | wmask)
+ * %esi = windowbestlen - i.e., (window + bestlen)
+ * %edi = prev
+ * %ebp = limit
+ */
+LookupLoop:
+ andl %edx, %ecx
+ movzwl (%edi,%ecx,2), %ecx
+ cmpl %ebp, %ecx
+ jbe LeaveNow
+ subl $0x00010000, %edx
+ js LeaveNow
+LoopEntry: movzwl -1(%esi,%ecx), %eax
+ cmpl %ebx, %eax
+ jnz LookupLoop
+ movl window(%esp), %eax
+ movzwl (%eax,%ecx), %eax
+ cmpl scanstart(%esp), %eax
+ jnz LookupLoop
+
+/* Store the current value of chainlen. */
+
+ movl %edx, chainlenwmask(%esp)
+
+/* Point %edi to the string under scrutiny, and %esi to the string we */
+/* are hoping to match it up with. In actuality, %esi and %edi are */
+/* both pointed (MAX_MATCH_8 - scanalign) bytes ahead, and %edx is */
+/* initialized to -(MAX_MATCH_8 - scanalign). */
+
+ movl window(%esp), %esi
+ movl scan(%esp), %edi
+ addl %ecx, %esi
+ movl scanalign(%esp), %eax
+ movl $(-MAX_MATCH_8), %edx
+ lea MAX_MATCH_8(%edi,%eax), %edi
+ lea MAX_MATCH_8(%esi,%eax), %esi
+
+/* Test the strings for equality, 8 bytes at a time. At the end,
+ * adjust %edx so that it is offset to the exact byte that mismatched.
+ *
+ * We already know at this point that the first three bytes of the
+ * strings match each other, and they can be safely passed over before
+ * starting the compare loop. So what this code does is skip over 0-3
+ * bytes, as much as necessary in order to dword-align the %edi
+ * pointer. (%esi will still be misaligned three times out of four.)
+ *
+ * It should be confessed that this loop usually does not represent
+ * much of the total running time. Replacing it with a more
+ * straightforward "rep cmpsb" would not drastically degrade
+ * performance.
+ */
+LoopCmps:
+ movl (%esi,%edx), %eax
+ xorl (%edi,%edx), %eax
+ jnz LeaveLoopCmps
+ movl 4(%esi,%edx), %eax
+ xorl 4(%edi,%edx), %eax
+ jnz LeaveLoopCmps4
+ addl $8, %edx
+ jnz LoopCmps
+ jmp LenMaximum
+LeaveLoopCmps4: addl $4, %edx
+LeaveLoopCmps: testl $0x0000FFFF, %eax
+ jnz LenLower
+ addl $2, %edx
+ shrl $16, %eax
+LenLower: subb $1, %al
+ adcl $0, %edx
+
+/* Calculate the length of the match. If it is longer than MAX_MATCH, */
+/* then automatically accept it as the best possible match and leave. */
+
+ lea (%edi,%edx), %eax
+ movl scan(%esp), %edi
+ subl %edi, %eax
+ cmpl $MAX_MATCH, %eax
+ jge LenMaximum
+
+/* If the length of the match is not longer than the best match we */
+/* have so far, then forget it and return to the lookup loop. */
+
+ movl deflatestate(%esp), %edx
+ movl bestlen(%esp), %ebx
+ cmpl %ebx, %eax
+ jg LongerMatch
+ movl windowbestlen(%esp), %esi
+ movl dsPrev(%edx), %edi
+ movl scanend(%esp), %ebx
+ movl chainlenwmask(%esp), %edx
+ jmp LookupLoop
+
+/* s->match_start = cur_match; */
+/* best_len = len; */
+/* if (len >= nice_match) break; */
+/* scan_end = *(ushf*)(scan+best_len-1); */
+
+LongerMatch: movl nicematch(%esp), %ebx
+ movl %eax, bestlen(%esp)
+ movl %ecx, dsMatchStart(%edx)
+ cmpl %ebx, %eax
+ jge LeaveNow
+ movl window(%esp), %esi
+ addl %eax, %esi
+ movl %esi, windowbestlen(%esp)
+ movzwl -1(%edi,%eax), %ebx
+ movl dsPrev(%edx), %edi
+ movl %ebx, scanend(%esp)
+ movl chainlenwmask(%esp), %edx
+ jmp LookupLoop
+
+/* Accept the current string, with the maximum possible length. */
+
+LenMaximum: movl deflatestate(%esp), %edx
+ movl $MAX_MATCH, bestlen(%esp)
+ movl %ecx, dsMatchStart(%edx)
+
+/* if ((uInt)best_len <= s->lookahead) return (uInt)best_len; */
+/* return s->lookahead; */
+
+LeaveNow:
+ movl deflatestate(%esp), %edx
+ movl bestlen(%esp), %ebx
+ movl dsLookahead(%edx), %eax
+ cmpl %eax, %ebx
+ jg LookaheadRet
+ movl %ebx, %eax
+LookaheadRet:
+
+/* Restore the stack and return from whence we came. */
+
+ addl $LocalVarsSize, %esp
+ popl %ebx
+ popl %esi
+ popl %edi
+ popl %ebp
+match_init: ret
--- /dev/null
+# Makefile for zlib32bd.lib
+# ------------- Borland C++ 4.5 -------------
+
+# The (32-bit) zlib32bd.lib made with this makefile is intended for use
+# in making the (32-bit) DLL, png32bd.dll. It uses the "stdcall" calling
+# convention.
+
+CFLAGS= -ps -O2 -C -K -N- -k- -d -3 -r- -w-par -w-aus -WDE
+CC=f:\bc45\bin\bcc32
+LIBFLAGS= /C
+LIB=f:\bc45\bin\tlib
+ZLIB=zlib32bd.lib
+
+.autodepend
+.c.obj:
+ $(CC) -c $(CFLAGS) $<
+
+OBJ1=adler32.obj compress.obj crc32.obj deflate.obj gzio.obj infblock.obj
+OBJ2=infcodes.obj inflate.obj inftrees.obj infutil.obj inffast.obj
+OBJ3=trees.obj uncompr.obj zutil.obj
+pOBJ1=+adler32.obj+compress.obj+crc32.obj+deflate.obj+gzio.obj+infblock.obj
+pOBJ2=+infcodes.obj+inflate.obj+inftrees.obj+infutil.obj+inffast.obj
+pOBJ3=+trees.obj+uncompr.obj+zutil.obj
+
+all: $(ZLIB)
+
+$(ZLIB): $(OBJ1) $(OBJ2) $(OBJ3)
+ @if exist $@ del $@
+ $(LIB) @&&|
+$@ $(LIBFLAGS) &
+$(pOBJ1) &
+$(pOBJ2) &
+$(pOBJ3)
+|
+
+# End of makefile for zlib32bd.lib
--- /dev/null
+unit zlibdef;
+
+interface
+
+uses
+ Windows;
+
+const
+ ZLIB_VERSION = '1.1.3';
+
+type
+ voidpf = Pointer;
+ int = Integer;
+ uInt = Cardinal;
+ pBytef = PChar;
+ uLong = Cardinal;
+
+ alloc_func = function(opaque: voidpf; items, size: uInt): voidpf;
+ stdcall;
+ free_func = procedure(opaque, address: voidpf);
+ stdcall;
+
+ internal_state = Pointer;
+
+ z_streamp = ^z_stream;
+ z_stream = packed record
+ next_in: pBytef; // next input byte
+ avail_in: uInt; // number of bytes available at next_in
+ total_in: uLong; // total nb of input bytes read so far
+
+ next_out: pBytef; // next output byte should be put there
+ avail_out: uInt; // remaining free space at next_out
+ total_out: uLong; // total nb of bytes output so far
+
+ msg: PChar; // last error message, NULL if no error
+ state: internal_state; // not visible by applications
+
+ zalloc: alloc_func; // used to allocate the internal state
+ zfree: free_func; // used to free the internal state
+ opaque: voidpf; // private data object passed to zalloc and zfree
+
+ data_type: int; // best guess about the data type: ascii or binary
+ adler: uLong; // adler32 value of the uncompressed data
+ reserved: uLong; // reserved for future use
+ end;
+
+const
+ Z_NO_FLUSH = 0;
+ Z_SYNC_FLUSH = 2;
+ Z_FULL_FLUSH = 3;
+ Z_FINISH = 4;
+
+ Z_OK = 0;
+ Z_STREAM_END = 1;
+
+ Z_NO_COMPRESSION = 0;
+ Z_BEST_SPEED = 1;
+ Z_BEST_COMPRESSION = 9;
+ Z_DEFAULT_COMPRESSION = -1;
+
+ Z_FILTERED = 1;
+ Z_HUFFMAN_ONLY = 2;
+ Z_DEFAULT_STRATEGY = 0;
+
+ Z_BINARY = 0;
+ Z_ASCII = 1;
+ Z_UNKNOWN = 2;
+
+ Z_DEFLATED = 8;
+
+ MAX_MEM_LEVEL = 9;
+
+function adler32(adler: uLong; const buf: pBytef; len: uInt): uLong;
+ stdcall;
+function crc32(crc: uLong; const buf: pBytef; len: uInt): uLong;
+ stdcall;
+function deflate(strm: z_streamp; flush: int): int;
+ stdcall;
+function deflateCopy(dest, source: z_streamp): int;
+ stdcall;
+function deflateEnd(strm: z_streamp): int;
+ stdcall;
+function deflateInit2_(strm: z_streamp; level, method,
+ windowBits, memLevel, strategy: int;
+ const version: PChar; stream_size: int): int;
+ stdcall;
+function deflateInit_(strm: z_streamp; level: int;
+ const version: PChar; stream_size: int): int;
+ stdcall;
+function deflateParams(strm: z_streamp; level, strategy: int): int;
+ stdcall;
+function deflateReset(strm: z_streamp): int;
+ stdcall;
+function deflateSetDictionary(strm: z_streamp;
+ const dictionary: pBytef;
+ dictLength: uInt): int;
+ stdcall;
+function inflate(strm: z_streamp; flush: int): int;
+ stdcall;
+function inflateEnd(strm: z_streamp): int;
+ stdcall;
+function inflateInit2_(strm: z_streamp; windowBits: int;
+ const version: PChar; stream_size: int): int;
+ stdcall;
+function inflateInit_(strm: z_streamp; const version: PChar;
+ stream_size: int): int;
+ stdcall;
+function inflateReset(strm: z_streamp): int;
+ stdcall;
+function inflateSetDictionary(strm: z_streamp;
+ const dictionary: pBytef;
+ dictLength: uInt): int;
+ stdcall;
+function inflateSync(strm: z_streamp): int;
+ stdcall;
+
+function deflateInit(strm: z_streamp; level: int): int;
+function deflateInit2(strm: z_streamp; level, method, windowBits,
+ memLevel, strategy: int): int;
+function inflateInit(strm: z_streamp): int;
+function inflateInit2(strm: z_streamp; windowBits: int): int;
+
+implementation
+
+function deflateInit(strm: z_streamp; level: int): int;
+begin
+ Result := deflateInit_(strm, level, ZLIB_VERSION, sizeof(z_stream));
+end;
+
+function deflateInit2(strm: z_streamp; level, method, windowBits,
+ memLevel, strategy: int): int;
+begin
+ Result := deflateInit2_(strm, level, method, windowBits, memLevel,
+ strategy, ZLIB_VERSION, sizeof(z_stream));
+end;
+
+function inflateInit(strm: z_streamp): int;
+begin
+ Result := inflateInit_(strm, ZLIB_VERSION, sizeof(z_stream));
+end;
+
+function inflateInit2(strm: z_streamp; windowBits: int): int;
+begin
+ Result := inflateInit2_(strm, windowBits, ZLIB_VERSION,
+ sizeof(z_stream));
+end;
+
+const
+ zlibDLL = 'png32bd.dll';
+
+function adler32; external zlibDLL;
+function crc32; external zlibDLL;
+function deflate; external zlibDLL;
+function deflateCopy; external zlibDLL;
+function deflateEnd; external zlibDLL;
+function deflateInit2_; external zlibDLL;
+function deflateInit_; external zlibDLL;
+function deflateParams; external zlibDLL;
+function deflateReset; external zlibDLL;
+function deflateSetDictionary; external zlibDLL;
+function inflate; external zlibDLL;
+function inflateEnd; external zlibDLL;
+function inflateInit2_; external zlibDLL;
+function inflateInit_; external zlibDLL;
+function inflateReset; external zlibDLL;
+function inflateSetDictionary; external zlibDLL;
+function inflateSync; external zlibDLL;
+
+end.
--- /dev/null
+# ---------------------------------------------------------------------------
+!if !$d(BCB)
+BCB = $(MAKEDIR)\..
+!endif
+
+# ---------------------------------------------------------------------------
+# IDE SECTION
+# ---------------------------------------------------------------------------
+# The following section of the project makefile is managed by the BCB IDE.
+# It is recommended to use the IDE to change any of the values in this
+# section.
+# ---------------------------------------------------------------------------
+
+VERSION = BCB.03
+# ---------------------------------------------------------------------------
+PROJECT = d_zlib.lib
+OBJFILES = d_zlib.obj adler32.obj deflate.obj infblock.obj infcodes.obj inffast.obj \
+ inflate.obj inftrees.obj infutil.obj trees.obj
+RESFILES =
+RESDEPEN = $(RESFILES)
+LIBFILES =
+LIBRARIES = VCL35.lib
+SPARELIBS = VCL35.lib
+DEFFILE =
+PACKAGES = VCLX35.bpi VCL35.bpi VCLDB35.bpi VCLDBX35.bpi ibsmp35.bpi bcbsmp35.bpi \
+ dclocx35.bpi QRPT35.bpi TEEUI35.bpi TEEDB35.bpi TEE35.bpi DSS35.bpi \
+ NMFAST35.bpi INETDB35.bpi INET35.bpi VCLMID35.bpi
+# ---------------------------------------------------------------------------
+PATHCPP = .;
+PATHASM = .;
+PATHPAS = .;
+PATHRC = .;
+DEBUGLIBPATH = $(BCB)\lib\debug
+RELEASELIBPATH = $(BCB)\lib\release
+# ---------------------------------------------------------------------------
+CFLAG1 = -O2 -Ve -d -k- -vi
+CFLAG2 = -I$(BCB)\include;$(BCB)\include\vcl -H=$(BCB)\lib\vcl35.csm
+CFLAG3 = -ff -pr -5
+PFLAGS = -U;$(DEBUGLIBPATH) -I$(BCB)\include;$(BCB)\include\vcl -H -W -$I- -v -JPHN -M
+RFLAGS = -i$(BCB)\include;$(BCB)\include\vcl
+AFLAGS = /i$(BCB)\include /i$(BCB)\include\vcl /mx /w2 /zn
+LFLAGS =
+IFLAGS = -g -Gn
+# ---------------------------------------------------------------------------
+ALLOBJ = c0w32.obj $(OBJFILES)
+ALLRES = $(RESFILES)
+ALLLIB = $(LIBFILES) $(LIBRARIES) import32.lib cp32mt.lib
+# ---------------------------------------------------------------------------
+!!ifdef IDEOPTIONS
+
+[Version Info]
+IncludeVerInfo=0
+AutoIncBuild=0
+MajorVer=1
+MinorVer=0
+Release=0
+Build=0
+Debug=0
+PreRelease=0
+Special=0
+Private=0
+DLL=0
+Locale=1040
+CodePage=1252
+
+[Version Info Keys]
+CompanyName=
+FileDescription=
+FileVersion=1.0.0.0
+InternalName=
+LegalCopyright=
+LegalTrademarks=
+OriginalFilename=
+ProductName=
+ProductVersion=1.0.0.0
+Comments=
+
+[HistoryLists\hlIncludePath]
+Count=2
+Item0=$(BCB)\include
+Item1=$(BCB)\include;$(BCB)\include\vcl
+
+[HistoryLists\hlLibraryPath]
+Count=1
+Item0=$(BCB)\lib\obj;$(BCB)\lib
+
+[HistoryLists\hlDebugSourcePath]
+Count=1
+Item0=$(BCB)\source\vcl
+
+[Debugging]
+DebugSourceDirs=
+
+[Parameters]
+RunParams=
+HostApplication=
+
+!endif
+
+ ---------------------------------------------------------------------------
+# MAKE SECTION
+# ---------------------------------------------------------------------------
+# This section of the project file is not used by the BCB IDE. It is for
+# the benefit of building from the command-line using the MAKE utility.
+# ---------------------------------------------------------------------------
+
+.autodepend
+# ---------------------------------------------------------------------------
+!if !$d(BCC32)
+BCC32 = bcc32
+!endif
+
+!if !$d(DCC32)
+DCC32 = dcc32
+!endif
+
+!if !$d(TASM32)
+TASM32 = tasm32
+!endif
+
+!if !$d(LINKER)
+LINKER = TLib
+!endif
+
+!if !$d(BRCC32)
+BRCC32 = brcc32
+!endif
+# ---------------------------------------------------------------------------
+!if $d(PATHCPP)
+.PATH.CPP = $(PATHCPP)
+.PATH.C = $(PATHCPP)
+!endif
+
+!if $d(PATHPAS)
+.PATH.PAS = $(PATHPAS)
+!endif
+
+!if $d(PATHASM)
+.PATH.ASM = $(PATHASM)
+!endif
+
+!if $d(PATHRC)
+.PATH.RC = $(PATHRC)
+!endif
+# ---------------------------------------------------------------------------
+!ifdef IDEOPTIONS
+
+[Version Info]
+IncludeVerInfo=0
+AutoIncBuild=0
+MajorVer=1
+MinorVer=0
+Release=0
+Build=0
+Debug=0
+PreRelease=0
+Special=0
+Private=0
+DLL=0
+Locale=1040
+CodePage=1252
+
+[Version Info Keys]
+CompanyName=
+FileDescription=
+FileVersion=1.0.0.0
+InternalName=
+LegalCopyright=
+LegalTrademarks=
+OriginalFilename=
+ProductName=
+ProductVersion=1.0.0.0
+Comments=
+
+[HistoryLists\hlIncludePath]
+Count=2
+Item0=$(BCB)\include;$(BCB)\include\vcl
+Item1=$(BCB)\include
+
+[HistoryLists\hlLibraryPath]
+Count=1
+Item0=$(BCB)\lib\obj;$(BCB)\lib
+
+[HistoryLists\hlDebugSourcePath]
+Count=1
+Item0=$(BCB)\source\vcl
+
+[Debugging]
+DebugSourceDirs=
+
+[Parameters]
+RunParams=
+HostApplication=
+
+!endif
+
+$(PROJECT): $(OBJFILES) $(RESDEPEN) $(DEFFILE)
+ $(BCB)\BIN\$(LINKER) @&&!
+ $(LFLAGS) $(IFLAGS) +
+ $(ALLOBJ), +
+ $(PROJECT),, +
+ $(ALLLIB), +
+ $(DEFFILE), +
+ $(ALLRES)
+!
+# ---------------------------------------------------------------------------
+.pas.hpp:
+ $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< }
+
+.pas.obj:
+ $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< }
+
+.cpp.obj:
+ $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< }
+
+.c.obj:
+ $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< }
+
+.asm.obj:
+ $(BCB)\BIN\$(TASM32) $(AFLAGS) $<, $@
+
+.rc.res:
+ $(BCB)\BIN\$(BRCC32) $(RFLAGS) -fo$@ $<
+# ---------------------------------------------------------------------------
--- /dev/null
+#include <condefs.h>
+#pragma hdrstop
+//---------------------------------------------------------------------------
+USEUNIT("adler32.c");
+USEUNIT("deflate.c");
+USEUNIT("infblock.c");
+USEUNIT("infcodes.c");
+USEUNIT("inffast.c");
+USEUNIT("inflate.c");
+USEUNIT("inftrees.c");
+USEUNIT("infutil.c");
+USEUNIT("trees.c");
+//---------------------------------------------------------------------------
+#define Library
+
+// To add a file to the library use the Project menu 'Add to Project'.
+
--- /dev/null
+These are files used to compile zlib under Borland C++ Builder 3.
+
+zlib.bpg is the main project group that can be loaded in the BCB IDE and
+loads all other *.bpr projects
+
+zlib.bpr is a project used to create a static zlib.lib library with C calling
+convention for functions.
+
+zlib32.bpr creates a zlib32.dll dynamic link library with Windows standard
+calling convention.
+
+d_zlib.bpr creates a set of .obj files with register calling convention.
+These files are used by zlib.pas to create a Delphi unit containing zlib.
+The d_zlib.lib file generated isn't useful and can be deleted.
+
+zlib.cpp, zlib32.cpp and d_zlib.cpp are used by the above projects.
+
--- /dev/null
+#------------------------------------------------------------------------------
+VERSION = BWS.01
+#------------------------------------------------------------------------------
+!ifndef ROOT
+ROOT = $(MAKEDIR)\..
+!endif
+#------------------------------------------------------------------------------
+MAKE = $(ROOT)\bin\make.exe -$(MAKEFLAGS) -f$**
+DCC = $(ROOT)\bin\dcc32.exe $**
+BRCC = $(ROOT)\bin\brcc32.exe $**
+#------------------------------------------------------------------------------
+PROJECTS = zlib zlib32 d_zlib
+#------------------------------------------------------------------------------
+default: $(PROJECTS)
+#------------------------------------------------------------------------------
+
+zlib: zlib.bpr
+ $(MAKE)
+
+zlib32: zlib32.bpr
+ $(MAKE)
+
+d_zlib: d_zlib.bpr
+ $(MAKE)
+
+
--- /dev/null
+# ---------------------------------------------------------------------------
+!if !$d(BCB)
+BCB = $(MAKEDIR)\..
+!endif
+
+# ---------------------------------------------------------------------------
+# IDE SECTION
+# ---------------------------------------------------------------------------
+# The following section of the project makefile is managed by the BCB IDE.
+# It is recommended to use the IDE to change any of the values in this
+# section.
+# ---------------------------------------------------------------------------
+
+VERSION = BCB.03
+# ---------------------------------------------------------------------------
+PROJECT = zlib.lib
+OBJFILES = zlib.obj adler32.obj compress.obj crc32.obj deflate.obj gzio.obj infblock.obj \
+ infcodes.obj inffast.obj inflate.obj inftrees.obj infutil.obj trees.obj \
+ uncompr.obj zutil.obj
+RESFILES =
+RESDEPEN = $(RESFILES)
+LIBFILES =
+LIBRARIES = VCL35.lib
+SPARELIBS = VCL35.lib
+DEFFILE =
+PACKAGES = VCLX35.bpi VCL35.bpi VCLDB35.bpi VCLDBX35.bpi ibsmp35.bpi bcbsmp35.bpi \
+ dclocx35.bpi QRPT35.bpi TEEUI35.bpi TEEDB35.bpi TEE35.bpi DSS35.bpi \
+ NMFAST35.bpi INETDB35.bpi INET35.bpi VCLMID35.bpi
+# ---------------------------------------------------------------------------
+PATHCPP = .;
+PATHASM = .;
+PATHPAS = .;
+PATHRC = .;
+DEBUGLIBPATH = $(BCB)\lib\debug
+RELEASELIBPATH = $(BCB)\lib\release
+# ---------------------------------------------------------------------------
+CFLAG1 = -O2 -Ve -d -k- -vi
+CFLAG2 = -I$(BCB)\include;$(BCB)\include\vcl -H=$(BCB)\lib\vcl35.csm
+CFLAG3 = -ff -5
+PFLAGS = -U;$(DEBUGLIBPATH) -I$(BCB)\include;$(BCB)\include\vcl -H -W -$I- -v -JPHN -M
+RFLAGS = -i$(BCB)\include;$(BCB)\include\vcl
+AFLAGS = /i$(BCB)\include /i$(BCB)\include\vcl /mx /w2 /zn
+LFLAGS =
+IFLAGS = -g -Gn
+# ---------------------------------------------------------------------------
+ALLOBJ = c0w32.obj $(OBJFILES)
+ALLRES = $(RESFILES)
+ALLLIB = $(LIBFILES) $(LIBRARIES) import32.lib cp32mt.lib
+# ---------------------------------------------------------------------------
+!!ifdef IDEOPTIONS
+
+[Version Info]
+IncludeVerInfo=0
+AutoIncBuild=0
+MajorVer=1
+MinorVer=0
+Release=0
+Build=0
+Debug=0
+PreRelease=0
+Special=0
+Private=0
+DLL=0
+Locale=1040
+CodePage=1252
+
+[Version Info Keys]
+CompanyName=
+FileDescription=
+FileVersion=1.0.0.0
+InternalName=
+LegalCopyright=
+LegalTrademarks=
+OriginalFilename=
+ProductName=
+ProductVersion=1.0.0.0
+Comments=
+
+[HistoryLists\hlIncludePath]
+Count=2
+Item0=$(BCB)\include
+Item1=$(BCB)\include;$(BCB)\include\vcl
+
+[HistoryLists\hlLibraryPath]
+Count=1
+Item0=$(BCB)\lib\obj;$(BCB)\lib
+
+[HistoryLists\hlDebugSourcePath]
+Count=1
+Item0=$(BCB)\source\vcl
+
+[Debugging]
+DebugSourceDirs=
+
+[Parameters]
+RunParams=
+HostApplication=
+
+!endif
+
+ ---------------------------------------------------------------------------
+# MAKE SECTION
+# ---------------------------------------------------------------------------
+# This section of the project file is not used by the BCB IDE. It is for
+# the benefit of building from the command-line using the MAKE utility.
+# ---------------------------------------------------------------------------
+
+.autodepend
+# ---------------------------------------------------------------------------
+!if !$d(BCC32)
+BCC32 = bcc32
+!endif
+
+!if !$d(DCC32)
+DCC32 = dcc32
+!endif
+
+!if !$d(TASM32)
+TASM32 = tasm32
+!endif
+
+!if !$d(LINKER)
+LINKER = TLib
+!endif
+
+!if !$d(BRCC32)
+BRCC32 = brcc32
+!endif
+# ---------------------------------------------------------------------------
+!if $d(PATHCPP)
+.PATH.CPP = $(PATHCPP)
+.PATH.C = $(PATHCPP)
+!endif
+
+!if $d(PATHPAS)
+.PATH.PAS = $(PATHPAS)
+!endif
+
+!if $d(PATHASM)
+.PATH.ASM = $(PATHASM)
+!endif
+
+!if $d(PATHRC)
+.PATH.RC = $(PATHRC)
+!endif
+# ---------------------------------------------------------------------------
+!ifdef IDEOPTIONS
+
+[Version Info]
+IncludeVerInfo=0
+AutoIncBuild=0
+MajorVer=1
+MinorVer=0
+Release=0
+Build=0
+Debug=0
+PreRelease=0
+Special=0
+Private=0
+DLL=0
+Locale=1040
+CodePage=1252
+
+[Version Info Keys]
+CompanyName=
+FileDescription=
+FileVersion=1.0.0.0
+InternalName=
+LegalCopyright=
+LegalTrademarks=
+OriginalFilename=
+ProductName=
+ProductVersion=1.0.0.0
+Comments=
+
+[HistoryLists\hlIncludePath]
+Count=2
+Item0=$(BCB)\include;$(BCB)\include\vcl
+Item1=$(BCB)\include
+
+[HistoryLists\hlLibraryPath]
+Count=1
+Item0=$(BCB)\lib\obj;$(BCB)\lib
+
+[HistoryLists\hlDebugSourcePath]
+Count=1
+Item0=$(BCB)\source\vcl
+
+[Debugging]
+DebugSourceDirs=
+
+[Parameters]
+RunParams=
+HostApplication=
+
+!endif
+
+$(PROJECT): $(OBJFILES) $(RESDEPEN) $(DEFFILE)
+ $(BCB)\BIN\$(LINKER) @&&!
+ $(LFLAGS) $(IFLAGS) +
+ $(ALLOBJ), +
+ $(PROJECT),, +
+ $(ALLLIB), +
+ $(DEFFILE), +
+ $(ALLRES)
+!
+# ---------------------------------------------------------------------------
+.pas.hpp:
+ $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< }
+
+.pas.obj:
+ $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< }
+
+.cpp.obj:
+ $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< }
+
+.c.obj:
+ $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< }
+
+.asm.obj:
+ $(BCB)\BIN\$(TASM32) $(AFLAGS) $<, $@
+
+.rc.res:
+ $(BCB)\BIN\$(BRCC32) $(RFLAGS) -fo$@ $<
+# ---------------------------------------------------------------------------
--- /dev/null
+#include <condefs.h>
+#pragma hdrstop
+//---------------------------------------------------------------------------
+USEUNIT("adler32.c");
+USEUNIT("compress.c");
+USEUNIT("crc32.c");
+USEUNIT("deflate.c");
+USEUNIT("gzio.c");
+USEUNIT("infblock.c");
+USEUNIT("infcodes.c");
+USEUNIT("inffast.c");
+USEUNIT("inflate.c");
+USEUNIT("inftrees.c");
+USEUNIT("infutil.c");
+USEUNIT("trees.c");
+USEUNIT("uncompr.c");
+USEUNIT("zutil.c");
+//---------------------------------------------------------------------------
+#define Library
+
+// To add a file to the library use the Project menu 'Add to Project'.
+
--- /dev/null
+{*******************************************************}
+{ }
+{ Delphi Supplemental Components }
+{ ZLIB Data Compression Interface Unit }
+{ }
+{ Copyright (c) 1997 Borland International }
+{ }
+{*******************************************************}
+
+{ Modified for zlib 1.1.3 by Davide Moretti <dave@rimini.com }
+
+unit zlib;
+
+interface
+
+uses Sysutils, Classes;
+
+type
+ TAlloc = function (AppData: Pointer; Items, Size: Integer): Pointer;
+ TFree = procedure (AppData, Block: Pointer);
+
+ // Internal structure. Ignore.
+ TZStreamRec = packed record
+ next_in: PChar; // next input byte
+ avail_in: Integer; // number of bytes available at next_in
+ total_in: Integer; // total nb of input bytes read so far
+
+ next_out: PChar; // next output byte should be put here
+ avail_out: Integer; // remaining free space at next_out
+ total_out: Integer; // total nb of bytes output so far
+
+ msg: PChar; // last error message, NULL if no error
+ internal: Pointer; // not visible by applications
+
+ zalloc: TAlloc; // used to allocate the internal state
+ zfree: TFree; // used to free the internal state
+ AppData: Pointer; // private data object passed to zalloc and zfree
+
+ data_type: Integer; // best guess about the data type: ascii or binary
+ adler: Integer; // adler32 value of the uncompressed data
+ reserved: Integer; // reserved for future use
+ end;
+
+ // Abstract ancestor class
+ TCustomZlibStream = class(TStream)
+ private
+ FStrm: TStream;
+ FStrmPos: Integer;
+ FOnProgress: TNotifyEvent;
+ FZRec: TZStreamRec;
+ FBuffer: array [Word] of Char;
+ protected
+ procedure Progress(Sender: TObject); dynamic;
+ property OnProgress: TNotifyEvent read FOnProgress write FOnProgress;
+ constructor Create(Strm: TStream);
+ end;
+
+{ TCompressionStream compresses data on the fly as data is written to it, and
+ stores the compressed data to another stream.
+
+ TCompressionStream is write-only and strictly sequential. Reading from the
+ stream will raise an exception. Using Seek to move the stream pointer
+ will raise an exception.
+
+ Output data is cached internally, written to the output stream only when
+ the internal output buffer is full. All pending output data is flushed
+ when the stream is destroyed.
+
+ The Position property returns the number of uncompressed bytes of
+ data that have been written to the stream so far.
+
+ CompressionRate returns the on-the-fly percentage by which the original
+ data has been compressed: (1 - (CompressedBytes / UncompressedBytes)) * 100
+ If raw data size = 100 and compressed data size = 25, the CompressionRate
+ is 75%
+
+ The OnProgress event is called each time the output buffer is filled and
+ written to the output stream. This is useful for updating a progress
+ indicator when you are writing a large chunk of data to the compression
+ stream in a single call.}
+
+
+ TCompressionLevel = (clNone, clFastest, clDefault, clMax);
+
+ TCompressionStream = class(TCustomZlibStream)
+ private
+ function GetCompressionRate: Single;
+ public
+ constructor Create(CompressionLevel: TCompressionLevel; Dest: TStream);
+ destructor Destroy; override;
+ function Read(var Buffer; Count: Longint): Longint; override;
+ function Write(const Buffer; Count: Longint): Longint; override;
+ function Seek(Offset: Longint; Origin: Word): Longint; override;
+ property CompressionRate: Single read GetCompressionRate;
+ property OnProgress;
+ end;
+
+{ TDecompressionStream decompresses data on the fly as data is read from it.
+
+ Compressed data comes from a separate source stream. TDecompressionStream
+ is read-only and unidirectional; you can seek forward in the stream, but not
+ backwards. The special case of setting the stream position to zero is
+ allowed. Seeking forward decompresses data until the requested position in
+ the uncompressed data has been reached. Seeking backwards, seeking relative
+ to the end of the stream, requesting the size of the stream, and writing to
+ the stream will raise an exception.
+
+ The Position property returns the number of bytes of uncompressed data that
+ have been read from the stream so far.
+
+ The OnProgress event is called each time the internal input buffer of
+ compressed data is exhausted and the next block is read from the input stream.
+ This is useful for updating a progress indicator when you are reading a
+ large chunk of data from the decompression stream in a single call.}
+
+ TDecompressionStream = class(TCustomZlibStream)
+ public
+ constructor Create(Source: TStream);
+ destructor Destroy; override;
+ function Read(var Buffer; Count: Longint): Longint; override;
+ function Write(const Buffer; Count: Longint): Longint; override;
+ function Seek(Offset: Longint; Origin: Word): Longint; override;
+ property OnProgress;
+ end;
+
+
+
+{ CompressBuf compresses data, buffer to buffer, in one call.
+ In: InBuf = ptr to compressed data
+ InBytes = number of bytes in InBuf
+ Out: OutBuf = ptr to newly allocated buffer containing decompressed data
+ OutBytes = number of bytes in OutBuf }
+procedure CompressBuf(const InBuf: Pointer; InBytes: Integer;
+ out OutBuf: Pointer; out OutBytes: Integer);
+
+
+{ DecompressBuf decompresses data, buffer to buffer, in one call.
+ In: InBuf = ptr to compressed data
+ InBytes = number of bytes in InBuf
+ OutEstimate = zero, or est. size of the decompressed data
+ Out: OutBuf = ptr to newly allocated buffer containing decompressed data
+ OutBytes = number of bytes in OutBuf }
+procedure DecompressBuf(const InBuf: Pointer; InBytes: Integer;
+ OutEstimate: Integer; out OutBuf: Pointer; out OutBytes: Integer);
+
+const
+ zlib_version = '1.1.3';
+
+type
+ EZlibError = class(Exception);
+ ECompressionError = class(EZlibError);
+ EDecompressionError = class(EZlibError);
+
+function adler32(adler: Integer; buf: PChar; len: Integer): Integer;
+
+implementation
+
+const
+ Z_NO_FLUSH = 0;
+ Z_PARTIAL_FLUSH = 1;
+ Z_SYNC_FLUSH = 2;
+ Z_FULL_FLUSH = 3;
+ Z_FINISH = 4;
+
+ Z_OK = 0;
+ Z_STREAM_END = 1;
+ Z_NEED_DICT = 2;
+ Z_ERRNO = (-1);
+ Z_STREAM_ERROR = (-2);
+ Z_DATA_ERROR = (-3);
+ Z_MEM_ERROR = (-4);
+ Z_BUF_ERROR = (-5);
+ Z_VERSION_ERROR = (-6);
+
+ Z_NO_COMPRESSION = 0;
+ Z_BEST_SPEED = 1;
+ Z_BEST_COMPRESSION = 9;
+ Z_DEFAULT_COMPRESSION = (-1);
+
+ Z_FILTERED = 1;
+ Z_HUFFMAN_ONLY = 2;
+ Z_DEFAULT_STRATEGY = 0;
+
+ Z_BINARY = 0;
+ Z_ASCII = 1;
+ Z_UNKNOWN = 2;
+
+ Z_DEFLATED = 8;
+
+ _z_errmsg: array[0..9] of PChar = (
+ 'need dictionary', // Z_NEED_DICT (2)
+ 'stream end', // Z_STREAM_END (1)
+ '', // Z_OK (0)
+ 'file error', // Z_ERRNO (-1)
+ 'stream error', // Z_STREAM_ERROR (-2)
+ 'data error', // Z_DATA_ERROR (-3)
+ 'insufficient memory', // Z_MEM_ERROR (-4)
+ 'buffer error', // Z_BUF_ERROR (-5)
+ 'incompatible version', // Z_VERSION_ERROR (-6)
+ ''
+ );
+
+{$L deflate.obj}
+{$L inflate.obj}
+{$L inftrees.obj}
+{$L trees.obj}
+{$L adler32.obj}
+{$L infblock.obj}
+{$L infcodes.obj}
+{$L infutil.obj}
+{$L inffast.obj}
+
+procedure _tr_init; external;
+procedure _tr_tally; external;
+procedure _tr_flush_block; external;
+procedure _tr_align; external;
+procedure _tr_stored_block; external;
+function adler32; external;
+procedure inflate_blocks_new; external;
+procedure inflate_blocks; external;
+procedure inflate_blocks_reset; external;
+procedure inflate_blocks_free; external;
+procedure inflate_set_dictionary; external;
+procedure inflate_trees_bits; external;
+procedure inflate_trees_dynamic; external;
+procedure inflate_trees_fixed; external;
+procedure inflate_codes_new; external;
+procedure inflate_codes; external;
+procedure inflate_codes_free; external;
+procedure _inflate_mask; external;
+procedure inflate_flush; external;
+procedure inflate_fast; external;
+
+procedure _memset(P: Pointer; B: Byte; count: Integer);cdecl;
+begin
+ FillChar(P^, count, B);
+end;
+
+procedure _memcpy(dest, source: Pointer; count: Integer);cdecl;
+begin
+ Move(source^, dest^, count);
+end;
+
+
+
+// deflate compresses data
+function deflateInit_(var strm: TZStreamRec; level: Integer; version: PChar;
+ recsize: Integer): Integer; external;
+function deflate(var strm: TZStreamRec; flush: Integer): Integer; external;
+function deflateEnd(var strm: TZStreamRec): Integer; external;
+
+// inflate decompresses data
+function inflateInit_(var strm: TZStreamRec; version: PChar;
+ recsize: Integer): Integer; external;
+function inflate(var strm: TZStreamRec; flush: Integer): Integer; external;
+function inflateEnd(var strm: TZStreamRec): Integer; external;
+function inflateReset(var strm: TZStreamRec): Integer; external;
+
+
+function zcalloc(AppData: Pointer; Items, Size: Integer): Pointer;
+begin
+ GetMem(Result, Items*Size);
+end;
+
+procedure zcfree(AppData, Block: Pointer);
+begin
+ FreeMem(Block);
+end;
+
+function zlibCheck(code: Integer): Integer;
+begin
+ Result := code;
+ if code < 0 then
+ raise EZlibError.Create('error'); //!!
+end;
+
+function CCheck(code: Integer): Integer;
+begin
+ Result := code;
+ if code < 0 then
+ raise ECompressionError.Create('error'); //!!
+end;
+
+function DCheck(code: Integer): Integer;
+begin
+ Result := code;
+ if code < 0 then
+ raise EDecompressionError.Create('error'); //!!
+end;
+
+procedure CompressBuf(const InBuf: Pointer; InBytes: Integer;
+ out OutBuf: Pointer; out OutBytes: Integer);
+var
+ strm: TZStreamRec;
+ P: Pointer;
+begin
+ FillChar(strm, sizeof(strm), 0);
+ OutBytes := ((InBytes + (InBytes div 10) + 12) + 255) and not 255;
+ GetMem(OutBuf, OutBytes);
+ try
+ strm.next_in := InBuf;
+ strm.avail_in := InBytes;
+ strm.next_out := OutBuf;
+ strm.avail_out := OutBytes;
+ CCheck(deflateInit_(strm, Z_BEST_COMPRESSION, zlib_version, sizeof(strm)));
+ try
+ while CCheck(deflate(strm, Z_FINISH)) <> Z_STREAM_END do
+ begin
+ P := OutBuf;
+ Inc(OutBytes, 256);
+ ReallocMem(OutBuf, OutBytes);
+ strm.next_out := PChar(Integer(OutBuf) + (Integer(strm.next_out) - Integer(P)));
+ strm.avail_out := 256;
+ end;
+ finally
+ CCheck(deflateEnd(strm));
+ end;
+ ReallocMem(OutBuf, strm.total_out);
+ OutBytes := strm.total_out;
+ except
+ FreeMem(OutBuf);
+ raise
+ end;
+end;
+
+
+procedure DecompressBuf(const InBuf: Pointer; InBytes: Integer;
+ OutEstimate: Integer; out OutBuf: Pointer; out OutBytes: Integer);
+var
+ strm: TZStreamRec;
+ P: Pointer;
+ BufInc: Integer;
+begin
+ FillChar(strm, sizeof(strm), 0);
+ BufInc := (InBytes + 255) and not 255;
+ if OutEstimate = 0 then
+ OutBytes := BufInc
+ else
+ OutBytes := OutEstimate;
+ GetMem(OutBuf, OutBytes);
+ try
+ strm.next_in := InBuf;
+ strm.avail_in := InBytes;
+ strm.next_out := OutBuf;
+ strm.avail_out := OutBytes;
+ DCheck(inflateInit_(strm, zlib_version, sizeof(strm)));
+ try
+ while DCheck(inflate(strm, Z_FINISH)) <> Z_STREAM_END do
+ begin
+ P := OutBuf;
+ Inc(OutBytes, BufInc);
+ ReallocMem(OutBuf, OutBytes);
+ strm.next_out := PChar(Integer(OutBuf) + (Integer(strm.next_out) - Integer(P)));
+ strm.avail_out := BufInc;
+ end;
+ finally
+ DCheck(inflateEnd(strm));
+ end;
+ ReallocMem(OutBuf, strm.total_out);
+ OutBytes := strm.total_out;
+ except
+ FreeMem(OutBuf);
+ raise
+ end;
+end;
+
+
+// TCustomZlibStream
+
+constructor TCustomZLibStream.Create(Strm: TStream);
+begin
+ inherited Create;
+ FStrm := Strm;
+ FStrmPos := Strm.Position;
+end;
+
+procedure TCustomZLibStream.Progress(Sender: TObject);
+begin
+ if Assigned(FOnProgress) then FOnProgress(Sender);
+end;
+
+
+// TCompressionStream
+
+constructor TCompressionStream.Create(CompressionLevel: TCompressionLevel;
+ Dest: TStream);
+const
+ Levels: array [TCompressionLevel] of ShortInt =
+ (Z_NO_COMPRESSION, Z_BEST_SPEED, Z_DEFAULT_COMPRESSION, Z_BEST_COMPRESSION);
+begin
+ inherited Create(Dest);
+ FZRec.next_out := FBuffer;
+ FZRec.avail_out := sizeof(FBuffer);
+ CCheck(deflateInit_(FZRec, Levels[CompressionLevel], zlib_version, sizeof(FZRec)));
+end;
+
+destructor TCompressionStream.Destroy;
+begin
+ FZRec.next_in := nil;
+ FZRec.avail_in := 0;
+ try
+ if FStrm.Position <> FStrmPos then FStrm.Position := FStrmPos;
+ while (CCheck(deflate(FZRec, Z_FINISH)) <> Z_STREAM_END)
+ and (FZRec.avail_out = 0) do
+ begin
+ FStrm.WriteBuffer(FBuffer, sizeof(FBuffer));
+ FZRec.next_out := FBuffer;
+ FZRec.avail_out := sizeof(FBuffer);
+ end;
+ if FZRec.avail_out < sizeof(FBuffer) then
+ FStrm.WriteBuffer(FBuffer, sizeof(FBuffer) - FZRec.avail_out);
+ finally
+ deflateEnd(FZRec);
+ end;
+ inherited Destroy;
+end;
+
+function TCompressionStream.Read(var Buffer; Count: Longint): Longint;
+begin
+ raise ECompressionError.Create('Invalid stream operation');
+end;
+
+function TCompressionStream.Write(const Buffer; Count: Longint): Longint;
+begin
+ FZRec.next_in := @Buffer;
+ FZRec.avail_in := Count;
+ if FStrm.Position <> FStrmPos then FStrm.Position := FStrmPos;
+ while (FZRec.avail_in > 0) do
+ begin
+ CCheck(deflate(FZRec, 0));
+ if FZRec.avail_out = 0 then
+ begin
+ FStrm.WriteBuffer(FBuffer, sizeof(FBuffer));
+ FZRec.next_out := FBuffer;
+ FZRec.avail_out := sizeof(FBuffer);
+ FStrmPos := FStrm.Position;
+ Progress(Self);
+ end;
+ end;
+ Result := Count;
+end;
+
+function TCompressionStream.Seek(Offset: Longint; Origin: Word): Longint;
+begin
+ if (Offset = 0) and (Origin = soFromCurrent) then
+ Result := FZRec.total_in
+ else
+ raise ECompressionError.Create('Invalid stream operation');
+end;
+
+function TCompressionStream.GetCompressionRate: Single;
+begin
+ if FZRec.total_in = 0 then
+ Result := 0
+ else
+ Result := (1.0 - (FZRec.total_out / FZRec.total_in)) * 100.0;
+end;
+
+
+// TDecompressionStream
+
+constructor TDecompressionStream.Create(Source: TStream);
+begin
+ inherited Create(Source);
+ FZRec.next_in := FBuffer;
+ FZRec.avail_in := 0;
+ DCheck(inflateInit_(FZRec, zlib_version, sizeof(FZRec)));
+end;
+
+destructor TDecompressionStream.Destroy;
+begin
+ inflateEnd(FZRec);
+ inherited Destroy;
+end;
+
+function TDecompressionStream.Read(var Buffer; Count: Longint): Longint;
+begin
+ FZRec.next_out := @Buffer;
+ FZRec.avail_out := Count;
+ if FStrm.Position <> FStrmPos then FStrm.Position := FStrmPos;
+ while (FZRec.avail_out > 0) do
+ begin
+ if FZRec.avail_in = 0 then
+ begin
+ FZRec.avail_in := FStrm.Read(FBuffer, sizeof(FBuffer));
+ if FZRec.avail_in = 0 then
+ begin
+ Result := Count - FZRec.avail_out;
+ Exit;
+ end;
+ FZRec.next_in := FBuffer;
+ FStrmPos := FStrm.Position;
+ Progress(Self);
+ end;
+ DCheck(inflate(FZRec, 0));
+ end;
+ Result := Count;
+end;
+
+function TDecompressionStream.Write(const Buffer; Count: Longint): Longint;
+begin
+ raise EDecompressionError.Create('Invalid stream operation');
+end;
+
+function TDecompressionStream.Seek(Offset: Longint; Origin: Word): Longint;
+var
+ I: Integer;
+ Buf: array [0..4095] of Char;
+begin
+ if (Offset = 0) and (Origin = soFromBeginning) then
+ begin
+ DCheck(inflateReset(FZRec));
+ FZRec.next_in := FBuffer;
+ FZRec.avail_in := 0;
+ FStrm.Position := 0;
+ FStrmPos := 0;
+ end
+ else if ( (Offset >= 0) and (Origin = soFromCurrent)) or
+ ( ((Offset - FZRec.total_out) > 0) and (Origin = soFromBeginning)) then
+ begin
+ if Origin = soFromBeginning then Dec(Offset, FZRec.total_out);
+ if Offset > 0 then
+ begin
+ for I := 1 to Offset div sizeof(Buf) do
+ ReadBuffer(Buf, sizeof(Buf));
+ ReadBuffer(Buf, Offset mod sizeof(Buf));
+ end;
+ end
+ else
+ raise EDecompressionError.Create('Invalid stream operation');
+ Result := FZRec.total_out;
+end;
+
+end.
--- /dev/null
+# ---------------------------------------------------------------------------
+!if !$d(BCB)
+BCB = $(MAKEDIR)\..
+!endif
+
+# ---------------------------------------------------------------------------
+# IDE SECTION
+# ---------------------------------------------------------------------------
+# The following section of the project makefile is managed by the BCB IDE.
+# It is recommended to use the IDE to change any of the values in this
+# section.
+# ---------------------------------------------------------------------------
+
+VERSION = BCB.03
+# ---------------------------------------------------------------------------
+PROJECT = zlib32.dll
+OBJFILES = zlib32.obj adler32.obj compress.obj crc32.obj deflate.obj gzio.obj infblock.obj \
+ infcodes.obj inffast.obj inflate.obj inftrees.obj infutil.obj trees.obj \
+ uncompr.obj zutil.obj
+RESFILES =
+RESDEPEN = $(RESFILES)
+LIBFILES =
+LIBRARIES =
+SPARELIBS =
+DEFFILE =
+PACKAGES = VCLX35.bpi VCL35.bpi VCLDB35.bpi VCLDBX35.bpi ibsmp35.bpi bcbsmp35.bpi \
+ dclocx35.bpi QRPT35.bpi TEEUI35.bpi TEEDB35.bpi TEE35.bpi DSS35.bpi \
+ NMFAST35.bpi INETDB35.bpi INET35.bpi VCLMID35.bpi
+# ---------------------------------------------------------------------------
+PATHCPP = .;
+PATHASM = .;
+PATHPAS = .;
+PATHRC = .;
+DEBUGLIBPATH = $(BCB)\lib\debug
+RELEASELIBPATH = $(BCB)\lib\release
+# ---------------------------------------------------------------------------
+CFLAG1 = -WD -O2 -Ve -d -k- -vi -c -tWD
+CFLAG2 = -D_NO_VCL;ZLIB_DLL -I$(BCB)\include
+CFLAG3 = -ff -5
+PFLAGS = -D_NO_VCL;ZLIB_DLL -U$(BCB)\lib;$(RELEASELIBPATH) -I$(BCB)\include -$I- -v \
+ -JPHN -M
+RFLAGS = -D_NO_VCL;ZLIB_DLL -i$(BCB)\include
+AFLAGS = /i$(BCB)\include /d_NO_VCL /dZLIB_DLL /mx /w2 /zn
+LFLAGS = -L$(BCB)\lib;$(RELEASELIBPATH) -aa -Tpd -x -Gi
+IFLAGS = -Gn -g
+# ---------------------------------------------------------------------------
+ALLOBJ = c0d32.obj $(OBJFILES)
+ALLRES = $(RESFILES)
+ALLLIB = $(LIBFILES) import32.lib cw32mt.lib
+# ---------------------------------------------------------------------------
+!ifdef IDEOPTIONS
+
+[Version Info]
+IncludeVerInfo=0
+AutoIncBuild=0
+MajorVer=1
+MinorVer=0
+Release=0
+Build=0
+Debug=0
+PreRelease=0
+Special=0
+Private=0
+DLL=1
+Locale=1040
+CodePage=1252
+
+[Version Info Keys]
+CompanyName=
+FileDescription=DLL (GUI)
+FileVersion=1.0.0.0
+InternalName=
+LegalCopyright=
+LegalTrademarks=
+OriginalFilename=
+ProductName=
+ProductVersion=1.0.0.0
+Comments=
+
+[HistoryLists\hlIncludePath]
+Count=1
+Item0=$(BCB)\include
+
+[HistoryLists\hlLibraryPath]
+Count=1
+Item0=$(BCB)\lib
+
+[HistoryLists\hlConditionals]
+Count=1
+Item0=_NO_VCL;ZLIB_DLL
+
+[Debugging]
+DebugSourceDirs=
+
+[Parameters]
+RunParams=
+HostApplication=
+
+!endif
+
+# ---------------------------------------------------------------------------
+# MAKE SECTION
+# ---------------------------------------------------------------------------
+# This section of the project file is not used by the BCB IDE. It is for
+# the benefit of building from the command-line using the MAKE utility.
+# ---------------------------------------------------------------------------
+
+.autodepend
+# ---------------------------------------------------------------------------
+!if !$d(BCC32)
+BCC32 = bcc32
+!endif
+
+!if !$d(DCC32)
+DCC32 = dcc32
+!endif
+
+!if !$d(TASM32)
+TASM32 = tasm32
+!endif
+
+!if !$d(LINKER)
+LINKER = ilink32
+!endif
+
+!if !$d(BRCC32)
+BRCC32 = brcc32
+!endif
+# ---------------------------------------------------------------------------
+!if $d(PATHCPP)
+.PATH.CPP = $(PATHCPP)
+.PATH.C = $(PATHCPP)
+!endif
+
+!if $d(PATHPAS)
+.PATH.PAS = $(PATHPAS)
+!endif
+
+!if $d(PATHASM)
+.PATH.ASM = $(PATHASM)
+!endif
+
+!if $d(PATHRC)
+.PATH.RC = $(PATHRC)
+!endif
+# ---------------------------------------------------------------------------
+$(PROJECT): $(OBJFILES) $(RESDEPEN) $(DEFFILE)
+ $(BCB)\BIN\$(LINKER) @&&!
+ $(LFLAGS) $(IFLAGS) +
+ $(ALLOBJ), +
+ $(PROJECT),, +
+ $(ALLLIB), +
+ $(DEFFILE), +
+ $(ALLRES)
+!
+# ---------------------------------------------------------------------------
+.pas.hpp:
+ $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< }
+
+.pas.obj:
+ $(BCB)\BIN\$(DCC32) $(PFLAGS) {$< }
+
+.cpp.obj:
+ $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< }
+
+.c.obj:
+ $(BCB)\BIN\$(BCC32) $(CFLAG1) $(CFLAG2) $(CFLAG3) -n$(@D) {$< }
+
+.asm.obj:
+ $(BCB)\BIN\$(TASM32) $(AFLAGS) $<, $@
+
+.rc.res:
+ $(BCB)\BIN\$(BRCC32) $(RFLAGS) -fo$@ $<
+# ---------------------------------------------------------------------------
--- /dev/null
+
+#include <windows.h>
+#pragma hdrstop
+#include <condefs.h>
+
+
+//---------------------------------------------------------------------------
+// Important note about DLL memory management in a VCL DLL:
+//
+//
+//
+// If your DLL uses VCL and exports any functions that pass VCL String objects
+// (or structs/classes containing nested Strings) as parameter or function
+// results, you will need to build both your DLL project and any EXE projects
+// that use your DLL with the dynamic RTL (the RTL DLL). This will change your
+// DLL and its calling EXE's to use BORLNDMM.DLL as their memory manager. In
+// these cases, the file BORLNDMM.DLL should be deployed along with your DLL
+// and the RTL DLL (CP3240MT.DLL). To avoid the requiring BORLNDMM.DLL in
+// these situations, pass string information using "char *" or ShortString
+// parameters and then link with the static RTL.
+//
+//---------------------------------------------------------------------------
+USEUNIT("adler32.c");
+USEUNIT("compress.c");
+USEUNIT("crc32.c");
+USEUNIT("deflate.c");
+USEUNIT("gzio.c");
+USEUNIT("infblock.c");
+USEUNIT("infcodes.c");
+USEUNIT("inffast.c");
+USEUNIT("inflate.c");
+USEUNIT("inftrees.c");
+USEUNIT("infutil.c");
+USEUNIT("trees.c");
+USEUNIT("uncompr.c");
+USEUNIT("zutil.c");
+//---------------------------------------------------------------------------
+#pragma argsused
+int WINAPI DllEntryPoint(HINSTANCE hinst, unsigned long reason, void*)
+{
+ return 1;
+}
--- /dev/null
+
+#include "zfstream.h"
+
+int main() {
+
+ // Construct a stream object with this filebuffer. Anything sent
+ // to this stream will go to standard out.
+ gzofstream os( 1, ios::out );
+
+ // This text is getting compressed and sent to stdout.
+ // To prove this, run 'test | zcat'.
+ os << "Hello, Mommy" << endl;
+
+ os << setcompressionlevel( Z_NO_COMPRESSION );
+ os << "hello, hello, hi, ho!" << endl;
+
+ setcompressionlevel( os, Z_DEFAULT_COMPRESSION )
+ << "I'm compressing again" << endl;
+
+ os.close();
+
+ return 0;
+
+}
--- /dev/null
+
+#include <memory.h>
+#include "zfstream.h"
+
+gzfilebuf::gzfilebuf() :
+ file(NULL),
+ mode(0),
+ own_file_descriptor(0)
+{ }
+
+gzfilebuf::~gzfilebuf() {
+
+ sync();
+ if ( own_file_descriptor )
+ close();
+
+}
+
+gzfilebuf *gzfilebuf::open( const char *name,
+ int io_mode ) {
+
+ if ( is_open() )
+ return NULL;
+
+ char char_mode[10];
+ char *p;
+ memset(char_mode,'\0',10);
+ p = char_mode;
+
+ if ( io_mode & ios::in ) {
+ mode = ios::in;
+ *p++ = 'r';
+ } else if ( io_mode & ios::app ) {
+ mode = ios::app;
+ *p++ = 'a';
+ } else {
+ mode = ios::out;
+ *p++ = 'w';
+ }
+
+ if ( io_mode & ios::binary ) {
+ mode |= ios::binary;
+ *p++ = 'b';
+ }
+
+ // Hard code the compression level
+ if ( io_mode & (ios::out|ios::app )) {
+ *p++ = '9';
+ }
+
+ if ( (file = gzopen(name, char_mode)) == NULL )
+ return NULL;
+
+ own_file_descriptor = 1;
+
+ return this;
+
+}
+
+gzfilebuf *gzfilebuf::attach( int file_descriptor,
+ int io_mode ) {
+
+ if ( is_open() )
+ return NULL;
+
+ char char_mode[10];
+ char *p;
+ memset(char_mode,'\0',10);
+ p = char_mode;
+
+ if ( io_mode & ios::in ) {
+ mode = ios::in;
+ *p++ = 'r';
+ } else if ( io_mode & ios::app ) {
+ mode = ios::app;
+ *p++ = 'a';
+ } else {
+ mode = ios::out;
+ *p++ = 'w';
+ }
+
+ if ( io_mode & ios::binary ) {
+ mode |= ios::binary;
+ *p++ = 'b';
+ }
+
+ // Hard code the compression level
+ if ( io_mode & (ios::out|ios::app )) {
+ *p++ = '9';
+ }
+
+ if ( (file = gzdopen(file_descriptor, char_mode)) == NULL )
+ return NULL;
+
+ own_file_descriptor = 0;
+
+ return this;
+
+}
+
+gzfilebuf *gzfilebuf::close() {
+
+ if ( is_open() ) {
+
+ sync();
+ gzclose( file );
+ file = NULL;
+
+ }
+
+ return this;
+
+}
+
+int gzfilebuf::setcompressionlevel( short comp_level ) {
+
+ return gzsetparams(file, comp_level, -2);
+
+}
+
+int gzfilebuf::setcompressionstrategy( short comp_strategy ) {
+
+ return gzsetparams(file, -2, comp_strategy);
+
+}
+
+
+streampos gzfilebuf::seekoff( streamoff off, ios::seek_dir dir, int which ) {
+
+ return streampos(EOF);
+
+}
+
+int gzfilebuf::underflow() {
+
+ // If the file hasn't been opened for reading, error.
+ if ( !is_open() || !(mode & ios::in) )
+ return EOF;
+
+ // if a buffer doesn't exists, allocate one.
+ if ( !base() ) {
+
+ if ( (allocate()) == EOF )
+ return EOF;
+ setp(0,0);
+
+ } else {
+
+ if ( in_avail() )
+ return (unsigned char) *gptr();
+
+ if ( out_waiting() ) {
+ if ( flushbuf() == EOF )
+ return EOF;
+ }
+
+ }
+
+ // Attempt to fill the buffer.
+
+ int result = fillbuf();
+ if ( result == EOF ) {
+ // disable get area
+ setg(0,0,0);
+ return EOF;
+ }
+
+ return (unsigned char) *gptr();
+
+}
+
+int gzfilebuf::overflow( int c ) {
+
+ if ( !is_open() || !(mode & ios::out) )
+ return EOF;
+
+ if ( !base() ) {
+ if ( allocate() == EOF )
+ return EOF;
+ setg(0,0,0);
+ } else {
+ if (in_avail()) {
+ return EOF;
+ }
+ if (out_waiting()) {
+ if (flushbuf() == EOF)
+ return EOF;
+ }
+ }
+
+ int bl = blen();
+ setp( base(), base() + bl);
+
+ if ( c != EOF ) {
+
+ *pptr() = c;
+ pbump(1);
+
+ }
+
+ return 0;
+
+}
+
+int gzfilebuf::sync() {
+
+ if ( !is_open() )
+ return EOF;
+
+ if ( out_waiting() )
+ return flushbuf();
+
+ return 0;
+
+}
+
+int gzfilebuf::flushbuf() {
+
+ int n;
+ char *q;
+
+ q = pbase();
+ n = pptr() - q;
+
+ if ( gzwrite( file, q, n) < n )
+ return EOF;
+
+ setp(0,0);
+
+ return 0;
+
+}
+
+int gzfilebuf::fillbuf() {
+
+ int required;
+ char *p;
+
+ p = base();
+
+ required = blen();
+
+ int t = gzread( file, p, required );
+
+ if ( t <= 0) return EOF;
+
+ setg( base(), base(), base()+t);
+
+ return t;
+
+}
+
+gzfilestream_common::gzfilestream_common() :
+ ios( gzfilestream_common::rdbuf() )
+{ }
+
+gzfilestream_common::~gzfilestream_common()
+{ }
+
+void gzfilestream_common::attach( int fd, int io_mode ) {
+
+ if ( !buffer.attach( fd, io_mode) )
+ clear( ios::failbit | ios::badbit );
+ else
+ clear();
+
+}
+
+void gzfilestream_common::open( const char *name, int io_mode ) {
+
+ if ( !buffer.open( name, io_mode ) )
+ clear( ios::failbit | ios::badbit );
+ else
+ clear();
+
+}
+
+void gzfilestream_common::close() {
+
+ if ( !buffer.close() )
+ clear( ios::failbit | ios::badbit );
+
+}
+
+gzfilebuf *gzfilestream_common::rdbuf() {
+
+ return &buffer;
+
+}
+
+gzifstream::gzifstream() :
+ ios( gzfilestream_common::rdbuf() )
+{
+ clear( ios::badbit );
+}
+
+gzifstream::gzifstream( const char *name, int io_mode ) :
+ ios( gzfilestream_common::rdbuf() )
+{
+ gzfilestream_common::open( name, io_mode );
+}
+
+gzifstream::gzifstream( int fd, int io_mode ) :
+ ios( gzfilestream_common::rdbuf() )
+{
+ gzfilestream_common::attach( fd, io_mode );
+}
+
+gzifstream::~gzifstream() { }
+
+gzofstream::gzofstream() :
+ ios( gzfilestream_common::rdbuf() )
+{
+ clear( ios::badbit );
+}
+
+gzofstream::gzofstream( const char *name, int io_mode ) :
+ ios( gzfilestream_common::rdbuf() )
+{
+ gzfilestream_common::open( name, io_mode );
+}
+
+gzofstream::gzofstream( int fd, int io_mode ) :
+ ios( gzfilestream_common::rdbuf() )
+{
+ gzfilestream_common::attach( fd, io_mode );
+}
+
+gzofstream::~gzofstream() { }
--- /dev/null
+
+#ifndef _zfstream_h
+#define _zfstream_h
+
+#include <fstream.h>
+#include "zlib.h"
+
+class gzfilebuf : public streambuf {
+
+public:
+
+ gzfilebuf( );
+ virtual ~gzfilebuf();
+
+ gzfilebuf *open( const char *name, int io_mode );
+ gzfilebuf *attach( int file_descriptor, int io_mode );
+ gzfilebuf *close();
+
+ int setcompressionlevel( short comp_level );
+ int setcompressionstrategy( short comp_strategy );
+
+ inline int is_open() const { return (file !=NULL); }
+
+ virtual streampos seekoff( streamoff, ios::seek_dir, int );
+
+ virtual int sync();
+
+protected:
+
+ virtual int underflow();
+ virtual int overflow( int = EOF );
+
+private:
+
+ gzFile file;
+ short mode;
+ short own_file_descriptor;
+
+ int flushbuf();
+ int fillbuf();
+
+};
+
+class gzfilestream_common : virtual public ios {
+
+ friend class gzifstream;
+ friend class gzofstream;
+ friend gzofstream &setcompressionlevel( gzofstream &, int );
+ friend gzofstream &setcompressionstrategy( gzofstream &, int );
+
+public:
+ virtual ~gzfilestream_common();
+
+ void attach( int fd, int io_mode );
+ void open( const char *name, int io_mode );
+ void close();
+
+protected:
+ gzfilestream_common();
+
+private:
+ gzfilebuf *rdbuf();
+
+ gzfilebuf buffer;
+
+};
+
+class gzifstream : public gzfilestream_common, public istream {
+
+public:
+
+ gzifstream();
+ gzifstream( const char *name, int io_mode = ios::in );
+ gzifstream( int fd, int io_mode = ios::in );
+
+ virtual ~gzifstream();
+
+};
+
+class gzofstream : public gzfilestream_common, public ostream {
+
+public:
+
+ gzofstream();
+ gzofstream( const char *name, int io_mode = ios::out );
+ gzofstream( int fd, int io_mode = ios::out );
+
+ virtual ~gzofstream();
+
+};
+
+template<class T> class gzomanip {
+ friend gzofstream &operator<<(gzofstream &, const gzomanip<T> &);
+public:
+ gzomanip(gzofstream &(*f)(gzofstream &, T), T v) : func(f), val(v) { }
+private:
+ gzofstream &(*func)(gzofstream &, T);
+ T val;
+};
+
+template<class T> gzofstream &operator<<(gzofstream &s,
+ const gzomanip<T> &m) {
+ return (*m.func)(s, m.val);
+
+}
+
+inline gzofstream &setcompressionlevel( gzofstream &s, int l ) {
+ (s.rdbuf())->setcompressionlevel(l);
+ return s;
+}
+
+inline gzofstream &setcompressionstrategy( gzofstream &s, int l ) {
+ (s.rdbuf())->setcompressionstrategy(l);
+ return s;
+}
+
+inline gzomanip<int> setcompressionlevel(int l)
+{
+ return gzomanip<int>(&setcompressionlevel,l);
+}
+
+inline gzomanip<int> setcompressionstrategy(int l)
+{
+ return gzomanip<int>(&setcompressionstrategy,l);
+}
+
+#endif
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
--- /dev/null
+/*
+ *
+ * Copyright (c) 1997
+ * Christian Michelsen Research AS
+ * Advanced Computing
+ * Fantoftvegen 38, 5036 BERGEN, Norway
+ * http://www.cmr.no
+ *
+ * Permission to use, copy, modify, distribute and sell this software
+ * and its documentation for any purpose is hereby granted without fee,
+ * provided that the above copyright notice appear in all copies and
+ * that both that copyright notice and this permission notice appear
+ * in supporting documentation. Christian Michelsen Research AS makes no
+ * representations about the suitability of this software for any
+ * purpose. It is provided "as is" without express or implied warranty.
+ *
+ */
+
+#ifndef ZSTREAM__H
+#define ZSTREAM__H
+
+/*
+ * zstream.h - C++ interface to the 'zlib' general purpose compression library
+ * Id: zstream.h 1.1 1997-06-25 12:00:56+02 tyge Exp tyge
+ */
+
+#include <strstream.h>
+#include <string.h>
+#include <stdio.h>
+#include "zlib.h"
+
+#if defined(_WIN32)
+# include <fcntl.h>
+# include <io.h>
+# define SET_BINARY_MODE(file) setmode(fileno(file), O_BINARY)
+#else
+# define SET_BINARY_MODE(file)
+#endif
+
+class zstringlen {
+public:
+ zstringlen(class izstream&);
+ zstringlen(class ozstream&, const char*);
+ size_t value() const { return val.word; }
+private:
+ struct Val { unsigned char byte; size_t word; } val;
+};
+
+// ----------------------------- izstream -----------------------------
+
+class izstream
+{
+ public:
+ izstream() : m_fp(0) {}
+ izstream(FILE* fp) : m_fp(0) { open(fp); }
+ izstream(const char* name) : m_fp(0) { open(name); }
+ ~izstream() { close(); }
+
+ /* Opens a gzip (.gz) file for reading.
+ * open() can be used to read a file which is not in gzip format;
+ * in this case read() will directly read from the file without
+ * decompression. errno can be checked to distinguish two error
+ * cases (if errno is zero, the zlib error is Z_MEM_ERROR).
+ */
+ void open(const char* name) {
+ if (m_fp) close();
+ m_fp = ::gzopen(name, "rb");
+ }
+
+ void open(FILE* fp) {
+ SET_BINARY_MODE(fp);
+ if (m_fp) close();
+ m_fp = ::gzdopen(fileno(fp), "rb");
+ }
+
+ /* Flushes all pending input if necessary, closes the compressed file
+ * and deallocates all the (de)compression state. The return value is
+ * the zlib error number (see function error() below).
+ */
+ int close() {
+ int r = ::gzclose(m_fp);
+ m_fp = 0; return r;
+ }
+
+ /* Binary read the given number of bytes from the compressed file.
+ */
+ int read(void* buf, size_t len) {
+ return ::gzread(m_fp, buf, len);
+ }
+
+ /* Returns the error message for the last error which occurred on the
+ * given compressed file. errnum is set to zlib error number. If an
+ * error occurred in the file system and not in the compression library,
+ * errnum is set to Z_ERRNO and the application may consult errno
+ * to get the exact error code.
+ */
+ const char* error(int* errnum) {
+ return ::gzerror(m_fp, errnum);
+ }
+
+ gzFile fp() { return m_fp; }
+
+ private:
+ gzFile m_fp;
+};
+
+/*
+ * Binary read the given (array of) object(s) from the compressed file.
+ * If the input file was not in gzip format, read() copies the objects number
+ * of bytes into the buffer.
+ * returns the number of uncompressed bytes actually read
+ * (0 for end of file, -1 for error).
+ */
+template <class T, class Items>
+inline int read(izstream& zs, T* x, Items items) {
+ return ::gzread(zs.fp(), x, items*sizeof(T));
+}
+
+/*
+ * Binary input with the '>' operator.
+ */
+template <class T>
+inline izstream& operator>(izstream& zs, T& x) {
+ ::gzread(zs.fp(), &x, sizeof(T));
+ return zs;
+}
+
+
+inline zstringlen::zstringlen(izstream& zs) {
+ zs > val.byte;
+ if (val.byte == 255) zs > val.word;
+ else val.word = val.byte;
+}
+
+/*
+ * Read length of string + the string with the '>' operator.
+ */
+inline izstream& operator>(izstream& zs, char* x) {
+ zstringlen len(zs);
+ ::gzread(zs.fp(), x, len.value());
+ x[len.value()] = '\0';
+ return zs;
+}
+
+inline char* read_string(izstream& zs) {
+ zstringlen len(zs);
+ char* x = new char[len.value()+1];
+ ::gzread(zs.fp(), x, len.value());
+ x[len.value()] = '\0';
+ return x;
+}
+
+// ----------------------------- ozstream -----------------------------
+
+class ozstream
+{
+ public:
+ ozstream() : m_fp(0), m_os(0) {
+ }
+ ozstream(FILE* fp, int level = Z_DEFAULT_COMPRESSION)
+ : m_fp(0), m_os(0) {
+ open(fp, level);
+ }
+ ozstream(const char* name, int level = Z_DEFAULT_COMPRESSION)
+ : m_fp(0), m_os(0) {
+ open(name, level);
+ }
+ ~ozstream() {
+ close();
+ }
+
+ /* Opens a gzip (.gz) file for writing.
+ * The compression level parameter should be in 0..9
+ * errno can be checked to distinguish two error cases
+ * (if errno is zero, the zlib error is Z_MEM_ERROR).
+ */
+ void open(const char* name, int level = Z_DEFAULT_COMPRESSION) {
+ char mode[4] = "wb\0";
+ if (level != Z_DEFAULT_COMPRESSION) mode[2] = '0'+level;
+ if (m_fp) close();
+ m_fp = ::gzopen(name, mode);
+ }
+
+ /* open from a FILE pointer.
+ */
+ void open(FILE* fp, int level = Z_DEFAULT_COMPRESSION) {
+ SET_BINARY_MODE(fp);
+ char mode[4] = "wb\0";
+ if (level != Z_DEFAULT_COMPRESSION) mode[2] = '0'+level;
+ if (m_fp) close();
+ m_fp = ::gzdopen(fileno(fp), mode);
+ }
+
+ /* Flushes all pending output if necessary, closes the compressed file
+ * and deallocates all the (de)compression state. The return value is
+ * the zlib error number (see function error() below).
+ */
+ int close() {
+ if (m_os) {
+ ::gzwrite(m_fp, m_os->str(), m_os->pcount());
+ delete[] m_os->str(); delete m_os; m_os = 0;
+ }
+ int r = ::gzclose(m_fp); m_fp = 0; return r;
+ }
+
+ /* Binary write the given number of bytes into the compressed file.
+ */
+ int write(const void* buf, size_t len) {
+ return ::gzwrite(m_fp, (voidp) buf, len);
+ }
+
+ /* Flushes all pending output into the compressed file. The parameter
+ * _flush is as in the deflate() function. The return value is the zlib
+ * error number (see function gzerror below). flush() returns Z_OK if
+ * the flush_ parameter is Z_FINISH and all output could be flushed.
+ * flush() should be called only when strictly necessary because it can
+ * degrade compression.
+ */
+ int flush(int _flush) {
+ os_flush();
+ return ::gzflush(m_fp, _flush);
+ }
+
+ /* Returns the error message for the last error which occurred on the
+ * given compressed file. errnum is set to zlib error number. If an
+ * error occurred in the file system and not in the compression library,
+ * errnum is set to Z_ERRNO and the application may consult errno
+ * to get the exact error code.
+ */
+ const char* error(int* errnum) {
+ return ::gzerror(m_fp, errnum);
+ }
+
+ gzFile fp() { return m_fp; }
+
+ ostream& os() {
+ if (m_os == 0) m_os = new ostrstream;
+ return *m_os;
+ }
+
+ void os_flush() {
+ if (m_os && m_os->pcount()>0) {
+ ostrstream* oss = new ostrstream;
+ oss->fill(m_os->fill());
+ oss->flags(m_os->flags());
+ oss->precision(m_os->precision());
+ oss->width(m_os->width());
+ ::gzwrite(m_fp, m_os->str(), m_os->pcount());
+ delete[] m_os->str(); delete m_os; m_os = oss;
+ }
+ }
+
+ private:
+ gzFile m_fp;
+ ostrstream* m_os;
+};
+
+/*
+ * Binary write the given (array of) object(s) into the compressed file.
+ * returns the number of uncompressed bytes actually written
+ * (0 in case of error).
+ */
+template <class T, class Items>
+inline int write(ozstream& zs, const T* x, Items items) {
+ return ::gzwrite(zs.fp(), (voidp) x, items*sizeof(T));
+}
+
+/*
+ * Binary output with the '<' operator.
+ */
+template <class T>
+inline ozstream& operator<(ozstream& zs, const T& x) {
+ ::gzwrite(zs.fp(), (voidp) &x, sizeof(T));
+ return zs;
+}
+
+inline zstringlen::zstringlen(ozstream& zs, const char* x) {
+ val.byte = 255; val.word = ::strlen(x);
+ if (val.word < 255) zs < (val.byte = val.word);
+ else zs < val;
+}
+
+/*
+ * Write length of string + the string with the '<' operator.
+ */
+inline ozstream& operator<(ozstream& zs, const char* x) {
+ zstringlen len(zs, x);
+ ::gzwrite(zs.fp(), (voidp) x, len.value());
+ return zs;
+}
+
+#ifdef _MSC_VER
+inline ozstream& operator<(ozstream& zs, char* const& x) {
+ return zs < (const char*) x;
+}
+#endif
+
+/*
+ * Ascii write with the << operator;
+ */
+template <class T>
+inline ostream& operator<<(ozstream& zs, const T& x) {
+ zs.os_flush();
+ return zs.os() << x;
+}
+
+#endif
--- /dev/null
+#include "zstream.h"
+#include <math.h>
+#include <stdlib.h>
+#include <iomanip.h>
+
+void main() {
+ char h[256] = "Hello";
+ char* g = "Goodbye";
+ ozstream out("temp.gz");
+ out < "This works well" < h < g;
+ out.close();
+
+ izstream in("temp.gz"); // read it back
+ char *x = read_string(in), *y = new char[256], z[256];
+ in > y > z;
+ in.close();
+ cout << x << endl << y << endl << z << endl;
+
+ out.open("temp.gz"); // try ascii output; zcat temp.gz to see the results
+ out << setw(50) << setfill('#') << setprecision(20) << x << endl << y << endl << z << endl;
+ out << z << endl << y << endl << x << endl;
+ out << 1.1234567890123456789 << endl;
+
+ delete[] x; delete[] y;
+}
--- /dev/null
+Change in 0.15: (19 Mar 98)
+- fix memory leak in minizip.c
+
+Change in 0.14: (10 Mar 98)
+- fix bugs in minizip.c sample for zipping big file
+- fix problem in month in date handling
+- fix bug in unzlocal_GetCurrentFileInfoInternal in unzip.c for
+ comment handling
+
+Change in 0.13: (6 Mar 98)
+- fix bugs in zip.c
+- add real minizip sample
+
+Change in 0.12: (4 Mar 98)
+- add zip.c and zip.h for creates .zip file
+- fix change_file_date in miniunz.c for Unix (Jean-loup Gailly)
+- fix miniunz.c for file without specific record for directory
+
+Change in 0.11: (3 Mar 98)
+- fix bug in unzGetCurrentFileInfo for get extra field and comment
+- enhance miniunz sample, remove the bad unztst.c sample
+
+Change in 0.10: (2 Mar 98)
+- fix bug in unzReadCurrentFile
+- rename unzip* to unz* function and structure
+- remove Windows-like hungary notation variable name
+- modify some structure in unzip.h
+- add somes comment in source
+- remove unzipGetcCurrentFile function
+- replace ZUNZEXPORT by ZEXPORT
+- add unzGetLocalExtrafield for get the local extrafield info
+- add a new sample, miniunz.c
+
+Change in 0.4: (25 Feb 98)
+- suppress the type unzipFileInZip.
+ Only on file in the zipfile can be open at the same time
+- fix somes typo in code
+- added tm_unz structure in unzip_file_info (date/time in readable format)
--- /dev/null
+CC=cc
+CFLAGS=-O -I../..
+
+UNZ_OBJS = miniunz.o unzip.o ../../libz.a
+ZIP_OBJS = minizip.o zip.o ../../libz.a
+
+.c.o:
+ $(CC) -c $(CFLAGS) $*.c
+
+all: miniunz minizip
+
+miniunz: $(UNZ_OBJS)
+ $(CC) $(CFLAGS) -o $@ $(UNZ_OBJS)
+
+minizip: $(ZIP_OBJS)
+ $(CC) $(CFLAGS) -o $@ $(ZIP_OBJS)
+
+test: miniunz minizip
+ ./minizip test readme.txt
+ ./miniunz -l test.zip
+ mv readme.txt readme.old
+ ./miniunz test.zip
+
+clean:
+ /bin/rm -f *.o *~ minizip miniunz
--- /dev/null
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <time.h>
+#include <errno.h>
+#include <fcntl.h>
+
+#ifdef unix
+# include <unistd.h>
+# include <utime.h>
+#else
+# include <direct.h>
+# include <io.h>
+#endif
+
+#include "unzip.h"
+
+#define CASESENSITIVITY (0)
+#define WRITEBUFFERSIZE (8192)
+
+/*
+ mini unzip, demo of unzip package
+
+ usage :
+ Usage : miniunz [-exvlo] file.zip [file_to_extract]
+
+ list the file in the zipfile, and print the content of FILE_ID.ZIP or README.TXT
+ if it exists
+*/
+
+
+/* change_file_date : change the date/time of a file
+ filename : the filename of the file where date/time must be modified
+ dosdate : the new date at the MSDos format (4 bytes)
+ tmu_date : the SAME new date at the tm_unz format */
+void change_file_date(filename,dosdate,tmu_date)
+ const char *filename;
+ uLong dosdate;
+ tm_unz tmu_date;
+{
+#ifdef WIN32
+ HANDLE hFile;
+ FILETIME ftm,ftLocal,ftCreate,ftLastAcc,ftLastWrite;
+
+ hFile = CreateFile(filename,GENERIC_READ | GENERIC_WRITE,
+ 0,NULL,OPEN_EXISTING,0,NULL);
+ GetFileTime(hFile,&ftCreate,&ftLastAcc,&ftLastWrite);
+ DosDateTimeToFileTime((WORD)(dosdate>>16),(WORD)dosdate,&ftLocal);
+ LocalFileTimeToFileTime(&ftLocal,&ftm);
+ SetFileTime(hFile,&ftm,&ftLastAcc,&ftm);
+ CloseHandle(hFile);
+#else
+#ifdef unix
+ struct utimbuf ut;
+ struct tm newdate;
+ newdate.tm_sec = tmu_date.tm_sec;
+ newdate.tm_min=tmu_date.tm_min;
+ newdate.tm_hour=tmu_date.tm_hour;
+ newdate.tm_mday=tmu_date.tm_mday;
+ newdate.tm_mon=tmu_date.tm_mon;
+ if (tmu_date.tm_year > 1900)
+ newdate.tm_year=tmu_date.tm_year - 1900;
+ else
+ newdate.tm_year=tmu_date.tm_year ;
+ newdate.tm_isdst=-1;
+
+ ut.actime=ut.modtime=mktime(&newdate);
+ utime(filename,&ut);
+#endif
+#endif
+}
+
+
+/* mymkdir and change_file_date are not 100 % portable
+ As I don't know well Unix, I wait feedback for the unix portion */
+
+int mymkdir(dirname)
+ const char* dirname;
+{
+ int ret=0;
+#ifdef WIN32
+ ret = mkdir(dirname);
+#else
+#ifdef unix
+ ret = mkdir (dirname,0775);
+#endif
+#endif
+ return ret;
+}
+
+int makedir (newdir)
+ char *newdir;
+{
+ char *buffer ;
+ char *p;
+ int len = strlen(newdir);
+
+ if (len <= 0)
+ return 0;
+
+ buffer = (char*)malloc(len+1);
+ strcpy(buffer,newdir);
+
+ if (buffer[len-1] == '/') {
+ buffer[len-1] = '\0';
+ }
+ if (mymkdir(buffer) == 0)
+ {
+ free(buffer);
+ return 1;
+ }
+
+ p = buffer+1;
+ while (1)
+ {
+ char hold;
+
+ while(*p && *p != '\\' && *p != '/')
+ p++;
+ hold = *p;
+ *p = 0;
+ if ((mymkdir(buffer) == -1) && (errno == ENOENT))
+ {
+ printf("couldn't create directory %s\n",buffer);
+ free(buffer);
+ return 0;
+ }
+ if (hold == 0)
+ break;
+ *p++ = hold;
+ }
+ free(buffer);
+ return 1;
+}
+
+void do_banner()
+{
+ printf("MiniUnz 0.15, demo of zLib + Unz package written by Gilles Vollant\n");
+ printf("more info at http://wwww.winimage/zLibDll/unzip.htm\n\n");
+}
+
+void do_help()
+{
+ printf("Usage : miniunz [-exvlo] file.zip [file_to_extract]\n\n") ;
+}
+
+
+int do_list(uf)
+ unzFile uf;
+{
+ uLong i;
+ unz_global_info gi;
+ int err;
+
+ err = unzGetGlobalInfo (uf,&gi);
+ if (err!=UNZ_OK)
+ printf("error %d with zipfile in unzGetGlobalInfo \n",err);
+ printf(" Length Method Size Ratio Date Time CRC-32 Name\n");
+ printf(" ------ ------ ---- ----- ---- ---- ------ ----\n");
+ for (i=0;i<gi.number_entry;i++)
+ {
+ char filename_inzip[256];
+ unz_file_info file_info;
+ uLong ratio=0;
+ const char *string_method;
+ err = unzGetCurrentFileInfo(uf,&file_info,filename_inzip,sizeof(filename_inzip),NULL,0,NULL,0);
+ if (err!=UNZ_OK)
+ {
+ printf("error %d with zipfile in unzGetCurrentFileInfo\n",err);
+ break;
+ }
+ if (file_info.uncompressed_size>0)
+ ratio = (file_info.compressed_size*100)/file_info.uncompressed_size;
+
+ if (file_info.compression_method==0)
+ string_method="Stored";
+ else
+ if (file_info.compression_method==Z_DEFLATED)
+ {
+ uInt iLevel=(uInt)((file_info.flag & 0x6)/2);
+ if (iLevel==0)
+ string_method="Defl:N";
+ else if (iLevel==1)
+ string_method="Defl:X";
+ else if ((iLevel==2) || (iLevel==3))
+ string_method="Defl:F"; /* 2:fast , 3 : extra fast*/
+ }
+ else
+ string_method="Unkn. ";
+
+ printf("%7lu %6s %7lu %3lu%% %2.2lu-%2.2lu-%2.2lu %2.2lu:%2.2lu %8.8lx %s\n",
+ file_info.uncompressed_size,string_method,file_info.compressed_size,
+ ratio,
+ (uLong)file_info.tmu_date.tm_mon + 1,
+ (uLong)file_info.tmu_date.tm_mday,
+ (uLong)file_info.tmu_date.tm_year % 100,
+ (uLong)file_info.tmu_date.tm_hour,(uLong)file_info.tmu_date.tm_min,
+ (uLong)file_info.crc,filename_inzip);
+ if ((i+1)<gi.number_entry)
+ {
+ err = unzGoToNextFile(uf);
+ if (err!=UNZ_OK)
+ {
+ printf("error %d with zipfile in unzGoToNextFile\n",err);
+ break;
+ }
+ }
+ }
+
+ return 0;
+}
+
+
+int do_extract_currentfile(uf,popt_extract_without_path,popt_overwrite)
+ unzFile uf;
+ const int* popt_extract_without_path;
+ int* popt_overwrite;
+{
+ char filename_inzip[256];
+ char* filename_withoutpath;
+ char* p;
+ int err=UNZ_OK;
+ FILE *fout=NULL;
+ void* buf;
+ uInt size_buf;
+
+ unz_file_info file_info;
+ uLong ratio=0;
+ err = unzGetCurrentFileInfo(uf,&file_info,filename_inzip,sizeof(filename_inzip),NULL,0,NULL,0);
+
+ if (err!=UNZ_OK)
+ {
+ printf("error %d with zipfile in unzGetCurrentFileInfo\n",err);
+ return err;
+ }
+
+ size_buf = WRITEBUFFERSIZE;
+ buf = (void*)malloc(size_buf);
+ if (buf==NULL)
+ {
+ printf("Error allocating memory\n");
+ return UNZ_INTERNALERROR;
+ }
+
+ p = filename_withoutpath = filename_inzip;
+ while ((*p) != '\0')
+ {
+ if (((*p)=='/') || ((*p)=='\\'))
+ filename_withoutpath = p+1;
+ p++;
+ }
+
+ if ((*filename_withoutpath)=='\0')
+ {
+ if ((*popt_extract_without_path)==0)
+ {
+ printf("creating directory: %s\n",filename_inzip);
+ mymkdir(filename_inzip);
+ }
+ }
+ else
+ {
+ const char* write_filename;
+ int skip=0;
+
+ if ((*popt_extract_without_path)==0)
+ write_filename = filename_inzip;
+ else
+ write_filename = filename_withoutpath;
+
+ err = unzOpenCurrentFile(uf);
+ if (err!=UNZ_OK)
+ {
+ printf("error %d with zipfile in unzOpenCurrentFile\n",err);
+ }
+
+ if (((*popt_overwrite)==0) && (err==UNZ_OK))
+ {
+ char rep;
+ FILE* ftestexist;
+ ftestexist = fopen(write_filename,"rb");
+ if (ftestexist!=NULL)
+ {
+ fclose(ftestexist);
+ do
+ {
+ char answer[128];
+ printf("The file %s exist. Overwrite ? [y]es, [n]o, [A]ll: ",write_filename);
+ scanf("%1s",answer);
+ rep = answer[0] ;
+ if ((rep>='a') && (rep<='z'))
+ rep -= 0x20;
+ }
+ while ((rep!='Y') && (rep!='N') && (rep!='A'));
+ }
+
+ if (rep == 'N')
+ skip = 1;
+
+ if (rep == 'A')
+ *popt_overwrite=1;
+ }
+
+ if ((skip==0) && (err==UNZ_OK))
+ {
+ fout=fopen(write_filename,"wb");
+
+ /* some zipfile don't contain directory alone before file */
+ if ((fout==NULL) && ((*popt_extract_without_path)==0) &&
+ (filename_withoutpath!=(char*)filename_inzip))
+ {
+ char c=*(filename_withoutpath-1);
+ *(filename_withoutpath-1)='\0';
+ makedir(write_filename);
+ *(filename_withoutpath-1)=c;
+ fout=fopen(write_filename,"wb");
+ }
+
+ if (fout==NULL)
+ {
+ printf("error opening %s\n",write_filename);
+ }
+ }
+
+ if (fout!=NULL)
+ {
+ printf(" extracting: %s\n",write_filename);
+
+ do
+ {
+ err = unzReadCurrentFile(uf,buf,size_buf);
+ if (err<0)
+ {
+ printf("error %d with zipfile in unzReadCurrentFile\n",err);
+ break;
+ }
+ if (err>0)
+ if (fwrite(buf,err,1,fout)!=1)
+ {
+ printf("error in writing extracted file\n");
+ err=UNZ_ERRNO;
+ break;
+ }
+ }
+ while (err>0);
+ fclose(fout);
+ if (err==0)
+ change_file_date(write_filename,file_info.dosDate,
+ file_info.tmu_date);
+ }
+
+ if (err==UNZ_OK)
+ {
+ err = unzCloseCurrentFile (uf);
+ if (err!=UNZ_OK)
+ {
+ printf("error %d with zipfile in unzCloseCurrentFile\n",err);
+ }
+ }
+ else
+ unzCloseCurrentFile(uf); /* don't lose the error */
+ }
+
+ free(buf);
+ return err;
+}
+
+
+int do_extract(uf,opt_extract_without_path,opt_overwrite)
+ unzFile uf;
+ int opt_extract_without_path;
+ int opt_overwrite;
+{
+ uLong i;
+ unz_global_info gi;
+ int err;
+ FILE* fout=NULL;
+
+ err = unzGetGlobalInfo (uf,&gi);
+ if (err!=UNZ_OK)
+ printf("error %d with zipfile in unzGetGlobalInfo \n",err);
+
+ for (i=0;i<gi.number_entry;i++)
+ {
+ if (do_extract_currentfile(uf,&opt_extract_without_path,
+ &opt_overwrite) != UNZ_OK)
+ break;
+
+ if ((i+1)<gi.number_entry)
+ {
+ err = unzGoToNextFile(uf);
+ if (err!=UNZ_OK)
+ {
+ printf("error %d with zipfile in unzGoToNextFile\n",err);
+ break;
+ }
+ }
+ }
+
+ return 0;
+}
+
+int do_extract_onefile(uf,filename,opt_extract_without_path,opt_overwrite)
+ unzFile uf;
+ const char* filename;
+ int opt_extract_without_path;
+ int opt_overwrite;
+{
+ int err = UNZ_OK;
+ if (unzLocateFile(uf,filename,CASESENSITIVITY)!=UNZ_OK)
+ {
+ printf("file %s not found in the zipfile\n",filename);
+ return 2;
+ }
+
+ if (do_extract_currentfile(uf,&opt_extract_without_path,
+ &opt_overwrite) == UNZ_OK)
+ return 0;
+ else
+ return 1;
+}
+
+
+int main(argc,argv)
+ int argc;
+ char *argv[];
+{
+ const char *zipfilename=NULL;
+ const char *filename_to_extract=NULL;
+ int i;
+ int opt_do_list=0;
+ int opt_do_extract=1;
+ int opt_do_extract_withoutpath=0;
+ int opt_overwrite=0;
+ char filename_try[512];
+ unzFile uf=NULL;
+
+ do_banner();
+ if (argc==1)
+ {
+ do_help();
+ exit(0);
+ }
+ else
+ {
+ for (i=1;i<argc;i++)
+ {
+ if ((*argv[i])=='-')
+ {
+ const char *p=argv[i]+1;
+
+ while ((*p)!='\0')
+ {
+ char c=*(p++);;
+ if ((c=='l') || (c=='L'))
+ opt_do_list = 1;
+ if ((c=='v') || (c=='V'))
+ opt_do_list = 1;
+ if ((c=='x') || (c=='X'))
+ opt_do_extract = 1;
+ if ((c=='e') || (c=='E'))
+ opt_do_extract = opt_do_extract_withoutpath = 1;
+ if ((c=='o') || (c=='O'))
+ opt_overwrite=1;
+ }
+ }
+ else
+ {
+ if (zipfilename == NULL)
+ zipfilename = argv[i];
+ else if (filename_to_extract==NULL)
+ filename_to_extract = argv[i] ;
+ }
+ }
+ }
+
+ if (zipfilename!=NULL)
+ {
+ strcpy(filename_try,zipfilename);
+ uf = unzOpen(zipfilename);
+ if (uf==NULL)
+ {
+ strcat(filename_try,".zip");
+ uf = unzOpen(filename_try);
+ }
+ }
+
+ if (uf==NULL)
+ {
+ printf("Cannot open %s or %s.zip\n",zipfilename,zipfilename);
+ exit (1);
+ }
+ printf("%s opened\n",filename_try);
+
+ if (opt_do_list==1)
+ return do_list(uf);
+ else if (opt_do_extract==1)
+ {
+ if (filename_to_extract == NULL)
+ return do_extract(uf,opt_do_extract_withoutpath,opt_overwrite);
+ else
+ return do_extract_onefile(uf,filename_to_extract,
+ opt_do_extract_withoutpath,opt_overwrite);
+ }
+ unzCloseCurrentFile(uf);
+
+ return 0; /* to avoid warning */
+}
--- /dev/null
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <time.h>
+#include <errno.h>
+#include <fcntl.h>
+
+#ifdef unix
+# include <unistd.h>
+# include <utime.h>
+# include <sys/types.h>
+# include <sys/stat.h>
+#else
+# include <direct.h>
+# include <io.h>
+#endif
+
+#include "zip.h"
+
+
+#define WRITEBUFFERSIZE (16384)
+#define MAXFILENAME (256)
+
+#ifdef WIN32
+uLong filetime(f, tmzip, dt)
+ char *f; /* name of file to get info on */
+ tm_zip *tmzip; /* return value: access, modific. and creation times */
+ uLong *dt; /* dostime */
+{
+ int ret = 0;
+ {
+ FILETIME ftLocal;
+ HANDLE hFind;
+ WIN32_FIND_DATA ff32;
+
+ hFind = FindFirstFile(f,&ff32);
+ if (hFind != INVALID_HANDLE_VALUE)
+ {
+ FileTimeToLocalFileTime(&(ff32.ftLastWriteTime),&ftLocal);
+ FileTimeToDosDateTime(&ftLocal,((LPWORD)dt)+1,((LPWORD)dt)+0);
+ FindClose(hFind);
+ ret = 1;
+ }
+ }
+ return ret;
+}
+#else
+#ifdef unix
+uLong filetime(f, tmzip, dt)
+ char *f; /* name of file to get info on */
+ tm_zip *tmzip; /* return value: access, modific. and creation times */
+ uLong *dt; /* dostime */
+{
+ int ret=0;
+ struct stat s; /* results of stat() */
+ struct tm* filedate;
+ time_t tm_t=0;
+
+ if (strcmp(f,"-")!=0)
+ {
+ char name[MAXFILENAME];
+ int len = strlen(f);
+ strcpy(name, f);
+ if (name[len - 1] == '/')
+ name[len - 1] = '\0';
+ /* not all systems allow stat'ing a file with / appended */
+ if (stat(name,&s)==0)
+ {
+ tm_t = s.st_mtime;
+ ret = 1;
+ }
+ }
+ filedate = localtime(&tm_t);
+
+ tmzip->tm_sec = filedate->tm_sec;
+ tmzip->tm_min = filedate->tm_min;
+ tmzip->tm_hour = filedate->tm_hour;
+ tmzip->tm_mday = filedate->tm_mday;
+ tmzip->tm_mon = filedate->tm_mon ;
+ tmzip->tm_year = filedate->tm_year;
+
+ return ret;
+}
+#else
+uLong filetime(f, tmzip, dt)
+ char *f; /* name of file to get info on */
+ tm_zip *tmzip; /* return value: access, modific. and creation times */
+ uLong *dt; /* dostime */
+{
+ return 0;
+}
+#endif
+#endif
+
+
+
+
+int check_exist_file(filename)
+ const char* filename;
+{
+ FILE* ftestexist;
+ int ret = 1;
+ ftestexist = fopen(filename,"rb");
+ if (ftestexist==NULL)
+ ret = 0;
+ else
+ fclose(ftestexist);
+ return ret;
+}
+
+void do_banner()
+{
+ printf("MiniZip 0.15, demo of zLib + Zip package written by Gilles Vollant\n");
+ printf("more info at http://wwww.winimage/zLibDll/unzip.htm\n\n");
+}
+
+void do_help()
+{
+ printf("Usage : minizip [-o] file.zip [files_to_add]\n\n") ;
+}
+
+int main(argc,argv)
+ int argc;
+ char *argv[];
+{
+ int i;
+ int opt_overwrite=0;
+ int opt_compress_level=Z_DEFAULT_COMPRESSION;
+ int zipfilenamearg = 0;
+ char filename_try[MAXFILENAME];
+ int zipok;
+ int err=0;
+ int size_buf=0;
+ void* buf=NULL,
+
+
+ do_banner();
+ if (argc==1)
+ {
+ do_help();
+ exit(0);
+ return 0;
+ }
+ else
+ {
+ for (i=1;i<argc;i++)
+ {
+ if ((*argv[i])=='-')
+ {
+ const char *p=argv[i]+1;
+
+ while ((*p)!='\0')
+ {
+ char c=*(p++);;
+ if ((c=='o') || (c=='O'))
+ opt_overwrite = 1;
+ if ((c>='0') && (c<='9'))
+ opt_compress_level = c-'0';
+ }
+ }
+ else
+ if (zipfilenamearg == 0)
+ zipfilenamearg = i ;
+ }
+ }
+
+ size_buf = WRITEBUFFERSIZE;
+ buf = (void*)malloc(size_buf);
+ if (buf==NULL)
+ {
+ printf("Error allocating memory\n");
+ return ZIP_INTERNALERROR;
+ }
+
+ if (zipfilenamearg==0)
+ zipok=0;
+ else
+ {
+ int i,len;
+ int dot_found=0;
+
+ zipok = 1 ;
+ strcpy(filename_try,argv[zipfilenamearg]);
+ len=strlen(filename_try);
+ for (i=0;i<len;i++)
+ if (filename_try[i]=='.')
+ dot_found=1;
+
+ if (dot_found==0)
+ strcat(filename_try,".zip");
+
+ if (opt_overwrite==0)
+ if (check_exist_file(filename_try)!=0)
+ {
+ char rep;
+ do
+ {
+ char answer[128];
+ printf("The file %s exist. Overwrite ? [y]es, [n]o : ",filename_try);
+ scanf("%1s",answer);
+ rep = answer[0] ;
+ if ((rep>='a') && (rep<='z'))
+ rep -= 0x20;
+ }
+ while ((rep!='Y') && (rep!='N'));
+ if (rep=='N')
+ zipok = 0;
+ }
+ }
+
+ if (zipok==1)
+ {
+ zipFile zf;
+ int errclose;
+ zf = zipOpen(filename_try,0);
+ if (zf == NULL)
+ {
+ printf("error opening %s\n",filename_try);
+ err= ZIP_ERRNO;
+ }
+ else
+ printf("creating %s\n",filename_try);
+
+ for (i=zipfilenamearg+1;(i<argc) && (err==ZIP_OK);i++)
+ {
+ if (((*(argv[i]))!='-') && ((*(argv[i]))!='/'))
+ {
+ FILE * fin;
+ int size_read;
+ const char* filenameinzip = argv[i];
+ zip_fileinfo zi;
+
+ zi.tmz_date.tm_sec = zi.tmz_date.tm_min = zi.tmz_date.tm_hour =
+ zi.tmz_date.tm_mday = zi.tmz_date.tm_min = zi.tmz_date.tm_year = 0;
+ zi.dosDate = 0;
+ zi.internal_fa = 0;
+ zi.external_fa = 0;
+ filetime(filenameinzip,&zi.tmz_date,&zi.dosDate);
+
+
+ err = zipOpenNewFileInZip(zf,filenameinzip,&zi,
+ NULL,0,NULL,0,NULL /* comment*/,
+ (opt_compress_level != 0) ? Z_DEFLATED : 0,
+ opt_compress_level);
+
+ if (err != ZIP_OK)
+ printf("error in opening %s in zipfile\n",filenameinzip);
+ else
+ {
+ fin = fopen(filenameinzip,"rb");
+ if (fin==NULL)
+ {
+ err=ZIP_ERRNO;
+ printf("error in opening %s for reading\n",filenameinzip);
+ }
+ }
+
+ if (err == ZIP_OK)
+ do
+ {
+ err = ZIP_OK;
+ size_read = fread(buf,1,size_buf,fin);
+ if (size_read < size_buf)
+ if (feof(fin)==0)
+ {
+ printf("error in reading %s\n",filenameinzip);
+ err = ZIP_ERRNO;
+ }
+
+ if (size_read>0)
+ {
+ err = zipWriteInFileInZip (zf,buf,size_read);
+ if (err<0)
+ {
+ printf("error in writing %s in the zipfile\n",
+ filenameinzip);
+ }
+
+ }
+ } while ((err == ZIP_OK) && (size_read>0));
+
+ fclose(fin);
+ if (err<0)
+ err=ZIP_ERRNO;
+ else
+ {
+ err = zipCloseFileInZip(zf);
+ if (err!=ZIP_OK)
+ printf("error in closing %s in the zipfile\n",
+ filenameinzip);
+ }
+ }
+ }
+ errclose = zipClose(zf,NULL);
+ if (errclose != ZIP_OK)
+ printf("error in closing %s\n",filename_try);
+ }
+
+ free(buf);
+ exit(0);
+ return 0; /* to avoid warning */
+}
--- /dev/null
+
+UnZip 0.15 additionnal library
+
+
+ This unzip package allow extract file from .ZIP file, compatible with
+PKZip 2.04g, WinZip, InfoZip tools and compatible.
+
+ Multi volume ZipFile (span) are not supported, and old compression used by old
+PKZip 1.x are not supported.
+
+See probdesc.zip from PKWare for specification of .ZIP format.
+
+What is Unzip
+ The Zlib library support the deflate compression and the creation of gzip (.gz)
+file. Zlib is free and small.
+ The .Zip format, which can contain several compressed files (.gz can containt
+only one file) is a very popular format. This is why I've written a package for reading file compressed in Zipfile.
+
+Using Unzip package
+
+You need source of Zlib (get zlib111.zip and read zlib.h).
+Get unzlb015.zip and read unzip.h (whith documentation of unzip functions)
+
+The Unzip package is only two file : unzip.h and unzip.c. But it use the Zlib
+ files.
+unztst.c is a simple sample program, which list file in a zipfile and display
+ README.TXT or FILE_ID.DIZ (if these files are found).
+miniunz.c is a mini unzip program.
+
+I'm also currenlyt writing a zipping portion (zip.h, zip.c and test with minizip.c)
+
+Please email me for feedback.
+I hope my source is compatible with Unix system, but I need your help for be sure
+
+Latest revision : Mar 04th, 1998
+
+Check http://www.winimage.com/zLibDll/unzip.html for up to date info.
--- /dev/null
+/* unzip.c -- IO on .zip files using zlib
+ Version 0.15 beta, Mar 19th, 1998,
+
+ Read unzip.h for more info
+*/
+
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include "zlib.h"
+#include "unzip.h"
+
+#ifdef STDC
+# include <stddef.h>
+# include <string.h>
+# include <stdlib.h>
+#endif
+#ifdef NO_ERRNO_H
+ extern int errno;
+#else
+# include <errno.h>
+#endif
+
+
+#ifndef local
+# define local static
+#endif
+/* compile with -Dlocal if your debugger can't find static symbols */
+
+
+
+#if !defined(unix) && !defined(CASESENSITIVITYDEFAULT_YES) && \
+ !defined(CASESENSITIVITYDEFAULT_NO)
+#define CASESENSITIVITYDEFAULT_NO
+#endif
+
+
+#ifndef UNZ_BUFSIZE
+#define UNZ_BUFSIZE (16384)
+#endif
+
+#ifndef UNZ_MAXFILENAMEINZIP
+#define UNZ_MAXFILENAMEINZIP (256)
+#endif
+
+#ifndef ALLOC
+# define ALLOC(size) (malloc(size))
+#endif
+#ifndef TRYFREE
+# define TRYFREE(p) {if (p) free(p);}
+#endif
+
+#define SIZECENTRALDIRITEM (0x2e)
+#define SIZEZIPLOCALHEADER (0x1e)
+
+
+/* I've found an old Unix (a SunOS 4.1.3_U1) without all SEEK_* defined.... */
+
+#ifndef SEEK_CUR
+#define SEEK_CUR 1
+#endif
+
+#ifndef SEEK_END
+#define SEEK_END 2
+#endif
+
+#ifndef SEEK_SET
+#define SEEK_SET 0
+#endif
+
+const char unz_copyright[] =
+ " unzip 0.15 Copyright 1998 Gilles Vollant ";
+
+/* unz_file_info_interntal contain internal info about a file in zipfile*/
+typedef struct unz_file_info_internal_s
+{
+ uLong offset_curfile;/* relative offset of local header 4 bytes */
+} unz_file_info_internal;
+
+
+/* file_in_zip_read_info_s contain internal information about a file in zipfile,
+ when reading and decompress it */
+typedef struct
+{
+ char *read_buffer; /* internal buffer for compressed data */
+ z_stream stream; /* zLib stream structure for inflate */
+
+ uLong pos_in_zipfile; /* position in byte on the zipfile, for fseek*/
+ uLong stream_initialised; /* flag set if stream structure is initialised*/
+
+ uLong offset_local_extrafield;/* offset of the local extra field */
+ uInt size_local_extrafield;/* size of the local extra field */
+ uLong pos_local_extrafield; /* position in the local extra field in read*/
+
+ uLong crc32; /* crc32 of all data uncompressed */
+ uLong crc32_wait; /* crc32 we must obtain after decompress all */
+ uLong rest_read_compressed; /* number of byte to be decompressed */
+ uLong rest_read_uncompressed;/*number of byte to be obtained after decomp*/
+ FILE* file; /* io structore of the zipfile */
+ uLong compression_method; /* compression method (0==store) */
+ uLong byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/
+} file_in_zip_read_info_s;
+
+
+/* unz_s contain internal information about the zipfile
+*/
+typedef struct
+{
+ FILE* file; /* io structore of the zipfile */
+ unz_global_info gi; /* public global information */
+ uLong byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/
+ uLong num_file; /* number of the current file in the zipfile*/
+ uLong pos_in_central_dir; /* pos of the current file in the central dir*/
+ uLong current_file_ok; /* flag about the usability of the current file*/
+ uLong central_pos; /* position of the beginning of the central dir*/
+
+ uLong size_central_dir; /* size of the central directory */
+ uLong offset_central_dir; /* offset of start of central directory with
+ respect to the starting disk number */
+
+ unz_file_info cur_file_info; /* public info about the current file in zip*/
+ unz_file_info_internal cur_file_info_internal; /* private info about it*/
+ file_in_zip_read_info_s* pfile_in_zip_read; /* structure about the current
+ file if we are decompressing it */
+} unz_s;
+
+
+/* ===========================================================================
+ Read a byte from a gz_stream; update next_in and avail_in. Return EOF
+ for end of file.
+ IN assertion: the stream s has been sucessfully opened for reading.
+*/
+
+
+local int unzlocal_getByte(fin,pi)
+ FILE *fin;
+ int *pi;
+{
+ unsigned char c;
+ int err = fread(&c, 1, 1, fin);
+ if (err==1)
+ {
+ *pi = (int)c;
+ return UNZ_OK;
+ }
+ else
+ {
+ if (ferror(fin))
+ return UNZ_ERRNO;
+ else
+ return UNZ_EOF;
+ }
+}
+
+
+/* ===========================================================================
+ Reads a long in LSB order from the given gz_stream. Sets
+*/
+local int unzlocal_getShort (fin,pX)
+ FILE* fin;
+ uLong *pX;
+{
+ uLong x ;
+ int i;
+ int err;
+
+ err = unzlocal_getByte(fin,&i);
+ x = (uLong)i;
+
+ if (err==UNZ_OK)
+ err = unzlocal_getByte(fin,&i);
+ x += ((uLong)i)<<8;
+
+ if (err==UNZ_OK)
+ *pX = x;
+ else
+ *pX = 0;
+ return err;
+}
+
+local int unzlocal_getLong (fin,pX)
+ FILE* fin;
+ uLong *pX;
+{
+ uLong x ;
+ int i;
+ int err;
+
+ err = unzlocal_getByte(fin,&i);
+ x = (uLong)i;
+
+ if (err==UNZ_OK)
+ err = unzlocal_getByte(fin,&i);
+ x += ((uLong)i)<<8;
+
+ if (err==UNZ_OK)
+ err = unzlocal_getByte(fin,&i);
+ x += ((uLong)i)<<16;
+
+ if (err==UNZ_OK)
+ err = unzlocal_getByte(fin,&i);
+ x += ((uLong)i)<<24;
+
+ if (err==UNZ_OK)
+ *pX = x;
+ else
+ *pX = 0;
+ return err;
+}
+
+
+/* My own strcmpi / strcasecmp */
+local int strcmpcasenosensitive_internal (fileName1,fileName2)
+ const char* fileName1;
+ const char* fileName2;
+{
+ for (;;)
+ {
+ char c1=*(fileName1++);
+ char c2=*(fileName2++);
+ if ((c1>='a') && (c1<='z'))
+ c1 -= 0x20;
+ if ((c2>='a') && (c2<='z'))
+ c2 -= 0x20;
+ if (c1=='\0')
+ return ((c2=='\0') ? 0 : -1);
+ if (c2=='\0')
+ return 1;
+ if (c1<c2)
+ return -1;
+ if (c1>c2)
+ return 1;
+ }
+}
+
+
+#ifdef CASESENSITIVITYDEFAULT_NO
+#define CASESENSITIVITYDEFAULTVALUE 2
+#else
+#define CASESENSITIVITYDEFAULTVALUE 1
+#endif
+
+#ifndef STRCMPCASENOSENTIVEFUNCTION
+#define STRCMPCASENOSENTIVEFUNCTION strcmpcasenosensitive_internal
+#endif
+
+/*
+ Compare two filename (fileName1,fileName2).
+ If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp)
+ If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi
+ or strcasecmp)
+ If iCaseSenisivity = 0, case sensitivity is defaut of your operating system
+ (like 1 on Unix, 2 on Windows)
+
+*/
+extern int ZEXPORT unzStringFileNameCompare (fileName1,fileName2,iCaseSensitivity)
+ const char* fileName1;
+ const char* fileName2;
+ int iCaseSensitivity;
+{
+ if (iCaseSensitivity==0)
+ iCaseSensitivity=CASESENSITIVITYDEFAULTVALUE;
+
+ if (iCaseSensitivity==1)
+ return strcmp(fileName1,fileName2);
+
+ return STRCMPCASENOSENTIVEFUNCTION(fileName1,fileName2);
+}
+
+#define BUFREADCOMMENT (0x400)
+
+/*
+ Locate the Central directory of a zipfile (at the end, just before
+ the global comment)
+*/
+local uLong unzlocal_SearchCentralDir(fin)
+ FILE *fin;
+{
+ unsigned char* buf;
+ uLong uSizeFile;
+ uLong uBackRead;
+ uLong uMaxBack=0xffff; /* maximum size of global comment */
+ uLong uPosFound=0;
+
+ if (fseek(fin,0,SEEK_END) != 0)
+ return 0;
+
+
+ uSizeFile = ftell( fin );
+
+ if (uMaxBack>uSizeFile)
+ uMaxBack = uSizeFile;
+
+ buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4);
+ if (buf==NULL)
+ return 0;
+
+ uBackRead = 4;
+ while (uBackRead<uMaxBack)
+ {
+ uLong uReadSize,uReadPos ;
+ int i;
+ if (uBackRead+BUFREADCOMMENT>uMaxBack)
+ uBackRead = uMaxBack;
+ else
+ uBackRead+=BUFREADCOMMENT;
+ uReadPos = uSizeFile-uBackRead ;
+
+ uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ?
+ (BUFREADCOMMENT+4) : (uSizeFile-uReadPos);
+ if (fseek(fin,uReadPos,SEEK_SET)!=0)
+ break;
+
+ if (fread(buf,(uInt)uReadSize,1,fin)!=1)
+ break;
+
+ for (i=(int)uReadSize-3; (i--)>0;)
+ if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) &&
+ ((*(buf+i+2))==0x05) && ((*(buf+i+3))==0x06))
+ {
+ uPosFound = uReadPos+i;
+ break;
+ }
+
+ if (uPosFound!=0)
+ break;
+ }
+ TRYFREE(buf);
+ return uPosFound;
+}
+
+/*
+ Open a Zip file. path contain the full pathname (by example,
+ on a Windows NT computer "c:\\test\\zlib109.zip" or on an Unix computer
+ "zlib/zlib109.zip".
+ If the zipfile cannot be opened (file don't exist or in not valid), the
+ return value is NULL.
+ Else, the return value is a unzFile Handle, usable with other function
+ of this unzip package.
+*/
+extern unzFile ZEXPORT unzOpen (path)
+ const char *path;
+{
+ unz_s us;
+ unz_s *s;
+ uLong central_pos,uL;
+ FILE * fin ;
+
+ uLong number_disk; /* number of the current dist, used for
+ spaning ZIP, unsupported, always 0*/
+ uLong number_disk_with_CD; /* number the the disk with central dir, used
+ for spaning ZIP, unsupported, always 0*/
+ uLong number_entry_CD; /* total number of entries in
+ the central dir
+ (same than number_entry on nospan) */
+
+ int err=UNZ_OK;
+
+ if (unz_copyright[0]!=' ')
+ return NULL;
+
+ fin=fopen(path,"rb");
+ if (fin==NULL)
+ return NULL;
+
+ central_pos = unzlocal_SearchCentralDir(fin);
+ if (central_pos==0)
+ err=UNZ_ERRNO;
+
+ if (fseek(fin,central_pos,SEEK_SET)!=0)
+ err=UNZ_ERRNO;
+
+ /* the signature, already checked */
+ if (unzlocal_getLong(fin,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* number of this disk */
+ if (unzlocal_getShort(fin,&number_disk)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* number of the disk with the start of the central directory */
+ if (unzlocal_getShort(fin,&number_disk_with_CD)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* total number of entries in the central dir on this disk */
+ if (unzlocal_getShort(fin,&us.gi.number_entry)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* total number of entries in the central dir */
+ if (unzlocal_getShort(fin,&number_entry_CD)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if ((number_entry_CD!=us.gi.number_entry) ||
+ (number_disk_with_CD!=0) ||
+ (number_disk!=0))
+ err=UNZ_BADZIPFILE;
+
+ /* size of the central directory */
+ if (unzlocal_getLong(fin,&us.size_central_dir)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* offset of start of central directory with respect to the
+ starting disk number */
+ if (unzlocal_getLong(fin,&us.offset_central_dir)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* zipfile comment length */
+ if (unzlocal_getShort(fin,&us.gi.size_comment)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if ((central_pos<us.offset_central_dir+us.size_central_dir) &&
+ (err==UNZ_OK))
+ err=UNZ_BADZIPFILE;
+
+ if (err!=UNZ_OK)
+ {
+ fclose(fin);
+ return NULL;
+ }
+
+ us.file=fin;
+ us.byte_before_the_zipfile = central_pos -
+ (us.offset_central_dir+us.size_central_dir);
+ us.central_pos = central_pos;
+ us.pfile_in_zip_read = NULL;
+
+
+ s=(unz_s*)ALLOC(sizeof(unz_s));
+ *s=us;
+ unzGoToFirstFile((unzFile)s);
+ return (unzFile)s;
+}
+
+
+/*
+ Close a ZipFile opened with unzipOpen.
+ If there is files inside the .Zip opened with unzipOpenCurrentFile (see later),
+ these files MUST be closed with unzipCloseCurrentFile before call unzipClose.
+ return UNZ_OK if there is no problem. */
+extern int ZEXPORT unzClose (file)
+ unzFile file;
+{
+ unz_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+
+ if (s->pfile_in_zip_read!=NULL)
+ unzCloseCurrentFile(file);
+
+ fclose(s->file);
+ TRYFREE(s);
+ return UNZ_OK;
+}
+
+
+/*
+ Write info about the ZipFile in the *pglobal_info structure.
+ No preparation of the structure is needed
+ return UNZ_OK if there is no problem. */
+extern int ZEXPORT unzGetGlobalInfo (file,pglobal_info)
+ unzFile file;
+ unz_global_info *pglobal_info;
+{
+ unz_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ *pglobal_info=s->gi;
+ return UNZ_OK;
+}
+
+
+/*
+ Translate date/time from Dos format to tm_unz (readable more easilty)
+*/
+local void unzlocal_DosDateToTmuDate (ulDosDate, ptm)
+ uLong ulDosDate;
+ tm_unz* ptm;
+{
+ uLong uDate;
+ uDate = (uLong)(ulDosDate>>16);
+ ptm->tm_mday = (uInt)(uDate&0x1f) ;
+ ptm->tm_mon = (uInt)((((uDate)&0x1E0)/0x20)-1) ;
+ ptm->tm_year = (uInt)(((uDate&0x0FE00)/0x0200)+1980) ;
+
+ ptm->tm_hour = (uInt) ((ulDosDate &0xF800)/0x800);
+ ptm->tm_min = (uInt) ((ulDosDate&0x7E0)/0x20) ;
+ ptm->tm_sec = (uInt) (2*(ulDosDate&0x1f)) ;
+}
+
+/*
+ Get Info about the current file in the zipfile, with internal only info
+*/
+local int unzlocal_GetCurrentFileInfoInternal OF((unzFile file,
+ unz_file_info *pfile_info,
+ unz_file_info_internal
+ *pfile_info_internal,
+ char *szFileName,
+ uLong fileNameBufferSize,
+ void *extraField,
+ uLong extraFieldBufferSize,
+ char *szComment,
+ uLong commentBufferSize));
+
+local int unzlocal_GetCurrentFileInfoInternal (file,
+ pfile_info,
+ pfile_info_internal,
+ szFileName, fileNameBufferSize,
+ extraField, extraFieldBufferSize,
+ szComment, commentBufferSize)
+ unzFile file;
+ unz_file_info *pfile_info;
+ unz_file_info_internal *pfile_info_internal;
+ char *szFileName;
+ uLong fileNameBufferSize;
+ void *extraField;
+ uLong extraFieldBufferSize;
+ char *szComment;
+ uLong commentBufferSize;
+{
+ unz_s* s;
+ unz_file_info file_info;
+ unz_file_info_internal file_info_internal;
+ int err=UNZ_OK;
+ uLong uMagic;
+ long lSeek=0;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ if (fseek(s->file,s->pos_in_central_dir+s->byte_before_the_zipfile,SEEK_SET)!=0)
+ err=UNZ_ERRNO;
+
+
+ /* we check the magic */
+ if (err==UNZ_OK)
+ if (unzlocal_getLong(s->file,&uMagic) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if (uMagic!=0x02014b50)
+ err=UNZ_BADZIPFILE;
+
+ if (unzlocal_getShort(s->file,&file_info.version) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.version_needed) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.flag) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.compression_method) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getLong(s->file,&file_info.dosDate) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ unzlocal_DosDateToTmuDate(file_info.dosDate,&file_info.tmu_date);
+
+ if (unzlocal_getLong(s->file,&file_info.crc) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getLong(s->file,&file_info.compressed_size) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getLong(s->file,&file_info.uncompressed_size) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.size_filename) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.size_file_extra) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.size_file_comment) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.disk_num_start) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&file_info.internal_fa) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getLong(s->file,&file_info.external_fa) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getLong(s->file,&file_info_internal.offset_curfile) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ lSeek+=file_info.size_filename;
+ if ((err==UNZ_OK) && (szFileName!=NULL))
+ {
+ uLong uSizeRead ;
+ if (file_info.size_filename<fileNameBufferSize)
+ {
+ *(szFileName+file_info.size_filename)='\0';
+ uSizeRead = file_info.size_filename;
+ }
+ else
+ uSizeRead = fileNameBufferSize;
+
+ if ((file_info.size_filename>0) && (fileNameBufferSize>0))
+ if (fread(szFileName,(uInt)uSizeRead,1,s->file)!=1)
+ err=UNZ_ERRNO;
+ lSeek -= uSizeRead;
+ }
+
+
+ if ((err==UNZ_OK) && (extraField!=NULL))
+ {
+ uLong uSizeRead ;
+ if (file_info.size_file_extra<extraFieldBufferSize)
+ uSizeRead = file_info.size_file_extra;
+ else
+ uSizeRead = extraFieldBufferSize;
+
+ if (lSeek!=0)
+ if (fseek(s->file,lSeek,SEEK_CUR)==0)
+ lSeek=0;
+ else
+ err=UNZ_ERRNO;
+ if ((file_info.size_file_extra>0) && (extraFieldBufferSize>0))
+ if (fread(extraField,(uInt)uSizeRead,1,s->file)!=1)
+ err=UNZ_ERRNO;
+ lSeek += file_info.size_file_extra - uSizeRead;
+ }
+ else
+ lSeek+=file_info.size_file_extra;
+
+
+ if ((err==UNZ_OK) && (szComment!=NULL))
+ {
+ uLong uSizeRead ;
+ if (file_info.size_file_comment<commentBufferSize)
+ {
+ *(szComment+file_info.size_file_comment)='\0';
+ uSizeRead = file_info.size_file_comment;
+ }
+ else
+ uSizeRead = commentBufferSize;
+
+ if (lSeek!=0)
+ if (fseek(s->file,lSeek,SEEK_CUR)==0)
+ lSeek=0;
+ else
+ err=UNZ_ERRNO;
+ if ((file_info.size_file_comment>0) && (commentBufferSize>0))
+ if (fread(szComment,(uInt)uSizeRead,1,s->file)!=1)
+ err=UNZ_ERRNO;
+ lSeek+=file_info.size_file_comment - uSizeRead;
+ }
+ else
+ lSeek+=file_info.size_file_comment;
+
+ if ((err==UNZ_OK) && (pfile_info!=NULL))
+ *pfile_info=file_info;
+
+ if ((err==UNZ_OK) && (pfile_info_internal!=NULL))
+ *pfile_info_internal=file_info_internal;
+
+ return err;
+}
+
+
+
+/*
+ Write info about the ZipFile in the *pglobal_info structure.
+ No preparation of the structure is needed
+ return UNZ_OK if there is no problem.
+*/
+extern int ZEXPORT unzGetCurrentFileInfo (file,
+ pfile_info,
+ szFileName, fileNameBufferSize,
+ extraField, extraFieldBufferSize,
+ szComment, commentBufferSize)
+ unzFile file;
+ unz_file_info *pfile_info;
+ char *szFileName;
+ uLong fileNameBufferSize;
+ void *extraField;
+ uLong extraFieldBufferSize;
+ char *szComment;
+ uLong commentBufferSize;
+{
+ return unzlocal_GetCurrentFileInfoInternal(file,pfile_info,NULL,
+ szFileName,fileNameBufferSize,
+ extraField,extraFieldBufferSize,
+ szComment,commentBufferSize);
+}
+
+/*
+ Set the current file of the zipfile to the first file.
+ return UNZ_OK if there is no problem
+*/
+extern int ZEXPORT unzGoToFirstFile (file)
+ unzFile file;
+{
+ int err=UNZ_OK;
+ unz_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ s->pos_in_central_dir=s->offset_central_dir;
+ s->num_file=0;
+ err=unzlocal_GetCurrentFileInfoInternal(file,&s->cur_file_info,
+ &s->cur_file_info_internal,
+ NULL,0,NULL,0,NULL,0);
+ s->current_file_ok = (err == UNZ_OK);
+ return err;
+}
+
+
+/*
+ Set the current file of the zipfile to the next file.
+ return UNZ_OK if there is no problem
+ return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest.
+*/
+extern int ZEXPORT unzGoToNextFile (file)
+ unzFile file;
+{
+ unz_s* s;
+ int err;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_END_OF_LIST_OF_FILE;
+ if (s->num_file+1==s->gi.number_entry)
+ return UNZ_END_OF_LIST_OF_FILE;
+
+ s->pos_in_central_dir += SIZECENTRALDIRITEM + s->cur_file_info.size_filename +
+ s->cur_file_info.size_file_extra + s->cur_file_info.size_file_comment ;
+ s->num_file++;
+ err = unzlocal_GetCurrentFileInfoInternal(file,&s->cur_file_info,
+ &s->cur_file_info_internal,
+ NULL,0,NULL,0,NULL,0);
+ s->current_file_ok = (err == UNZ_OK);
+ return err;
+}
+
+
+/*
+ Try locate the file szFileName in the zipfile.
+ For the iCaseSensitivity signification, see unzipStringFileNameCompare
+
+ return value :
+ UNZ_OK if the file is found. It becomes the current file.
+ UNZ_END_OF_LIST_OF_FILE if the file is not found
+*/
+extern int ZEXPORT unzLocateFile (file, szFileName, iCaseSensitivity)
+ unzFile file;
+ const char *szFileName;
+ int iCaseSensitivity;
+{
+ unz_s* s;
+ int err;
+
+
+ uLong num_fileSaved;
+ uLong pos_in_central_dirSaved;
+
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+
+ if (strlen(szFileName)>=UNZ_MAXFILENAMEINZIP)
+ return UNZ_PARAMERROR;
+
+ s=(unz_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_END_OF_LIST_OF_FILE;
+
+ num_fileSaved = s->num_file;
+ pos_in_central_dirSaved = s->pos_in_central_dir;
+
+ err = unzGoToFirstFile(file);
+
+ while (err == UNZ_OK)
+ {
+ char szCurrentFileName[UNZ_MAXFILENAMEINZIP+1];
+ unzGetCurrentFileInfo(file,NULL,
+ szCurrentFileName,sizeof(szCurrentFileName)-1,
+ NULL,0,NULL,0);
+ if (unzStringFileNameCompare(szCurrentFileName,
+ szFileName,iCaseSensitivity)==0)
+ return UNZ_OK;
+ err = unzGoToNextFile(file);
+ }
+
+ s->num_file = num_fileSaved ;
+ s->pos_in_central_dir = pos_in_central_dirSaved ;
+ return err;
+}
+
+
+/*
+ Read the local header of the current zipfile
+ Check the coherency of the local header and info in the end of central
+ directory about this file
+ store in *piSizeVar the size of extra info in local header
+ (filename and size of extra field data)
+*/
+local int unzlocal_CheckCurrentFileCoherencyHeader (s,piSizeVar,
+ poffset_local_extrafield,
+ psize_local_extrafield)
+ unz_s* s;
+ uInt* piSizeVar;
+ uLong *poffset_local_extrafield;
+ uInt *psize_local_extrafield;
+{
+ uLong uMagic,uData,uFlags;
+ uLong size_filename;
+ uLong size_extra_field;
+ int err=UNZ_OK;
+
+ *piSizeVar = 0;
+ *poffset_local_extrafield = 0;
+ *psize_local_extrafield = 0;
+
+ if (fseek(s->file,s->cur_file_info_internal.offset_curfile +
+ s->byte_before_the_zipfile,SEEK_SET)!=0)
+ return UNZ_ERRNO;
+
+
+ if (err==UNZ_OK)
+ if (unzlocal_getLong(s->file,&uMagic) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if (uMagic!=0x04034b50)
+ err=UNZ_BADZIPFILE;
+
+ if (unzlocal_getShort(s->file,&uData) != UNZ_OK)
+ err=UNZ_ERRNO;
+/*
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.wVersion))
+ err=UNZ_BADZIPFILE;
+*/
+ if (unzlocal_getShort(s->file,&uFlags) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getShort(s->file,&uData) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compression_method))
+ err=UNZ_BADZIPFILE;
+
+ if ((err==UNZ_OK) && (s->cur_file_info.compression_method!=0) &&
+ (s->cur_file_info.compression_method!=Z_DEFLATED))
+ err=UNZ_BADZIPFILE;
+
+ if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* date/time */
+ err=UNZ_ERRNO;
+
+ if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* crc */
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.crc) &&
+ ((uFlags & 8)==0))
+ err=UNZ_BADZIPFILE;
+
+ if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* size compr */
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compressed_size) &&
+ ((uFlags & 8)==0))
+ err=UNZ_BADZIPFILE;
+
+ if (unzlocal_getLong(s->file,&uData) != UNZ_OK) /* size uncompr */
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.uncompressed_size) &&
+ ((uFlags & 8)==0))
+ err=UNZ_BADZIPFILE;
+
+
+ if (unzlocal_getShort(s->file,&size_filename) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (size_filename!=s->cur_file_info.size_filename))
+ err=UNZ_BADZIPFILE;
+
+ *piSizeVar += (uInt)size_filename;
+
+ if (unzlocal_getShort(s->file,&size_extra_field) != UNZ_OK)
+ err=UNZ_ERRNO;
+ *poffset_local_extrafield= s->cur_file_info_internal.offset_curfile +
+ SIZEZIPLOCALHEADER + size_filename;
+ *psize_local_extrafield = (uInt)size_extra_field;
+
+ *piSizeVar += (uInt)size_extra_field;
+
+ return err;
+}
+
+/*
+ Open for reading data the current file in the zipfile.
+ If there is no error and the file is opened, the return value is UNZ_OK.
+*/
+extern int ZEXPORT unzOpenCurrentFile (file)
+ unzFile file;
+{
+ int err=UNZ_OK;
+ int Store;
+ uInt iSizeVar;
+ unz_s* s;
+ file_in_zip_read_info_s* pfile_in_zip_read_info;
+ uLong offset_local_extrafield; /* offset of the local extra field */
+ uInt size_local_extrafield; /* size of the local extra field */
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_PARAMERROR;
+
+ if (s->pfile_in_zip_read != NULL)
+ unzCloseCurrentFile(file);
+
+ if (unzlocal_CheckCurrentFileCoherencyHeader(s,&iSizeVar,
+ &offset_local_extrafield,&size_local_extrafield)!=UNZ_OK)
+ return UNZ_BADZIPFILE;
+
+ pfile_in_zip_read_info = (file_in_zip_read_info_s*)
+ ALLOC(sizeof(file_in_zip_read_info_s));
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_INTERNALERROR;
+
+ pfile_in_zip_read_info->read_buffer=(char*)ALLOC(UNZ_BUFSIZE);
+ pfile_in_zip_read_info->offset_local_extrafield = offset_local_extrafield;
+ pfile_in_zip_read_info->size_local_extrafield = size_local_extrafield;
+ pfile_in_zip_read_info->pos_local_extrafield=0;
+
+ if (pfile_in_zip_read_info->read_buffer==NULL)
+ {
+ TRYFREE(pfile_in_zip_read_info);
+ return UNZ_INTERNALERROR;
+ }
+
+ pfile_in_zip_read_info->stream_initialised=0;
+
+ if ((s->cur_file_info.compression_method!=0) &&
+ (s->cur_file_info.compression_method!=Z_DEFLATED))
+ err=UNZ_BADZIPFILE;
+ Store = s->cur_file_info.compression_method==0;
+
+ pfile_in_zip_read_info->crc32_wait=s->cur_file_info.crc;
+ pfile_in_zip_read_info->crc32=0;
+ pfile_in_zip_read_info->compression_method =
+ s->cur_file_info.compression_method;
+ pfile_in_zip_read_info->file=s->file;
+ pfile_in_zip_read_info->byte_before_the_zipfile=s->byte_before_the_zipfile;
+
+ pfile_in_zip_read_info->stream.total_out = 0;
+
+ if (!Store)
+ {
+ pfile_in_zip_read_info->stream.zalloc = (alloc_func)0;
+ pfile_in_zip_read_info->stream.zfree = (free_func)0;
+ pfile_in_zip_read_info->stream.opaque = (voidpf)0;
+
+ err=inflateInit2(&pfile_in_zip_read_info->stream, -MAX_WBITS);
+ if (err == Z_OK)
+ pfile_in_zip_read_info->stream_initialised=1;
+ /* windowBits is passed < 0 to tell that there is no zlib header.
+ * Note that in this case inflate *requires* an extra "dummy" byte
+ * after the compressed stream in order to complete decompression and
+ * return Z_STREAM_END.
+ * In unzip, i don't wait absolutely Z_STREAM_END because I known the
+ * size of both compressed and uncompressed data
+ */
+ }
+ pfile_in_zip_read_info->rest_read_compressed =
+ s->cur_file_info.compressed_size ;
+ pfile_in_zip_read_info->rest_read_uncompressed =
+ s->cur_file_info.uncompressed_size ;
+
+
+ pfile_in_zip_read_info->pos_in_zipfile =
+ s->cur_file_info_internal.offset_curfile + SIZEZIPLOCALHEADER +
+ iSizeVar;
+
+ pfile_in_zip_read_info->stream.avail_in = (uInt)0;
+
+
+ s->pfile_in_zip_read = pfile_in_zip_read_info;
+ return UNZ_OK;
+}
+
+
+/*
+ Read bytes from the current file.
+ buf contain buffer where data must be copied
+ len the size of buf.
+
+ return the number of byte copied if somes bytes are copied
+ return 0 if the end of file was reached
+ return <0 with error code if there is an error
+ (UNZ_ERRNO for IO error, or zLib error for uncompress error)
+*/
+extern int ZEXPORT unzReadCurrentFile (file, buf, len)
+ unzFile file;
+ voidp buf;
+ unsigned len;
+{
+ int err=UNZ_OK;
+ uInt iRead = 0;
+ unz_s* s;
+ file_in_zip_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+
+ if ((pfile_in_zip_read_info->read_buffer == NULL))
+ return UNZ_END_OF_LIST_OF_FILE;
+ if (len==0)
+ return 0;
+
+ pfile_in_zip_read_info->stream.next_out = (Bytef*)buf;
+
+ pfile_in_zip_read_info->stream.avail_out = (uInt)len;
+
+ if (len>pfile_in_zip_read_info->rest_read_uncompressed)
+ pfile_in_zip_read_info->stream.avail_out =
+ (uInt)pfile_in_zip_read_info->rest_read_uncompressed;
+
+ while (pfile_in_zip_read_info->stream.avail_out>0)
+ {
+ if ((pfile_in_zip_read_info->stream.avail_in==0) &&
+ (pfile_in_zip_read_info->rest_read_compressed>0))
+ {
+ uInt uReadThis = UNZ_BUFSIZE;
+ if (pfile_in_zip_read_info->rest_read_compressed<uReadThis)
+ uReadThis = (uInt)pfile_in_zip_read_info->rest_read_compressed;
+ if (uReadThis == 0)
+ return UNZ_EOF;
+ if (fseek(pfile_in_zip_read_info->file,
+ pfile_in_zip_read_info->pos_in_zipfile +
+ pfile_in_zip_read_info->byte_before_the_zipfile,SEEK_SET)!=0)
+ return UNZ_ERRNO;
+ if (fread(pfile_in_zip_read_info->read_buffer,uReadThis,1,
+ pfile_in_zip_read_info->file)!=1)
+ return UNZ_ERRNO;
+ pfile_in_zip_read_info->pos_in_zipfile += uReadThis;
+
+ pfile_in_zip_read_info->rest_read_compressed-=uReadThis;
+
+ pfile_in_zip_read_info->stream.next_in =
+ (Bytef*)pfile_in_zip_read_info->read_buffer;
+ pfile_in_zip_read_info->stream.avail_in = (uInt)uReadThis;
+ }
+
+ if (pfile_in_zip_read_info->compression_method==0)
+ {
+ uInt uDoCopy,i ;
+ if (pfile_in_zip_read_info->stream.avail_out <
+ pfile_in_zip_read_info->stream.avail_in)
+ uDoCopy = pfile_in_zip_read_info->stream.avail_out ;
+ else
+ uDoCopy = pfile_in_zip_read_info->stream.avail_in ;
+
+ for (i=0;i<uDoCopy;i++)
+ *(pfile_in_zip_read_info->stream.next_out+i) =
+ *(pfile_in_zip_read_info->stream.next_in+i);
+
+ pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32,
+ pfile_in_zip_read_info->stream.next_out,
+ uDoCopy);
+ pfile_in_zip_read_info->rest_read_uncompressed-=uDoCopy;
+ pfile_in_zip_read_info->stream.avail_in -= uDoCopy;
+ pfile_in_zip_read_info->stream.avail_out -= uDoCopy;
+ pfile_in_zip_read_info->stream.next_out += uDoCopy;
+ pfile_in_zip_read_info->stream.next_in += uDoCopy;
+ pfile_in_zip_read_info->stream.total_out += uDoCopy;
+ iRead += uDoCopy;
+ }
+ else
+ {
+ uLong uTotalOutBefore,uTotalOutAfter;
+ const Bytef *bufBefore;
+ uLong uOutThis;
+ int flush=Z_SYNC_FLUSH;
+
+ uTotalOutBefore = pfile_in_zip_read_info->stream.total_out;
+ bufBefore = pfile_in_zip_read_info->stream.next_out;
+
+ /*
+ if ((pfile_in_zip_read_info->rest_read_uncompressed ==
+ pfile_in_zip_read_info->stream.avail_out) &&
+ (pfile_in_zip_read_info->rest_read_compressed == 0))
+ flush = Z_FINISH;
+ */
+ err=inflate(&pfile_in_zip_read_info->stream,flush);
+
+ uTotalOutAfter = pfile_in_zip_read_info->stream.total_out;
+ uOutThis = uTotalOutAfter-uTotalOutBefore;
+
+ pfile_in_zip_read_info->crc32 =
+ crc32(pfile_in_zip_read_info->crc32,bufBefore,
+ (uInt)(uOutThis));
+
+ pfile_in_zip_read_info->rest_read_uncompressed -=
+ uOutThis;
+
+ iRead += (uInt)(uTotalOutAfter - uTotalOutBefore);
+
+ if (err==Z_STREAM_END)
+ return (iRead==0) ? UNZ_EOF : iRead;
+ if (err!=Z_OK)
+ break;
+ }
+ }
+
+ if (err==Z_OK)
+ return iRead;
+ return err;
+}
+
+
+/*
+ Give the current position in uncompressed data
+*/
+extern z_off_t ZEXPORT unztell (file)
+ unzFile file;
+{
+ unz_s* s;
+ file_in_zip_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+ return (z_off_t)pfile_in_zip_read_info->stream.total_out;
+}
+
+
+/*
+ return 1 if the end of file was reached, 0 elsewhere
+*/
+extern int ZEXPORT unzeof (file)
+ unzFile file;
+{
+ unz_s* s;
+ file_in_zip_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+ if (pfile_in_zip_read_info->rest_read_uncompressed == 0)
+ return 1;
+ else
+ return 0;
+}
+
+
+
+/*
+ Read extra field from the current file (opened by unzOpenCurrentFile)
+ This is the local-header version of the extra field (sometimes, there is
+ more info in the local-header version than in the central-header)
+
+ if buf==NULL, it return the size of the local extra field that can be read
+
+ if buf!=NULL, len is the size of the buffer, the extra header is copied in
+ buf.
+ the return value is the number of bytes copied in buf, or (if <0)
+ the error code
+*/
+extern int ZEXPORT unzGetLocalExtrafield (file,buf,len)
+ unzFile file;
+ voidp buf;
+ unsigned len;
+{
+ unz_s* s;
+ file_in_zip_read_info_s* pfile_in_zip_read_info;
+ uInt read_now;
+ uLong size_to_read;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+ size_to_read = (pfile_in_zip_read_info->size_local_extrafield -
+ pfile_in_zip_read_info->pos_local_extrafield);
+
+ if (buf==NULL)
+ return (int)size_to_read;
+
+ if (len>size_to_read)
+ read_now = (uInt)size_to_read;
+ else
+ read_now = (uInt)len ;
+
+ if (read_now==0)
+ return 0;
+
+ if (fseek(pfile_in_zip_read_info->file,
+ pfile_in_zip_read_info->offset_local_extrafield +
+ pfile_in_zip_read_info->pos_local_extrafield,SEEK_SET)!=0)
+ return UNZ_ERRNO;
+
+ if (fread(buf,(uInt)size_to_read,1,pfile_in_zip_read_info->file)!=1)
+ return UNZ_ERRNO;
+
+ return (int)read_now;
+}
+
+/*
+ Close the file in zip opened with unzipOpenCurrentFile
+ Return UNZ_CRCERROR if all the file was read but the CRC is not good
+*/
+extern int ZEXPORT unzCloseCurrentFile (file)
+ unzFile file;
+{
+ int err=UNZ_OK;
+
+ unz_s* s;
+ file_in_zip_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+
+ if (pfile_in_zip_read_info->rest_read_uncompressed == 0)
+ {
+ if (pfile_in_zip_read_info->crc32 != pfile_in_zip_read_info->crc32_wait)
+ err=UNZ_CRCERROR;
+ }
+
+
+ TRYFREE(pfile_in_zip_read_info->read_buffer);
+ pfile_in_zip_read_info->read_buffer = NULL;
+ if (pfile_in_zip_read_info->stream_initialised)
+ inflateEnd(&pfile_in_zip_read_info->stream);
+
+ pfile_in_zip_read_info->stream_initialised = 0;
+ TRYFREE(pfile_in_zip_read_info);
+
+ s->pfile_in_zip_read=NULL;
+
+ return err;
+}
+
+
+/*
+ Get the global comment string of the ZipFile, in the szComment buffer.
+ uSizeBuf is the size of the szComment buffer.
+ return the number of byte copied or an error code <0
+*/
+extern int ZEXPORT unzGetGlobalComment (file, szComment, uSizeBuf)
+ unzFile file;
+ char *szComment;
+ uLong uSizeBuf;
+{
+ int err=UNZ_OK;
+ unz_s* s;
+ uLong uReadThis ;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz_s*)file;
+
+ uReadThis = uSizeBuf;
+ if (uReadThis>s->gi.size_comment)
+ uReadThis = s->gi.size_comment;
+
+ if (fseek(s->file,s->central_pos+22,SEEK_SET)!=0)
+ return UNZ_ERRNO;
+
+ if (uReadThis>0)
+ {
+ *szComment='\0';
+ if (fread(szComment,(uInt)uReadThis,1,s->file)!=1)
+ return UNZ_ERRNO;
+ }
+
+ if ((szComment != NULL) && (uSizeBuf > s->gi.size_comment))
+ *(szComment+s->gi.size_comment)='\0';
+ return (int)uReadThis;
+}
--- /dev/null
+ unzOpen @61
+ unzClose @62
+ unzGetGlobalInfo @63
+ unzGetCurrentFileInfo @64
+ unzGoToFirstFile @65
+ unzGoToNextFile @66
+ unzOpenCurrentFile @67
+ unzReadCurrentFile @68
+ unztell @70
+ unzeof @71
+ unzCloseCurrentFile @72
+ unzGetGlobalComment @73
+ unzStringFileNameCompare @74
+ unzLocateFile @75
+ unzGetLocalExtrafield @76
--- /dev/null
+/* unzip.h -- IO for uncompress .zip files using zlib
+ Version 0.15 beta, Mar 19th, 1998,
+
+ Copyright (C) 1998 Gilles Vollant
+
+ This unzip package allow extract file from .ZIP file, compatible with PKZip 2.04g
+ WinZip, InfoZip tools and compatible.
+ Encryption and multi volume ZipFile (span) are not supported.
+ Old compressions used by old PKZip 1.x are not supported
+
+ THIS IS AN ALPHA VERSION. AT THIS STAGE OF DEVELOPPEMENT, SOMES API OR STRUCTURE
+ CAN CHANGE IN FUTURE VERSION !!
+ I WAIT FEEDBACK at mail info@winimage.com
+ Visit also http://www.winimage.com/zLibDll/unzip.htm for evolution
+
+ Condition of use and distribution are the same than zlib :
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+
+*/
+/* for more info about .ZIP format, see
+ ftp://ftp.cdrom.com/pub/infozip/doc/appnote-970311-iz.zip
+ PkWare has also a specification at :
+ ftp://ftp.pkware.com/probdesc.zip */
+
+#ifndef _unz_H
+#define _unz_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#ifndef _ZLIB_H
+#include "zlib.h"
+#endif
+
+#if defined(STRICTUNZIP) || defined(STRICTZIPUNZIP)
+/* like the STRICT of WIN32, we define a pointer that cannot be converted
+ from (void*) without cast */
+typedef struct TagunzFile__ { int unused; } unzFile__;
+typedef unzFile__ *unzFile;
+#else
+typedef voidp unzFile;
+#endif
+
+
+#define UNZ_OK (0)
+#define UNZ_END_OF_LIST_OF_FILE (-100)
+#define UNZ_ERRNO (Z_ERRNO)
+#define UNZ_EOF (0)
+#define UNZ_PARAMERROR (-102)
+#define UNZ_BADZIPFILE (-103)
+#define UNZ_INTERNALERROR (-104)
+#define UNZ_CRCERROR (-105)
+
+/* tm_unz contain date/time info */
+typedef struct tm_unz_s
+{
+ uInt tm_sec; /* seconds after the minute - [0,59] */
+ uInt tm_min; /* minutes after the hour - [0,59] */
+ uInt tm_hour; /* hours since midnight - [0,23] */
+ uInt tm_mday; /* day of the month - [1,31] */
+ uInt tm_mon; /* months since January - [0,11] */
+ uInt tm_year; /* years - [1980..2044] */
+} tm_unz;
+
+/* unz_global_info structure contain global data about the ZIPfile
+ These data comes from the end of central dir */
+typedef struct unz_global_info_s
+{
+ uLong number_entry; /* total number of entries in
+ the central dir on this disk */
+ uLong size_comment; /* size of the global comment of the zipfile */
+} unz_global_info;
+
+
+/* unz_file_info contain information about a file in the zipfile */
+typedef struct unz_file_info_s
+{
+ uLong version; /* version made by 2 bytes */
+ uLong version_needed; /* version needed to extract 2 bytes */
+ uLong flag; /* general purpose bit flag 2 bytes */
+ uLong compression_method; /* compression method 2 bytes */
+ uLong dosDate; /* last mod file date in Dos fmt 4 bytes */
+ uLong crc; /* crc-32 4 bytes */
+ uLong compressed_size; /* compressed size 4 bytes */
+ uLong uncompressed_size; /* uncompressed size 4 bytes */
+ uLong size_filename; /* filename length 2 bytes */
+ uLong size_file_extra; /* extra field length 2 bytes */
+ uLong size_file_comment; /* file comment length 2 bytes */
+
+ uLong disk_num_start; /* disk number start 2 bytes */
+ uLong internal_fa; /* internal file attributes 2 bytes */
+ uLong external_fa; /* external file attributes 4 bytes */
+
+ tm_unz tmu_date;
+} unz_file_info;
+
+extern int ZEXPORT unzStringFileNameCompare OF ((const char* fileName1,
+ const char* fileName2,
+ int iCaseSensitivity));
+/*
+ Compare two filename (fileName1,fileName2).
+ If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp)
+ If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi
+ or strcasecmp)
+ If iCaseSenisivity = 0, case sensitivity is defaut of your operating system
+ (like 1 on Unix, 2 on Windows)
+*/
+
+
+extern unzFile ZEXPORT unzOpen OF((const char *path));
+/*
+ Open a Zip file. path contain the full pathname (by example,
+ on a Windows NT computer "c:\\zlib\\zlib111.zip" or on an Unix computer
+ "zlib/zlib111.zip".
+ If the zipfile cannot be opened (file don't exist or in not valid), the
+ return value is NULL.
+ Else, the return value is a unzFile Handle, usable with other function
+ of this unzip package.
+*/
+
+extern int ZEXPORT unzClose OF((unzFile file));
+/*
+ Close a ZipFile opened with unzipOpen.
+ If there is files inside the .Zip opened with unzOpenCurrentFile (see later),
+ these files MUST be closed with unzipCloseCurrentFile before call unzipClose.
+ return UNZ_OK if there is no problem. */
+
+extern int ZEXPORT unzGetGlobalInfo OF((unzFile file,
+ unz_global_info *pglobal_info));
+/*
+ Write info about the ZipFile in the *pglobal_info structure.
+ No preparation of the structure is needed
+ return UNZ_OK if there is no problem. */
+
+
+extern int ZEXPORT unzGetGlobalComment OF((unzFile file,
+ char *szComment,
+ uLong uSizeBuf));
+/*
+ Get the global comment string of the ZipFile, in the szComment buffer.
+ uSizeBuf is the size of the szComment buffer.
+ return the number of byte copied or an error code <0
+*/
+
+
+/***************************************************************************/
+/* Unzip package allow you browse the directory of the zipfile */
+
+extern int ZEXPORT unzGoToFirstFile OF((unzFile file));
+/*
+ Set the current file of the zipfile to the first file.
+ return UNZ_OK if there is no problem
+*/
+
+extern int ZEXPORT unzGoToNextFile OF((unzFile file));
+/*
+ Set the current file of the zipfile to the next file.
+ return UNZ_OK if there is no problem
+ return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest.
+*/
+
+extern int ZEXPORT unzLocateFile OF((unzFile file,
+ const char *szFileName,
+ int iCaseSensitivity));
+/*
+ Try locate the file szFileName in the zipfile.
+ For the iCaseSensitivity signification, see unzStringFileNameCompare
+
+ return value :
+ UNZ_OK if the file is found. It becomes the current file.
+ UNZ_END_OF_LIST_OF_FILE if the file is not found
+*/
+
+
+extern int ZEXPORT unzGetCurrentFileInfo OF((unzFile file,
+ unz_file_info *pfile_info,
+ char *szFileName,
+ uLong fileNameBufferSize,
+ void *extraField,
+ uLong extraFieldBufferSize,
+ char *szComment,
+ uLong commentBufferSize));
+/*
+ Get Info about the current file
+ if pfile_info!=NULL, the *pfile_info structure will contain somes info about
+ the current file
+ if szFileName!=NULL, the filemane string will be copied in szFileName
+ (fileNameBufferSize is the size of the buffer)
+ if extraField!=NULL, the extra field information will be copied in extraField
+ (extraFieldBufferSize is the size of the buffer).
+ This is the Central-header version of the extra field
+ if szComment!=NULL, the comment string of the file will be copied in szComment
+ (commentBufferSize is the size of the buffer)
+*/
+
+/***************************************************************************/
+/* for reading the content of the current zipfile, you can open it, read data
+ from it, and close it (you can close it before reading all the file)
+ */
+
+extern int ZEXPORT unzOpenCurrentFile OF((unzFile file));
+/*
+ Open for reading data the current file in the zipfile.
+ If there is no error, the return value is UNZ_OK.
+*/
+
+extern int ZEXPORT unzCloseCurrentFile OF((unzFile file));
+/*
+ Close the file in zip opened with unzOpenCurrentFile
+ Return UNZ_CRCERROR if all the file was read but the CRC is not good
+*/
+
+
+extern int ZEXPORT unzReadCurrentFile OF((unzFile file,
+ voidp buf,
+ unsigned len));
+/*
+ Read bytes from the current file (opened by unzOpenCurrentFile)
+ buf contain buffer where data must be copied
+ len the size of buf.
+
+ return the number of byte copied if somes bytes are copied
+ return 0 if the end of file was reached
+ return <0 with error code if there is an error
+ (UNZ_ERRNO for IO error, or zLib error for uncompress error)
+*/
+
+extern z_off_t ZEXPORT unztell OF((unzFile file));
+/*
+ Give the current position in uncompressed data
+*/
+
+extern int ZEXPORT unzeof OF((unzFile file));
+/*
+ return 1 if the end of file was reached, 0 elsewhere
+*/
+
+extern int ZEXPORT unzGetLocalExtrafield OF((unzFile file,
+ voidp buf,
+ unsigned len));
+/*
+ Read extra field from the current file (opened by unzOpenCurrentFile)
+ This is the local-header version of the extra field (sometimes, there is
+ more info in the local-header version than in the central-header)
+
+ if buf==NULL, it return the size of the local extra field
+
+ if buf!=NULL, len is the size of the buffer, the extra header is copied in
+ buf.
+ the return value is the number of bytes copied in buf, or (if <0)
+ the error code
+*/
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* _unz_H */
--- /dev/null
+/* zip.c -- IO on .zip files using zlib
+ Version 0.15 beta, Mar 19th, 1998,
+
+ Read zip.h for more info
+*/
+
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include "zlib.h"
+#include "zip.h"
+
+#ifdef STDC
+# include <stddef.h>
+# include <string.h>
+# include <stdlib.h>
+#endif
+#ifdef NO_ERRNO_H
+ extern int errno;
+#else
+# include <errno.h>
+#endif
+
+
+#ifndef local
+# define local static
+#endif
+/* compile with -Dlocal if your debugger can't find static symbols */
+
+#ifndef VERSIONMADEBY
+# define VERSIONMADEBY (0x0) /* platform depedent */
+#endif
+
+#ifndef Z_BUFSIZE
+#define Z_BUFSIZE (16384)
+#endif
+
+#ifndef Z_MAXFILENAMEINZIP
+#define Z_MAXFILENAMEINZIP (256)
+#endif
+
+#ifndef ALLOC
+# define ALLOC(size) (malloc(size))
+#endif
+#ifndef TRYFREE
+# define TRYFREE(p) {if (p) free(p);}
+#endif
+
+/*
+#define SIZECENTRALDIRITEM (0x2e)
+#define SIZEZIPLOCALHEADER (0x1e)
+*/
+
+/* I've found an old Unix (a SunOS 4.1.3_U1) without all SEEK_* defined.... */
+
+#ifndef SEEK_CUR
+#define SEEK_CUR 1
+#endif
+
+#ifndef SEEK_END
+#define SEEK_END 2
+#endif
+
+#ifndef SEEK_SET
+#define SEEK_SET 0
+#endif
+
+const char zip_copyright[] =
+ " zip 0.15 Copyright 1998 Gilles Vollant ";
+
+
+#define SIZEDATA_INDATABLOCK (4096-(4*4))
+
+#define LOCALHEADERMAGIC (0x04034b50)
+#define CENTRALHEADERMAGIC (0x02014b50)
+#define ENDHEADERMAGIC (0x06054b50)
+
+#define FLAG_LOCALHEADER_OFFSET (0x06)
+#define CRC_LOCALHEADER_OFFSET (0x0e)
+
+#define SIZECENTRALHEADER (0x2e) /* 46 */
+
+typedef struct linkedlist_datablock_internal_s
+{
+ struct linkedlist_datablock_internal_s* next_datablock;
+ uLong avail_in_this_block;
+ uLong filled_in_this_block;
+ uLong unused; /* for future use and alignement */
+ unsigned char data[SIZEDATA_INDATABLOCK];
+} linkedlist_datablock_internal;
+
+typedef struct linkedlist_data_s
+{
+ linkedlist_datablock_internal* first_block;
+ linkedlist_datablock_internal* last_block;
+} linkedlist_data;
+
+
+typedef struct
+{
+ z_stream stream; /* zLib stream structure for inflate */
+ int stream_initialised; /* 1 is stream is initialised */
+ uInt pos_in_buffered_data; /* last written byte in buffered_data */
+
+ uLong pos_local_header; /* offset of the local header of the file
+ currenty writing */
+ char* central_header; /* central header data for the current file */
+ uLong size_centralheader; /* size of the central header for cur file */
+ uLong flag; /* flag of the file currently writing */
+
+ int method; /* compression method of file currenty wr.*/
+ Byte buffered_data[Z_BUFSIZE];/* buffer contain compressed data to be writ*/
+ uLong dosDate;
+ uLong crc32;
+} curfile_info;
+
+typedef struct
+{
+ FILE * filezip;
+ linkedlist_data central_dir;/* datablock with central dir in construction*/
+ int in_opened_file_inzip; /* 1 if a file in the zip is currently writ.*/
+ curfile_info ci; /* info on the file curretly writing */
+
+ uLong begin_pos; /* position of the beginning of the zipfile */
+ uLong number_entry;
+} zip_internal;
+
+local linkedlist_datablock_internal* allocate_new_datablock()
+{
+ linkedlist_datablock_internal* ldi;
+ ldi = (linkedlist_datablock_internal*)
+ ALLOC(sizeof(linkedlist_datablock_internal));
+ if (ldi!=NULL)
+ {
+ ldi->next_datablock = NULL ;
+ ldi->filled_in_this_block = 0 ;
+ ldi->avail_in_this_block = SIZEDATA_INDATABLOCK ;
+ }
+ return ldi;
+}
+
+local void free_datablock(ldi)
+ linkedlist_datablock_internal* ldi;
+{
+ while (ldi!=NULL)
+ {
+ linkedlist_datablock_internal* ldinext = ldi->next_datablock;
+ TRYFREE(ldi);
+ ldi = ldinext;
+ }
+}
+
+local void init_linkedlist(ll)
+ linkedlist_data* ll;
+{
+ ll->first_block = ll->last_block = NULL;
+}
+
+local void free_linkedlist(ll)
+ linkedlist_data* ll;
+{
+ free_datablock(ll->first_block);
+ ll->first_block = ll->last_block = NULL;
+}
+
+
+local int add_data_in_datablock(ll,buf,len)
+ linkedlist_data* ll;
+ const void* buf;
+ uLong len;
+{
+ linkedlist_datablock_internal* ldi;
+ const unsigned char* from_copy;
+
+ if (ll==NULL)
+ return ZIP_INTERNALERROR;
+
+ if (ll->last_block == NULL)
+ {
+ ll->first_block = ll->last_block = allocate_new_datablock();
+ if (ll->first_block == NULL)
+ return ZIP_INTERNALERROR;
+ }
+
+ ldi = ll->last_block;
+ from_copy = (unsigned char*)buf;
+
+ while (len>0)
+ {
+ uInt copy_this;
+ uInt i;
+ unsigned char* to_copy;
+
+ if (ldi->avail_in_this_block==0)
+ {
+ ldi->next_datablock = allocate_new_datablock();
+ if (ldi->next_datablock == NULL)
+ return ZIP_INTERNALERROR;
+ ldi = ldi->next_datablock ;
+ ll->last_block = ldi;
+ }
+
+ if (ldi->avail_in_this_block < len)
+ copy_this = (uInt)ldi->avail_in_this_block;
+ else
+ copy_this = (uInt)len;
+
+ to_copy = &(ldi->data[ldi->filled_in_this_block]);
+
+ for (i=0;i<copy_this;i++)
+ *(to_copy+i)=*(from_copy+i);
+
+ ldi->filled_in_this_block += copy_this;
+ ldi->avail_in_this_block -= copy_this;
+ from_copy += copy_this ;
+ len -= copy_this;
+ }
+ return ZIP_OK;
+}
+
+
+local int write_datablock(fout,ll)
+ FILE * fout;
+ linkedlist_data* ll;
+{
+ linkedlist_datablock_internal* ldi;
+ ldi = ll->first_block;
+ while (ldi!=NULL)
+ {
+ if (ldi->filled_in_this_block > 0)
+ if (fwrite(ldi->data,(uInt)ldi->filled_in_this_block,1,fout)!=1)
+ return ZIP_ERRNO;
+ ldi = ldi->next_datablock;
+ }
+ return ZIP_OK;
+}
+
+/****************************************************************************/
+
+/* ===========================================================================
+ Outputs a long in LSB order to the given file
+ nbByte == 1, 2 or 4 (byte, short or long)
+*/
+
+local int ziplocal_putValue OF((FILE *file, uLong x, int nbByte));
+local int ziplocal_putValue (file, x, nbByte)
+ FILE *file;
+ uLong x;
+ int nbByte;
+{
+ unsigned char buf[4];
+ int n;
+ for (n = 0; n < nbByte; n++) {
+ buf[n] = (unsigned char)(x & 0xff);
+ x >>= 8;
+ }
+ if (fwrite(buf,nbByte,1,file)!=1)
+ return ZIP_ERRNO;
+ else
+ return ZIP_OK;
+}
+
+local void ziplocal_putValue_inmemory OF((void* dest, uLong x, int nbByte));
+local void ziplocal_putValue_inmemory (dest, x, nbByte)
+ void* dest;
+ uLong x;
+ int nbByte;
+{
+ unsigned char* buf=(unsigned char*)dest;
+ int n;
+ for (n = 0; n < nbByte; n++) {
+ buf[n] = (unsigned char)(x & 0xff);
+ x >>= 8;
+ }
+}
+/****************************************************************************/
+
+
+local uLong ziplocal_TmzDateToDosDate(ptm,dosDate)
+ tm_zip* ptm;
+ uLong dosDate;
+{
+ uLong year = (uLong)ptm->tm_year;
+ if (year>1980)
+ year-=1980;
+ else if (year>80)
+ year-=80;
+ return
+ (uLong) (((ptm->tm_mday) + (32 * (ptm->tm_mon+1)) + (512 * year)) << 16) |
+ ((ptm->tm_sec/2) + (32* ptm->tm_min) + (2048 * (uLong)ptm->tm_hour));
+}
+
+
+/****************************************************************************/
+
+extern zipFile ZEXPORT zipOpen (pathname, append)
+ const char *pathname;
+ int append;
+{
+ zip_internal ziinit;
+ zip_internal* zi;
+
+ ziinit.filezip = fopen(pathname,(append == 0) ? "wb" : "ab");
+ if (ziinit.filezip == NULL)
+ return NULL;
+ ziinit.begin_pos = ftell(ziinit.filezip);
+ ziinit.in_opened_file_inzip = 0;
+ ziinit.ci.stream_initialised = 0;
+ ziinit.number_entry = 0;
+ init_linkedlist(&(ziinit.central_dir));
+
+
+ zi = (zip_internal*)ALLOC(sizeof(zip_internal));
+ if (zi==NULL)
+ {
+ fclose(ziinit.filezip);
+ return NULL;
+ }
+
+ *zi = ziinit;
+ return (zipFile)zi;
+}
+
+extern int ZEXPORT zipOpenNewFileInZip (file, filename, zipfi,
+ extrafield_local, size_extrafield_local,
+ extrafield_global, size_extrafield_global,
+ comment, method, level)
+ zipFile file;
+ const char* filename;
+ const zip_fileinfo* zipfi;
+ const void* extrafield_local;
+ uInt size_extrafield_local;
+ const void* extrafield_global;
+ uInt size_extrafield_global;
+ const char* comment;
+ int method;
+ int level;
+{
+ zip_internal* zi;
+ uInt size_filename;
+ uInt size_comment;
+ uInt i;
+ int err = ZIP_OK;
+
+ if (file == NULL)
+ return ZIP_PARAMERROR;
+ if ((method!=0) && (method!=Z_DEFLATED))
+ return ZIP_PARAMERROR;
+
+ zi = (zip_internal*)file;
+
+ if (zi->in_opened_file_inzip == 1)
+ {
+ err = zipCloseFileInZip (file);
+ if (err != ZIP_OK)
+ return err;
+ }
+
+
+ if (filename==NULL)
+ filename="-";
+
+ if (comment==NULL)
+ size_comment = 0;
+ else
+ size_comment = strlen(comment);
+
+ size_filename = strlen(filename);
+
+ if (zipfi == NULL)
+ zi->ci.dosDate = 0;
+ else
+ {
+ if (zipfi->dosDate != 0)
+ zi->ci.dosDate = zipfi->dosDate;
+ else zi->ci.dosDate = ziplocal_TmzDateToDosDate(&zipfi->tmz_date,zipfi->dosDate);
+ }
+
+ zi->ci.flag = 0;
+ if ((level==8) || (level==9))
+ zi->ci.flag |= 2;
+ if ((level==2))
+ zi->ci.flag |= 4;
+ if ((level==1))
+ zi->ci.flag |= 6;
+
+ zi->ci.crc32 = 0;
+ zi->ci.method = method;
+ zi->ci.stream_initialised = 0;
+ zi->ci.pos_in_buffered_data = 0;
+ zi->ci.pos_local_header = ftell(zi->filezip);
+ zi->ci.size_centralheader = SIZECENTRALHEADER + size_filename +
+ size_extrafield_global + size_comment;
+ zi->ci.central_header = (char*)ALLOC((uInt)zi->ci.size_centralheader);
+
+ ziplocal_putValue_inmemory(zi->ci.central_header,(uLong)CENTRALHEADERMAGIC,4);
+ /* version info */
+ ziplocal_putValue_inmemory(zi->ci.central_header+4,(uLong)VERSIONMADEBY,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+6,(uLong)20,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+8,(uLong)zi->ci.flag,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+10,(uLong)zi->ci.method,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+12,(uLong)zi->ci.dosDate,4);
+ ziplocal_putValue_inmemory(zi->ci.central_header+16,(uLong)0,4); /*crc*/
+ ziplocal_putValue_inmemory(zi->ci.central_header+20,(uLong)0,4); /*compr size*/
+ ziplocal_putValue_inmemory(zi->ci.central_header+24,(uLong)0,4); /*uncompr size*/
+ ziplocal_putValue_inmemory(zi->ci.central_header+28,(uLong)size_filename,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+30,(uLong)size_extrafield_global,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+32,(uLong)size_comment,2);
+ ziplocal_putValue_inmemory(zi->ci.central_header+34,(uLong)0,2); /*disk nm start*/
+
+ if (zipfi==NULL)
+ ziplocal_putValue_inmemory(zi->ci.central_header+36,(uLong)0,2);
+ else
+ ziplocal_putValue_inmemory(zi->ci.central_header+36,(uLong)zipfi->internal_fa,2);
+
+ if (zipfi==NULL)
+ ziplocal_putValue_inmemory(zi->ci.central_header+38,(uLong)0,4);
+ else
+ ziplocal_putValue_inmemory(zi->ci.central_header+38,(uLong)zipfi->external_fa,4);
+
+ ziplocal_putValue_inmemory(zi->ci.central_header+42,(uLong)zi->ci.pos_local_header,4);
+
+ for (i=0;i<size_filename;i++)
+ *(zi->ci.central_header+SIZECENTRALHEADER+i) = *(filename+i);
+
+ for (i=0;i<size_extrafield_global;i++)
+ *(zi->ci.central_header+SIZECENTRALHEADER+size_filename+i) =
+ *(((const char*)extrafield_global)+i);
+
+ for (i=0;i<size_comment;i++)
+ *(zi->ci.central_header+SIZECENTRALHEADER+size_filename+
+ size_extrafield_global+i) = *(filename+i);
+ if (zi->ci.central_header == NULL)
+ return ZIP_INTERNALERROR;
+
+ /* write the local header */
+ err = ziplocal_putValue(zi->filezip,(uLong)LOCALHEADERMAGIC,4);
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)20,2);/* version needed to extract */
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.flag,2);
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.method,2);
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.dosDate,4);
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)0,4); /* crc 32, unknown */
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)0,4); /* compressed size, unknown */
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)0,4); /* uncompressed size, unknown */
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)size_filename,2);
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)size_extrafield_local,2);
+
+ if ((err==ZIP_OK) && (size_filename>0))
+ if (fwrite(filename,(uInt)size_filename,1,zi->filezip)!=1)
+ err = ZIP_ERRNO;
+
+ if ((err==ZIP_OK) && (size_extrafield_local>0))
+ if (fwrite(extrafield_local,(uInt)size_extrafield_local,1,zi->filezip)
+ !=1)
+ err = ZIP_ERRNO;
+
+ zi->ci.stream.avail_in = (uInt)0;
+ zi->ci.stream.avail_out = (uInt)Z_BUFSIZE;
+ zi->ci.stream.next_out = zi->ci.buffered_data;
+ zi->ci.stream.total_in = 0;
+ zi->ci.stream.total_out = 0;
+
+ if ((err==ZIP_OK) && (zi->ci.method == Z_DEFLATED))
+ {
+ zi->ci.stream.zalloc = (alloc_func)0;
+ zi->ci.stream.zfree = (free_func)0;
+ zi->ci.stream.opaque = (voidpf)0;
+
+ err = deflateInit2(&zi->ci.stream, level,
+ Z_DEFLATED, -MAX_WBITS, DEF_MEM_LEVEL, 0);
+
+ if (err==Z_OK)
+ zi->ci.stream_initialised = 1;
+ }
+
+
+ if (err==Z_OK)
+ zi->in_opened_file_inzip = 1;
+ return err;
+}
+
+extern int ZEXPORT zipWriteInFileInZip (file, buf, len)
+ zipFile file;
+ const voidp buf;
+ unsigned len;
+{
+ zip_internal* zi;
+ int err=ZIP_OK;
+
+ if (file == NULL)
+ return ZIP_PARAMERROR;
+ zi = (zip_internal*)file;
+
+ if (zi->in_opened_file_inzip == 0)
+ return ZIP_PARAMERROR;
+
+ zi->ci.stream.next_in = buf;
+ zi->ci.stream.avail_in = len;
+ zi->ci.crc32 = crc32(zi->ci.crc32,buf,len);
+
+ while ((err==ZIP_OK) && (zi->ci.stream.avail_in>0))
+ {
+ if (zi->ci.stream.avail_out == 0)
+ {
+ if (fwrite(zi->ci.buffered_data,(uInt)zi->ci.pos_in_buffered_data,1,zi->filezip)
+ !=1)
+ err = ZIP_ERRNO;
+ zi->ci.pos_in_buffered_data = 0;
+ zi->ci.stream.avail_out = (uInt)Z_BUFSIZE;
+ zi->ci.stream.next_out = zi->ci.buffered_data;
+ }
+
+ if (zi->ci.method == Z_DEFLATED)
+ {
+ uLong uTotalOutBefore = zi->ci.stream.total_out;
+ err=deflate(&zi->ci.stream, Z_NO_FLUSH);
+ zi->ci.pos_in_buffered_data += (uInt)(zi->ci.stream.total_out - uTotalOutBefore) ;
+
+ }
+ else
+ {
+ uInt copy_this,i;
+ if (zi->ci.stream.avail_in < zi->ci.stream.avail_out)
+ copy_this = zi->ci.stream.avail_in;
+ else
+ copy_this = zi->ci.stream.avail_out;
+ for (i=0;i<copy_this;i++)
+ *(((char*)zi->ci.stream.next_out)+i) =
+ *(((const char*)zi->ci.stream.next_in)+i);
+ {
+ zi->ci.stream.avail_in -= copy_this;
+ zi->ci.stream.avail_out-= copy_this;
+ zi->ci.stream.next_in+= copy_this;
+ zi->ci.stream.next_out+= copy_this;
+ zi->ci.stream.total_in+= copy_this;
+ zi->ci.stream.total_out+= copy_this;
+ zi->ci.pos_in_buffered_data += copy_this;
+ }
+ }
+ }
+
+ return 0;
+}
+
+extern int ZEXPORT zipCloseFileInZip (file)
+ zipFile file;
+{
+ zip_internal* zi;
+ int err=ZIP_OK;
+
+ if (file == NULL)
+ return ZIP_PARAMERROR;
+ zi = (zip_internal*)file;
+
+ if (zi->in_opened_file_inzip == 0)
+ return ZIP_PARAMERROR;
+ zi->ci.stream.avail_in = 0;
+
+ if (zi->ci.method == Z_DEFLATED)
+ while (err==ZIP_OK)
+ {
+ uLong uTotalOutBefore;
+ if (zi->ci.stream.avail_out == 0)
+ {
+ if (fwrite(zi->ci.buffered_data,(uInt)zi->ci.pos_in_buffered_data,1,zi->filezip)
+ !=1)
+ err = ZIP_ERRNO;
+ zi->ci.pos_in_buffered_data = 0;
+ zi->ci.stream.avail_out = (uInt)Z_BUFSIZE;
+ zi->ci.stream.next_out = zi->ci.buffered_data;
+ }
+ uTotalOutBefore = zi->ci.stream.total_out;
+ err=deflate(&zi->ci.stream, Z_FINISH);
+ zi->ci.pos_in_buffered_data += (uInt)(zi->ci.stream.total_out - uTotalOutBefore) ;
+ }
+
+ if (err==Z_STREAM_END)
+ err=ZIP_OK; /* this is normal */
+
+ if ((zi->ci.pos_in_buffered_data>0) && (err==ZIP_OK))
+ if (fwrite(zi->ci.buffered_data,(uInt)zi->ci.pos_in_buffered_data,1,zi->filezip)
+ !=1)
+ err = ZIP_ERRNO;
+
+ if ((zi->ci.method == Z_DEFLATED) && (err==ZIP_OK))
+ {
+ err=deflateEnd(&zi->ci.stream);
+ zi->ci.stream_initialised = 0;
+ }
+
+ ziplocal_putValue_inmemory(zi->ci.central_header+16,(uLong)zi->ci.crc32,4); /*crc*/
+ ziplocal_putValue_inmemory(zi->ci.central_header+20,
+ (uLong)zi->ci.stream.total_out,4); /*compr size*/
+ ziplocal_putValue_inmemory(zi->ci.central_header+24,
+ (uLong)zi->ci.stream.total_in,4); /*uncompr size*/
+
+ if (err==ZIP_OK)
+ err = add_data_in_datablock(&zi->central_dir,zi->ci.central_header,
+ (uLong)zi->ci.size_centralheader);
+ free(zi->ci.central_header);
+
+ if (err==ZIP_OK)
+ {
+ long cur_pos_inzip = ftell(zi->filezip);
+ if (fseek(zi->filezip,
+ zi->ci.pos_local_header + 14,SEEK_SET)!=0)
+ err = ZIP_ERRNO;
+
+ if (err==ZIP_OK)
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.crc32,4); /* crc 32, unknown */
+
+ if (err==ZIP_OK) /* compressed size, unknown */
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.stream.total_out,4);
+
+ if (err==ZIP_OK) /* uncompressed size, unknown */
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->ci.stream.total_in,4);
+
+ if (fseek(zi->filezip,
+ cur_pos_inzip,SEEK_SET)!=0)
+ err = ZIP_ERRNO;
+ }
+
+ zi->number_entry ++;
+ zi->in_opened_file_inzip = 0;
+
+ return err;
+}
+
+extern int ZEXPORT zipClose (file, global_comment)
+ zipFile file;
+ const char* global_comment;
+{
+ zip_internal* zi;
+ int err = 0;
+ uLong size_centraldir = 0;
+ uLong centraldir_pos_inzip ;
+ uInt size_global_comment;
+ if (file == NULL)
+ return ZIP_PARAMERROR;
+ zi = (zip_internal*)file;
+
+ if (zi->in_opened_file_inzip == 1)
+ {
+ err = zipCloseFileInZip (file);
+ }
+
+ if (global_comment==NULL)
+ size_global_comment = 0;
+ else
+ size_global_comment = strlen(global_comment);
+
+
+ centraldir_pos_inzip = ftell(zi->filezip);
+ if (err==ZIP_OK)
+ {
+ linkedlist_datablock_internal* ldi = zi->central_dir.first_block ;
+ while (ldi!=NULL)
+ {
+ if ((err==ZIP_OK) && (ldi->filled_in_this_block>0))
+ if (fwrite(ldi->data,(uInt)ldi->filled_in_this_block,
+ 1,zi->filezip) !=1 )
+ err = ZIP_ERRNO;
+
+ size_centraldir += ldi->filled_in_this_block;
+ ldi = ldi->next_datablock;
+ }
+ }
+ free_datablock(zi->central_dir.first_block);
+
+ if (err==ZIP_OK) /* Magic End */
+ err = ziplocal_putValue(zi->filezip,(uLong)ENDHEADERMAGIC,4);
+
+ if (err==ZIP_OK) /* number of this disk */
+ err = ziplocal_putValue(zi->filezip,(uLong)0,2);
+
+ if (err==ZIP_OK) /* number of the disk with the start of the central directory */
+ err = ziplocal_putValue(zi->filezip,(uLong)0,2);
+
+ if (err==ZIP_OK) /* total number of entries in the central dir on this disk */
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->number_entry,2);
+
+ if (err==ZIP_OK) /* total number of entries in the central dir */
+ err = ziplocal_putValue(zi->filezip,(uLong)zi->number_entry,2);
+
+ if (err==ZIP_OK) /* size of the central directory */
+ err = ziplocal_putValue(zi->filezip,(uLong)size_centraldir,4);
+
+ if (err==ZIP_OK) /* offset of start of central directory with respect to the
+ starting disk number */
+ err = ziplocal_putValue(zi->filezip,(uLong)centraldir_pos_inzip ,4);
+
+ if (err==ZIP_OK) /* zipfile comment length */
+ err = ziplocal_putValue(zi->filezip,(uLong)size_global_comment,2);
+
+ if ((err==ZIP_OK) && (size_global_comment>0))
+ if (fwrite(global_comment,(uInt)size_global_comment,1,zi->filezip) !=1 )
+ err = ZIP_ERRNO;
+ fclose(zi->filezip);
+ TRYFREE(zi);
+
+ return err;
+}
--- /dev/null
+ zipOpen @80
+ zipOpenNewFileInZip @81
+ zipWriteInFileInZip @82
+ zipCloseFileInZip @83
+ zipClose @84
--- /dev/null
+/* zip.h -- IO for compress .zip files using zlib
+ Version 0.15 alpha, Mar 19th, 1998,
+
+ Copyright (C) 1998 Gilles Vollant
+
+ This unzip package allow creates .ZIP file, compatible with PKZip 2.04g
+ WinZip, InfoZip tools and compatible.
+ Encryption and multi volume ZipFile (span) are not supported.
+ Old compressions used by old PKZip 1.x are not supported
+
+ For uncompress .zip file, look at unzip.h
+
+ THIS IS AN ALPHA VERSION. AT THIS STAGE OF DEVELOPPEMENT, SOMES API OR STRUCTURE
+ CAN CHANGE IN FUTURE VERSION !!
+ I WAIT FEEDBACK at mail info@winimage.com
+ Visit also http://www.winimage.com/zLibDll/zip.htm for evolution
+
+ Condition of use and distribution are the same than zlib :
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+
+*/
+
+/* for more info about .ZIP format, see
+ ftp://ftp.cdrom.com/pub/infozip/doc/appnote-970311-iz.zip
+ PkWare has also a specification at :
+ ftp://ftp.pkware.com/probdesc.zip
+*/
+
+#ifndef _zip_H
+#define _zip_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#ifndef _ZLIB_H
+#include "zlib.h"
+#endif
+
+#if defined(STRICTZIP) || defined(STRICTZIPUNZIP)
+/* like the STRICT of WIN32, we define a pointer that cannot be converted
+ from (void*) without cast */
+typedef struct TagzipFile__ { int unused; } zipFile__;
+typedef zipFile__ *zipFile;
+#else
+typedef voidp zipFile;
+#endif
+
+#define ZIP_OK (0)
+#define ZIP_ERRNO (Z_ERRNO)
+#define ZIP_PARAMERROR (-102)
+#define ZIP_INTERNALERROR (-104)
+
+/* tm_zip contain date/time info */
+typedef struct tm_zip_s
+{
+ uInt tm_sec; /* seconds after the minute - [0,59] */
+ uInt tm_min; /* minutes after the hour - [0,59] */
+ uInt tm_hour; /* hours since midnight - [0,23] */
+ uInt tm_mday; /* day of the month - [1,31] */
+ uInt tm_mon; /* months since January - [0,11] */
+ uInt tm_year; /* years - [1980..2044] */
+} tm_zip;
+
+typedef struct
+{
+ tm_zip tmz_date; /* date in understandable format */
+ uLong dosDate; /* if dos_date == 0, tmu_date is used */
+/* uLong flag; */ /* general purpose bit flag 2 bytes */
+
+ uLong internal_fa; /* internal file attributes 2 bytes */
+ uLong external_fa; /* external file attributes 4 bytes */
+} zip_fileinfo;
+
+extern zipFile ZEXPORT zipOpen OF((const char *pathname, int append));
+/*
+ Create a zipfile.
+ pathname contain on Windows NT a filename like "c:\\zlib\\zlib111.zip" or on
+ an Unix computer "zlib/zlib111.zip".
+ if the file pathname exist and append=1, the zip will be created at the end
+ of the file. (useful if the file contain a self extractor code)
+ If the zipfile cannot be opened, the return value is NULL.
+ Else, the return value is a zipFile Handle, usable with other function
+ of this zip package.
+
+
+*/
+
+extern int ZEXPORT zipOpenNewFileInZip OF((zipFile file,
+ const char* filename,
+ const zip_fileinfo* zipfi,
+ const void* extrafield_local,
+ uInt size_extrafield_local,
+ const void* extrafield_global,
+ uInt size_extrafield_global,
+ const char* comment,
+ int method,
+ int level));
+/*
+ Open a file in the ZIP for writing.
+ filename : the filename in zip (if NULL, '-' without quote will be used
+ *zipfi contain supplemental information
+ if extrafield_local!=NULL and size_extrafield_local>0, extrafield_local
+ contains the extrafield data the the local header
+ if extrafield_global!=NULL and size_extrafield_global>0, extrafield_global
+ contains the extrafield data the the local header
+ if comment != NULL, comment contain the comment string
+ method contain the compression method (0 for store, Z_DEFLATED for deflate)
+ level contain the level of compression (can be Z_DEFAULT_COMPRESSION)
+*/
+
+extern int ZEXPORT zipWriteInFileInZip OF((zipFile file,
+ const voidp buf,
+ unsigned len));
+/*
+ Write data in the zipfile
+*/
+
+extern int ZEXPORT zipCloseFileInZip OF((zipFile file));
+/*
+ Close the current file in the zipfile
+*/
+
+extern int ZEXPORT zipClose OF((zipFile file,
+ const char* global_comment));
+/*
+ Close the zipfile
+*/
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* _zip_H */
--- /dev/null
+LIBRARY "zlib"
+
+DESCRIPTION '"""zlib data compression library"""'
+
+
+VERSION 1.11
+
+
+HEAPSIZE 1048576,8192
+
+EXPORTS
+ adler32 @1
+ compress @2
+ crc32 @3
+ deflate @4
+ deflateCopy @5
+ deflateEnd @6
+ deflateInit2_ @7
+ deflateInit_ @8
+ deflateParams @9
+ deflateReset @10
+ deflateSetDictionary @11
+ gzclose @12
+ gzdopen @13
+ gzerror @14
+ gzflush @15
+ gzopen @16
+ gzread @17
+ gzwrite @18
+ inflate @19
+ inflateEnd @20
+ inflateInit2_ @21
+ inflateInit_ @22
+ inflateReset @23
+ inflateSetDictionary @24
+ inflateSync @25
+ uncompress @26
+ zlibVersion @27
+ gzprintf @28
+ gzputc @29
+ gzgetc @30
+ gzseek @31
+ gzrewind @32
+ gztell @33
+ gzeof @34
+ gzsetparams @35
+ zError @36
+ inflateSyncPoint @37
+ get_crc_table @38
+ compress2 @39
+ gzputs @40
+ gzgets @41
+
+ unzOpen @61
+ unzClose @62
+ unzGetGlobalInfo @63
+ unzGetCurrentFileInfo @64
+ unzGoToFirstFile @65
+ unzGoToNextFile @66
+ unzOpenCurrentFile @67
+ unzReadCurrentFile @68
+ unztell @70
+ unzeof @71
+ unzCloseCurrentFile @72
+ unzGetGlobalComment @73
+ unzStringFileNameCompare @74
+ unzLocateFile @75
+ unzGetLocalExtrafield @76
+
+ zipOpen @80
+ zipOpenNewFileInZip @81
+ zipWriteInFileInZip @82
+ zipCloseFileInZip @83
+ zipClose @84
--- /dev/null
+# Microsoft Developer Studio Project File - Name="zlibvc" - Package Owner=<4>
+# Microsoft Developer Studio Generated Build File, Format Version 5.00
+# ** DO NOT EDIT **
+
+# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102
+# TARGTYPE "Win32 (ALPHA) Dynamic-Link Library" 0x0602
+
+CFG=zlibvc - Win32 Release
+!MESSAGE This is not a valid makefile. To build this project using NMAKE,
+!MESSAGE use the Export Makefile command and run
+!MESSAGE
+!MESSAGE NMAKE /f "zlibvc.mak".
+!MESSAGE
+!MESSAGE You can specify a configuration when running NMAKE
+!MESSAGE by defining the macro CFG on the command line. For example:
+!MESSAGE
+!MESSAGE NMAKE /f "zlibvc.mak" CFG="zlibvc - Win32 Release"
+!MESSAGE
+!MESSAGE Possible choices for configuration are:
+!MESSAGE
+!MESSAGE "zlibvc - Win32 Release" (based on "Win32 (x86) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 Debug" (based on "Win32 (x86) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 ReleaseAxp" (based on\
+ "Win32 (ALPHA) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 ReleaseWithoutAsm" (based on\
+ "Win32 (x86) Dynamic-Link Library")
+!MESSAGE "zlibvc - Win32 ReleaseWithoutCrtdll" (based on\
+ "Win32 (x86) Dynamic-Link Library")
+!MESSAGE
+
+# Begin Project
+# PROP Scc_ProjName ""
+# PROP Scc_LocalPath ""
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir ".\Release"
+# PROP BASE Intermediate_Dir ".\Release"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir ".\Release"
+# PROP Intermediate_Dir ".\Release"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386
+# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 1
+# PROP BASE Output_Dir ".\Debug"
+# PROP BASE Intermediate_Dir ".\Debug"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 1
+# PROP Output_Dir ".\Debug"
+# PROP Intermediate_Dir ".\Debug"
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /c
+# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "_DEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "_DEBUG" /win32
+# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "_DEBUG"
+# ADD RSC /l 0x40c /d "_DEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:".\Debug\zlib.dll"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "zlibvc__"
+# PROP BASE Intermediate_Dir "zlibvc__"
+# PROP BASE Ignore_Export_Lib 0
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "zlibvc__"
+# PROP Intermediate_Dir "zlibvc__"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c
+# ADD CPP /nologo /MT /Gt0 /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT BASE LINK32 /pdb:none
+# ADD LINK32 crtdll.lib kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib /nologo /subsystem:windows /dll /map /machine:ALPHA /nodefaultlib /out:"zlibvc__\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "zlibvc_0"
+# PROP BASE Intermediate_Dir "zlibvc_0"
+# PROP BASE Ignore_Export_Lib 0
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "zlibvc_0"
+# PROP Intermediate_Dir "zlibvc_0"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /YX /FD /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT BASE LINK32 /pdb:none
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_0\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "zlibvc_1"
+# PROP BASE Intermediate_Dir "zlibvc_1"
+# PROP BASE Ignore_Export_Lib 0
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "zlibvc_1"
+# PROP Intermediate_Dir "zlibvc_1"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+CPP=cl.exe
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /YX /FD /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "NDEBUG" /D "WIN32" /D "_WINDOWS" /D "_WINDLL" /D "_WIN32" /D "BUILD_ZLIBDLL" /D "ZLIB_DLL" /D "DYNAMIC_CRC_TABLE" /D "ASMV" /FAcs /FR /FD /c
+# SUBTRACT CPP /YX
+MTL=midl.exe
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /win32
+RSC=rc.exe
+# ADD BASE RSC /l 0x40c /d "NDEBUG"
+# ADD RSC /l 0x40c /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\Release\zlib.dll"
+# SUBTRACT BASE LINK32 /pdb:none
+# ADD LINK32 gvmat32.obj kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib crtdll.lib /nologo /subsystem:windows /dll /map /machine:I386 /nodefaultlib /out:".\zlibvc_1\zlib.dll"
+# SUBTRACT LINK32 /pdb:none
+
+!ENDIF
+
+# Begin Target
+
+# Name "zlibvc - Win32 Release"
+# Name "zlibvc - Win32 Debug"
+# Name "zlibvc - Win32 ReleaseAxp"
+# Name "zlibvc - Win32 ReleaseWithoutAsm"
+# Name "zlibvc - Win32 ReleaseWithoutCrtdll"
+# Begin Group "Source Files"
+
+# PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;hpj;bat;for;f90"
+# Begin Source File
+
+SOURCE=.\adler32.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_ADLER=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\compress.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_COMPR=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\crc32.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_CRC32=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\deflate.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_DEFLA=\
+ ".\deflate.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\gvmat32c.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\gzio.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_GZIO_=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\infblock.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFBL=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\infcodes.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFCO=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inffast.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\inffast.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFFA=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inffast.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\inflate.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFLA=\
+ ".\infblock.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\inftrees.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFTR=\
+ ".\inftrees.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\infutil.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_INFUT=\
+ ".\infblock.h"\
+ ".\infcodes.h"\
+ ".\inftrees.h"\
+ ".\infutil.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\trees.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_TREES=\
+ ".\deflate.h"\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\uncompr.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_UNCOM=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\unzip.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\zip.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# Begin Source File
+
+SOURCE=.\zlib.rc
+# End Source File
+# Begin Source File
+
+SOURCE=.\zlibvc.def
+# End Source File
+# Begin Source File
+
+SOURCE=.\zutil.c
+
+!IF "$(CFG)" == "zlibvc - Win32 Release"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 Debug"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseAxp"
+
+DEP_CPP_ZUTIL=\
+ ".\zconf.h"\
+ ".\zlib.h"\
+ ".\zutil.h"\
+
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutAsm"
+
+!ELSEIF "$(CFG)" == "zlibvc - Win32 ReleaseWithoutCrtdll"
+
+!ENDIF
+
+# End Source File
+# End Group
+# Begin Group "Header Files"
+
+# PROP Default_Filter "h;hpp;hxx;hm;inl;fi;fd"
+# Begin Source File
+
+SOURCE=.\deflate.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\infblock.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\infcodes.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\inffast.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\inftrees.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\infutil.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\zconf.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\zlib.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\zutil.h
+# End Source File
+# End Group
+# Begin Group "Resource Files"
+
+# PROP Default_Filter "ico;cur;bmp;dlg;rc2;rct;bin;cnt;rtf;gif;jpg;jpeg;jpe"
+# End Group
+# End Target
+# End Project
--- /dev/null
+Microsoft Developer Studio Workspace File, Format Version 5.00
+# WARNING: DO NOT EDIT OR DELETE THIS WORKSPACE FILE!
+
+###############################################################################
+
+Project: "zlibstat"=.\zlibstat.dsp - Package Owner=<4>
+
+Package=<5>
+{{{
+}}}
+
+Package=<4>
+{{{
+}}}
+
+###############################################################################
+
+Project: "zlibvc"=.\zlibvc.dsp - Package Owner=<4>
+
+Package=<5>
+{{{
+}}}
+
+Package=<4>
+{{{
+}}}
+
+###############################################################################
+
+Global:
+
+Package=<5>
+{{{
+}}}
+
+Package=<3>
+{{{
+}}}
+
+###############################################################################
+
--- /dev/null
+CC=cc
+CFLAGS=-g
+
+untgz: untgz.o ../../libz.a
+ $(CC) $(CFLAGS) -o untgz untgz.o -L../.. -lz
+
+untgz.o: untgz.c ../../zlib.h
+ $(CC) $(CFLAGS) -c -I../.. untgz.c
+
+../../libz.a:
+ cd ../..; make
+
+clean:
+ rm -f untgz untgz.o *~
--- /dev/null
+# Makefile for zlib. Modified for mingw32
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile,
+#
+# make -fmakefile.w32
+#
+
+CC=gcc
+
+# Generate dependencies (see end of the file)
+
+CPPFLAGS=-MMD
+
+#CFLAGS=-MMD -O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-MMD -g -DDEBUG
+CFLAGS=-O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+ -Wstrict-prototypes -Wmissing-prototypes
+
+# If cp.exe is not found, replace with copy /Y .
+CP=cp -f
+
+# The default value of RM is "rm -f."
+# If "rm.exe" is not found, uncomment:
+# RM=del
+
+LD=gcc
+LDLIBS=-L. -lz
+LDFLAGS=-s
+
+
+INCL=zlib.h zconf.h
+LIBS=libz.a
+
+AR=ar rcs
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o \
+ inffast.o
+
+TEST_OBJS = minigzip.o untgz.o
+
+all: minigzip.exe untgz.exe
+
+rebuild: clean all
+
+libz.a: $(OBJS)
+ $(AR) $@ $(OBJS)
+
+%.exe : %.o $(LIBS)
+ $(LD) $(LDFLAGS) -o $@ $< $(LDLIBS)
+
+.PHONY : clean
+
+clean:
+ $(RM) *.d *.o *.exe libz.a foo.gz
+
+DEPS := $(wildcard *.d)
+ifneq ($(DEPS),)
+include $(DEPS)
+endif
+
--- /dev/null
+/*
+ * untgz.c -- Display contents and/or extract file from
+ * a gzip'd TAR file
+ * written by "Pedro A. Aranda Guti\irrez" <paag@tid.es>
+ * adaptation to Unix by Jean-loup Gailly <jloup@gzip.org>
+ */
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <time.h>
+#include <errno.h>
+#include <fcntl.h>
+#ifdef unix
+# include <unistd.h>
+#else
+# include <direct.h>
+# include <io.h>
+#endif
+
+#include "zlib.h"
+
+#ifdef WIN32
+# ifndef F_OK
+# define F_OK (0)
+# endif
+# ifdef _MSC_VER
+# define mkdir(dirname,mode) _mkdir(dirname)
+# define strdup(str) _strdup(str)
+# define unlink(fn) _unlink(fn)
+# define access(path,mode) _access(path,mode)
+# else
+# define mkdir(dirname,mode) _mkdir(dirname)
+# endif
+#else
+# include <utime.h>
+#endif
+
+
+/* Values used in typeflag field. */
+
+#define REGTYPE '0' /* regular file */
+#define AREGTYPE '\0' /* regular file */
+#define LNKTYPE '1' /* link */
+#define SYMTYPE '2' /* reserved */
+#define CHRTYPE '3' /* character special */
+#define BLKTYPE '4' /* block special */
+#define DIRTYPE '5' /* directory */
+#define FIFOTYPE '6' /* FIFO special */
+#define CONTTYPE '7' /* reserved */
+
+#define BLOCKSIZE 512
+
+struct tar_header
+{ /* byte offset */
+ char name[100]; /* 0 */
+ char mode[8]; /* 100 */
+ char uid[8]; /* 108 */
+ char gid[8]; /* 116 */
+ char size[12]; /* 124 */
+ char mtime[12]; /* 136 */
+ char chksum[8]; /* 148 */
+ char typeflag; /* 156 */
+ char linkname[100]; /* 157 */
+ char magic[6]; /* 257 */
+ char version[2]; /* 263 */
+ char uname[32]; /* 265 */
+ char gname[32]; /* 297 */
+ char devmajor[8]; /* 329 */
+ char devminor[8]; /* 337 */
+ char prefix[155]; /* 345 */
+ /* 500 */
+};
+
+union tar_buffer {
+ char buffer[BLOCKSIZE];
+ struct tar_header header;
+};
+
+enum { TGZ_EXTRACT = 0, TGZ_LIST };
+
+static char *TGZfname OF((const char *));
+void TGZnotfound OF((const char *));
+
+int getoct OF((char *, int));
+char *strtime OF((time_t *));
+int ExprMatch OF((char *,char *));
+
+int makedir OF((char *));
+int matchname OF((int,int,char **,char *));
+
+void error OF((const char *));
+int tar OF((gzFile, int, int, int, char **));
+
+void help OF((int));
+int main OF((int, char **));
+
+char *prog;
+
+/* This will give a benign warning */
+
+static char *TGZprefix[] = { "\0", ".tgz", ".tar.gz", ".tar", NULL };
+
+/* Return the real name of the TGZ archive */
+/* or NULL if it does not exist. */
+
+static char *TGZfname OF((const char *fname))
+{
+ static char buffer[1024];
+ int origlen,i;
+
+ strcpy(buffer,fname);
+ origlen = strlen(buffer);
+
+ for (i=0; TGZprefix[i]; i++)
+ {
+ strcpy(buffer+origlen,TGZprefix[i]);
+ if (access(buffer,F_OK) == 0)
+ return buffer;
+ }
+ return NULL;
+}
+
+/* error message for the filename */
+
+void TGZnotfound OF((const char *fname))
+{
+ int i;
+
+ fprintf(stderr,"%s : couldn't find ",prog);
+ for (i=0;TGZprefix[i];i++)
+ fprintf(stderr,(TGZprefix[i+1]) ? "%s%s, " : "or %s%s\n",
+ fname,
+ TGZprefix[i]);
+ exit(1);
+}
+
+
+/* help functions */
+
+int getoct(char *p,int width)
+{
+ int result = 0;
+ char c;
+
+ while (width --)
+ {
+ c = *p++;
+ if (c == ' ')
+ continue;
+ if (c == 0)
+ break;
+ result = result * 8 + (c - '0');
+ }
+ return result;
+}
+
+char *strtime (time_t *t)
+{
+ struct tm *local;
+ static char result[32];
+
+ local = localtime(t);
+ sprintf(result,"%2d/%02d/%4d %02d:%02d:%02d",
+ local->tm_mday, local->tm_mon+1, local->tm_year+1900,
+ local->tm_hour, local->tm_min, local->tm_sec);
+ return result;
+}
+
+
+/* regular expression matching */
+
+#define ISSPECIAL(c) (((c) == '*') || ((c) == '/'))
+
+int ExprMatch(char *string,char *expr)
+{
+ while (1)
+ {
+ if (ISSPECIAL(*expr))
+ {
+ if (*expr == '/')
+ {
+ if (*string != '\\' && *string != '/')
+ return 0;
+ string ++; expr++;
+ }
+ else if (*expr == '*')
+ {
+ if (*expr ++ == 0)
+ return 1;
+ while (*++string != *expr)
+ if (*string == 0)
+ return 0;
+ }
+ }
+ else
+ {
+ if (*string != *expr)
+ return 0;
+ if (*expr++ == 0)
+ return 1;
+ string++;
+ }
+ }
+}
+
+/* recursive make directory */
+/* abort if you get an ENOENT errno somewhere in the middle */
+/* e.g. ignore error "mkdir on existing directory" */
+/* */
+/* return 1 if OK */
+/* 0 on error */
+
+int makedir (char *newdir)
+{
+ char *buffer = strdup(newdir);
+ char *p;
+ int len = strlen(buffer);
+
+ if (len <= 0) {
+ free(buffer);
+ return 0;
+ }
+ if (buffer[len-1] == '/') {
+ buffer[len-1] = '\0';
+ }
+ if (mkdir(buffer, 0775) == 0)
+ {
+ free(buffer);
+ return 1;
+ }
+
+ p = buffer+1;
+ while (1)
+ {
+ char hold;
+
+ while(*p && *p != '\\' && *p != '/')
+ p++;
+ hold = *p;
+ *p = 0;
+ if ((mkdir(buffer, 0775) == -1) && (errno == ENOENT))
+ {
+ fprintf(stderr,"%s: couldn't create directory %s\n",prog,buffer);
+ free(buffer);
+ return 0;
+ }
+ if (hold == 0)
+ break;
+ *p++ = hold;
+ }
+ free(buffer);
+ return 1;
+}
+
+int matchname (int arg,int argc,char **argv,char *fname)
+{
+ if (arg == argc) /* no arguments given (untgz tgzarchive) */
+ return 1;
+
+ while (arg < argc)
+ if (ExprMatch(fname,argv[arg++]))
+ return 1;
+
+ return 0; /* ignore this for the moment being */
+}
+
+
+/* Tar file list or extract */
+
+int tar (gzFile in,int action,int arg,int argc,char **argv)
+{
+ union tar_buffer buffer;
+ int len;
+ int err;
+ int getheader = 1;
+ int remaining = 0;
+ FILE *outfile = NULL;
+ char fname[BLOCKSIZE];
+ time_t tartime;
+
+ if (action == TGZ_LIST)
+ printf(" day time size file\n"
+ " ---------- -------- --------- -------------------------------------\n");
+ while (1)
+ {
+ len = gzread(in, &buffer, BLOCKSIZE);
+ if (len < 0)
+ error (gzerror(in, &err));
+ /*
+ * Always expect complete blocks to process
+ * the tar information.
+ */
+ if (len != BLOCKSIZE)
+ error("gzread: incomplete block read");
+
+ /*
+ * If we have to get a tar header
+ */
+ if (getheader == 1)
+ {
+ /*
+ * if we met the end of the tar
+ * or the end-of-tar block,
+ * we are done
+ */
+ if ((len == 0) || (buffer.header.name[0]== 0)) break;
+
+ tartime = (time_t)getoct(buffer.header.mtime,12);
+ strcpy(fname,buffer.header.name);
+
+ switch (buffer.header.typeflag)
+ {
+ case DIRTYPE:
+ if (action == TGZ_LIST)
+ printf(" %s <dir> %s\n",strtime(&tartime),fname);
+ if (action == TGZ_EXTRACT)
+ makedir(fname);
+ break;
+ case REGTYPE:
+ case AREGTYPE:
+ remaining = getoct(buffer.header.size,12);
+ if (action == TGZ_LIST)
+ printf(" %s %9d %s\n",strtime(&tartime),remaining,fname);
+ if (action == TGZ_EXTRACT)
+ {
+ if ((remaining) && (matchname(arg,argc,argv,fname)))
+ {
+ outfile = fopen(fname,"wb");
+ if (outfile == NULL) {
+ /* try creating directory */
+ char *p = strrchr(fname, '/');
+ if (p != NULL) {
+ *p = '\0';
+ makedir(fname);
+ *p = '/';
+ outfile = fopen(fname,"wb");
+ }
+ }
+ fprintf(stderr,
+ "%s %s\n",
+ (outfile) ? "Extracting" : "Couldn't create",
+ fname);
+ }
+ else
+ outfile = NULL;
+ }
+ /*
+ * could have no contents
+ */
+ getheader = (remaining) ? 0 : 1;
+ break;
+ default:
+ if (action == TGZ_LIST)
+ printf(" %s <---> %s\n",strtime(&tartime),fname);
+ break;
+ }
+ }
+ else
+ {
+ unsigned int bytes = (remaining > BLOCKSIZE) ? BLOCKSIZE : remaining;
+
+ if ((action == TGZ_EXTRACT) && (outfile != NULL))
+ {
+ if (fwrite(&buffer,sizeof(char),bytes,outfile) != bytes)
+ {
+ fprintf(stderr,"%s : error writing %s skipping...\n",prog,fname);
+ fclose(outfile);
+ unlink(fname);
+ }
+ }
+ remaining -= bytes;
+ if (remaining == 0)
+ {
+ getheader = 1;
+ if ((action == TGZ_EXTRACT) && (outfile != NULL))
+ {
+#ifdef WIN32
+ HANDLE hFile;
+ FILETIME ftm,ftLocal;
+ SYSTEMTIME st;
+ struct tm localt;
+
+ fclose(outfile);
+
+ localt = *localtime(&tartime);
+
+ hFile = CreateFile(fname, GENERIC_READ | GENERIC_WRITE,
+ 0, NULL, OPEN_EXISTING, 0, NULL);
+
+ st.wYear = (WORD)localt.tm_year+1900;
+ st.wMonth = (WORD)localt.tm_mon;
+ st.wDayOfWeek = (WORD)localt.tm_wday;
+ st.wDay = (WORD)localt.tm_mday;
+ st.wHour = (WORD)localt.tm_hour;
+ st.wMinute = (WORD)localt.tm_min;
+ st.wSecond = (WORD)localt.tm_sec;
+ st.wMilliseconds = 0;
+ SystemTimeToFileTime(&st,&ftLocal);
+ LocalFileTimeToFileTime(&ftLocal,&ftm);
+ SetFileTime(hFile,&ftm,NULL,&ftm);
+ CloseHandle(hFile);
+
+ outfile = NULL;
+#else
+ struct utimbuf settime;
+
+ settime.actime = settime.modtime = tartime;
+
+ fclose(outfile);
+ outfile = NULL;
+ utime(fname,&settime);
+#endif
+ }
+ }
+ }
+ }
+
+ if (gzclose(in) != Z_OK)
+ error("failed gzclose");
+
+ return 0;
+}
+
+
+/* =========================================================== */
+
+void help(int exitval)
+{
+ fprintf(stderr,
+ "untgz v 0.1\n"
+ " an sample application of zlib 1.0.4\n\n"
+ "Usage : untgz TGZfile to extract all files\n"
+ " untgz TGZfile fname ... to extract selected files\n"
+ " untgz -l TGZfile to list archive contents\n"
+ " untgz -h to display this help\n\n");
+ exit(exitval);
+}
+
+void error(const char *msg)
+{
+ fprintf(stderr, "%s: %s\n", prog, msg);
+ exit(1);
+}
+
+
+/* ====================================================================== */
+
+int _CRT_glob = 0; /* disable globbing of the arguments */
+
+int main(int argc,char **argv)
+{
+ int action = TGZ_EXTRACT;
+ int arg = 1;
+ char *TGZfile;
+ gzFile *f;
+
+
+ prog = strrchr(argv[0],'\\');
+ if (prog == NULL)
+ {
+ prog = strrchr(argv[0],'/');
+ if (prog == NULL)
+ {
+ prog = strrchr(argv[0],':');
+ if (prog == NULL)
+ prog = argv[0];
+ else
+ prog++;
+ }
+ else
+ prog++;
+ }
+ else
+ prog++;
+
+ if (argc == 1)
+ help(0);
+
+ if (strcmp(argv[arg],"-l") == 0)
+ {
+ action = TGZ_LIST;
+ if (argc == ++arg)
+ help(0);
+ }
+ else if (strcmp(argv[arg],"-h") == 0)
+ {
+ help(0);
+ }
+
+ if ((TGZfile = TGZfname(argv[arg])) == NULL)
+ TGZnotfound(argv[arg]);
+
+ ++arg;
+ if ((action == TGZ_LIST) && (arg != argc))
+ help(1);
+
+/*
+ * Process the TGZ file
+ */
+ switch(action)
+ {
+ case TGZ_LIST:
+ case TGZ_EXTRACT:
+ f = gzopen(TGZfile,"rb");
+ if (f == NULL)
+ {
+ fprintf(stderr,"%s: Couldn't gzopen %s\n",
+ prog,
+ TGZfile);
+ return 1;
+ }
+ exit(tar(f, action, arg, argc, argv));
+ break;
+
+ default:
+ error("Unknown option!");
+ exit(1);
+ }
+
+ return 0;
+}
--- /dev/null
+See below some functions declarations for Visual Basic.
+
+Frequently Asked Question:
+
+Q: Each time I use the compress function I get the -5 error (not enough
+ room in the output buffer).
+
+A: Make sure that the length of the compressed buffer is passed by
+ reference ("as any"), not by value ("as long"). Also check that
+ before the call of compress this length is equal to the total size of
+ the compressed buffer and not zero.
+
+
+From: "Jon Caruana" <jon-net@usa.net>
+Subject: Re: How to port zlib declares to vb?
+Date: Mon, 28 Oct 1996 18:33:03 -0600
+
+Got the answer! (I haven't had time to check this but it's what I got, and
+looks correct):
+
+He has the following routines working:
+ compress
+ uncompress
+ gzopen
+ gzwrite
+ gzread
+ gzclose
+
+Declares follow: (Quoted from Carlos Rios <c_rios@sonda.cl>, in Vb4 form)
+
+#If Win16 Then 'Use Win16 calls.
+Declare Function compress Lib "ZLIB.DLL" (ByVal compr As
+ String, comprLen As Any, ByVal buf As String, ByVal buflen
+ As Long) As Integer
+Declare Function uncompress Lib "ZLIB.DLL" (ByVal uncompr
+ As String, uncomprLen As Any, ByVal compr As String, ByVal
+ lcompr As Long) As Integer
+Declare Function gzopen Lib "ZLIB.DLL" (ByVal filePath As
+ String, ByVal mode As String) As Long
+Declare Function gzread Lib "ZLIB.DLL" (ByVal file As
+ Long, ByVal uncompr As String, ByVal uncomprLen As Integer)
+ As Integer
+Declare Function gzwrite Lib "ZLIB.DLL" (ByVal file As
+ Long, ByVal uncompr As String, ByVal uncomprLen As Integer)
+ As Integer
+Declare Function gzclose Lib "ZLIB.DLL" (ByVal file As
+ Long) As Integer
+#Else
+Declare Function compress Lib "ZLIB32.DLL"
+ (ByVal compr As String, comprLen As Any, ByVal buf As
+ String, ByVal buflen As Long) As Integer
+Declare Function uncompress Lib "ZLIB32.DLL"
+ (ByVal uncompr As String, uncomprLen As Any, ByVal compr As
+ String, ByVal lcompr As Long) As Long
+Declare Function gzopen Lib "ZLIB32.DLL"
+ (ByVal file As String, ByVal mode As String) As Long
+Declare Function gzread Lib "ZLIB32.DLL"
+ (ByVal file As Long, ByVal uncompr As String, ByVal
+ uncomprLen As Long) As Long
+Declare Function gzwrite Lib "ZLIB32.DLL"
+ (ByVal file As Long, ByVal uncompr As String, ByVal
+ uncomprLen As Long) As Long
+Declare Function gzclose Lib "ZLIB32.DLL"
+ (ByVal file As Long) As Long
+#End If
+
+-Jon Caruana
+jon-net@usa.net
+Microsoft Sitebuilder Network Level 1 Member - HTML Writer's Guild Member
--- /dev/null
+/* crc32.c -- compute the CRC-32 of a data stream
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include "zlib.h"
+
+#define local static
+
+#ifdef DYNAMIC_CRC_TABLE
+
+local int crc_table_empty = 1;
+local uLongf crc_table[256];
+local void make_crc_table OF((void));
+
+/*
+ Generate a table for a byte-wise 32-bit CRC calculation on the polynomial:
+ x^32+x^26+x^23+x^22+x^16+x^12+x^11+x^10+x^8+x^7+x^5+x^4+x^2+x+1.
+
+ Polynomials over GF(2) are represented in binary, one bit per coefficient,
+ with the lowest powers in the most significant bit. Then adding polynomials
+ is just exclusive-or, and multiplying a polynomial by x is a right shift by
+ one. If we call the above polynomial p, and represent a byte as the
+ polynomial q, also with the lowest power in the most significant bit (so the
+ byte 0xb1 is the polynomial x^7+x^3+x+1), then the CRC is (q*x^32) mod p,
+ where a mod b means the remainder after dividing a by b.
+
+ This calculation is done using the shift-register method of multiplying and
+ taking the remainder. The register is initialized to zero, and for each
+ incoming bit, x^32 is added mod p to the register if the bit is a one (where
+ x^32 mod p is p+x^32 = x^26+...+1), and the register is multiplied mod p by
+ x (which is shifting right by one and adding x^32 mod p if the bit shifted
+ out is a one). We start with the highest power (least significant bit) of
+ q and repeat for all eight bits of q.
+
+ The table is simply the CRC of all possible eight bit values. This is all
+ the information needed to generate CRC's on data a byte at a time for all
+ combinations of CRC register values and incoming bytes.
+*/
+local void make_crc_table()
+{
+ uLong c;
+ int n, k;
+ uLong poly; /* polynomial exclusive-or pattern */
+ /* terms of polynomial defining this crc (except x^32): */
+ static const Byte p[] = {0,1,2,4,5,7,8,10,11,12,16,22,23,26};
+
+ /* make exclusive-or pattern from polynomial (0xedb88320L) */
+ poly = 0L;
+ for (n = 0; n < sizeof(p)/sizeof(Byte); n++)
+ poly |= 1L << (31 - p[n]);
+
+ for (n = 0; n < 256; n++)
+ {
+ c = (uLong)n;
+ for (k = 0; k < 8; k++)
+ c = c & 1 ? poly ^ (c >> 1) : c >> 1;
+ crc_table[n] = c;
+ }
+ crc_table_empty = 0;
+}
+#else
+/* ========================================================================
+ * Table of CRC-32's of all single-byte values (made by make_crc_table)
+ */
+local const uLongf crc_table[256] = {
+ 0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L,
+ 0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L,
+ 0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L,
+ 0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL,
+ 0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L,
+ 0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L,
+ 0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L,
+ 0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL,
+ 0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L,
+ 0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL,
+ 0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L,
+ 0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L,
+ 0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L,
+ 0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL,
+ 0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL,
+ 0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L,
+ 0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL,
+ 0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L,
+ 0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L,
+ 0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L,
+ 0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL,
+ 0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L,
+ 0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L,
+ 0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL,
+ 0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L,
+ 0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L,
+ 0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L,
+ 0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L,
+ 0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L,
+ 0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL,
+ 0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL,
+ 0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L,
+ 0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L,
+ 0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL,
+ 0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL,
+ 0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L,
+ 0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL,
+ 0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L,
+ 0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL,
+ 0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L,
+ 0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL,
+ 0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L,
+ 0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L,
+ 0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL,
+ 0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L,
+ 0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L,
+ 0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L,
+ 0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L,
+ 0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L,
+ 0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L,
+ 0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL,
+ 0x2d02ef8dL
+};
+#endif
+
+/* =========================================================================
+ * This function can be used by asm versions of crc32()
+ */
+const uLongf * ZEXPORT get_crc_table()
+{
+#ifdef DYNAMIC_CRC_TABLE
+ if (crc_table_empty) make_crc_table();
+#endif
+ return (const uLongf *)crc_table;
+}
+
+/* ========================================================================= */
+#define DO1(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8);
+#define DO2(buf) DO1(buf); DO1(buf);
+#define DO4(buf) DO2(buf); DO2(buf);
+#define DO8(buf) DO4(buf); DO4(buf);
+
+/* ========================================================================= */
+uLong ZEXPORT crc32(crc, buf, len)
+ uLong crc;
+ const Bytef *buf;
+ uInt len;
+{
+ if (buf == Z_NULL) return 0L;
+#ifdef DYNAMIC_CRC_TABLE
+ if (crc_table_empty)
+ make_crc_table();
+#endif
+ crc = crc ^ 0xffffffffL;
+ while (len >= 8)
+ {
+ DO8(buf);
+ len -= 8;
+ }
+ if (len) do {
+ DO1(buf);
+ } while (--len);
+ return crc ^ 0xffffffffL;
+}
--- /dev/null
+/* deflate.c -- compress data using the deflation algorithm
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ * ALGORITHM
+ *
+ * The "deflation" process depends on being able to identify portions
+ * of the input text which are identical to earlier input (within a
+ * sliding window trailing behind the input currently being processed).
+ *
+ * The most straightforward technique turns out to be the fastest for
+ * most input files: try all possible matches and select the longest.
+ * The key feature of this algorithm is that insertions into the string
+ * dictionary are very simple and thus fast, and deletions are avoided
+ * completely. Insertions are performed at each input character, whereas
+ * string matches are performed only when the previous match ends. So it
+ * is preferable to spend more time in matches to allow very fast string
+ * insertions and avoid deletions. The matching algorithm for small
+ * strings is inspired from that of Rabin & Karp. A brute force approach
+ * is used to find longer strings when a small match has been found.
+ * A similar algorithm is used in comic (by Jan-Mark Wams) and freeze
+ * (by Leonid Broukhis).
+ * A previous version of this file used a more sophisticated algorithm
+ * (by Fiala and Greene) which is guaranteed to run in linear amortized
+ * time, but has a larger average cost, uses more memory and is patented.
+ * However the F&G algorithm may be faster for some highly redundant
+ * files if the parameter max_chain_length (described below) is too large.
+ *
+ * ACKNOWLEDGEMENTS
+ *
+ * The idea of lazy evaluation of matches is due to Jan-Mark Wams, and
+ * I found it in 'freeze' written by Leonid Broukhis.
+ * Thanks to many people for bug reports and testing.
+ *
+ * REFERENCES
+ *
+ * Deutsch, L.P.,"DEFLATE Compressed Data Format Specification".
+ * Available in ftp://ds.internic.net/rfc/rfc1951.txt
+ *
+ * A description of the Rabin and Karp algorithm is given in the book
+ * "Algorithms" by R. Sedgewick, Addison-Wesley, p252.
+ *
+ * Fiala,E.R., and Greene,D.H.
+ * Data Compression with Finite Windows, Comm.ACM, 32,4 (1989) 490-595
+ *
+ */
+
+/* @(#) $Id$ */
+
+#include "deflate.h"
+
+const char deflate_copyright[] =
+ " deflate 1.1.3 Copyright 1995-1998 Jean-loup Gailly ";
+/*
+ If you use the zlib library in a product, an acknowledgment is welcome
+ in the documentation of your product. If for some reason you cannot
+ include such an acknowledgment, I would appreciate that you keep this
+ copyright string in the executable of your product.
+ */
+
+/* ===========================================================================
+ * Function prototypes.
+ */
+typedef enum {
+ need_more, /* block not completed, need more input or more output */
+ block_done, /* block flush performed */
+ finish_started, /* finish started, need only more output at next deflate */
+ finish_done /* finish done, accept no more input or output */
+} block_state;
+
+typedef block_state (*compress_func) OF((deflate_state *s, int flush));
+/* Compression function. Returns the block state after the call. */
+
+local void fill_window OF((deflate_state *s));
+local block_state deflate_stored OF((deflate_state *s, int flush));
+local block_state deflate_fast OF((deflate_state *s, int flush));
+local block_state deflate_slow OF((deflate_state *s, int flush));
+local void lm_init OF((deflate_state *s));
+local void putShortMSB OF((deflate_state *s, uInt b));
+local void flush_pending OF((z_streamp strm));
+local int read_buf OF((z_streamp strm, Bytef *buf, unsigned size));
+#ifdef ASMV
+ void match_init OF((void)); /* asm code initialization */
+ uInt longest_match OF((deflate_state *s, IPos cur_match));
+#else
+local uInt longest_match OF((deflate_state *s, IPos cur_match));
+#endif
+
+#ifdef DEBUG
+local void check_match OF((deflate_state *s, IPos start, IPos match,
+ int length));
+#endif
+
+/* ===========================================================================
+ * Local data
+ */
+
+#define NIL 0
+/* Tail of hash chains */
+
+#ifndef TOO_FAR
+# define TOO_FAR 4096
+#endif
+/* Matches of length 3 are discarded if their distance exceeds TOO_FAR */
+
+#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1)
+/* Minimum amount of lookahead, except at the end of the input file.
+ * See deflate.c for comments about the MIN_MATCH+1.
+ */
+
+/* Values for max_lazy_match, good_match and max_chain_length, depending on
+ * the desired pack level (0..9). The values given below have been tuned to
+ * exclude worst case performance for pathological files. Better values may be
+ * found for specific files.
+ */
+typedef struct config_s {
+ ush good_length; /* reduce lazy search above this match length */
+ ush max_lazy; /* do not perform lazy search above this match length */
+ ush nice_length; /* quit search above this match length */
+ ush max_chain;
+ compress_func func;
+} config;
+
+local const config configuration_table[10] = {
+/* good lazy nice chain */
+/* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */
+/* 1 */ {4, 4, 8, 4, deflate_fast}, /* maximum speed, no lazy matches */
+/* 2 */ {4, 5, 16, 8, deflate_fast},
+/* 3 */ {4, 6, 32, 32, deflate_fast},
+
+/* 4 */ {4, 4, 16, 16, deflate_slow}, /* lazy matches */
+/* 5 */ {8, 16, 32, 32, deflate_slow},
+/* 6 */ {8, 16, 128, 128, deflate_slow},
+/* 7 */ {8, 32, 128, 256, deflate_slow},
+/* 8 */ {32, 128, 258, 1024, deflate_slow},
+/* 9 */ {32, 258, 258, 4096, deflate_slow}}; /* maximum compression */
+
+/* Note: the deflate() code requires max_lazy >= MIN_MATCH and max_chain >= 4
+ * For deflate_fast() (levels <= 3) good is ignored and lazy has a different
+ * meaning.
+ */
+
+#define EQUAL 0
+/* result of memcmp for equal strings */
+
+struct static_tree_desc_s {int dummy;}; /* for buggy compilers */
+
+/* ===========================================================================
+ * Update a hash value with the given input byte
+ * IN assertion: all calls to to UPDATE_HASH are made with consecutive
+ * input characters, so that a running hash key can be computed from the
+ * previous key instead of complete recalculation each time.
+ */
+#define UPDATE_HASH(s,h,c) (h = (((h)<<s->hash_shift) ^ (c)) & s->hash_mask)
+
+
+/* ===========================================================================
+ * Insert string str in the dictionary and set match_head to the previous head
+ * of the hash chain (the most recent string with same hash key). Return
+ * the previous length of the hash chain.
+ * If this file is compiled with -DFASTEST, the compression level is forced
+ * to 1, and no hash chains are maintained.
+ * IN assertion: all calls to to INSERT_STRING are made with consecutive
+ * input characters and the first MIN_MATCH bytes of str are valid
+ * (except for the last MIN_MATCH-1 bytes of the input file).
+ */
+#ifdef FASTEST
+#define INSERT_STRING(s, str, match_head) \
+ (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \
+ match_head = s->head[s->ins_h], \
+ s->head[s->ins_h] = (Pos)(str))
+#else
+#define INSERT_STRING(s, str, match_head) \
+ (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \
+ s->prev[(str) & s->w_mask] = match_head = s->head[s->ins_h], \
+ s->head[s->ins_h] = (Pos)(str))
+#endif
+
+/* ===========================================================================
+ * Initialize the hash table (avoiding 64K overflow for 16 bit systems).
+ * prev[] will be initialized on the fly.
+ */
+#define CLEAR_HASH(s) \
+ s->head[s->hash_size-1] = NIL; \
+ zmemzero((Bytef *)s->head, (unsigned)(s->hash_size-1)*sizeof(*s->head));
+
+/* ========================================================================= */
+int ZEXPORT deflateInit_(strm, level, version, stream_size)
+ z_streamp strm;
+ int level;
+ const char *version;
+ int stream_size;
+{
+ return deflateInit2_(strm, level, Z_DEFLATED, MAX_WBITS, DEF_MEM_LEVEL,
+ Z_DEFAULT_STRATEGY, version, stream_size);
+ /* To do: ignore strm->next_in if we use it as window */
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateInit2_(strm, level, method, windowBits, memLevel, strategy,
+ version, stream_size)
+ z_streamp strm;
+ int level;
+ int method;
+ int windowBits;
+ int memLevel;
+ int strategy;
+ const char *version;
+ int stream_size;
+{
+ deflate_state *s;
+ int noheader = 0;
+ static const char* my_version = ZLIB_VERSION;
+
+ ushf *overlay;
+ /* We overlay pending_buf and d_buf+l_buf. This works since the average
+ * output size for (length,distance) codes is <= 24 bits.
+ */
+
+ if (version == Z_NULL || version[0] != my_version[0] ||
+ stream_size != sizeof(z_stream)) {
+ return Z_VERSION_ERROR;
+ }
+ if (strm == Z_NULL) return Z_STREAM_ERROR;
+
+ strm->msg = Z_NULL;
+ if (strm->zalloc == Z_NULL) {
+ strm->zalloc = zcalloc;
+ strm->opaque = (voidpf)0;
+ }
+ if (strm->zfree == Z_NULL) strm->zfree = zcfree;
+
+ if (level == Z_DEFAULT_COMPRESSION) level = 6;
+#ifdef FASTEST
+ level = 1;
+#endif
+
+ if (windowBits < 0) { /* undocumented feature: suppress zlib header */
+ noheader = 1;
+ windowBits = -windowBits;
+ }
+ if (memLevel < 1 || memLevel > MAX_MEM_LEVEL || method != Z_DEFLATED ||
+ windowBits < 8 || windowBits > 15 || level < 0 || level > 9 ||
+ strategy < 0 || strategy > Z_HUFFMAN_ONLY) {
+ return Z_STREAM_ERROR;
+ }
+ s = (deflate_state *) ZALLOC(strm, 1, sizeof(deflate_state));
+ if (s == Z_NULL) return Z_MEM_ERROR;
+ strm->state = (struct internal_state FAR *)s;
+ s->strm = strm;
+
+ s->noheader = noheader;
+ s->w_bits = windowBits;
+ s->w_size = 1 << s->w_bits;
+ s->w_mask = s->w_size - 1;
+
+ s->hash_bits = memLevel + 7;
+ s->hash_size = 1 << s->hash_bits;
+ s->hash_mask = s->hash_size - 1;
+ s->hash_shift = ((s->hash_bits+MIN_MATCH-1)/MIN_MATCH);
+
+ s->window = (Bytef *) ZALLOC(strm, s->w_size, 2*sizeof(Byte));
+ s->prev = (Posf *) ZALLOC(strm, s->w_size, sizeof(Pos));
+ s->head = (Posf *) ZALLOC(strm, s->hash_size, sizeof(Pos));
+
+ s->lit_bufsize = 1 << (memLevel + 6); /* 16K elements by default */
+
+ overlay = (ushf *) ZALLOC(strm, s->lit_bufsize, sizeof(ush)+2);
+ s->pending_buf = (uchf *) overlay;
+ s->pending_buf_size = (ulg)s->lit_bufsize * (sizeof(ush)+2L);
+
+ if (s->window == Z_NULL || s->prev == Z_NULL || s->head == Z_NULL ||
+ s->pending_buf == Z_NULL) {
+ strm->msg = (char*)ERR_MSG(Z_MEM_ERROR);
+ deflateEnd (strm);
+ return Z_MEM_ERROR;
+ }
+ s->d_buf = overlay + s->lit_bufsize/sizeof(ush);
+ s->l_buf = s->pending_buf + (1+sizeof(ush))*s->lit_bufsize;
+
+ s->level = level;
+ s->strategy = strategy;
+ s->method = (Byte)method;
+
+ return deflateReset(strm);
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateSetDictionary (strm, dictionary, dictLength)
+ z_streamp strm;
+ const Bytef *dictionary;
+ uInt dictLength;
+{
+ deflate_state *s;
+ uInt length = dictLength;
+ uInt n;
+ IPos hash_head = 0;
+
+ if (strm == Z_NULL || strm->state == Z_NULL || dictionary == Z_NULL ||
+ strm->state->status != INIT_STATE) return Z_STREAM_ERROR;
+
+ s = strm->state;
+ strm->adler = adler32(strm->adler, dictionary, dictLength);
+
+ if (length < MIN_MATCH) return Z_OK;
+ if (length > MAX_DIST(s)) {
+ length = MAX_DIST(s);
+#ifndef USE_DICT_HEAD
+ dictionary += dictLength - length; /* use the tail of the dictionary */
+#endif
+ }
+ zmemcpy(s->window, dictionary, length);
+ s->strstart = length;
+ s->block_start = (long)length;
+
+ /* Insert all strings in the hash table (except for the last two bytes).
+ * s->lookahead stays null, so s->ins_h will be recomputed at the next
+ * call of fill_window.
+ */
+ s->ins_h = s->window[0];
+ UPDATE_HASH(s, s->ins_h, s->window[1]);
+ for (n = 0; n <= length - MIN_MATCH; n++) {
+ INSERT_STRING(s, n, hash_head);
+ }
+ if (hash_head) hash_head = 0; /* to make compiler happy */
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateReset (strm)
+ z_streamp strm;
+{
+ deflate_state *s;
+
+ if (strm == Z_NULL || strm->state == Z_NULL ||
+ strm->zalloc == Z_NULL || strm->zfree == Z_NULL) return Z_STREAM_ERROR;
+
+ strm->total_in = strm->total_out = 0;
+ strm->msg = Z_NULL; /* use zfree if we ever allocate msg dynamically */
+ strm->data_type = Z_UNKNOWN;
+
+ s = (deflate_state *)strm->state;
+ s->pending = 0;
+ s->pending_out = s->pending_buf;
+
+ if (s->noheader < 0) {
+ s->noheader = 0; /* was set to -1 by deflate(..., Z_FINISH); */
+ }
+ s->status = s->noheader ? BUSY_STATE : INIT_STATE;
+ strm->adler = 1;
+ s->last_flush = Z_NO_FLUSH;
+
+ _tr_init(s);
+ lm_init(s);
+
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateParams(strm, level, strategy)
+ z_streamp strm;
+ int level;
+ int strategy;
+{
+ deflate_state *s;
+ compress_func func;
+ int err = Z_OK;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ s = strm->state;
+
+ if (level == Z_DEFAULT_COMPRESSION) {
+ level = 6;
+ }
+ if (level < 0 || level > 9 || strategy < 0 || strategy > Z_HUFFMAN_ONLY) {
+ return Z_STREAM_ERROR;
+ }
+ func = configuration_table[s->level].func;
+
+ if (func != configuration_table[level].func && strm->total_in != 0) {
+ /* Flush the last buffer: */
+ err = deflate(strm, Z_PARTIAL_FLUSH);
+ }
+ if (s->level != level) {
+ s->level = level;
+ s->max_lazy_match = configuration_table[level].max_lazy;
+ s->good_match = configuration_table[level].good_length;
+ s->nice_match = configuration_table[level].nice_length;
+ s->max_chain_length = configuration_table[level].max_chain;
+ }
+ s->strategy = strategy;
+ return err;
+}
+
+/* =========================================================================
+ * Put a short in the pending buffer. The 16-bit value is put in MSB order.
+ * IN assertion: the stream state is correct and there is enough room in
+ * pending_buf.
+ */
+local void putShortMSB (s, b)
+ deflate_state *s;
+ uInt b;
+{
+ put_byte(s, (Byte)(b >> 8));
+ put_byte(s, (Byte)(b & 0xff));
+}
+
+/* =========================================================================
+ * Flush as much pending output as possible. All deflate() output goes
+ * through this function so some applications may wish to modify it
+ * to avoid allocating a large strm->next_out buffer and copying into it.
+ * (See also read_buf()).
+ */
+local void flush_pending(strm)
+ z_streamp strm;
+{
+ unsigned len = strm->state->pending;
+
+ if (len > strm->avail_out) len = strm->avail_out;
+ if (len == 0) return;
+
+ zmemcpy(strm->next_out, strm->state->pending_out, len);
+ strm->next_out += len;
+ strm->state->pending_out += len;
+ strm->total_out += len;
+ strm->avail_out -= len;
+ strm->state->pending -= len;
+ if (strm->state->pending == 0) {
+ strm->state->pending_out = strm->state->pending_buf;
+ }
+}
+
+/* ========================================================================= */
+int ZEXPORT deflate (strm, flush)
+ z_streamp strm;
+ int flush;
+{
+ int old_flush; /* value of flush param for previous deflate call */
+ deflate_state *s;
+
+ if (strm == Z_NULL || strm->state == Z_NULL ||
+ flush > Z_FINISH || flush < 0) {
+ return Z_STREAM_ERROR;
+ }
+ s = strm->state;
+
+ if (strm->next_out == Z_NULL ||
+ (strm->next_in == Z_NULL && strm->avail_in != 0) ||
+ (s->status == FINISH_STATE && flush != Z_FINISH)) {
+ ERR_RETURN(strm, Z_STREAM_ERROR);
+ }
+ if (strm->avail_out == 0) ERR_RETURN(strm, Z_BUF_ERROR);
+
+ s->strm = strm; /* just in case */
+ old_flush = s->last_flush;
+ s->last_flush = flush;
+
+ /* Write the zlib header */
+ if (s->status == INIT_STATE) {
+
+ uInt header = (Z_DEFLATED + ((s->w_bits-8)<<4)) << 8;
+ uInt level_flags = (s->level-1) >> 1;
+
+ if (level_flags > 3) level_flags = 3;
+ header |= (level_flags << 6);
+ if (s->strstart != 0) header |= PRESET_DICT;
+ header += 31 - (header % 31);
+
+ s->status = BUSY_STATE;
+ putShortMSB(s, header);
+
+ /* Save the adler32 of the preset dictionary: */
+ if (s->strstart != 0) {
+ putShortMSB(s, (uInt)(strm->adler >> 16));
+ putShortMSB(s, (uInt)(strm->adler & 0xffff));
+ }
+ strm->adler = 1L;
+ }
+
+ /* Flush as much pending output as possible */
+ if (s->pending != 0) {
+ flush_pending(strm);
+ if (strm->avail_out == 0) {
+ /* Since avail_out is 0, deflate will be called again with
+ * more output space, but possibly with both pending and
+ * avail_in equal to zero. There won't be anything to do,
+ * but this is not an error situation so make sure we
+ * return OK instead of BUF_ERROR at next call of deflate:
+ */
+ s->last_flush = -1;
+ return Z_OK;
+ }
+
+ /* Make sure there is something to do and avoid duplicate consecutive
+ * flushes. For repeated and useless calls with Z_FINISH, we keep
+ * returning Z_STREAM_END instead of Z_BUFF_ERROR.
+ */
+ } else if (strm->avail_in == 0 && flush <= old_flush &&
+ flush != Z_FINISH) {
+ ERR_RETURN(strm, Z_BUF_ERROR);
+ }
+
+ /* User must not provide more input after the first FINISH: */
+ if (s->status == FINISH_STATE && strm->avail_in != 0) {
+ ERR_RETURN(strm, Z_BUF_ERROR);
+ }
+
+ /* Start a new block or continue the current one.
+ */
+ if (strm->avail_in != 0 || s->lookahead != 0 ||
+ (flush != Z_NO_FLUSH && s->status != FINISH_STATE)) {
+ block_state bstate;
+
+ bstate = (*(configuration_table[s->level].func))(s, flush);
+
+ if (bstate == finish_started || bstate == finish_done) {
+ s->status = FINISH_STATE;
+ }
+ if (bstate == need_more || bstate == finish_started) {
+ if (strm->avail_out == 0) {
+ s->last_flush = -1; /* avoid BUF_ERROR next call, see above */
+ }
+ return Z_OK;
+ /* If flush != Z_NO_FLUSH && avail_out == 0, the next call
+ * of deflate should use the same flush parameter to make sure
+ * that the flush is complete. So we don't have to output an
+ * empty block here, this will be done at next call. This also
+ * ensures that for a very small output buffer, we emit at most
+ * one empty block.
+ */
+ }
+ if (bstate == block_done) {
+ if (flush == Z_PARTIAL_FLUSH) {
+ _tr_align(s);
+ } else { /* FULL_FLUSH or SYNC_FLUSH */
+ _tr_stored_block(s, (char*)0, 0L, 0);
+ /* For a full flush, this empty block will be recognized
+ * as a special marker by inflate_sync().
+ */
+ if (flush == Z_FULL_FLUSH) {
+ CLEAR_HASH(s); /* forget history */
+ }
+ }
+ flush_pending(strm);
+ if (strm->avail_out == 0) {
+ s->last_flush = -1; /* avoid BUF_ERROR at next call, see above */
+ return Z_OK;
+ }
+ }
+ }
+ Assert(strm->avail_out > 0, "bug2");
+
+ if (flush != Z_FINISH) return Z_OK;
+ if (s->noheader) return Z_STREAM_END;
+
+ /* Write the zlib trailer (adler32) */
+ putShortMSB(s, (uInt)(strm->adler >> 16));
+ putShortMSB(s, (uInt)(strm->adler & 0xffff));
+ flush_pending(strm);
+ /* If avail_out is zero, the application will call deflate again
+ * to flush the rest.
+ */
+ s->noheader = -1; /* write the trailer only once! */
+ return s->pending != 0 ? Z_OK : Z_STREAM_END;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateEnd (strm)
+ z_streamp strm;
+{
+ int status;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+
+ status = strm->state->status;
+ if (status != INIT_STATE && status != BUSY_STATE &&
+ status != FINISH_STATE) {
+ return Z_STREAM_ERROR;
+ }
+
+ /* Deallocate in reverse order of allocations: */
+ TRY_FREE(strm, strm->state->pending_buf);
+ TRY_FREE(strm, strm->state->head);
+ TRY_FREE(strm, strm->state->prev);
+ TRY_FREE(strm, strm->state->window);
+
+ ZFREE(strm, strm->state);
+ strm->state = Z_NULL;
+
+ return status == BUSY_STATE ? Z_DATA_ERROR : Z_OK;
+}
+
+/* =========================================================================
+ * Copy the source state to the destination state.
+ * To simplify the source, this is not supported for 16-bit MSDOS (which
+ * doesn't have enough memory anyway to duplicate compression states).
+ */
+int ZEXPORT deflateCopy (dest, source)
+ z_streamp dest;
+ z_streamp source;
+{
+#ifdef MAXSEG_64K
+ return Z_STREAM_ERROR;
+#else
+ deflate_state *ds;
+ deflate_state *ss;
+ ushf *overlay;
+
+
+ if (source == Z_NULL || dest == Z_NULL || source->state == Z_NULL) {
+ return Z_STREAM_ERROR;
+ }
+
+ ss = source->state;
+
+ *dest = *source;
+
+ ds = (deflate_state *) ZALLOC(dest, 1, sizeof(deflate_state));
+ if (ds == Z_NULL) return Z_MEM_ERROR;
+ dest->state = (struct internal_state FAR *) ds;
+ *ds = *ss;
+ ds->strm = dest;
+
+ ds->window = (Bytef *) ZALLOC(dest, ds->w_size, 2*sizeof(Byte));
+ ds->prev = (Posf *) ZALLOC(dest, ds->w_size, sizeof(Pos));
+ ds->head = (Posf *) ZALLOC(dest, ds->hash_size, sizeof(Pos));
+ overlay = (ushf *) ZALLOC(dest, ds->lit_bufsize, sizeof(ush)+2);
+ ds->pending_buf = (uchf *) overlay;
+
+ if (ds->window == Z_NULL || ds->prev == Z_NULL || ds->head == Z_NULL ||
+ ds->pending_buf == Z_NULL) {
+ deflateEnd (dest);
+ return Z_MEM_ERROR;
+ }
+ /* following zmemcpy do not work for 16-bit MSDOS */
+ zmemcpy(ds->window, ss->window, ds->w_size * 2 * sizeof(Byte));
+ zmemcpy(ds->prev, ss->prev, ds->w_size * sizeof(Pos));
+ zmemcpy(ds->head, ss->head, ds->hash_size * sizeof(Pos));
+ zmemcpy(ds->pending_buf, ss->pending_buf, (uInt)ds->pending_buf_size);
+
+ ds->pending_out = ds->pending_buf + (ss->pending_out - ss->pending_buf);
+ ds->d_buf = overlay + ds->lit_bufsize/sizeof(ush);
+ ds->l_buf = ds->pending_buf + (1+sizeof(ush))*ds->lit_bufsize;
+
+ ds->l_desc.dyn_tree = ds->dyn_ltree;
+ ds->d_desc.dyn_tree = ds->dyn_dtree;
+ ds->bl_desc.dyn_tree = ds->bl_tree;
+
+ return Z_OK;
+#endif
+}
+
+/* ===========================================================================
+ * Read a new buffer from the current input stream, update the adler32
+ * and total number of bytes read. All deflate() input goes through
+ * this function so some applications may wish to modify it to avoid
+ * allocating a large strm->next_in buffer and copying from it.
+ * (See also flush_pending()).
+ */
+local int read_buf(strm, buf, size)
+ z_streamp strm;
+ Bytef *buf;
+ unsigned size;
+{
+ unsigned len = strm->avail_in;
+
+ if (len > size) len = size;
+ if (len == 0) return 0;
+
+ strm->avail_in -= len;
+
+ if (!strm->state->noheader) {
+ strm->adler = adler32(strm->adler, strm->next_in, len);
+ }
+ zmemcpy(buf, strm->next_in, len);
+ strm->next_in += len;
+ strm->total_in += len;
+
+ return (int)len;
+}
+
+/* ===========================================================================
+ * Initialize the "longest match" routines for a new zlib stream
+ */
+local void lm_init (s)
+ deflate_state *s;
+{
+ s->window_size = (ulg)2L*s->w_size;
+
+ CLEAR_HASH(s);
+
+ /* Set the default configuration parameters:
+ */
+ s->max_lazy_match = configuration_table[s->level].max_lazy;
+ s->good_match = configuration_table[s->level].good_length;
+ s->nice_match = configuration_table[s->level].nice_length;
+ s->max_chain_length = configuration_table[s->level].max_chain;
+
+ s->strstart = 0;
+ s->block_start = 0L;
+ s->lookahead = 0;
+ s->match_length = s->prev_length = MIN_MATCH-1;
+ s->match_available = 0;
+ s->ins_h = 0;
+#ifdef ASMV
+ match_init(); /* initialize the asm code */
+#endif
+}
+
+/* ===========================================================================
+ * Set match_start to the longest match starting at the given string and
+ * return its length. Matches shorter or equal to prev_length are discarded,
+ * in which case the result is equal to prev_length and match_start is
+ * garbage.
+ * IN assertions: cur_match is the head of the hash chain for the current
+ * string (strstart) and its distance is <= MAX_DIST, and prev_length >= 1
+ * OUT assertion: the match length is not greater than s->lookahead.
+ */
+#ifndef ASMV
+/* For 80x86 and 680x0, an optimized version will be provided in match.asm or
+ * match.S. The code will be functionally equivalent.
+ */
+#ifndef FASTEST
+local uInt longest_match(s, cur_match)
+ deflate_state *s;
+ IPos cur_match; /* current match */
+{
+ unsigned chain_length = s->max_chain_length;/* max hash chain length */
+ register Bytef *scan = s->window + s->strstart; /* current string */
+ register Bytef *match; /* matched string */
+ register int len; /* length of current match */
+ int best_len = s->prev_length; /* best match length so far */
+ int nice_match = s->nice_match; /* stop if match long enough */
+ IPos limit = s->strstart > (IPos)MAX_DIST(s) ?
+ s->strstart - (IPos)MAX_DIST(s) : NIL;
+ /* Stop when cur_match becomes <= limit. To simplify the code,
+ * we prevent matches with the string of window index 0.
+ */
+ Posf *prev = s->prev;
+ uInt wmask = s->w_mask;
+
+#ifdef UNALIGNED_OK
+ /* Compare two bytes at a time. Note: this is not always beneficial.
+ * Try with and without -DUNALIGNED_OK to check.
+ */
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1;
+ register ush scan_start = *(ushf*)scan;
+ register ush scan_end = *(ushf*)(scan+best_len-1);
+#else
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH;
+ register Byte scan_end1 = scan[best_len-1];
+ register Byte scan_end = scan[best_len];
+#endif
+
+ /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16.
+ * It is easy to get rid of this optimization if necessary.
+ */
+ Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever");
+
+ /* Do not waste too much time if we already have a good match: */
+ if (s->prev_length >= s->good_match) {
+ chain_length >>= 2;
+ }
+ /* Do not look for matches beyond the end of the input. This is necessary
+ * to make deflate deterministic.
+ */
+ if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead;
+
+ Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead");
+
+ do {
+ Assert(cur_match < s->strstart, "no future");
+ match = s->window + cur_match;
+
+ /* Skip to next match if the match length cannot increase
+ * or if the match length is less than 2:
+ */
+#if (defined(UNALIGNED_OK) && MAX_MATCH == 258)
+ /* This code assumes sizeof(unsigned short) == 2. Do not use
+ * UNALIGNED_OK if your compiler uses a different size.
+ */
+ if (*(ushf*)(match+best_len-1) != scan_end ||
+ *(ushf*)match != scan_start) continue;
+
+ /* It is not necessary to compare scan[2] and match[2] since they are
+ * always equal when the other bytes match, given that the hash keys
+ * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at
+ * strstart+3, +5, ... up to strstart+257. We check for insufficient
+ * lookahead only every 4th comparison; the 128th check will be made
+ * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is
+ * necessary to put more guard bytes at the end of the window, or
+ * to check more often for insufficient lookahead.
+ */
+ Assert(scan[2] == match[2], "scan[2]?");
+ scan++, match++;
+ do {
+ } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ scan < strend);
+ /* The funny "do {}" generates better code on most compilers */
+
+ /* Here, scan <= window+strstart+257 */
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+ if (*scan == *match) scan++;
+
+ len = (MAX_MATCH - 1) - (int)(strend-scan);
+ scan = strend - (MAX_MATCH-1);
+
+#else /* UNALIGNED_OK */
+
+ if (match[best_len] != scan_end ||
+ match[best_len-1] != scan_end1 ||
+ *match != *scan ||
+ *++match != scan[1]) continue;
+
+ /* The check at best_len-1 can be removed because it will be made
+ * again later. (This heuristic is not always a win.)
+ * It is not necessary to compare scan[2] and match[2] since they
+ * are always equal when the other bytes match, given that
+ * the hash keys are equal and that HASH_BITS >= 8.
+ */
+ scan += 2, match++;
+ Assert(*scan == *match, "match[2]?");
+
+ /* We check for insufficient lookahead only every 8th comparison;
+ * the 256th check will be made at strstart+258.
+ */
+ do {
+ } while (*++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ scan < strend);
+
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+
+ len = MAX_MATCH - (int)(strend - scan);
+ scan = strend - MAX_MATCH;
+
+#endif /* UNALIGNED_OK */
+
+ if (len > best_len) {
+ s->match_start = cur_match;
+ best_len = len;
+ if (len >= nice_match) break;
+#ifdef UNALIGNED_OK
+ scan_end = *(ushf*)(scan+best_len-1);
+#else
+ scan_end1 = scan[best_len-1];
+ scan_end = scan[best_len];
+#endif
+ }
+ } while ((cur_match = prev[cur_match & wmask]) > limit
+ && --chain_length != 0);
+
+ if ((uInt)best_len <= s->lookahead) return (uInt)best_len;
+ return s->lookahead;
+}
+
+#else /* FASTEST */
+/* ---------------------------------------------------------------------------
+ * Optimized version for level == 1 only
+ */
+local uInt longest_match(s, cur_match)
+ deflate_state *s;
+ IPos cur_match; /* current match */
+{
+ register Bytef *scan = s->window + s->strstart; /* current string */
+ register Bytef *match; /* matched string */
+ register int len; /* length of current match */
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH;
+
+ /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16.
+ * It is easy to get rid of this optimization if necessary.
+ */
+ Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever");
+
+ Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead");
+
+ Assert(cur_match < s->strstart, "no future");
+
+ match = s->window + cur_match;
+
+ /* Return failure if the match length is less than 2:
+ */
+ if (match[0] != scan[0] || match[1] != scan[1]) return MIN_MATCH-1;
+
+ /* The check at best_len-1 can be removed because it will be made
+ * again later. (This heuristic is not always a win.)
+ * It is not necessary to compare scan[2] and match[2] since they
+ * are always equal when the other bytes match, given that
+ * the hash keys are equal and that HASH_BITS >= 8.
+ */
+ scan += 2, match += 2;
+ Assert(*scan == *match, "match[2]?");
+
+ /* We check for insufficient lookahead only every 8th comparison;
+ * the 256th check will be made at strstart+258.
+ */
+ do {
+ } while (*++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ scan < strend);
+
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+
+ len = MAX_MATCH - (int)(strend - scan);
+
+ if (len < MIN_MATCH) return MIN_MATCH - 1;
+
+ s->match_start = cur_match;
+ return len <= s->lookahead ? len : s->lookahead;
+}
+#endif /* FASTEST */
+#endif /* ASMV */
+
+#ifdef DEBUG
+/* ===========================================================================
+ * Check that the match at match_start is indeed a match.
+ */
+local void check_match(s, start, match, length)
+ deflate_state *s;
+ IPos start, match;
+ int length;
+{
+ /* check that the match is indeed a match */
+ if (zmemcmp(s->window + match,
+ s->window + start, length) != EQUAL) {
+ fprintf(stderr, " start %u, match %u, length %d\n",
+ start, match, length);
+ do {
+ fprintf(stderr, "%c%c", s->window[match++], s->window[start++]);
+ } while (--length != 0);
+ z_error("invalid match");
+ }
+ if (z_verbose > 1) {
+ fprintf(stderr,"\\[%d,%d]", start-match, length);
+ do { putc(s->window[start++], stderr); } while (--length != 0);
+ }
+}
+#else
+# define check_match(s, start, match, length)
+#endif
+
+/* ===========================================================================
+ * Fill the window when the lookahead becomes insufficient.
+ * Updates strstart and lookahead.
+ *
+ * IN assertion: lookahead < MIN_LOOKAHEAD
+ * OUT assertions: strstart <= window_size-MIN_LOOKAHEAD
+ * At least one byte has been read, or avail_in == 0; reads are
+ * performed for at least two bytes (required for the zip translate_eol
+ * option -- not supported here).
+ */
+local void fill_window(s)
+ deflate_state *s;
+{
+ register unsigned n, m;
+ register Posf *p;
+ unsigned more; /* Amount of free space at the end of the window. */
+ uInt wsize = s->w_size;
+
+ do {
+ more = (unsigned)(s->window_size -(ulg)s->lookahead -(ulg)s->strstart);
+
+ /* Deal with !@#$% 64K limit: */
+ if (more == 0 && s->strstart == 0 && s->lookahead == 0) {
+ more = wsize;
+
+ } else if (more == (unsigned)(-1)) {
+ /* Very unlikely, but possible on 16 bit machine if strstart == 0
+ * and lookahead == 1 (input done one byte at time)
+ */
+ more--;
+
+ /* If the window is almost full and there is insufficient lookahead,
+ * move the upper half to the lower one to make room in the upper half.
+ */
+ } else if (s->strstart >= wsize+MAX_DIST(s)) {
+
+ zmemcpy(s->window, s->window+wsize, (unsigned)wsize);
+ s->match_start -= wsize;
+ s->strstart -= wsize; /* we now have strstart >= MAX_DIST */
+ s->block_start -= (long) wsize;
+
+ /* Slide the hash table (could be avoided with 32 bit values
+ at the expense of memory usage). We slide even when level == 0
+ to keep the hash table consistent if we switch back to level > 0
+ later. (Using level 0 permanently is not an optimal usage of
+ zlib, so we don't care about this pathological case.)
+ */
+ n = s->hash_size;
+ p = &s->head[n];
+ do {
+ m = *--p;
+ *p = (Pos)(m >= wsize ? m-wsize : NIL);
+ } while (--n);
+
+ n = wsize;
+#ifndef FASTEST
+ p = &s->prev[n];
+ do {
+ m = *--p;
+ *p = (Pos)(m >= wsize ? m-wsize : NIL);
+ /* If n is not on any hash chain, prev[n] is garbage but
+ * its value will never be used.
+ */
+ } while (--n);
+#endif
+ more += wsize;
+ }
+ if (s->strm->avail_in == 0) return;
+
+ /* If there was no sliding:
+ * strstart <= WSIZE+MAX_DIST-1 && lookahead <= MIN_LOOKAHEAD - 1 &&
+ * more == window_size - lookahead - strstart
+ * => more >= window_size - (MIN_LOOKAHEAD-1 + WSIZE + MAX_DIST-1)
+ * => more >= window_size - 2*WSIZE + 2
+ * In the BIG_MEM or MMAP case (not yet supported),
+ * window_size == input_size + MIN_LOOKAHEAD &&
+ * strstart + s->lookahead <= input_size => more >= MIN_LOOKAHEAD.
+ * Otherwise, window_size == 2*WSIZE so more >= 2.
+ * If there was sliding, more >= WSIZE. So in all cases, more >= 2.
+ */
+ Assert(more >= 2, "more < 2");
+
+ n = read_buf(s->strm, s->window + s->strstart + s->lookahead, more);
+ s->lookahead += n;
+
+ /* Initialize the hash value now that we have some input: */
+ if (s->lookahead >= MIN_MATCH) {
+ s->ins_h = s->window[s->strstart];
+ UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]);
+#if MIN_MATCH != 3
+ Call UPDATE_HASH() MIN_MATCH-3 more times
+#endif
+ }
+ /* If the whole input has less than MIN_MATCH bytes, ins_h is garbage,
+ * but this is not important since only literal bytes will be emitted.
+ */
+
+ } while (s->lookahead < MIN_LOOKAHEAD && s->strm->avail_in != 0);
+}
+
+/* ===========================================================================
+ * Flush the current block, with given end-of-file flag.
+ * IN assertion: strstart is set to the end of the current match.
+ */
+#define FLUSH_BLOCK_ONLY(s, eof) { \
+ _tr_flush_block(s, (s->block_start >= 0L ? \
+ (charf *)&s->window[(unsigned)s->block_start] : \
+ (charf *)Z_NULL), \
+ (ulg)((long)s->strstart - s->block_start), \
+ (eof)); \
+ s->block_start = s->strstart; \
+ flush_pending(s->strm); \
+ Tracev((stderr,"[FLUSH]")); \
+}
+
+/* Same but force premature exit if necessary. */
+#define FLUSH_BLOCK(s, eof) { \
+ FLUSH_BLOCK_ONLY(s, eof); \
+ if (s->strm->avail_out == 0) return (eof) ? finish_started : need_more; \
+}
+
+/* ===========================================================================
+ * Copy without compression as much as possible from the input stream, return
+ * the current block state.
+ * This function does not insert new strings in the dictionary since
+ * uncompressible data is probably not useful. This function is used
+ * only for the level=0 compression option.
+ * NOTE: this function should be optimized to avoid extra copying from
+ * window to pending_buf.
+ */
+local block_state deflate_stored(s, flush)
+ deflate_state *s;
+ int flush;
+{
+ /* Stored blocks are limited to 0xffff bytes, pending_buf is limited
+ * to pending_buf_size, and each stored block has a 5 byte header:
+ */
+ ulg max_block_size = 0xffff;
+ ulg max_start;
+
+ if (max_block_size > s->pending_buf_size - 5) {
+ max_block_size = s->pending_buf_size - 5;
+ }
+
+ /* Copy as much as possible from input to output: */
+ for (;;) {
+ /* Fill the window as much as possible: */
+ if (s->lookahead <= 1) {
+
+ Assert(s->strstart < s->w_size+MAX_DIST(s) ||
+ s->block_start >= (long)s->w_size, "slide too late");
+
+ fill_window(s);
+ if (s->lookahead == 0 && flush == Z_NO_FLUSH) return need_more;
+
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+ Assert(s->block_start >= 0L, "block gone");
+
+ s->strstart += s->lookahead;
+ s->lookahead = 0;
+
+ /* Emit a stored block if pending_buf will be full: */
+ max_start = s->block_start + max_block_size;
+ if (s->strstart == 0 || (ulg)s->strstart >= max_start) {
+ /* strstart == 0 is possible when wraparound on 16-bit machine */
+ s->lookahead = (uInt)(s->strstart - max_start);
+ s->strstart = (uInt)max_start;
+ FLUSH_BLOCK(s, 0);
+ }
+ /* Flush if we may have to slide, otherwise block_start may become
+ * negative and the data will be gone:
+ */
+ if (s->strstart - (uInt)s->block_start >= MAX_DIST(s)) {
+ FLUSH_BLOCK(s, 0);
+ }
+ }
+ FLUSH_BLOCK(s, flush == Z_FINISH);
+ return flush == Z_FINISH ? finish_done : block_done;
+}
+
+/* ===========================================================================
+ * Compress as much as possible from the input stream, return the current
+ * block state.
+ * This function does not perform lazy evaluation of matches and inserts
+ * new strings in the dictionary only for unmatched strings or for short
+ * matches. It is used only for the fast compression options.
+ */
+local block_state deflate_fast(s, flush)
+ deflate_state *s;
+ int flush;
+{
+ IPos hash_head = NIL; /* head of the hash chain */
+ int bflush; /* set if current block must be flushed */
+
+ for (;;) {
+ /* Make sure that we always have enough lookahead, except
+ * at the end of the input file. We need MAX_MATCH bytes
+ * for the next match, plus MIN_MATCH bytes to insert the
+ * string following the next match.
+ */
+ if (s->lookahead < MIN_LOOKAHEAD) {
+ fill_window(s);
+ if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) {
+ return need_more;
+ }
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+
+ /* Insert the string window[strstart .. strstart+2] in the
+ * dictionary, and set hash_head to the head of the hash chain:
+ */
+ if (s->lookahead >= MIN_MATCH) {
+ INSERT_STRING(s, s->strstart, hash_head);
+ }
+
+ /* Find the longest match, discarding those <= prev_length.
+ * At this point we have always match_length < MIN_MATCH
+ */
+ if (hash_head != NIL && s->strstart - hash_head <= MAX_DIST(s)) {
+ /* To simplify the code, we prevent matches with the string
+ * of window index 0 (in particular we have to avoid a match
+ * of the string with itself at the start of the input file).
+ */
+ if (s->strategy != Z_HUFFMAN_ONLY) {
+ s->match_length = longest_match (s, hash_head);
+ }
+ /* longest_match() sets match_start */
+ }
+ if (s->match_length >= MIN_MATCH) {
+ check_match(s, s->strstart, s->match_start, s->match_length);
+
+ _tr_tally_dist(s, s->strstart - s->match_start,
+ s->match_length - MIN_MATCH, bflush);
+
+ s->lookahead -= s->match_length;
+
+ /* Insert new strings in the hash table only if the match length
+ * is not too large. This saves time but degrades compression.
+ */
+#ifndef FASTEST
+ if (s->match_length <= s->max_insert_length &&
+ s->lookahead >= MIN_MATCH) {
+ s->match_length--; /* string at strstart already in hash table */
+ do {
+ s->strstart++;
+ INSERT_STRING(s, s->strstart, hash_head);
+ /* strstart never exceeds WSIZE-MAX_MATCH, so there are
+ * always MIN_MATCH bytes ahead.
+ */
+ } while (--s->match_length != 0);
+ s->strstart++;
+ } else
+#endif
+ {
+ s->strstart += s->match_length;
+ s->match_length = 0;
+ s->ins_h = s->window[s->strstart];
+ UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]);
+#if MIN_MATCH != 3
+ Call UPDATE_HASH() MIN_MATCH-3 more times
+#endif
+ /* If lookahead < MIN_MATCH, ins_h is garbage, but it does not
+ * matter since it will be recomputed at next deflate call.
+ */
+ }
+ } else {
+ /* No match, output a literal byte */
+ Tracevv((stderr,"%c", s->window[s->strstart]));
+ _tr_tally_lit (s, s->window[s->strstart], bflush);
+ s->lookahead--;
+ s->strstart++;
+ }
+ if (bflush) FLUSH_BLOCK(s, 0);
+ }
+ FLUSH_BLOCK(s, flush == Z_FINISH);
+ return flush == Z_FINISH ? finish_done : block_done;
+}
+
+/* ===========================================================================
+ * Same as above, but achieves better compression. We use a lazy
+ * evaluation for matches: a match is finally adopted only if there is
+ * no better match at the next window position.
+ */
+local block_state deflate_slow(s, flush)
+ deflate_state *s;
+ int flush;
+{
+ IPos hash_head = NIL; /* head of hash chain */
+ int bflush; /* set if current block must be flushed */
+
+ /* Process the input block. */
+ for (;;) {
+ /* Make sure that we always have enough lookahead, except
+ * at the end of the input file. We need MAX_MATCH bytes
+ * for the next match, plus MIN_MATCH bytes to insert the
+ * string following the next match.
+ */
+ if (s->lookahead < MIN_LOOKAHEAD) {
+ fill_window(s);
+ if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) {
+ return need_more;
+ }
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+
+ /* Insert the string window[strstart .. strstart+2] in the
+ * dictionary, and set hash_head to the head of the hash chain:
+ */
+ if (s->lookahead >= MIN_MATCH) {
+ INSERT_STRING(s, s->strstart, hash_head);
+ }
+
+ /* Find the longest match, discarding those <= prev_length.
+ */
+ s->prev_length = s->match_length, s->prev_match = s->match_start;
+ s->match_length = MIN_MATCH-1;
+
+ if (hash_head != NIL && s->prev_length < s->max_lazy_match &&
+ s->strstart - hash_head <= MAX_DIST(s)) {
+ /* To simplify the code, we prevent matches with the string
+ * of window index 0 (in particular we have to avoid a match
+ * of the string with itself at the start of the input file).
+ */
+ if (s->strategy != Z_HUFFMAN_ONLY) {
+ s->match_length = longest_match (s, hash_head);
+ }
+ /* longest_match() sets match_start */
+
+ if (s->match_length <= 5 && (s->strategy == Z_FILTERED ||
+ (s->match_length == MIN_MATCH &&
+ s->strstart - s->match_start > TOO_FAR))) {
+
+ /* If prev_match is also MIN_MATCH, match_start is garbage
+ * but we will ignore the current match anyway.
+ */
+ s->match_length = MIN_MATCH-1;
+ }
+ }
+ /* If there was a match at the previous step and the current
+ * match is not better, output the previous match:
+ */
+ if (s->prev_length >= MIN_MATCH && s->match_length <= s->prev_length) {
+ uInt max_insert = s->strstart + s->lookahead - MIN_MATCH;
+ /* Do not insert strings in hash table beyond this. */
+
+ check_match(s, s->strstart-1, s->prev_match, s->prev_length);
+
+ _tr_tally_dist(s, s->strstart -1 - s->prev_match,
+ s->prev_length - MIN_MATCH, bflush);
+
+ /* Insert in hash table all strings up to the end of the match.
+ * strstart-1 and strstart are already inserted. If there is not
+ * enough lookahead, the last two strings are not inserted in
+ * the hash table.
+ */
+ s->lookahead -= s->prev_length-1;
+ s->prev_length -= 2;
+ do {
+ if (++s->strstart <= max_insert) {
+ INSERT_STRING(s, s->strstart, hash_head);
+ }
+ } while (--s->prev_length != 0);
+ s->match_available = 0;
+ s->match_length = MIN_MATCH-1;
+ s->strstart++;
+
+ if (bflush) FLUSH_BLOCK(s, 0);
+
+ } else if (s->match_available) {
+ /* If there was no match at the previous position, output a
+ * single literal. If there was a match but the current match
+ * is longer, truncate the previous match to a single literal.
+ */
+ Tracevv((stderr,"%c", s->window[s->strstart-1]));
+ _tr_tally_lit(s, s->window[s->strstart-1], bflush);
+ if (bflush) {
+ FLUSH_BLOCK_ONLY(s, 0);
+ }
+ s->strstart++;
+ s->lookahead--;
+ if (s->strm->avail_out == 0) return need_more;
+ } else {
+ /* There is no previous match to compare with, wait for
+ * the next step to decide.
+ */
+ s->match_available = 1;
+ s->strstart++;
+ s->lookahead--;
+ }
+ }
+ Assert (flush != Z_NO_FLUSH, "no flush?");
+ if (s->match_available) {
+ Tracevv((stderr,"%c", s->window[s->strstart-1]));
+ _tr_tally_lit(s, s->window[s->strstart-1], bflush);
+ s->match_available = 0;
+ }
+ FLUSH_BLOCK(s, flush == Z_FINISH);
+ return flush == Z_FINISH ? finish_done : block_done;
+}
--- /dev/null
+/* deflate.h -- internal compression state
+ * Copyright (C) 1995-1998 Jean-loup Gailly
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* @(#) $Id$ */
+
+#ifndef _DEFLATE_H
+#define _DEFLATE_H
+
+#include "zutil.h"
+
+/* ===========================================================================
+ * Internal compression state.
+ */
+
+#define LENGTH_CODES 29
+/* number of length codes, not counting the special END_BLOCK code */
+
+#define LITERALS 256
+/* number of literal bytes 0..255 */
+
+#define L_CODES (LITERALS+1+LENGTH_CODES)
+/* number of Literal or Length codes, including the END_BLOCK code */
+
+#define D_CODES 30
+/* number of distance codes */
+
+#define BL_CODES 19
+/* number of codes used to transfer the bit lengths */
+
+#define HEAP_SIZE (2*L_CODES+1)
+/* maximum heap size */
+
+#define MAX_BITS 15
+/* All codes must not exceed MAX_BITS bits */
+
+#define INIT_STATE 42
+#define BUSY_STATE 113
+#define FINISH_STATE 666
+/* Stream status */
+
+
+/* Data structure describing a single value and its code string. */
+typedef struct ct_data_s {
+ union {
+ ush freq; /* frequency count */
+ ush code; /* bit string */
+ } fc;
+ union {
+ ush dad; /* father node in Huffman tree */
+ ush len; /* length of bit string */
+ } dl;
+} FAR ct_data;
+
+#define Freq fc.freq
+#define Code fc.code
+#define Dad dl.dad
+#define Len dl.len
+
+typedef struct static_tree_desc_s static_tree_desc;
+
+typedef struct tree_desc_s {
+ ct_data *dyn_tree; /* the dynamic tree */
+ int max_code; /* largest code with non zero frequency */
+ static_tree_desc *stat_desc; /* the corresponding static tree */
+} FAR tree_desc;
+
+typedef ush Pos;
+typedef Pos FAR Posf;
+typedef unsigned IPos;
+
+/* A Pos is an index in the character window. We use short instead of int to
+ * save space in the various tables. IPos is used only for parameter passing.
+ */
+
+typedef struct internal_state {
+ z_streamp strm; /* pointer back to this zlib stream */
+ int status; /* as the name implies */
+ Bytef *pending_buf; /* output still pending */
+ ulg pending_buf_size; /* size of pending_buf */
+ Bytef *pending_out; /* next pending byte to output to the stream */
+ int pending; /* nb of bytes in the pending buffer */
+ int noheader; /* suppress zlib header and adler32 */
+ Byte data_type; /* UNKNOWN, BINARY or ASCII */
+ Byte method; /* STORED (for zip only) or DEFLATED */
+ int last_flush; /* value of flush param for previous deflate call */
+
+ /* used by deflate.c: */
+
+ uInt w_size; /* LZ77 window size (32K by default) */
+ uInt w_bits; /* log2(w_size) (8..16) */
+ uInt w_mask; /* w_size - 1 */
+
+ Bytef *window;
+ /* Sliding window. Input bytes are read into the second half of the window,
+ * and move to the first half later to keep a dictionary of at least wSize
+ * bytes. With this organization, matches are limited to a distance of
+ * wSize-MAX_MATCH bytes, but this ensures that IO is always
+ * performed with a length multiple of the block size. Also, it limits
+ * the window size to 64K, which is quite useful on MSDOS.
+ * To do: use the user input buffer as sliding window.
+ */
+
+ ulg window_size;
+ /* Actual size of window: 2*wSize, except when the user input buffer
+ * is directly used as sliding window.
+ */
+
+ Posf *prev;
+ /* Link to older string with same hash index. To limit the size of this
+ * array to 64K, this link is maintained only for the last 32K strings.
+ * An index in this array is thus a window index modulo 32K.
+ */
+
+ Posf *head; /* Heads of the hash chains or NIL. */
+
+ uInt ins_h; /* hash index of string to be inserted */
+ uInt hash_size; /* number of elements in hash table */
+ uInt hash_bits; /* log2(hash_size) */
+ uInt hash_mask; /* hash_size-1 */
+
+ uInt hash_shift;
+ /* Number of bits by which ins_h must be shifted at each input
+ * step. It must be such that after MIN_MATCH steps, the oldest
+ * byte no longer takes part in the hash key, that is:
+ * hash_shift * MIN_MATCH >= hash_bits
+ */
+
+ long block_start;
+ /* Window position at the beginning of the current output block. Gets
+ * negative when the window is moved backwards.
+ */
+
+ uInt match_length; /* length of best match */
+ IPos prev_match; /* previous match */
+ int match_available; /* set if previous match exists */
+ uInt strstart; /* start of string to insert */
+ uInt match_start; /* start of matching string */
+ uInt lookahead; /* number of valid bytes ahead in window */
+
+ uInt prev_length;
+ /* Length of the best match at previous step. Matches not greater than this
+ * are discarded. This is used in the lazy match evaluation.
+ */
+
+ uInt max_chain_length;
+ /* To speed up deflation, hash chains are never searched beyond this
+ * length. A higher limit improves compression ratio but degrades the
+ * speed.
+ */
+
+ uInt max_lazy_match;
+ /* Attempt to find a better match only when the current match is strictly
+ * smaller than this value. This mechanism is used only for compression
+ * levels >= 4.
+ */
+# define max_insert_length max_lazy_match
+ /* Insert new strings in the hash table only if the match length is not
+ * greater than this length. This saves time but degrades compression.
+ * max_insert_length is used only for compression levels <= 3.
+ */
+
+ int level; /* compression level (1..9) */
+ int strategy; /* favor or force Huffman coding*/
+
+ uInt good_match;
+ /* Use a faster search when the previous match is longer than this */
+
+ int nice_match; /* Stop searching when current match exceeds this */
+
+ /* used by trees.c: */
+ /* Didn't use ct_data typedef below to supress compiler warning */
+ struct ct_data_s dyn_ltree[HEAP_SIZE]; /* literal and length tree */
+ struct ct_data_s dyn_dtree[2*D_CODES+1]; /* distance tree */
+ struct ct_data_s bl_tree[2*BL_CODES+1]; /* Huffman tree for bit lengths */
+
+ struct tree_desc_s l_desc; /* desc. for literal tree */
+ struct tree_desc_s d_desc; /* desc. for distance tree */
+ struct tree_desc_s bl_desc; /* desc. for bit length tree */
+
+ ush bl_count[MAX_BITS+1];
+ /* number of codes at each bit length for an optimal tree */
+
+ int heap[2*L_CODES+1]; /* heap used to build the Huffman trees */
+ int heap_len; /* number of elements in the heap */
+ int heap_max; /* element of largest frequency */
+ /* The sons of heap[n] are heap[2*n] and heap[2*n+1]. heap[0] is not used.
+ * The same heap array is used to build all trees.
+ */
+
+ uch depth[2*L_CODES+1];
+ /* Depth of each subtree used as tie breaker for trees of equal frequency
+ */
+
+ uchf *l_buf; /* buffer for literals or lengths */
+
+ uInt lit_bufsize;
+ /* Size of match buffer for literals/lengths. There are 4 reasons for
+ * limiting lit_bufsize to 64K:
+ * - frequencies can be kept in 16 bit counters
+ * - if compression is not successful for the first block, all input
+ * data is still in the window so we can still emit a stored block even
+ * when input comes from standard input. (This can also be done for
+ * all blocks if lit_bufsize is not greater than 32K.)
+ * - if compression is not successful for a file smaller than 64K, we can
+ * even emit a stored file instead of a stored block (saving 5 bytes).
+ * This is applicable only for zip (not gzip or zlib).
+ * - creating new Huffman trees less frequently may not provide fast
+ * adaptation to changes in the input data statistics. (Take for
+ * example a binary file with poorly compressible code followed by
+ * a highly compressible string table.) Smaller buffer sizes give
+ * fast adaptation but have of course the overhead of transmitting
+ * trees more frequently.
+ * - I can't count above 4
+ */
+
+ uInt last_lit; /* running index in l_buf */
+
+ ushf *d_buf;
+ /* Buffer for distances. To simplify the code, d_buf and l_buf have
+ * the same number of elements. To use different lengths, an extra flag
+ * array would be necessary.
+ */
+
+ ulg opt_len; /* bit length of current block with optimal trees */
+ ulg static_len; /* bit length of current block with static trees */
+ uInt matches; /* number of string matches in current block */
+ int last_eob_len; /* bit length of EOB code for last block */
+
+#ifdef DEBUG
+ ulg compressed_len; /* total bit length of compressed file mod 2^32 */
+ ulg bits_sent; /* bit length of compressed data sent mod 2^32 */
+#endif
+
+ ush bi_buf;
+ /* Output buffer. bits are inserted starting at the bottom (least
+ * significant bits).
+ */
+ int bi_valid;
+ /* Number of valid bits in bi_buf. All bits above the last valid bit
+ * are always zero.
+ */
+
+} FAR deflate_state;
+
+/* Output a byte on the stream.
+ * IN assertion: there is enough room in pending_buf.
+ */
+#define put_byte(s, c) {s->pending_buf[s->pending++] = (c);}
+
+
+#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1)
+/* Minimum amount of lookahead, except at the end of the input file.
+ * See deflate.c for comments about the MIN_MATCH+1.
+ */
+
+#define MAX_DIST(s) ((s)->w_size-MIN_LOOKAHEAD)
+/* In order to simplify the code, particularly on 16 bit machines, match
+ * distances are limited to MAX_DIST instead of WSIZE.
+ */
+
+ /* in trees.c */
+void _tr_init OF((deflate_state *s));
+int _tr_tally OF((deflate_state *s, unsigned dist, unsigned lc));
+void _tr_flush_block OF((deflate_state *s, charf *buf, ulg stored_len,
+ int eof));
+void _tr_align OF((deflate_state *s));
+void _tr_stored_block OF((deflate_state *s, charf *buf, ulg stored_len,
+ int eof));
+
+#define d_code(dist) \
+ ((dist) < 256 ? _dist_code[dist] : _dist_code[256+((dist)>>7)])
+/* Mapping from a distance to a distance code. dist is the distance - 1 and
+ * must not have side effects. _dist_code[256] and _dist_code[257] are never
+ * used.
+ */
+
+#ifndef DEBUG
+/* Inline versions of _tr_tally for speed: */
+
+#if defined(GEN_TREES_H) || !defined(STDC)
+ extern uch _length_code[];
+ extern uch _dist_code[];
+#else
+ extern const uch _length_code[];
+ extern const uch _dist_code[];
+#endif
+
+# define _tr_tally_lit(s, c, flush) \
+ { uch cc = (c); \
+ s->d_buf[s->last_lit] = 0; \
+ s->l_buf[s->last_lit++] = cc; \
+ s->dyn_ltree[cc].Freq++; \
+ flush = (s->last_lit == s->lit_bufsize-1); \
+ }
+# define _tr_tally_dist(s, distance, length, flush) \
+ { uch len = (length); \
+ ush dist = (distance); \
+ s->d_buf[s->last_lit] = dist; \
+ s->l_buf[s->last_lit++] = len; \
+ dist--; \
+ s->dyn_ltree[_length_code[len]+LITERALS+1].Freq++; \
+ s->dyn_dtree[d_code(dist)].Freq++; \
+ flush = (s->last_lit == s->lit_bufsize-1); \
+ }
+#else
+# define _tr_tally_lit(s, c, flush) flush = _tr_tally(s, 0, c)
+# define _tr_tally_dist(s, distance, length, flush) \
+ flush = _tr_tally(s, distance, length)
+#endif
+
+#endif
--- /dev/null
+# descrip.mms: MMS description file for building zlib on VMS
+# written by Martin P.J. Zinser <m.zinser@gsi.de>
+
+cc_defs =
+c_deb =
+
+.ifdef __DECC__
+pref = /prefix=all
+.endif
+
+OBJS = adler32.obj, compress.obj, crc32.obj, gzio.obj, uncompr.obj,\
+ deflate.obj, trees.obj, zutil.obj, inflate.obj, infblock.obj,\
+ inftrees.obj, infcodes.obj, infutil.obj, inffast.obj
+
+CFLAGS= $(C_DEB) $(CC_DEFS) $(PREF)
+
+all : example.exe minigzip.exe
+ @ write sys$output " Example applications available"
+libz.olb : libz.olb($(OBJS))
+ @ write sys$output " libz available"
+
+example.exe : example.obj libz.olb
+ link example,libz.olb/lib
+
+minigzip.exe : minigzip.obj libz.olb
+ link minigzip,libz.olb/lib,x11vms:xvmsutils.olb/lib
+
+clean :
+ delete *.obj;*,libz.olb;*
+
+
+# Other dependencies.
+adler32.obj : zutil.h zlib.h zconf.h
+compress.obj : zlib.h zconf.h
+crc32.obj : zutil.h zlib.h zconf.h
+deflate.obj : deflate.h zutil.h zlib.h zconf.h
+example.obj : zlib.h zconf.h
+gzio.obj : zutil.h zlib.h zconf.h
+infblock.obj : zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h
+infcodes.obj : zutil.h zlib.h zconf.h inftrees.h infutil.h infcodes.h inffast.h
+inffast.obj : zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+inflate.obj : zutil.h zlib.h zconf.h infblock.h
+inftrees.obj : zutil.h zlib.h zconf.h inftrees.h
+infutil.obj : zutil.h zlib.h zconf.h inftrees.h infutil.h
+minigzip.obj : zlib.h zconf.h
+trees.obj : deflate.h zutil.h zlib.h zconf.h
+uncompr.obj : zlib.h zconf.h
+zutil.obj : zutil.h zlib.h zconf.h
--- /dev/null
+/* example.c -- usage example of the zlib compression library
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include <stdio.h>
+#include "zlib.h"
+
+#ifdef STDC
+# include <string.h>
+# include <stdlib.h>
+#else
+ extern void exit OF((int));
+#endif
+
+#if defined(VMS) || defined(RISCOS)
+# define TESTFILE "foo-gz"
+#else
+# define TESTFILE "foo.gz"
+#endif
+
+#define CHECK_ERR(err, msg) { \
+ if (err != Z_OK) { \
+ fprintf(stderr, "%s error: %d\n", msg, err); \
+ exit(1); \
+ } \
+}
+
+const char hello[] = "hello, hello!";
+/* "hello world" would be more standard, but the repeated "hello"
+ * stresses the compression code better, sorry...
+ */
+
+const char dictionary[] = "hello";
+uLong dictId; /* Adler32 value of the dictionary */
+
+void test_compress OF((Byte *compr, uLong comprLen,
+ Byte *uncompr, uLong uncomprLen));
+void test_gzio OF((const char *out, const char *in,
+ Byte *uncompr, int uncomprLen));
+void test_deflate OF((Byte *compr, uLong comprLen));
+void test_inflate OF((Byte *compr, uLong comprLen,
+ Byte *uncompr, uLong uncomprLen));
+void test_large_deflate OF((Byte *compr, uLong comprLen,
+ Byte *uncompr, uLong uncomprLen));
+void test_large_inflate OF((Byte *compr, uLong comprLen,
+ Byte *uncompr, uLong uncomprLen));
+void test_flush OF((Byte *compr, uLong *comprLen));
+void test_sync OF((Byte *compr, uLong comprLen,
+ Byte *uncompr, uLong uncomprLen));
+void test_dict_deflate OF((Byte *compr, uLong comprLen));
+void test_dict_inflate OF((Byte *compr, uLong comprLen,
+ Byte *uncompr, uLong uncomprLen));
+int main OF((int argc, char *argv[]));
+
+/* ===========================================================================
+ * Test compress() and uncompress()
+ */
+void test_compress(compr, comprLen, uncompr, uncomprLen)
+ Byte *compr, *uncompr;
+ uLong comprLen, uncomprLen;
+{
+ int err;
+ uLong len = strlen(hello)+1;
+
+ err = compress(compr, &comprLen, (const Bytef*)hello, len);
+ CHECK_ERR(err, "compress");
+
+ strcpy((char*)uncompr, "garbage");
+
+ err = uncompress(uncompr, &uncomprLen, compr, comprLen);
+ CHECK_ERR(err, "uncompress");
+
+ if (strcmp((char*)uncompr, hello)) {
+ fprintf(stderr, "bad uncompress\n");
+ exit(1);
+ } else {
+ printf("uncompress(): %s\n", (char *)uncompr);
+ }
+}
+
+/* ===========================================================================
+ * Test read/write of .gz files
+ */
+void test_gzio(out, in, uncompr, uncomprLen)
+ const char *out; /* compressed output file */
+ const char *in; /* compressed input file */
+ Byte *uncompr;
+ int uncomprLen;
+{
+ int err;
+ int len = strlen(hello)+1;
+ gzFile file;
+ z_off_t pos;
+
+ file = gzopen(out, "wb");
+ if (file == NULL) {
+ fprintf(stderr, "gzopen error\n");
+ exit(1);
+ }
+ gzputc(file, 'h');
+ if (gzputs(file, "ello") != 4) {
+ fprintf(stderr, "gzputs err: %s\n", gzerror(file, &err));
+ exit(1);
+ }
+ if (gzprintf(file, ", %s!", "hello") != 8) {
+ fprintf(stderr, "gzprintf err: %s\n", gzerror(file, &err));
+ exit(1);
+ }
+ gzseek(file, 1L, SEEK_CUR); /* add one zero byte */
+ gzclose(file);
+
+ file = gzopen(in, "rb");
+ if (file == NULL) {
+ fprintf(stderr, "gzopen error\n");
+ }
+ strcpy((char*)uncompr, "garbage");
+
+ uncomprLen = gzread(file, uncompr, (unsigned)uncomprLen);
+ if (uncomprLen != len) {
+ fprintf(stderr, "gzread err: %s\n", gzerror(file, &err));
+ exit(1);
+ }
+ if (strcmp((char*)uncompr, hello)) {
+ fprintf(stderr, "bad gzread: %s\n", (char*)uncompr);
+ exit(1);
+ } else {
+ printf("gzread(): %s\n", (char *)uncompr);
+ }
+
+ pos = gzseek(file, -8L, SEEK_CUR);
+ if (pos != 6 || gztell(file) != pos) {
+ fprintf(stderr, "gzseek error, pos=%ld, gztell=%ld\n",
+ (long)pos, (long)gztell(file));
+ exit(1);
+ }
+
+ if (gzgetc(file) != ' ') {
+ fprintf(stderr, "gzgetc error\n");
+ exit(1);
+ }
+
+ gzgets(file, (char*)uncompr, uncomprLen);
+ uncomprLen = strlen((char*)uncompr);
+ if (uncomprLen != 6) { /* "hello!" */
+ fprintf(stderr, "gzgets err after gzseek: %s\n", gzerror(file, &err));
+ exit(1);
+ }
+ if (strcmp((char*)uncompr, hello+7)) {
+ fprintf(stderr, "bad gzgets after gzseek\n");
+ exit(1);
+ } else {
+ printf("gzgets() after gzseek: %s\n", (char *)uncompr);
+ }
+
+ gzclose(file);
+}
+
+/* ===========================================================================
+ * Test deflate() with small buffers
+ */
+void test_deflate(compr, comprLen)
+ Byte *compr;
+ uLong comprLen;
+{
+ z_stream c_stream; /* compression stream */
+ int err;
+ int len = strlen(hello)+1;
+
+ c_stream.zalloc = (alloc_func)0;
+ c_stream.zfree = (free_func)0;
+ c_stream.opaque = (voidpf)0;
+
+ err = deflateInit(&c_stream, Z_DEFAULT_COMPRESSION);
+ CHECK_ERR(err, "deflateInit");
+
+ c_stream.next_in = (Bytef*)hello;
+ c_stream.next_out = compr;
+
+ while (c_stream.total_in != (uLong)len && c_stream.total_out < comprLen) {
+ c_stream.avail_in = c_stream.avail_out = 1; /* force small buffers */
+ err = deflate(&c_stream, Z_NO_FLUSH);
+ CHECK_ERR(err, "deflate");
+ }
+ /* Finish the stream, still forcing small buffers: */
+ for (;;) {
+ c_stream.avail_out = 1;
+ err = deflate(&c_stream, Z_FINISH);
+ if (err == Z_STREAM_END) break;
+ CHECK_ERR(err, "deflate");
+ }
+
+ err = deflateEnd(&c_stream);
+ CHECK_ERR(err, "deflateEnd");
+}
+
+/* ===========================================================================
+ * Test inflate() with small buffers
+ */
+void test_inflate(compr, comprLen, uncompr, uncomprLen)
+ Byte *compr, *uncompr;
+ uLong comprLen, uncomprLen;
+{
+ int err;
+ z_stream d_stream; /* decompression stream */
+
+ strcpy((char*)uncompr, "garbage");
+
+ d_stream.zalloc = (alloc_func)0;
+ d_stream.zfree = (free_func)0;
+ d_stream.opaque = (voidpf)0;
+
+ d_stream.next_in = compr;
+ d_stream.avail_in = 0;
+ d_stream.next_out = uncompr;
+
+ err = inflateInit(&d_stream);
+ CHECK_ERR(err, "inflateInit");
+
+ while (d_stream.total_out < uncomprLen && d_stream.total_in < comprLen) {
+ d_stream.avail_in = d_stream.avail_out = 1; /* force small buffers */
+ err = inflate(&d_stream, Z_NO_FLUSH);
+ if (err == Z_STREAM_END) break;
+ CHECK_ERR(err, "inflate");
+ }
+
+ err = inflateEnd(&d_stream);
+ CHECK_ERR(err, "inflateEnd");
+
+ if (strcmp((char*)uncompr, hello)) {
+ fprintf(stderr, "bad inflate\n");
+ exit(1);
+ } else {
+ printf("inflate(): %s\n", (char *)uncompr);
+ }
+}
+
+/* ===========================================================================
+ * Test deflate() with large buffers and dynamic change of compression level
+ */
+void test_large_deflate(compr, comprLen, uncompr, uncomprLen)
+ Byte *compr, *uncompr;
+ uLong comprLen, uncomprLen;
+{
+ z_stream c_stream; /* compression stream */
+ int err;
+
+ c_stream.zalloc = (alloc_func)0;
+ c_stream.zfree = (free_func)0;
+ c_stream.opaque = (voidpf)0;
+
+ err = deflateInit(&c_stream, Z_BEST_SPEED);
+ CHECK_ERR(err, "deflateInit");
+
+ c_stream.next_out = compr;
+ c_stream.avail_out = (uInt)comprLen;
+
+ /* At this point, uncompr is still mostly zeroes, so it should compress
+ * very well:
+ */
+ c_stream.next_in = uncompr;
+ c_stream.avail_in = (uInt)uncomprLen;
+ err = deflate(&c_stream, Z_NO_FLUSH);
+ CHECK_ERR(err, "deflate");
+ if (c_stream.avail_in != 0) {
+ fprintf(stderr, "deflate not greedy\n");
+ exit(1);
+ }
+
+ /* Feed in already compressed data and switch to no compression: */
+ deflateParams(&c_stream, Z_NO_COMPRESSION, Z_DEFAULT_STRATEGY);
+ c_stream.next_in = compr;
+ c_stream.avail_in = (uInt)comprLen/2;
+ err = deflate(&c_stream, Z_NO_FLUSH);
+ CHECK_ERR(err, "deflate");
+
+ /* Switch back to compressing mode: */
+ deflateParams(&c_stream, Z_BEST_COMPRESSION, Z_FILTERED);
+ c_stream.next_in = uncompr;
+ c_stream.avail_in = (uInt)uncomprLen;
+ err = deflate(&c_stream, Z_NO_FLUSH);
+ CHECK_ERR(err, "deflate");
+
+ err = deflate(&c_stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ fprintf(stderr, "deflate should report Z_STREAM_END\n");
+ exit(1);
+ }
+ err = deflateEnd(&c_stream);
+ CHECK_ERR(err, "deflateEnd");
+}
+
+/* ===========================================================================
+ * Test inflate() with large buffers
+ */
+void test_large_inflate(compr, comprLen, uncompr, uncomprLen)
+ Byte *compr, *uncompr;
+ uLong comprLen, uncomprLen;
+{
+ int err;
+ z_stream d_stream; /* decompression stream */
+
+ strcpy((char*)uncompr, "garbage");
+
+ d_stream.zalloc = (alloc_func)0;
+ d_stream.zfree = (free_func)0;
+ d_stream.opaque = (voidpf)0;
+
+ d_stream.next_in = compr;
+ d_stream.avail_in = (uInt)comprLen;
+
+ err = inflateInit(&d_stream);
+ CHECK_ERR(err, "inflateInit");
+
+ for (;;) {
+ d_stream.next_out = uncompr; /* discard the output */
+ d_stream.avail_out = (uInt)uncomprLen;
+ err = inflate(&d_stream, Z_NO_FLUSH);
+ if (err == Z_STREAM_END) break;
+ CHECK_ERR(err, "large inflate");
+ }
+
+ err = inflateEnd(&d_stream);
+ CHECK_ERR(err, "inflateEnd");
+
+ if (d_stream.total_out != 2*uncomprLen + comprLen/2) {
+ fprintf(stderr, "bad large inflate: %ld\n", d_stream.total_out);
+ exit(1);
+ } else {
+ printf("large_inflate(): OK\n");
+ }
+}
+
+/* ===========================================================================
+ * Test deflate() with full flush
+ */
+void test_flush(compr, comprLen)
+ Byte *compr;
+ uLong *comprLen;
+{
+ z_stream c_stream; /* compression stream */
+ int err;
+ int len = strlen(hello)+1;
+
+ c_stream.zalloc = (alloc_func)0;
+ c_stream.zfree = (free_func)0;
+ c_stream.opaque = (voidpf)0;
+
+ err = deflateInit(&c_stream, Z_DEFAULT_COMPRESSION);
+ CHECK_ERR(err, "deflateInit");
+
+ c_stream.next_in = (Bytef*)hello;
+ c_stream.next_out = compr;
+ c_stream.avail_in = 3;
+ c_stream.avail_out = (uInt)*comprLen;
+ err = deflate(&c_stream, Z_FULL_FLUSH);
+ CHECK_ERR(err, "deflate");
+
+ compr[3]++; /* force an error in first compressed block */
+ c_stream.avail_in = len - 3;
+
+ err = deflate(&c_stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ CHECK_ERR(err, "deflate");
+ }
+ err = deflateEnd(&c_stream);
+ CHECK_ERR(err, "deflateEnd");
+
+ *comprLen = c_stream.total_out;
+}
+
+/* ===========================================================================
+ * Test inflateSync()
+ */
+void test_sync(compr, comprLen, uncompr, uncomprLen)
+ Byte *compr, *uncompr;
+ uLong comprLen, uncomprLen;
+{
+ int err;
+ z_stream d_stream; /* decompression stream */
+
+ strcpy((char*)uncompr, "garbage");
+
+ d_stream.zalloc = (alloc_func)0;
+ d_stream.zfree = (free_func)0;
+ d_stream.opaque = (voidpf)0;
+
+ d_stream.next_in = compr;
+ d_stream.avail_in = 2; /* just read the zlib header */
+
+ err = inflateInit(&d_stream);
+ CHECK_ERR(err, "inflateInit");
+
+ d_stream.next_out = uncompr;
+ d_stream.avail_out = (uInt)uncomprLen;
+
+ inflate(&d_stream, Z_NO_FLUSH);
+ CHECK_ERR(err, "inflate");
+
+ d_stream.avail_in = (uInt)comprLen-2; /* read all compressed data */
+ err = inflateSync(&d_stream); /* but skip the damaged part */
+ CHECK_ERR(err, "inflateSync");
+
+ err = inflate(&d_stream, Z_FINISH);
+ if (err != Z_DATA_ERROR) {
+ fprintf(stderr, "inflate should report DATA_ERROR\n");
+ /* Because of incorrect adler32 */
+ exit(1);
+ }
+ err = inflateEnd(&d_stream);
+ CHECK_ERR(err, "inflateEnd");
+
+ printf("after inflateSync(): hel%s\n", (char *)uncompr);
+}
+
+/* ===========================================================================
+ * Test deflate() with preset dictionary
+ */
+void test_dict_deflate(compr, comprLen)
+ Byte *compr;
+ uLong comprLen;
+{
+ z_stream c_stream; /* compression stream */
+ int err;
+
+ c_stream.zalloc = (alloc_func)0;
+ c_stream.zfree = (free_func)0;
+ c_stream.opaque = (voidpf)0;
+
+ err = deflateInit(&c_stream, Z_BEST_COMPRESSION);
+ CHECK_ERR(err, "deflateInit");
+
+ err = deflateSetDictionary(&c_stream,
+ (const Bytef*)dictionary, sizeof(dictionary));
+ CHECK_ERR(err, "deflateSetDictionary");
+
+ dictId = c_stream.adler;
+ c_stream.next_out = compr;
+ c_stream.avail_out = (uInt)comprLen;
+
+ c_stream.next_in = (Bytef*)hello;
+ c_stream.avail_in = (uInt)strlen(hello)+1;
+
+ err = deflate(&c_stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ fprintf(stderr, "deflate should report Z_STREAM_END\n");
+ exit(1);
+ }
+ err = deflateEnd(&c_stream);
+ CHECK_ERR(err, "deflateEnd");
+}
+
+/* ===========================================================================
+ * Test inflate() with a preset dictionary
+ */
+void test_dict_inflate(compr, comprLen, uncompr, uncomprLen)
+ Byte *compr, *uncompr;
+ uLong comprLen, uncomprLen;
+{
+ int err;
+ z_stream d_stream; /* decompression stream */
+
+ strcpy((char*)uncompr, "garbage");
+
+ d_stream.zalloc = (alloc_func)0;
+ d_stream.zfree = (free_func)0;
+ d_stream.opaque = (voidpf)0;
+
+ d_stream.next_in = compr;
+ d_stream.avail_in = (uInt)comprLen;
+
+ err = inflateInit(&d_stream);
+ CHECK_ERR(err, "inflateInit");
+
+ d_stream.next_out = uncompr;
+ d_stream.avail_out = (uInt)uncomprLen;
+
+ for (;;) {
+ err = inflate(&d_stream, Z_NO_FLUSH);
+ if (err == Z_STREAM_END) break;
+ if (err == Z_NEED_DICT) {
+ if (d_stream.adler != dictId) {
+ fprintf(stderr, "unexpected dictionary");
+ exit(1);
+ }
+ err = inflateSetDictionary(&d_stream, (const Bytef*)dictionary,
+ sizeof(dictionary));
+ }
+ CHECK_ERR(err, "inflate with dict");
+ }
+
+ err = inflateEnd(&d_stream);
+ CHECK_ERR(err, "inflateEnd");
+
+ if (strcmp((char*)uncompr, hello)) {
+ fprintf(stderr, "bad inflate with dict\n");
+ exit(1);
+ } else {
+ printf("inflate with dictionary: %s\n", (char *)uncompr);
+ }
+}
+
+/* ===========================================================================
+ * Usage: example [output.gz [input.gz]]
+ */
+
+int main(argc, argv)
+ int argc;
+ char *argv[];
+{
+ Byte *compr, *uncompr;
+ uLong comprLen = 10000*sizeof(int); /* don't overflow on MSDOS */
+ uLong uncomprLen = comprLen;
+ static const char* myVersion = ZLIB_VERSION;
+
+ if (zlibVersion()[0] != myVersion[0]) {
+ fprintf(stderr, "incompatible zlib version\n");
+ exit(1);
+
+ } else if (strcmp(zlibVersion(), ZLIB_VERSION) != 0) {
+ fprintf(stderr, "warning: different zlib version\n");
+ }
+
+ compr = (Byte*)calloc((uInt)comprLen, 1);
+ uncompr = (Byte*)calloc((uInt)uncomprLen, 1);
+ /* compr and uncompr are cleared to avoid reading uninitialized
+ * data and to ensure that uncompr compresses well.
+ */
+ if (compr == Z_NULL || uncompr == Z_NULL) {
+ printf("out of memory\n");
+ exit(1);
+ }
+ test_compress(compr, comprLen, uncompr, uncomprLen);
+
+ test_gzio((argc > 1 ? argv[1] : TESTFILE),
+ (argc > 2 ? argv[2] : TESTFILE),
+ uncompr, (int)uncomprLen);
+
+ test_deflate(compr, comprLen);
+ test_inflate(compr, comprLen, uncompr, uncomprLen);
+
+ test_large_deflate(compr, comprLen, uncompr, uncomprLen);
+ test_large_inflate(compr, comprLen, uncompr, uncomprLen);
+
+ test_flush(compr, &comprLen);
+ test_sync(compr, comprLen, uncompr, uncomprLen);
+ comprLen = uncomprLen;
+
+ test_dict_deflate(compr, comprLen);
+ test_dict_inflate(compr, comprLen, uncompr, uncomprLen);
+
+ exit(0);
+ return 0; /* to avoid warning */
+}
--- /dev/null
+/* gzio.c -- IO on .gz files
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ *
+ * Compile this file with -DNO_DEFLATE to avoid the compression code.
+ */
+
+/* @(#) $Id$ */
+
+#include <stdio.h>
+
+#include "zutil.h"
+
+struct internal_state {int dummy;}; /* for buggy compilers */
+
+#ifndef Z_BUFSIZE
+# ifdef MAXSEG_64K
+# define Z_BUFSIZE 4096 /* minimize memory usage for 16-bit DOS */
+# else
+# define Z_BUFSIZE 16384
+# endif
+#endif
+#ifndef Z_PRINTF_BUFSIZE
+# define Z_PRINTF_BUFSIZE 4096
+#endif
+
+#define ALLOC(size) malloc(size)
+#define TRYFREE(p) {if (p) free(p);}
+
+static int gz_magic[2] = {0x1f, 0x8b}; /* gzip magic header */
+
+/* gzip flag byte */
+#define ASCII_FLAG 0x01 /* bit 0 set: file probably ascii text */
+#define HEAD_CRC 0x02 /* bit 1 set: header CRC present */
+#define EXTRA_FIELD 0x04 /* bit 2 set: extra field present */
+#define ORIG_NAME 0x08 /* bit 3 set: original file name present */
+#define COMMENT 0x10 /* bit 4 set: file comment present */
+#define RESERVED 0xE0 /* bits 5..7: reserved */
+
+typedef struct gz_stream {
+ z_stream stream;
+ int z_err; /* error code for last stream operation */
+ int z_eof; /* set if end of input file */
+ FILE *file; /* .gz file */
+ Byte *inbuf; /* input buffer */
+ Byte *outbuf; /* output buffer */
+ uLong crc; /* crc32 of uncompressed data */
+ char *msg; /* error message */
+ char *path; /* path name for debugging only */
+ int transparent; /* 1 if input file is not a .gz file */
+ char mode; /* 'w' or 'r' */
+ long startpos; /* start of compressed data in file (header skipped) */
+} gz_stream;
+
+
+local gzFile gz_open OF((const char *path, const char *mode, int fd));
+local int do_flush OF((gzFile file, int flush));
+local int get_byte OF((gz_stream *s));
+local void check_header OF((gz_stream *s));
+local int destroy OF((gz_stream *s));
+local void putLong OF((FILE *file, uLong x));
+local uLong getLong OF((gz_stream *s));
+
+/* ===========================================================================
+ Opens a gzip (.gz) file for reading or writing. The mode parameter
+ is as in fopen ("rb" or "wb"). The file is given either by file descriptor
+ or path name (if fd == -1).
+ gz_open return NULL if the file could not be opened or if there was
+ insufficient memory to allocate the (de)compression state; errno
+ can be checked to distinguish the two cases (if errno is zero, the
+ zlib error is Z_MEM_ERROR).
+*/
+local gzFile gz_open (path, mode, fd)
+ const char *path;
+ const char *mode;
+ int fd;
+{
+ int err;
+ int level = Z_DEFAULT_COMPRESSION; /* compression level */
+ int strategy = Z_DEFAULT_STRATEGY; /* compression strategy */
+ char *p = (char*)mode;
+ gz_stream *s;
+ char fmode[80]; /* copy of mode, without the compression level */
+ char *m = fmode;
+
+ if (!path || !mode) return Z_NULL;
+
+ s = (gz_stream *)ALLOC(sizeof(gz_stream));
+ if (!s) return Z_NULL;
+
+ s->stream.zalloc = (alloc_func)0;
+ s->stream.zfree = (free_func)0;
+ s->stream.opaque = (voidpf)0;
+ s->stream.next_in = s->inbuf = Z_NULL;
+ s->stream.next_out = s->outbuf = Z_NULL;
+ s->stream.avail_in = s->stream.avail_out = 0;
+ s->file = NULL;
+ s->z_err = Z_OK;
+ s->z_eof = 0;
+ s->crc = crc32(0L, Z_NULL, 0);
+ s->msg = NULL;
+ s->transparent = 0;
+
+ s->path = (char*)ALLOC(strlen(path)+1);
+ if (s->path == NULL) {
+ return destroy(s), (gzFile)Z_NULL;
+ }
+ strcpy(s->path, path); /* do this early for debugging */
+
+ s->mode = '\0';
+ do {
+ if (*p == 'r') s->mode = 'r';
+ if (*p == 'w' || *p == 'a') s->mode = 'w';
+ if (*p >= '0' && *p <= '9') {
+ level = *p - '0';
+ } else if (*p == 'f') {
+ strategy = Z_FILTERED;
+ } else if (*p == 'h') {
+ strategy = Z_HUFFMAN_ONLY;
+ } else {
+ *m++ = *p; /* copy the mode */
+ }
+ } while (*p++ && m != fmode + sizeof(fmode));
+ if (s->mode == '\0') return destroy(s), (gzFile)Z_NULL;
+
+ if (s->mode == 'w') {
+#ifdef NO_DEFLATE
+ err = Z_STREAM_ERROR;
+#else
+ err = deflateInit2(&(s->stream), level,
+ Z_DEFLATED, -MAX_WBITS, DEF_MEM_LEVEL, strategy);
+ /* windowBits is passed < 0 to suppress zlib header */
+
+ s->stream.next_out = s->outbuf = (Byte*)ALLOC(Z_BUFSIZE);
+#endif
+ if (err != Z_OK || s->outbuf == Z_NULL) {
+ return destroy(s), (gzFile)Z_NULL;
+ }
+ } else {
+ s->stream.next_in = s->inbuf = (Byte*)ALLOC(Z_BUFSIZE);
+
+ err = inflateInit2(&(s->stream), -MAX_WBITS);
+ /* windowBits is passed < 0 to tell that there is no zlib header.
+ * Note that in this case inflate *requires* an extra "dummy" byte
+ * after the compressed stream in order to complete decompression and
+ * return Z_STREAM_END. Here the gzip CRC32 ensures that 4 bytes are
+ * present after the compressed stream.
+ */
+ if (err != Z_OK || s->inbuf == Z_NULL) {
+ return destroy(s), (gzFile)Z_NULL;
+ }
+ }
+ s->stream.avail_out = Z_BUFSIZE;
+
+ errno = 0;
+ s->file = fd < 0 ? F_OPEN(path, fmode) : (FILE*)fdopen(fd, fmode);
+
+ if (s->file == NULL) {
+ return destroy(s), (gzFile)Z_NULL;
+ }
+ if (s->mode == 'w') {
+ /* Write a very simple .gz header:
+ */
+ fprintf(s->file, "%c%c%c%c%c%c%c%c%c%c", gz_magic[0], gz_magic[1],
+ Z_DEFLATED, 0 /*flags*/, 0,0,0,0 /*time*/, 0 /*xflags*/, OS_CODE);
+ s->startpos = 10L;
+ /* We use 10L instead of ftell(s->file) to because ftell causes an
+ * fflush on some systems. This version of the library doesn't use
+ * startpos anyway in write mode, so this initialization is not
+ * necessary.
+ */
+ } else {
+ check_header(s); /* skip the .gz header */
+ s->startpos = (ftell(s->file) - s->stream.avail_in);
+ }
+
+ return (gzFile)s;
+}
+
+/* ===========================================================================
+ Opens a gzip (.gz) file for reading or writing.
+*/
+gzFile ZEXPORT gzopen (path, mode)
+ const char *path;
+ const char *mode;
+{
+ return gz_open (path, mode, -1);
+}
+
+/* ===========================================================================
+ Associate a gzFile with the file descriptor fd. fd is not dup'ed here
+ to mimic the behavio(u)r of fdopen.
+*/
+gzFile ZEXPORT gzdopen (fd, mode)
+ int fd;
+ const char *mode;
+{
+ char name[20];
+
+ if (fd < 0) return (gzFile)Z_NULL;
+ sprintf(name, "<fd:%d>", fd); /* for debugging */
+
+ return gz_open (name, mode, fd);
+}
+
+/* ===========================================================================
+ * Update the compression level and strategy
+ */
+int ZEXPORT gzsetparams (file, level, strategy)
+ gzFile file;
+ int level;
+ int strategy;
+{
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL || s->mode != 'w') return Z_STREAM_ERROR;
+
+ /* Make room to allow flushing */
+ if (s->stream.avail_out == 0) {
+
+ s->stream.next_out = s->outbuf;
+ if (fwrite(s->outbuf, 1, Z_BUFSIZE, s->file) != Z_BUFSIZE) {
+ s->z_err = Z_ERRNO;
+ }
+ s->stream.avail_out = Z_BUFSIZE;
+ }
+
+ return deflateParams (&(s->stream), level, strategy);
+}
+
+/* ===========================================================================
+ Read a byte from a gz_stream; update next_in and avail_in. Return EOF
+ for end of file.
+ IN assertion: the stream s has been sucessfully opened for reading.
+*/
+local int get_byte(s)
+ gz_stream *s;
+{
+ if (s->z_eof) return EOF;
+ if (s->stream.avail_in == 0) {
+ errno = 0;
+ s->stream.avail_in = fread(s->inbuf, 1, Z_BUFSIZE, s->file);
+ if (s->stream.avail_in == 0) {
+ s->z_eof = 1;
+ if (ferror(s->file)) s->z_err = Z_ERRNO;
+ return EOF;
+ }
+ s->stream.next_in = s->inbuf;
+ }
+ s->stream.avail_in--;
+ return *(s->stream.next_in)++;
+}
+
+/* ===========================================================================
+ Check the gzip header of a gz_stream opened for reading. Set the stream
+ mode to transparent if the gzip magic header is not present; set s->err
+ to Z_DATA_ERROR if the magic header is present but the rest of the header
+ is incorrect.
+ IN assertion: the stream s has already been created sucessfully;
+ s->stream.avail_in is zero for the first time, but may be non-zero
+ for concatenated .gz files.
+*/
+local void check_header(s)
+ gz_stream *s;
+{
+ int method; /* method byte */
+ int flags; /* flags byte */
+ uInt len;
+ int c;
+
+ /* Check the gzip magic header */
+ for (len = 0; len < 2; len++) {
+ c = get_byte(s);
+ if (c != gz_magic[len]) {
+ if (len != 0) s->stream.avail_in++, s->stream.next_in--;
+ if (c != EOF) {
+ s->stream.avail_in++, s->stream.next_in--;
+ s->transparent = 1;
+ }
+ s->z_err = s->stream.avail_in != 0 ? Z_OK : Z_STREAM_END;
+ return;
+ }
+ }
+ method = get_byte(s);
+ flags = get_byte(s);
+ if (method != Z_DEFLATED || (flags & RESERVED) != 0) {
+ s->z_err = Z_DATA_ERROR;
+ return;
+ }
+
+ /* Discard time, xflags and OS code: */
+ for (len = 0; len < 6; len++) (void)get_byte(s);
+
+ if ((flags & EXTRA_FIELD) != 0) { /* skip the extra field */
+ len = (uInt)get_byte(s);
+ len += ((uInt)get_byte(s))<<8;
+ /* len is garbage if EOF but the loop below will quit anyway */
+ while (len-- != 0 && get_byte(s) != EOF) ;
+ }
+ if ((flags & ORIG_NAME) != 0) { /* skip the original file name */
+ while ((c = get_byte(s)) != 0 && c != EOF) ;
+ }
+ if ((flags & COMMENT) != 0) { /* skip the .gz file comment */
+ while ((c = get_byte(s)) != 0 && c != EOF) ;
+ }
+ if ((flags & HEAD_CRC) != 0) { /* skip the header crc */
+ for (len = 0; len < 2; len++) (void)get_byte(s);
+ }
+ s->z_err = s->z_eof ? Z_DATA_ERROR : Z_OK;
+}
+
+ /* ===========================================================================
+ * Cleanup then free the given gz_stream. Return a zlib error code.
+ Try freeing in the reverse order of allocations.
+ */
+local int destroy (s)
+ gz_stream *s;
+{
+ int err = Z_OK;
+
+ if (!s) return Z_STREAM_ERROR;
+
+ TRYFREE(s->msg);
+
+ if (s->stream.state != NULL) {
+ if (s->mode == 'w') {
+#ifdef NO_DEFLATE
+ err = Z_STREAM_ERROR;
+#else
+ err = deflateEnd(&(s->stream));
+#endif
+ } else if (s->mode == 'r') {
+ err = inflateEnd(&(s->stream));
+ }
+ }
+ if (s->file != NULL && fclose(s->file)) {
+#ifdef ESPIPE
+ if (errno != ESPIPE) /* fclose is broken for pipes in HP/UX */
+#endif
+ err = Z_ERRNO;
+ }
+ if (s->z_err < 0) err = s->z_err;
+
+ TRYFREE(s->inbuf);
+ TRYFREE(s->outbuf);
+ TRYFREE(s->path);
+ TRYFREE(s);
+ return err;
+}
+
+/* ===========================================================================
+ Reads the given number of uncompressed bytes from the compressed file.
+ gzread returns the number of bytes actually read (0 for end of file).
+*/
+int ZEXPORT gzread (file, buf, len)
+ gzFile file;
+ voidp buf;
+ unsigned len;
+{
+ gz_stream *s = (gz_stream*)file;
+ Bytef *start = (Bytef*)buf; /* starting point for crc computation */
+ Byte *next_out; /* == stream.next_out but not forced far (for MSDOS) */
+
+ if (s == NULL || s->mode != 'r') return Z_STREAM_ERROR;
+
+ if (s->z_err == Z_DATA_ERROR || s->z_err == Z_ERRNO) return -1;
+ if (s->z_err == Z_STREAM_END) return 0; /* EOF */
+
+ next_out = (Byte*)buf;
+ s->stream.next_out = (Bytef*)buf;
+ s->stream.avail_out = len;
+
+ while (s->stream.avail_out != 0) {
+
+ if (s->transparent) {
+ /* Copy first the lookahead bytes: */
+ uInt n = s->stream.avail_in;
+ if (n > s->stream.avail_out) n = s->stream.avail_out;
+ if (n > 0) {
+ zmemcpy(s->stream.next_out, s->stream.next_in, n);
+ next_out += n;
+ s->stream.next_out = next_out;
+ s->stream.next_in += n;
+ s->stream.avail_out -= n;
+ s->stream.avail_in -= n;
+ }
+ if (s->stream.avail_out > 0) {
+ s->stream.avail_out -= fread(next_out, 1, s->stream.avail_out,
+ s->file);
+ }
+ len -= s->stream.avail_out;
+ s->stream.total_in += (uLong)len;
+ s->stream.total_out += (uLong)len;
+ if (len == 0) s->z_eof = 1;
+ return (int)len;
+ }
+ if (s->stream.avail_in == 0 && !s->z_eof) {
+
+ errno = 0;
+ s->stream.avail_in = fread(s->inbuf, 1, Z_BUFSIZE, s->file);
+ if (s->stream.avail_in == 0) {
+ s->z_eof = 1;
+ if (ferror(s->file)) {
+ s->z_err = Z_ERRNO;
+ break;
+ }
+ }
+ s->stream.next_in = s->inbuf;
+ }
+ s->z_err = inflate(&(s->stream), Z_NO_FLUSH);
+
+ if (s->z_err == Z_STREAM_END) {
+ /* Check CRC and original size */
+ s->crc = crc32(s->crc, start, (uInt)(s->stream.next_out - start));
+ start = s->stream.next_out;
+
+ if (getLong(s) != s->crc) {
+ s->z_err = Z_DATA_ERROR;
+ } else {
+ (void)getLong(s);
+ /* The uncompressed length returned by above getlong() may
+ * be different from s->stream.total_out) in case of
+ * concatenated .gz files. Check for such files:
+ */
+ check_header(s);
+ if (s->z_err == Z_OK) {
+ uLong total_in = s->stream.total_in;
+ uLong total_out = s->stream.total_out;
+
+ inflateReset(&(s->stream));
+ s->stream.total_in = total_in;
+ s->stream.total_out = total_out;
+ s->crc = crc32(0L, Z_NULL, 0);
+ }
+ }
+ }
+ if (s->z_err != Z_OK || s->z_eof) break;
+ }
+ s->crc = crc32(s->crc, start, (uInt)(s->stream.next_out - start));
+
+ return (int)(len - s->stream.avail_out);
+}
+
+
+/* ===========================================================================
+ Reads one byte from the compressed file. gzgetc returns this byte
+ or -1 in case of end of file or error.
+*/
+int ZEXPORT gzgetc(file)
+ gzFile file;
+{
+ unsigned char c;
+
+ return gzread(file, &c, 1) == 1 ? c : -1;
+}
+
+
+/* ===========================================================================
+ Reads bytes from the compressed file until len-1 characters are
+ read, or a newline character is read and transferred to buf, or an
+ end-of-file condition is encountered. The string is then terminated
+ with a null character.
+ gzgets returns buf, or Z_NULL in case of error.
+
+ The current implementation is not optimized at all.
+*/
+char * ZEXPORT gzgets(file, buf, len)
+ gzFile file;
+ char *buf;
+ int len;
+{
+ char *b = buf;
+ if (buf == Z_NULL || len <= 0) return Z_NULL;
+
+ while (--len > 0 && gzread(file, buf, 1) == 1 && *buf++ != '\n') ;
+ *buf = '\0';
+ return b == buf && len > 0 ? Z_NULL : b;
+}
+
+
+#ifndef NO_DEFLATE
+/* ===========================================================================
+ Writes the given number of uncompressed bytes into the compressed file.
+ gzwrite returns the number of bytes actually written (0 in case of error).
+*/
+int ZEXPORT gzwrite (file, buf, len)
+ gzFile file;
+ const voidp buf;
+ unsigned len;
+{
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL || s->mode != 'w') return Z_STREAM_ERROR;
+
+ s->stream.next_in = (Bytef*)buf;
+ s->stream.avail_in = len;
+
+ while (s->stream.avail_in != 0) {
+
+ if (s->stream.avail_out == 0) {
+
+ s->stream.next_out = s->outbuf;
+ if (fwrite(s->outbuf, 1, Z_BUFSIZE, s->file) != Z_BUFSIZE) {
+ s->z_err = Z_ERRNO;
+ break;
+ }
+ s->stream.avail_out = Z_BUFSIZE;
+ }
+ s->z_err = deflate(&(s->stream), Z_NO_FLUSH);
+ if (s->z_err != Z_OK) break;
+ }
+ s->crc = crc32(s->crc, (const Bytef *)buf, len);
+
+ return (int)(len - s->stream.avail_in);
+}
+
+/* ===========================================================================
+ Converts, formats, and writes the args to the compressed file under
+ control of the format string, as in fprintf. gzprintf returns the number of
+ uncompressed bytes actually written (0 in case of error).
+*/
+#ifdef STDC
+#include <stdarg.h>
+
+int ZEXPORTVA gzprintf (gzFile file, const char *format, /* args */ ...)
+{
+ char buf[Z_PRINTF_BUFSIZE];
+ va_list va;
+ int len;
+
+ va_start(va, format);
+#ifdef HAS_vsnprintf
+ (void)vsnprintf(buf, sizeof(buf), format, va);
+#else
+ (void)vsprintf(buf, format, va);
+#endif
+ va_end(va);
+ len = strlen(buf); /* some *sprintf don't return the nb of bytes written */
+ if (len <= 0) return 0;
+
+ return gzwrite(file, buf, (unsigned)len);
+}
+#else /* not ANSI C */
+
+int ZEXPORTVA gzprintf (file, format, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10,
+ a11, a12, a13, a14, a15, a16, a17, a18, a19, a20)
+ gzFile file;
+ const char *format;
+ int a1, a2, a3, a4, a5, a6, a7, a8, a9, a10,
+ a11, a12, a13, a14, a15, a16, a17, a18, a19, a20;
+{
+ char buf[Z_PRINTF_BUFSIZE];
+ int len;
+
+#ifdef HAS_snprintf
+ snprintf(buf, sizeof(buf), format, a1, a2, a3, a4, a5, a6, a7, a8,
+ a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20);
+#else
+ sprintf(buf, format, a1, a2, a3, a4, a5, a6, a7, a8,
+ a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20);
+#endif
+ len = strlen(buf); /* old sprintf doesn't return the nb of bytes written */
+ if (len <= 0) return 0;
+
+ return gzwrite(file, buf, len);
+}
+#endif
+
+/* ===========================================================================
+ Writes c, converted to an unsigned char, into the compressed file.
+ gzputc returns the value that was written, or -1 in case of error.
+*/
+int ZEXPORT gzputc(file, c)
+ gzFile file;
+ int c;
+{
+ unsigned char cc = (unsigned char) c; /* required for big endian systems */
+
+ return gzwrite(file, &cc, 1) == 1 ? (int)cc : -1;
+}
+
+
+/* ===========================================================================
+ Writes the given null-terminated string to the compressed file, excluding
+ the terminating null character.
+ gzputs returns the number of characters written, or -1 in case of error.
+*/
+int ZEXPORT gzputs(file, s)
+ gzFile file;
+ const char *s;
+{
+ return gzwrite(file, (char*)s, (unsigned)strlen(s));
+}
+
+
+/* ===========================================================================
+ Flushes all pending output into the compressed file. The parameter
+ flush is as in the deflate() function.
+*/
+local int do_flush (file, flush)
+ gzFile file;
+ int flush;
+{
+ uInt len;
+ int done = 0;
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL || s->mode != 'w') return Z_STREAM_ERROR;
+
+ s->stream.avail_in = 0; /* should be zero already anyway */
+
+ for (;;) {
+ len = Z_BUFSIZE - s->stream.avail_out;
+
+ if (len != 0) {
+ if ((uInt)fwrite(s->outbuf, 1, len, s->file) != len) {
+ s->z_err = Z_ERRNO;
+ return Z_ERRNO;
+ }
+ s->stream.next_out = s->outbuf;
+ s->stream.avail_out = Z_BUFSIZE;
+ }
+ if (done) break;
+ s->z_err = deflate(&(s->stream), flush);
+
+ /* Ignore the second of two consecutive flushes: */
+ if (len == 0 && s->z_err == Z_BUF_ERROR) s->z_err = Z_OK;
+
+ /* deflate has finished flushing only when it hasn't used up
+ * all the available space in the output buffer:
+ */
+ done = (s->stream.avail_out != 0 || s->z_err == Z_STREAM_END);
+
+ if (s->z_err != Z_OK && s->z_err != Z_STREAM_END) break;
+ }
+ return s->z_err == Z_STREAM_END ? Z_OK : s->z_err;
+}
+
+int ZEXPORT gzflush (file, flush)
+ gzFile file;
+ int flush;
+{
+ gz_stream *s = (gz_stream*)file;
+ int err = do_flush (file, flush);
+
+ if (err) return err;
+ fflush(s->file);
+ return s->z_err == Z_STREAM_END ? Z_OK : s->z_err;
+}
+#endif /* NO_DEFLATE */
+
+/* ===========================================================================
+ Sets the starting position for the next gzread or gzwrite on the given
+ compressed file. The offset represents a number of bytes in the
+ gzseek returns the resulting offset location as measured in bytes from
+ the beginning of the uncompressed stream, or -1 in case of error.
+ SEEK_END is not implemented, returns error.
+ In this version of the library, gzseek can be extremely slow.
+*/
+z_off_t ZEXPORT gzseek (file, offset, whence)
+ gzFile file;
+ z_off_t offset;
+ int whence;
+{
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL || whence == SEEK_END ||
+ s->z_err == Z_ERRNO || s->z_err == Z_DATA_ERROR) {
+ return -1L;
+ }
+
+ if (s->mode == 'w') {
+#ifdef NO_DEFLATE
+ return -1L;
+#else
+ if (whence == SEEK_SET) {
+ offset -= s->stream.total_in;
+ }
+ if (offset < 0) return -1L;
+
+ /* At this point, offset is the number of zero bytes to write. */
+ if (s->inbuf == Z_NULL) {
+ s->inbuf = (Byte*)ALLOC(Z_BUFSIZE); /* for seeking */
+ zmemzero(s->inbuf, Z_BUFSIZE);
+ }
+ while (offset > 0) {
+ uInt size = Z_BUFSIZE;
+ if (offset < Z_BUFSIZE) size = (uInt)offset;
+
+ size = gzwrite(file, s->inbuf, size);
+ if (size == 0) return -1L;
+
+ offset -= size;
+ }
+ return (z_off_t)s->stream.total_in;
+#endif
+ }
+ /* Rest of function is for reading only */
+
+ /* compute absolute position */
+ if (whence == SEEK_CUR) {
+ offset += s->stream.total_out;
+ }
+ if (offset < 0) return -1L;
+
+ if (s->transparent) {
+ /* map to fseek */
+ s->stream.avail_in = 0;
+ s->stream.next_in = s->inbuf;
+ if (fseek(s->file, offset, SEEK_SET) < 0) return -1L;
+
+ s->stream.total_in = s->stream.total_out = (uLong)offset;
+ return offset;
+ }
+
+ /* For a negative seek, rewind and use positive seek */
+ if ((uLong)offset >= s->stream.total_out) {
+ offset -= s->stream.total_out;
+ } else if (gzrewind(file) < 0) {
+ return -1L;
+ }
+ /* offset is now the number of bytes to skip. */
+
+ if (offset != 0 && s->outbuf == Z_NULL) {
+ s->outbuf = (Byte*)ALLOC(Z_BUFSIZE);
+ }
+ while (offset > 0) {
+ int size = Z_BUFSIZE;
+ if (offset < Z_BUFSIZE) size = (int)offset;
+
+ size = gzread(file, s->outbuf, (uInt)size);
+ if (size <= 0) return -1L;
+ offset -= size;
+ }
+ return (z_off_t)s->stream.total_out;
+}
+
+/* ===========================================================================
+ Rewinds input file.
+*/
+int ZEXPORT gzrewind (file)
+ gzFile file;
+{
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL || s->mode != 'r') return -1;
+
+ s->z_err = Z_OK;
+ s->z_eof = 0;
+ s->stream.avail_in = 0;
+ s->stream.next_in = s->inbuf;
+ s->crc = crc32(0L, Z_NULL, 0);
+
+ if (s->startpos == 0) { /* not a compressed file */
+ rewind(s->file);
+ return 0;
+ }
+
+ (void) inflateReset(&s->stream);
+ return fseek(s->file, s->startpos, SEEK_SET);
+}
+
+/* ===========================================================================
+ Returns the starting position for the next gzread or gzwrite on the
+ given compressed file. This position represents a number of bytes in the
+ uncompressed data stream.
+*/
+z_off_t ZEXPORT gztell (file)
+ gzFile file;
+{
+ return gzseek(file, 0L, SEEK_CUR);
+}
+
+/* ===========================================================================
+ Returns 1 when EOF has previously been detected reading the given
+ input stream, otherwise zero.
+*/
+int ZEXPORT gzeof (file)
+ gzFile file;
+{
+ gz_stream *s = (gz_stream*)file;
+
+ return (s == NULL || s->mode != 'r') ? 0 : s->z_eof;
+}
+
+/* ===========================================================================
+ Outputs a long in LSB order to the given file
+*/
+local void putLong (file, x)
+ FILE *file;
+ uLong x;
+{
+ int n;
+ for (n = 0; n < 4; n++) {
+ fputc((int)(x & 0xff), file);
+ x >>= 8;
+ }
+}
+
+/* ===========================================================================
+ Reads a long in LSB order from the given gz_stream. Sets z_err in case
+ of error.
+*/
+local uLong getLong (s)
+ gz_stream *s;
+{
+ uLong x = (uLong)get_byte(s);
+ int c;
+
+ x += ((uLong)get_byte(s))<<8;
+ x += ((uLong)get_byte(s))<<16;
+ c = get_byte(s);
+ if (c == EOF) s->z_err = Z_DATA_ERROR;
+ x += ((uLong)c)<<24;
+ return x;
+}
+
+/* ===========================================================================
+ Flushes all pending output if necessary, closes the compressed file
+ and deallocates all the (de)compression state.
+*/
+int ZEXPORT gzclose (file)
+ gzFile file;
+{
+ int err;
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL) return Z_STREAM_ERROR;
+
+ if (s->mode == 'w') {
+#ifdef NO_DEFLATE
+ return Z_STREAM_ERROR;
+#else
+ err = do_flush (file, Z_FINISH);
+ if (err != Z_OK) return destroy((gz_stream*)file);
+
+ putLong (s->file, s->crc);
+ putLong (s->file, s->stream.total_in);
+#endif
+ }
+ return destroy((gz_stream*)file);
+}
+
+/* ===========================================================================
+ Returns the error message for the last error which occured on the
+ given compressed file. errnum is set to zlib error number. If an
+ error occured in the file system and not in the compression library,
+ errnum is set to Z_ERRNO and the application may consult errno
+ to get the exact error code.
+*/
+const char* ZEXPORT gzerror (file, errnum)
+ gzFile file;
+ int *errnum;
+{
+ char *m;
+ gz_stream *s = (gz_stream*)file;
+
+ if (s == NULL) {
+ *errnum = Z_STREAM_ERROR;
+ return (const char*)ERR_MSG(Z_STREAM_ERROR);
+ }
+ *errnum = s->z_err;
+ if (*errnum == Z_OK) return (const char*)"";
+
+ m = (char*)(*errnum == Z_ERRNO ? zstrerror(errno) : s->stream.msg);
+
+ if (m == NULL || *m == '\0') m = (char*)ERR_MSG(s->z_err);
+
+ TRYFREE(s->msg);
+ s->msg = (char*)ALLOC(strlen(s->path) + strlen(m) + 3);
+ strcpy(s->msg, s->path);
+ strcat(s->msg, ": ");
+ strcat(s->msg, m);
+ return (const char*)s->msg;
+}
--- /dev/null
+/* infblock.c -- interpret and process block types to last block
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "infblock.h"
+#include "inftrees.h"
+#include "infcodes.h"
+#include "infutil.h"
+
+struct inflate_codes_state {int dummy;}; /* for buggy compilers */
+
+/* simplify the use of the inflate_huft type with some defines */
+#define exop word.what.Exop
+#define bits word.what.Bits
+
+/* Table for deflate from PKZIP's appnote.txt. */
+local const uInt border[] = { /* Order of the bit length code lengths */
+ 16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15};
+
+/*
+ Notes beyond the 1.93a appnote.txt:
+
+ 1. Distance pointers never point before the beginning of the output
+ stream.
+ 2. Distance pointers can point back across blocks, up to 32k away.
+ 3. There is an implied maximum of 7 bits for the bit length table and
+ 15 bits for the actual data.
+ 4. If only one code exists, then it is encoded using one bit. (Zero
+ would be more efficient, but perhaps a little confusing.) If two
+ codes exist, they are coded using one bit each (0 and 1).
+ 5. There is no way of sending zero distance codes--a dummy must be
+ sent if there are none. (History: a pre 2.0 version of PKZIP would
+ store blocks with no distance codes, but this was discovered to be
+ too harsh a criterion.) Valid only for 1.93a. 2.04c does allow
+ zero distance codes, which is sent as one code of zero bits in
+ length.
+ 6. There are up to 286 literal/length codes. Code 256 represents the
+ end-of-block. Note however that the static length tree defines
+ 288 codes just to fill out the Huffman codes. Codes 286 and 287
+ cannot be used though, since there is no length base or extra bits
+ defined for them. Similarily, there are up to 30 distance codes.
+ However, static trees define 32 codes (all 5 bits) to fill out the
+ Huffman codes, but the last two had better not show up in the data.
+ 7. Unzip can check dynamic Huffman blocks for complete code sets.
+ The exception is that a single code would not be complete (see #4).
+ 8. The five bits following the block type is really the number of
+ literal codes sent minus 257.
+ 9. Length codes 8,16,16 are interpreted as 13 length codes of 8 bits
+ (1+6+6). Therefore, to output three times the length, you output
+ three codes (1+1+1), whereas to output four times the same length,
+ you only need two codes (1+3). Hmm.
+ 10. In the tree reconstruction algorithm, Code = Code + Increment
+ only if BitLength(i) is not zero. (Pretty obvious.)
+ 11. Correction: 4 Bits: # of Bit Length codes - 4 (4 - 19)
+ 12. Note: length code 284 can represent 227-258, but length code 285
+ really is 258. The last length deserves its own, short code
+ since it gets used a lot in very redundant files. The length
+ 258 is special since 258 - 3 (the min match length) is 255.
+ 13. The literal/length and distance code bit lengths are read as a
+ single stream of lengths. It is possible (and advantageous) for
+ a repeat code (16, 17, or 18) to go across the boundary between
+ the two sets of lengths.
+ */
+
+
+void inflate_blocks_reset(s, z, c)
+inflate_blocks_statef *s;
+z_streamp z;
+uLongf *c;
+{
+ if (c != Z_NULL)
+ *c = s->check;
+ if (s->mode == BTREE || s->mode == DTREE)
+ ZFREE(z, s->sub.trees.blens);
+ if (s->mode == CODES)
+ inflate_codes_free(s->sub.decode.codes, z);
+ s->mode = TYPE;
+ s->bitk = 0;
+ s->bitb = 0;
+ s->read = s->write = s->window;
+ if (s->checkfn != Z_NULL)
+ z->adler = s->check = (*s->checkfn)(0L, (const Bytef *)Z_NULL, 0);
+ Tracev((stderr, "inflate: blocks reset\n"));
+}
+
+
+inflate_blocks_statef *inflate_blocks_new(z, c, w)
+z_streamp z;
+check_func c;
+uInt w;
+{
+ inflate_blocks_statef *s;
+
+ if ((s = (inflate_blocks_statef *)ZALLOC
+ (z,1,sizeof(struct inflate_blocks_state))) == Z_NULL)
+ return s;
+ if ((s->hufts =
+ (inflate_huft *)ZALLOC(z, sizeof(inflate_huft), MANY)) == Z_NULL)
+ {
+ ZFREE(z, s);
+ return Z_NULL;
+ }
+ if ((s->window = (Bytef *)ZALLOC(z, 1, w)) == Z_NULL)
+ {
+ ZFREE(z, s->hufts);
+ ZFREE(z, s);
+ return Z_NULL;
+ }
+ s->end = s->window + w;
+ s->checkfn = c;
+ s->mode = TYPE;
+ Tracev((stderr, "inflate: blocks allocated\n"));
+ inflate_blocks_reset(s, z, Z_NULL);
+ return s;
+}
+
+
+int inflate_blocks(s, z, r)
+inflate_blocks_statef *s;
+z_streamp z;
+int r;
+{
+ uInt t; /* temporary storage */
+ uLong b; /* bit buffer */
+ uInt k; /* bits in bit buffer */
+ Bytef *p; /* input data pointer */
+ uInt n; /* bytes available there */
+ Bytef *q; /* output window write pointer */
+ uInt m; /* bytes to end of window or read pointer */
+
+ /* copy input/output information to locals (UPDATE macro restores) */
+ LOAD
+
+ /* process input based on current state */
+ while (1) switch (s->mode)
+ {
+ case TYPE:
+ NEEDBITS(3)
+ t = (uInt)b & 7;
+ s->last = t & 1;
+ switch (t >> 1)
+ {
+ case 0: /* stored */
+ Tracev((stderr, "inflate: stored block%s\n",
+ s->last ? " (last)" : ""));
+ DUMPBITS(3)
+ t = k & 7; /* go to byte boundary */
+ DUMPBITS(t)
+ s->mode = LENS; /* get length of stored block */
+ break;
+ case 1: /* fixed */
+ Tracev((stderr, "inflate: fixed codes block%s\n",
+ s->last ? " (last)" : ""));
+ {
+ uInt bl, bd;
+ inflate_huft *tl, *td;
+
+ inflate_trees_fixed(&bl, &bd, &tl, &td, z);
+ s->sub.decode.codes = inflate_codes_new(bl, bd, tl, td, z);
+ if (s->sub.decode.codes == Z_NULL)
+ {
+ r = Z_MEM_ERROR;
+ LEAVE
+ }
+ }
+ DUMPBITS(3)
+ s->mode = CODES;
+ break;
+ case 2: /* dynamic */
+ Tracev((stderr, "inflate: dynamic codes block%s\n",
+ s->last ? " (last)" : ""));
+ DUMPBITS(3)
+ s->mode = TABLE;
+ break;
+ case 3: /* illegal */
+ DUMPBITS(3)
+ s->mode = BAD;
+ z->msg = (char*)"invalid block type";
+ r = Z_DATA_ERROR;
+ LEAVE
+ }
+ break;
+ case LENS:
+ NEEDBITS(32)
+ if ((((~b) >> 16) & 0xffff) != (b & 0xffff))
+ {
+ s->mode = BAD;
+ z->msg = (char*)"invalid stored block lengths";
+ r = Z_DATA_ERROR;
+ LEAVE
+ }
+ s->sub.left = (uInt)b & 0xffff;
+ b = k = 0; /* dump bits */
+ Tracev((stderr, "inflate: stored length %u\n", s->sub.left));
+ s->mode = s->sub.left ? STORED : (s->last ? DRY : TYPE);
+ break;
+ case STORED:
+ if (n == 0)
+ LEAVE
+ NEEDOUT
+ t = s->sub.left;
+ if (t > n) t = n;
+ if (t > m) t = m;
+ zmemcpy(q, p, t);
+ p += t; n -= t;
+ q += t; m -= t;
+ if ((s->sub.left -= t) != 0)
+ break;
+ Tracev((stderr, "inflate: stored end, %lu total out\n",
+ z->total_out + (q >= s->read ? q - s->read :
+ (s->end - s->read) + (q - s->window))));
+ s->mode = s->last ? DRY : TYPE;
+ break;
+ case TABLE:
+ NEEDBITS(14)
+ s->sub.trees.table = t = (uInt)b & 0x3fff;
+#ifndef PKZIP_BUG_WORKAROUND
+ if ((t & 0x1f) > 29 || ((t >> 5) & 0x1f) > 29)
+ {
+ s->mode = BAD;
+ z->msg = (char*)"too many length or distance symbols";
+ r = Z_DATA_ERROR;
+ LEAVE
+ }
+#endif
+ t = 258 + (t & 0x1f) + ((t >> 5) & 0x1f);
+ if ((s->sub.trees.blens = (uIntf*)ZALLOC(z, t, sizeof(uInt))) == Z_NULL)
+ {
+ r = Z_MEM_ERROR;
+ LEAVE
+ }
+ DUMPBITS(14)
+ s->sub.trees.index = 0;
+ Tracev((stderr, "inflate: table sizes ok\n"));
+ s->mode = BTREE;
+ case BTREE:
+ while (s->sub.trees.index < 4 + (s->sub.trees.table >> 10))
+ {
+ NEEDBITS(3)
+ s->sub.trees.blens[border[s->sub.trees.index++]] = (uInt)b & 7;
+ DUMPBITS(3)
+ }
+ while (s->sub.trees.index < 19)
+ s->sub.trees.blens[border[s->sub.trees.index++]] = 0;
+ s->sub.trees.bb = 7;
+ t = inflate_trees_bits(s->sub.trees.blens, &s->sub.trees.bb,
+ &s->sub.trees.tb, s->hufts, z);
+ if (t != Z_OK)
+ {
+ ZFREE(z, s->sub.trees.blens);
+ r = t;
+ if (r == Z_DATA_ERROR)
+ s->mode = BAD;
+ LEAVE
+ }
+ s->sub.trees.index = 0;
+ Tracev((stderr, "inflate: bits tree ok\n"));
+ s->mode = DTREE;
+ case DTREE:
+ while (t = s->sub.trees.table,
+ s->sub.trees.index < 258 + (t & 0x1f) + ((t >> 5) & 0x1f))
+ {
+ inflate_huft *h;
+ uInt i, j, c;
+
+ t = s->sub.trees.bb;
+ NEEDBITS(t)
+ h = s->sub.trees.tb + ((uInt)b & inflate_mask[t]);
+ t = h->bits;
+ c = h->base;
+ if (c < 16)
+ {
+ DUMPBITS(t)
+ s->sub.trees.blens[s->sub.trees.index++] = c;
+ }
+ else /* c == 16..18 */
+ {
+ i = c == 18 ? 7 : c - 14;
+ j = c == 18 ? 11 : 3;
+ NEEDBITS(t + i)
+ DUMPBITS(t)
+ j += (uInt)b & inflate_mask[i];
+ DUMPBITS(i)
+ i = s->sub.trees.index;
+ t = s->sub.trees.table;
+ if (i + j > 258 + (t & 0x1f) + ((t >> 5) & 0x1f) ||
+ (c == 16 && i < 1))
+ {
+ ZFREE(z, s->sub.trees.blens);
+ s->mode = BAD;
+ z->msg = (char*)"invalid bit length repeat";
+ r = Z_DATA_ERROR;
+ LEAVE
+ }
+ c = c == 16 ? s->sub.trees.blens[i - 1] : 0;
+ do {
+ s->sub.trees.blens[i++] = c;
+ } while (--j);
+ s->sub.trees.index = i;
+ }
+ }
+ s->sub.trees.tb = Z_NULL;
+ {
+ uInt bl, bd;
+ inflate_huft *tl, *td;
+ inflate_codes_statef *c;
+
+ bl = 9; /* must be <= 9 for lookahead assumptions */
+ bd = 6; /* must be <= 9 for lookahead assumptions */
+ t = s->sub.trees.table;
+ t = inflate_trees_dynamic(257 + (t & 0x1f), 1 + ((t >> 5) & 0x1f),
+ s->sub.trees.blens, &bl, &bd, &tl, &td,
+ s->hufts, z);
+ ZFREE(z, s->sub.trees.blens);
+ if (t != Z_OK)
+ {
+ if (t == (uInt)Z_DATA_ERROR)
+ s->mode = BAD;
+ r = t;
+ LEAVE
+ }
+ Tracev((stderr, "inflate: trees ok\n"));
+ if ((c = inflate_codes_new(bl, bd, tl, td, z)) == Z_NULL)
+ {
+ r = Z_MEM_ERROR;
+ LEAVE
+ }
+ s->sub.decode.codes = c;
+ }
+ s->mode = CODES;
+ case CODES:
+ UPDATE
+ if ((r = inflate_codes(s, z, r)) != Z_STREAM_END)
+ return inflate_flush(s, z, r);
+ r = Z_OK;
+ inflate_codes_free(s->sub.decode.codes, z);
+ LOAD
+ Tracev((stderr, "inflate: codes end, %lu total out\n",
+ z->total_out + (q >= s->read ? q - s->read :
+ (s->end - s->read) + (q - s->window))));
+ if (!s->last)
+ {
+ s->mode = TYPE;
+ break;
+ }
+ s->mode = DRY;
+ case DRY:
+ FLUSH
+ if (s->read != s->write)
+ LEAVE
+ s->mode = DONE;
+ case DONE:
+ r = Z_STREAM_END;
+ LEAVE
+ case BAD:
+ r = Z_DATA_ERROR;
+ LEAVE
+ default:
+ r = Z_STREAM_ERROR;
+ LEAVE
+ }
+}
+
+
+int inflate_blocks_free(s, z)
+inflate_blocks_statef *s;
+z_streamp z;
+{
+ inflate_blocks_reset(s, z, Z_NULL);
+ ZFREE(z, s->window);
+ ZFREE(z, s->hufts);
+ ZFREE(z, s);
+ Tracev((stderr, "inflate: blocks freed\n"));
+ return Z_OK;
+}
+
+
+void inflate_set_dictionary(s, d, n)
+inflate_blocks_statef *s;
+const Bytef *d;
+uInt n;
+{
+ zmemcpy(s->window, d, n);
+ s->read = s->write = s->window + n;
+}
+
+
+/* Returns true if inflate is currently at the end of a block generated
+ * by Z_SYNC_FLUSH or Z_FULL_FLUSH.
+ * IN assertion: s != Z_NULL
+ */
+int inflate_blocks_sync_point(s)
+inflate_blocks_statef *s;
+{
+ return s->mode == LENS;
+}
--- /dev/null
+/* infblock.h -- header to use infblock.c
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+struct inflate_blocks_state;
+typedef struct inflate_blocks_state FAR inflate_blocks_statef;
+
+extern inflate_blocks_statef * inflate_blocks_new OF((
+ z_streamp z,
+ check_func c, /* check function */
+ uInt w)); /* window size */
+
+extern int inflate_blocks OF((
+ inflate_blocks_statef *,
+ z_streamp ,
+ int)); /* initial return code */
+
+extern void inflate_blocks_reset OF((
+ inflate_blocks_statef *,
+ z_streamp ,
+ uLongf *)); /* check value on output */
+
+extern int inflate_blocks_free OF((
+ inflate_blocks_statef *,
+ z_streamp));
+
+extern void inflate_set_dictionary OF((
+ inflate_blocks_statef *s,
+ const Bytef *d, /* dictionary */
+ uInt n)); /* dictionary length */
+
+extern int inflate_blocks_sync_point OF((
+ inflate_blocks_statef *s));
--- /dev/null
+/* infcodes.c -- process literals and length/distance pairs
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+#include "infblock.h"
+#include "infcodes.h"
+#include "infutil.h"
+#include "inffast.h"
+
+/* simplify the use of the inflate_huft type with some defines */
+#define exop word.what.Exop
+#define bits word.what.Bits
+
+typedef enum { /* waiting for "i:"=input, "o:"=output, "x:"=nothing */
+ START, /* x: set up for LEN */
+ LEN, /* i: get length/literal/eob next */
+ LENEXT, /* i: getting length extra (have base) */
+ DIST, /* i: get distance next */
+ DISTEXT, /* i: getting distance extra */
+ COPY, /* o: copying bytes in window, waiting for space */
+ LIT, /* o: got literal, waiting for output space */
+ WASH, /* o: got eob, possibly still output waiting */
+ END, /* x: got eob and all data flushed */
+ BADCODE} /* x: got error */
+inflate_codes_mode;
+
+/* inflate codes private state */
+struct inflate_codes_state {
+
+ /* mode */
+ inflate_codes_mode mode; /* current inflate_codes mode */
+
+ /* mode dependent information */
+ uInt len;
+ union {
+ struct {
+ inflate_huft *tree; /* pointer into tree */
+ uInt need; /* bits needed */
+ } code; /* if LEN or DIST, where in tree */
+ uInt lit; /* if LIT, literal */
+ struct {
+ uInt get; /* bits to get for extra */
+ uInt dist; /* distance back to copy from */
+ } copy; /* if EXT or COPY, where and how much */
+ } sub; /* submode */
+
+ /* mode independent information */
+ Byte lbits; /* ltree bits decoded per branch */
+ Byte dbits; /* dtree bits decoder per branch */
+ inflate_huft *ltree; /* literal/length/eob tree */
+ inflate_huft *dtree; /* distance tree */
+
+};
+
+
+inflate_codes_statef *inflate_codes_new(bl, bd, tl, td, z)
+uInt bl, bd;
+inflate_huft *tl;
+inflate_huft *td; /* need separate declaration for Borland C++ */
+z_streamp z;
+{
+ inflate_codes_statef *c;
+
+ if ((c = (inflate_codes_statef *)
+ ZALLOC(z,1,sizeof(struct inflate_codes_state))) != Z_NULL)
+ {
+ c->mode = START;
+ c->lbits = (Byte)bl;
+ c->dbits = (Byte)bd;
+ c->ltree = tl;
+ c->dtree = td;
+ Tracev((stderr, "inflate: codes new\n"));
+ }
+ return c;
+}
+
+
+int inflate_codes(s, z, r)
+inflate_blocks_statef *s;
+z_streamp z;
+int r;
+{
+ uInt j; /* temporary storage */
+ inflate_huft *t; /* temporary pointer */
+ uInt e; /* extra bits or operation */
+ uLong b; /* bit buffer */
+ uInt k; /* bits in bit buffer */
+ Bytef *p; /* input data pointer */
+ uInt n; /* bytes available there */
+ Bytef *q; /* output window write pointer */
+ uInt m; /* bytes to end of window or read pointer */
+ Bytef *f; /* pointer to copy strings from */
+ inflate_codes_statef *c = s->sub.decode.codes; /* codes state */
+
+ /* copy input/output information to locals (UPDATE macro restores) */
+ LOAD
+
+ /* process input and output based on current state */
+ while (1) switch (c->mode)
+ { /* waiting for "i:"=input, "o:"=output, "x:"=nothing */
+ case START: /* x: set up for LEN */
+#ifndef SLOW
+ if (m >= 258 && n >= 10)
+ {
+ UPDATE
+ r = inflate_fast(c->lbits, c->dbits, c->ltree, c->dtree, s, z);
+ LOAD
+ if (r != Z_OK)
+ {
+ c->mode = r == Z_STREAM_END ? WASH : BADCODE;
+ break;
+ }
+ }
+#endif /* !SLOW */
+ c->sub.code.need = c->lbits;
+ c->sub.code.tree = c->ltree;
+ c->mode = LEN;
+ case LEN: /* i: get length/literal/eob next */
+ j = c->sub.code.need;
+ NEEDBITS(j)
+ t = c->sub.code.tree + ((uInt)b & inflate_mask[j]);
+ DUMPBITS(t->bits)
+ e = (uInt)(t->exop);
+ if (e == 0) /* literal */
+ {
+ c->sub.lit = t->base;
+ Tracevv((stderr, t->base >= 0x20 && t->base < 0x7f ?
+ "inflate: literal '%c'\n" :
+ "inflate: literal 0x%02x\n", t->base));
+ c->mode = LIT;
+ break;
+ }
+ if (e & 16) /* length */
+ {
+ c->sub.copy.get = e & 15;
+ c->len = t->base;
+ c->mode = LENEXT;
+ break;
+ }
+ if ((e & 64) == 0) /* next table */
+ {
+ c->sub.code.need = e;
+ c->sub.code.tree = t + t->base;
+ break;
+ }
+ if (e & 32) /* end of block */
+ {
+ Tracevv((stderr, "inflate: end of block\n"));
+ c->mode = WASH;
+ break;
+ }
+ c->mode = BADCODE; /* invalid code */
+ z->msg = (char*)"invalid literal/length code";
+ r = Z_DATA_ERROR;
+ LEAVE
+ case LENEXT: /* i: getting length extra (have base) */
+ j = c->sub.copy.get;
+ NEEDBITS(j)
+ c->len += (uInt)b & inflate_mask[j];
+ DUMPBITS(j)
+ c->sub.code.need = c->dbits;
+ c->sub.code.tree = c->dtree;
+ Tracevv((stderr, "inflate: length %u\n", c->len));
+ c->mode = DIST;
+ case DIST: /* i: get distance next */
+ j = c->sub.code.need;
+ NEEDBITS(j)
+ t = c->sub.code.tree + ((uInt)b & inflate_mask[j]);
+ DUMPBITS(t->bits)
+ e = (uInt)(t->exop);
+ if (e & 16) /* distance */
+ {
+ c->sub.copy.get = e & 15;
+ c->sub.copy.dist = t->base;
+ c->mode = DISTEXT;
+ break;
+ }
+ if ((e & 64) == 0) /* next table */
+ {
+ c->sub.code.need = e;
+ c->sub.code.tree = t + t->base;
+ break;
+ }
+ c->mode = BADCODE; /* invalid code */
+ z->msg = (char*)"invalid distance code";
+ r = Z_DATA_ERROR;
+ LEAVE
+ case DISTEXT: /* i: getting distance extra */
+ j = c->sub.copy.get;
+ NEEDBITS(j)
+ c->sub.copy.dist += (uInt)b & inflate_mask[j];
+ DUMPBITS(j)
+ Tracevv((stderr, "inflate: distance %u\n", c->sub.copy.dist));
+ c->mode = COPY;
+ case COPY: /* o: copying bytes in window, waiting for space */
+#ifndef __TURBOC__ /* Turbo C bug for following expression */
+ f = (uInt)(q - s->window) < c->sub.copy.dist ?
+ s->end - (c->sub.copy.dist - (q - s->window)) :
+ q - c->sub.copy.dist;
+#else
+ f = q - c->sub.copy.dist;
+ if ((uInt)(q - s->window) < c->sub.copy.dist)
+ f = s->end - (c->sub.copy.dist - (uInt)(q - s->window));
+#endif
+ while (c->len)
+ {
+ NEEDOUT
+ OUTBYTE(*f++)
+ if (f == s->end)
+ f = s->window;
+ c->len--;
+ }
+ c->mode = START;
+ break;
+ case LIT: /* o: got literal, waiting for output space */
+ NEEDOUT
+ OUTBYTE(c->sub.lit)
+ c->mode = START;
+ break;
+ case WASH: /* o: got eob, possibly more output */
+ if (k > 7) /* return unused byte, if any */
+ {
+ Assert(k < 16, "inflate_codes grabbed too many bytes")
+ k -= 8;
+ n++;
+ p--; /* can always return one */
+ }
+ FLUSH
+ if (s->read != s->write)
+ LEAVE
+ c->mode = END;
+ case END:
+ r = Z_STREAM_END;
+ LEAVE
+ case BADCODE: /* x: got error */
+ r = Z_DATA_ERROR;
+ LEAVE
+ default:
+ r = Z_STREAM_ERROR;
+ LEAVE
+ }
+#ifdef NEED_DUMMY_RETURN
+ return Z_STREAM_ERROR; /* Some dumb compilers complain without this */
+#endif
+}
+
+
+void inflate_codes_free(c, z)
+inflate_codes_statef *c;
+z_streamp z;
+{
+ ZFREE(z, c);
+ Tracev((stderr, "inflate: codes free\n"));
+}
--- /dev/null
+/* infcodes.h -- header to use infcodes.c
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+struct inflate_codes_state;
+typedef struct inflate_codes_state FAR inflate_codes_statef;
+
+extern inflate_codes_statef *inflate_codes_new OF((
+ uInt, uInt,
+ inflate_huft *, inflate_huft *,
+ z_streamp ));
+
+extern int inflate_codes OF((
+ inflate_blocks_statef *,
+ z_streamp ,
+ int));
+
+extern void inflate_codes_free OF((
+ inflate_codes_statef *,
+ z_streamp ));
+
--- /dev/null
+/* inffast.c -- process literals and length/distance pairs fast
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+#include "infblock.h"
+#include "infcodes.h"
+#include "infutil.h"
+#include "inffast.h"
+
+struct inflate_codes_state {int dummy;}; /* for buggy compilers */
+
+/* simplify the use of the inflate_huft type with some defines */
+#define exop word.what.Exop
+#define bits word.what.Bits
+
+/* macros for bit input with no checking and for returning unused bytes */
+#define GRABBITS(j) {while(k<(j)){b|=((uLong)NEXTBYTE)<<k;k+=8;}}
+#define UNGRAB {c=z->avail_in-n;c=(k>>3)<c?k>>3:c;n+=c;p-=c;k-=c<<3;}
+
+/* Called with number of bytes left to write in window at least 258
+ (the maximum string length) and number of input bytes available
+ at least ten. The ten bytes are six bytes for the longest length/
+ distance pair plus four bytes for overloading the bit buffer. */
+
+int inflate_fast(bl, bd, tl, td, s, z)
+uInt bl, bd;
+inflate_huft *tl;
+inflate_huft *td; /* need separate declaration for Borland C++ */
+inflate_blocks_statef *s;
+z_streamp z;
+{
+ inflate_huft *t; /* temporary pointer */
+ uInt e; /* extra bits or operation */
+ uLong b; /* bit buffer */
+ uInt k; /* bits in bit buffer */
+ Bytef *p; /* input data pointer */
+ uInt n; /* bytes available there */
+ Bytef *q; /* output window write pointer */
+ uInt m; /* bytes to end of window or read pointer */
+ uInt ml; /* mask for literal/length tree */
+ uInt md; /* mask for distance tree */
+ uInt c; /* bytes to copy */
+ uInt d; /* distance back to copy from */
+ Bytef *r; /* copy source pointer */
+
+ /* load input, output, bit values */
+ LOAD
+
+ /* initialize masks */
+ ml = inflate_mask[bl];
+ md = inflate_mask[bd];
+
+ /* do until not enough input or output space for fast loop */
+ do { /* assume called with m >= 258 && n >= 10 */
+ /* get literal/length code */
+ GRABBITS(20) /* max bits for literal/length code */
+ if ((e = (t = tl + ((uInt)b & ml))->exop) == 0)
+ {
+ DUMPBITS(t->bits)
+ Tracevv((stderr, t->base >= 0x20 && t->base < 0x7f ?
+ "inflate: * literal '%c'\n" :
+ "inflate: * literal 0x%02x\n", t->base));
+ *q++ = (Byte)t->base;
+ m--;
+ continue;
+ }
+ do {
+ DUMPBITS(t->bits)
+ if (e & 16)
+ {
+ /* get extra bits for length */
+ e &= 15;
+ c = t->base + ((uInt)b & inflate_mask[e]);
+ DUMPBITS(e)
+ Tracevv((stderr, "inflate: * length %u\n", c));
+
+ /* decode distance base of block to copy */
+ GRABBITS(15); /* max bits for distance code */
+ e = (t = td + ((uInt)b & md))->exop;
+ do {
+ DUMPBITS(t->bits)
+ if (e & 16)
+ {
+ /* get extra bits to add to distance base */
+ e &= 15;
+ GRABBITS(e) /* get extra bits (up to 13) */
+ d = t->base + ((uInt)b & inflate_mask[e]);
+ DUMPBITS(e)
+ Tracevv((stderr, "inflate: * distance %u\n", d));
+
+ /* do the copy */
+ m -= c;
+ if ((uInt)(q - s->window) >= d) /* offset before dest */
+ { /* just copy */
+ r = q - d;
+ *q++ = *r++; c--; /* minimum count is three, */
+ *q++ = *r++; c--; /* so unroll loop a little */
+ }
+ else /* else offset after destination */
+ {
+ e = d - (uInt)(q - s->window); /* bytes from offset to end */
+ r = s->end - e; /* pointer to offset */
+ if (c > e) /* if source crosses, */
+ {
+ c -= e; /* copy to end of window */
+ do {
+ *q++ = *r++;
+ } while (--e);
+ r = s->window; /* copy rest from start of window */
+ }
+ }
+ do { /* copy all or what's left */
+ *q++ = *r++;
+ } while (--c);
+ break;
+ }
+ else if ((e & 64) == 0)
+ {
+ t += t->base;
+ e = (t += ((uInt)b & inflate_mask[e]))->exop;
+ }
+ else
+ {
+ z->msg = (char*)"invalid distance code";
+ UNGRAB
+ UPDATE
+ return Z_DATA_ERROR;
+ }
+ } while (1);
+ break;
+ }
+ if ((e & 64) == 0)
+ {
+ t += t->base;
+ if ((e = (t += ((uInt)b & inflate_mask[e]))->exop) == 0)
+ {
+ DUMPBITS(t->bits)
+ Tracevv((stderr, t->base >= 0x20 && t->base < 0x7f ?
+ "inflate: * literal '%c'\n" :
+ "inflate: * literal 0x%02x\n", t->base));
+ *q++ = (Byte)t->base;
+ m--;
+ break;
+ }
+ }
+ else if (e & 32)
+ {
+ Tracevv((stderr, "inflate: * end of block\n"));
+ UNGRAB
+ UPDATE
+ return Z_STREAM_END;
+ }
+ else
+ {
+ z->msg = (char*)"invalid literal/length code";
+ UNGRAB
+ UPDATE
+ return Z_DATA_ERROR;
+ }
+ } while (1);
+ } while (m >= 258 && n >= 10);
+
+ /* not enough input or output--restore pointers and return */
+ UNGRAB
+ UPDATE
+ return Z_OK;
+}
--- /dev/null
+/* inffast.h -- header to use inffast.c
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+extern int inflate_fast OF((
+ uInt,
+ uInt,
+ inflate_huft *,
+ inflate_huft *,
+ inflate_blocks_statef *,
+ z_streamp ));
--- /dev/null
+/* inffixed.h -- table for decoding fixed codes
+ * Generated automatically by the maketree.c program
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+local uInt fixed_bl = 9;
+local uInt fixed_bd = 5;
+local inflate_huft fixed_tl[] = {
+ {{{96,7}},256}, {{{0,8}},80}, {{{0,8}},16}, {{{84,8}},115},
+ {{{82,7}},31}, {{{0,8}},112}, {{{0,8}},48}, {{{0,9}},192},
+ {{{80,7}},10}, {{{0,8}},96}, {{{0,8}},32}, {{{0,9}},160},
+ {{{0,8}},0}, {{{0,8}},128}, {{{0,8}},64}, {{{0,9}},224},
+ {{{80,7}},6}, {{{0,8}},88}, {{{0,8}},24}, {{{0,9}},144},
+ {{{83,7}},59}, {{{0,8}},120}, {{{0,8}},56}, {{{0,9}},208},
+ {{{81,7}},17}, {{{0,8}},104}, {{{0,8}},40}, {{{0,9}},176},
+ {{{0,8}},8}, {{{0,8}},136}, {{{0,8}},72}, {{{0,9}},240},
+ {{{80,7}},4}, {{{0,8}},84}, {{{0,8}},20}, {{{85,8}},227},
+ {{{83,7}},43}, {{{0,8}},116}, {{{0,8}},52}, {{{0,9}},200},
+ {{{81,7}},13}, {{{0,8}},100}, {{{0,8}},36}, {{{0,9}},168},
+ {{{0,8}},4}, {{{0,8}},132}, {{{0,8}},68}, {{{0,9}},232},
+ {{{80,7}},8}, {{{0,8}},92}, {{{0,8}},28}, {{{0,9}},152},
+ {{{84,7}},83}, {{{0,8}},124}, {{{0,8}},60}, {{{0,9}},216},
+ {{{82,7}},23}, {{{0,8}},108}, {{{0,8}},44}, {{{0,9}},184},
+ {{{0,8}},12}, {{{0,8}},140}, {{{0,8}},76}, {{{0,9}},248},
+ {{{80,7}},3}, {{{0,8}},82}, {{{0,8}},18}, {{{85,8}},163},
+ {{{83,7}},35}, {{{0,8}},114}, {{{0,8}},50}, {{{0,9}},196},
+ {{{81,7}},11}, {{{0,8}},98}, {{{0,8}},34}, {{{0,9}},164},
+ {{{0,8}},2}, {{{0,8}},130}, {{{0,8}},66}, {{{0,9}},228},
+ {{{80,7}},7}, {{{0,8}},90}, {{{0,8}},26}, {{{0,9}},148},
+ {{{84,7}},67}, {{{0,8}},122}, {{{0,8}},58}, {{{0,9}},212},
+ {{{82,7}},19}, {{{0,8}},106}, {{{0,8}},42}, {{{0,9}},180},
+ {{{0,8}},10}, {{{0,8}},138}, {{{0,8}},74}, {{{0,9}},244},
+ {{{80,7}},5}, {{{0,8}},86}, {{{0,8}},22}, {{{192,8}},0},
+ {{{83,7}},51}, {{{0,8}},118}, {{{0,8}},54}, {{{0,9}},204},
+ {{{81,7}},15}, {{{0,8}},102}, {{{0,8}},38}, {{{0,9}},172},
+ {{{0,8}},6}, {{{0,8}},134}, {{{0,8}},70}, {{{0,9}},236},
+ {{{80,7}},9}, {{{0,8}},94}, {{{0,8}},30}, {{{0,9}},156},
+ {{{84,7}},99}, {{{0,8}},126}, {{{0,8}},62}, {{{0,9}},220},
+ {{{82,7}},27}, {{{0,8}},110}, {{{0,8}},46}, {{{0,9}},188},
+ {{{0,8}},14}, {{{0,8}},142}, {{{0,8}},78}, {{{0,9}},252},
+ {{{96,7}},256}, {{{0,8}},81}, {{{0,8}},17}, {{{85,8}},131},
+ {{{82,7}},31}, {{{0,8}},113}, {{{0,8}},49}, {{{0,9}},194},
+ {{{80,7}},10}, {{{0,8}},97}, {{{0,8}},33}, {{{0,9}},162},
+ {{{0,8}},1}, {{{0,8}},129}, {{{0,8}},65}, {{{0,9}},226},
+ {{{80,7}},6}, {{{0,8}},89}, {{{0,8}},25}, {{{0,9}},146},
+ {{{83,7}},59}, {{{0,8}},121}, {{{0,8}},57}, {{{0,9}},210},
+ {{{81,7}},17}, {{{0,8}},105}, {{{0,8}},41}, {{{0,9}},178},
+ {{{0,8}},9}, {{{0,8}},137}, {{{0,8}},73}, {{{0,9}},242},
+ {{{80,7}},4}, {{{0,8}},85}, {{{0,8}},21}, {{{80,8}},258},
+ {{{83,7}},43}, {{{0,8}},117}, {{{0,8}},53}, {{{0,9}},202},
+ {{{81,7}},13}, {{{0,8}},101}, {{{0,8}},37}, {{{0,9}},170},
+ {{{0,8}},5}, {{{0,8}},133}, {{{0,8}},69}, {{{0,9}},234},
+ {{{80,7}},8}, {{{0,8}},93}, {{{0,8}},29}, {{{0,9}},154},
+ {{{84,7}},83}, {{{0,8}},125}, {{{0,8}},61}, {{{0,9}},218},
+ {{{82,7}},23}, {{{0,8}},109}, {{{0,8}},45}, {{{0,9}},186},
+ {{{0,8}},13}, {{{0,8}},141}, {{{0,8}},77}, {{{0,9}},250},
+ {{{80,7}},3}, {{{0,8}},83}, {{{0,8}},19}, {{{85,8}},195},
+ {{{83,7}},35}, {{{0,8}},115}, {{{0,8}},51}, {{{0,9}},198},
+ {{{81,7}},11}, {{{0,8}},99}, {{{0,8}},35}, {{{0,9}},166},
+ {{{0,8}},3}, {{{0,8}},131}, {{{0,8}},67}, {{{0,9}},230},
+ {{{80,7}},7}, {{{0,8}},91}, {{{0,8}},27}, {{{0,9}},150},
+ {{{84,7}},67}, {{{0,8}},123}, {{{0,8}},59}, {{{0,9}},214},
+ {{{82,7}},19}, {{{0,8}},107}, {{{0,8}},43}, {{{0,9}},182},
+ {{{0,8}},11}, {{{0,8}},139}, {{{0,8}},75}, {{{0,9}},246},
+ {{{80,7}},5}, {{{0,8}},87}, {{{0,8}},23}, {{{192,8}},0},
+ {{{83,7}},51}, {{{0,8}},119}, {{{0,8}},55}, {{{0,9}},206},
+ {{{81,7}},15}, {{{0,8}},103}, {{{0,8}},39}, {{{0,9}},174},
+ {{{0,8}},7}, {{{0,8}},135}, {{{0,8}},71}, {{{0,9}},238},
+ {{{80,7}},9}, {{{0,8}},95}, {{{0,8}},31}, {{{0,9}},158},
+ {{{84,7}},99}, {{{0,8}},127}, {{{0,8}},63}, {{{0,9}},222},
+ {{{82,7}},27}, {{{0,8}},111}, {{{0,8}},47}, {{{0,9}},190},
+ {{{0,8}},15}, {{{0,8}},143}, {{{0,8}},79}, {{{0,9}},254},
+ {{{96,7}},256}, {{{0,8}},80}, {{{0,8}},16}, {{{84,8}},115},
+ {{{82,7}},31}, {{{0,8}},112}, {{{0,8}},48}, {{{0,9}},193},
+ {{{80,7}},10}, {{{0,8}},96}, {{{0,8}},32}, {{{0,9}},161},
+ {{{0,8}},0}, {{{0,8}},128}, {{{0,8}},64}, {{{0,9}},225},
+ {{{80,7}},6}, {{{0,8}},88}, {{{0,8}},24}, {{{0,9}},145},
+ {{{83,7}},59}, {{{0,8}},120}, {{{0,8}},56}, {{{0,9}},209},
+ {{{81,7}},17}, {{{0,8}},104}, {{{0,8}},40}, {{{0,9}},177},
+ {{{0,8}},8}, {{{0,8}},136}, {{{0,8}},72}, {{{0,9}},241},
+ {{{80,7}},4}, {{{0,8}},84}, {{{0,8}},20}, {{{85,8}},227},
+ {{{83,7}},43}, {{{0,8}},116}, {{{0,8}},52}, {{{0,9}},201},
+ {{{81,7}},13}, {{{0,8}},100}, {{{0,8}},36}, {{{0,9}},169},
+ {{{0,8}},4}, {{{0,8}},132}, {{{0,8}},68}, {{{0,9}},233},
+ {{{80,7}},8}, {{{0,8}},92}, {{{0,8}},28}, {{{0,9}},153},
+ {{{84,7}},83}, {{{0,8}},124}, {{{0,8}},60}, {{{0,9}},217},
+ {{{82,7}},23}, {{{0,8}},108}, {{{0,8}},44}, {{{0,9}},185},
+ {{{0,8}},12}, {{{0,8}},140}, {{{0,8}},76}, {{{0,9}},249},
+ {{{80,7}},3}, {{{0,8}},82}, {{{0,8}},18}, {{{85,8}},163},
+ {{{83,7}},35}, {{{0,8}},114}, {{{0,8}},50}, {{{0,9}},197},
+ {{{81,7}},11}, {{{0,8}},98}, {{{0,8}},34}, {{{0,9}},165},
+ {{{0,8}},2}, {{{0,8}},130}, {{{0,8}},66}, {{{0,9}},229},
+ {{{80,7}},7}, {{{0,8}},90}, {{{0,8}},26}, {{{0,9}},149},
+ {{{84,7}},67}, {{{0,8}},122}, {{{0,8}},58}, {{{0,9}},213},
+ {{{82,7}},19}, {{{0,8}},106}, {{{0,8}},42}, {{{0,9}},181},
+ {{{0,8}},10}, {{{0,8}},138}, {{{0,8}},74}, {{{0,9}},245},
+ {{{80,7}},5}, {{{0,8}},86}, {{{0,8}},22}, {{{192,8}},0},
+ {{{83,7}},51}, {{{0,8}},118}, {{{0,8}},54}, {{{0,9}},205},
+ {{{81,7}},15}, {{{0,8}},102}, {{{0,8}},38}, {{{0,9}},173},
+ {{{0,8}},6}, {{{0,8}},134}, {{{0,8}},70}, {{{0,9}},237},
+ {{{80,7}},9}, {{{0,8}},94}, {{{0,8}},30}, {{{0,9}},157},
+ {{{84,7}},99}, {{{0,8}},126}, {{{0,8}},62}, {{{0,9}},221},
+ {{{82,7}},27}, {{{0,8}},110}, {{{0,8}},46}, {{{0,9}},189},
+ {{{0,8}},14}, {{{0,8}},142}, {{{0,8}},78}, {{{0,9}},253},
+ {{{96,7}},256}, {{{0,8}},81}, {{{0,8}},17}, {{{85,8}},131},
+ {{{82,7}},31}, {{{0,8}},113}, {{{0,8}},49}, {{{0,9}},195},
+ {{{80,7}},10}, {{{0,8}},97}, {{{0,8}},33}, {{{0,9}},163},
+ {{{0,8}},1}, {{{0,8}},129}, {{{0,8}},65}, {{{0,9}},227},
+ {{{80,7}},6}, {{{0,8}},89}, {{{0,8}},25}, {{{0,9}},147},
+ {{{83,7}},59}, {{{0,8}},121}, {{{0,8}},57}, {{{0,9}},211},
+ {{{81,7}},17}, {{{0,8}},105}, {{{0,8}},41}, {{{0,9}},179},
+ {{{0,8}},9}, {{{0,8}},137}, {{{0,8}},73}, {{{0,9}},243},
+ {{{80,7}},4}, {{{0,8}},85}, {{{0,8}},21}, {{{80,8}},258},
+ {{{83,7}},43}, {{{0,8}},117}, {{{0,8}},53}, {{{0,9}},203},
+ {{{81,7}},13}, {{{0,8}},101}, {{{0,8}},37}, {{{0,9}},171},
+ {{{0,8}},5}, {{{0,8}},133}, {{{0,8}},69}, {{{0,9}},235},
+ {{{80,7}},8}, {{{0,8}},93}, {{{0,8}},29}, {{{0,9}},155},
+ {{{84,7}},83}, {{{0,8}},125}, {{{0,8}},61}, {{{0,9}},219},
+ {{{82,7}},23}, {{{0,8}},109}, {{{0,8}},45}, {{{0,9}},187},
+ {{{0,8}},13}, {{{0,8}},141}, {{{0,8}},77}, {{{0,9}},251},
+ {{{80,7}},3}, {{{0,8}},83}, {{{0,8}},19}, {{{85,8}},195},
+ {{{83,7}},35}, {{{0,8}},115}, {{{0,8}},51}, {{{0,9}},199},
+ {{{81,7}},11}, {{{0,8}},99}, {{{0,8}},35}, {{{0,9}},167},
+ {{{0,8}},3}, {{{0,8}},131}, {{{0,8}},67}, {{{0,9}},231},
+ {{{80,7}},7}, {{{0,8}},91}, {{{0,8}},27}, {{{0,9}},151},
+ {{{84,7}},67}, {{{0,8}},123}, {{{0,8}},59}, {{{0,9}},215},
+ {{{82,7}},19}, {{{0,8}},107}, {{{0,8}},43}, {{{0,9}},183},
+ {{{0,8}},11}, {{{0,8}},139}, {{{0,8}},75}, {{{0,9}},247},
+ {{{80,7}},5}, {{{0,8}},87}, {{{0,8}},23}, {{{192,8}},0},
+ {{{83,7}},51}, {{{0,8}},119}, {{{0,8}},55}, {{{0,9}},207},
+ {{{81,7}},15}, {{{0,8}},103}, {{{0,8}},39}, {{{0,9}},175},
+ {{{0,8}},7}, {{{0,8}},135}, {{{0,8}},71}, {{{0,9}},239},
+ {{{80,7}},9}, {{{0,8}},95}, {{{0,8}},31}, {{{0,9}},159},
+ {{{84,7}},99}, {{{0,8}},127}, {{{0,8}},63}, {{{0,9}},223},
+ {{{82,7}},27}, {{{0,8}},111}, {{{0,8}},47}, {{{0,9}},191},
+ {{{0,8}},15}, {{{0,8}},143}, {{{0,8}},79}, {{{0,9}},255}
+ };
+local inflate_huft fixed_td[] = {
+ {{{80,5}},1}, {{{87,5}},257}, {{{83,5}},17}, {{{91,5}},4097},
+ {{{81,5}},5}, {{{89,5}},1025}, {{{85,5}},65}, {{{93,5}},16385},
+ {{{80,5}},3}, {{{88,5}},513}, {{{84,5}},33}, {{{92,5}},8193},
+ {{{82,5}},9}, {{{90,5}},2049}, {{{86,5}},129}, {{{192,5}},24577},
+ {{{80,5}},2}, {{{87,5}},385}, {{{83,5}},25}, {{{91,5}},6145},
+ {{{81,5}},7}, {{{89,5}},1537}, {{{85,5}},97}, {{{93,5}},24577},
+ {{{80,5}},4}, {{{88,5}},769}, {{{84,5}},49}, {{{92,5}},12289},
+ {{{82,5}},13}, {{{90,5}},3073}, {{{86,5}},193}, {{{192,5}},24577}
+ };
--- /dev/null
+/* inflate.c -- zlib interface to inflate modules
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "infblock.h"
+
+struct inflate_blocks_state {int dummy;}; /* for buggy compilers */
+
+typedef enum {
+ METHOD, /* waiting for method byte */
+ FLAG, /* waiting for flag byte */
+ DICT4, /* four dictionary check bytes to go */
+ DICT3, /* three dictionary check bytes to go */
+ DICT2, /* two dictionary check bytes to go */
+ DICT1, /* one dictionary check byte to go */
+ DICT0, /* waiting for inflateSetDictionary */
+ BLOCKS, /* decompressing blocks */
+ CHECK4, /* four check bytes to go */
+ CHECK3, /* three check bytes to go */
+ CHECK2, /* two check bytes to go */
+ CHECK1, /* one check byte to go */
+ DONE, /* finished check, done */
+ BAD} /* got an error--stay here */
+inflate_mode;
+
+/* inflate private state */
+struct internal_state {
+
+ /* mode */
+ inflate_mode mode; /* current inflate mode */
+
+ /* mode dependent information */
+ union {
+ uInt method; /* if FLAGS, method byte */
+ struct {
+ uLong was; /* computed check value */
+ uLong need; /* stream check value */
+ } check; /* if CHECK, check values to compare */
+ uInt marker; /* if BAD, inflateSync's marker bytes count */
+ } sub; /* submode */
+
+ /* mode independent information */
+ int nowrap; /* flag for no wrapper */
+ uInt wbits; /* log2(window size) (8..15, defaults to 15) */
+ inflate_blocks_statef
+ *blocks; /* current inflate_blocks state */
+
+};
+
+
+int ZEXPORT inflateReset(z)
+z_streamp z;
+{
+ if (z == Z_NULL || z->state == Z_NULL)
+ return Z_STREAM_ERROR;
+ z->total_in = z->total_out = 0;
+ z->msg = Z_NULL;
+ z->state->mode = z->state->nowrap ? BLOCKS : METHOD;
+ inflate_blocks_reset(z->state->blocks, z, Z_NULL);
+ Tracev((stderr, "inflate: reset\n"));
+ return Z_OK;
+}
+
+
+int ZEXPORT inflateEnd(z)
+z_streamp z;
+{
+ if (z == Z_NULL || z->state == Z_NULL || z->zfree == Z_NULL)
+ return Z_STREAM_ERROR;
+ if (z->state->blocks != Z_NULL)
+ inflate_blocks_free(z->state->blocks, z);
+ ZFREE(z, z->state);
+ z->state = Z_NULL;
+ Tracev((stderr, "inflate: end\n"));
+ return Z_OK;
+}
+
+
+int ZEXPORT inflateInit2_(z, w, version, stream_size)
+z_streamp z;
+int w;
+const char *version;
+int stream_size;
+{
+ if (version == Z_NULL || version[0] != ZLIB_VERSION[0] ||
+ stream_size != sizeof(z_stream))
+ return Z_VERSION_ERROR;
+
+ /* initialize state */
+ if (z == Z_NULL)
+ return Z_STREAM_ERROR;
+ z->msg = Z_NULL;
+ if (z->zalloc == Z_NULL)
+ {
+ z->zalloc = zcalloc;
+ z->opaque = (voidpf)0;
+ }
+ if (z->zfree == Z_NULL) z->zfree = zcfree;
+ if ((z->state = (struct internal_state FAR *)
+ ZALLOC(z,1,sizeof(struct internal_state))) == Z_NULL)
+ return Z_MEM_ERROR;
+ z->state->blocks = Z_NULL;
+
+ /* handle undocumented nowrap option (no zlib header or check) */
+ z->state->nowrap = 0;
+ if (w < 0)
+ {
+ w = - w;
+ z->state->nowrap = 1;
+ }
+
+ /* set window size */
+ if (w < 8 || w > 15)
+ {
+ inflateEnd(z);
+ return Z_STREAM_ERROR;
+ }
+ z->state->wbits = (uInt)w;
+
+ /* create inflate_blocks state */
+ if ((z->state->blocks =
+ inflate_blocks_new(z, z->state->nowrap ? Z_NULL : adler32, (uInt)1 << w))
+ == Z_NULL)
+ {
+ inflateEnd(z);
+ return Z_MEM_ERROR;
+ }
+ Tracev((stderr, "inflate: allocated\n"));
+
+ /* reset state */
+ inflateReset(z);
+ return Z_OK;
+}
+
+
+int ZEXPORT inflateInit_(z, version, stream_size)
+z_streamp z;
+const char *version;
+int stream_size;
+{
+ return inflateInit2_(z, DEF_WBITS, version, stream_size);
+}
+
+
+#define NEEDBYTE {if(z->avail_in==0)return r;r=f;}
+#define NEXTBYTE (z->avail_in--,z->total_in++,*z->next_in++)
+
+int ZEXPORT inflate(z, f)
+z_streamp z;
+int f;
+{
+ int r;
+ uInt b;
+
+ if (z == Z_NULL || z->state == Z_NULL || z->next_in == Z_NULL)
+ return Z_STREAM_ERROR;
+ f = f == Z_FINISH ? Z_BUF_ERROR : Z_OK;
+ r = Z_BUF_ERROR;
+ while (1) switch (z->state->mode)
+ {
+ case METHOD:
+ NEEDBYTE
+ if (((z->state->sub.method = NEXTBYTE) & 0xf) != Z_DEFLATED)
+ {
+ z->state->mode = BAD;
+ z->msg = (char*)"unknown compression method";
+ z->state->sub.marker = 5; /* can't try inflateSync */
+ break;
+ }
+ if ((z->state->sub.method >> 4) + 8 > z->state->wbits)
+ {
+ z->state->mode = BAD;
+ z->msg = (char*)"invalid window size";
+ z->state->sub.marker = 5; /* can't try inflateSync */
+ break;
+ }
+ z->state->mode = FLAG;
+ case FLAG:
+ NEEDBYTE
+ b = NEXTBYTE;
+ if (((z->state->sub.method << 8) + b) % 31)
+ {
+ z->state->mode = BAD;
+ z->msg = (char*)"incorrect header check";
+ z->state->sub.marker = 5; /* can't try inflateSync */
+ break;
+ }
+ Tracev((stderr, "inflate: zlib header ok\n"));
+ if (!(b & PRESET_DICT))
+ {
+ z->state->mode = BLOCKS;
+ break;
+ }
+ z->state->mode = DICT4;
+ case DICT4:
+ NEEDBYTE
+ z->state->sub.check.need = (uLong)NEXTBYTE << 24;
+ z->state->mode = DICT3;
+ case DICT3:
+ NEEDBYTE
+ z->state->sub.check.need += (uLong)NEXTBYTE << 16;
+ z->state->mode = DICT2;
+ case DICT2:
+ NEEDBYTE
+ z->state->sub.check.need += (uLong)NEXTBYTE << 8;
+ z->state->mode = DICT1;
+ case DICT1:
+ NEEDBYTE
+ z->state->sub.check.need += (uLong)NEXTBYTE;
+ z->adler = z->state->sub.check.need;
+ z->state->mode = DICT0;
+ return Z_NEED_DICT;
+ case DICT0:
+ z->state->mode = BAD;
+ z->msg = (char*)"need dictionary";
+ z->state->sub.marker = 0; /* can try inflateSync */
+ return Z_STREAM_ERROR;
+ case BLOCKS:
+ r = inflate_blocks(z->state->blocks, z, r);
+ if (r == Z_DATA_ERROR)
+ {
+ z->state->mode = BAD;
+ z->state->sub.marker = 0; /* can try inflateSync */
+ break;
+ }
+ if (r == Z_OK)
+ r = f;
+ if (r != Z_STREAM_END)
+ return r;
+ r = f;
+ inflate_blocks_reset(z->state->blocks, z, &z->state->sub.check.was);
+ if (z->state->nowrap)
+ {
+ z->state->mode = DONE;
+ break;
+ }
+ z->state->mode = CHECK4;
+ case CHECK4:
+ NEEDBYTE
+ z->state->sub.check.need = (uLong)NEXTBYTE << 24;
+ z->state->mode = CHECK3;
+ case CHECK3:
+ NEEDBYTE
+ z->state->sub.check.need += (uLong)NEXTBYTE << 16;
+ z->state->mode = CHECK2;
+ case CHECK2:
+ NEEDBYTE
+ z->state->sub.check.need += (uLong)NEXTBYTE << 8;
+ z->state->mode = CHECK1;
+ case CHECK1:
+ NEEDBYTE
+ z->state->sub.check.need += (uLong)NEXTBYTE;
+
+ if (z->state->sub.check.was != z->state->sub.check.need)
+ {
+ z->state->mode = BAD;
+ z->msg = (char*)"incorrect data check";
+ z->state->sub.marker = 5; /* can't try inflateSync */
+ break;
+ }
+ Tracev((stderr, "inflate: zlib check ok\n"));
+ z->state->mode = DONE;
+ case DONE:
+ return Z_STREAM_END;
+ case BAD:
+ return Z_DATA_ERROR;
+ default:
+ return Z_STREAM_ERROR;
+ }
+#ifdef NEED_DUMMY_RETURN
+ return Z_STREAM_ERROR; /* Some dumb compilers complain without this */
+#endif
+}
+
+
+int ZEXPORT inflateSetDictionary(z, dictionary, dictLength)
+z_streamp z;
+const Bytef *dictionary;
+uInt dictLength;
+{
+ uInt length = dictLength;
+
+ if (z == Z_NULL || z->state == Z_NULL || z->state->mode != DICT0)
+ return Z_STREAM_ERROR;
+
+ if (adler32(1L, dictionary, dictLength) != z->adler) return Z_DATA_ERROR;
+ z->adler = 1L;
+
+ if (length >= ((uInt)1<<z->state->wbits))
+ {
+ length = (1<<z->state->wbits)-1;
+ dictionary += dictLength - length;
+ }
+ inflate_set_dictionary(z->state->blocks, dictionary, length);
+ z->state->mode = BLOCKS;
+ return Z_OK;
+}
+
+
+int ZEXPORT inflateSync(z)
+z_streamp z;
+{
+ uInt n; /* number of bytes to look at */
+ Bytef *p; /* pointer to bytes */
+ uInt m; /* number of marker bytes found in a row */
+ uLong r, w; /* temporaries to save total_in and total_out */
+
+ /* set up */
+ if (z == Z_NULL || z->state == Z_NULL)
+ return Z_STREAM_ERROR;
+ if (z->state->mode != BAD)
+ {
+ z->state->mode = BAD;
+ z->state->sub.marker = 0;
+ }
+ if ((n = z->avail_in) == 0)
+ return Z_BUF_ERROR;
+ p = z->next_in;
+ m = z->state->sub.marker;
+
+ /* search */
+ while (n && m < 4)
+ {
+ static const Byte mark[4] = {0, 0, 0xff, 0xff};
+ if (*p == mark[m])
+ m++;
+ else if (*p)
+ m = 0;
+ else
+ m = 4 - m;
+ p++, n--;
+ }
+
+ /* restore */
+ z->total_in += p - z->next_in;
+ z->next_in = p;
+ z->avail_in = n;
+ z->state->sub.marker = m;
+
+ /* return no joy or set up to restart on a new block */
+ if (m != 4)
+ return Z_DATA_ERROR;
+ r = z->total_in; w = z->total_out;
+ inflateReset(z);
+ z->total_in = r; z->total_out = w;
+ z->state->mode = BLOCKS;
+ return Z_OK;
+}
+
+
+/* Returns true if inflate is currently at the end of a block generated
+ * by Z_SYNC_FLUSH or Z_FULL_FLUSH. This function is used by one PPP
+ * implementation to provide an additional safety check. PPP uses Z_SYNC_FLUSH
+ * but removes the length bytes of the resulting empty stored block. When
+ * decompressing, PPP checks that at the end of input packet, inflate is
+ * waiting for these length bytes.
+ */
+int ZEXPORT inflateSyncPoint(z)
+z_streamp z;
+{
+ if (z == Z_NULL || z->state == Z_NULL || z->state->blocks == Z_NULL)
+ return Z_STREAM_ERROR;
+ return inflate_blocks_sync_point(z->state->blocks);
+}
--- /dev/null
+/* inftrees.c -- generate Huffman trees for efficient decoding
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+
+#if !defined(BUILDFIXED) && !defined(STDC)
+# define BUILDFIXED /* non ANSI compilers may not accept inffixed.h */
+#endif
+
+const char inflate_copyright[] =
+ " inflate 1.1.3 Copyright 1995-1998 Mark Adler ";
+/*
+ If you use the zlib library in a product, an acknowledgment is welcome
+ in the documentation of your product. If for some reason you cannot
+ include such an acknowledgment, I would appreciate that you keep this
+ copyright string in the executable of your product.
+ */
+struct internal_state {int dummy;}; /* for buggy compilers */
+
+/* simplify the use of the inflate_huft type with some defines */
+#define exop word.what.Exop
+#define bits word.what.Bits
+
+
+local int huft_build OF((
+ uIntf *, /* code lengths in bits */
+ uInt, /* number of codes */
+ uInt, /* number of "simple" codes */
+ const uIntf *, /* list of base values for non-simple codes */
+ const uIntf *, /* list of extra bits for non-simple codes */
+ inflate_huft * FAR*,/* result: starting table */
+ uIntf *, /* maximum lookup bits (returns actual) */
+ inflate_huft *, /* space for trees */
+ uInt *, /* hufts used in space */
+ uIntf * )); /* space for values */
+
+/* Tables for deflate from PKZIP's appnote.txt. */
+local const uInt cplens[31] = { /* Copy lengths for literal codes 257..285 */
+ 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 17, 19, 23, 27, 31,
+ 35, 43, 51, 59, 67, 83, 99, 115, 131, 163, 195, 227, 258, 0, 0};
+ /* see note #13 above about 258 */
+local const uInt cplext[31] = { /* Extra bits for literal codes 257..285 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2,
+ 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0, 112, 112}; /* 112==invalid */
+local const uInt cpdist[30] = { /* Copy offsets for distance codes 0..29 */
+ 1, 2, 3, 4, 5, 7, 9, 13, 17, 25, 33, 49, 65, 97, 129, 193,
+ 257, 385, 513, 769, 1025, 1537, 2049, 3073, 4097, 6145,
+ 8193, 12289, 16385, 24577};
+local const uInt cpdext[30] = { /* Extra bits for distance codes */
+ 0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6,
+ 7, 7, 8, 8, 9, 9, 10, 10, 11, 11,
+ 12, 12, 13, 13};
+
+/*
+ Huffman code decoding is performed using a multi-level table lookup.
+ The fastest way to decode is to simply build a lookup table whose
+ size is determined by the longest code. However, the time it takes
+ to build this table can also be a factor if the data being decoded
+ is not very long. The most common codes are necessarily the
+ shortest codes, so those codes dominate the decoding time, and hence
+ the speed. The idea is you can have a shorter table that decodes the
+ shorter, more probable codes, and then point to subsidiary tables for
+ the longer codes. The time it costs to decode the longer codes is
+ then traded against the time it takes to make longer tables.
+
+ This results of this trade are in the variables lbits and dbits
+ below. lbits is the number of bits the first level table for literal/
+ length codes can decode in one step, and dbits is the same thing for
+ the distance codes. Subsequent tables are also less than or equal to
+ those sizes. These values may be adjusted either when all of the
+ codes are shorter than that, in which case the longest code length in
+ bits is used, or when the shortest code is *longer* than the requested
+ table size, in which case the length of the shortest code in bits is
+ used.
+
+ There are two different values for the two tables, since they code a
+ different number of possibilities each. The literal/length table
+ codes 286 possible values, or in a flat code, a little over eight
+ bits. The distance table codes 30 possible values, or a little less
+ than five bits, flat. The optimum values for speed end up being
+ about one bit more than those, so lbits is 8+1 and dbits is 5+1.
+ The optimum values may differ though from machine to machine, and
+ possibly even between compilers. Your mileage may vary.
+ */
+
+
+/* If BMAX needs to be larger than 16, then h and x[] should be uLong. */
+#define BMAX 15 /* maximum bit length of any code */
+
+local int huft_build(b, n, s, d, e, t, m, hp, hn, v)
+uIntf *b; /* code lengths in bits (all assumed <= BMAX) */
+uInt n; /* number of codes (assumed <= 288) */
+uInt s; /* number of simple-valued codes (0..s-1) */
+const uIntf *d; /* list of base values for non-simple codes */
+const uIntf *e; /* list of extra bits for non-simple codes */
+inflate_huft * FAR *t; /* result: starting table */
+uIntf *m; /* maximum lookup bits, returns actual */
+inflate_huft *hp; /* space for trees */
+uInt *hn; /* hufts used in space */
+uIntf *v; /* working area: values in order of bit length */
+/* Given a list of code lengths and a maximum table size, make a set of
+ tables to decode that set of codes. Return Z_OK on success, Z_BUF_ERROR
+ if the given code set is incomplete (the tables are still built in this
+ case), Z_DATA_ERROR if the input is invalid (an over-subscribed set of
+ lengths), or Z_MEM_ERROR if not enough memory. */
+{
+
+ uInt a; /* counter for codes of length k */
+ uInt c[BMAX+1]; /* bit length count table */
+ uInt f; /* i repeats in table every f entries */
+ int g; /* maximum code length */
+ int h; /* table level */
+ register uInt i; /* counter, current code */
+ register uInt j; /* counter */
+ register int k; /* number of bits in current code */
+ int l; /* bits per table (returned in m) */
+ uInt mask; /* (1 << w) - 1, to avoid cc -O bug on HP */
+ register uIntf *p; /* pointer into c[], b[], or v[] */
+ inflate_huft *q; /* points to current table */
+ struct inflate_huft_s r; /* table entry for structure assignment */
+ inflate_huft *u[BMAX]; /* table stack */
+ register int w; /* bits before this table == (l * h) */
+ uInt x[BMAX+1]; /* bit offsets, then code stack */
+ uIntf *xp; /* pointer into x */
+ int y; /* number of dummy codes added */
+ uInt z; /* number of entries in current table */
+
+
+ /* Generate counts for each bit length */
+ p = c;
+#define C0 *p++ = 0;
+#define C2 C0 C0 C0 C0
+#define C4 C2 C2 C2 C2
+ C4 /* clear c[]--assume BMAX+1 is 16 */
+ p = b; i = n;
+ do {
+ c[*p++]++; /* assume all entries <= BMAX */
+ } while (--i);
+ if (c[0] == n) /* null input--all zero length codes */
+ {
+ *t = (inflate_huft *)Z_NULL;
+ *m = 0;
+ return Z_OK;
+ }
+
+
+ /* Find minimum and maximum length, bound *m by those */
+ l = *m;
+ for (j = 1; j <= BMAX; j++)
+ if (c[j])
+ break;
+ k = j; /* minimum code length */
+ if ((uInt)l < j)
+ l = j;
+ for (i = BMAX; i; i--)
+ if (c[i])
+ break;
+ g = i; /* maximum code length */
+ if ((uInt)l > i)
+ l = i;
+ *m = l;
+
+
+ /* Adjust last length count to fill out codes, if needed */
+ for (y = 1 << j; j < i; j++, y <<= 1)
+ if ((y -= c[j]) < 0)
+ return Z_DATA_ERROR;
+ if ((y -= c[i]) < 0)
+ return Z_DATA_ERROR;
+ c[i] += y;
+
+
+ /* Generate starting offsets into the value table for each length */
+ x[1] = j = 0;
+ p = c + 1; xp = x + 2;
+ while (--i) { /* note that i == g from above */
+ *xp++ = (j += *p++);
+ }
+
+
+ /* Make a table of values in order of bit lengths */
+ p = b; i = 0;
+ do {
+ if ((j = *p++) != 0)
+ v[x[j]++] = i;
+ } while (++i < n);
+ n = x[g]; /* set n to length of v */
+
+
+ /* Generate the Huffman codes and for each, make the table entries */
+ x[0] = i = 0; /* first Huffman code is zero */
+ p = v; /* grab values in bit order */
+ h = -1; /* no tables yet--level -1 */
+ w = -l; /* bits decoded == (l * h) */
+ u[0] = (inflate_huft *)Z_NULL; /* just to keep compilers happy */
+ q = (inflate_huft *)Z_NULL; /* ditto */
+ z = 0; /* ditto */
+
+ /* go through the bit lengths (k already is bits in shortest code) */
+ for (; k <= g; k++)
+ {
+ a = c[k];
+ while (a--)
+ {
+ /* here i is the Huffman code of length k bits for value *p */
+ /* make tables up to required level */
+ while (k > w + l)
+ {
+ h++;
+ w += l; /* previous table always l bits */
+
+ /* compute minimum size table less than or equal to l bits */
+ z = g - w;
+ z = z > (uInt)l ? l : z; /* table size upper limit */
+ if ((f = 1 << (j = k - w)) > a + 1) /* try a k-w bit table */
+ { /* too few codes for k-w bit table */
+ f -= a + 1; /* deduct codes from patterns left */
+ xp = c + k;
+ if (j < z)
+ while (++j < z) /* try smaller tables up to z bits */
+ {
+ if ((f <<= 1) <= *++xp)
+ break; /* enough codes to use up j bits */
+ f -= *xp; /* else deduct codes from patterns */
+ }
+ }
+ z = 1 << j; /* table entries for j-bit table */
+
+ /* allocate new table */
+ if (*hn + z > MANY) /* (note: doesn't matter for fixed) */
+ return Z_MEM_ERROR; /* not enough memory */
+ u[h] = q = hp + *hn;
+ *hn += z;
+
+ /* connect to last table, if there is one */
+ if (h)
+ {
+ x[h] = i; /* save pattern for backing up */
+ r.bits = (Byte)l; /* bits to dump before this table */
+ r.exop = (Byte)j; /* bits in this table */
+ j = i >> (w - l);
+ r.base = (uInt)(q - u[h-1] - j); /* offset to this table */
+ u[h-1][j] = r; /* connect to last table */
+ }
+ else
+ *t = q; /* first table is returned result */
+ }
+
+ /* set up table entry in r */
+ r.bits = (Byte)(k - w);
+ if (p >= v + n)
+ r.exop = 128 + 64; /* out of values--invalid code */
+ else if (*p < s)
+ {
+ r.exop = (Byte)(*p < 256 ? 0 : 32 + 64); /* 256 is end-of-block */
+ r.base = *p++; /* simple code is just the value */
+ }
+ else
+ {
+ r.exop = (Byte)(e[*p - s] + 16 + 64);/* non-simple--look up in lists */
+ r.base = d[*p++ - s];
+ }
+
+ /* fill code-like entries with r */
+ f = 1 << (k - w);
+ for (j = i >> w; j < z; j += f)
+ q[j] = r;
+
+ /* backwards increment the k-bit code i */
+ for (j = 1 << (k - 1); i & j; j >>= 1)
+ i ^= j;
+ i ^= j;
+
+ /* backup over finished tables */
+ mask = (1 << w) - 1; /* needed on HP, cc -O bug */
+ while ((i & mask) != x[h])
+ {
+ h--; /* don't need to update q */
+ w -= l;
+ mask = (1 << w) - 1;
+ }
+ }
+ }
+
+
+ /* Return Z_BUF_ERROR if we were given an incomplete table */
+ return y != 0 && g != 1 ? Z_BUF_ERROR : Z_OK;
+}
+
+
+int inflate_trees_bits(c, bb, tb, hp, z)
+uIntf *c; /* 19 code lengths */
+uIntf *bb; /* bits tree desired/actual depth */
+inflate_huft * FAR *tb; /* bits tree result */
+inflate_huft *hp; /* space for trees */
+z_streamp z; /* for messages */
+{
+ int r;
+ uInt hn = 0; /* hufts used in space */
+ uIntf *v; /* work area for huft_build */
+
+ if ((v = (uIntf*)ZALLOC(z, 19, sizeof(uInt))) == Z_NULL)
+ return Z_MEM_ERROR;
+ r = huft_build(c, 19, 19, (uIntf*)Z_NULL, (uIntf*)Z_NULL,
+ tb, bb, hp, &hn, v);
+ if (r == Z_DATA_ERROR)
+ z->msg = (char*)"oversubscribed dynamic bit lengths tree";
+ else if (r == Z_BUF_ERROR || *bb == 0)
+ {
+ z->msg = (char*)"incomplete dynamic bit lengths tree";
+ r = Z_DATA_ERROR;
+ }
+ ZFREE(z, v);
+ return r;
+}
+
+
+int inflate_trees_dynamic(nl, nd, c, bl, bd, tl, td, hp, z)
+uInt nl; /* number of literal/length codes */
+uInt nd; /* number of distance codes */
+uIntf *c; /* that many (total) code lengths */
+uIntf *bl; /* literal desired/actual bit depth */
+uIntf *bd; /* distance desired/actual bit depth */
+inflate_huft * FAR *tl; /* literal/length tree result */
+inflate_huft * FAR *td; /* distance tree result */
+inflate_huft *hp; /* space for trees */
+z_streamp z; /* for messages */
+{
+ int r;
+ uInt hn = 0; /* hufts used in space */
+ uIntf *v; /* work area for huft_build */
+
+ /* allocate work area */
+ if ((v = (uIntf*)ZALLOC(z, 288, sizeof(uInt))) == Z_NULL)
+ return Z_MEM_ERROR;
+
+ /* build literal/length tree */
+ r = huft_build(c, nl, 257, cplens, cplext, tl, bl, hp, &hn, v);
+ if (r != Z_OK || *bl == 0)
+ {
+ if (r == Z_DATA_ERROR)
+ z->msg = (char*)"oversubscribed literal/length tree";
+ else if (r != Z_MEM_ERROR)
+ {
+ z->msg = (char*)"incomplete literal/length tree";
+ r = Z_DATA_ERROR;
+ }
+ ZFREE(z, v);
+ return r;
+ }
+
+ /* build distance tree */
+ r = huft_build(c + nl, nd, 0, cpdist, cpdext, td, bd, hp, &hn, v);
+ if (r != Z_OK || (*bd == 0 && nl > 257))
+ {
+ if (r == Z_DATA_ERROR)
+ z->msg = (char*)"oversubscribed distance tree";
+ else if (r == Z_BUF_ERROR) {
+#ifdef PKZIP_BUG_WORKAROUND
+ r = Z_OK;
+ }
+#else
+ z->msg = (char*)"incomplete distance tree";
+ r = Z_DATA_ERROR;
+ }
+ else if (r != Z_MEM_ERROR)
+ {
+ z->msg = (char*)"empty distance tree with lengths";
+ r = Z_DATA_ERROR;
+ }
+ ZFREE(z, v);
+ return r;
+#endif
+ }
+
+ /* done */
+ ZFREE(z, v);
+ return Z_OK;
+}
+
+
+/* build fixed tables only once--keep them here */
+#ifdef BUILDFIXED
+local int fixed_built = 0;
+#define FIXEDH 544 /* number of hufts used by fixed tables */
+local inflate_huft fixed_mem[FIXEDH];
+local uInt fixed_bl;
+local uInt fixed_bd;
+local inflate_huft *fixed_tl;
+local inflate_huft *fixed_td;
+#else
+#include "inffixed.h"
+#endif
+
+
+int inflate_trees_fixed(bl, bd, tl, td, z)
+uIntf *bl; /* literal desired/actual bit depth */
+uIntf *bd; /* distance desired/actual bit depth */
+inflate_huft * FAR *tl; /* literal/length tree result */
+inflate_huft * FAR *td; /* distance tree result */
+z_streamp z; /* for memory allocation */
+{
+#ifdef BUILDFIXED
+ /* build fixed tables if not already */
+ if (!fixed_built)
+ {
+ int k; /* temporary variable */
+ uInt f = 0; /* number of hufts used in fixed_mem */
+ uIntf *c; /* length list for huft_build */
+ uIntf *v; /* work area for huft_build */
+
+ /* allocate memory */
+ if ((c = (uIntf*)ZALLOC(z, 288, sizeof(uInt))) == Z_NULL)
+ return Z_MEM_ERROR;
+ if ((v = (uIntf*)ZALLOC(z, 288, sizeof(uInt))) == Z_NULL)
+ {
+ ZFREE(z, c);
+ return Z_MEM_ERROR;
+ }
+
+ /* literal table */
+ for (k = 0; k < 144; k++)
+ c[k] = 8;
+ for (; k < 256; k++)
+ c[k] = 9;
+ for (; k < 280; k++)
+ c[k] = 7;
+ for (; k < 288; k++)
+ c[k] = 8;
+ fixed_bl = 9;
+ huft_build(c, 288, 257, cplens, cplext, &fixed_tl, &fixed_bl,
+ fixed_mem, &f, v);
+
+ /* distance table */
+ for (k = 0; k < 30; k++)
+ c[k] = 5;
+ fixed_bd = 5;
+ huft_build(c, 30, 0, cpdist, cpdext, &fixed_td, &fixed_bd,
+ fixed_mem, &f, v);
+
+ /* done */
+ ZFREE(z, v);
+ ZFREE(z, c);
+ fixed_built = 1;
+ }
+#endif
+ *bl = fixed_bl;
+ *bd = fixed_bd;
+ *tl = fixed_tl;
+ *td = fixed_td;
+ return Z_OK;
+}
--- /dev/null
+/* inftrees.h -- header to use inftrees.c
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* Huffman code lookup table entry--this entry is four bytes for machines
+ that have 16-bit pointers (e.g. PC's in the small or medium model). */
+
+typedef struct inflate_huft_s FAR inflate_huft;
+
+struct inflate_huft_s {
+ union {
+ struct {
+ Byte Exop; /* number of extra bits or operation */
+ Byte Bits; /* number of bits in this code or subcode */
+ } what;
+ uInt pad; /* pad structure to a power of 2 (4 bytes for */
+ } word; /* 16-bit, 8 bytes for 32-bit int's) */
+ uInt base; /* literal, length base, distance base,
+ or table offset */
+};
+
+/* Maximum size of dynamic tree. The maximum found in a long but non-
+ exhaustive search was 1004 huft structures (850 for length/literals
+ and 154 for distances, the latter actually the result of an
+ exhaustive search). The actual maximum is not known, but the
+ value below is more than safe. */
+#define MANY 1440
+
+extern int inflate_trees_bits OF((
+ uIntf *, /* 19 code lengths */
+ uIntf *, /* bits tree desired/actual depth */
+ inflate_huft * FAR *, /* bits tree result */
+ inflate_huft *, /* space for trees */
+ z_streamp)); /* for messages */
+
+extern int inflate_trees_dynamic OF((
+ uInt, /* number of literal/length codes */
+ uInt, /* number of distance codes */
+ uIntf *, /* that many (total) code lengths */
+ uIntf *, /* literal desired/actual bit depth */
+ uIntf *, /* distance desired/actual bit depth */
+ inflate_huft * FAR *, /* literal/length tree result */
+ inflate_huft * FAR *, /* distance tree result */
+ inflate_huft *, /* space for trees */
+ z_streamp)); /* for messages */
+
+extern int inflate_trees_fixed OF((
+ uIntf *, /* literal desired/actual bit depth */
+ uIntf *, /* distance desired/actual bit depth */
+ inflate_huft * FAR *, /* literal/length tree result */
+ inflate_huft * FAR *, /* distance tree result */
+ z_streamp)); /* for memory allocation */
--- /dev/null
+/* inflate_util.c -- data and routines common to blocks and codes
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "infblock.h"
+#include "inftrees.h"
+#include "infcodes.h"
+#include "infutil.h"
+
+struct inflate_codes_state {int dummy;}; /* for buggy compilers */
+
+/* And'ing with mask[n] masks the lower n bits */
+uInt inflate_mask[17] = {
+ 0x0000,
+ 0x0001, 0x0003, 0x0007, 0x000f, 0x001f, 0x003f, 0x007f, 0x00ff,
+ 0x01ff, 0x03ff, 0x07ff, 0x0fff, 0x1fff, 0x3fff, 0x7fff, 0xffff
+};
+
+
+/* copy as much as possible from the sliding window to the output area */
+int inflate_flush(s, z, r)
+inflate_blocks_statef *s;
+z_streamp z;
+int r;
+{
+ uInt n;
+ Bytef *p;
+ Bytef *q;
+
+ /* local copies of source and destination pointers */
+ p = z->next_out;
+ q = s->read;
+
+ /* compute number of bytes to copy as far as end of window */
+ n = (uInt)((q <= s->write ? s->write : s->end) - q);
+ if (n > z->avail_out) n = z->avail_out;
+ if (n && r == Z_BUF_ERROR) r = Z_OK;
+
+ /* update counters */
+ z->avail_out -= n;
+ z->total_out += n;
+
+ /* update check information */
+ if (s->checkfn != Z_NULL)
+ z->adler = s->check = (*s->checkfn)(s->check, q, n);
+
+ /* copy as far as end of window */
+ zmemcpy(p, q, n);
+ p += n;
+ q += n;
+
+ /* see if more to copy at beginning of window */
+ if (q == s->end)
+ {
+ /* wrap pointers */
+ q = s->window;
+ if (s->write == s->end)
+ s->write = s->window;
+
+ /* compute bytes to copy */
+ n = (uInt)(s->write - q);
+ if (n > z->avail_out) n = z->avail_out;
+ if (n && r == Z_BUF_ERROR) r = Z_OK;
+
+ /* update counters */
+ z->avail_out -= n;
+ z->total_out += n;
+
+ /* update check information */
+ if (s->checkfn != Z_NULL)
+ z->adler = s->check = (*s->checkfn)(s->check, q, n);
+
+ /* copy */
+ zmemcpy(p, q, n);
+ p += n;
+ q += n;
+ }
+
+ /* update pointers */
+ z->next_out = p;
+ s->read = q;
+
+ /* done */
+ return r;
+}
--- /dev/null
+/* infutil.h -- types and macros common to blocks and codes
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+#ifndef _INFUTIL_H
+#define _INFUTIL_H
+
+typedef enum {
+ TYPE, /* get type bits (3, including end bit) */
+ LENS, /* get lengths for stored */
+ STORED, /* processing stored block */
+ TABLE, /* get table lengths */
+ BTREE, /* get bit lengths tree for a dynamic block */
+ DTREE, /* get length, distance trees for a dynamic block */
+ CODES, /* processing fixed or dynamic block */
+ DRY, /* output remaining window bytes */
+ DONE, /* finished last block, done */
+ BAD} /* got a data error--stuck here */
+inflate_block_mode;
+
+/* inflate blocks semi-private state */
+struct inflate_blocks_state {
+
+ /* mode */
+ inflate_block_mode mode; /* current inflate_block mode */
+
+ /* mode dependent information */
+ union {
+ uInt left; /* if STORED, bytes left to copy */
+ struct {
+ uInt table; /* table lengths (14 bits) */
+ uInt index; /* index into blens (or border) */
+ uIntf *blens; /* bit lengths of codes */
+ uInt bb; /* bit length tree depth */
+ inflate_huft *tb; /* bit length decoding tree */
+ } trees; /* if DTREE, decoding info for trees */
+ struct {
+ inflate_codes_statef
+ *codes;
+ } decode; /* if CODES, current state */
+ } sub; /* submode */
+ uInt last; /* true if this block is the last block */
+
+ /* mode independent information */
+ uInt bitk; /* bits in bit buffer */
+ uLong bitb; /* bit buffer */
+ inflate_huft *hufts; /* single malloc for tree space */
+ Bytef *window; /* sliding window */
+ Bytef *end; /* one byte after sliding window */
+ Bytef *read; /* window read pointer */
+ Bytef *write; /* window write pointer */
+ check_func checkfn; /* check function */
+ uLong check; /* check on output */
+
+};
+
+
+/* defines for inflate input/output */
+/* update pointers and return */
+#define UPDBITS {s->bitb=b;s->bitk=k;}
+#define UPDIN {z->avail_in=n;z->total_in+=p-z->next_in;z->next_in=p;}
+#define UPDOUT {s->write=q;}
+#define UPDATE {UPDBITS UPDIN UPDOUT}
+#define LEAVE {UPDATE return inflate_flush(s,z,r);}
+/* get bytes and bits */
+#define LOADIN {p=z->next_in;n=z->avail_in;b=s->bitb;k=s->bitk;}
+#define NEEDBYTE {if(n)r=Z_OK;else LEAVE}
+#define NEXTBYTE (n--,*p++)
+#define NEEDBITS(j) {while(k<(j)){NEEDBYTE;b|=((uLong)NEXTBYTE)<<k;k+=8;}}
+#define DUMPBITS(j) {b>>=(j);k-=(j);}
+/* output bytes */
+#define WAVAIL (uInt)(q<s->read?s->read-q-1:s->end-q)
+#define LOADOUT {q=s->write;m=(uInt)WAVAIL;}
+#define WRAP {if(q==s->end&&s->read!=s->window){q=s->window;m=(uInt)WAVAIL;}}
+#define FLUSH {UPDOUT r=inflate_flush(s,z,r); LOADOUT}
+#define NEEDOUT {if(m==0){WRAP if(m==0){FLUSH WRAP if(m==0) LEAVE}}r=Z_OK;}
+#define OUTBYTE(a) {*q++=(Byte)(a);m--;}
+/* load local pointers */
+#define LOAD {LOADIN LOADOUT}
+
+/* masks for lower bits (size given to avoid silly warnings with Visual C++) */
+extern uInt inflate_mask[17];
+
+/* copy as much as possible from the sliding window to the output area */
+extern int inflate_flush OF((
+ inflate_blocks_statef *,
+ z_streamp ,
+ int));
+
+struct internal_state {int dummy;}; /* for buggy compilers */
+
+#endif
--- /dev/null
+/* maketree.c -- make inffixed.h table for decoding fixed codes
+ * Copyright (C) 1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* This program is included in the distribution for completeness.
+ You do not need to compile or run this program since inffixed.h
+ is already included in the distribution. To use this program
+ you need to compile zlib with BUILDFIXED defined and then compile
+ and link this program with the zlib library. Then the output of
+ this program can be piped to inffixed.h. */
+
+#include <stdio.h>
+#include <stdlib.h>
+#include "zutil.h"
+#include "inftrees.h"
+
+/* simplify the use of the inflate_huft type with some defines */
+#define exop word.what.Exop
+#define bits word.what.Bits
+
+/* generate initialization table for an inflate_huft structure array */
+void maketree(uInt b, inflate_huft *t)
+{
+ int i, e;
+
+ i = 0;
+ while (1)
+ {
+ e = t[i].exop;
+ if (e && (e & (16+64)) == 0) /* table pointer */
+ {
+ fprintf(stderr, "maketree: cannot initialize sub-tables!\n");
+ exit(1);
+ }
+ if (i % 4 == 0)
+ printf("\n ");
+ printf(" {{{%u,%u}},%u}", t[i].exop, t[i].bits, t[i].base);
+ if (++i == (1<<b))
+ break;
+ putchar(',');
+ }
+ puts("");
+}
+
+/* create the fixed tables in C initialization syntax */
+void main(void)
+{
+ int r;
+ uInt bl, bd;
+ inflate_huft *tl, *td;
+ z_stream z;
+
+ z.zalloc = zcalloc;
+ z.opaque = (voidpf)0;
+ z.zfree = zcfree;
+ r = inflate_trees_fixed(&bl, &bd, &tl, &td, &z);
+ if (r)
+ {
+ fprintf(stderr, "inflate_trees_fixed error %d\n", r);
+ return;
+ }
+ puts("/* inffixed.h -- table for decoding fixed codes");
+ puts(" * Generated automatically by the maketree.c program");
+ puts(" */");
+ puts("");
+ puts("/* WARNING: this file should *not* be used by applications. It is");
+ puts(" part of the implementation of the compression library and is");
+ puts(" subject to change. Applications should only use zlib.h.");
+ puts(" */");
+ puts("");
+ printf("local uInt fixed_bl = %d;\n", bl);
+ printf("local uInt fixed_bd = %d;\n", bd);
+ printf("local inflate_huft fixed_tl[] = {");
+ maketree(bl, tl);
+ puts(" };");
+ printf("local inflate_huft fixed_td[] = {");
+ maketree(bd, td);
+ puts(" };");
+}
--- /dev/null
+/* minigzip.c -- simulate gzip using the zlib compression library
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ * minigzip is a minimal implementation of the gzip utility. This is
+ * only an example of using zlib and isn't meant to replace the
+ * full-featured gzip. No attempt is made to deal with file systems
+ * limiting names to 14 or 8+3 characters, etc... Error checking is
+ * very limited. So use minigzip only for testing; use gzip for the
+ * real thing. On MSDOS, use only on file names without extension
+ * or in pipe mode.
+ */
+
+/* @(#) $Id$ */
+
+#include <stdio.h>
+#include "zlib.h"
+
+#ifdef STDC
+# include <string.h>
+# include <stdlib.h>
+#else
+ extern void exit OF((int));
+#endif
+
+#ifdef USE_MMAP
+# include <sys/types.h>
+# include <sys/mman.h>
+# include <sys/stat.h>
+#endif
+
+#if defined(MSDOS) || defined(OS2) || defined(WIN32)
+# include <fcntl.h>
+# include <io.h>
+# define SET_BINARY_MODE(file) setmode(fileno(file), O_BINARY)
+#else
+# define SET_BINARY_MODE(file)
+#endif
+
+#ifdef VMS
+# define unlink delete
+# define GZ_SUFFIX "-gz"
+#endif
+#ifdef RISCOS
+# define unlink remove
+# define GZ_SUFFIX "-gz"
+# define fileno(file) file->__file
+#endif
+#if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os
+# include <unix.h> /* for fileno */
+#endif
+
+#ifndef WIN32 /* unlink already in stdio.h for WIN32 */
+ extern int unlink OF((const char *));
+#endif
+
+#ifndef GZ_SUFFIX
+# define GZ_SUFFIX ".gz"
+#endif
+#define SUFFIX_LEN (sizeof(GZ_SUFFIX)-1)
+
+#define BUFLEN 16384
+#define MAX_NAME_LEN 1024
+
+#ifdef MAXSEG_64K
+# define local static
+ /* Needed for systems with limitation on stack size. */
+#else
+# define local
+#endif
+
+char *prog;
+
+void error OF((const char *msg));
+void gz_compress OF((FILE *in, gzFile out));
+#ifdef USE_MMAP
+int gz_compress_mmap OF((FILE *in, gzFile out));
+#endif
+void gz_uncompress OF((gzFile in, FILE *out));
+void file_compress OF((char *file, char *mode));
+void file_uncompress OF((char *file));
+int main OF((int argc, char *argv[]));
+
+/* ===========================================================================
+ * Display error message and exit
+ */
+void error(msg)
+ const char *msg;
+{
+ fprintf(stderr, "%s: %s\n", prog, msg);
+ exit(1);
+}
+
+/* ===========================================================================
+ * Compress input to output then close both files.
+ */
+
+void gz_compress(in, out)
+ FILE *in;
+ gzFile out;
+{
+ local char buf[BUFLEN];
+ int len;
+ int err;
+
+#ifdef USE_MMAP
+ /* Try first compressing with mmap. If mmap fails (minigzip used in a
+ * pipe), use the normal fread loop.
+ */
+ if (gz_compress_mmap(in, out) == Z_OK) return;
+#endif
+ for (;;) {
+ len = fread(buf, 1, sizeof(buf), in);
+ if (ferror(in)) {
+ perror("fread");
+ exit(1);
+ }
+ if (len == 0) break;
+
+ if (gzwrite(out, buf, (unsigned)len) != len) error(gzerror(out, &err));
+ }
+ fclose(in);
+ if (gzclose(out) != Z_OK) error("failed gzclose");
+}
+
+#ifdef USE_MMAP /* MMAP version, Miguel Albrecht <malbrech@eso.org> */
+
+/* Try compressing the input file at once using mmap. Return Z_OK if
+ * if success, Z_ERRNO otherwise.
+ */
+int gz_compress_mmap(in, out)
+ FILE *in;
+ gzFile out;
+{
+ int len;
+ int err;
+ int ifd = fileno(in);
+ caddr_t buf; /* mmap'ed buffer for the entire input file */
+ off_t buf_len; /* length of the input file */
+ struct stat sb;
+
+ /* Determine the size of the file, needed for mmap: */
+ if (fstat(ifd, &sb) < 0) return Z_ERRNO;
+ buf_len = sb.st_size;
+ if (buf_len <= 0) return Z_ERRNO;
+
+ /* Now do the actual mmap: */
+ buf = mmap((caddr_t) 0, buf_len, PROT_READ, MAP_SHARED, ifd, (off_t)0);
+ if (buf == (caddr_t)(-1)) return Z_ERRNO;
+
+ /* Compress the whole file at once: */
+ len = gzwrite(out, (char *)buf, (unsigned)buf_len);
+
+ if (len != (int)buf_len) error(gzerror(out, &err));
+
+ munmap(buf, buf_len);
+ fclose(in);
+ if (gzclose(out) != Z_OK) error("failed gzclose");
+ return Z_OK;
+}
+#endif /* USE_MMAP */
+
+/* ===========================================================================
+ * Uncompress input to output then close both files.
+ */
+void gz_uncompress(in, out)
+ gzFile in;
+ FILE *out;
+{
+ local char buf[BUFLEN];
+ int len;
+ int err;
+
+ for (;;) {
+ len = gzread(in, buf, sizeof(buf));
+ if (len < 0) error (gzerror(in, &err));
+ if (len == 0) break;
+
+ if ((int)fwrite(buf, 1, (unsigned)len, out) != len) {
+ error("failed fwrite");
+ }
+ }
+ if (fclose(out)) error("failed fclose");
+
+ if (gzclose(in) != Z_OK) error("failed gzclose");
+}
+
+
+/* ===========================================================================
+ * Compress the given file: create a corresponding .gz file and remove the
+ * original.
+ */
+void file_compress(file, mode)
+ char *file;
+ char *mode;
+{
+ local char outfile[MAX_NAME_LEN];
+ FILE *in;
+ gzFile out;
+
+ strcpy(outfile, file);
+ strcat(outfile, GZ_SUFFIX);
+
+ in = fopen(file, "rb");
+ if (in == NULL) {
+ perror(file);
+ exit(1);
+ }
+ out = gzopen(outfile, mode);
+ if (out == NULL) {
+ fprintf(stderr, "%s: can't gzopen %s\n", prog, outfile);
+ exit(1);
+ }
+ gz_compress(in, out);
+
+ unlink(file);
+}
+
+
+/* ===========================================================================
+ * Uncompress the given file and remove the original.
+ */
+void file_uncompress(file)
+ char *file;
+{
+ local char buf[MAX_NAME_LEN];
+ char *infile, *outfile;
+ FILE *out;
+ gzFile in;
+ int len = strlen(file);
+
+ strcpy(buf, file);
+
+ if (len > SUFFIX_LEN && strcmp(file+len-SUFFIX_LEN, GZ_SUFFIX) == 0) {
+ infile = file;
+ outfile = buf;
+ outfile[len-3] = '\0';
+ } else {
+ outfile = file;
+ infile = buf;
+ strcat(infile, GZ_SUFFIX);
+ }
+ in = gzopen(infile, "rb");
+ if (in == NULL) {
+ fprintf(stderr, "%s: can't gzopen %s\n", prog, infile);
+ exit(1);
+ }
+ out = fopen(outfile, "wb");
+ if (out == NULL) {
+ perror(file);
+ exit(1);
+ }
+
+ gz_uncompress(in, out);
+
+ unlink(infile);
+}
+
+
+/* ===========================================================================
+ * Usage: minigzip [-d] [-f] [-h] [-1 to -9] [files...]
+ * -d : decompress
+ * -f : compress with Z_FILTERED
+ * -h : compress with Z_HUFFMAN_ONLY
+ * -1 to -9 : compression level
+ */
+
+int main(argc, argv)
+ int argc;
+ char *argv[];
+{
+ int uncompr = 0;
+ gzFile file;
+ char outmode[20];
+
+ strcpy(outmode, "wb6 ");
+
+ prog = argv[0];
+ argc--, argv++;
+
+ while (argc > 0) {
+ if (strcmp(*argv, "-d") == 0)
+ uncompr = 1;
+ else if (strcmp(*argv, "-f") == 0)
+ outmode[3] = 'f';
+ else if (strcmp(*argv, "-h") == 0)
+ outmode[3] = 'h';
+ else if ((*argv)[0] == '-' && (*argv)[1] >= '1' && (*argv)[1] <= '9' &&
+ (*argv)[2] == 0)
+ outmode[2] = (*argv)[1];
+ else
+ break;
+ argc--, argv++;
+ }
+ if (argc == 0) {
+ SET_BINARY_MODE(stdin);
+ SET_BINARY_MODE(stdout);
+ if (uncompr) {
+ file = gzdopen(fileno(stdin), "rb");
+ if (file == NULL) error("can't gzdopen stdin");
+ gz_uncompress(file, stdout);
+ } else {
+ file = gzdopen(fileno(stdout), outmode);
+ if (file == NULL) error("can't gzdopen stdout");
+ gz_compress(stdin, file);
+ }
+ } else {
+ do {
+ if (uncompr) {
+ file_uncompress(*argv);
+ } else {
+ file_compress(*argv, outmode);
+ }
+ } while (argv++, --argc);
+ }
+ exit(0);
+ return 0; /* to avoid warning */
+}
--- /dev/null
+# Makefile for zlib
+# Borland C++
+
+# This version of the zlib makefile was adapted by Chris Young for use
+# with Borland C 4.5x with the Dos Power Pack for a 32-bit protected mode
+# flat memory model. It was created for use with POV-Ray ray tracer and
+# you may choose to edit the CFLAGS to suit your needs but the
+# switches -WX and -DMSDOS are required.
+# -- Chris Young 76702.1655@compuserve.com
+
+# To use, do "make -fmakefile.b32"
+
+# See zconf.h for details about the memory requirements.
+
+# ------------- Borland C++ -------------
+MODEL=-WX
+CFLAGS= $(MODEL) -P-C -K -N- -k- -d -3 -r- -v- -f -DMSDOS
+CC=bcc32
+LD=bcc32
+LIB=tlib
+LDFLAGS= $(MODEL)
+O=.obj
+
+# variables
+OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \
+ trees$(O)
+OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\
+ trees$(O)
+OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \
+ infutil$(O) inffast$(O)
+OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\
+ infutil$(O)+inffast$(O)
+
+all: test
+
+adler32.obj: adler32.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+compress.obj: compress.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+crc32.obj: crc32.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+gzio.obj: gzio.c zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h\
+ infcodes.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h\
+ infcodes.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+uncompr.obj: uncompr.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+zutil.obj: zutil.c zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+example.obj: example.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+# we must cut the command line to fit in the MS/DOS 128 byte limit:
+zlib.lib: $(OBJ1) $(OBJ2)
+ del zlib.lib
+ $(LIB) zlib +$(OBJP1)
+ $(LIB) zlib +$(OBJP2)
+
+example.exe: example.obj zlib.lib
+ $(LD) $(LDFLAGS) example.obj zlib.lib
+
+minigzip.exe: minigzip.obj zlib.lib
+ $(LD) $(LDFLAGS) minigzip.obj zlib.lib
+
+test: example.exe minigzip.exe
+ example
+ echo hello world | minigzip | minigzip -d
+
+#clean:
+# del *.obj
+# del *.exe
--- /dev/null
+# Makefile for zlib
+# Borland C++ ************ UNTESTED ***********
+
+# To use, do "make -fmakefile.bor"
+# To compile in small model, set below: MODEL=s
+
+# WARNING: the small model is supported but only for small values of
+# MAX_WBITS and MAX_MEM_LEVEL. For example:
+# -DMAX_WBITS=11 -DDEF_WBITS=11 -DMAX_MEM_LEVEL=3
+# If you wish to reduce the memory requirements (default 256K for big
+# objects plus a few K), you can add to the LOC macro below:
+# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14
+# See zconf.h for details about the memory requirements.
+
+# ------------- Turbo C++, Borland C++ -------------
+
+# Optional nonstandard preprocessor flags (e.g. -DMAX_MEM_LEVEL=7)
+# should be added to the environment via "set LOCAL_ZLIB=-DFOO" or added
+# to the declaration of LOC here:
+LOC = $(LOCAL_ZLIB)
+
+# Type for CPU required: 0: 8086, 1: 80186, 2: 80286, 3: 80386, etc.
+CPU_TYP = 0
+
+# Memory model: one of s, m, c, l (small, medium, compact, large)
+MODEL=l
+
+CC=bcc
+# replace bcc with tcc for Turbo C++ 1.0, with bcc32 for the 32 bit version
+LD=$(CC)
+AR=tlib
+
+# compiler flags
+CFLAGS=-O2 -Z -m$(MODEL) $(LOC)
+# replace "-O2" by "-O -G -a -d" for Turbo C++ 1.0
+
+LDFLAGS=-m$(MODEL)
+
+O=.obj
+
+# variables
+OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \
+ trees$(O)
+OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\
+ trees$(O)
+OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \
+ infutil$(O) inffast$(O)
+OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\
+ infutil$(O)+inffast$(O)
+
+ZLIB_H = zlib.h zconf.h
+ZUTIL_H = zutil.h $(ZLIB_H)
+
+ZLIB_LIB = zlib_$(MODEL).lib
+
+all: test
+
+# individual dependencies and action rules:
+adler32.obj: adler32.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+compress.obj: compress.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+crc32.obj: crc32.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+gzio.obj: gzio.c $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+infblock.obj: infblock.c $(ZUTIL_H) infblock.h inftrees.h infcodes.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infcodes.obj: infcodes.c $(ZUTIL_H) inftrees.h infutil.h infcodes.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inflate.obj: inflate.c $(ZUTIL_H) infblock.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inftrees.obj: inftrees.c $(ZUTIL_H) inftrees.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infutil.obj: infutil.c $(ZUTIL_H) inftrees.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inffast.obj: inffast.c $(ZUTIL_H) inftrees.h infutil.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+uncompr.obj: uncompr.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+zutil.obj: zutil.c $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+example.obj: example.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+# we must cut the command line to fit in the MS/DOS 128 byte limit:
+$(ZLIB_LIB): $(OBJ1) $(OBJ2)
+ del $(ZLIB_LIB)
+ $(AR) $(ZLIB_LIB) +$(OBJP1)
+ $(AR) $(ZLIB_LIB) +$(OBJP2)
+
+example.exe: example.obj $(ZLIB_LIB)
+ $(LD) $(LDFLAGS) example.obj $(ZLIB_LIB)
+
+minigzip.exe: minigzip.obj $(ZLIB_LIB)
+ $(LD) $(LDFLAGS) minigzip.obj $(ZLIB_LIB)
+
+test: example.exe minigzip.exe
+ example
+ echo hello world | minigzip | minigzip -d
+
+#clean:
+# del *.obj
+# del *.exe
--- /dev/null
+# Makefile for zlib. Modified for djgpp v2.0 by F. J. Donahoe, 3/15/96.
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile, or to compile and test, type:
+#
+# make -fmakefile.dj2; make test -fmakefile.dj2
+#
+# To install libz.a, zconf.h and zlib.h in the djgpp directories, type:
+#
+# make install -fmakefile.dj2
+#
+# after first defining LIBRARY_PATH and INCLUDE_PATH in djgpp.env as
+# in the sample below if the pattern of the DJGPP distribution is to
+# be followed. Remember that, while <sp>'es around <=> are ignored in
+# makefiles, they are *not* in batch files or in djgpp.env.
+# - - - - -
+# [make]
+# INCLUDE_PATH=%\>;INCLUDE_PATH%%\DJDIR%\include
+# LIBRARY_PATH=%\>;LIBRARY_PATH%%\DJDIR%\lib
+# BUTT=-m486
+# - - - - -
+# Alternately, these variables may be defined below, overriding the values
+# in djgpp.env, as
+# INCLUDE_PATH=c:\usr\include
+# LIBRARY_PATH=c:\usr\lib
+
+CC=gcc
+
+#CFLAGS=-MMD -O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-MMD -g -DDEBUG
+CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+ -Wstrict-prototypes -Wmissing-prototypes
+
+# If cp.exe is available, replace "copy /Y" with "cp -fp" .
+CP=copy /Y
+# If gnu install.exe is available, replace $(CP) with ginstall.
+INSTALL=$(CP)
+# The default value of RM is "rm -f." If "rm.exe" is found, comment out:
+RM=del
+LDLIBS=-L. -lz
+LD=$(CC) -s -o
+LDSHARED=$(CC)
+
+INCL=zlib.h zconf.h
+LIBS=libz.a
+
+AR=ar rcs
+
+prefix=/usr/local
+exec_prefix = $(prefix)
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: example.exe minigzip.exe
+
+test: all
+ ./example
+ echo hello world | .\minigzip | .\minigzip -d
+
+%.o : %.c
+ $(CC) $(CFLAGS) -c $< -o $@
+
+libz.a: $(OBJS)
+ $(AR) $@ $(OBJS)
+
+%.exe : %.o $(LIBS)
+ $(LD) $@ $< $(LDLIBS)
+
+# INCLUDE_PATH and LIBRARY_PATH were set for [make] in djgpp.env .
+
+.PHONY : uninstall clean
+
+install: $(INCL) $(LIBS)
+ -@if not exist $(INCLUDE_PATH)\nul mkdir $(INCLUDE_PATH)
+ -@if not exist $(LIBRARY_PATH)\nul mkdir $(LIBRARY_PATH)
+ $(INSTALL) zlib.h $(INCLUDE_PATH)
+ $(INSTALL) zconf.h $(INCLUDE_PATH)
+ $(INSTALL) libz.a $(LIBRARY_PATH)
+
+uninstall:
+ $(RM) $(INCLUDE_PATH)\zlib.h
+ $(RM) $(INCLUDE_PATH)\zconf.h
+ $(RM) $(LIBRARY_PATH)\libz.a
+
+clean:
+ $(RM) *.d
+ $(RM) *.o
+ $(RM) *.exe
+ $(RM) libz.a
+ $(RM) foo.gz
+
+DEPS := $(wildcard *.d)
+ifneq ($(DEPS),)
+include $(DEPS)
+endif
--- /dev/null
+# Makefile for zlib. Modified for emx 0.9c by Chr. Spieler, 6/17/98.
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile, or to compile and test, type:
+#
+# make -fmakefile.emx; make test -fmakefile.emx
+#
+
+CC=gcc
+
+#CFLAGS=-MMD -O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-MMD -g -DDEBUG
+CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+ -Wstrict-prototypes -Wmissing-prototypes
+
+# If cp.exe is available, replace "copy /Y" with "cp -fp" .
+CP=copy /Y
+# If gnu install.exe is available, replace $(CP) with ginstall.
+INSTALL=$(CP)
+# The default value of RM is "rm -f." If "rm.exe" is found, comment out:
+RM=del
+LDLIBS=-L. -lzlib
+LD=$(CC) -s -o
+LDSHARED=$(CC)
+
+INCL=zlib.h zconf.h
+LIBS=zlib.a
+
+AR=ar rcs
+
+prefix=/usr/local
+exec_prefix = $(prefix)
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: example.exe minigzip.exe
+
+test: all
+ ./example
+ echo hello world | .\minigzip | .\minigzip -d
+
+%.o : %.c
+ $(CC) $(CFLAGS) -c $< -o $@
+
+zlib.a: $(OBJS)
+ $(AR) $@ $(OBJS)
+
+%.exe : %.o $(LIBS)
+ $(LD) $@ $< $(LDLIBS)
+
+
+.PHONY : clean
+
+clean:
+ $(RM) *.d
+ $(RM) *.o
+ $(RM) *.exe
+ $(RM) zlib.a
+ $(RM) foo.gz
+
+DEPS := $(wildcard *.d)
+ifneq ($(DEPS),)
+include $(DEPS)
+endif
--- /dev/null
+# Makefile for zlib
+# Microsoft C 5.1 or later
+
+# To use, do "make makefile.msc"
+# To compile in small model, set below: MODEL=S
+
+# If you wish to reduce the memory requirements (default 256K for big
+# objects plus a few K), you can add to the LOC macro below:
+# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14
+# See zconf.h for details about the memory requirements.
+
+# ------------- Microsoft C 5.1 and later -------------
+
+# Optional nonstandard preprocessor flags (e.g. -DMAX_MEM_LEVEL=7)
+# should be added to the environment via "set LOCAL_ZLIB=-DFOO" or added
+# to the declaration of LOC here:
+LOC = $(LOCAL_ZLIB)
+
+# Type for CPU required: 0: 8086, 1: 80186, 2: 80286, 3: 80386, etc.
+CPU_TYP = 0
+
+# Memory model: one of S, M, C, L (small, medium, compact, large)
+MODEL=L
+
+CC=cl
+CFLAGS=-nologo -A$(MODEL) -G$(CPU_TYP) -W3 -Oait -Gs $(LOC)
+#-Ox generates bad code with MSC 5.1
+LIB_CFLAGS=-Zl $(CFLAGS)
+
+LD=link
+LDFLAGS=/noi/e/st:0x1500/noe/farcall/packcode
+# "/farcall/packcode" are only useful for `large code' memory models
+# but should be a "no-op" for small code models.
+
+O=.obj
+
+# variables
+OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \
+ trees$(O)
+OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\
+ trees$(O)
+OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \
+ infutil$(O) inffast$(O)
+OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\
+ infutil$(O)+inffast$(O)
+
+ZLIB_H = zlib.h zconf.h
+ZUTIL_H = zutil.h $(ZLIB_H)
+
+ZLIB_LIB = zlib_$(MODEL).lib
+
+all: $(ZLIB_LIB) example.exe minigzip.exe
+
+# individual dependencies and action rules:
+adler32.obj: adler32.c $(ZLIB_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+compress.obj: compress.c $(ZLIB_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+crc32.obj: crc32.c $(ZLIB_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h $(ZUTIL_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+gzio.obj: gzio.c $(ZUTIL_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+infblock.obj: infblock.c $(ZUTIL_H) infblock.h inftrees.h infcodes.h infutil.h
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+infcodes.obj: infcodes.c $(ZUTIL_H) inftrees.h infutil.h infcodes.h inffast.h
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+inflate.obj: inflate.c $(ZUTIL_H) infblock.h
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+inftrees.obj: inftrees.c $(ZUTIL_H) inftrees.h
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+infutil.obj: infutil.c $(ZUTIL_H) inftrees.h infutil.h
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+inffast.obj: inffast.c $(ZUTIL_H) inftrees.h infutil.h inffast.h
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h $(ZUTIL_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+uncompr.obj: uncompr.c $(ZLIB_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+zutil.obj: zutil.c $(ZUTIL_H)
+ $(CC) -c $(LIB_CFLAGS) $*.c
+
+example.obj: example.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+# we must cut the command line to fit in the MS/DOS 128 byte limit:
+$(ZLIB_LIB): $(OBJ1) $(OBJ2)
+ if exist $(ZLIB_LIB) del $(ZLIB_LIB)
+ lib $(ZLIB_LIB) $(OBJ1);
+ lib $(ZLIB_LIB) $(OBJ2);
+
+example.exe: example.obj $(ZLIB_LIB)
+ $(LD) $(LDFLAGS) example.obj,,,$(ZLIB_LIB);
+
+minigzip.exe: minigzip.obj $(ZLIB_LIB)
+ $(LD) $(LDFLAGS) minigzip.obj,,,$(ZLIB_LIB);
+
+test: example.exe minigzip.exe
+ example
+ echo hello world | minigzip | minigzip -d
+
+#clean:
+# del *.obj
+# del *.exe
--- /dev/null
+# Makefile for zlib
+# TurboC 2.0
+
+# To use, do "make -fmakefile.tc"
+# To compile in small model, set below: MODEL=-ms
+
+# WARNING: the small model is supported but only for small values of
+# MAX_WBITS and MAX_MEM_LEVEL. For example:
+# -DMAX_WBITS=11 -DMAX_MEM_LEVEL=3
+# If you wish to reduce the memory requirements (default 256K for big
+# objects plus a few K), you can add to CFLAGS below:
+# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14
+# See zconf.h for details about the memory requirements.
+
+# ------------- Turbo C 2.0 -------------
+MODEL=l
+# CFLAGS=-O2 -G -Z -m$(MODEL) -DMAX_WBITS=11 -DMAX_MEM_LEVEL=3
+CFLAGS=-O2 -G -Z -m$(MODEL)
+CC=tcc -I\tc\include
+LD=tcc -L\tc\lib
+AR=tlib
+LDFLAGS=-m$(MODEL) -f-
+O=.obj
+
+# variables
+OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \
+ trees$(O)
+OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\
+ trees$(O)
+OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \
+ infutil$(O) inffast$(O)
+OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\
+ infutil$(O)+inffast$(O)
+
+ZLIB_H = zlib.h zconf.h
+ZUTIL_H = zutil.h $(ZLIB_H)
+
+ZLIB_LIB = zlib_$(MODEL).lib
+
+all: test
+
+adler32.obj: adler32.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+compress.obj: compress.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+crc32.obj: crc32.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+gzio.obj: gzio.c $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+infblock.obj: infblock.c $(ZUTIL_H) infblock.h inftrees.h infcodes.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infcodes.obj: infcodes.c $(ZUTIL_H) inftrees.h infutil.h infcodes.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inflate.obj: inflate.c $(ZUTIL_H) infblock.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inftrees.obj: inftrees.c $(ZUTIL_H) inftrees.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infutil.obj: infutil.c $(ZUTIL_H) inftrees.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inffast.obj: inffast.c $(ZUTIL_H) inftrees.h infutil.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+uncompr.obj: uncompr.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+zutil.obj: zutil.c $(ZUTIL_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+example.obj: example.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c $(ZLIB_H)
+ $(CC) -c $(CFLAGS) $*.c
+
+# we must cut the command line to fit in the MS/DOS 128 byte limit:
+$(ZLIB_LIB): $(OBJ1) $(OBJ2)
+ del $(ZLIB_LIB)
+ $(AR) $(ZLIB_LIB) +$(OBJP1)
+ $(AR) $(ZLIB_LIB) +$(OBJP2)
+
+example.exe: example.obj $(ZLIB_LIB)
+ $(LD) $(LDFLAGS) -eexample.exe example.obj $(ZLIB_LIB)
+
+minigzip.exe: minigzip.obj $(ZLIB_LIB)
+ $(LD) $(LDFLAGS) -eminigzip.exe minigzip.obj $(ZLIB_LIB)
+
+test: example.exe minigzip.exe
+ example
+ echo hello world | minigzip | minigzip -d
+
+#clean:
+# del *.obj
+# del *.exe
--- /dev/null
+# Makefile for zlib
+# Microsoft 32-bit Visual C++ 4.0 or later (may work on earlier versions)
+
+# To use, do "nmake /f makefile.w32"
+
+# If you wish to reduce the memory requirements (default 256K for big
+# objects plus a few K), you can add to CFLAGS below:
+# -DMAX_MEM_LEVEL=7 -DMAX_WBITS=14
+# See zconf.h for details about the memory requirements.
+
+# ------------- Microsoft Visual C++ 4.0 and later -------------
+MODEL=
+CFLAGS=-Ox -GA3s -nologo -W3
+CC=cl
+LD=link
+LDFLAGS=
+O=.obj
+
+# variables
+OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \
+ trees$(O)
+OBJP1 = adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)+\
+ trees$(O)
+OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \
+ infutil$(O) inffast$(O)
+OBJP2 = zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)+\
+ infutil$(O)+inffast$(O)
+
+all: zlib.lib example.exe minigzip.exe
+
+adler32.obj: adler32.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+compress.obj: compress.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+crc32.obj: crc32.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+gzio.obj: gzio.c zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h\
+ infcodes.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h\
+ infcodes.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h
+ $(CC) -c $(CFLAGS) $*.c
+
+infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h
+ $(CC) -c $(CFLAGS) $*.c
+
+inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+ $(CC) -c $(CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+uncompr.obj: uncompr.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+zutil.obj: zutil.c zutil.h zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+example.obj: example.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c zlib.h zconf.h
+ $(CC) -c $(CFLAGS) $*.c
+
+zlib.lib: $(OBJ1) $(OBJ2)
+ if exist zlib.lib del zlib.lib
+ lib /OUT:zlib.lib $(OBJ1) $(OBJ2)
+
+example.exe: example.obj zlib.lib
+ $(LD) $(LDFLAGS) example.obj zlib.lib /OUT:example.exe /SUBSYSTEM:CONSOLE
+
+minigzip.exe: minigzip.obj zlib.lib
+ $(LD) $(LDFLAGS) minigzip.obj zlib.lib /OUT:minigzip.exe /SUBSYSTEM:CONSOLE
+
+test: example.exe minigzip.exe
+ example
+ echo hello world | minigzip | minigzip -d
+
+#clean:
+# del *.obj
+# del *.exe
--- /dev/null
+# Makefile for zlib
+# Watcom 10a
+
+# This version of the zlib makefile was adapted by Chris Young for use
+# with Watcom 10a 32-bit protected mode flat memory model. It was created
+# for use with POV-Ray ray tracer and you may choose to edit the CFLAGS to
+# suit your needs but the -DMSDOS is required.
+# -- Chris Young 76702.1655@compuserve.com
+
+# To use, do "wmake -f makefile.wat"
+
+# See zconf.h for details about the memory requirements.
+
+# ------------- Watcom 10a -------------
+MODEL=-mf
+CFLAGS= $(MODEL) -fpi87 -fp5 -zp4 -5r -w5 -oneatx -DMSDOS
+CC=wcc386
+LD=wcl386
+LIB=wlib -b -c
+LDFLAGS=
+O=.obj
+
+# variables
+OBJ1=adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O)
+OBJ2=trees$(O) zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O)
+OBJ3=infutil$(O) inffast$(O)
+OBJP1=adler32$(O)+compress$(O)+crc32$(O)+gzio$(O)+uncompr$(O)+deflate$(O)
+OBJP2=trees$(O)+zutil$(O)+inflate$(O)+infblock$(O)+inftrees$(O)+infcodes$(O)
+OBJP3=infutil$(O)+inffast$(O)
+
+all: test
+
+adler32.obj: adler32.c zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+compress.obj: compress.c zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+crc32.obj: crc32.c zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+gzio.obj: gzio.c zutil.h zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h &
+ infcodes.h infutil.h
+ $(CC) $(CFLAGS) $*.c
+
+infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h &
+ infcodes.h inffast.h
+ $(CC) $(CFLAGS) $*.c
+
+inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h
+ $(CC) $(CFLAGS) $*.c
+
+inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h
+ $(CC) $(CFLAGS) $*.c
+
+infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h
+ $(CC) $(CFLAGS) $*.c
+
+inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+ $(CC) $(CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+uncompr.obj: uncompr.c zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+zutil.obj: zutil.c zutil.h zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+example.obj: example.c zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c zlib.h zconf.h
+ $(CC) $(CFLAGS) $*.c
+
+# we must cut the command line to fit in the MS/DOS 128 byte limit:
+zlib.lib: $(OBJ1) $(OBJ2) $(OBJ3)
+ del zlib.lib
+ $(LIB) zlib.lib +$(OBJP1)
+ $(LIB) zlib.lib +$(OBJP2)
+ $(LIB) zlib.lib +$(OBJP3)
+
+example.exe: example.obj zlib.lib
+ $(LD) $(LDFLAGS) example.obj zlib.lib
+
+minigzip.exe: minigzip.obj zlib.lib
+ $(LD) $(LDFLAGS) minigzip.obj zlib.lib
+
+test: minigzip.exe example.exe
+ example
+ echo hello world | minigzip | minigzip -d >test
+ type test
+
+#clean:
+# del *.obj
+# del *.exe
--- /dev/null
+LIBRARY "zlib"
+
+DESCRIPTION '"""zlib data compression library"""'
+
+EXETYPE NT
+
+SUBSYSTEM WINDOWS
+
+STUB 'WINSTUB.EXE'
+
+VERSION 1.13
+
+CODE EXECUTE READ
+
+DATA READ WRITE
+
+HEAPSIZE 1048576,4096
+
+EXPORTS
+ adler32 @1
+ compress @2
+ crc32 @3
+ deflate @4
+ deflateCopy @5
+ deflateEnd @6
+ deflateInit2_ @7
+ deflateInit_ @8
+ deflateParams @9
+ deflateReset @10
+ deflateSetDictionary @11
+ gzclose @12
+ gzdopen @13
+ gzerror @14
+ gzflush @15
+ gzopen @16
+ gzread @17
+ gzwrite @18
+ inflate @19
+ inflateEnd @20
+ inflateInit2_ @21
+ inflateInit_ @22
+ inflateReset @23
+ inflateSetDictionary @24
+ inflateSync @25
+ uncompress @26
+ zlibVersion @27
+ gzprintf @28
+ gzputc @29
+ gzgetc @30
+ gzseek @31
+ gzrewind @32
+ gztell @33
+ gzeof @34
+ gzsetparams @35
+ zError @36
+ inflateSyncPoint @37
+ get_crc_table @38
+ compress2 @39
+ gzputs @40
+ gzgets @41
--- /dev/null
+#include <windows.h>
+
+#define IDR_VERSION1 1
+IDR_VERSION1 VERSIONINFO MOVEABLE IMPURE LOADONCALL DISCARDABLE
+ FILEVERSION 1,1,3,0
+ PRODUCTVERSION 1,1,3,0
+ FILEFLAGSMASK VS_FFI_FILEFLAGSMASK
+ FILEFLAGS 0
+ FILEOS VOS_DOS_WINDOWS32
+ FILETYPE VFT_DLL
+ FILESUBTYPE 0 // not used
+BEGIN
+ BLOCK "StringFileInfo"
+ BEGIN
+ BLOCK "040904E4"
+ //language ID = U.S. English, char set = Windows, Multilingual
+
+ BEGIN
+ VALUE "FileDescription", "zlib data compression library\0"
+ VALUE "FileVersion", "1.1.3\0"
+ VALUE "InternalName", "zlib\0"
+ VALUE "OriginalFilename", "zlib.dll\0"
+ VALUE "ProductName", "ZLib.DLL\0"
+ VALUE "Comments","DLL support by Alessandro Iacopetti & Gilles Vollant\0"
+ VALUE "LegalCopyright", "(C) 1995-1998 Jean-loup Gailly & Mark Adler\0"
+ END
+ END
+ BLOCK "VarFileInfo"
+ BEGIN
+ VALUE "Translation", 0x0409, 1252
+ END
+END
--- /dev/null
+# Makefile for zlib. Modified for emx/rsxnt by Chr. Spieler, 6/16/98.
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile, or to compile and test, type:
+#
+# make -fmakefile.emx; make test -fmakefile.emx
+#
+
+CC=gcc -Zwin32
+
+#CFLAGS=-MMD -O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-MMD -g -DDEBUG
+CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+ -Wstrict-prototypes -Wmissing-prototypes
+
+# If cp.exe is available, replace "copy /Y" with "cp -fp" .
+CP=copy /Y
+# If gnu install.exe is available, replace $(CP) with ginstall.
+INSTALL=$(CP)
+# The default value of RM is "rm -f." If "rm.exe" is found, comment out:
+RM=del
+LDLIBS=-L. -lzlib
+LD=$(CC) -s -o
+LDSHARED=$(CC)
+
+INCL=zlib.h zconf.h
+LIBS=zlib.a
+
+AR=ar rcs
+
+prefix=/usr/local
+exec_prefix = $(prefix)
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: example.exe minigzip.exe
+
+test: all
+ ./example
+ echo hello world | .\minigzip | .\minigzip -d
+
+%.o : %.c
+ $(CC) $(CFLAGS) -c $< -o $@
+
+zlib.a: $(OBJS)
+ $(AR) $@ $(OBJS)
+
+%.exe : %.o $(LIBS)
+ $(LD) $@ $< $(LDLIBS)
+
+
+.PHONY : clean
+
+clean:
+ $(RM) *.d
+ $(RM) *.o
+ $(RM) *.exe
+ $(RM) zlib.a
+ $(RM) foo.gz
+
+DEPS := $(wildcard *.d)
+ifneq ($(DEPS),)
+include $(DEPS)
+endif
+# Makefile for zlib. Modified for emx 0.9c by Chr. Spieler, 6/17/98.
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile, or to compile and test, type:
+#
+# make -fmakefile.emx; make test -fmakefile.emx
+#
+
+CC=gcc
+
+#CFLAGS=-MMD -O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-MMD -g -DDEBUG
+CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+ -Wstrict-prototypes -Wmissing-prototypes
+
+# If cp.exe is available, replace "copy /Y" with "cp -fp" .
+CP=copy /Y
+# If gnu install.exe is available, replace $(CP) with ginstall.
+INSTALL=$(CP)
+# The default value of RM is "rm -f." If "rm.exe" is found, comment out:
+RM=del
+LDLIBS=-L. -lzlib
+LD=$(CC) -s -o
+LDSHARED=$(CC)
+
+INCL=zlib.h zconf.h
+LIBS=zlib.a
+
+AR=ar rcs
+
+prefix=/usr/local
+exec_prefix = $(prefix)
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: example.exe minigzip.exe
+
+test: all
+ ./example
+ echo hello world | .\minigzip | .\minigzip -d
+
+%.o : %.c
+ $(CC) $(CFLAGS) -c $< -o $@
+
+zlib.a: $(OBJS)
+ $(AR) $@ $(OBJS)
+
+%.exe : %.o $(LIBS)
+ $(LD) $@ $< $(LDLIBS)
+
+
+.PHONY : clean
+
+clean:
+ $(RM) *.d
+ $(RM) *.o
+ $(RM) *.exe
+ $(RM) zlib.a
+ $(RM) foo.gz
+
+DEPS := $(wildcard *.d)
+ifneq ($(DEPS),)
+include $(DEPS)
+endif
--- /dev/null
+# Makefile for zlib. Modified for mingw32 by C. Spieler, 6/16/98.
+# (This Makefile is directly derived from Makefile.dj2)
+# Copyright (C) 1995-1998 Jean-loup Gailly.
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile, or to compile and test, type:
+#
+# make -fmakefile.gcc; make test -fmakefile.gcc
+#
+# To install libz.a, zconf.h and zlib.h in the mingw32 directories, type:
+#
+# make install -fmakefile.gcc
+#
+
+CC=gcc
+
+#CFLAGS=-MMD -O
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-MMD -g -DDEBUG
+CFLAGS=-MMD -O3 $(BUTT) -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+ -Wstrict-prototypes -Wmissing-prototypes
+
+# If cp.exe is available, replace "copy /Y" with "cp -fp" .
+CP=copy /Y
+# If gnu install.exe is available, replace $(CP) with ginstall.
+INSTALL=$(CP)
+# The default value of RM is "rm -f." If "rm.exe" is found, comment out:
+RM=del
+LDLIBS=-L. -lz
+LD=$(CC) -s -o
+LDSHARED=$(CC)
+
+INCL=zlib.h zconf.h
+LIBS=libz.a
+
+AR=ar rcs
+
+prefix=/usr/local
+exec_prefix = $(prefix)
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+all: example.exe minigzip.exe
+
+test: all
+ ./example
+ echo hello world | .\minigzip | .\minigzip -d
+
+%.o : %.c
+ $(CC) $(CFLAGS) -c $< -o $@
+
+libz.a: $(OBJS)
+ $(AR) $@ $(OBJS)
+
+%.exe : %.o $(LIBS)
+ $(LD) $@ $< $(LDLIBS)
+
+# INCLUDE_PATH and LIBRARY_PATH were set for [make] in djgpp.env .
+
+.PHONY : uninstall clean
+
+install: $(INCL) $(LIBS)
+ -@if not exist $(INCLUDE_PATH)\nul mkdir $(INCLUDE_PATH)
+ -@if not exist $(LIBRARY_PATH)\nul mkdir $(LIBRARY_PATH)
+ $(INSTALL) zlib.h $(INCLUDE_PATH)
+ $(INSTALL) zconf.h $(INCLUDE_PATH)
+ $(INSTALL) libz.a $(LIBRARY_PATH)
+
+uninstall:
+ $(RM) $(INCLUDE_PATH)\zlib.h
+ $(RM) $(INCLUDE_PATH)\zconf.h
+ $(RM) $(LIBRARY_PATH)\libz.a
+
+clean:
+ $(RM) *.d
+ $(RM) *.o
+ $(RM) *.exe
+ $(RM) libz.a
+ $(RM) foo.gz
+
+DEPS := $(wildcard *.d)
+ifneq ($(DEPS),)
+include $(DEPS)
+endif
--- /dev/null
+# Makefile for zlib
+
+!include <ntwin32.mak>
+
+CC=cl
+LD=link
+CFLAGS=-O -nologo
+LDFLAGS=
+O=.obj
+
+# variables
+OBJ1 = adler32$(O) compress$(O) crc32$(O) gzio$(O) uncompr$(O) deflate$(O) \
+ trees$(O)
+OBJ2 = zutil$(O) inflate$(O) infblock$(O) inftrees$(O) infcodes$(O) \
+ infutil$(O) inffast$(O)
+
+all: zlib.dll example.exe minigzip.exe
+
+adler32.obj: adler32.c zutil.h zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+compress.obj: compress.c zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+crc32.obj: crc32.c zutil.h zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+deflate.obj: deflate.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+gzio.obj: gzio.c zutil.h zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+infblock.obj: infblock.c zutil.h zlib.h zconf.h infblock.h inftrees.h\
+ infcodes.h infutil.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+infcodes.obj: infcodes.c zutil.h zlib.h zconf.h inftrees.h infutil.h\
+ infcodes.h inffast.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+inflate.obj: inflate.c zutil.h zlib.h zconf.h infblock.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+inftrees.obj: inftrees.c zutil.h zlib.h zconf.h inftrees.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+infutil.obj: infutil.c zutil.h zlib.h zconf.h inftrees.h infutil.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+inffast.obj: inffast.c zutil.h zlib.h zconf.h inftrees.h infutil.h inffast.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+trees.obj: trees.c deflate.h zutil.h zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+uncompr.obj: uncompr.c zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+zutil.obj: zutil.c zutil.h zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+example.obj: example.c zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+minigzip.obj: minigzip.c zlib.h zconf.h
+ $(CC) -c $(cvarsdll) $(CFLAGS) $*.c
+
+zlib.dll: $(OBJ1) $(OBJ2) zlib.dnt
+ link $(dlllflags) -out:$@ -def:zlib.dnt $(OBJ1) $(OBJ2) $(guilibsdll)
+
+zlib.lib: zlib.dll
+
+example.exe: example.obj zlib.lib
+ $(LD) $(LDFLAGS) example.obj zlib.lib
+
+minigzip.exe: minigzip.obj zlib.lib
+ $(LD) $(LDFLAGS) minigzip.obj zlib.lib
+
+test: example.exe minigzip.exe
+ example
+ echo hello world | minigzip | minigzip -d
+
+clean:
+ del *.obj
+ del *.exe
+ del *.dll
+ del *.lib
--- /dev/null
+LIBRARY zlib.dll
+EXETYPE WINDOWS
+CODE PRELOAD MOVEABLE DISCARDABLE
+DATA PRELOAD MOVEABLE MULTIPLE
+
+EXPORTS
+ adler32 @1
+ compress @2
+ crc32 @3
+ deflate @4
+ deflateCopy @5
+ deflateEnd @6
+ deflateInit2_ @7
+ deflateInit_ @8
+ deflateParams @9
+ deflateReset @10
+ deflateSetDictionary @11
+ gzclose @12
+ gzdopen @13
+ gzerror @14
+ gzflush @15
+ gzopen @16
+ gzread @17
+ gzwrite @18
+ inflate @19
+ inflateEnd @20
+ inflateInit2_ @21
+ inflateInit_ @22
+ inflateReset @23
+ inflateSetDictionary @24
+ inflateSync @25
+ uncompress @26
+ zlibVersion @27
+ gzprintf @28
+ gzputc @29
+ gzgetc @30
+ gzseek @31
+ gzrewind @32
+ gztell @33
+ gzeof @34
+ gzsetparams @35
+ zError @36
+ inflateSyncPoint @37
+ get_crc_table @38
+ compress2 @39
+ gzputs @40
+ gzgets @41
--- /dev/null
+# Makefile for zlib under OS/2 using GCC (PGCC)
+# For conditions of distribution and use, see copyright notice in zlib.h
+
+# To compile and test, type:
+# cp Makefile.os2 ..
+# cd ..
+# make -f Makefile.os2 test
+
+# This makefile will build a static library z.lib, a shared library
+# z.dll and a import library zdll.lib. You can use either z.lib or
+# zdll.lib by specifying either -lz or -lzdll on gcc's command line
+
+CC=gcc -Zomf -s
+
+CFLAGS=-O6 -Wall
+#CFLAGS=-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7
+#CFLAGS=-g -DDEBUG
+#CFLAGS=-O3 -Wall -Wwrite-strings -Wpointer-arith -Wconversion \
+# -Wstrict-prototypes -Wmissing-prototypes
+
+#################### BUG WARNING: #####################
+## infcodes.c hits a bug in pgcc-1.0, so you have to use either
+## -O# where # <= 4 or one of (-fno-ommit-frame-pointer or -fno-force-mem)
+## This bug is reportedly fixed in pgcc >1.0, but this was not tested
+CFLAGS+=-fno-force-mem
+
+LDFLAGS=-s -L. -lzdll -Zcrtdll
+LDSHARED=$(CC) -s -Zomf -Zdll -Zcrtdll
+
+VER=1.1.0
+ZLIB=z.lib
+SHAREDLIB=z.dll
+SHAREDLIBIMP=zdll.lib
+LIBS=$(ZLIB) $(SHAREDLIB) $(SHAREDLIBIMP)
+
+AR=emxomfar cr
+IMPLIB=emximp
+RANLIB=echo
+TAR=tar
+SHELL=bash
+
+prefix=/usr/local
+exec_prefix = $(prefix)
+
+OBJS = adler32.o compress.o crc32.o gzio.o uncompr.o deflate.o trees.o \
+ zutil.o inflate.o infblock.o inftrees.o infcodes.o infutil.o inffast.o
+
+TEST_OBJS = example.o minigzip.o
+
+DISTFILES = README INDEX ChangeLog configure Make*[a-z0-9] *.[ch] descrip.mms \
+ algorithm.txt zlib.3 msdos/Make*[a-z0-9] msdos/zlib.def msdos/zlib.rc \
+ nt/Makefile.nt nt/zlib.dnt contrib/README.contrib contrib/*.txt \
+ contrib/asm386/*.asm contrib/asm386/*.c \
+ contrib/asm386/*.bat contrib/asm386/zlibvc.d?? contrib/iostream/*.cpp \
+ contrib/iostream/*.h contrib/iostream2/*.h contrib/iostream2/*.cpp \
+ contrib/untgz/Makefile contrib/untgz/*.c contrib/untgz/*.w32
+
+all: example.exe minigzip.exe
+
+test: all
+ @LD_LIBRARY_PATH=.:$(LD_LIBRARY_PATH) ; export LD_LIBRARY_PATH; \
+ echo hello world | ./minigzip | ./minigzip -d || \
+ echo ' *** minigzip test FAILED ***' ; \
+ if ./example; then \
+ echo ' *** zlib test OK ***'; \
+ else \
+ echo ' *** zlib test FAILED ***'; \
+ fi
+
+$(ZLIB): $(OBJS)
+ $(AR) $@ $(OBJS)
+ -@ ($(RANLIB) $@ || true) >/dev/null 2>&1
+
+$(SHAREDLIB): $(OBJS) os2/z.def
+ $(LDSHARED) -o $@ $^
+
+$(SHAREDLIBIMP): os2/z.def
+ $(IMPLIB) -o $@ $^
+
+example.exe: example.o $(LIBS)
+ $(CC) $(CFLAGS) -o $@ example.o $(LDFLAGS)
+
+minigzip.exe: minigzip.o $(LIBS)
+ $(CC) $(CFLAGS) -o $@ minigzip.o $(LDFLAGS)
+
+clean:
+ rm -f *.o *~ example minigzip libz.a libz.so* foo.gz
+
+distclean: clean
+
+zip:
+ mv Makefile Makefile~; cp -p Makefile.in Makefile
+ rm -f test.c ztest*.c
+ v=`sed -n -e 's/\.//g' -e '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\
+ zip -ul9 zlib$$v $(DISTFILES)
+ mv Makefile~ Makefile
+
+dist:
+ mv Makefile Makefile~; cp -p Makefile.in Makefile
+ rm -f test.c ztest*.c
+ d=zlib-`sed -n '/VERSION "/s/.*"\(.*\)".*/\1/p' < zlib.h`;\
+ rm -f $$d.tar.gz; \
+ if test ! -d ../$$d; then rm -f ../$$d; ln -s `pwd` ../$$d; fi; \
+ files=""; \
+ for f in $(DISTFILES); do files="$$files $$d/$$f"; done; \
+ cd ..; \
+ GZIP=-9 $(TAR) chofz $$d/$$d.tar.gz $$files; \
+ if test ! -d $$d; then rm -f $$d; fi
+ mv Makefile~ Makefile
+
+tags:
+ etags *.[ch]
+
+depend:
+ makedepend -- $(CFLAGS) -- *.[ch]
+
+# DO NOT DELETE THIS LINE -- make depend depends on it.
+
+adler32.o: zlib.h zconf.h
+compress.o: zlib.h zconf.h
+crc32.o: zlib.h zconf.h
+deflate.o: deflate.h zutil.h zlib.h zconf.h
+example.o: zlib.h zconf.h
+gzio.o: zutil.h zlib.h zconf.h
+infblock.o: infblock.h inftrees.h infcodes.h infutil.h zutil.h zlib.h zconf.h
+infcodes.o: zutil.h zlib.h zconf.h
+infcodes.o: inftrees.h infblock.h infcodes.h infutil.h inffast.h
+inffast.o: zutil.h zlib.h zconf.h inftrees.h
+inffast.o: infblock.h infcodes.h infutil.h inffast.h
+inflate.o: zutil.h zlib.h zconf.h infblock.h
+inftrees.o: zutil.h zlib.h zconf.h inftrees.h
+infutil.o: zutil.h zlib.h zconf.h infblock.h inftrees.h infcodes.h infutil.h
+minigzip.o: zlib.h zconf.h
+trees.o: deflate.h zutil.h zlib.h zconf.h trees.h
+uncompr.o: zlib.h zconf.h
+zutil.o: zutil.h zlib.h zconf.h
--- /dev/null
+;
+; Slightly modified version of ../nt/zlib.dnt :-)
+;
+
+LIBRARY Z
+DESCRIPTION "Zlib compression library for OS/2"
+CODE PRELOAD MOVEABLE DISCARDABLE
+DATA PRELOAD MOVEABLE MULTIPLE
+
+EXPORTS
+ adler32
+ compress
+ crc32
+ deflate
+ deflateCopy
+ deflateEnd
+ deflateInit2_
+ deflateInit_
+ deflateParams
+ deflateReset
+ deflateSetDictionary
+ gzclose
+ gzdopen
+ gzerror
+ gzflush
+ gzopen
+ gzread
+ gzwrite
+ inflate
+ inflateEnd
+ inflateInit2_
+ inflateInit_
+ inflateReset
+ inflateSetDictionary
+ inflateSync
+ uncompress
+ zlibVersion
+ gzprintf
+ gzputc
+ gzgetc
+ gzseek
+ gzrewind
+ gztell
+ gzeof
+ gzsetparams
+ zError
+ inflateSyncPoint
+ get_crc_table
+ compress2
+ gzputs
+ gzgets
--- /dev/null
+/* trees.c -- output deflated data using Huffman coding
+ * Copyright (C) 1995-1998 Jean-loup Gailly
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ * ALGORITHM
+ *
+ * The "deflation" process uses several Huffman trees. The more
+ * common source values are represented by shorter bit sequences.
+ *
+ * Each code tree is stored in a compressed form which is itself
+ * a Huffman encoding of the lengths of all the code strings (in
+ * ascending order by source values). The actual code strings are
+ * reconstructed from the lengths in the inflate process, as described
+ * in the deflate specification.
+ *
+ * REFERENCES
+ *
+ * Deutsch, L.P.,"'Deflate' Compressed Data Format Specification".
+ * Available in ftp.uu.net:/pub/archiving/zip/doc/deflate-1.1.doc
+ *
+ * Storer, James A.
+ * Data Compression: Methods and Theory, pp. 49-50.
+ * Computer Science Press, 1988. ISBN 0-7167-8156-5.
+ *
+ * Sedgewick, R.
+ * Algorithms, p290.
+ * Addison-Wesley, 1983. ISBN 0-201-06672-6.
+ */
+
+/* @(#) $Id$ */
+
+/* #define GEN_TREES_H */
+
+#include "deflate.h"
+
+#ifdef DEBUG
+# include <ctype.h>
+#endif
+
+/* ===========================================================================
+ * Constants
+ */
+
+#define MAX_BL_BITS 7
+/* Bit length codes must not exceed MAX_BL_BITS bits */
+
+#define END_BLOCK 256
+/* end of block literal code */
+
+#define REP_3_6 16
+/* repeat previous bit length 3-6 times (2 bits of repeat count) */
+
+#define REPZ_3_10 17
+/* repeat a zero length 3-10 times (3 bits of repeat count) */
+
+#define REPZ_11_138 18
+/* repeat a zero length 11-138 times (7 bits of repeat count) */
+
+local const int extra_lbits[LENGTH_CODES] /* extra bits for each length code */
+ = {0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0};
+
+local const int extra_dbits[D_CODES] /* extra bits for each distance code */
+ = {0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13};
+
+local const int extra_blbits[BL_CODES]/* extra bits for each bit length code */
+ = {0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7};
+
+local const uch bl_order[BL_CODES]
+ = {16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15};
+/* The lengths of the bit length codes are sent in order of decreasing
+ * probability, to avoid transmitting the lengths for unused bit length codes.
+ */
+
+#define Buf_size (8 * 2*sizeof(char))
+/* Number of bits used within bi_buf. (bi_buf might be implemented on
+ * more than 16 bits on some systems.)
+ */
+
+/* ===========================================================================
+ * Local data. These are initialized only once.
+ */
+
+#define DIST_CODE_LEN 512 /* see definition of array dist_code below */
+
+#if defined(GEN_TREES_H) || !defined(STDC)
+/* non ANSI compilers may not accept trees.h */
+
+local ct_data static_ltree[L_CODES+2];
+/* The static literal tree. Since the bit lengths are imposed, there is no
+ * need for the L_CODES extra codes used during heap construction. However
+ * The codes 286 and 287 are needed to build a canonical tree (see _tr_init
+ * below).
+ */
+
+local ct_data static_dtree[D_CODES];
+/* The static distance tree. (Actually a trivial tree since all codes use
+ * 5 bits.)
+ */
+
+uch _dist_code[DIST_CODE_LEN];
+/* Distance codes. The first 256 values correspond to the distances
+ * 3 .. 258, the last 256 values correspond to the top 8 bits of
+ * the 15 bit distances.
+ */
+
+uch _length_code[MAX_MATCH-MIN_MATCH+1];
+/* length code for each normalized match length (0 == MIN_MATCH) */
+
+local int base_length[LENGTH_CODES];
+/* First normalized length for each code (0 = MIN_MATCH) */
+
+local int base_dist[D_CODES];
+/* First normalized distance for each code (0 = distance of 1) */
+
+#else
+# include "trees.h"
+#endif /* GEN_TREES_H */
+
+struct static_tree_desc_s {
+ const ct_data *static_tree; /* static tree or NULL */
+ const intf *extra_bits; /* extra bits for each code or NULL */
+ int extra_base; /* base index for extra_bits */
+ int elems; /* max number of elements in the tree */
+ int max_length; /* max bit length for the codes */
+};
+
+local static_tree_desc static_l_desc =
+{static_ltree, extra_lbits, LITERALS+1, L_CODES, MAX_BITS};
+
+local static_tree_desc static_d_desc =
+{static_dtree, extra_dbits, 0, D_CODES, MAX_BITS};
+
+local static_tree_desc static_bl_desc =
+{(const ct_data *)0, extra_blbits, 0, BL_CODES, MAX_BL_BITS};
+
+/* ===========================================================================
+ * Local (static) routines in this file.
+ */
+
+local void tr_static_init OF((void));
+local void init_block OF((deflate_state *s));
+local void pqdownheap OF((deflate_state *s, ct_data *tree, int k));
+local void gen_bitlen OF((deflate_state *s, tree_desc *desc));
+local void gen_codes OF((ct_data *tree, int max_code, ushf *bl_count));
+local void build_tree OF((deflate_state *s, tree_desc *desc));
+local void scan_tree OF((deflate_state *s, ct_data *tree, int max_code));
+local void send_tree OF((deflate_state *s, ct_data *tree, int max_code));
+local int build_bl_tree OF((deflate_state *s));
+local void send_all_trees OF((deflate_state *s, int lcodes, int dcodes,
+ int blcodes));
+local void compress_block OF((deflate_state *s, ct_data *ltree,
+ ct_data *dtree));
+local void set_data_type OF((deflate_state *s));
+local unsigned bi_reverse OF((unsigned value, int length));
+local void bi_windup OF((deflate_state *s));
+local void bi_flush OF((deflate_state *s));
+local void copy_block OF((deflate_state *s, charf *buf, unsigned len,
+ int header));
+
+#ifdef GEN_TREES_H
+local void gen_trees_header OF((void));
+#endif
+
+#ifndef DEBUG
+# define send_code(s, c, tree) send_bits(s, tree[c].Code, tree[c].Len)
+ /* Send a code of the given tree. c and tree must not have side effects */
+
+#else /* DEBUG */
+# define send_code(s, c, tree) \
+ { if (z_verbose>2) fprintf(stderr,"\ncd %3d ",(c)); \
+ send_bits(s, tree[c].Code, tree[c].Len); }
+#endif
+
+/* ===========================================================================
+ * Output a short LSB first on the stream.
+ * IN assertion: there is enough room in pendingBuf.
+ */
+#define put_short(s, w) { \
+ put_byte(s, (uch)((w) & 0xff)); \
+ put_byte(s, (uch)((ush)(w) >> 8)); \
+}
+
+/* ===========================================================================
+ * Send a value on a given number of bits.
+ * IN assertion: length <= 16 and value fits in length bits.
+ */
+#ifdef DEBUG
+local void send_bits OF((deflate_state *s, int value, int length));
+
+local void send_bits(s, value, length)
+ deflate_state *s;
+ int value; /* value to send */
+ int length; /* number of bits */
+{
+ Tracevv((stderr," l %2d v %4x ", length, value));
+ Assert(length > 0 && length <= 15, "invalid length");
+ s->bits_sent += (ulg)length;
+
+ /* If not enough room in bi_buf, use (valid) bits from bi_buf and
+ * (16 - bi_valid) bits from value, leaving (width - (16-bi_valid))
+ * unused bits in value.
+ */
+ if (s->bi_valid > (int)Buf_size - length) {
+ s->bi_buf |= (value << s->bi_valid);
+ put_short(s, s->bi_buf);
+ s->bi_buf = (ush)value >> (Buf_size - s->bi_valid);
+ s->bi_valid += length - Buf_size;
+ } else {
+ s->bi_buf |= value << s->bi_valid;
+ s->bi_valid += length;
+ }
+}
+#else /* !DEBUG */
+
+#define send_bits(s, value, length) \
+{ int len = length;\
+ if (s->bi_valid > (int)Buf_size - len) {\
+ int val = value;\
+ s->bi_buf |= (val << s->bi_valid);\
+ put_short(s, s->bi_buf);\
+ s->bi_buf = (ush)val >> (Buf_size - s->bi_valid);\
+ s->bi_valid += len - Buf_size;\
+ } else {\
+ s->bi_buf |= (value) << s->bi_valid;\
+ s->bi_valid += len;\
+ }\
+}
+#endif /* DEBUG */
+
+
+#define MAX(a,b) (a >= b ? a : b)
+/* the arguments must not have side effects */
+
+/* ===========================================================================
+ * Initialize the various 'constant' tables.
+ */
+local void tr_static_init()
+{
+#if defined(GEN_TREES_H) || !defined(STDC)
+ static int static_init_done = 0;
+ int n; /* iterates over tree elements */
+ int bits; /* bit counter */
+ int length; /* length value */
+ int code; /* code value */
+ int dist; /* distance index */
+ ush bl_count[MAX_BITS+1];
+ /* number of codes at each bit length for an optimal tree */
+
+ if (static_init_done) return;
+
+ /* For some embedded targets, global variables are not initialized: */
+ static_l_desc.static_tree = static_ltree;
+ static_l_desc.extra_bits = extra_lbits;
+ static_d_desc.static_tree = static_dtree;
+ static_d_desc.extra_bits = extra_dbits;
+ static_bl_desc.extra_bits = extra_blbits;
+
+ /* Initialize the mapping length (0..255) -> length code (0..28) */
+ length = 0;
+ for (code = 0; code < LENGTH_CODES-1; code++) {
+ base_length[code] = length;
+ for (n = 0; n < (1<<extra_lbits[code]); n++) {
+ _length_code[length++] = (uch)code;
+ }
+ }
+ Assert (length == 256, "tr_static_init: length != 256");
+ /* Note that the length 255 (match length 258) can be represented
+ * in two different ways: code 284 + 5 bits or code 285, so we
+ * overwrite length_code[255] to use the best encoding:
+ */
+ _length_code[length-1] = (uch)code;
+
+ /* Initialize the mapping dist (0..32K) -> dist code (0..29) */
+ dist = 0;
+ for (code = 0 ; code < 16; code++) {
+ base_dist[code] = dist;
+ for (n = 0; n < (1<<extra_dbits[code]); n++) {
+ _dist_code[dist++] = (uch)code;
+ }
+ }
+ Assert (dist == 256, "tr_static_init: dist != 256");
+ dist >>= 7; /* from now on, all distances are divided by 128 */
+ for ( ; code < D_CODES; code++) {
+ base_dist[code] = dist << 7;
+ for (n = 0; n < (1<<(extra_dbits[code]-7)); n++) {
+ _dist_code[256 + dist++] = (uch)code;
+ }
+ }
+ Assert (dist == 256, "tr_static_init: 256+dist != 512");
+
+ /* Construct the codes of the static literal tree */
+ for (bits = 0; bits <= MAX_BITS; bits++) bl_count[bits] = 0;
+ n = 0;
+ while (n <= 143) static_ltree[n++].Len = 8, bl_count[8]++;
+ while (n <= 255) static_ltree[n++].Len = 9, bl_count[9]++;
+ while (n <= 279) static_ltree[n++].Len = 7, bl_count[7]++;
+ while (n <= 287) static_ltree[n++].Len = 8, bl_count[8]++;
+ /* Codes 286 and 287 do not exist, but we must include them in the
+ * tree construction to get a canonical Huffman tree (longest code
+ * all ones)
+ */
+ gen_codes((ct_data *)static_ltree, L_CODES+1, bl_count);
+
+ /* The static distance tree is trivial: */
+ for (n = 0; n < D_CODES; n++) {
+ static_dtree[n].Len = 5;
+ static_dtree[n].Code = bi_reverse((unsigned)n, 5);
+ }
+ static_init_done = 1;
+
+# ifdef GEN_TREES_H
+ gen_trees_header();
+# endif
+#endif /* defined(GEN_TREES_H) || !defined(STDC) */
+}
+
+/* ===========================================================================
+ * Genererate the file trees.h describing the static trees.
+ */
+#ifdef GEN_TREES_H
+# ifndef DEBUG
+# include <stdio.h>
+# endif
+
+# define SEPARATOR(i, last, width) \
+ ((i) == (last)? "\n};\n\n" : \
+ ((i) % (width) == (width)-1 ? ",\n" : ", "))
+
+void gen_trees_header()
+{
+ FILE *header = fopen("trees.h", "w");
+ int i;
+
+ Assert (header != NULL, "Can't open trees.h");
+ fprintf(header,
+ "/* header created automatically with -DGEN_TREES_H */\n\n");
+
+ fprintf(header, "local const ct_data static_ltree[L_CODES+2] = {\n");
+ for (i = 0; i < L_CODES+2; i++) {
+ fprintf(header, "{{%3u},{%3u}}%s", static_ltree[i].Code,
+ static_ltree[i].Len, SEPARATOR(i, L_CODES+1, 5));
+ }
+
+ fprintf(header, "local const ct_data static_dtree[D_CODES] = {\n");
+ for (i = 0; i < D_CODES; i++) {
+ fprintf(header, "{{%2u},{%2u}}%s", static_dtree[i].Code,
+ static_dtree[i].Len, SEPARATOR(i, D_CODES-1, 5));
+ }
+
+ fprintf(header, "const uch _dist_code[DIST_CODE_LEN] = {\n");
+ for (i = 0; i < DIST_CODE_LEN; i++) {
+ fprintf(header, "%2u%s", _dist_code[i],
+ SEPARATOR(i, DIST_CODE_LEN-1, 20));
+ }
+
+ fprintf(header, "const uch _length_code[MAX_MATCH-MIN_MATCH+1]= {\n");
+ for (i = 0; i < MAX_MATCH-MIN_MATCH+1; i++) {
+ fprintf(header, "%2u%s", _length_code[i],
+ SEPARATOR(i, MAX_MATCH-MIN_MATCH, 20));
+ }
+
+ fprintf(header, "local const int base_length[LENGTH_CODES] = {\n");
+ for (i = 0; i < LENGTH_CODES; i++) {
+ fprintf(header, "%1u%s", base_length[i],
+ SEPARATOR(i, LENGTH_CODES-1, 20));
+ }
+
+ fprintf(header, "local const int base_dist[D_CODES] = {\n");
+ for (i = 0; i < D_CODES; i++) {
+ fprintf(header, "%5u%s", base_dist[i],
+ SEPARATOR(i, D_CODES-1, 10));
+ }
+
+ fclose(header);
+}
+#endif /* GEN_TREES_H */
+
+/* ===========================================================================
+ * Initialize the tree data structures for a new zlib stream.
+ */
+void _tr_init(s)
+ deflate_state *s;
+{
+ tr_static_init();
+
+ s->l_desc.dyn_tree = s->dyn_ltree;
+ s->l_desc.stat_desc = &static_l_desc;
+
+ s->d_desc.dyn_tree = s->dyn_dtree;
+ s->d_desc.stat_desc = &static_d_desc;
+
+ s->bl_desc.dyn_tree = s->bl_tree;
+ s->bl_desc.stat_desc = &static_bl_desc;
+
+ s->bi_buf = 0;
+ s->bi_valid = 0;
+ s->last_eob_len = 8; /* enough lookahead for inflate */
+#ifdef DEBUG
+ s->compressed_len = 0L;
+ s->bits_sent = 0L;
+#endif
+
+ /* Initialize the first block of the first file: */
+ init_block(s);
+}
+
+/* ===========================================================================
+ * Initialize a new block.
+ */
+local void init_block(s)
+ deflate_state *s;
+{
+ int n; /* iterates over tree elements */
+
+ /* Initialize the trees. */
+ for (n = 0; n < L_CODES; n++) s->dyn_ltree[n].Freq = 0;
+ for (n = 0; n < D_CODES; n++) s->dyn_dtree[n].Freq = 0;
+ for (n = 0; n < BL_CODES; n++) s->bl_tree[n].Freq = 0;
+
+ s->dyn_ltree[END_BLOCK].Freq = 1;
+ s->opt_len = s->static_len = 0L;
+ s->last_lit = s->matches = 0;
+}
+
+#define SMALLEST 1
+/* Index within the heap array of least frequent node in the Huffman tree */
+
+
+/* ===========================================================================
+ * Remove the smallest element from the heap and recreate the heap with
+ * one less element. Updates heap and heap_len.
+ */
+#define pqremove(s, tree, top) \
+{\
+ top = s->heap[SMALLEST]; \
+ s->heap[SMALLEST] = s->heap[s->heap_len--]; \
+ pqdownheap(s, tree, SMALLEST); \
+}
+
+/* ===========================================================================
+ * Compares to subtrees, using the tree depth as tie breaker when
+ * the subtrees have equal frequency. This minimizes the worst case length.
+ */
+#define smaller(tree, n, m, depth) \
+ (tree[n].Freq < tree[m].Freq || \
+ (tree[n].Freq == tree[m].Freq && depth[n] <= depth[m]))
+
+/* ===========================================================================
+ * Restore the heap property by moving down the tree starting at node k,
+ * exchanging a node with the smallest of its two sons if necessary, stopping
+ * when the heap property is re-established (each father smaller than its
+ * two sons).
+ */
+local void pqdownheap(s, tree, k)
+ deflate_state *s;
+ ct_data *tree; /* the tree to restore */
+ int k; /* node to move down */
+{
+ int v = s->heap[k];
+ int j = k << 1; /* left son of k */
+ while (j <= s->heap_len) {
+ /* Set j to the smallest of the two sons: */
+ if (j < s->heap_len &&
+ smaller(tree, s->heap[j+1], s->heap[j], s->depth)) {
+ j++;
+ }
+ /* Exit if v is smaller than both sons */
+ if (smaller(tree, v, s->heap[j], s->depth)) break;
+
+ /* Exchange v with the smallest son */
+ s->heap[k] = s->heap[j]; k = j;
+
+ /* And continue down the tree, setting j to the left son of k */
+ j <<= 1;
+ }
+ s->heap[k] = v;
+}
+
+/* ===========================================================================
+ * Compute the optimal bit lengths for a tree and update the total bit length
+ * for the current block.
+ * IN assertion: the fields freq and dad are set, heap[heap_max] and
+ * above are the tree nodes sorted by increasing frequency.
+ * OUT assertions: the field len is set to the optimal bit length, the
+ * array bl_count contains the frequencies for each bit length.
+ * The length opt_len is updated; static_len is also updated if stree is
+ * not null.
+ */
+local void gen_bitlen(s, desc)
+ deflate_state *s;
+ tree_desc *desc; /* the tree descriptor */
+{
+ ct_data *tree = desc->dyn_tree;
+ int max_code = desc->max_code;
+ const ct_data *stree = desc->stat_desc->static_tree;
+ const intf *extra = desc->stat_desc->extra_bits;
+ int base = desc->stat_desc->extra_base;
+ int max_length = desc->stat_desc->max_length;
+ int h; /* heap index */
+ int n, m; /* iterate over the tree elements */
+ int bits; /* bit length */
+ int xbits; /* extra bits */
+ ush f; /* frequency */
+ int overflow = 0; /* number of elements with bit length too large */
+
+ for (bits = 0; bits <= MAX_BITS; bits++) s->bl_count[bits] = 0;
+
+ /* In a first pass, compute the optimal bit lengths (which may
+ * overflow in the case of the bit length tree).
+ */
+ tree[s->heap[s->heap_max]].Len = 0; /* root of the heap */
+
+ for (h = s->heap_max+1; h < HEAP_SIZE; h++) {
+ n = s->heap[h];
+ bits = tree[tree[n].Dad].Len + 1;
+ if (bits > max_length) bits = max_length, overflow++;
+ tree[n].Len = (ush)bits;
+ /* We overwrite tree[n].Dad which is no longer needed */
+
+ if (n > max_code) continue; /* not a leaf node */
+
+ s->bl_count[bits]++;
+ xbits = 0;
+ if (n >= base) xbits = extra[n-base];
+ f = tree[n].Freq;
+ s->opt_len += (ulg)f * (bits + xbits);
+ if (stree) s->static_len += (ulg)f * (stree[n].Len + xbits);
+ }
+ if (overflow == 0) return;
+
+ Trace((stderr,"\nbit length overflow\n"));
+ /* This happens for example on obj2 and pic of the Calgary corpus */
+
+ /* Find the first bit length which could increase: */
+ do {
+ bits = max_length-1;
+ while (s->bl_count[bits] == 0) bits--;
+ s->bl_count[bits]--; /* move one leaf down the tree */
+ s->bl_count[bits+1] += 2; /* move one overflow item as its brother */
+ s->bl_count[max_length]--;
+ /* The brother of the overflow item also moves one step up,
+ * but this does not affect bl_count[max_length]
+ */
+ overflow -= 2;
+ } while (overflow > 0);
+
+ /* Now recompute all bit lengths, scanning in increasing frequency.
+ * h is still equal to HEAP_SIZE. (It is simpler to reconstruct all
+ * lengths instead of fixing only the wrong ones. This idea is taken
+ * from 'ar' written by Haruhiko Okumura.)
+ */
+ for (bits = max_length; bits != 0; bits--) {
+ n = s->bl_count[bits];
+ while (n != 0) {
+ m = s->heap[--h];
+ if (m > max_code) continue;
+ if (tree[m].Len != (unsigned) bits) {
+ Trace((stderr,"code %d bits %d->%d\n", m, tree[m].Len, bits));
+ s->opt_len += ((long)bits - (long)tree[m].Len)
+ *(long)tree[m].Freq;
+ tree[m].Len = (ush)bits;
+ }
+ n--;
+ }
+ }
+}
+
+/* ===========================================================================
+ * Generate the codes for a given tree and bit counts (which need not be
+ * optimal).
+ * IN assertion: the array bl_count contains the bit length statistics for
+ * the given tree and the field len is set for all tree elements.
+ * OUT assertion: the field code is set for all tree elements of non
+ * zero code length.
+ */
+local void gen_codes (tree, max_code, bl_count)
+ ct_data *tree; /* the tree to decorate */
+ int max_code; /* largest code with non zero frequency */
+ ushf *bl_count; /* number of codes at each bit length */
+{
+ ush next_code[MAX_BITS+1]; /* next code value for each bit length */
+ ush code = 0; /* running code value */
+ int bits; /* bit index */
+ int n; /* code index */
+
+ /* The distribution counts are first used to generate the code values
+ * without bit reversal.
+ */
+ for (bits = 1; bits <= MAX_BITS; bits++) {
+ next_code[bits] = code = (code + bl_count[bits-1]) << 1;
+ }
+ /* Check that the bit counts in bl_count are consistent. The last code
+ * must be all ones.
+ */
+ Assert (code + bl_count[MAX_BITS]-1 == (1<<MAX_BITS)-1,
+ "inconsistent bit counts");
+ Tracev((stderr,"\ngen_codes: max_code %d ", max_code));
+
+ for (n = 0; n <= max_code; n++) {
+ int len = tree[n].Len;
+ if (len == 0) continue;
+ /* Now reverse the bits */
+ tree[n].Code = bi_reverse(next_code[len]++, len);
+
+ Tracecv(tree != static_ltree, (stderr,"\nn %3d %c l %2d c %4x (%x) ",
+ n, (isgraph(n) ? n : ' '), len, tree[n].Code, next_code[len]-1));
+ }
+}
+
+/* ===========================================================================
+ * Construct one Huffman tree and assigns the code bit strings and lengths.
+ * Update the total bit length for the current block.
+ * IN assertion: the field freq is set for all tree elements.
+ * OUT assertions: the fields len and code are set to the optimal bit length
+ * and corresponding code. The length opt_len is updated; static_len is
+ * also updated if stree is not null. The field max_code is set.
+ */
+local void build_tree(s, desc)
+ deflate_state *s;
+ tree_desc *desc; /* the tree descriptor */
+{
+ ct_data *tree = desc->dyn_tree;
+ const ct_data *stree = desc->stat_desc->static_tree;
+ int elems = desc->stat_desc->elems;
+ int n, m; /* iterate over heap elements */
+ int max_code = -1; /* largest code with non zero frequency */
+ int node; /* new node being created */
+
+ /* Construct the initial heap, with least frequent element in
+ * heap[SMALLEST]. The sons of heap[n] are heap[2*n] and heap[2*n+1].
+ * heap[0] is not used.
+ */
+ s->heap_len = 0, s->heap_max = HEAP_SIZE;
+
+ for (n = 0; n < elems; n++) {
+ if (tree[n].Freq != 0) {
+ s->heap[++(s->heap_len)] = max_code = n;
+ s->depth[n] = 0;
+ } else {
+ tree[n].Len = 0;
+ }
+ }
+
+ /* The pkzip format requires that at least one distance code exists,
+ * and that at least one bit should be sent even if there is only one
+ * possible code. So to avoid special checks later on we force at least
+ * two codes of non zero frequency.
+ */
+ while (s->heap_len < 2) {
+ node = s->heap[++(s->heap_len)] = (max_code < 2 ? ++max_code : 0);
+ tree[node].Freq = 1;
+ s->depth[node] = 0;
+ s->opt_len--; if (stree) s->static_len -= stree[node].Len;
+ /* node is 0 or 1 so it does not have extra bits */
+ }
+ desc->max_code = max_code;
+
+ /* The elements heap[heap_len/2+1 .. heap_len] are leaves of the tree,
+ * establish sub-heaps of increasing lengths:
+ */
+ for (n = s->heap_len/2; n >= 1; n--) pqdownheap(s, tree, n);
+
+ /* Construct the Huffman tree by repeatedly combining the least two
+ * frequent nodes.
+ */
+ node = elems; /* next internal node of the tree */
+ do {
+ pqremove(s, tree, n); /* n = node of least frequency */
+ m = s->heap[SMALLEST]; /* m = node of next least frequency */
+
+ s->heap[--(s->heap_max)] = n; /* keep the nodes sorted by frequency */
+ s->heap[--(s->heap_max)] = m;
+
+ /* Create a new node father of n and m */
+ tree[node].Freq = tree[n].Freq + tree[m].Freq;
+ s->depth[node] = (uch) (MAX(s->depth[n], s->depth[m]) + 1);
+ tree[n].Dad = tree[m].Dad = (ush)node;
+#ifdef DUMP_BL_TREE
+ if (tree == s->bl_tree) {
+ fprintf(stderr,"\nnode %d(%d), sons %d(%d) %d(%d)",
+ node, tree[node].Freq, n, tree[n].Freq, m, tree[m].Freq);
+ }
+#endif
+ /* and insert the new node in the heap */
+ s->heap[SMALLEST] = node++;
+ pqdownheap(s, tree, SMALLEST);
+
+ } while (s->heap_len >= 2);
+
+ s->heap[--(s->heap_max)] = s->heap[SMALLEST];
+
+ /* At this point, the fields freq and dad are set. We can now
+ * generate the bit lengths.
+ */
+ gen_bitlen(s, (tree_desc *)desc);
+
+ /* The field len is now set, we can generate the bit codes */
+ gen_codes ((ct_data *)tree, max_code, s->bl_count);
+}
+
+/* ===========================================================================
+ * Scan a literal or distance tree to determine the frequencies of the codes
+ * in the bit length tree.
+ */
+local void scan_tree (s, tree, max_code)
+ deflate_state *s;
+ ct_data *tree; /* the tree to be scanned */
+ int max_code; /* and its largest code of non zero frequency */
+{
+ int n; /* iterates over all tree elements */
+ int prevlen = -1; /* last emitted length */
+ int curlen; /* length of current code */
+ int nextlen = tree[0].Len; /* length of next code */
+ int count = 0; /* repeat count of the current code */
+ int max_count = 7; /* max repeat count */
+ int min_count = 4; /* min repeat count */
+
+ if (nextlen == 0) max_count = 138, min_count = 3;
+ tree[max_code+1].Len = (ush)0xffff; /* guard */
+
+ for (n = 0; n <= max_code; n++) {
+ curlen = nextlen; nextlen = tree[n+1].Len;
+ if (++count < max_count && curlen == nextlen) {
+ continue;
+ } else if (count < min_count) {
+ s->bl_tree[curlen].Freq += count;
+ } else if (curlen != 0) {
+ if (curlen != prevlen) s->bl_tree[curlen].Freq++;
+ s->bl_tree[REP_3_6].Freq++;
+ } else if (count <= 10) {
+ s->bl_tree[REPZ_3_10].Freq++;
+ } else {
+ s->bl_tree[REPZ_11_138].Freq++;
+ }
+ count = 0; prevlen = curlen;
+ if (nextlen == 0) {
+ max_count = 138, min_count = 3;
+ } else if (curlen == nextlen) {
+ max_count = 6, min_count = 3;
+ } else {
+ max_count = 7, min_count = 4;
+ }
+ }
+}
+
+/* ===========================================================================
+ * Send a literal or distance tree in compressed form, using the codes in
+ * bl_tree.
+ */
+local void send_tree (s, tree, max_code)
+ deflate_state *s;
+ ct_data *tree; /* the tree to be scanned */
+ int max_code; /* and its largest code of non zero frequency */
+{
+ int n; /* iterates over all tree elements */
+ int prevlen = -1; /* last emitted length */
+ int curlen; /* length of current code */
+ int nextlen = tree[0].Len; /* length of next code */
+ int count = 0; /* repeat count of the current code */
+ int max_count = 7; /* max repeat count */
+ int min_count = 4; /* min repeat count */
+
+ /* tree[max_code+1].Len = -1; */ /* guard already set */
+ if (nextlen == 0) max_count = 138, min_count = 3;
+
+ for (n = 0; n <= max_code; n++) {
+ curlen = nextlen; nextlen = tree[n+1].Len;
+ if (++count < max_count && curlen == nextlen) {
+ continue;
+ } else if (count < min_count) {
+ do { send_code(s, curlen, s->bl_tree); } while (--count != 0);
+
+ } else if (curlen != 0) {
+ if (curlen != prevlen) {
+ send_code(s, curlen, s->bl_tree); count--;
+ }
+ Assert(count >= 3 && count <= 6, " 3_6?");
+ send_code(s, REP_3_6, s->bl_tree); send_bits(s, count-3, 2);
+
+ } else if (count <= 10) {
+ send_code(s, REPZ_3_10, s->bl_tree); send_bits(s, count-3, 3);
+
+ } else {
+ send_code(s, REPZ_11_138, s->bl_tree); send_bits(s, count-11, 7);
+ }
+ count = 0; prevlen = curlen;
+ if (nextlen == 0) {
+ max_count = 138, min_count = 3;
+ } else if (curlen == nextlen) {
+ max_count = 6, min_count = 3;
+ } else {
+ max_count = 7, min_count = 4;
+ }
+ }
+}
+
+/* ===========================================================================
+ * Construct the Huffman tree for the bit lengths and return the index in
+ * bl_order of the last bit length code to send.
+ */
+local int build_bl_tree(s)
+ deflate_state *s;
+{
+ int max_blindex; /* index of last bit length code of non zero freq */
+
+ /* Determine the bit length frequencies for literal and distance trees */
+ scan_tree(s, (ct_data *)s->dyn_ltree, s->l_desc.max_code);
+ scan_tree(s, (ct_data *)s->dyn_dtree, s->d_desc.max_code);
+
+ /* Build the bit length tree: */
+ build_tree(s, (tree_desc *)(&(s->bl_desc)));
+ /* opt_len now includes the length of the tree representations, except
+ * the lengths of the bit lengths codes and the 5+5+4 bits for the counts.
+ */
+
+ /* Determine the number of bit length codes to send. The pkzip format
+ * requires that at least 4 bit length codes be sent. (appnote.txt says
+ * 3 but the actual value used is 4.)
+ */
+ for (max_blindex = BL_CODES-1; max_blindex >= 3; max_blindex--) {
+ if (s->bl_tree[bl_order[max_blindex]].Len != 0) break;
+ }
+ /* Update opt_len to include the bit length tree and counts */
+ s->opt_len += 3*(max_blindex+1) + 5+5+4;
+ Tracev((stderr, "\ndyn trees: dyn %ld, stat %ld",
+ s->opt_len, s->static_len));
+
+ return max_blindex;
+}
+
+/* ===========================================================================
+ * Send the header for a block using dynamic Huffman trees: the counts, the
+ * lengths of the bit length codes, the literal tree and the distance tree.
+ * IN assertion: lcodes >= 257, dcodes >= 1, blcodes >= 4.
+ */
+local void send_all_trees(s, lcodes, dcodes, blcodes)
+ deflate_state *s;
+ int lcodes, dcodes, blcodes; /* number of codes for each tree */
+{
+ int rank; /* index in bl_order */
+
+ Assert (lcodes >= 257 && dcodes >= 1 && blcodes >= 4, "not enough codes");
+ Assert (lcodes <= L_CODES && dcodes <= D_CODES && blcodes <= BL_CODES,
+ "too many codes");
+ Tracev((stderr, "\nbl counts: "));
+ send_bits(s, lcodes-257, 5); /* not +255 as stated in appnote.txt */
+ send_bits(s, dcodes-1, 5);
+ send_bits(s, blcodes-4, 4); /* not -3 as stated in appnote.txt */
+ for (rank = 0; rank < blcodes; rank++) {
+ Tracev((stderr, "\nbl code %2d ", bl_order[rank]));
+ send_bits(s, s->bl_tree[bl_order[rank]].Len, 3);
+ }
+ Tracev((stderr, "\nbl tree: sent %ld", s->bits_sent));
+
+ send_tree(s, (ct_data *)s->dyn_ltree, lcodes-1); /* literal tree */
+ Tracev((stderr, "\nlit tree: sent %ld", s->bits_sent));
+
+ send_tree(s, (ct_data *)s->dyn_dtree, dcodes-1); /* distance tree */
+ Tracev((stderr, "\ndist tree: sent %ld", s->bits_sent));
+}
+
+/* ===========================================================================
+ * Send a stored block
+ */
+void _tr_stored_block(s, buf, stored_len, eof)
+ deflate_state *s;
+ charf *buf; /* input block */
+ ulg stored_len; /* length of input block */
+ int eof; /* true if this is the last block for a file */
+{
+ send_bits(s, (STORED_BLOCK<<1)+eof, 3); /* send block type */
+#ifdef DEBUG
+ s->compressed_len = (s->compressed_len + 3 + 7) & (ulg)~7L;
+ s->compressed_len += (stored_len + 4) << 3;
+#endif
+ copy_block(s, buf, (unsigned)stored_len, 1); /* with header */
+}
+
+/* ===========================================================================
+ * Send one empty static block to give enough lookahead for inflate.
+ * This takes 10 bits, of which 7 may remain in the bit buffer.
+ * The current inflate code requires 9 bits of lookahead. If the
+ * last two codes for the previous block (real code plus EOB) were coded
+ * on 5 bits or less, inflate may have only 5+3 bits of lookahead to decode
+ * the last real code. In this case we send two empty static blocks instead
+ * of one. (There are no problems if the previous block is stored or fixed.)
+ * To simplify the code, we assume the worst case of last real code encoded
+ * on one bit only.
+ */
+void _tr_align(s)
+ deflate_state *s;
+{
+ send_bits(s, STATIC_TREES<<1, 3);
+ send_code(s, END_BLOCK, static_ltree);
+#ifdef DEBUG
+ s->compressed_len += 10L; /* 3 for block type, 7 for EOB */
+#endif
+ bi_flush(s);
+ /* Of the 10 bits for the empty block, we have already sent
+ * (10 - bi_valid) bits. The lookahead for the last real code (before
+ * the EOB of the previous block) was thus at least one plus the length
+ * of the EOB plus what we have just sent of the empty static block.
+ */
+ if (1 + s->last_eob_len + 10 - s->bi_valid < 9) {
+ send_bits(s, STATIC_TREES<<1, 3);
+ send_code(s, END_BLOCK, static_ltree);
+#ifdef DEBUG
+ s->compressed_len += 10L;
+#endif
+ bi_flush(s);
+ }
+ s->last_eob_len = 7;
+}
+
+/* ===========================================================================
+ * Determine the best encoding for the current block: dynamic trees, static
+ * trees or store, and output the encoded block to the zip file.
+ */
+void _tr_flush_block(s, buf, stored_len, eof)
+ deflate_state *s;
+ charf *buf; /* input block, or NULL if too old */
+ ulg stored_len; /* length of input block */
+ int eof; /* true if this is the last block for a file */
+{
+ ulg opt_lenb, static_lenb; /* opt_len and static_len in bytes */
+ int max_blindex = 0; /* index of last bit length code of non zero freq */
+
+ /* Build the Huffman trees unless a stored block is forced */
+ if (s->level > 0) {
+
+ /* Check if the file is ascii or binary */
+ if (s->data_type == Z_UNKNOWN) set_data_type(s);
+
+ /* Construct the literal and distance trees */
+ build_tree(s, (tree_desc *)(&(s->l_desc)));
+ Tracev((stderr, "\nlit data: dyn %ld, stat %ld", s->opt_len,
+ s->static_len));
+
+ build_tree(s, (tree_desc *)(&(s->d_desc)));
+ Tracev((stderr, "\ndist data: dyn %ld, stat %ld", s->opt_len,
+ s->static_len));
+ /* At this point, opt_len and static_len are the total bit lengths of
+ * the compressed block data, excluding the tree representations.
+ */
+
+ /* Build the bit length tree for the above two trees, and get the index
+ * in bl_order of the last bit length code to send.
+ */
+ max_blindex = build_bl_tree(s);
+
+ /* Determine the best encoding. Compute first the block length in bytes*/
+ opt_lenb = (s->opt_len+3+7)>>3;
+ static_lenb = (s->static_len+3+7)>>3;
+
+ Tracev((stderr, "\nopt %lu(%lu) stat %lu(%lu) stored %lu lit %u ",
+ opt_lenb, s->opt_len, static_lenb, s->static_len, stored_len,
+ s->last_lit));
+
+ if (static_lenb <= opt_lenb) opt_lenb = static_lenb;
+
+ } else {
+ Assert(buf != (char*)0, "lost buf");
+ opt_lenb = static_lenb = stored_len + 5; /* force a stored block */
+ }
+
+#ifdef FORCE_STORED
+ if (buf != (char*)0) { /* force stored block */
+#else
+ if (stored_len+4 <= opt_lenb && buf != (char*)0) {
+ /* 4: two words for the lengths */
+#endif
+ /* The test buf != NULL is only necessary if LIT_BUFSIZE > WSIZE.
+ * Otherwise we can't have processed more than WSIZE input bytes since
+ * the last block flush, because compression would have been
+ * successful. If LIT_BUFSIZE <= WSIZE, it is never too late to
+ * transform a block into a stored block.
+ */
+ _tr_stored_block(s, buf, stored_len, eof);
+
+#ifdef FORCE_STATIC
+ } else if (static_lenb >= 0) { /* force static trees */
+#else
+ } else if (static_lenb == opt_lenb) {
+#endif
+ send_bits(s, (STATIC_TREES<<1)+eof, 3);
+ compress_block(s, (ct_data *)static_ltree, (ct_data *)static_dtree);
+#ifdef DEBUG
+ s->compressed_len += 3 + s->static_len;
+#endif
+ } else {
+ send_bits(s, (DYN_TREES<<1)+eof, 3);
+ send_all_trees(s, s->l_desc.max_code+1, s->d_desc.max_code+1,
+ max_blindex+1);
+ compress_block(s, (ct_data *)s->dyn_ltree, (ct_data *)s->dyn_dtree);
+#ifdef DEBUG
+ s->compressed_len += 3 + s->opt_len;
+#endif
+ }
+ Assert (s->compressed_len == s->bits_sent, "bad compressed size");
+ /* The above check is made mod 2^32, for files larger than 512 MB
+ * and uLong implemented on 32 bits.
+ */
+ init_block(s);
+
+ if (eof) {
+ bi_windup(s);
+#ifdef DEBUG
+ s->compressed_len += 7; /* align on byte boundary */
+#endif
+ }
+ Tracev((stderr,"\ncomprlen %lu(%lu) ", s->compressed_len>>3,
+ s->compressed_len-7*eof));
+}
+
+/* ===========================================================================
+ * Save the match info and tally the frequency counts. Return true if
+ * the current block must be flushed.
+ */
+int _tr_tally (s, dist, lc)
+ deflate_state *s;
+ unsigned dist; /* distance of matched string */
+ unsigned lc; /* match length-MIN_MATCH or unmatched char (if dist==0) */
+{
+ s->d_buf[s->last_lit] = (ush)dist;
+ s->l_buf[s->last_lit++] = (uch)lc;
+ if (dist == 0) {
+ /* lc is the unmatched char */
+ s->dyn_ltree[lc].Freq++;
+ } else {
+ s->matches++;
+ /* Here, lc is the match length - MIN_MATCH */
+ dist--; /* dist = match distance - 1 */
+ Assert((ush)dist < (ush)MAX_DIST(s) &&
+ (ush)lc <= (ush)(MAX_MATCH-MIN_MATCH) &&
+ (ush)d_code(dist) < (ush)D_CODES, "_tr_tally: bad match");
+
+ s->dyn_ltree[_length_code[lc]+LITERALS+1].Freq++;
+ s->dyn_dtree[d_code(dist)].Freq++;
+ }
+
+#ifdef TRUNCATE_BLOCK
+ /* Try to guess if it is profitable to stop the current block here */
+ if ((s->last_lit & 0x1fff) == 0 && s->level > 2) {
+ /* Compute an upper bound for the compressed length */
+ ulg out_length = (ulg)s->last_lit*8L;
+ ulg in_length = (ulg)((long)s->strstart - s->block_start);
+ int dcode;
+ for (dcode = 0; dcode < D_CODES; dcode++) {
+ out_length += (ulg)s->dyn_dtree[dcode].Freq *
+ (5L+extra_dbits[dcode]);
+ }
+ out_length >>= 3;
+ Tracev((stderr,"\nlast_lit %u, in %ld, out ~%ld(%ld%%) ",
+ s->last_lit, in_length, out_length,
+ 100L - out_length*100L/in_length));
+ if (s->matches < s->last_lit/2 && out_length < in_length/2) return 1;
+ }
+#endif
+ return (s->last_lit == s->lit_bufsize-1);
+ /* We avoid equality with lit_bufsize because of wraparound at 64K
+ * on 16 bit machines and because stored blocks are restricted to
+ * 64K-1 bytes.
+ */
+}
+
+/* ===========================================================================
+ * Send the block data compressed using the given Huffman trees
+ */
+local void compress_block(s, ltree, dtree)
+ deflate_state *s;
+ ct_data *ltree; /* literal tree */
+ ct_data *dtree; /* distance tree */
+{
+ unsigned dist; /* distance of matched string */
+ int lc; /* match length or unmatched char (if dist == 0) */
+ unsigned lx = 0; /* running index in l_buf */
+ unsigned code; /* the code to send */
+ int extra; /* number of extra bits to send */
+
+ if (s->last_lit != 0) do {
+ dist = s->d_buf[lx];
+ lc = s->l_buf[lx++];
+ if (dist == 0) {
+ send_code(s, lc, ltree); /* send a literal byte */
+ Tracecv(isgraph(lc), (stderr," '%c' ", lc));
+ } else {
+ /* Here, lc is the match length - MIN_MATCH */
+ code = _length_code[lc];
+ send_code(s, code+LITERALS+1, ltree); /* send the length code */
+ extra = extra_lbits[code];
+ if (extra != 0) {
+ lc -= base_length[code];
+ send_bits(s, lc, extra); /* send the extra length bits */
+ }
+ dist--; /* dist is now the match distance - 1 */
+ code = d_code(dist);
+ Assert (code < D_CODES, "bad d_code");
+
+ send_code(s, code, dtree); /* send the distance code */
+ extra = extra_dbits[code];
+ if (extra != 0) {
+ dist -= base_dist[code];
+ send_bits(s, dist, extra); /* send the extra distance bits */
+ }
+ } /* literal or match pair ? */
+
+ /* Check that the overlay between pending_buf and d_buf+l_buf is ok: */
+ Assert(s->pending < s->lit_bufsize + 2*lx, "pendingBuf overflow");
+
+ } while (lx < s->last_lit);
+
+ send_code(s, END_BLOCK, ltree);
+ s->last_eob_len = ltree[END_BLOCK].Len;
+}
+
+/* ===========================================================================
+ * Set the data type to ASCII or BINARY, using a crude approximation:
+ * binary if more than 20% of the bytes are <= 6 or >= 128, ascii otherwise.
+ * IN assertion: the fields freq of dyn_ltree are set and the total of all
+ * frequencies does not exceed 64K (to fit in an int on 16 bit machines).
+ */
+local void set_data_type(s)
+ deflate_state *s;
+{
+ int n = 0;
+ unsigned ascii_freq = 0;
+ unsigned bin_freq = 0;
+ while (n < 7) bin_freq += s->dyn_ltree[n++].Freq;
+ while (n < 128) ascii_freq += s->dyn_ltree[n++].Freq;
+ while (n < LITERALS) bin_freq += s->dyn_ltree[n++].Freq;
+ s->data_type = (Byte)(bin_freq > (ascii_freq >> 2) ? Z_BINARY : Z_ASCII);
+}
+
+/* ===========================================================================
+ * Reverse the first len bits of a code, using straightforward code (a faster
+ * method would use a table)
+ * IN assertion: 1 <= len <= 15
+ */
+local unsigned bi_reverse(code, len)
+ unsigned code; /* the value to invert */
+ int len; /* its bit length */
+{
+ register unsigned res = 0;
+ do {
+ res |= code & 1;
+ code >>= 1, res <<= 1;
+ } while (--len > 0);
+ return res >> 1;
+}
+
+/* ===========================================================================
+ * Flush the bit buffer, keeping at most 7 bits in it.
+ */
+local void bi_flush(s)
+ deflate_state *s;
+{
+ if (s->bi_valid == 16) {
+ put_short(s, s->bi_buf);
+ s->bi_buf = 0;
+ s->bi_valid = 0;
+ } else if (s->bi_valid >= 8) {
+ put_byte(s, (Byte)s->bi_buf);
+ s->bi_buf >>= 8;
+ s->bi_valid -= 8;
+ }
+}
+
+/* ===========================================================================
+ * Flush the bit buffer and align the output on a byte boundary
+ */
+local void bi_windup(s)
+ deflate_state *s;
+{
+ if (s->bi_valid > 8) {
+ put_short(s, s->bi_buf);
+ } else if (s->bi_valid > 0) {
+ put_byte(s, (Byte)s->bi_buf);
+ }
+ s->bi_buf = 0;
+ s->bi_valid = 0;
+#ifdef DEBUG
+ s->bits_sent = (s->bits_sent+7) & ~7;
+#endif
+}
+
+/* ===========================================================================
+ * Copy a stored block, storing first the length and its
+ * one's complement if requested.
+ */
+local void copy_block(s, buf, len, header)
+ deflate_state *s;
+ charf *buf; /* the input data */
+ unsigned len; /* its length */
+ int header; /* true if block header must be written */
+{
+ bi_windup(s); /* align on byte boundary */
+ s->last_eob_len = 8; /* enough lookahead for inflate */
+
+ if (header) {
+ put_short(s, (ush)len);
+ put_short(s, (ush)~len);
+#ifdef DEBUG
+ s->bits_sent += 2*16;
+#endif
+ }
+#ifdef DEBUG
+ s->bits_sent += (ulg)len<<3;
+#endif
+ while (len--) {
+ put_byte(s, *buf++);
+ }
+}
--- /dev/null
+/* header created automatically with -DGEN_TREES_H */
+
+local const ct_data static_ltree[L_CODES+2] = {
+{{ 12},{ 8}}, {{140},{ 8}}, {{ 76},{ 8}}, {{204},{ 8}}, {{ 44},{ 8}},
+{{172},{ 8}}, {{108},{ 8}}, {{236},{ 8}}, {{ 28},{ 8}}, {{156},{ 8}},
+{{ 92},{ 8}}, {{220},{ 8}}, {{ 60},{ 8}}, {{188},{ 8}}, {{124},{ 8}},
+{{252},{ 8}}, {{ 2},{ 8}}, {{130},{ 8}}, {{ 66},{ 8}}, {{194},{ 8}},
+{{ 34},{ 8}}, {{162},{ 8}}, {{ 98},{ 8}}, {{226},{ 8}}, {{ 18},{ 8}},
+{{146},{ 8}}, {{ 82},{ 8}}, {{210},{ 8}}, {{ 50},{ 8}}, {{178},{ 8}},
+{{114},{ 8}}, {{242},{ 8}}, {{ 10},{ 8}}, {{138},{ 8}}, {{ 74},{ 8}},
+{{202},{ 8}}, {{ 42},{ 8}}, {{170},{ 8}}, {{106},{ 8}}, {{234},{ 8}},
+{{ 26},{ 8}}, {{154},{ 8}}, {{ 90},{ 8}}, {{218},{ 8}}, {{ 58},{ 8}},
+{{186},{ 8}}, {{122},{ 8}}, {{250},{ 8}}, {{ 6},{ 8}}, {{134},{ 8}},
+{{ 70},{ 8}}, {{198},{ 8}}, {{ 38},{ 8}}, {{166},{ 8}}, {{102},{ 8}},
+{{230},{ 8}}, {{ 22},{ 8}}, {{150},{ 8}}, {{ 86},{ 8}}, {{214},{ 8}},
+{{ 54},{ 8}}, {{182},{ 8}}, {{118},{ 8}}, {{246},{ 8}}, {{ 14},{ 8}},
+{{142},{ 8}}, {{ 78},{ 8}}, {{206},{ 8}}, {{ 46},{ 8}}, {{174},{ 8}},
+{{110},{ 8}}, {{238},{ 8}}, {{ 30},{ 8}}, {{158},{ 8}}, {{ 94},{ 8}},
+{{222},{ 8}}, {{ 62},{ 8}}, {{190},{ 8}}, {{126},{ 8}}, {{254},{ 8}},
+{{ 1},{ 8}}, {{129},{ 8}}, {{ 65},{ 8}}, {{193},{ 8}}, {{ 33},{ 8}},
+{{161},{ 8}}, {{ 97},{ 8}}, {{225},{ 8}}, {{ 17},{ 8}}, {{145},{ 8}},
+{{ 81},{ 8}}, {{209},{ 8}}, {{ 49},{ 8}}, {{177},{ 8}}, {{113},{ 8}},
+{{241},{ 8}}, {{ 9},{ 8}}, {{137},{ 8}}, {{ 73},{ 8}}, {{201},{ 8}},
+{{ 41},{ 8}}, {{169},{ 8}}, {{105},{ 8}}, {{233},{ 8}}, {{ 25},{ 8}},
+{{153},{ 8}}, {{ 89},{ 8}}, {{217},{ 8}}, {{ 57},{ 8}}, {{185},{ 8}},
+{{121},{ 8}}, {{249},{ 8}}, {{ 5},{ 8}}, {{133},{ 8}}, {{ 69},{ 8}},
+{{197},{ 8}}, {{ 37},{ 8}}, {{165},{ 8}}, {{101},{ 8}}, {{229},{ 8}},
+{{ 21},{ 8}}, {{149},{ 8}}, {{ 85},{ 8}}, {{213},{ 8}}, {{ 53},{ 8}},
+{{181},{ 8}}, {{117},{ 8}}, {{245},{ 8}}, {{ 13},{ 8}}, {{141},{ 8}},
+{{ 77},{ 8}}, {{205},{ 8}}, {{ 45},{ 8}}, {{173},{ 8}}, {{109},{ 8}},
+{{237},{ 8}}, {{ 29},{ 8}}, {{157},{ 8}}, {{ 93},{ 8}}, {{221},{ 8}},
+{{ 61},{ 8}}, {{189},{ 8}}, {{125},{ 8}}, {{253},{ 8}}, {{ 19},{ 9}},
+{{275},{ 9}}, {{147},{ 9}}, {{403},{ 9}}, {{ 83},{ 9}}, {{339},{ 9}},
+{{211},{ 9}}, {{467},{ 9}}, {{ 51},{ 9}}, {{307},{ 9}}, {{179},{ 9}},
+{{435},{ 9}}, {{115},{ 9}}, {{371},{ 9}}, {{243},{ 9}}, {{499},{ 9}},
+{{ 11},{ 9}}, {{267},{ 9}}, {{139},{ 9}}, {{395},{ 9}}, {{ 75},{ 9}},
+{{331},{ 9}}, {{203},{ 9}}, {{459},{ 9}}, {{ 43},{ 9}}, {{299},{ 9}},
+{{171},{ 9}}, {{427},{ 9}}, {{107},{ 9}}, {{363},{ 9}}, {{235},{ 9}},
+{{491},{ 9}}, {{ 27},{ 9}}, {{283},{ 9}}, {{155},{ 9}}, {{411},{ 9}},
+{{ 91},{ 9}}, {{347},{ 9}}, {{219},{ 9}}, {{475},{ 9}}, {{ 59},{ 9}},
+{{315},{ 9}}, {{187},{ 9}}, {{443},{ 9}}, {{123},{ 9}}, {{379},{ 9}},
+{{251},{ 9}}, {{507},{ 9}}, {{ 7},{ 9}}, {{263},{ 9}}, {{135},{ 9}},
+{{391},{ 9}}, {{ 71},{ 9}}, {{327},{ 9}}, {{199},{ 9}}, {{455},{ 9}},
+{{ 39},{ 9}}, {{295},{ 9}}, {{167},{ 9}}, {{423},{ 9}}, {{103},{ 9}},
+{{359},{ 9}}, {{231},{ 9}}, {{487},{ 9}}, {{ 23},{ 9}}, {{279},{ 9}},
+{{151},{ 9}}, {{407},{ 9}}, {{ 87},{ 9}}, {{343},{ 9}}, {{215},{ 9}},
+{{471},{ 9}}, {{ 55},{ 9}}, {{311},{ 9}}, {{183},{ 9}}, {{439},{ 9}},
+{{119},{ 9}}, {{375},{ 9}}, {{247},{ 9}}, {{503},{ 9}}, {{ 15},{ 9}},
+{{271},{ 9}}, {{143},{ 9}}, {{399},{ 9}}, {{ 79},{ 9}}, {{335},{ 9}},
+{{207},{ 9}}, {{463},{ 9}}, {{ 47},{ 9}}, {{303},{ 9}}, {{175},{ 9}},
+{{431},{ 9}}, {{111},{ 9}}, {{367},{ 9}}, {{239},{ 9}}, {{495},{ 9}},
+{{ 31},{ 9}}, {{287},{ 9}}, {{159},{ 9}}, {{415},{ 9}}, {{ 95},{ 9}},
+{{351},{ 9}}, {{223},{ 9}}, {{479},{ 9}}, {{ 63},{ 9}}, {{319},{ 9}},
+{{191},{ 9}}, {{447},{ 9}}, {{127},{ 9}}, {{383},{ 9}}, {{255},{ 9}},
+{{511},{ 9}}, {{ 0},{ 7}}, {{ 64},{ 7}}, {{ 32},{ 7}}, {{ 96},{ 7}},
+{{ 16},{ 7}}, {{ 80},{ 7}}, {{ 48},{ 7}}, {{112},{ 7}}, {{ 8},{ 7}},
+{{ 72},{ 7}}, {{ 40},{ 7}}, {{104},{ 7}}, {{ 24},{ 7}}, {{ 88},{ 7}},
+{{ 56},{ 7}}, {{120},{ 7}}, {{ 4},{ 7}}, {{ 68},{ 7}}, {{ 36},{ 7}},
+{{100},{ 7}}, {{ 20},{ 7}}, {{ 84},{ 7}}, {{ 52},{ 7}}, {{116},{ 7}},
+{{ 3},{ 8}}, {{131},{ 8}}, {{ 67},{ 8}}, {{195},{ 8}}, {{ 35},{ 8}},
+{{163},{ 8}}, {{ 99},{ 8}}, {{227},{ 8}}
+};
+
+local const ct_data static_dtree[D_CODES] = {
+{{ 0},{ 5}}, {{16},{ 5}}, {{ 8},{ 5}}, {{24},{ 5}}, {{ 4},{ 5}},
+{{20},{ 5}}, {{12},{ 5}}, {{28},{ 5}}, {{ 2},{ 5}}, {{18},{ 5}},
+{{10},{ 5}}, {{26},{ 5}}, {{ 6},{ 5}}, {{22},{ 5}}, {{14},{ 5}},
+{{30},{ 5}}, {{ 1},{ 5}}, {{17},{ 5}}, {{ 9},{ 5}}, {{25},{ 5}},
+{{ 5},{ 5}}, {{21},{ 5}}, {{13},{ 5}}, {{29},{ 5}}, {{ 3},{ 5}},
+{{19},{ 5}}, {{11},{ 5}}, {{27},{ 5}}, {{ 7},{ 5}}, {{23},{ 5}}
+};
+
+const uch _dist_code[DIST_CODE_LEN] = {
+ 0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8,
+ 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 10, 10, 10,
+10, 10, 10, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11,
+11, 11, 11, 11, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12,
+12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 13, 13, 13, 13,
+13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13,
+13, 13, 13, 13, 13, 13, 13, 13, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14,
+14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14,
+14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14,
+14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 15, 15, 15, 15, 15, 15, 15, 15,
+15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15,
+15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15,
+15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 0, 0, 16, 17,
+18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22,
+23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
+24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25,
+26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
+26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27,
+27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27,
+27, 27, 27, 27, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28,
+28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28,
+28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28,
+28, 28, 28, 28, 28, 28, 28, 28, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29,
+29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29,
+29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29,
+29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29
+};
+
+const uch _length_code[MAX_MATCH-MIN_MATCH+1]= {
+ 0, 1, 2, 3, 4, 5, 6, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 12, 12,
+13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, 16, 16, 16, 16, 16, 16,
+17, 17, 17, 17, 17, 17, 17, 17, 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, 19, 19,
+19, 19, 19, 19, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20,
+21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 22, 22, 22, 22,
+22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23,
+23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
+24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
+25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25,
+25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26,
+26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
+26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27,
+27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28
+};
+
+local const int base_length[LENGTH_CODES] = {
+0, 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 20, 24, 28, 32, 40, 48, 56,
+64, 80, 96, 112, 128, 160, 192, 224, 0
+};
+
+local const int base_dist[D_CODES] = {
+ 0, 1, 2, 3, 4, 6, 8, 12, 16, 24,
+ 32, 48, 64, 96, 128, 192, 256, 384, 512, 768,
+ 1024, 1536, 2048, 3072, 4096, 6144, 8192, 12288, 16384, 24576
+};
+
--- /dev/null
+/* uncompr.c -- decompress a memory buffer
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include "zlib.h"
+
+/* ===========================================================================
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total
+ size of the destination buffer, which must be large enough to hold the
+ entire uncompressed data. (The size of the uncompressed data must have
+ been saved previously by the compressor and transmitted to the decompressor
+ by some mechanism outside the scope of this compression library.)
+ Upon exit, destLen is the actual size of the compressed buffer.
+ This function can be used to decompress a whole file at once if the
+ input file is mmap'ed.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted.
+*/
+int ZEXPORT uncompress (dest, destLen, source, sourceLen)
+ Bytef *dest;
+ uLongf *destLen;
+ const Bytef *source;
+ uLong sourceLen;
+{
+ z_stream stream;
+ int err;
+
+ stream.next_in = (Bytef*)source;
+ stream.avail_in = (uInt)sourceLen;
+ /* Check for source > 64K on 16-bit machine: */
+ if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR;
+
+ stream.next_out = dest;
+ stream.avail_out = (uInt)*destLen;
+ if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR;
+
+ stream.zalloc = (alloc_func)0;
+ stream.zfree = (free_func)0;
+
+ err = inflateInit(&stream);
+ if (err != Z_OK) return err;
+
+ err = inflate(&stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ inflateEnd(&stream);
+ return err == Z_OK ? Z_BUF_ERROR : err;
+ }
+ *destLen = stream.total_out;
+
+ err = inflateEnd(&stream);
+ return err;
+}
--- /dev/null
+/* zconf.h -- configuration of the zlib compression library
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#ifndef _ZCONF_H
+#define _ZCONF_H
+
+/*
+ * If you *really* need a unique prefix for all types and library functions,
+ * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it.
+ */
+#ifdef Z_PREFIX
+# define deflateInit_ z_deflateInit_
+# define deflate z_deflate
+# define deflateEnd z_deflateEnd
+# define inflateInit_ z_inflateInit_
+# define inflate z_inflate
+# define inflateEnd z_inflateEnd
+# define deflateInit2_ z_deflateInit2_
+# define deflateSetDictionary z_deflateSetDictionary
+# define deflateCopy z_deflateCopy
+# define deflateReset z_deflateReset
+# define deflateParams z_deflateParams
+# define inflateInit2_ z_inflateInit2_
+# define inflateSetDictionary z_inflateSetDictionary
+# define inflateSync z_inflateSync
+# define inflateSyncPoint z_inflateSyncPoint
+# define inflateReset z_inflateReset
+# define compress z_compress
+# define compress2 z_compress2
+# define uncompress z_uncompress
+# define adler32 z_adler32
+# define crc32 z_crc32
+# define get_crc_table z_get_crc_table
+
+# define Byte z_Byte
+# define uInt z_uInt
+# define uLong z_uLong
+# define Bytef z_Bytef
+# define charf z_charf
+# define intf z_intf
+# define uIntf z_uIntf
+# define uLongf z_uLongf
+# define voidpf z_voidpf
+# define voidp z_voidp
+#endif
+
+#if (defined(_WIN32) || defined(__WIN32__)) && !defined(WIN32)
+# define WIN32
+#endif
+#if defined(__GNUC__) || defined(WIN32) || defined(__386__) || defined(i386)
+# ifndef __32BIT__
+# define __32BIT__
+# endif
+#endif
+#if defined(__MSDOS__) && !defined(MSDOS)
+# define MSDOS
+#endif
+
+/*
+ * Compile with -DMAXSEG_64K if the alloc function cannot allocate more
+ * than 64k bytes at a time (needed on systems with 16-bit int).
+ */
+#if defined(MSDOS) && !defined(__32BIT__)
+# define MAXSEG_64K
+#endif
+#ifdef MSDOS
+# define UNALIGNED_OK
+#endif
+
+#if (defined(MSDOS) || defined(_WINDOWS) || defined(WIN32)) && !defined(STDC)
+# define STDC
+#endif
+#if defined(__STDC__) || defined(__cplusplus) || defined(__OS2__)
+# ifndef STDC
+# define STDC
+# endif
+#endif
+
+#ifndef STDC
+# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */
+# define const
+# endif
+#endif
+
+/* Some Mac compilers merge all .h files incorrectly: */
+#if defined(__MWERKS__) || defined(applec) ||defined(THINK_C) ||defined(__SC__)
+# define NO_DUMMY_DECL
+#endif
+
+/* Old Borland C incorrectly complains about missing returns: */
+#if defined(__BORLANDC__) && (__BORLANDC__ < 0x500)
+# define NEED_DUMMY_RETURN
+#endif
+
+
+/* Maximum value for memLevel in deflateInit2 */
+#ifndef MAX_MEM_LEVEL
+# ifdef MAXSEG_64K
+# define MAX_MEM_LEVEL 8
+# else
+# define MAX_MEM_LEVEL 9
+# endif
+#endif
+
+/* Maximum value for windowBits in deflateInit2 and inflateInit2.
+ * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files
+ * created by gzip. (Files created by minigzip can still be extracted by
+ * gzip.)
+ */
+#ifndef MAX_WBITS
+# define MAX_WBITS 15 /* 32K LZ77 window */
+#endif
+
+/* The memory requirements for deflate are (in bytes):
+ (1 << (windowBits+2)) + (1 << (memLevel+9))
+ that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values)
+ plus a few kilobytes for small objects. For example, if you want to reduce
+ the default memory requirements from 256K to 128K, compile with
+ make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7"
+ Of course this will generally degrade compression (there's no free lunch).
+
+ The memory requirements for inflate are (in bytes) 1 << windowBits
+ that is, 32K for windowBits=15 (default value) plus a few kilobytes
+ for small objects.
+*/
+
+ /* Type declarations */
+
+#ifndef OF /* function prototypes */
+# ifdef STDC
+# define OF(args) args
+# else
+# define OF(args) ()
+# endif
+#endif
+
+/* The following definitions for FAR are needed only for MSDOS mixed
+ * model programming (small or medium model with some far allocations).
+ * This was tested only with MSC; for other MSDOS compilers you may have
+ * to define NO_MEMCPY in zutil.h. If you don't need the mixed model,
+ * just define FAR to be empty.
+ */
+#if (defined(M_I86SM) || defined(M_I86MM)) && !defined(__32BIT__)
+ /* MSC small or medium model */
+# define SMALL_MEDIUM
+# ifdef _MSC_VER
+# define FAR _far
+# else
+# define FAR far
+# endif
+#endif
+#if defined(__BORLANDC__) && (defined(__SMALL__) || defined(__MEDIUM__))
+# ifndef __32BIT__
+# define SMALL_MEDIUM
+# define FAR _far
+# endif
+#endif
+
+/* Compile with -DZLIB_DLL for Windows DLL support */
+#if defined(ZLIB_DLL)
+# if defined(_WINDOWS) || defined(WINDOWS)
+# ifdef FAR
+# undef FAR
+# endif
+# include <windows.h>
+# define ZEXPORT WINAPI
+# ifdef WIN32
+# define ZEXPORTVA WINAPIV
+# else
+# define ZEXPORTVA FAR _cdecl _export
+# endif
+# endif
+# if defined (__BORLANDC__)
+# if (__BORLANDC__ >= 0x0500) && defined (WIN32)
+# include <windows.h>
+# define ZEXPORT __declspec(dllexport) WINAPI
+# define ZEXPORTRVA __declspec(dllexport) WINAPIV
+# else
+# if defined (_Windows) && defined (__DLL__)
+# define ZEXPORT _export
+# define ZEXPORTVA _export
+# endif
+# endif
+# endif
+#endif
+
+#if defined (__BEOS__)
+# if defined (ZLIB_DLL)
+# define ZEXTERN extern __declspec(dllexport)
+# else
+# define ZEXTERN extern __declspec(dllimport)
+# endif
+#endif
+
+#ifndef ZEXPORT
+# define ZEXPORT
+#endif
+#ifndef ZEXPORTVA
+# define ZEXPORTVA
+#endif
+#ifndef ZEXTERN
+# define ZEXTERN extern
+#endif
+
+#ifndef FAR
+# define FAR
+#endif
+
+#if !defined(MACOS) && !defined(TARGET_OS_MAC)
+typedef unsigned char Byte; /* 8 bits */
+#endif
+typedef unsigned int uInt; /* 16 bits or more */
+typedef unsigned long uLong; /* 32 bits or more */
+
+#ifdef SMALL_MEDIUM
+ /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */
+# define Bytef Byte FAR
+#else
+ typedef Byte FAR Bytef;
+#endif
+typedef char FAR charf;
+typedef int FAR intf;
+typedef uInt FAR uIntf;
+typedef uLong FAR uLongf;
+
+#ifdef STDC
+ typedef void FAR *voidpf;
+ typedef void *voidp;
+#else
+ typedef Byte FAR *voidpf;
+ typedef Byte *voidp;
+#endif
+
+#ifdef HAVE_UNISTD_H
+# include <sys/types.h> /* for off_t */
+# include <unistd.h> /* for SEEK_* and off_t */
+# define z_off_t off_t
+#endif
+#ifndef SEEK_SET
+# define SEEK_SET 0 /* Seek from beginning of file. */
+# define SEEK_CUR 1 /* Seek from current position. */
+# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */
+#endif
+#ifndef z_off_t
+# define z_off_t long
+#endif
+
+/* MVS linker does not support external names larger than 8 bytes */
+#if defined(__MVS__)
+# pragma map(deflateInit_,"DEIN")
+# pragma map(deflateInit2_,"DEIN2")
+# pragma map(deflateEnd,"DEEND")
+# pragma map(inflateInit_,"ININ")
+# pragma map(inflateInit2_,"ININ2")
+# pragma map(inflateEnd,"INEND")
+# pragma map(inflateSync,"INSY")
+# pragma map(inflateSetDictionary,"INSEDI")
+# pragma map(inflate_blocks,"INBL")
+# pragma map(inflate_blocks_new,"INBLNE")
+# pragma map(inflate_blocks_free,"INBLFR")
+# pragma map(inflate_blocks_reset,"INBLRE")
+# pragma map(inflate_codes_free,"INCOFR")
+# pragma map(inflate_codes,"INCO")
+# pragma map(inflate_fast,"INFA")
+# pragma map(inflate_flush,"INFLU")
+# pragma map(inflate_mask,"INMA")
+# pragma map(inflate_set_dictionary,"INSEDI2")
+# pragma map(inflate_copyright,"INCOPY")
+# pragma map(inflate_trees_bits,"INTRBI")
+# pragma map(inflate_trees_dynamic,"INTRDY")
+# pragma map(inflate_trees_fixed,"INTRFI")
+# pragma map(inflate_trees_free,"INTRFR")
+#endif
+
+#endif /* _ZCONF_H */
--- /dev/null
+.TH ZLIB 3 "9 July 1998"
+.SH NAME
+zlib \- compression/decompression library
+.SH SYNOPSIS
+[see
+.I zlib.h
+for full description]
+.SH DESCRIPTION
+The
+.I zlib
+library is a general purpose data compression library.
+The code is thread safe.
+It provides in-memory compression and decompression functions,
+including integrity checks of the uncompressed data.
+This version of the library supports only one compression method (deflation)
+but other algorithms will be added later and will have the same stream interface.
+.LP
+Compression can be done in a single step if the buffers are large enough
+(for example if an input file is mmap'ed),
+or can be done by repeated calls of the compression function.
+In the latter case,
+the application must provide more input and/or consume the output
+(providing more output space) before each call.
+.LP
+The library also supports reading and writing files in
+.I gzip
+(.gz) format
+with an interface similar to that of stdio.
+.LP
+The library does not install any signal handler. The decoder checks
+the consistency of the compressed data, so the library should never
+crash even in case of corrupted input.
+.LP
+All functions of the compression library are documented in the file
+.IR zlib.h.
+The distribution source includes examples of use of the library
+the files
+.I example.c
+and
+.IR minigzip.c .
+.LP
+A Java implementation of
+.IR zlib
+is available in the Java Development Kit 1.1
+.IP
+http://www.javasoft.com/products/JDK/1.1/docs/api/Package-java.util.zip.html
+.LP
+A Perl interface to
+.IR zlib ,
+written by Paul Marquess (pmarquess@bfsec.bt.co.uk)
+is available at CPAN (Comprehensive Perl Archive Network) sites,
+such as:
+.IP
+ftp://ftp.cis.ufl.edu/pub/perl/CPAN/modules/by-module/Compress/Compress-Zlib*
+.LP
+A Python interface to
+.IR zlib
+written by A.M. Kuchling <amk@magnet.com>
+is available from the Python Software Association sites, such as:
+.IP
+ftp://ftp.python.org/pub/python/contrib/Encoding/zlib*.tar.gz
+.SH "SEE ALSO"
+Questions about zlib should be sent to:
+.IP
+zlib@quest.jpl.nasa.gov
+or, if this fails, to the author addresses given below.
+The zlib home page is:
+.IP
+http://www.cdrom.com/pub/infozip/zlib/
+.LP
+The data format used by the zlib library is described by RFC
+(Request for Comments) 1950 to 1952 in the files:
+.IP
+ftp://ds.internic.net/rfc/rfc1950.txt (zlib format)
+.br
+rfc1951.txt (deflate format)
+.br
+rfc1952.txt (gzip format)
+.LP
+These documents are also available in other formats from:
+.IP
+ftp://ftp.uu.net/graphics/png/documents/zlib/zdoc-index.html
+.SH AUTHORS
+Version 1.1.3
+Copyright (C) 1995-1998 Jean-loup Gailly (jloup@gzip.org)
+and Mark Adler (madler@alumni.caltech.edu).
+.LP
+This software is provided "as-is,"
+without any express or implied warranty.
+In no event will the authors be held liable for any damages
+arising from the use of this software.
+See the distribution directory with respect to requirements
+governing redistribution.
+The deflate format used by
+.I zlib
+was defined by Phil Katz.
+The deflate and
+.I zlib
+specifications were written by L. Peter Deutsch.
+Thanks to all the people who reported problems and suggested various
+improvements in
+.IR zlib ;
+who are too numerous to cite here.
+.LP
+UNIX manual page by R. P. C. Rodgers,
+U.S. National Library of Medicine (rodgers@nlm.nih.gov).
+.\" end of man page
--- /dev/null
+/* zlib.h -- interface of the 'zlib' general purpose compression library
+ version 1.1.3, July 9th, 1998
+
+ Copyright (C) 1995-1998 Jean-loup Gailly and Mark Adler
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ Jean-loup Gailly Mark Adler
+ jloup@gzip.org madler@alumni.caltech.edu
+
+
+ The data format used by the zlib library is described by RFCs (Request for
+ Comments) 1950 to 1952 in the files ftp://ds.internic.net/rfc/rfc1950.txt
+ (zlib format), rfc1951.txt (deflate format) and rfc1952.txt (gzip format).
+*/
+
+#ifndef _ZLIB_H
+#define _ZLIB_H
+
+#include "zconf.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define ZLIB_VERSION "1.1.3"
+
+/*
+ The 'zlib' compression library provides in-memory compression and
+ decompression functions, including integrity checks of the uncompressed
+ data. This version of the library supports only one compression method
+ (deflation) but other algorithms will be added later and will have the same
+ stream interface.
+
+ Compression can be done in a single step if the buffers are large
+ enough (for example if an input file is mmap'ed), or can be done by
+ repeated calls of the compression function. In the latter case, the
+ application must provide more input and/or consume the output
+ (providing more output space) before each call.
+
+ The library also supports reading and writing files in gzip (.gz) format
+ with an interface similar to that of stdio.
+
+ The library does not install any signal handler. The decoder checks
+ the consistency of the compressed data, so the library should never
+ crash even in case of corrupted input.
+*/
+
+typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size));
+typedef void (*free_func) OF((voidpf opaque, voidpf address));
+
+struct internal_state;
+
+typedef struct z_stream_s {
+ Bytef *next_in; /* next input byte */
+ uInt avail_in; /* number of bytes available at next_in */
+ uLong total_in; /* total nb of input bytes read so far */
+
+ Bytef *next_out; /* next output byte should be put there */
+ uInt avail_out; /* remaining free space at next_out */
+ uLong total_out; /* total nb of bytes output so far */
+
+ char *msg; /* last error message, NULL if no error */
+ struct internal_state FAR *state; /* not visible by applications */
+
+ alloc_func zalloc; /* used to allocate the internal state */
+ free_func zfree; /* used to free the internal state */
+ voidpf opaque; /* private data object passed to zalloc and zfree */
+
+ int data_type; /* best guess about the data type: ascii or binary */
+ uLong adler; /* adler32 value of the uncompressed data */
+ uLong reserved; /* reserved for future use */
+} z_stream;
+
+typedef z_stream FAR *z_streamp;
+
+/*
+ The application must update next_in and avail_in when avail_in has
+ dropped to zero. It must update next_out and avail_out when avail_out
+ has dropped to zero. The application must initialize zalloc, zfree and
+ opaque before calling the init function. All other fields are set by the
+ compression library and must not be updated by the application.
+
+ The opaque value provided by the application will be passed as the first
+ parameter for calls of zalloc and zfree. This can be useful for custom
+ memory management. The compression library attaches no meaning to the
+ opaque value.
+
+ zalloc must return Z_NULL if there is not enough memory for the object.
+ If zlib is used in a multi-threaded application, zalloc and zfree must be
+ thread safe.
+
+ On 16-bit systems, the functions zalloc and zfree must be able to allocate
+ exactly 65536 bytes, but will not be required to allocate more than this
+ if the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS,
+ pointers returned by zalloc for objects of exactly 65536 bytes *must*
+ have their offset normalized to zero. The default allocation function
+ provided by this library ensures this (see zutil.c). To reduce memory
+ requirements and avoid any allocation of 64K objects, at the expense of
+ compression ratio, compile the library with -DMAX_WBITS=14 (see zconf.h).
+
+ The fields total_in and total_out can be used for statistics or
+ progress reports. After compression, total_in holds the total size of
+ the uncompressed data and may be saved for use in the decompressor
+ (particularly if the decompressor wants to decompress everything in
+ a single step).
+*/
+
+ /* constants */
+
+#define Z_NO_FLUSH 0
+#define Z_PARTIAL_FLUSH 1 /* will be removed, use Z_SYNC_FLUSH instead */
+#define Z_SYNC_FLUSH 2
+#define Z_FULL_FLUSH 3
+#define Z_FINISH 4
+/* Allowed flush values; see deflate() below for details */
+
+#define Z_OK 0
+#define Z_STREAM_END 1
+#define Z_NEED_DICT 2
+#define Z_ERRNO (-1)
+#define Z_STREAM_ERROR (-2)
+#define Z_DATA_ERROR (-3)
+#define Z_MEM_ERROR (-4)
+#define Z_BUF_ERROR (-5)
+#define Z_VERSION_ERROR (-6)
+/* Return codes for the compression/decompression functions. Negative
+ * values are errors, positive values are used for special but normal events.
+ */
+
+#define Z_NO_COMPRESSION 0
+#define Z_BEST_SPEED 1
+#define Z_BEST_COMPRESSION 9
+#define Z_DEFAULT_COMPRESSION (-1)
+/* compression levels */
+
+#define Z_FILTERED 1
+#define Z_HUFFMAN_ONLY 2
+#define Z_DEFAULT_STRATEGY 0
+/* compression strategy; see deflateInit2() below for details */
+
+#define Z_BINARY 0
+#define Z_ASCII 1
+#define Z_UNKNOWN 2
+/* Possible values of the data_type field */
+
+#define Z_DEFLATED 8
+/* The deflate compression method (the only one supported in this version) */
+
+#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */
+
+#define zlib_version zlibVersion()
+/* for compatibility with versions < 1.0.2 */
+
+ /* basic functions */
+
+ZEXTERN const char * ZEXPORT zlibVersion OF((void));
+/* The application can compare zlibVersion and ZLIB_VERSION for consistency.
+ If the first character differs, the library code actually used is
+ not compatible with the zlib.h header file used by the application.
+ This check is automatically made by deflateInit and inflateInit.
+ */
+
+/*
+ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level));
+
+ Initializes the internal stream state for compression. The fields
+ zalloc, zfree and opaque must be initialized before by the caller.
+ If zalloc and zfree are set to Z_NULL, deflateInit updates them to
+ use default allocation functions.
+
+ The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9:
+ 1 gives best speed, 9 gives best compression, 0 gives no compression at
+ all (the input data is simply copied a block at a time).
+ Z_DEFAULT_COMPRESSION requests a default compromise between speed and
+ compression (currently equivalent to level 6).
+
+ deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if level is not a valid compression level,
+ Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible
+ with the version assumed by the caller (ZLIB_VERSION).
+ msg is set to null if there is no error message. deflateInit does not
+ perform any compression: this will be done by deflate().
+*/
+
+
+ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush));
+/*
+ deflate compresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce some
+ output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. deflate performs one or both of the
+ following actions:
+
+ - Compress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in and avail_in are updated and
+ processing will resume at this point for the next call of deflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. This action is forced if the parameter flush is non zero.
+ Forcing flush frequently degrades the compression ratio, so this parameter
+ should be set only when necessary (in interactive applications).
+ Some output may be provided even if flush is not set.
+
+ Before the call of deflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming
+ more output, and updating avail_in or avail_out accordingly; avail_out
+ should never be zero before the call. The application can consume the
+ compressed output when it wants, for example when the output buffer is full
+ (avail_out == 0), or after each call of deflate(). If deflate returns Z_OK
+ and with zero avail_out, it must be called again after making room in the
+ output buffer because there might be more output pending.
+
+ If the parameter flush is set to Z_SYNC_FLUSH, all pending output is
+ flushed to the output buffer and the output is aligned on a byte boundary, so
+ that the decompressor can get all input data available so far. (In particular
+ avail_in is zero after the call if enough output space has been provided
+ before the call.) Flushing may degrade compression for some compression
+ algorithms and so it should be used only when necessary.
+
+ If flush is set to Z_FULL_FLUSH, all output is flushed as with
+ Z_SYNC_FLUSH, and the compression state is reset so that decompression can
+ restart from this point if previous compressed data has been damaged or if
+ random access is desired. Using Z_FULL_FLUSH too often can seriously degrade
+ the compression.
+
+ If deflate returns with avail_out == 0, this function must be called again
+ with the same value of the flush parameter and more output space (updated
+ avail_out), until the flush is complete (deflate returns with non-zero
+ avail_out).
+
+ If the parameter flush is set to Z_FINISH, pending input is processed,
+ pending output is flushed and deflate returns with Z_STREAM_END if there
+ was enough output space; if deflate returns with Z_OK, this function must be
+ called again with Z_FINISH and more output space (updated avail_out) but no
+ more input data, until it returns with Z_STREAM_END or an error. After
+ deflate has returned Z_STREAM_END, the only possible operations on the
+ stream are deflateReset or deflateEnd.
+
+ Z_FINISH can be used immediately after deflateInit if all the compression
+ is to be done in a single step. In this case, avail_out must be at least
+ 0.1% larger than avail_in plus 12 bytes. If deflate does not return
+ Z_STREAM_END, then it must be called again as described above.
+
+ deflate() sets strm->adler to the adler32 checksum of all input read
+ so far (that is, total_in bytes).
+
+ deflate() may update data_type if it can make a good guess about
+ the input data type (Z_ASCII or Z_BINARY). In doubt, the data is considered
+ binary. This field is only for information purposes and does not affect
+ the compression algorithm in any manner.
+
+ deflate() returns Z_OK if some progress has been made (more input
+ processed or more output produced), Z_STREAM_END if all input has been
+ consumed and all output has been produced (only when flush is set to
+ Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example
+ if next_in or next_out was NULL), Z_BUF_ERROR if no progress is possible
+ (for example avail_in or avail_out was zero).
+*/
+
+
+ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any
+ pending output.
+
+ deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the
+ stream state was inconsistent, Z_DATA_ERROR if the stream was freed
+ prematurely (some input or output was discarded). In the error case,
+ msg may be set but then points to a static string (which must not be
+ deallocated).
+*/
+
+
+/*
+ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm));
+
+ Initializes the internal stream state for decompression. The fields
+ next_in, avail_in, zalloc, zfree and opaque must be initialized before by
+ the caller. If next_in is not Z_NULL and avail_in is large enough (the exact
+ value depends on the compression method), inflateInit determines the
+ compression method from the zlib header and allocates all data structures
+ accordingly; otherwise the allocation will be deferred to the first call of
+ inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to
+ use default allocation functions.
+
+ inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller. msg is set to null if there is no error
+ message. inflateInit does not perform any decompression apart from reading
+ the zlib header if present: this will be done by inflate(). (So next_in and
+ avail_in may be modified, but next_out and avail_out are unchanged.)
+*/
+
+
+ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush));
+/*
+ inflate decompresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may some
+ introduce some output latency (reading input without producing any output)
+ except when forced to flush.
+
+ The detailed semantics are as follows. inflate performs one or both of the
+ following actions:
+
+ - Decompress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in is updated and processing
+ will resume at this point for the next call of inflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. inflate() provides as much output as possible, until there
+ is no more input data or no more space in the output buffer (see below
+ about the flush parameter).
+
+ Before the call of inflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming
+ more output, and updating the next_* and avail_* values accordingly.
+ The application can consume the uncompressed output when it wants, for
+ example when the output buffer is full (avail_out == 0), or after each
+ call of inflate(). If inflate returns Z_OK and with zero avail_out, it
+ must be called again after making room in the output buffer because there
+ might be more output pending.
+
+ If the parameter flush is set to Z_SYNC_FLUSH, inflate flushes as much
+ output as possible to the output buffer. The flushing behavior of inflate is
+ not specified for values of the flush parameter other than Z_SYNC_FLUSH
+ and Z_FINISH, but the current implementation actually flushes as much output
+ as possible anyway.
+
+ inflate() should normally be called until it returns Z_STREAM_END or an
+ error. However if all decompression is to be performed in a single step
+ (a single call of inflate), the parameter flush should be set to
+ Z_FINISH. In this case all pending input is processed and all pending
+ output is flushed; avail_out must be large enough to hold all the
+ uncompressed data. (The size of the uncompressed data may have been saved
+ by the compressor for this purpose.) The next operation on this stream must
+ be inflateEnd to deallocate the decompression state. The use of Z_FINISH
+ is never required, but can be used to inform inflate that a faster routine
+ may be used for the single inflate() call.
+
+ If a preset dictionary is needed at this point (see inflateSetDictionary
+ below), inflate sets strm-adler to the adler32 checksum of the
+ dictionary chosen by the compressor and returns Z_NEED_DICT; otherwise
+ it sets strm->adler to the adler32 checksum of all output produced
+ so far (that is, total_out bytes) and returns Z_OK, Z_STREAM_END or
+ an error code as described below. At the end of the stream, inflate()
+ checks that its computed adler32 checksum is equal to that saved by the
+ compressor and returns Z_STREAM_END only if the checksum is correct.
+
+ inflate() returns Z_OK if some progress has been made (more input processed
+ or more output produced), Z_STREAM_END if the end of the compressed data has
+ been reached and all uncompressed output has been produced, Z_NEED_DICT if a
+ preset dictionary is needed at this point, Z_DATA_ERROR if the input data was
+ corrupted (input stream not conforming to the zlib format or incorrect
+ adler32 checksum), Z_STREAM_ERROR if the stream structure was inconsistent
+ (for example if next_in or next_out was NULL), Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if no progress is possible or if there was not
+ enough room in the output buffer when Z_FINISH is used. In the Z_DATA_ERROR
+ case, the application may then call inflateSync to look for a good
+ compression block.
+*/
+
+
+ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any
+ pending output.
+
+ inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state
+ was inconsistent. In the error case, msg may be set but then points to a
+ static string (which must not be deallocated).
+*/
+
+ /* Advanced functions */
+
+/*
+ The following functions are needed only in some special applications.
+*/
+
+/*
+ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm,
+ int level,
+ int method,
+ int windowBits,
+ int memLevel,
+ int strategy));
+
+ This is another version of deflateInit with more compression options. The
+ fields next_in, zalloc, zfree and opaque must be initialized before by
+ the caller.
+
+ The method parameter is the compression method. It must be Z_DEFLATED in
+ this version of the library.
+
+ The windowBits parameter is the base two logarithm of the window size
+ (the size of the history buffer). It should be in the range 8..15 for this
+ version of the library. Larger values of this parameter result in better
+ compression at the expense of memory usage. The default value is 15 if
+ deflateInit is used instead.
+
+ The memLevel parameter specifies how much memory should be allocated
+ for the internal compression state. memLevel=1 uses minimum memory but
+ is slow and reduces compression ratio; memLevel=9 uses maximum memory
+ for optimal speed. The default value is 8. See zconf.h for total memory
+ usage as a function of windowBits and memLevel.
+
+ The strategy parameter is used to tune the compression algorithm. Use the
+ value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a
+ filter (or predictor), or Z_HUFFMAN_ONLY to force Huffman encoding only (no
+ string match). Filtered data consists mostly of small values with a
+ somewhat random distribution. In this case, the compression algorithm is
+ tuned to compress them better. The effect of Z_FILTERED is to force more
+ Huffman coding and less string matching; it is somewhat intermediate
+ between Z_DEFAULT and Z_HUFFMAN_ONLY. The strategy parameter only affects
+ the compression ratio but not the correctness of the compressed output even
+ if it is not set appropriately.
+
+ deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if a parameter is invalid (such as an invalid
+ method). msg is set to null if there is no error message. deflateInit2 does
+ not perform any compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the compression dictionary from the given byte sequence
+ without producing any compressed output. This function must be called
+ immediately after deflateInit, deflateInit2 or deflateReset, before any
+ call of deflate. The compressor and decompressor must use exactly the same
+ dictionary (see inflateSetDictionary).
+
+ The dictionary should consist of strings (byte sequences) that are likely
+ to be encountered later in the data to be compressed, with the most commonly
+ used strings preferably put towards the end of the dictionary. Using a
+ dictionary is most useful when the data to be compressed is short and can be
+ predicted with good accuracy; the data can then be compressed better than
+ with the default empty dictionary.
+
+ Depending on the size of the compression data structures selected by
+ deflateInit or deflateInit2, a part of the dictionary may in effect be
+ discarded, for example if the dictionary is larger than the window size in
+ deflate or deflate2. Thus the strings most likely to be useful should be
+ put at the end of the dictionary, not at the front.
+
+ Upon return of this function, strm->adler is set to the Adler32 value
+ of the dictionary; the decompressor may later use this value to determine
+ which dictionary has been used by the compressor. (The Adler32 value
+ applies to the whole dictionary even if only a subset of the dictionary is
+ actually used by the compressor.)
+
+ deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a
+ parameter is invalid (such as NULL dictionary) or the stream state is
+ inconsistent (for example if deflate has already been called for this stream
+ or if the compression method is bsort). deflateSetDictionary does not
+ perform any compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when several compression strategies will be
+ tried, for example when there are several ways of pre-processing the input
+ data with a filter. The streams that will be discarded should then be freed
+ by calling deflateEnd. Note that deflateCopy duplicates the internal
+ compression state which can be quite large, so this strategy is slow and
+ can consume lots of memory.
+
+ deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to deflateEnd followed by deflateInit,
+ but does not free and reallocate all the internal compression state.
+ The stream will keep the same compression level and any other attributes
+ that may have been set by deflateInit2.
+
+ deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being NULL).
+*/
+
+ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm,
+ int level,
+ int strategy));
+/*
+ Dynamically update the compression level and compression strategy. The
+ interpretation of level and strategy is as in deflateInit2. This can be
+ used to switch between compression and straight copy of the input data, or
+ to switch to a different kind of input data requiring a different
+ strategy. If the compression level is changed, the input available so far
+ is compressed with the old level (and may be flushed); the new level will
+ take effect only at the next call of deflate().
+
+ Before the call of deflateParams, the stream state must be set as for
+ a call of deflate(), since the currently available input may have to
+ be compressed and flushed. In particular, strm->avail_out must be non-zero.
+
+ deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source
+ stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR
+ if strm->avail_out was zero.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm,
+ int windowBits));
+
+ This is another version of inflateInit with an extra parameter. The
+ fields next_in, avail_in, zalloc, zfree and opaque must be initialized
+ before by the caller.
+
+ The windowBits parameter is the base two logarithm of the maximum window
+ size (the size of the history buffer). It should be in the range 8..15 for
+ this version of the library. The default value is 15 if inflateInit is used
+ instead. If a compressed stream with a larger window size is given as
+ input, inflate() will return with the error code Z_DATA_ERROR instead of
+ trying to allocate a larger window.
+
+ inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if a parameter is invalid (such as a negative
+ memLevel). msg is set to null if there is no error message. inflateInit2
+ does not perform any decompression apart from reading the zlib header if
+ present: this will be done by inflate(). (So next_in and avail_in may be
+ modified, but next_out and avail_out are unchanged.)
+*/
+
+ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the decompression dictionary from the given uncompressed byte
+ sequence. This function must be called immediately after a call of inflate
+ if this call returned Z_NEED_DICT. The dictionary chosen by the compressor
+ can be determined from the Adler32 value returned by this call of
+ inflate. The compressor and decompressor must use exactly the same
+ dictionary (see deflateSetDictionary).
+
+ inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a
+ parameter is invalid (such as NULL dictionary) or the stream state is
+ inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the
+ expected one (incorrect Adler32 value). inflateSetDictionary does not
+ perform any decompression: this will be done by subsequent calls of
+ inflate().
+*/
+
+ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm));
+/*
+ Skips invalid compressed data until a full flush point (see above the
+ description of deflate with Z_FULL_FLUSH) can be found, or until all
+ available input is skipped. No output is provided.
+
+ inflateSync returns Z_OK if a full flush point has been found, Z_BUF_ERROR
+ if no more input was provided, Z_DATA_ERROR if no flush point has been found,
+ or Z_STREAM_ERROR if the stream structure was inconsistent. In the success
+ case, the application may save the current current value of total_in which
+ indicates where valid compressed data was found. In the error case, the
+ application may repeatedly call inflateSync, providing more input each time,
+ until success or end of the input data.
+*/
+
+ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to inflateEnd followed by inflateInit,
+ but does not free and reallocate all the internal decompression state.
+ The stream will keep attributes that may have been set by inflateInit2.
+
+ inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being NULL).
+*/
+
+
+ /* utility functions */
+
+/*
+ The following utility functions are implemented on top of the
+ basic stream-oriented functions. To simplify the interface, some
+ default options are assumed (compression level and memory usage,
+ standard memory allocation functions). The source code of these
+ utility functions can easily be modified if you need special options.
+*/
+
+ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Compresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total
+ size of the destination buffer, which must be at least 0.1% larger than
+ sourceLen plus 12 bytes. Upon exit, destLen is the actual size of the
+ compressed buffer.
+ This function can be used to compress a whole file at once if the
+ input file is mmap'ed.
+ compress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer.
+*/
+
+ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen,
+ int level));
+/*
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least 0.1% larger than sourceLen plus
+ 12 bytes. Upon exit, destLen is the actual size of the compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+*/
+
+ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total
+ size of the destination buffer, which must be large enough to hold the
+ entire uncompressed data. (The size of the uncompressed data must have
+ been saved previously by the compressor and transmitted to the decompressor
+ by some mechanism outside the scope of this compression library.)
+ Upon exit, destLen is the actual size of the compressed buffer.
+ This function can be used to decompress a whole file at once if the
+ input file is mmap'ed.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted.
+*/
+
+
+typedef voidp gzFile;
+
+ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode));
+/*
+ Opens a gzip (.gz) file for reading or writing. The mode parameter
+ is as in fopen ("rb" or "wb") but can also include a compression level
+ ("wb9") or a strategy: 'f' for filtered data as in "wb6f", 'h' for
+ Huffman only compression as in "wb1h". (See the description
+ of deflateInit2 for more information about the strategy parameter.)
+
+ gzopen can be used to read a file which is not in gzip format; in this
+ case gzread will directly read from the file without decompression.
+
+ gzopen returns NULL if the file could not be opened or if there was
+ insufficient memory to allocate the (de)compression state; errno
+ can be checked to distinguish the two cases (if errno is zero, the
+ zlib error is Z_MEM_ERROR). */
+
+ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode));
+/*
+ gzdopen() associates a gzFile with the file descriptor fd. File
+ descriptors are obtained from calls like open, dup, creat, pipe or
+ fileno (in the file has been previously opened with fopen).
+ The mode parameter is as in gzopen.
+ The next call of gzclose on the returned gzFile will also close the
+ file descriptor fd, just like fclose(fdopen(fd), mode) closes the file
+ descriptor fd. If you want to keep fd open, use gzdopen(dup(fd), mode).
+ gzdopen returns NULL if there was insufficient memory to allocate
+ the (de)compression state.
+*/
+
+ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy));
+/*
+ Dynamically update the compression level or strategy. See the description
+ of deflateInit2 for the meaning of these parameters.
+ gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not
+ opened for writing.
+*/
+
+ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len));
+/*
+ Reads the given number of uncompressed bytes from the compressed file.
+ If the input file was not in gzip format, gzread copies the given number
+ of bytes into the buffer.
+ gzread returns the number of uncompressed bytes actually read (0 for
+ end of file, -1 for error). */
+
+ZEXTERN int ZEXPORT gzwrite OF((gzFile file,
+ const voidp buf, unsigned len));
+/*
+ Writes the given number of uncompressed bytes into the compressed file.
+ gzwrite returns the number of uncompressed bytes actually written
+ (0 in case of error).
+*/
+
+ZEXTERN int ZEXPORTVA gzprintf OF((gzFile file, const char *format, ...));
+/*
+ Converts, formats, and writes the args to the compressed file under
+ control of the format string, as in fprintf. gzprintf returns the number of
+ uncompressed bytes actually written (0 in case of error).
+*/
+
+ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s));
+/*
+ Writes the given null-terminated string to the compressed file, excluding
+ the terminating null character.
+ gzputs returns the number of characters written, or -1 in case of error.
+*/
+
+ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len));
+/*
+ Reads bytes from the compressed file until len-1 characters are read, or
+ a newline character is read and transferred to buf, or an end-of-file
+ condition is encountered. The string is then terminated with a null
+ character.
+ gzgets returns buf, or Z_NULL in case of error.
+*/
+
+ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c));
+/*
+ Writes c, converted to an unsigned char, into the compressed file.
+ gzputc returns the value that was written, or -1 in case of error.
+*/
+
+ZEXTERN int ZEXPORT gzgetc OF((gzFile file));
+/*
+ Reads one byte from the compressed file. gzgetc returns this byte
+ or -1 in case of end of file or error.
+*/
+
+ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush));
+/*
+ Flushes all pending output into the compressed file. The parameter
+ flush is as in the deflate() function. The return value is the zlib
+ error number (see function gzerror below). gzflush returns Z_OK if
+ the flush parameter is Z_FINISH and all output could be flushed.
+ gzflush should be called only when strictly necessary because it can
+ degrade compression.
+*/
+
+ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file,
+ z_off_t offset, int whence));
+/*
+ Sets the starting position for the next gzread or gzwrite on the
+ given compressed file. The offset represents a number of bytes in the
+ uncompressed data stream. The whence parameter is defined as in lseek(2);
+ the value SEEK_END is not supported.
+ If the file is opened for reading, this function is emulated but can be
+ extremely slow. If the file is opened for writing, only forward seeks are
+ supported; gzseek then compresses a sequence of zeroes up to the new
+ starting position.
+
+ gzseek returns the resulting offset location as measured in bytes from
+ the beginning of the uncompressed stream, or -1 in case of error, in
+ particular if the file is opened for writing and the new starting position
+ would be before the current position.
+*/
+
+ZEXTERN int ZEXPORT gzrewind OF((gzFile file));
+/*
+ Rewinds the given file. This function is supported only for reading.
+
+ gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET)
+*/
+
+ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file));
+/*
+ Returns the starting position for the next gzread or gzwrite on the
+ given compressed file. This position represents a number of bytes in the
+ uncompressed data stream.
+
+ gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR)
+*/
+
+ZEXTERN int ZEXPORT gzeof OF((gzFile file));
+/*
+ Returns 1 when EOF has previously been detected reading the given
+ input stream, otherwise zero.
+*/
+
+ZEXTERN int ZEXPORT gzclose OF((gzFile file));
+/*
+ Flushes all pending output if necessary, closes the compressed file
+ and deallocates all the (de)compression state. The return value is the zlib
+ error number (see function gzerror below).
+*/
+
+ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum));
+/*
+ Returns the error message for the last error which occurred on the
+ given compressed file. errnum is set to zlib error number. If an
+ error occurred in the file system and not in the compression library,
+ errnum is set to Z_ERRNO and the application may consult errno
+ to get the exact error code.
+*/
+
+ /* checksum functions */
+
+/*
+ These functions are not related to compression but are exported
+ anyway because they might be useful in applications using the
+ compression library.
+*/
+
+ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len));
+
+/*
+ Update a running Adler-32 checksum with the bytes buf[0..len-1] and
+ return the updated checksum. If buf is NULL, this function returns
+ the required initial value for the checksum.
+ An Adler-32 checksum is almost as reliable as a CRC32 but can be computed
+ much faster. Usage example:
+
+ uLong adler = adler32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ adler = adler32(adler, buffer, length);
+ }
+ if (adler != original_adler) error();
+*/
+
+ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len));
+/*
+ Update a running crc with the bytes buf[0..len-1] and return the updated
+ crc. If buf is NULL, this function returns the required initial value
+ for the crc. Pre- and post-conditioning (one's complement) is performed
+ within this function so it shouldn't be done by the application.
+ Usage example:
+
+ uLong crc = crc32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ crc = crc32(crc, buffer, length);
+ }
+ if (crc != original_crc) error();
+*/
+
+
+ /* various hacks, don't look :) */
+
+/* deflateInit and inflateInit are macros to allow checking the zlib version
+ * and the compiler's view of z_stream:
+ */
+ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method,
+ int windowBits, int memLevel,
+ int strategy, const char *version,
+ int stream_size));
+ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits,
+ const char *version, int stream_size));
+#define deflateInit(strm, level) \
+ deflateInit_((strm), (level), ZLIB_VERSION, sizeof(z_stream))
+#define inflateInit(strm) \
+ inflateInit_((strm), ZLIB_VERSION, sizeof(z_stream))
+#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \
+ deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\
+ (strategy), ZLIB_VERSION, sizeof(z_stream))
+#define inflateInit2(strm, windowBits) \
+ inflateInit2_((strm), (windowBits), ZLIB_VERSION, sizeof(z_stream))
+
+
+#if !defined(_Z_UTIL_H) && !defined(NO_DUMMY_DECL)
+ struct internal_state {int dummy;}; /* hack for buggy compilers */
+#endif
+
+ZEXTERN const char * ZEXPORT zError OF((int err));
+ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp z));
+ZEXTERN const uLongf * ZEXPORT get_crc_table OF((void));
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* _ZLIB_H */
--- /dev/null
+/* zutil.c -- target dependent utility functions for the compression library
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include "zutil.h"
+
+struct internal_state {int dummy;}; /* for buggy compilers */
+
+#ifndef STDC
+extern void exit OF((int));
+#endif
+
+const char *z_errmsg[10] = {
+"need dictionary", /* Z_NEED_DICT 2 */
+"stream end", /* Z_STREAM_END 1 */
+"", /* Z_OK 0 */
+"file error", /* Z_ERRNO (-1) */
+"stream error", /* Z_STREAM_ERROR (-2) */
+"data error", /* Z_DATA_ERROR (-3) */
+"insufficient memory", /* Z_MEM_ERROR (-4) */
+"buffer error", /* Z_BUF_ERROR (-5) */
+"incompatible version",/* Z_VERSION_ERROR (-6) */
+""};
+
+
+const char * ZEXPORT zlibVersion()
+{
+ return ZLIB_VERSION;
+}
+
+#ifdef DEBUG
+
+# ifndef verbose
+# define verbose 0
+# endif
+int z_verbose = verbose;
+
+void z_error (m)
+ char *m;
+{
+ fprintf(stderr, "%s\n", m);
+ exit(1);
+}
+#endif
+
+/* exported to allow conversion of error code to string for compress() and
+ * uncompress()
+ */
+const char * ZEXPORT zError(err)
+ int err;
+{
+ return ERR_MSG(err);
+}
+
+
+#ifndef HAVE_MEMCPY
+
+void zmemcpy(dest, source, len)
+ Bytef* dest;
+ const Bytef* source;
+ uInt len;
+{
+ if (len == 0) return;
+ do {
+ *dest++ = *source++; /* ??? to be unrolled */
+ } while (--len != 0);
+}
+
+int zmemcmp(s1, s2, len)
+ const Bytef* s1;
+ const Bytef* s2;
+ uInt len;
+{
+ uInt j;
+
+ for (j = 0; j < len; j++) {
+ if (s1[j] != s2[j]) return 2*(s1[j] > s2[j])-1;
+ }
+ return 0;
+}
+
+void zmemzero(dest, len)
+ Bytef* dest;
+ uInt len;
+{
+ if (len == 0) return;
+ do {
+ *dest++ = 0; /* ??? to be unrolled */
+ } while (--len != 0);
+}
+#endif
+
+#ifdef __TURBOC__
+#if (defined( __BORLANDC__) || !defined(SMALL_MEDIUM)) && !defined(__32BIT__)
+/* Small and medium model in Turbo C are for now limited to near allocation
+ * with reduced MAX_WBITS and MAX_MEM_LEVEL
+ */
+# define MY_ZCALLOC
+
+/* Turbo C malloc() does not allow dynamic allocation of 64K bytes
+ * and farmalloc(64K) returns a pointer with an offset of 8, so we
+ * must fix the pointer. Warning: the pointer must be put back to its
+ * original form in order to free it, use zcfree().
+ */
+
+#define MAX_PTR 10
+/* 10*64K = 640K */
+
+local int next_ptr = 0;
+
+typedef struct ptr_table_s {
+ voidpf org_ptr;
+ voidpf new_ptr;
+} ptr_table;
+
+local ptr_table table[MAX_PTR];
+/* This table is used to remember the original form of pointers
+ * to large buffers (64K). Such pointers are normalized with a zero offset.
+ * Since MSDOS is not a preemptive multitasking OS, this table is not
+ * protected from concurrent access. This hack doesn't work anyway on
+ * a protected system like OS/2. Use Microsoft C instead.
+ */
+
+voidpf zcalloc (voidpf opaque, unsigned items, unsigned size)
+{
+ voidpf buf = opaque; /* just to make some compilers happy */
+ ulg bsize = (ulg)items*size;
+
+ /* If we allocate less than 65520 bytes, we assume that farmalloc
+ * will return a usable pointer which doesn't have to be normalized.
+ */
+ if (bsize < 65520L) {
+ buf = farmalloc(bsize);
+ if (*(ush*)&buf != 0) return buf;
+ } else {
+ buf = farmalloc(bsize + 16L);
+ }
+ if (buf == NULL || next_ptr >= MAX_PTR) return NULL;
+ table[next_ptr].org_ptr = buf;
+
+ /* Normalize the pointer to seg:0 */
+ *((ush*)&buf+1) += ((ush)((uch*)buf-0) + 15) >> 4;
+ *(ush*)&buf = 0;
+ table[next_ptr++].new_ptr = buf;
+ return buf;
+}
+
+void zcfree (voidpf opaque, voidpf ptr)
+{
+ int n;
+ if (*(ush*)&ptr != 0) { /* object < 64K */
+ farfree(ptr);
+ return;
+ }
+ /* Find the original pointer */
+ for (n = 0; n < next_ptr; n++) {
+ if (ptr != table[n].new_ptr) continue;
+
+ farfree(table[n].org_ptr);
+ while (++n < next_ptr) {
+ table[n-1] = table[n];
+ }
+ next_ptr--;
+ return;
+ }
+ ptr = opaque; /* just to make some compilers happy */
+ Assert(0, "zcfree: ptr not found");
+}
+#endif
+#endif /* __TURBOC__ */
+
+
+#if defined(M_I86) && !defined(__32BIT__)
+/* Microsoft C in 16-bit mode */
+
+# define MY_ZCALLOC
+
+#if (!defined(_MSC_VER) || (_MSC_VER <= 600))
+# define _halloc halloc
+# define _hfree hfree
+#endif
+
+voidpf zcalloc (voidpf opaque, unsigned items, unsigned size)
+{
+ if (opaque) opaque = 0; /* to make compiler happy */
+ return _halloc((long)items, size);
+}
+
+void zcfree (voidpf opaque, voidpf ptr)
+{
+ if (opaque) opaque = 0; /* to make compiler happy */
+ _hfree(ptr);
+}
+
+#endif /* MSC */
+
+
+#ifndef MY_ZCALLOC /* Any system without a special alloc function */
+
+#ifndef STDC
+extern voidp calloc OF((uInt items, uInt size));
+extern void free OF((voidpf ptr));
+#endif
+
+voidpf zcalloc (opaque, items, size)
+ voidpf opaque;
+ unsigned items;
+ unsigned size;
+{
+ if (opaque) items += size - size; /* make compiler happy */
+ return (voidpf)calloc(items, size);
+}
+
+void zcfree (opaque, ptr)
+ voidpf opaque;
+ voidpf ptr;
+{
+ free(ptr);
+ if (opaque) return; /* make compiler happy */
+}
+
+#endif /* MY_ZCALLOC */
--- /dev/null
+/* zutil.h -- internal interface and configuration of the compression library
+ * Copyright (C) 1995-1998 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* @(#) $Id$ */
+
+#ifndef _Z_UTIL_H
+#define _Z_UTIL_H
+
+#include "zlib.h"
+
+#ifdef STDC
+# include <stddef.h>
+# include <string.h>
+# include <stdlib.h>
+#endif
+#ifdef NO_ERRNO_H
+ extern int errno;
+#else
+# include <errno.h>
+#endif
+
+#ifndef local
+# define local static
+#endif
+/* compile with -Dlocal if your debugger can't find static symbols */
+
+typedef unsigned char uch;
+typedef uch FAR uchf;
+typedef unsigned short ush;
+typedef ush FAR ushf;
+typedef unsigned long ulg;
+
+extern const char *z_errmsg[10]; /* indexed by 2-zlib_error */
+/* (size given to avoid silly warnings with Visual C++) */
+
+#define ERR_MSG(err) z_errmsg[Z_NEED_DICT-(err)]
+
+#define ERR_RETURN(strm,err) \
+ return (strm->msg = (char*)ERR_MSG(err), (err))
+/* To be used only when the state is known to be valid */
+
+ /* common constants */
+
+#ifndef DEF_WBITS
+# define DEF_WBITS MAX_WBITS
+#endif
+/* default windowBits for decompression. MAX_WBITS is for compression only */
+
+#if MAX_MEM_LEVEL >= 8
+# define DEF_MEM_LEVEL 8
+#else
+# define DEF_MEM_LEVEL MAX_MEM_LEVEL
+#endif
+/* default memLevel */
+
+#define STORED_BLOCK 0
+#define STATIC_TREES 1
+#define DYN_TREES 2
+/* The three kinds of block type */
+
+#define MIN_MATCH 3
+#define MAX_MATCH 258
+/* The minimum and maximum match lengths */
+
+#define PRESET_DICT 0x20 /* preset dictionary flag in zlib header */
+
+ /* target dependencies */
+
+#ifdef MSDOS
+# define OS_CODE 0x00
+# if defined(__TURBOC__) || defined(__BORLANDC__)
+# if(__STDC__ == 1) && (defined(__LARGE__) || defined(__COMPACT__))
+ /* Allow compilation with ANSI keywords only enabled */
+ void _Cdecl farfree( void *block );
+ void *_Cdecl farmalloc( unsigned long nbytes );
+# else
+# include <alloc.h>
+# endif
+# else /* MSC or DJGPP */
+# include <malloc.h>
+# endif
+#endif
+
+#ifdef OS2
+# define OS_CODE 0x06
+#endif
+
+#ifdef WIN32 /* Window 95 & Windows NT */
+# define OS_CODE 0x0b
+#endif
+
+#if defined(VAXC) || defined(VMS)
+# define OS_CODE 0x02
+# define F_OPEN(name, mode) \
+ fopen((name), (mode), "mbc=60", "ctx=stm", "rfm=fix", "mrs=512")
+#endif
+
+#ifdef AMIGA
+# define OS_CODE 0x01
+#endif
+
+#if defined(ATARI) || defined(atarist)
+# define OS_CODE 0x05
+#endif
+
+#if defined(MACOS) || defined(TARGET_OS_MAC)
+# define OS_CODE 0x07
+# if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os
+# include <unix.h> /* for fdopen */
+# else
+# ifndef fdopen
+# define fdopen(fd,mode) NULL /* No fdopen() */
+# endif
+# endif
+#endif
+
+#ifdef __50SERIES /* Prime/PRIMOS */
+# define OS_CODE 0x0F
+#endif
+
+#ifdef TOPS20
+# define OS_CODE 0x0a
+#endif
+
+#if defined(_BEOS_) || defined(RISCOS)
+# define fdopen(fd,mode) NULL /* No fdopen() */
+#endif
+
+#if (defined(_MSC_VER) && (_MSC_VER > 600))
+# define fdopen(fd,type) _fdopen(fd,type)
+#endif
+
+
+ /* Common defaults */
+
+#ifndef OS_CODE
+# define OS_CODE 0x03 /* assume Unix */
+#endif
+
+#ifndef F_OPEN
+# define F_OPEN(name, mode) fopen((name), (mode))
+#endif
+
+ /* functions */
+
+#ifdef HAVE_STRERROR
+ extern char *strerror OF((int));
+# define zstrerror(errnum) strerror(errnum)
+#else
+# define zstrerror(errnum) ""
+#endif
+
+#if defined(pyr)
+# define NO_MEMCPY
+#endif
+#if defined(SMALL_MEDIUM) && !defined(_MSC_VER) && !defined(__SC__)
+ /* Use our own functions for small and medium model with MSC <= 5.0.
+ * You may have to use the same strategy for Borland C (untested).
+ * The __SC__ check is for Symantec.
+ */
+# define NO_MEMCPY
+#endif
+#if defined(STDC) && !defined(HAVE_MEMCPY) && !defined(NO_MEMCPY)
+# define HAVE_MEMCPY
+#endif
+#ifdef HAVE_MEMCPY
+# ifdef SMALL_MEDIUM /* MSDOS small or medium model */
+# define zmemcpy _fmemcpy
+# define zmemcmp _fmemcmp
+# define zmemzero(dest, len) _fmemset(dest, 0, len)
+# else
+# define zmemcpy memcpy
+# define zmemcmp memcmp
+# define zmemzero(dest, len) memset(dest, 0, len)
+# endif
+#else
+ extern void zmemcpy OF((Bytef* dest, const Bytef* source, uInt len));
+ extern int zmemcmp OF((const Bytef* s1, const Bytef* s2, uInt len));
+ extern void zmemzero OF((Bytef* dest, uInt len));
+#endif
+
+/* Diagnostic functions */
+#ifdef DEBUG
+# include <stdio.h>
+ extern int z_verbose;
+ extern void z_error OF((char *m));
+# define Assert(cond,msg) {if(!(cond)) z_error(msg);}
+# define Trace(x) {if (z_verbose>=0) fprintf x ;}
+# define Tracev(x) {if (z_verbose>0) fprintf x ;}
+# define Tracevv(x) {if (z_verbose>1) fprintf x ;}
+# define Tracec(c,x) {if (z_verbose>0 && (c)) fprintf x ;}
+# define Tracecv(c,x) {if (z_verbose>1 && (c)) fprintf x ;}
+#else
+# define Assert(cond,msg)
+# define Trace(x)
+# define Tracev(x)
+# define Tracevv(x)
+# define Tracec(c,x)
+# define Tracecv(c,x)
+#endif
+
+
+typedef uLong (ZEXPORT *check_func) OF((uLong check, const Bytef *buf,
+ uInt len));
+voidpf zcalloc OF((voidpf opaque, unsigned items, unsigned size));
+void zcfree OF((voidpf opaque, voidpf ptr));
+
+#define ZALLOC(strm, items, size) \
+ (*((strm)->zalloc))((strm)->opaque, (items), (size))
+#define ZFREE(strm, addr) (*((strm)->zfree))((strm)->opaque, (voidpf)(addr))
+#define TRY_FREE(s, p) {if (p) ZFREE(s, p);}
+
+#endif /* _Z_UTIL_H */
projects / platform / upstream / rpm.git / commitdiff